Browse entries in the PDBbind-CN Database
HEADER 3HO2_COMPLEX COMPND 3HO2_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 411 LYS ARG ARG VAL VAL VAL THR GLY LEU GLY MET LEU SER SEQRES 2 A 411 PRO VAL GLY ASN THR VAL GLU SER THR TRP LYS ALA LEU SEQRES 3 A 411 LEU ALA GLY GLN SER GLY ILE SER LEU ILE ASP HIS PHE SEQRES 4 A 411 ASP THR SER ALA TYR ALA THR LYS PHE ALA GLY LEU VAL SEQRES 5 A 411 LYS ASP PHE ASN CYS GLU ASP ILE ILE SER ARG LYS GLU SEQRES 6 A 411 GLN ARG LYS MET ASP ALA PHE ILE GLN TYR GLY ILE VAL SEQRES 7 A 411 ALA GLY VAL GLN ALA MET GLN ASP SER GLY LEU GLU ILE SEQRES 8 A 411 THR GLU GLU ASN ALA THR ARG ILE GLY ALA ALA ILE GLY SEQRES 9 A 411 SER GLY ILE GLY GLY LEU GLY LEU ILE GLU GLU ASN HIS SEQRES 10 A 411 THR SER LEU MET ASN GLY GLY PRO ARG LYS ILE SER PRO SEQRES 11 A 411 PHE PHE VAL PRO SER THR ILE VAL ASN MET VAL ALA GLY SEQRES 12 A 411 HIS LEU THR ILE MET TYR GLY LEU ARG GLY PRO SER ILE SEQRES 13 A 411 SER ILE ALA THR ALA ALA THR SER GLY VAL HIS ASN ILE SEQRES 14 A 411 GLY HIS ALA ALA ARG ILE ILE ALA TYR GLY ASP ALA ASP SEQRES 15 A 411 VAL MET VAL ALA GLY GLY ALA GLU LYS ALA SER THR PRO SEQRES 16 A 411 LEU GLY VAL GLY GLY PHE GLY ALA ALA ARG ALA LEU SER SEQRES 17 A 411 THR ARG ASN ASP ASN PRO GLN ALA ALA SER ARG PRO TRP SEQRES 18 A 411 ASP LYS GLU ARG ASP GLY PHE VAL LEU GLY ASP GLY ALA SEQRES 19 A 411 GLY MET LEU VAL LEU GLU GLU TYR GLU HIS ALA LYS LYS SEQRES 20 A 411 ARG GLY ALA LYS ILE TYR ALA GLU LEU VAL GLY PHE GLY SEQRES 21 A 411 MET SER SER ASP ALA TYR HIS MET THR SER PRO PRO GLU SEQRES 22 A 411 ASN GLY ALA GLY ALA ALA LEU ALA MET ALA ASN ALA LEU SEQRES 23 A 411 ARG ASP ALA GLY ILE GLU ALA SER GLN ILE GLY TYR VAL SEQRES 24 A 411 ASN ALA HIS GLY THR SER THR PRO ALA GLY ASP LYS ALA SEQRES 25 A 411 GLU ALA GLN ALA VAL LYS THR ILE PHE GLY GLU ALA ALA SEQRES 26 A 411 SER ARG VAL LEU VAL SER SER THR LYS SER MET THR GLY SEQRES 27 A 411 HIS LEU LEU GLY ALA ALA GLY ALA VAL GLU SER ILE TYR SEQRES 28 A 411 SER ILE LEU ALA LEU ARG ASP GLN ALA VAL PRO PRO THR SEQRES 29 A 411 ILE ASN LEU ASP ASN PRO ASP GLU GLY CYS ASP LEU ASP SEQRES 30 A 411 PHE VAL PRO HIS GLU ALA ARG GLN VAL SER GLY MET GLU SEQRES 31 A 411 TYR THR LEU CYS ASN SER PHE GLY PHE GLY GLY THR ASN SEQRES 32 A 411 GLY SER LEU ILE PHE LYS LYS ILE SEQRES 1 B 411 LYS ARG ARG VAL VAL VAL THR GLY LEU GLY MET LEU SER SEQRES 2 B 411 PRO VAL GLY ASN THR VAL GLU SER THR TRP LYS ALA LEU SEQRES 3 B 411 LEU ALA GLY GLN SER GLY ILE SER LEU ILE ASP HIS PHE SEQRES 4 B 411 ASP THR SER ALA TYR ALA THR LYS PHE ALA GLY LEU VAL SEQRES 5 B 411 LYS ASP PHE ASN CYS GLU ASP ILE ILE SER ARG LYS GLU SEQRES 6 B 411 GLN ARG LYS MET ASP ALA PHE ILE GLN TYR GLY ILE VAL SEQRES 7 B 411 ALA GLY VAL GLN ALA MET GLN ASP SER GLY LEU GLU ILE SEQRES 8 B 411 THR GLU GLU ASN ALA THR ARG ILE GLY ALA ALA ILE GLY SEQRES 9 B 411 SER GLY ILE GLY GLY LEU GLY LEU ILE GLU GLU ASN HIS SEQRES 10 B 411 THR SER LEU MET ASN GLY GLY PRO ARG LYS ILE SER PRO SEQRES 11 B 411 PHE PHE VAL PRO SER THR ILE VAL ASN MET VAL ALA GLY SEQRES 12 B 411 HIS LEU THR ILE MET TYR GLY LEU ARG GLY PRO SER ILE SEQRES 13 B 411 SER ILE ALA THR ALA ALA THR SER GLY VAL HIS ASN ILE SEQRES 14 B 411 GLY HIS ALA ALA ARG ILE ILE ALA TYR GLY ASP ALA ASP SEQRES 15 B 411 VAL MET VAL ALA GLY GLY ALA GLU LYS ALA SER THR PRO SEQRES 16 B 411 LEU GLY VAL GLY GLY PHE GLY ALA ALA ARG ALA LEU SER SEQRES 17 B 411 THR ARG ASN ASP ASN PRO GLN ALA ALA SER ARG PRO TRP SEQRES 18 B 411 ASP LYS GLU ARG ASP GLY PHE VAL LEU GLY ASP GLY ALA SEQRES 19 B 411 GLY MET LEU VAL LEU GLU GLU TYR GLU HIS ALA LYS LYS SEQRES 20 B 411 ARG GLY ALA LYS ILE TYR ALA GLU LEU VAL GLY PHE GLY SEQRES 21 B 411 MET SER SER ASP ALA TYR HIS MET THR SER PRO PRO GLU SEQRES 22 B 411 ASN GLY ALA GLY ALA ALA LEU ALA MET ALA ASN ALA LEU SEQRES 23 B 411 ARG ASP ALA GLY ILE GLU ALA SER GLN ILE GLY TYR VAL SEQRES 24 B 411 ASN ALA HIS GLY THR SER THR PRO ALA GLY ASP LYS ALA SEQRES 25 B 411 GLU ALA GLN ALA VAL LYS THR ILE PHE GLY GLU ALA ALA SEQRES 26 B 411 SER ARG VAL LEU VAL SER SER THR LYS SER MET THR GLY SEQRES 27 B 411 HIS LEU LEU GLY ALA ALA GLY ALA VAL GLU SER ILE TYR SEQRES 28 B 411 SER ILE LEU ALA LEU ARG ASP GLN ALA VAL PRO PRO THR SEQRES 29 B 411 ILE ASN LEU ASP ASN PRO ASP GLU GLY CYS ASP LEU ASP SEQRES 30 B 411 PHE VAL PRO HIS GLU ALA ARG GLN VAL SER GLY MET GLU SEQRES 31 B 411 TYR THR LEU CYS ASN SER PHE GLY PHE GLY GLY THR ASN SEQRES 32 B 411 GLY SER LEU ILE PHE LYS LYS ILE HET N A 32 57 ATOM 1 N LYS A 2 31.450 62.393 24.943 1.00 49.84 N ATOM 2 CA LYS A 2 32.435 61.612 25.708 1.00 49.43 C ATOM 3 C LYS A 2 31.925 60.180 25.791 1.00 48.20 C ATOM 4 O LYS A 2 30.788 59.951 26.202 1.00 48.83 O ATOM 5 CB LYS A 2 32.648 62.193 27.108 1.00 52.48 C ATOM 6 CG LYS A 2 32.919 61.132 28.154 1.00 69.00 C ATOM 7 CD LYS A 2 34.207 61.411 28.903 1.00 82.69 C ATOM 8 CE LYS A 2 34.831 60.120 29.399 1.00 97.95 C ATOM 9 NZ LYS A 2 34.285 58.945 28.660 1.00112.54 N ATOM 10 HA LYS A 2 33.402 61.646 25.206 1.00 0.00 H ATOM 11 HB2 LYS A 2 33.498 62.875 27.076 1.00 0.00 H ATOM 12 HB3 LYS A 2 31.753 62.744 27.396 1.00 0.00 H ATOM 13 HG2 LYS A 2 32.092 61.114 28.864 1.00 0.00 H ATOM 14 HG3 LYS A 2 32.996 60.162 27.664 1.00 0.00 H ATOM 15 HD2 LYS A 2 34.907 61.914 28.236 1.00 0.00 H ATOM 16 HD3 LYS A 2 33.993 62.056 29.755 1.00 0.00 H ATOM 17 HE2 LYS A 2 34.616 60.005 30.461 1.00 0.00 H ATOM 18 HE3 LYS A 2 35.910 60.165 29.251 1.00 0.00 H ATOM 19 HZ1 LYS A 2 33.256 58.895 28.802 1.00 0.00 H ATOM 20 HZ2 LYS A 2 34.492 59.048 27.646 1.00 0.00 H ATOM 21 HZ3 LYS A 2 34.728 58.075 29.018 1.00 0.00 H ATOM 22 HN3 LYS A 2 30.532 62.363 25.430 1.00 0.00 H ATOM 23 HN2 LYS A 2 31.352 61.987 23.990 1.00 0.00 H ATOM 24 HN1 LYS A 2 31.773 63.379 24.870 1.00 0.00 H ATOM 25 N ARG A 3 32.726 59.229 25.317 1.00 39.53 N ATOM 26 CA ARG A 3 32.256 57.867 25.214 1.00 36.96 C ATOM 27 C ARG A 3 32.486 57.007 26.433 1.00 38.89 C ATOM 28 O ARG A 3 33.624 56.805 26.883 1.00 38.84 O ATOM 29 CB ARG A 3 32.774 57.213 23.935 1.00 37.41 C ATOM 30 CG ARG A 3 32.361 57.949 22.671 1.00 37.36 C ATOM 31 CD ARG A 3 33.276 57.675 21.497 1.00 37.03 C ATOM 32 NE ARG A 3 33.454 56.252 21.179 1.00 28.69 N ATOM 33 CZ ARG A 3 32.729 55.588 20.292 1.00 41.76 C ATOM 34 NH1 ARG A 3 31.698 56.185 19.718 1.00 32.48 N ATOM 35 NH2 ARG A 3 33.000 54.314 20.019 1.00 36.77 N ATOM 36 HA ARG A 3 31.170 57.940 25.159 1.00 0.00 H ATOM 37 HB2 ARG A 3 33.863 57.184 23.978 1.00 0.00 H ATOM 38 HB3 ARG A 3 32.386 56.196 23.885 1.00 0.00 H ATOM 39 HG2 ARG A 3 31.351 57.639 22.403 1.00 0.00 H ATOM 40 HG3 ARG A 3 32.369 59.020 22.875 1.00 0.00 H ATOM 41 HD2 ARG A 3 34.255 58.098 21.723 1.00 0.00 H ATOM 42 HD3 ARG A 3 32.861 58.170 20.619 1.00 0.00 H ATOM 43 HE ARG A 3 34.199 55.731 21.684 1.00 0.00 H ATOM 44 HH12 ARG A 3 31.122 55.672 19.020 1.00 0.00 H ATOM 45 HH11 ARG A 3 31.463 57.168 19.964 1.00 0.00 H ATOM 46 HH22 ARG A 3 32.427 53.798 19.321 1.00 0.00 H ATOM 47 HH21 ARG A 3 33.785 53.834 20.503 1.00 0.00 H ATOM 48 H ARG A 3 33.694 59.467 25.020 1.00 0.00 H ATOM 49 N ARG A 4 31.384 56.500 26.981 1.00 32.53 N ATOM 50 CA ARG A 4 31.453 55.623 28.136 1.00 30.77 C ATOM 51 C ARG A 4 31.553 54.184 27.647 1.00 31.33 C ATOM 52 O ARG A 4 31.045 53.851 26.586 1.00 31.81 O ATOM 53 CB ARG A 4 30.214 55.828 29.021 1.00 30.48 C ATOM 54 CG ARG A 4 30.045 57.287 29.458 1.00 32.87 C ATOM 55 CD ARG A 4 28.644 57.537 29.997 1.00 39.70 C ATOM 56 NE ARG A 4 28.285 56.564 31.021 1.00 47.04 N ATOM 57 CZ ARG A 4 27.135 56.560 31.688 1.00 62.04 C ATOM 58 NH1 ARG A 4 26.219 57.490 31.436 1.00 43.51 N ATOM 59 NH2 ARG A 4 26.903 55.625 32.606 1.00 43.39 N ATOM 60 HA ARG A 4 32.332 55.854 28.738 1.00 0.00 H ATOM 61 HB2 ARG A 4 29.329 55.525 28.461 1.00 0.00 H ATOM 62 HB3 ARG A 4 30.311 55.205 29.910 1.00 0.00 H ATOM 63 HG2 ARG A 4 30.773 57.512 30.238 1.00 0.00 H ATOM 64 HG3 ARG A 4 30.219 57.938 28.601 1.00 0.00 H ATOM 65 HD2 ARG A 4 27.930 57.467 29.176 1.00 0.00 H ATOM 66 HD3 ARG A 4 28.603 58.537 30.428 1.00 0.00 H ATOM 67 HE ARG A 4 28.977 55.821 31.246 1.00 0.00 H ATOM 68 HH12 ARG A 4 25.319 57.488 31.957 1.00 0.00 H ATOM 69 HH11 ARG A 4 26.402 58.219 30.718 1.00 0.00 H ATOM 70 HH22 ARG A 4 26.004 55.621 33.128 1.00 0.00 H ATOM 71 HH21 ARG A 4 27.621 54.898 32.801 1.00 0.00 H ATOM 72 H ARG A 4 30.456 56.736 26.574 1.00 0.00 H ATOM 73 N VAL A 5 32.165 53.328 28.460 1.00 26.03 N ATOM 74 CA VAL A 5 32.369 51.920 28.124 1.00 23.89 C ATOM 75 C VAL A 5 31.691 51.031 29.168 1.00 28.18 C ATOM 76 O VAL A 5 31.935 51.163 30.361 1.00 29.07 O ATOM 77 CB VAL A 5 33.907 51.617 28.023 1.00 25.96 C ATOM 78 CG1 VAL A 5 34.151 50.128 27.690 1.00 25.34 C ATOM 79 CG2 VAL A 5 34.572 52.542 26.957 1.00 24.76 C ATOM 80 HA VAL A 5 31.917 51.704 27.156 1.00 0.00 H ATOM 81 HB VAL A 5 34.365 51.823 28.990 1.00 0.00 H ATOM 82 HG11 VAL A 5 33.720 49.506 28.475 1.00 0.00 H ATOM 83 HG12 VAL A 5 33.681 49.889 26.736 1.00 0.00 H ATOM 84 HG13 VAL A 5 35.223 49.942 27.625 1.00 0.00 H ATOM 85 HG21 VAL A 5 34.109 52.366 25.986 1.00 0.00 H ATOM 86 HG22 VAL A 5 34.432 53.584 27.244 1.00 0.00 H ATOM 87 HG23 VAL A 5 35.638 52.320 26.899 1.00 0.00 H ATOM 88 H VAL A 5 32.514 53.676 29.376 1.00 0.00 H ATOM 89 N VAL A 6 30.883 50.077 28.716 1.00 25.49 N ATOM 90 CA VAL A 6 30.215 49.158 29.638 1.00 24.72 C ATOM 91 C VAL A 6 30.582 47.736 29.246 1.00 29.86 C ATOM 92 O VAL A 6 31.137 47.525 28.179 1.00 29.58 O ATOM 93 CB VAL A 6 28.671 49.357 29.617 1.00 29.02 C ATOM 94 CG1 VAL A 6 28.281 50.686 30.280 1.00 28.29 C ATOM 95 CG2 VAL A 6 28.161 49.304 28.202 1.00 28.31 C ATOM 96 HA VAL A 6 30.547 49.361 30.656 1.00 0.00 H ATOM 97 HB VAL A 6 28.212 48.549 30.186 1.00 0.00 H ATOM 98 HG11 VAL A 6 28.621 50.688 31.316 1.00 0.00 H ATOM 99 HG12 VAL A 6 28.749 51.510 29.741 1.00 0.00 H ATOM 100 HG13 VAL A 6 27.197 50.800 30.252 1.00 0.00 H ATOM 101 HG21 VAL A 6 28.632 50.094 27.618 1.00 0.00 H ATOM 102 HG22 VAL A 6 28.403 48.335 27.766 1.00 0.00 H ATOM 103 HG23 VAL A 6 27.080 49.444 28.201 1.00 0.00 H ATOM 104 H VAL A 6 30.723 49.983 27.693 1.00 0.00 H ATOM 105 N VAL A 7 30.257 46.775 30.112 1.00 26.89 N ATOM 106 CA VAL A 7 30.532 45.365 29.890 1.00 26.52 C ATOM 107 C VAL A 7 29.234 44.686 29.538 1.00 31.14 C ATOM 108 O VAL A 7 28.268 44.763 30.296 1.00 28.74 O ATOM 109 CB VAL A 7 31.136 44.723 31.148 1.00 29.25 C ATOM 110 CG1 VAL A 7 31.436 43.238 30.888 1.00 28.92 C ATOM 111 CG2 VAL A 7 32.344 45.509 31.616 1.00 28.59 C ATOM 112 HA VAL A 7 31.253 45.254 29.080 1.00 0.00 H ATOM 113 HB VAL A 7 30.415 44.758 31.965 1.00 0.00 H ATOM 114 HG11 VAL A 7 30.511 42.722 30.630 1.00 0.00 H ATOM 115 HG12 VAL A 7 32.145 43.151 30.064 1.00 0.00 H ATOM 116 HG13 VAL A 7 31.864 42.792 31.786 1.00 0.00 H ATOM 117 HG21 VAL A 7 33.096 45.521 30.827 1.00 0.00 H ATOM 118 HG22 VAL A 7 32.043 46.531 31.848 1.00 0.00 H ATOM 119 HG23 VAL A 7 32.758 45.039 32.508 1.00 0.00 H ATOM 120 H VAL A 7 29.781 47.050 30.995 1.00 0.00 H ATOM 121 N THR A 8 29.205 44.018 28.395 1.00 29.54 N ATOM 122 CA THR A 8 27.961 43.438 27.909 1.00 29.21 C ATOM 123 C THR A 8 27.994 41.947 27.670 1.00 32.33 C ATOM 124 O THR A 8 27.006 41.384 27.208 1.00 32.16 O ATOM 125 CB THR A 8 27.497 44.162 26.628 1.00 32.81 C ATOM 126 OG1 THR A 8 28.486 44.007 25.604 1.00 29.01 O ATOM 127 CG2 THR A 8 27.290 45.631 26.893 1.00 29.39 C ATOM 128 HA THR A 8 27.248 43.586 28.720 1.00 0.00 H ATOM 129 HB THR A 8 26.553 43.723 26.306 1.00 0.00 H ATOM 130 HG1 THR A 8 28.186 44.472 24.784 1.00 0.00 H ATOM 131 HG23 THR A 8 26.538 45.756 27.672 1.00 0.00 H ATOM 132 HG21 THR A 8 28.230 46.076 27.219 1.00 0.00 H ATOM 133 HG22 THR A 8 26.953 46.120 25.979 1.00 0.00 H ATOM 134 H THR A 8 30.078 43.907 27.840 1.00 0.00 H ATOM 135 N GLY A 9 29.124 41.304 27.947 1.00 27.36 N ATOM 136 CA GLY A 9 29.242 39.863 27.751 1.00 25.68 C ATOM 137 C GLY A 9 30.422 39.339 28.539 1.00 28.31 C ATOM 138 O GLY A 9 31.390 40.082 28.746 1.00 27.57 O ATOM 139 HA3 GLY A 9 29.390 39.651 26.692 1.00 0.00 H ATOM 140 HA2 GLY A 9 28.330 39.374 28.094 1.00 0.00 H ATOM 141 H GLY A 9 29.939 41.838 28.310 1.00 0.00 H ATOM 142 N LEU A 10 30.293 38.120 29.066 1.00 23.39 N ATOM 143 CA LEU A 10 31.337 37.484 29.884 1.00 23.26 C ATOM 144 C LEU A 10 31.594 36.042 29.450 1.00 28.60 C ATOM 145 O LEU A 10 30.671 35.335 29.050 1.00 26.60 O ATOM 146 CB LEU A 10 30.939 37.492 31.377 1.00 23.38 C ATOM 147 CG LEU A 10 30.572 38.828 32.023 1.00 27.64 C ATOM 148 CD1 LEU A 10 29.928 38.641 33.390 1.00 27.27 C ATOM 149 CD2 LEU A 10 31.777 39.766 32.138 1.00 27.51 C ATOM 150 HA LEU A 10 32.250 38.062 29.740 1.00 0.00 H ATOM 151 HB2 LEU A 10 30.077 36.834 31.485 1.00 0.00 H ATOM 152 HB3 LEU A 10 31.780 37.083 31.937 1.00 0.00 H ATOM 153 HG LEU A 10 29.843 39.292 31.359 1.00 0.00 H ATOM 154 HD21 LEU A 10 32.546 39.294 32.749 1.00 0.00 H ATOM 155 HD22 LEU A 10 32.175 39.968 31.143 1.00 0.00 H ATOM 156 HD23 LEU A 10 31.465 40.701 32.603 1.00 0.00 H ATOM 157 HD11 LEU A 10 29.017 38.051 33.284 1.00 0.00 H ATOM 158 HD12 LEU A 10 30.623 38.122 34.050 1.00 0.00 H ATOM 159 HD13 LEU A 10 29.684 39.616 33.812 1.00 0.00 H ATOM 160 H LEU A 10 29.413 37.595 28.890 1.00 0.00 H ATOM 161 N GLY A 11 32.853 35.596 29.536 1.00 23.01 N ATOM 162 CA GLY A 11 33.235 34.230 29.179 1.00 21.20 C ATOM 163 C GLY A 11 34.375 33.794 30.091 1.00 24.01 C ATOM 164 O GLY A 11 35.215 34.620 30.454 1.00 23.21 O ATOM 165 HA3 GLY A 11 33.562 34.199 28.140 1.00 0.00 H ATOM 166 HA2 GLY A 11 32.383 33.563 29.310 1.00 0.00 H ATOM 167 H GLY A 11 33.591 36.248 29.871 1.00 0.00 H ATOM 168 N MET A 12 34.417 32.533 30.503 1.00 21.71 N ATOM 169 CA MET A 12 35.461 32.135 31.448 1.00 21.53 C ATOM 170 C MET A 12 35.653 30.650 31.599 1.00 27.82 C ATOM 171 O MET A 12 34.685 29.865 31.572 1.00 28.84 O ATOM 172 CB MET A 12 35.110 32.724 32.831 1.00 23.94 C ATOM 173 CG MET A 12 35.972 32.231 33.980 1.00 27.05 C ATOM 174 SD MET A 12 36.117 33.462 35.290 1.00 29.98 S ATOM 175 CE MET A 12 34.417 33.783 35.763 1.00 28.74 C ATOM 176 HA MET A 12 36.398 32.519 31.044 1.00 0.00 H ATOM 177 HB2 MET A 12 35.213 33.808 32.773 1.00 0.00 H ATOM 178 HB3 MET A 12 34.074 32.470 33.053 1.00 0.00 H ATOM 179 HG2 MET A 12 36.968 32.001 33.600 1.00 0.00 H ATOM 180 HG3 MET A 12 35.525 31.327 34.394 1.00 0.00 H ATOM 181 HE1 MET A 12 33.866 34.160 34.901 1.00 0.00 H ATOM 182 HE2 MET A 12 33.958 32.859 36.113 1.00 0.00 H ATOM 183 HE3 MET A 12 34.397 34.525 36.561 1.00 0.00 H ATOM 184 H MET A 12 33.721 31.841 30.161 1.00 0.00 H ATOM 185 N LEU A 13 36.915 30.261 31.767 1.00 23.08 N ATOM 186 CA LEU A 13 37.288 28.881 32.063 1.00 22.91 C ATOM 187 C LEU A 13 38.235 29.087 33.225 1.00 27.73 C ATOM 188 O LEU A 13 39.104 29.935 33.139 1.00 25.41 O ATOM 189 CB LEU A 13 38.040 28.209 30.912 1.00 22.85 C ATOM 190 CG LEU A 13 37.247 28.004 29.608 1.00 27.76 C ATOM 191 CD1 LEU A 13 38.188 27.597 28.477 1.00 28.78 C ATOM 192 CD2 LEU A 13 36.221 26.893 29.813 1.00 28.35 C ATOM 193 HA LEU A 13 36.427 28.239 32.250 1.00 0.00 H ATOM 194 HB2 LEU A 13 38.910 28.823 30.679 1.00 0.00 H ATOM 195 HB3 LEU A 13 38.371 27.230 31.258 1.00 0.00 H ATOM 196 HG LEU A 13 36.749 28.938 29.348 1.00 0.00 H ATOM 197 HD21 LEU A 13 36.736 25.969 30.078 1.00 0.00 H ATOM 198 HD22 LEU A 13 35.539 27.173 30.616 1.00 0.00 H ATOM 199 HD23 LEU A 13 35.658 26.746 28.891 1.00 0.00 H ATOM 200 HD11 LEU A 13 38.931 28.380 28.324 1.00 0.00 H ATOM 201 HD12 LEU A 13 38.689 26.666 28.741 1.00 0.00 H ATOM 202 HD13 LEU A 13 37.614 27.456 27.561 1.00 0.00 H ATOM 203 H LEU A 13 37.669 30.972 31.684 1.00 0.00 H ATOM 204 N SER A 14 38.001 28.392 34.337 1.00 22.99 N ATOM 205 CA SER A 14 38.858 28.546 35.510 1.00 23.57 C ATOM 206 C SER A 14 38.992 27.213 36.239 1.00 27.22 C ATOM 207 O SER A 14 38.333 26.226 35.902 1.00 27.09 O ATOM 208 CB SER A 14 38.310 29.614 36.450 1.00 24.66 C ATOM 209 OG SER A 14 37.326 29.032 37.291 1.00 32.23 O ATOM 210 HA SER A 14 39.844 28.867 35.175 1.00 0.00 H ATOM 211 HB2 SER A 14 37.863 30.419 35.867 1.00 0.00 H ATOM 212 HB3 SER A 14 39.120 30.015 37.059 1.00 0.00 H ATOM 213 HG SER A 14 36.592 28.668 36.735 1.00 0.00 H ATOM 214 H SER A 14 37.198 27.732 34.371 1.00 0.00 H ATOM 215 N PRO A 15 39.885 27.157 37.226 1.00 24.80 N ATOM 216 CA PRO A 15 40.045 25.864 37.908 1.00 23.29 C ATOM 217 C PRO A 15 38.809 25.490 38.764 1.00 29.28 C ATOM 218 O PRO A 15 38.748 24.382 39.315 1.00 28.81 O ATOM 219 CB PRO A 15 41.231 26.124 38.823 1.00 24.46 C ATOM 220 CG PRO A 15 42.057 27.178 38.046 1.00 28.28 C ATOM 221 CD PRO A 15 41.004 28.081 37.503 1.00 25.23 C ATOM 222 HA PRO A 15 40.174 25.041 37.205 1.00 0.00 H ATOM 223 HD3 PRO A 15 40.718 28.835 38.236 1.00 0.00 H ATOM 224 HD2 PRO A 15 41.341 28.573 36.591 1.00 0.00 H ATOM 225 HG3 PRO A 15 42.631 26.715 37.243 1.00 0.00 H ATOM 226 HG2 PRO A 15 42.733 27.716 38.710 1.00 0.00 H ATOM 227 HB2 PRO A 15 40.903 26.517 39.786 1.00 0.00 H ATOM 228 HB3 PRO A 15 41.809 25.214 38.981 1.00 0.00 H ATOM 229 N VAL A 16 37.895 26.442 38.957 1.00 25.99 N ATOM 230 CA VAL A 16 36.682 26.181 39.769 1.00 25.95 C ATOM 231 C VAL A 16 35.403 26.161 38.923 1.00 30.57 C ATOM 232 O VAL A 16 34.311 26.070 39.473 1.00 31.22 O ATOM 233 CB VAL A 16 36.546 27.057 41.047 1.00 27.13 C ATOM 234 CG1 VAL A 16 37.741 26.811 42.046 1.00 25.16 C ATOM 235 CG2 VAL A 16 36.387 28.529 40.712 1.00 26.99 C ATOM 236 HA VAL A 16 36.826 25.172 40.155 1.00 0.00 H ATOM 237 HB VAL A 16 35.631 26.748 41.552 1.00 0.00 H ATOM 238 HG11 VAL A 16 37.753 25.763 42.345 1.00 0.00 H ATOM 239 HG12 VAL A 16 38.681 27.061 41.554 1.00 0.00 H ATOM 240 HG13 VAL A 16 37.612 27.440 42.927 1.00 0.00 H ATOM 241 HG21 VAL A 16 37.260 28.870 40.156 1.00 0.00 H ATOM 242 HG22 VAL A 16 35.492 28.668 40.106 1.00 0.00 H ATOM 243 HG23 VAL A 16 36.296 29.102 41.634 1.00 0.00 H ATOM 244 H VAL A 16 38.035 27.381 38.532 1.00 0.00 H ATOM 245 N GLY A 17 35.549 26.138 37.598 1.00 24.26 N ATOM 246 CA GLY A 17 34.380 26.075 36.732 1.00 24.96 C ATOM 247 C GLY A 17 34.614 26.452 35.283 1.00 29.42 C ATOM 248 O GLY A 17 35.506 27.257 34.977 1.00 26.98 O ATOM 249 HA3 GLY A 17 33.626 26.751 37.137 1.00 0.00 H ATOM 250 HA2 GLY A 17 34.000 25.054 36.755 1.00 0.00 H ATOM 251 H GLY A 17 36.501 26.165 37.181 1.00 0.00 H ATOM 252 N ASN A 18 33.811 25.870 34.391 1.00 22.86 N ATOM 253 CA ASN A 18 33.955 26.111 32.957 1.00 24.05 C ATOM 254 C ASN A 18 32.953 27.064 32.350 1.00 26.15 C ATOM 255 O ASN A 18 32.799 27.120 31.138 1.00 25.63 O ATOM 256 CB ASN A 18 34.035 24.807 32.162 1.00 25.62 C ATOM 257 CG ASN A 18 35.223 23.978 32.549 1.00 36.90 C ATOM 258 OD1 ASN A 18 36.131 24.465 33.201 1.00 37.78 O ATOM 259 ND2 ASN A 18 35.238 22.726 32.135 1.00 36.60 N ATOM 260 HA ASN A 18 34.910 26.631 32.877 1.00 0.00 H ATOM 261 HB2 ASN A 18 33.129 24.229 32.344 1.00 0.00 H ATOM 262 HB3 ASN A 18 34.105 25.046 31.101 1.00 0.00 H ATOM 263 HD22 ASN A 18 34.441 22.352 31.581 1.00 0.00 H ATOM 264 HD21 ASN A 18 36.046 22.113 32.363 1.00 0.00 H ATOM 265 H ASN A 18 33.064 25.228 34.725 1.00 0.00 H ATOM 266 N THR A 19 32.308 27.843 33.206 1.00 23.00 N ATOM 267 CA THR A 19 31.416 28.903 32.770 1.00 22.46 C ATOM 268 C THR A 19 31.591 30.021 33.776 1.00 24.10 C ATOM 269 O THR A 19 32.129 29.809 34.843 1.00 24.63 O ATOM 270 CB THR A 19 29.920 28.442 32.752 1.00 30.97 C ATOM 271 OG1 THR A 19 29.515 28.135 34.096 1.00 28.97 O ATOM 272 CG2 THR A 19 29.733 27.225 31.858 1.00 30.22 C ATOM 273 HA THR A 19 31.657 29.208 31.752 1.00 0.00 H ATOM 274 HB THR A 19 29.304 29.246 32.350 1.00 0.00 H ATOM 275 HG1 THR A 19 28.569 27.842 34.096 1.00 0.00 H ATOM 276 HG23 THR A 19 30.043 27.471 30.842 1.00 0.00 H ATOM 277 HG21 THR A 19 30.339 26.402 32.236 1.00 0.00 H ATOM 278 HG22 THR A 19 28.683 26.934 31.858 1.00 0.00 H ATOM 279 H THR A 19 32.445 27.690 34.226 1.00 0.00 H ATOM 280 N VAL A 20 31.056 31.190 33.467 1.00 22.91 N ATOM 281 CA VAL A 20 31.100 32.343 34.369 1.00 22.10 C ATOM 282 C VAL A 20 30.320 32.080 35.672 1.00 29.05 C ATOM 283 O VAL A 20 30.858 32.215 36.789 1.00 25.81 O ATOM 284 CB VAL A 20 30.554 33.614 33.651 1.00 26.34 C ATOM 285 CG1 VAL A 20 30.405 34.799 34.625 1.00 25.44 C ATOM 286 CG2 VAL A 20 31.475 34.004 32.481 1.00 25.09 C ATOM 287 HA VAL A 20 32.142 32.510 34.641 1.00 0.00 H ATOM 288 HB VAL A 20 29.564 33.374 33.264 1.00 0.00 H ATOM 289 HG11 VAL A 20 29.711 34.529 35.421 1.00 0.00 H ATOM 290 HG12 VAL A 20 31.377 35.038 35.055 1.00 0.00 H ATOM 291 HG13 VAL A 20 30.022 35.665 34.085 1.00 0.00 H ATOM 292 HG21 VAL A 20 32.475 34.211 32.861 1.00 0.00 H ATOM 293 HG22 VAL A 20 31.520 33.182 31.766 1.00 0.00 H ATOM 294 HG23 VAL A 20 31.080 34.893 31.990 1.00 0.00 H ATOM 295 H VAL A 20 30.585 31.295 32.546 1.00 0.00 H ATOM 296 N GLU A 21 29.056 31.694 35.534 1.00 27.58 N ATOM 297 CA GLU A 21 28.223 31.439 36.717 1.00 26.68 C ATOM 298 C GLU A 21 28.663 30.285 37.618 1.00 28.77 C ATOM 299 O GLU A 21 28.599 30.404 38.844 1.00 28.77 O ATOM 300 CB GLU A 21 26.731 31.336 36.336 1.00 27.82 C ATOM 301 CG GLU A 21 26.250 32.527 35.483 1.00 27.10 C ATOM 302 CD GLU A 21 26.204 33.828 36.237 1.00 29.22 C ATOM 303 OE1 GLU A 21 26.232 33.821 37.483 1.00 28.21 O ATOM 304 OE2 GLU A 21 26.158 34.892 35.587 1.00 37.01 O ATOM 305 HA GLU A 21 28.375 32.317 37.344 1.00 0.00 H ATOM 306 HB2 GLU A 21 26.578 30.417 35.770 1.00 0.00 H ATOM 307 HB3 GLU A 21 26.139 31.300 37.251 1.00 0.00 H ATOM 308 HG2 GLU A 21 26.928 32.642 34.638 1.00 0.00 H ATOM 309 HG3 GLU A 21 25.248 32.306 35.116 1.00 0.00 H ATOM 310 H GLU A 21 28.654 31.572 34.583 1.00 0.00 H ATOM 311 N SER A 22 29.118 29.178 37.037 1.00 25.63 N ATOM 312 CA SER A 22 29.599 28.065 37.858 1.00 26.61 C ATOM 313 C SER A 22 30.874 28.452 38.598 1.00 31.88 C ATOM 314 O SER A 22 31.071 28.094 39.762 1.00 31.36 O ATOM 315 CB SER A 22 29.812 26.807 37.012 1.00 31.87 C ATOM 316 OG SER A 22 30.861 26.973 36.078 1.00 35.39 O ATOM 317 HA SER A 22 28.834 27.838 38.600 1.00 0.00 H ATOM 318 HB2 SER A 22 28.891 26.584 36.473 1.00 0.00 H ATOM 319 HB3 SER A 22 30.056 25.975 37.672 1.00 0.00 H ATOM 320 HG SER A 22 30.644 27.724 35.470 1.00 0.00 H ATOM 321 H SER A 22 29.132 29.103 36.000 1.00 0.00 H ATOM 322 N THR A 23 31.751 29.204 37.927 1.00 26.60 N ATOM 323 CA THR A 23 32.965 29.653 38.584 1.00 23.33 C ATOM 324 C THR A 23 32.596 30.575 39.749 1.00 25.41 C ATOM 325 O THR A 23 33.130 30.455 40.835 1.00 25.77 O ATOM 326 CB THR A 23 33.862 30.418 37.590 1.00 23.68 C ATOM 327 OG1 THR A 23 34.468 29.489 36.682 1.00 21.80 O ATOM 328 CG2 THR A 23 34.927 31.218 38.344 1.00 25.73 C ATOM 329 HA THR A 23 33.510 28.785 38.954 1.00 0.00 H ATOM 330 HB THR A 23 33.255 31.121 37.020 1.00 0.00 H ATOM 331 HG1 THR A 23 33.761 29.006 36.185 1.00 0.00 H ATOM 332 HG23 THR A 23 34.441 31.915 39.026 1.00 0.00 H ATOM 333 HG21 THR A 23 35.559 30.535 38.911 1.00 0.00 H ATOM 334 HG22 THR A 23 35.537 31.772 37.630 1.00 0.00 H ATOM 335 H THR A 23 31.565 29.467 36.938 1.00 0.00 H ATOM 336 N TRP A 24 31.718 31.532 39.507 1.00 24.00 N ATOM 337 CA TRP A 24 31.329 32.492 40.553 1.00 24.21 C ATOM 338 C TRP A 24 30.641 31.801 41.728 1.00 28.29 C ATOM 339 O TRP A 24 30.906 32.107 42.895 1.00 28.73 O ATOM 340 CB TRP A 24 30.458 33.609 39.941 1.00 23.49 C ATOM 341 CG TRP A 24 29.986 34.712 40.889 1.00 23.96 C ATOM 342 CD1 TRP A 24 28.680 35.063 41.124 1.00 26.68 C ATOM 343 CD2 TRP A 24 30.783 35.691 41.594 1.00 24.28 C ATOM 344 NE1 TRP A 24 28.614 36.147 41.949 1.00 24.83 N ATOM 345 CE2 TRP A 24 29.884 36.528 42.298 1.00 26.88 C ATOM 346 CE3 TRP A 24 32.162 35.907 41.749 1.00 24.91 C ATOM 347 CZ2 TRP A 24 30.317 37.623 43.060 1.00 26.12 C ATOM 348 CZ3 TRP A 24 32.582 36.959 42.548 1.00 25.33 C ATOM 349 CH2 TRP A 24 31.669 37.837 43.141 1.00 25.86 C ATOM 350 HA TRP A 24 32.231 32.950 40.959 1.00 0.00 H ATOM 351 HB2 TRP A 24 31.037 34.081 39.147 1.00 0.00 H ATOM 352 HB3 TRP A 24 29.572 33.140 39.513 1.00 0.00 H ATOM 353 HE1 TRP A 24 27.738 36.611 42.264 1.00 0.00 H ATOM 354 HD1 TRP A 24 27.815 34.546 40.708 1.00 0.00 H ATOM 355 HZ2 TRP A 24 29.608 38.277 43.567 1.00 0.00 H ATOM 356 HH2 TRP A 24 32.040 38.710 43.679 1.00 0.00 H ATOM 357 HZ3 TRP A 24 33.649 37.105 42.718 1.00 0.00 H ATOM 358 HE3 TRP A 24 32.886 35.262 41.252 1.00 0.00 H ATOM 359 H TRP A 24 31.294 31.609 38.560 1.00 0.00 H ATOM 360 N LYS A 25 29.800 30.822 41.435 1.00 26.78 N ATOM 361 CA LYS A 25 29.154 30.076 42.529 1.00 26.11 C ATOM 362 C LYS A 25 30.205 29.405 43.433 1.00 29.28 C ATOM 363 O LYS A 25 30.091 29.414 44.656 1.00 27.26 O ATOM 364 CB LYS A 25 28.217 29.022 41.943 1.00 27.59 C ATOM 365 CG LYS A 25 27.423 28.228 42.984 1.00 38.16 C ATOM 366 CD LYS A 25 26.538 27.204 42.291 1.00 42.66 C ATOM 367 CE LYS A 25 25.664 26.469 43.303 1.00 49.15 C ATOM 368 NZ LYS A 25 24.815 25.403 42.686 1.00 43.38 N ATOM 369 HA LYS A 25 28.581 30.775 43.138 1.00 0.00 H ATOM 370 HB2 LYS A 25 27.508 29.525 41.285 1.00 0.00 H ATOM 371 HB3 LYS A 25 28.815 28.320 41.362 1.00 0.00 H ATOM 372 HG2 LYS A 25 28.115 27.715 43.652 1.00 0.00 H ATOM 373 HG3 LYS A 25 26.801 28.911 43.562 1.00 0.00 H ATOM 374 HD2 LYS A 25 25.899 27.713 41.570 1.00 0.00 H ATOM 375 HD3 LYS A 25 27.167 26.482 41.771 1.00 0.00 H ATOM 376 HE2 LYS A 25 25.011 27.194 43.788 1.00 0.00 H ATOM 377 HE3 LYS A 25 26.311 26.008 44.049 1.00 0.00 H ATOM 378 HZ1 LYS A 25 24.184 25.830 41.978 1.00 0.00 H ATOM 379 HZ2 LYS A 25 25.426 24.697 42.227 1.00 0.00 H ATOM 380 HZ3 LYS A 25 24.247 24.943 43.425 1.00 0.00 H ATOM 381 H LYS A 25 29.597 30.582 40.444 1.00 0.00 H ATOM 382 N ALA A 26 31.212 28.791 42.818 1.00 26.37 N ATOM 383 CA ALA A 26 32.247 28.089 43.576 1.00 25.97 C ATOM 384 C ALA A 26 33.065 29.028 44.422 1.00 27.52 C ATOM 385 O ALA A 26 33.402 28.705 45.556 1.00 28.14 O ATOM 386 CB ALA A 26 33.149 27.236 42.633 1.00 26.14 C ATOM 387 HA ALA A 26 31.741 27.409 44.262 1.00 0.00 H ATOM 388 HB1 ALA A 26 32.536 26.500 42.114 1.00 0.00 H ATOM 389 HB2 ALA A 26 33.630 27.889 41.905 1.00 0.00 H ATOM 390 HB3 ALA A 26 33.909 26.725 43.224 1.00 0.00 H ATOM 391 H ALA A 26 31.264 28.811 41.779 1.00 0.00 H ATOM 392 N LEU A 27 33.335 30.224 43.895 1.00 25.80 N ATOM 393 CA LEU A 27 34.115 31.238 44.621 1.00 25.74 C ATOM 394 C LEU A 27 33.366 31.780 45.852 1.00 29.74 C ATOM 395 O LEU A 27 33.950 31.952 46.925 1.00 27.71 O ATOM 396 CB LEU A 27 34.516 32.408 43.713 1.00 26.04 C ATOM 397 CG LEU A 27 35.531 32.077 42.579 1.00 28.96 C ATOM 398 CD1 LEU A 27 35.727 33.315 41.695 1.00 28.79 C ATOM 399 CD2 LEU A 27 36.891 31.593 43.154 1.00 26.11 C ATOM 400 HA LEU A 27 35.017 30.730 44.962 1.00 0.00 H ATOM 401 HB2 LEU A 27 33.610 32.794 43.247 1.00 0.00 H ATOM 402 HB3 LEU A 27 34.958 33.181 44.341 1.00 0.00 H ATOM 403 HG LEU A 27 35.127 31.262 41.979 1.00 0.00 H ATOM 404 HD21 LEU A 27 37.318 32.375 43.782 1.00 0.00 H ATOM 405 HD22 LEU A 27 36.733 30.694 43.749 1.00 0.00 H ATOM 406 HD23 LEU A 27 37.573 31.372 42.333 1.00 0.00 H ATOM 407 HD11 LEU A 27 34.771 33.602 41.257 1.00 0.00 H ATOM 408 HD12 LEU A 27 36.111 34.135 42.301 1.00 0.00 H ATOM 409 HD13 LEU A 27 36.437 33.084 40.901 1.00 0.00 H ATOM 410 H LEU A 27 32.983 30.446 42.942 1.00 0.00 H ATOM 411 N LEU A 28 32.086 32.086 45.696 1.00 27.48 N ATOM 412 CA LEU A 28 31.314 32.569 46.848 1.00 26.89 C ATOM 413 C LEU A 28 31.203 31.465 47.934 1.00 30.43 C ATOM 414 O LEU A 28 31.049 31.774 49.112 1.00 32.42 O ATOM 415 CB LEU A 28 29.932 33.021 46.400 1.00 26.04 C ATOM 416 CG LEU A 28 29.890 34.335 45.617 1.00 28.62 C ATOM 417 CD1 LEU A 28 28.442 34.654 45.147 1.00 29.80 C ATOM 418 CD2 LEU A 28 30.510 35.505 46.403 1.00 26.26 C ATOM 419 HA LEU A 28 31.835 33.422 47.283 1.00 0.00 H ATOM 420 HB2 LEU A 28 29.511 32.239 45.767 1.00 0.00 H ATOM 421 HB3 LEU A 28 29.313 33.140 47.289 1.00 0.00 H ATOM 422 HG LEU A 28 30.508 34.204 44.729 1.00 0.00 H ATOM 423 HD21 LEU A 28 29.960 35.648 47.333 1.00 0.00 H ATOM 424 HD22 LEU A 28 31.552 35.279 46.627 1.00 0.00 H ATOM 425 HD23 LEU A 28 30.455 36.414 45.803 1.00 0.00 H ATOM 426 HD11 LEU A 28 28.085 33.850 44.503 1.00 0.00 H ATOM 427 HD12 LEU A 28 27.790 34.742 46.016 1.00 0.00 H ATOM 428 HD13 LEU A 28 28.440 35.593 44.593 1.00 0.00 H ATOM 429 H LEU A 28 31.632 31.985 44.766 1.00 0.00 H ATOM 430 N ALA A 29 31.311 30.199 47.518 1.00 25.42 N ATOM 431 CA ALA A 29 31.262 29.032 48.415 1.00 25.27 C ATOM 432 C ALA A 29 32.632 28.648 49.000 1.00 33.45 C ATOM 433 O ALA A 29 32.732 27.681 49.763 1.00 34.93 O ATOM 434 CB ALA A 29 30.630 27.832 47.715 1.00 24.50 C ATOM 435 HA ALA A 29 30.638 29.330 49.257 1.00 0.00 H ATOM 436 HB1 ALA A 29 29.614 28.084 47.411 1.00 0.00 H ATOM 437 HB2 ALA A 29 31.220 27.574 46.836 1.00 0.00 H ATOM 438 HB3 ALA A 29 30.606 26.984 48.400 1.00 0.00 H ATOM 439 H ALA A 29 31.437 30.028 46.500 1.00 0.00 H ATOM 440 N GLY A 30 33.674 29.413 48.677 1.00 29.14 N ATOM 441 CA GLY A 30 35.027 29.182 49.189 1.00 27.97 C ATOM 442 C GLY A 30 35.683 27.893 48.715 1.00 30.52 C ATOM 443 O GLY A 30 36.584 27.363 49.384 1.00 30.50 O ATOM 444 HA3 GLY A 30 34.977 29.156 50.278 1.00 0.00 H ATOM 445 HA2 GLY A 30 35.655 30.016 48.875 1.00 0.00 H ATOM 446 H GLY A 30 33.519 30.213 48.030 1.00 0.00 H ATOM 447 N GLN A 31 35.251 27.381 47.564 1.00 25.80 N ATOM 448 CA GLN A 31 35.814 26.123 47.040 1.00 25.46 C ATOM 449 C GLN A 31 37.179 26.337 46.378 1.00 32.74 C ATOM 450 O GLN A 31 37.336 27.237 45.575 1.00 31.62 O ATOM 451 CB GLN A 31 34.914 25.556 45.963 1.00 25.77 C ATOM 452 CG GLN A 31 33.547 25.113 46.457 1.00 63.29 C ATOM 453 CD GLN A 31 32.598 24.765 45.321 1.00 90.87 C ATOM 454 OE1 GLN A 31 33.020 24.306 44.251 1.00 89.86 O ATOM 455 NE2 GLN A 31 31.309 24.976 45.550 1.00 83.84 N ATOM 456 HA GLN A 31 35.907 25.453 47.895 1.00 0.00 H ATOM 457 HB2 GLN A 31 34.770 26.322 45.201 1.00 0.00 H ATOM 458 HB3 GLN A 31 35.413 24.694 45.520 1.00 0.00 H ATOM 459 HG2 GLN A 31 33.672 24.234 47.089 1.00 0.00 H ATOM 460 HG3 GLN A 31 33.109 25.921 47.043 1.00 0.00 H ATOM 461 HE22 GLN A 31 31.000 25.363 46.464 1.00 0.00 H ATOM 462 HE21 GLN A 31 30.607 24.754 44.815 1.00 0.00 H ATOM 463 H GLN A 31 34.508 27.874 47.029 1.00 0.00 H ATOM 464 N SER A 32 38.101 25.412 46.599 1.00 30.97 N ATOM 465 CA SER A 32 39.427 25.479 45.996 1.00 30.15 C ATOM 466 C SER A 32 39.429 24.708 44.699 1.00 31.08 C ATOM 467 O SER A 32 38.804 23.655 44.584 1.00 29.30 O ATOM 468 CB SER A 32 40.461 24.861 46.957 1.00 32.91 C ATOM 469 OG SER A 32 41.729 24.753 46.331 1.00 36.05 O ATOM 470 HA SER A 32 39.685 26.520 45.803 1.00 0.00 H ATOM 471 HB2 SER A 32 40.124 23.868 47.255 1.00 0.00 H ATOM 472 HB3 SER A 32 40.551 25.493 47.840 1.00 0.00 H ATOM 473 HG SER A 32 42.041 25.653 46.062 1.00 0.00 H ATOM 474 H SER A 32 37.872 24.612 47.223 1.00 0.00 H ATOM 475 N GLY A 33 40.154 25.203 43.713 1.00 25.67 N ATOM 476 CA GLY A 33 40.233 24.478 42.455 1.00 24.49 C ATOM 477 C GLY A 33 41.610 23.863 42.260 1.00 26.82 C ATOM 478 O GLY A 33 41.926 23.335 41.207 1.00 26.93 O ATOM 479 HA3 GLY A 33 40.031 25.166 41.634 1.00 0.00 H ATOM 480 HA2 GLY A 33 39.486 23.685 42.454 1.00 0.00 H ATOM 481 H GLY A 33 40.663 26.102 43.835 1.00 0.00 H ATOM 482 N ILE A 34 42.410 23.880 43.309 1.00 25.24 N ATOM 483 CA ILE A 34 43.767 23.312 43.246 1.00 26.33 C ATOM 484 C ILE A 34 43.829 21.786 43.412 1.00 32.90 C ATOM 485 O ILE A 34 43.236 21.222 44.331 1.00 30.81 O ATOM 486 CB ILE A 34 44.664 23.986 44.276 1.00 28.42 C ATOM 487 CG1 ILE A 34 44.461 25.492 44.202 1.00 28.17 C ATOM 488 CG2 ILE A 34 46.132 23.589 44.031 1.00 28.48 C ATOM 489 CD1 ILE A 34 44.623 26.049 42.788 1.00 28.96 C ATOM 490 HA ILE A 34 44.124 23.514 42.236 1.00 0.00 H ATOM 491 HB ILE A 34 44.402 23.657 45.281 1.00 0.00 H ATOM 492 HG12 ILE A 34 43.456 25.725 44.554 1.00 0.00 H ATOM 493 HG13 ILE A 34 45.193 25.973 44.851 1.00 0.00 H ATOM 494 HD11 ILE A 34 45.628 25.832 42.426 1.00 0.00 H ATOM 495 HD12 ILE A 34 43.890 25.583 42.129 1.00 0.00 H ATOM 496 HD13 ILE A 34 44.466 27.128 42.804 1.00 0.00 H ATOM 497 HG21 ILE A 34 46.234 22.507 44.117 1.00 0.00 H ATOM 498 HG22 ILE A 34 46.430 23.905 43.031 1.00 0.00 H ATOM 499 HG23 ILE A 34 46.767 24.075 44.772 1.00 0.00 H ATOM 500 H ILE A 34 42.075 24.303 44.198 1.00 0.00 H ATOM 501 N SER A 35 44.594 21.121 42.553 1.00 27.98 N ATOM 502 CA SER A 35 44.769 19.707 42.708 1.00 29.16 C ATOM 503 C SER A 35 46.166 19.274 42.245 1.00 34.43 C ATOM 504 O SER A 35 46.944 20.077 41.710 1.00 33.22 O ATOM 505 CB SER A 35 43.655 18.937 41.958 1.00 32.48 C ATOM 506 OG SER A 35 43.834 19.047 40.561 1.00 38.43 O ATOM 507 HA SER A 35 44.687 19.462 43.767 1.00 0.00 H ATOM 508 HB2 SER A 35 42.685 19.353 42.230 1.00 0.00 H ATOM 509 HB3 SER A 35 43.691 17.886 42.243 1.00 0.00 H ATOM 510 HG SER A 35 43.799 20.001 40.299 1.00 0.00 H ATOM 511 H SER A 35 45.063 21.624 41.773 1.00 0.00 H ATOM 512 N LEU A 36 46.470 18.002 42.469 1.00 30.02 N ATOM 513 CA LEU A 36 47.734 17.398 42.059 1.00 29.80 C ATOM 514 C LEU A 36 47.805 17.247 40.543 1.00 32.16 C ATOM 515 O LEU A 36 46.845 16.819 39.880 1.00 29.56 O ATOM 516 CB LEU A 36 47.900 16.009 42.716 1.00 29.61 C ATOM 517 CG LEU A 36 48.203 16.027 44.213 1.00 33.19 C ATOM 518 CD1 LEU A 36 48.168 14.615 44.768 1.00 33.78 C ATOM 519 CD2 LEU A 36 49.574 16.686 44.481 1.00 32.79 C ATOM 520 HA LEU A 36 48.538 18.058 42.384 1.00 0.00 H ATOM 521 HB2 LEU A 36 46.975 15.453 42.566 1.00 0.00 H ATOM 522 HB3 LEU A 36 48.718 15.494 42.213 1.00 0.00 H ATOM 523 HG LEU A 36 47.439 16.618 44.718 1.00 0.00 H ATOM 524 HD21 LEU A 36 50.353 16.122 43.969 1.00 0.00 H ATOM 525 HD22 LEU A 36 49.562 17.711 44.110 1.00 0.00 H ATOM 526 HD23 LEU A 36 49.771 16.689 45.553 1.00 0.00 H ATOM 527 HD11 LEU A 36 47.178 14.187 44.607 1.00 0.00 H ATOM 528 HD12 LEU A 36 48.915 14.007 44.258 1.00 0.00 H ATOM 529 HD13 LEU A 36 48.385 14.640 45.836 1.00 0.00 H ATOM 530 H LEU A 36 45.774 17.406 42.961 1.00 0.00 H ATOM 531 N ILE A 37 48.977 17.535 39.982 1.00 27.87 N ATOM 532 CA ILE A 37 49.124 17.445 38.547 1.00 27.01 C ATOM 533 C ILE A 37 49.215 15.979 38.150 1.00 31.97 C ATOM 534 O ILE A 37 49.893 15.200 38.814 1.00 33.47 O ATOM 535 CB ILE A 37 50.392 18.223 38.091 1.00 28.45 C ATOM 536 CG1 ILE A 37 50.117 19.732 38.053 1.00 27.36 C ATOM 537 CG2 ILE A 37 50.874 17.694 36.754 1.00 26.35 C ATOM 538 CD1 ILE A 37 51.418 20.585 38.168 1.00 26.25 C ATOM 539 HA ILE A 37 48.260 17.893 38.056 1.00 0.00 H ATOM 540 HB ILE A 37 51.191 18.064 38.815 1.00 0.00 H ATOM 541 HG12 ILE A 37 49.624 19.973 37.111 1.00 0.00 H ATOM 542 HG13 ILE A 37 49.458 19.987 38.883 1.00 0.00 H ATOM 543 HD11 ILE A 37 51.916 20.360 39.111 1.00 0.00 H ATOM 544 HD12 ILE A 37 52.083 20.345 37.338 1.00 0.00 H ATOM 545 HD13 ILE A 37 51.161 21.644 38.135 1.00 0.00 H ATOM 546 HG21 ILE A 37 51.118 16.636 36.850 1.00 0.00 H ATOM 547 HG22 ILE A 37 50.088 17.821 36.010 1.00 0.00 H ATOM 548 HG23 ILE A 37 51.762 18.246 36.445 1.00 0.00 H ATOM 549 H ILE A 37 49.783 17.823 40.573 1.00 0.00 H ATOM 550 N ASP A 38 48.596 15.609 37.040 1.00 31.01 N ATOM 551 CA ASP A 38 48.700 14.237 36.555 1.00 32.76 C ATOM 552 C ASP A 38 49.148 14.112 35.115 1.00 35.32 C ATOM 553 O ASP A 38 49.448 13.016 34.658 1.00 37.64 O ATOM 554 CB ASP A 38 47.396 13.445 36.773 1.00 37.20 C ATOM 555 CG ASP A 38 46.209 14.022 36.017 1.00 62.81 C ATOM 556 OD1 ASP A 38 45.063 13.629 36.330 1.00 67.96 O ATOM 557 OD2 ASP A 38 46.401 14.861 35.115 1.00 75.13 O ATOM 558 HA ASP A 38 49.491 13.799 37.163 1.00 0.00 H ATOM 559 HB2 ASP A 38 47.554 12.419 36.439 1.00 0.00 H ATOM 560 HB3 ASP A 38 47.163 13.448 37.838 1.00 0.00 H ATOM 561 H ASP A 38 48.031 16.302 36.509 1.00 0.00 H ATOM 562 N HIS A 39 49.162 15.213 34.375 1.00 28.90 N ATOM 563 CA HIS A 39 49.463 15.145 32.933 1.00 27.20 C ATOM 564 C HIS A 39 50.962 15.106 32.580 1.00 32.28 C ATOM 565 O HIS A 39 51.339 14.941 31.419 1.00 32.31 O ATOM 566 CB HIS A 39 48.723 16.256 32.177 1.00 27.23 C ATOM 567 CG HIS A 39 49.157 17.631 32.573 1.00 29.59 C ATOM 568 ND1 HIS A 39 48.726 18.247 33.727 1.00 30.65 N ATOM 569 CD2 HIS A 39 49.994 18.505 31.968 1.00 30.81 C ATOM 570 CE1 HIS A 39 49.283 19.439 33.823 1.00 29.72 C ATOM 571 NE2 HIS A 39 50.065 19.616 32.772 1.00 30.02 N ATOM 572 HA HIS A 39 49.090 14.176 32.600 1.00 0.00 H ATOM 573 HB2 HIS A 39 48.905 16.129 31.110 1.00 0.00 H ATOM 574 HB3 HIS A 39 47.656 16.159 32.376 1.00 0.00 H ATOM 575 HD2 HIS A 39 50.514 18.356 31.022 1.00 0.00 H ATOM 576 HE1 HIS A 39 49.126 20.155 34.630 1.00 0.00 H ATOM 577 H HIS A 39 48.959 16.133 34.816 1.00 0.00 H ATOM 578 N PHE A 40 51.809 15.254 33.593 1.00 30.91 N ATOM 579 CA PHE A 40 53.241 15.041 33.451 1.00 30.30 C ATOM 580 C PHE A 40 53.813 14.464 34.756 1.00 34.36 C ATOM 581 O PHE A 40 53.231 14.635 35.824 1.00 33.62 O ATOM 582 CB PHE A 40 54.025 16.252 32.873 1.00 31.42 C ATOM 583 CG PHE A 40 54.183 17.439 33.824 1.00 30.36 C ATOM 584 CD1 PHE A 40 55.290 17.530 34.674 1.00 29.96 C ATOM 585 CD2 PHE A 40 53.316 18.526 33.752 1.00 27.11 C ATOM 586 CE1 PHE A 40 55.496 18.647 35.460 1.00 28.32 C ATOM 587 CE2 PHE A 40 53.502 19.648 34.564 1.00 27.88 C ATOM 588 CZ PHE A 40 54.586 19.705 35.433 1.00 26.14 C ATOM 589 HA PHE A 40 53.387 14.294 32.671 1.00 0.00 H ATOM 590 HB2 PHE A 40 55.021 15.908 32.595 1.00 0.00 H ATOM 591 HB3 PHE A 40 53.501 16.600 31.983 1.00 0.00 H ATOM 592 HD2 PHE A 40 52.480 18.501 33.052 1.00 0.00 H ATOM 593 HE2 PHE A 40 52.797 20.478 34.516 1.00 0.00 H ATOM 594 HZ PHE A 40 54.724 20.567 36.086 1.00 0.00 H ATOM 595 HE1 PHE A 40 56.373 18.702 36.104 1.00 0.00 H ATOM 596 HD1 PHE A 40 56.002 16.706 34.717 1.00 0.00 H ATOM 597 H PHE A 40 51.434 15.533 34.522 1.00 0.00 H ATOM 598 N ASP A 41 54.912 13.725 34.656 1.00 30.02 N ATOM 599 CA ASP A 41 55.548 13.129 35.824 1.00 29.15 C ATOM 600 C ASP A 41 56.205 14.216 36.696 1.00 32.09 C ATOM 601 O ASP A 41 57.194 14.845 36.308 1.00 33.24 O ATOM 602 CB ASP A 41 56.562 12.080 35.339 1.00 31.72 C ATOM 603 CG ASP A 41 57.210 11.287 36.489 1.00 40.57 C ATOM 604 OD1 ASP A 41 57.075 11.678 37.667 1.00 40.87 O ATOM 605 OD2 ASP A 41 57.925 10.311 36.193 1.00 48.12 O ATOM 606 HA ASP A 41 54.807 12.636 36.453 1.00 0.00 H ATOM 607 HB2 ASP A 41 56.048 11.379 34.681 1.00 0.00 H ATOM 608 HB3 ASP A 41 57.349 12.589 34.782 1.00 0.00 H ATOM 609 H ASP A 41 55.331 13.567 33.717 1.00 0.00 H ATOM 610 N THR A 42 55.629 14.465 37.865 1.00 27.35 N ATOM 611 CA THR A 42 56.100 15.512 38.773 1.00 26.94 C ATOM 612 C THR A 42 57.126 15.003 39.810 1.00 31.42 C ATOM 613 O THR A 42 57.452 15.726 40.742 1.00 29.72 O ATOM 614 CB THR A 42 54.918 16.210 39.492 1.00 29.88 C ATOM 615 OG1 THR A 42 54.204 15.241 40.282 1.00 32.26 O ATOM 616 CG2 THR A 42 53.931 16.803 38.488 1.00 24.44 C ATOM 617 HA THR A 42 56.614 16.238 38.144 1.00 0.00 H ATOM 618 HB THR A 42 55.329 17.007 40.112 1.00 0.00 H ATOM 619 HG1 THR A 42 53.448 15.685 40.742 1.00 0.00 H ATOM 620 HG23 THR A 42 54.442 17.543 37.872 1.00 0.00 H ATOM 621 HG21 THR A 42 53.539 16.008 37.853 1.00 0.00 H ATOM 622 HG22 THR A 42 53.111 17.279 39.025 1.00 0.00 H ATOM 623 H THR A 42 54.808 13.892 38.148 1.00 0.00 H ATOM 624 N SER A 43 57.586 13.754 39.685 1.00 29.00 N ATOM 625 CA SER A 43 58.532 13.194 40.692 1.00 29.84 C ATOM 626 C SER A 43 59.669 14.143 41.045 1.00 35.27 C ATOM 627 O SER A 43 59.928 14.386 42.201 1.00 35.64 O ATOM 628 CB SER A 43 59.151 11.867 40.206 1.00 31.18 C ATOM 629 OG SER A 43 58.144 10.944 39.796 1.00 41.91 O ATOM 630 HA SER A 43 57.928 13.031 41.584 1.00 0.00 H ATOM 631 HB2 SER A 43 59.728 11.425 41.019 1.00 0.00 H ATOM 632 HB3 SER A 43 59.811 12.071 39.363 1.00 0.00 H ATOM 633 HG SER A 43 57.620 11.338 39.054 1.00 0.00 H ATOM 634 H SER A 43 57.282 13.169 38.880 1.00 0.00 H ATOM 635 N ALA A 44 60.346 14.678 40.033 1.00 32.85 N ATOM 636 CA ALA A 44 61.492 15.576 40.253 1.00 31.97 C ATOM 637 C ALA A 44 61.160 17.044 40.546 1.00 34.79 C ATOM 638 O ALA A 44 62.065 17.838 40.820 1.00 30.76 O ATOM 639 CB ALA A 44 62.458 15.486 39.067 1.00 32.62 C ATOM 640 HA ALA A 44 61.950 15.213 41.173 1.00 0.00 H ATOM 641 HB1 ALA A 44 62.816 14.461 38.969 1.00 0.00 H ATOM 642 HB2 ALA A 44 61.939 15.780 38.154 1.00 0.00 H ATOM 643 HB3 ALA A 44 63.303 16.153 39.237 1.00 0.00 H ATOM 644 H ALA A 44 60.058 14.456 39.059 1.00 0.00 H ATOM 645 N TYR A 45 59.872 17.408 40.495 1.00 31.99 N ATOM 646 CA TYR A 45 59.450 18.791 40.730 1.00 30.34 C ATOM 647 C TYR A 45 59.198 19.150 42.185 1.00 33.06 C ATOM 648 O TYR A 45 58.506 18.445 42.917 1.00 33.03 O ATOM 649 CB TYR A 45 58.205 19.147 39.860 1.00 29.59 C ATOM 650 CG TYR A 45 58.511 19.122 38.363 1.00 27.97 C ATOM 651 CD1 TYR A 45 58.734 17.923 37.700 1.00 28.90 C ATOM 652 CD2 TYR A 45 58.647 20.304 37.635 1.00 27.49 C ATOM 653 CE1 TYR A 45 59.091 17.904 36.343 1.00 29.73 C ATOM 654 CE2 TYR A 45 58.977 20.290 36.277 1.00 27.05 C ATOM 655 CZ TYR A 45 59.203 19.092 35.646 1.00 30.59 C ATOM 656 OH TYR A 45 59.532 19.072 34.315 1.00 28.45 O ATOM 657 HA TYR A 45 60.304 19.397 40.428 1.00 0.00 H ATOM 658 HB3 TYR A 45 57.863 20.146 40.131 1.00 0.00 H ATOM 659 HB2 TYR A 45 57.415 18.425 40.068 1.00 0.00 H ATOM 660 HD2 TYR A 45 58.493 21.260 38.136 1.00 0.00 H ATOM 661 HE2 TYR A 45 59.054 21.225 35.722 1.00 0.00 H ATOM 662 HE1 TYR A 45 59.279 16.955 35.840 1.00 0.00 H ATOM 663 HD1 TYR A 45 58.630 16.983 38.241 1.00 0.00 H ATOM 664 HH TYR A 45 59.659 18.135 34.022 1.00 0.00 H ATOM 665 H TYR A 45 59.151 16.689 40.283 1.00 0.00 H ATOM 666 N ALA A 46 59.686 20.306 42.587 1.00 27.91 N ATOM 667 CA ALA A 46 59.445 20.749 43.937 1.00 27.23 C ATOM 668 C ALA A 46 57.969 21.037 44.160 1.00 31.34 C ATOM 669 O ALA A 46 57.509 20.948 45.298 1.00 28.48 O ATOM 670 CB ALA A 46 60.293 21.975 44.282 1.00 26.71 C ATOM 671 HA ALA A 46 59.740 19.940 44.605 1.00 0.00 H ATOM 672 HB1 ALA A 46 61.349 21.724 44.183 1.00 0.00 H ATOM 673 HB2 ALA A 46 60.046 22.789 43.601 1.00 0.00 H ATOM 674 HB3 ALA A 46 60.086 22.282 45.307 1.00 0.00 H ATOM 675 H ALA A 46 60.242 20.895 41.934 1.00 0.00 H ATOM 676 N THR A 47 57.267 21.492 43.106 1.00 26.80 N ATOM 677 CA THR A 47 55.834 21.815 43.187 1.00 27.00 C ATOM 678 C THR A 47 55.091 20.798 42.350 1.00 31.13 C ATOM 679 O THR A 47 55.495 20.509 41.224 1.00 30.33 O ATOM 680 CB THR A 47 55.569 23.236 42.702 1.00 30.31 C ATOM 681 OG1 THR A 47 56.183 24.131 43.616 1.00 23.56 O ATOM 682 CG2 THR A 47 54.065 23.541 42.647 1.00 26.77 C ATOM 683 HA THR A 47 55.490 21.770 44.220 1.00 0.00 H ATOM 684 HB THR A 47 55.974 23.347 41.696 1.00 0.00 H ATOM 685 HG1 THR A 47 57.157 23.954 43.645 1.00 0.00 H ATOM 686 HG23 THR A 47 53.583 22.859 41.947 1.00 0.00 H ATOM 687 HG21 THR A 47 53.633 23.411 43.639 1.00 0.00 H ATOM 688 HG22 THR A 47 53.916 24.569 42.316 1.00 0.00 H ATOM 689 H THR A 47 57.757 21.620 42.198 1.00 0.00 H ATOM 690 N LYS A 48 54.072 20.156 42.914 1.00 26.69 N ATOM 691 CA LYS A 48 53.444 19.059 42.168 1.00 25.69 C ATOM 692 C LYS A 48 51.954 19.227 41.990 1.00 28.76 C ATOM 693 O LYS A 48 51.243 18.270 41.690 1.00 29.40 O ATOM 694 CB LYS A 48 53.717 17.727 42.898 1.00 28.07 C ATOM 695 CG LYS A 48 55.204 17.531 43.265 1.00 28.92 C ATOM 696 CD LYS A 48 55.423 16.349 44.221 1.00 33.35 C ATOM 697 CE LYS A 48 56.835 16.403 44.826 1.00 28.88 C ATOM 698 NZ LYS A 48 57.796 15.836 43.837 1.00 28.35 N ATOM 699 HA LYS A 48 53.885 19.064 41.171 1.00 0.00 H ATOM 700 HB2 LYS A 48 53.128 17.706 43.815 1.00 0.00 H ATOM 701 HB3 LYS A 48 53.408 16.906 42.250 1.00 0.00 H ATOM 702 HG2 LYS A 48 55.769 17.351 42.351 1.00 0.00 H ATOM 703 HG3 LYS A 48 55.569 18.440 43.743 1.00 0.00 H ATOM 704 HD2 LYS A 48 54.686 16.394 45.023 1.00 0.00 H ATOM 705 HD3 LYS A 48 55.303 15.415 43.671 1.00 0.00 H ATOM 706 HE2 LYS A 48 56.864 15.817 45.745 1.00 0.00 H ATOM 707 HE3 LYS A 48 57.101 17.437 45.047 1.00 0.00 H ATOM 708 HZ1 LYS A 48 57.536 14.851 43.629 1.00 0.00 H ATOM 709 HZ2 LYS A 48 57.763 16.397 42.962 1.00 0.00 H ATOM 710 HZ3 LYS A 48 58.757 15.866 44.233 1.00 0.00 H ATOM 711 H LYS A 48 53.729 20.424 43.859 1.00 0.00 H ATOM 712 N PHE A 49 51.488 20.448 42.178 1.00 24.38 N ATOM 713 CA PHE A 49 50.062 20.725 42.083 1.00 23.95 C ATOM 714 C PHE A 49 49.834 22.060 41.371 1.00 27.40 C ATOM 715 O PHE A 49 50.764 22.866 41.233 1.00 26.34 O ATOM 716 CB PHE A 49 49.475 20.791 43.499 1.00 24.51 C ATOM 717 CG PHE A 49 50.168 21.778 44.398 1.00 24.66 C ATOM 718 CD1 PHE A 49 51.238 21.387 45.177 1.00 25.74 C ATOM 719 CD2 PHE A 49 49.767 23.102 44.438 1.00 25.56 C ATOM 720 CE1 PHE A 49 51.866 22.272 46.027 1.00 26.34 C ATOM 721 CE2 PHE A 49 50.386 24.014 45.303 1.00 27.57 C ATOM 722 CZ PHE A 49 51.457 23.595 46.084 1.00 26.38 C ATOM 723 HA PHE A 49 49.574 19.934 41.513 1.00 0.00 H ATOM 724 HB2 PHE A 49 48.425 21.073 43.423 1.00 0.00 H ATOM 725 HB3 PHE A 49 49.552 19.802 43.950 1.00 0.00 H ATOM 726 HD2 PHE A 49 48.959 23.440 43.788 1.00 0.00 H ATOM 727 HE2 PHE A 49 50.031 25.043 45.363 1.00 0.00 H ATOM 728 HZ PHE A 49 51.971 24.301 46.736 1.00 0.00 H ATOM 729 HE1 PHE A 49 52.687 21.930 46.657 1.00 0.00 H ATOM 730 HD1 PHE A 49 51.593 20.358 45.119 1.00 0.00 H ATOM 731 H PHE A 49 52.148 21.221 42.397 1.00 0.00 H ATOM 732 N ALA A 50 48.601 22.284 40.927 1.00 22.74 N ATOM 733 CA ALA A 50 48.251 23.550 40.266 1.00 22.02 C ATOM 734 C ALA A 50 46.729 23.637 40.173 1.00 27.02 C ATOM 735 O ALA A 50 46.042 22.667 40.456 1.00 25.42 O ATOM 736 CB ALA A 50 48.831 23.539 38.834 1.00 22.29 C ATOM 737 HA ALA A 50 48.650 24.395 40.827 1.00 0.00 H ATOM 738 HB1 ALA A 50 49.915 23.434 38.883 1.00 0.00 H ATOM 739 HB2 ALA A 50 48.408 22.702 38.279 1.00 0.00 H ATOM 740 HB3 ALA A 50 48.578 24.474 38.334 1.00 0.00 H ATOM 741 H ALA A 50 47.872 21.552 41.049 1.00 0.00 H ATOM 742 N GLY A 51 46.205 24.782 39.730 1.00 23.66 N ATOM 743 CA GLY A 51 44.773 24.927 39.482 1.00 22.81 C ATOM 744 C GLY A 51 44.522 24.603 38.013 1.00 27.44 C ATOM 745 O GLY A 51 44.868 25.384 37.125 1.00 25.32 O ATOM 746 HA3 GLY A 51 44.460 25.949 39.696 1.00 0.00 H ATOM 747 HA2 GLY A 51 44.215 24.238 40.115 1.00 0.00 H ATOM 748 H GLY A 51 46.833 25.593 39.557 1.00 0.00 H ATOM 749 N LEU A 52 44.025 23.402 37.746 1.00 25.97 N ATOM 750 CA LEU A 52 43.767 22.966 36.390 1.00 26.33 C ATOM 751 C LEU A 52 42.327 23.191 35.939 1.00 28.81 C ATOM 752 O LEU A 52 41.407 23.216 36.751 1.00 27.81 O ATOM 753 CB LEU A 52 44.122 21.476 36.252 1.00 27.46 C ATOM 754 CG LEU A 52 45.565 21.222 36.716 1.00 32.38 C ATOM 755 CD1 LEU A 52 45.837 19.750 36.902 1.00 34.29 C ATOM 756 CD2 LEU A 52 46.595 21.878 35.777 1.00 31.38 C ATOM 757 HA LEU A 52 44.395 23.577 35.742 1.00 0.00 H ATOM 758 HB2 LEU A 52 43.439 20.886 36.863 1.00 0.00 H ATOM 759 HB3 LEU A 52 44.023 21.178 35.208 1.00 0.00 H ATOM 760 HG LEU A 52 45.676 21.698 37.690 1.00 0.00 H ATOM 761 HD21 LEU A 52 46.482 21.469 34.773 1.00 0.00 H ATOM 762 HD22 LEU A 52 46.428 22.955 35.753 1.00 0.00 H ATOM 763 HD23 LEU A 52 47.601 21.673 36.143 1.00 0.00 H ATOM 764 HD11 LEU A 52 45.157 19.348 37.654 1.00 0.00 H ATOM 765 HD12 LEU A 52 45.682 19.231 35.956 1.00 0.00 H ATOM 766 HD13 LEU A 52 46.867 19.611 37.230 1.00 0.00 H ATOM 767 H LEU A 52 43.815 22.756 38.533 1.00 0.00 H ATOM 768 N VAL A 53 42.142 23.325 34.629 1.00 25.30 N ATOM 769 CA VAL A 53 40.805 23.403 34.037 1.00 24.12 C ATOM 770 C VAL A 53 40.359 21.943 33.933 1.00 27.37 C ATOM 771 O VAL A 53 41.050 21.118 33.335 1.00 26.84 O ATOM 772 CB VAL A 53 40.822 24.134 32.640 1.00 25.17 C ATOM 773 CG1 VAL A 53 39.518 23.851 31.841 1.00 24.44 C ATOM 774 CG2 VAL A 53 40.951 25.635 32.856 1.00 24.99 C ATOM 775 HA VAL A 53 40.115 23.996 34.637 1.00 0.00 H ATOM 776 HB VAL A 53 41.670 23.756 32.069 1.00 0.00 H ATOM 777 HG11 VAL A 53 39.423 22.778 31.672 1.00 0.00 H ATOM 778 HG12 VAL A 53 38.660 24.208 32.410 1.00 0.00 H ATOM 779 HG13 VAL A 53 39.561 24.369 30.883 1.00 0.00 H ATOM 780 HG21 VAL A 53 40.104 25.990 33.443 1.00 0.00 H ATOM 781 HG22 VAL A 53 41.878 25.846 33.389 1.00 0.00 H ATOM 782 HG23 VAL A 53 40.963 26.140 31.890 1.00 0.00 H ATOM 783 H VAL A 53 42.973 23.376 34.005 1.00 0.00 H ATOM 784 N LYS A 54 39.250 21.596 34.580 1.00 25.09 N ATOM 785 CA LYS A 54 38.768 20.215 34.521 1.00 25.64 C ATOM 786 C LYS A 54 37.865 19.962 33.331 1.00 30.44 C ATOM 787 O LYS A 54 37.013 20.788 33.012 1.00 29.21 O ATOM 788 CB LYS A 54 38.059 19.829 35.821 1.00 29.56 C ATOM 789 CG LYS A 54 39.050 19.212 36.798 1.00 46.98 C ATOM 790 CD LYS A 54 39.246 20.015 38.083 1.00 48.24 C ATOM 791 CE LYS A 54 39.504 21.472 37.864 1.00 42.50 C ATOM 792 NZ LYS A 54 40.219 22.033 39.050 1.00 31.65 N ATOM 793 HA LYS A 54 39.648 19.584 34.395 1.00 0.00 H ATOM 794 HB2 LYS A 54 37.618 20.720 36.269 1.00 0.00 H ATOM 795 HB3 LYS A 54 37.272 19.107 35.602 1.00 0.00 H ATOM 796 HG2 LYS A 54 38.692 18.218 37.067 1.00 0.00 H ATOM 797 HG3 LYS A 54 40.015 19.126 36.298 1.00 0.00 H ATOM 798 HD2 LYS A 54 38.346 19.915 38.689 1.00 0.00 H ATOM 799 HD3 LYS A 54 40.095 19.595 38.623 1.00 0.00 H ATOM 800 HE2 LYS A 54 38.556 21.993 37.730 1.00 0.00 H ATOM 801 HE3 LYS A 54 40.118 21.603 36.973 1.00 0.00 H ATOM 802 HZ1 LYS A 54 39.631 21.907 39.899 1.00 0.00 H ATOM 803 HZ2 LYS A 54 41.123 21.535 39.176 1.00 0.00 H ATOM 804 HZ3 LYS A 54 40.398 23.046 38.898 1.00 0.00 H ATOM 805 H LYS A 54 38.725 22.307 35.128 1.00 0.00 H ATOM 806 N ASP A 55 38.078 18.829 32.666 1.00 30.04 N ATOM 807 CA ASP A 55 37.274 18.424 31.519 1.00 31.43 C ATOM 808 C ASP A 55 37.019 19.515 30.480 1.00 35.19 C ATOM 809 O ASP A 55 35.885 19.717 30.035 1.00 35.43 O ATOM 810 CB ASP A 55 35.955 17.775 31.990 1.00 34.95 C ATOM 811 CG ASP A 55 36.197 16.620 32.965 1.00 42.10 C ATOM 812 OD1 ASP A 55 37.014 15.751 32.628 1.00 47.25 O ATOM 813 OD2 ASP A 55 35.696 16.655 34.103 1.00 45.38 O ATOM 814 HA ASP A 55 37.879 17.688 30.989 1.00 0.00 H ATOM 815 HB2 ASP A 55 35.348 18.532 32.486 1.00 0.00 H ATOM 816 HB3 ASP A 55 35.420 17.395 31.120 1.00 0.00 H ATOM 817 H ASP A 55 38.850 18.206 32.978 1.00 0.00 H ATOM 818 N PHE A 56 38.083 20.194 30.062 1.00 29.14 N ATOM 819 CA PHE A 56 37.967 21.193 29.014 1.00 27.91 C ATOM 820 C PHE A 56 37.365 20.521 27.795 1.00 32.70 C ATOM 821 O PHE A 56 37.783 19.438 27.402 1.00 32.84 O ATOM 822 CB PHE A 56 39.352 21.710 28.609 1.00 28.30 C ATOM 823 CG PHE A 56 39.311 22.664 27.444 1.00 28.39 C ATOM 824 CD1 PHE A 56 38.588 23.833 27.527 1.00 29.33 C ATOM 825 CD2 PHE A 56 39.987 22.381 26.263 1.00 29.83 C ATOM 826 CE1 PHE A 56 38.541 24.719 26.453 1.00 28.83 C ATOM 827 CE2 PHE A 56 39.997 23.288 25.205 1.00 30.23 C ATOM 828 CZ PHE A 56 39.253 24.427 25.282 1.00 28.19 C ATOM 829 HA PHE A 56 37.356 22.020 29.375 1.00 0.00 H ATOM 830 HB2 PHE A 56 39.794 22.224 29.463 1.00 0.00 H ATOM 831 HB3 PHE A 56 39.975 20.858 28.338 1.00 0.00 H ATOM 832 HD2 PHE A 56 40.518 21.434 26.163 1.00 0.00 H ATOM 833 HE2 PHE A 56 40.598 23.087 24.318 1.00 0.00 H ATOM 834 HZ PHE A 56 39.212 25.110 24.434 1.00 0.00 H ATOM 835 HE1 PHE A 56 37.954 25.634 26.523 1.00 0.00 H ATOM 836 HD1 PHE A 56 38.046 24.068 28.443 1.00 0.00 H ATOM 837 H PHE A 56 39.012 20.007 30.492 1.00 0.00 H ATOM 838 N ASN A 57 36.432 21.200 27.153 1.00 33.26 N ATOM 839 CA ASN A 57 35.777 20.663 25.959 1.00 34.28 C ATOM 840 C ASN A 57 35.579 21.746 24.898 1.00 38.20 C ATOM 841 O ASN A 57 34.929 22.763 25.161 1.00 39.76 O ATOM 842 CB ASN A 57 34.404 20.087 26.331 1.00 40.79 C ATOM 843 CG ASN A 57 33.851 19.169 25.250 1.00 62.08 C ATOM 844 OD1 ASN A 57 33.939 17.947 25.358 1.00 74.57 O ATOM 845 ND2 ASN A 57 33.398 19.755 24.152 1.00 39.02 N ATOM 846 HA ASN A 57 36.420 19.882 25.553 1.00 0.00 H ATOM 847 HB2 ASN A 57 34.500 19.520 27.257 1.00 0.00 H ATOM 848 HB3 ASN A 57 33.707 20.911 26.482 1.00 0.00 H ATOM 849 HD22 ASN A 57 33.340 20.792 24.102 1.00 0.00 H ATOM 850 HD21 ASN A 57 33.100 19.178 23.340 1.00 0.00 H ATOM 851 H ASN A 57 36.156 22.139 27.504 1.00 0.00 H ATOM 852 N CYS A 58 36.097 21.527 23.692 1.00 33.30 N ATOM 853 CA CYS A 58 35.895 22.508 22.640 1.00 34.94 C ATOM 854 C CYS A 58 35.311 21.864 21.371 1.00 41.59 C ATOM 855 O CYS A 58 35.192 22.520 20.331 1.00 38.35 O ATOM 856 CB CYS A 58 37.213 23.202 22.310 1.00 36.48 C ATOM 857 SG CYS A 58 38.431 22.095 21.560 1.00 41.87 S ATOM 858 HA CYS A 58 35.178 23.243 23.005 1.00 0.00 H ATOM 859 HB2 CYS A 58 37.632 23.606 23.231 1.00 0.00 H ATOM 860 HB3 CYS A 58 37.011 24.018 21.616 1.00 0.00 H ATOM 861 HG CYS A 58 38.709 21.062 22.431 1.00 0.00 H ATOM 862 H CYS A 58 36.642 20.661 23.504 1.00 0.00 H ATOM 863 N GLU A 59 34.911 20.600 21.472 1.00 43.86 N ATOM 864 CA GLU A 59 34.404 19.836 20.314 1.00 46.45 C ATOM 865 C GLU A 59 33.458 20.554 19.358 1.00 51.89 C ATOM 866 O GLU A 59 33.625 20.510 18.128 1.00 53.83 O ATOM 867 CB GLU A 59 33.843 18.471 20.729 1.00 48.75 C ATOM 868 CG GLU A 59 34.610 17.296 20.118 1.00 63.88 C ATOM 869 CD GLU A 59 36.120 17.448 20.263 1.00 92.16 C ATOM 870 OE1 GLU A 59 36.562 18.252 21.108 1.00 86.11 O ATOM 871 OE2 GLU A 59 36.870 16.765 19.533 1.00 93.95 O ATOM 872 HA GLU A 59 35.304 19.699 19.715 1.00 0.00 H ATOM 873 HB2 GLU A 59 33.892 18.391 21.815 1.00 0.00 H ATOM 874 HB3 GLU A 59 32.803 18.411 20.408 1.00 0.00 H ATOM 875 HG2 GLU A 59 34.301 16.378 20.618 1.00 0.00 H ATOM 876 HG3 GLU A 59 34.365 17.231 19.058 1.00 0.00 H ATOM 877 H GLU A 59 34.957 20.132 22.400 1.00 0.00 H ATOM 878 N ASP A 60 32.490 21.241 19.931 1.00 46.33 N ATOM 879 CA ASP A 60 31.494 21.979 19.173 1.00 47.36 C ATOM 880 C ASP A 60 31.930 23.398 18.761 1.00 45.79 C ATOM 881 O ASP A 60 31.202 24.111 18.073 1.00 44.05 O ATOM 882 CB ASP A 60 30.280 22.123 20.098 1.00 51.51 C ATOM 883 CG ASP A 60 30.687 22.283 21.571 1.00 71.45 C ATOM 884 OD1 ASP A 60 31.801 21.834 21.939 1.00 71.72 O ATOM 885 OD2 ASP A 60 29.898 22.867 22.356 1.00 81.36 O ATOM 886 HA ASP A 60 31.304 21.433 18.249 1.00 0.00 H ATOM 887 HB2 ASP A 60 29.709 23.000 19.794 1.00 0.00 H ATOM 888 HB3 ASP A 60 29.657 21.234 20.000 1.00 0.00 H ATOM 889 H ASP A 60 32.437 21.255 20.970 1.00 0.00 H ATOM 890 N ILE A 61 33.075 23.839 19.263 1.00 38.55 N ATOM 891 CA ILE A 61 33.512 25.221 19.068 1.00 36.42 C ATOM 892 C ILE A 61 34.682 25.379 18.113 1.00 34.38 C ATOM 893 O ILE A 61 34.699 26.297 17.304 1.00 32.96 O ATOM 894 CB ILE A 61 33.806 25.840 20.451 1.00 39.35 C ATOM 895 CG1 ILE A 61 32.521 25.833 21.290 1.00 40.72 C ATOM 896 CG2 ILE A 61 34.422 27.219 20.325 1.00 36.79 C ATOM 897 CD1 ILE A 61 32.654 25.115 22.626 1.00 50.68 C ATOM 898 HA ILE A 61 32.701 25.760 18.578 1.00 0.00 H ATOM 899 HB ILE A 61 34.551 25.236 20.969 1.00 0.00 H ATOM 900 HG12 ILE A 61 32.233 26.866 21.484 1.00 0.00 H ATOM 901 HG13 ILE A 61 31.738 25.341 20.713 1.00 0.00 H ATOM 902 HD11 ILE A 61 32.930 24.075 22.452 1.00 0.00 H ATOM 903 HD12 ILE A 61 33.425 25.602 23.223 1.00 0.00 H ATOM 904 HD13 ILE A 61 31.702 25.156 23.156 1.00 0.00 H ATOM 905 HG21 ILE A 61 35.359 27.148 19.773 1.00 0.00 H ATOM 906 HG22 ILE A 61 33.734 27.876 19.793 1.00 0.00 H ATOM 907 HG23 ILE A 61 34.614 27.622 21.319 1.00 0.00 H ATOM 908 H ILE A 61 33.676 23.188 19.808 1.00 0.00 H ATOM 909 N ILE A 62 35.647 24.468 18.211 1.00 29.09 N ATOM 910 CA ILE A 62 36.826 24.511 17.364 1.00 28.84 C ATOM 911 C ILE A 62 36.883 23.212 16.573 1.00 34.29 C ATOM 912 O ILE A 62 36.897 22.139 17.170 1.00 31.98 O ATOM 913 CB ILE A 62 38.120 24.617 18.243 1.00 30.10 C ATOM 914 CG1 ILE A 62 38.065 25.852 19.151 1.00 28.23 C ATOM 915 CG2 ILE A 62 39.370 24.585 17.357 1.00 28.93 C ATOM 916 CD1 ILE A 62 39.222 25.924 20.220 1.00 26.32 C ATOM 917 HA ILE A 62 36.772 25.376 16.702 1.00 0.00 H ATOM 918 HB ILE A 62 38.175 23.752 18.903 1.00 0.00 H ATOM 919 HG12 ILE A 62 38.125 26.741 18.523 1.00 0.00 H ATOM 920 HG13 ILE A 62 37.112 25.845 19.679 1.00 0.00 H ATOM 921 HD11 ILE A 62 39.171 25.049 20.868 1.00 0.00 H ATOM 922 HD12 ILE A 62 40.185 25.945 19.710 1.00 0.00 H ATOM 923 HD13 ILE A 62 39.106 26.828 20.818 1.00 0.00 H ATOM 924 HG21 ILE A 62 39.394 23.649 16.799 1.00 0.00 H ATOM 925 HG22 ILE A 62 39.342 25.424 16.661 1.00 0.00 H ATOM 926 HG23 ILE A 62 40.259 24.660 17.983 1.00 0.00 H ATOM 927 H ILE A 62 35.555 23.706 18.912 1.00 0.00 H ATOM 928 N SER A 63 36.982 23.314 15.247 1.00 32.75 N ATOM 929 CA SER A 63 37.035 22.116 14.397 1.00 34.11 C ATOM 930 C SER A 63 38.254 21.276 14.723 1.00 41.05 C ATOM 931 O SER A 63 39.213 21.765 15.324 1.00 41.18 O ATOM 932 CB SER A 63 37.072 22.511 12.919 1.00 38.96 C ATOM 933 OG SER A 63 38.393 22.839 12.538 1.00 44.91 O ATOM 934 HA SER A 63 36.138 21.528 14.592 1.00 0.00 H ATOM 935 HB2 SER A 63 36.425 23.374 12.760 1.00 0.00 H ATOM 936 HB3 SER A 63 36.718 21.677 12.313 1.00 0.00 H ATOM 937 HG SER A 63 38.406 23.093 11.581 1.00 0.00 H ATOM 938 H SER A 63 37.022 24.256 14.808 1.00 0.00 H ATOM 939 N ARG A 64 38.232 20.005 14.348 1.00 38.24 N ATOM 940 CA ARG A 64 39.399 19.172 14.619 1.00 40.12 C ATOM 941 C ARG A 64 40.617 19.544 13.763 1.00 42.89 C ATOM 942 O ARG A 64 41.762 19.453 14.208 1.00 42.03 O ATOM 943 CB ARG A 64 39.055 17.686 14.592 1.00 47.11 C ATOM 944 CG ARG A 64 38.379 17.290 15.917 1.00 74.28 C ATOM 945 CD ARG A 64 37.707 15.940 15.856 1.00100.96 C ATOM 946 NE ARG A 64 36.321 16.001 16.310 1.00120.39 N ATOM 947 CZ ARG A 64 35.409 15.078 16.024 1.00141.43 C ATOM 948 NH1 ARG A 64 35.743 14.031 15.281 1.00130.06 N ATOM 949 NH2 ARG A 64 34.168 15.200 16.477 1.00132.85 N ATOM 950 HA ARG A 64 39.710 19.388 15.641 1.00 0.00 H ATOM 951 HB2 ARG A 64 38.376 17.485 13.763 1.00 0.00 H ATOM 952 HB3 ARG A 64 39.967 17.104 14.461 1.00 0.00 H ATOM 953 HG2 ARG A 64 39.137 17.266 16.700 1.00 0.00 H ATOM 954 HG3 ARG A 64 37.628 18.041 16.162 1.00 0.00 H ATOM 955 HD2 ARG A 64 38.256 15.244 16.490 1.00 0.00 H ATOM 956 HD3 ARG A 64 37.725 15.583 14.826 1.00 0.00 H ATOM 957 HE ARG A 64 36.031 16.814 16.891 1.00 0.00 H ATOM 958 HH12 ARG A 64 35.032 13.306 15.055 1.00 0.00 H ATOM 959 HH11 ARG A 64 36.715 13.935 14.925 1.00 0.00 H ATOM 960 HH22 ARG A 64 33.458 14.475 16.250 1.00 0.00 H ATOM 961 HH21 ARG A 64 33.905 16.021 17.059 1.00 0.00 H ATOM 962 H ARG A 64 37.398 19.609 13.869 1.00 0.00 H ATOM 963 N LYS A 65 40.353 20.047 12.563 1.00 38.91 N ATOM 964 CA LYS A 65 41.425 20.503 11.711 1.00 39.47 C ATOM 965 C LYS A 65 42.103 21.714 12.365 1.00 39.56 C ATOM 966 O LYS A 65 43.306 21.876 12.239 1.00 37.84 O ATOM 967 CB LYS A 65 40.919 20.853 10.301 1.00 43.20 C ATOM 968 CG LYS A 65 40.959 19.676 9.324 1.00 64.67 C ATOM 969 CD LYS A 65 39.872 18.637 9.681 1.00 79.52 C ATOM 970 CE LYS A 65 40.241 17.171 9.363 1.00 85.77 C ATOM 971 NZ LYS A 65 41.702 16.847 9.376 1.00 82.82 N ATOM 972 HA LYS A 65 42.149 19.697 11.596 1.00 0.00 H ATOM 973 HB2 LYS A 65 39.889 21.200 10.381 1.00 0.00 H ATOM 974 HB3 LYS A 65 41.540 21.654 9.901 1.00 0.00 H ATOM 975 HG2 LYS A 65 40.786 20.043 8.313 1.00 0.00 H ATOM 976 HG3 LYS A 65 41.939 19.201 9.374 1.00 0.00 H ATOM 977 HD2 LYS A 65 39.671 18.711 10.750 1.00 0.00 H ATOM 978 HD3 LYS A 65 38.969 18.887 9.124 1.00 0.00 H ATOM 979 HE2 LYS A 65 39.856 16.937 8.371 1.00 0.00 H ATOM 980 HE3 LYS A 65 39.751 16.535 10.101 1.00 0.00 H ATOM 981 HZ1 LYS A 65 42.191 17.430 8.667 1.00 0.00 H ATOM 982 HZ2 LYS A 65 42.092 17.046 10.319 1.00 0.00 H ATOM 983 HZ3 LYS A 65 41.835 15.840 9.150 1.00 0.00 H ATOM 984 H LYS A 65 39.368 20.113 12.235 1.00 0.00 H ATOM 985 N GLU A 66 41.327 22.535 13.081 1.00 33.92 N ATOM 986 CA GLU A 66 41.871 23.722 13.735 1.00 32.91 C ATOM 987 C GLU A 66 42.544 23.466 15.081 1.00 35.54 C ATOM 988 O GLU A 66 43.543 24.101 15.400 1.00 33.92 O ATOM 989 CB GLU A 66 40.820 24.824 13.839 1.00 33.58 C ATOM 990 CG GLU A 66 40.450 25.437 12.488 1.00 37.63 C ATOM 991 CD GLU A 66 41.642 26.030 11.774 1.00 49.93 C ATOM 992 OE1 GLU A 66 42.149 27.081 12.222 1.00 41.72 O ATOM 993 OE2 GLU A 66 42.089 25.448 10.765 1.00 38.50 O ATOM 994 HA GLU A 66 42.677 24.058 13.083 1.00 0.00 H ATOM 995 HB2 GLU A 66 39.920 24.403 14.286 1.00 0.00 H ATOM 996 HB3 GLU A 66 41.209 25.613 14.483 1.00 0.00 H ATOM 997 HG2 GLU A 66 40.017 24.660 11.859 1.00 0.00 H ATOM 998 HG3 GLU A 66 39.713 26.224 12.651 1.00 0.00 H ATOM 999 H GLU A 66 40.313 22.323 13.174 1.00 0.00 H ATOM 1000 N GLN A 67 42.010 22.544 15.881 1.00 30.79 N ATOM 1001 CA GLN A 67 42.617 22.260 17.177 1.00 29.60 C ATOM 1002 C GLN A 67 44.094 21.922 17.113 1.00 34.12 C ATOM 1003 O GLN A 67 44.854 22.274 18.017 1.00 33.36 O ATOM 1004 CB GLN A 67 41.891 21.129 17.900 1.00 30.53 C ATOM 1005 CG GLN A 67 40.410 21.422 18.144 1.00 43.14 C ATOM 1006 CD GLN A 67 39.703 20.273 18.832 1.00 46.60 C ATOM 1007 OE1 GLN A 67 40.305 19.569 19.630 1.00 33.85 O ATOM 1008 NE2 GLN A 67 38.427 20.072 18.509 1.00 36.03 N ATOM 1009 HA GLN A 67 42.517 23.193 17.731 1.00 0.00 H ATOM 1010 HB2 GLN A 67 41.971 20.225 17.297 1.00 0.00 H ATOM 1011 HB3 GLN A 67 42.375 20.966 18.863 1.00 0.00 H ATOM 1012 HG2 GLN A 67 40.327 22.311 18.770 1.00 0.00 H ATOM 1013 HG3 GLN A 67 39.926 21.608 17.185 1.00 0.00 H ATOM 1014 HE22 GLN A 67 37.959 20.699 17.824 1.00 0.00 H ATOM 1015 HE21 GLN A 67 37.898 19.288 18.942 1.00 0.00 H ATOM 1016 H GLN A 67 41.159 22.026 15.581 1.00 0.00 H ATOM 1017 N ARG A 68 44.470 21.138 16.099 1.00 29.37 N ATOM 1018 CA ARG A 68 45.851 20.689 15.931 1.00 30.14 C ATOM 1019 C ARG A 68 46.815 21.873 15.733 1.00 31.91 C ATOM 1020 O ARG A 68 48.029 21.715 15.821 1.00 32.18 O ATOM 1021 CB ARG A 68 45.912 19.779 14.682 1.00 35.76 C ATOM 1022 CG ARG A 68 47.278 19.165 14.409 1.00 68.68 C ATOM 1023 CD ARG A 68 47.905 19.694 13.110 1.00 90.59 C ATOM 1024 NE ARG A 68 49.310 20.089 13.267 1.00100.73 N ATOM 1025 CZ ARG A 68 50.253 19.340 13.841 1.00112.23 C ATOM 1026 NH1 ARG A 68 49.949 18.147 14.339 1.00 97.29 N ATOM 1027 NH2 ARG A 68 51.504 19.787 13.925 1.00 92.60 N ATOM 1028 HA ARG A 68 46.157 20.155 16.831 1.00 0.00 H ATOM 1029 HB2 ARG A 68 45.196 18.968 14.817 1.00 0.00 H ATOM 1030 HB3 ARG A 68 45.627 20.374 13.814 1.00 0.00 H ATOM 1031 HG2 ARG A 68 47.942 19.401 15.241 1.00 0.00 H ATOM 1032 HG3 ARG A 68 47.167 18.083 14.330 1.00 0.00 H ATOM 1033 HD2 ARG A 68 47.335 20.562 12.778 1.00 0.00 H ATOM 1034 HD3 ARG A 68 47.847 18.912 12.353 1.00 0.00 H ATOM 1035 HE ARG A 68 49.591 21.022 12.904 1.00 0.00 H ATOM 1036 HH12 ARG A 68 50.687 17.566 14.786 1.00 0.00 H ATOM 1037 HH11 ARG A 68 48.973 17.793 14.282 1.00 0.00 H ATOM 1038 HH22 ARG A 68 52.237 19.201 14.373 1.00 0.00 H ATOM 1039 HH21 ARG A 68 51.749 20.723 13.543 1.00 0.00 H ATOM 1040 H ARG A 68 43.756 20.837 15.405 1.00 0.00 H ATOM 1041 N LYS A 69 46.275 23.032 15.388 1.00 26.23 N ATOM 1042 CA LYS A 69 47.106 24.207 15.090 1.00 25.47 C ATOM 1043 C LYS A 69 47.276 25.163 16.287 1.00 26.99 C ATOM 1044 O LYS A 69 47.763 26.288 16.127 1.00 25.51 O ATOM 1045 CB LYS A 69 46.451 24.994 13.952 1.00 27.21 C ATOM 1046 CG LYS A 69 46.017 24.156 12.733 1.00 30.59 C ATOM 1047 CD LYS A 69 45.667 25.096 11.561 1.00 35.17 C ATOM 1048 CE LYS A 69 45.071 24.346 10.347 1.00 37.73 C ATOM 1049 NZ LYS A 69 44.399 25.312 9.433 1.00 35.29 N ATOM 1050 HA LYS A 69 48.095 23.832 14.826 1.00 0.00 H ATOM 1051 HB2 LYS A 69 45.567 25.490 14.351 1.00 0.00 H ATOM 1052 HB3 LYS A 69 47.163 25.744 13.608 1.00 0.00 H ATOM 1053 HG2 LYS A 69 46.832 23.495 12.438 1.00 0.00 H ATOM 1054 HG3 LYS A 69 45.143 23.560 12.994 1.00 0.00 H ATOM 1055 HD2 LYS A 69 44.940 25.830 11.908 1.00 0.00 H ATOM 1056 HD3 LYS A 69 46.575 25.608 11.242 1.00 0.00 H ATOM 1057 HE2 LYS A 69 44.344 23.613 10.696 1.00 0.00 H ATOM 1058 HE3 LYS A 69 45.870 23.836 9.809 1.00 0.00 H ATOM 1059 HZ1 LYS A 69 43.635 25.798 9.945 1.00 0.00 H ATOM 1060 HZ2 LYS A 69 45.093 26.011 9.098 1.00 0.00 H ATOM 1061 HZ3 LYS A 69 44.001 24.799 8.620 1.00 0.00 H ATOM 1062 H LYS A 69 45.240 23.112 15.327 1.00 0.00 H ATOM 1063 N MET A 70 46.816 24.753 17.460 1.00 24.39 N ATOM 1064 CA MET A 70 46.768 25.657 18.626 1.00 23.19 C ATOM 1065 C MET A 70 47.249 25.064 19.922 1.00 25.49 C ATOM 1066 O MET A 70 46.751 24.022 20.330 1.00 24.60 O ATOM 1067 CB MET A 70 45.316 26.033 18.920 1.00 25.32 C ATOM 1068 CG MET A 70 44.419 26.301 17.708 1.00 27.74 C ATOM 1069 SD MET A 70 42.688 26.494 18.247 1.00 27.65 S ATOM 1070 CE MET A 70 42.010 27.383 16.805 1.00 24.12 C ATOM 1071 HA MET A 70 47.418 26.484 18.339 1.00 0.00 H ATOM 1072 HB2 MET A 70 44.871 25.216 19.487 1.00 0.00 H ATOM 1073 HB3 MET A 70 45.325 26.935 19.531 1.00 0.00 H ATOM 1074 HG2 MET A 70 44.490 25.464 17.013 1.00 0.00 H ATOM 1075 HG3 MET A 70 44.747 27.214 17.210 1.00 0.00 H ATOM 1076 HE1 MET A 70 42.543 28.325 16.677 1.00 0.00 H ATOM 1077 HE2 MET A 70 42.132 26.770 15.912 1.00 0.00 H ATOM 1078 HE3 MET A 70 40.951 27.583 16.968 1.00 0.00 H ATOM 1079 H MET A 70 46.482 23.773 17.561 1.00 0.00 H ATOM 1080 N ASP A 71 48.048 25.829 20.672 1.00 22.78 N ATOM 1081 CA ASP A 71 48.434 25.396 22.006 1.00 21.51 C ATOM 1082 C ASP A 71 47.156 25.457 22.855 1.00 24.61 C ATOM 1083 O ASP A 71 46.226 26.151 22.516 1.00 23.24 O ATOM 1084 CB ASP A 71 49.433 26.376 22.622 1.00 21.66 C ATOM 1085 CG ASP A 71 49.882 25.937 24.002 1.00 23.08 C ATOM 1086 OD1 ASP A 71 50.791 25.075 24.090 1.00 22.04 O ATOM 1087 OD2 ASP A 71 49.336 26.452 25.002 1.00 24.93 O ATOM 1088 HA ASP A 71 48.884 24.404 21.967 1.00 0.00 H ATOM 1089 HB2 ASP A 71 50.306 26.444 21.973 1.00 0.00 H ATOM 1090 HB3 ASP A 71 48.963 27.356 22.700 1.00 0.00 H ATOM 1091 H ASP A 71 48.395 26.737 20.301 1.00 0.00 H ATOM 1092 N ALA A 72 47.157 24.794 23.993 1.00 26.04 N ATOM 1093 CA ALA A 72 46.006 24.821 24.901 1.00 25.86 C ATOM 1094 C ALA A 72 45.584 26.219 25.279 1.00 26.67 C ATOM 1095 O ALA A 72 44.384 26.469 25.443 1.00 23.82 O ATOM 1096 CB ALA A 72 46.315 24.004 26.189 1.00 26.50 C ATOM 1097 HA ALA A 72 45.175 24.369 24.359 1.00 0.00 H ATOM 1098 HB1 ALA A 72 46.532 22.970 25.919 1.00 0.00 H ATOM 1099 HB2 ALA A 72 47.178 24.437 26.694 1.00 0.00 H ATOM 1100 HB3 ALA A 72 45.451 24.034 26.853 1.00 0.00 H ATOM 1101 H ALA A 72 47.996 24.237 24.254 1.00 0.00 H ATOM 1102 N PHE A 73 46.536 27.141 25.496 1.00 21.02 N ATOM 1103 CA PHE A 73 46.107 28.471 25.939 1.00 18.86 C ATOM 1104 C PHE A 73 45.221 29.147 24.906 1.00 22.42 C ATOM 1105 O PHE A 73 44.325 29.917 25.243 1.00 22.43 O ATOM 1106 CB PHE A 73 47.273 29.377 26.372 1.00 19.68 C ATOM 1107 CG PHE A 73 47.848 30.206 25.255 1.00 19.59 C ATOM 1108 CD1 PHE A 73 48.786 29.651 24.390 1.00 20.42 C ATOM 1109 CD2 PHE A 73 47.520 31.563 25.137 1.00 20.44 C ATOM 1110 CE1 PHE A 73 49.369 30.438 23.371 1.00 21.23 C ATOM 1111 CE2 PHE A 73 48.074 32.332 24.140 1.00 22.53 C ATOM 1112 CZ PHE A 73 48.977 31.745 23.225 1.00 19.33 C ATOM 1113 HA PHE A 73 45.509 28.309 26.836 1.00 0.00 H ATOM 1114 HB2 PHE A 73 46.914 30.051 27.150 1.00 0.00 H ATOM 1115 HB3 PHE A 73 48.066 28.747 26.776 1.00 0.00 H ATOM 1116 HD2 PHE A 73 46.820 32.013 25.841 1.00 0.00 H ATOM 1117 HE2 PHE A 73 47.818 33.388 24.056 1.00 0.00 H ATOM 1118 HZ PHE A 73 49.366 32.336 22.396 1.00 0.00 H ATOM 1119 HE1 PHE A 73 50.122 30.011 22.708 1.00 0.00 H ATOM 1120 HD1 PHE A 73 49.072 28.605 24.499 1.00 0.00 H ATOM 1121 H PHE A 73 47.542 26.919 25.355 1.00 0.00 H ATOM 1122 N ILE A 74 45.504 28.890 23.638 1.00 20.06 N ATOM 1123 CA ILE A 74 44.695 29.471 22.555 1.00 18.84 C ATOM 1124 C ILE A 74 43.306 28.824 22.563 1.00 22.71 C ATOM 1125 O ILE A 74 42.297 29.479 22.356 1.00 24.96 O ATOM 1126 CB ILE A 74 45.429 29.285 21.202 1.00 22.23 C ATOM 1127 CG1 ILE A 74 46.670 30.220 21.171 1.00 23.54 C ATOM 1128 CG2 ILE A 74 44.491 29.571 20.013 1.00 23.13 C ATOM 1129 CD1 ILE A 74 47.708 29.838 20.089 1.00 24.95 C ATOM 1130 HA ILE A 74 44.562 30.542 22.705 1.00 0.00 H ATOM 1131 HB ILE A 74 45.753 28.248 21.109 1.00 0.00 H ATOM 1132 HG12 ILE A 74 46.330 31.238 20.979 1.00 0.00 H ATOM 1133 HG13 ILE A 74 47.157 30.179 22.145 1.00 0.00 H ATOM 1134 HD11 ILE A 74 48.067 28.826 20.274 1.00 0.00 H ATOM 1135 HD12 ILE A 74 47.240 29.885 19.106 1.00 0.00 H ATOM 1136 HD13 ILE A 74 48.545 30.535 20.128 1.00 0.00 H ATOM 1137 HG21 ILE A 74 43.645 28.885 20.046 1.00 0.00 H ATOM 1138 HG22 ILE A 74 44.131 30.598 20.075 1.00 0.00 H ATOM 1139 HG23 ILE A 74 45.037 29.432 19.080 1.00 0.00 H ATOM 1140 H ILE A 74 46.307 28.271 23.405 1.00 0.00 H ATOM 1141 N GLN A 75 43.271 27.515 22.709 1.00 20.86 N ATOM 1142 CA GLN A 75 41.980 26.803 22.748 1.00 21.67 C ATOM 1143 C GLN A 75 41.128 27.338 23.910 1.00 24.51 C ATOM 1144 O GLN A 75 39.947 27.639 23.728 1.00 23.16 O ATOM 1145 CB GLN A 75 42.247 25.324 22.923 1.00 22.56 C ATOM 1146 CG GLN A 75 42.934 24.734 21.712 1.00 20.54 C ATOM 1147 CD GLN A 75 43.151 23.245 21.853 1.00 35.44 C ATOM 1148 OE1 GLN A 75 42.541 22.611 22.695 1.00 32.33 O ATOM 1149 NE2 GLN A 75 44.060 22.692 21.064 1.00 32.72 N ATOM 1150 HA GLN A 75 41.433 26.964 21.819 1.00 0.00 H ATOM 1151 HB2 GLN A 75 42.884 25.180 23.796 1.00 0.00 H ATOM 1152 HB3 GLN A 75 41.299 24.809 23.078 1.00 0.00 H ATOM 1153 HG2 GLN A 75 42.317 24.918 20.833 1.00 0.00 H ATOM 1154 HG3 GLN A 75 43.901 25.220 21.584 1.00 0.00 H ATOM 1155 HE22 GLN A 75 44.557 23.271 20.358 1.00 0.00 H ATOM 1156 HE21 GLN A 75 44.276 21.678 21.151 1.00 0.00 H ATOM 1157 H GLN A 75 44.159 26.981 22.797 1.00 0.00 H ATOM 1158 N TYR A 76 41.733 27.526 25.085 1.00 21.34 N ATOM 1159 CA TYR A 76 40.985 28.093 26.234 1.00 21.25 C ATOM 1160 C TYR A 76 40.529 29.480 25.898 1.00 24.98 C ATOM 1161 O TYR A 76 39.406 29.884 26.234 1.00 24.98 O ATOM 1162 CB TYR A 76 41.842 28.249 27.489 1.00 21.97 C ATOM 1163 CG TYR A 76 42.260 26.988 28.190 1.00 24.26 C ATOM 1164 CD1 TYR A 76 41.851 25.733 27.746 1.00 24.66 C ATOM 1165 CD2 TYR A 76 43.186 27.051 29.230 1.00 24.23 C ATOM 1166 CE1 TYR A 76 42.313 24.573 28.370 1.00 23.83 C ATOM 1167 CE2 TYR A 76 43.601 25.916 29.877 1.00 25.27 C ATOM 1168 CZ TYR A 76 43.179 24.679 29.445 1.00 25.67 C ATOM 1169 OH TYR A 76 43.660 23.563 30.099 1.00 27.31 O ATOM 1170 HA TYR A 76 40.167 27.399 26.425 1.00 0.00 H ATOM 1171 HB3 TYR A 76 41.276 28.850 28.201 1.00 0.00 H ATOM 1172 HB2 TYR A 76 42.748 28.783 27.204 1.00 0.00 H ATOM 1173 HD2 TYR A 76 43.587 28.018 29.534 1.00 0.00 H ATOM 1174 HE2 TYR A 76 44.267 25.993 30.736 1.00 0.00 H ATOM 1175 HE1 TYR A 76 41.995 23.593 28.014 1.00 0.00 H ATOM 1176 HD1 TYR A 76 41.164 25.656 26.903 1.00 0.00 H ATOM 1177 HH TYR A 76 43.276 22.749 29.686 1.00 0.00 H ATOM 1178 H TYR A 76 42.736 27.273 25.196 1.00 0.00 H ATOM 1179 N GLY A 77 41.431 30.287 25.348 1.00 21.44 N ATOM 1180 CA GLY A 77 41.030 31.663 25.077 1.00 20.54 C ATOM 1181 C GLY A 77 39.885 31.742 24.085 1.00 23.17 C ATOM 1182 O GLY A 77 39.006 32.588 24.211 1.00 21.89 O ATOM 1183 HA3 GLY A 77 41.884 32.204 24.671 1.00 0.00 H ATOM 1184 HA2 GLY A 77 40.718 32.128 26.012 1.00 0.00 H ATOM 1185 H GLY A 77 42.388 29.950 25.119 1.00 0.00 H ATOM 1186 N ILE A 78 39.925 30.897 23.057 1.00 21.00 N ATOM 1187 CA ILE A 78 38.848 30.914 22.025 1.00 19.68 C ATOM 1188 C ILE A 78 37.513 30.507 22.654 1.00 23.71 C ATOM 1189 O ILE A 78 36.494 31.156 22.443 1.00 25.84 O ATOM 1190 CB ILE A 78 39.190 29.987 20.807 1.00 21.33 C ATOM 1191 CG1 ILE A 78 40.308 30.588 19.906 1.00 19.10 C ATOM 1192 CG2 ILE A 78 37.896 29.714 19.901 1.00 22.05 C ATOM 1193 CD1 ILE A 78 40.950 29.474 19.019 1.00 20.09 C ATOM 1194 HA ILE A 78 38.768 31.932 21.643 1.00 0.00 H ATOM 1195 HB ILE A 78 39.547 29.050 21.234 1.00 0.00 H ATOM 1196 HG12 ILE A 78 39.878 31.356 19.263 1.00 0.00 H ATOM 1197 HG13 ILE A 78 41.077 31.033 20.537 1.00 0.00 H ATOM 1198 HD11 ILE A 78 41.384 28.706 19.660 1.00 0.00 H ATOM 1199 HD12 ILE A 78 40.183 29.029 18.385 1.00 0.00 H ATOM 1200 HD13 ILE A 78 41.730 29.912 18.396 1.00 0.00 H ATOM 1201 HG21 ILE A 78 37.129 29.227 20.503 1.00 0.00 H ATOM 1202 HG22 ILE A 78 37.514 30.661 19.520 1.00 0.00 H ATOM 1203 HG23 ILE A 78 38.168 29.068 19.066 1.00 0.00 H ATOM 1204 H ILE A 78 40.711 30.221 22.973 1.00 0.00 H ATOM 1205 N VAL A 79 37.520 29.433 23.447 1.00 22.79 N ATOM 1206 CA VAL A 79 36.285 28.958 24.082 1.00 22.68 C ATOM 1207 C VAL A 79 35.691 30.051 24.969 1.00 28.04 C ATOM 1208 O VAL A 79 34.516 30.421 24.834 1.00 27.75 O ATOM 1209 CB VAL A 79 36.470 27.604 24.767 1.00 26.05 C ATOM 1210 CG1 VAL A 79 35.276 27.265 25.667 1.00 26.21 C ATOM 1211 CG2 VAL A 79 36.707 26.477 23.718 1.00 25.53 C ATOM 1212 HA VAL A 79 35.542 28.759 23.310 1.00 0.00 H ATOM 1213 HB VAL A 79 37.355 27.674 25.400 1.00 0.00 H ATOM 1214 HG11 VAL A 79 35.173 28.031 26.436 1.00 0.00 H ATOM 1215 HG12 VAL A 79 34.368 27.228 25.065 1.00 0.00 H ATOM 1216 HG13 VAL A 79 35.441 26.296 26.138 1.00 0.00 H ATOM 1217 HG21 VAL A 79 35.848 26.418 23.050 1.00 0.00 H ATOM 1218 HG22 VAL A 79 37.603 26.703 23.140 1.00 0.00 H ATOM 1219 HG23 VAL A 79 36.835 25.525 24.232 1.00 0.00 H ATOM 1220 H VAL A 79 38.412 28.926 23.617 1.00 0.00 H ATOM 1221 N ALA A 80 36.513 30.656 25.817 1.00 24.19 N ATOM 1222 CA ALA A 80 36.018 31.762 26.653 1.00 22.56 C ATOM 1223 C ALA A 80 35.558 32.977 25.839 1.00 25.10 C ATOM 1224 O ALA A 80 34.627 33.687 26.223 1.00 24.95 O ATOM 1225 CB ALA A 80 37.079 32.164 27.726 1.00 23.52 C ATOM 1226 HA ALA A 80 35.130 31.391 27.164 1.00 0.00 H ATOM 1227 HB1 ALA A 80 37.290 31.307 28.365 1.00 0.00 H ATOM 1228 HB2 ALA A 80 37.995 32.482 27.228 1.00 0.00 H ATOM 1229 HB3 ALA A 80 36.690 32.983 28.331 1.00 0.00 H ATOM 1230 H ALA A 80 37.504 30.350 25.891 1.00 0.00 H ATOM 1231 N GLY A 81 36.202 33.239 24.706 1.00 23.95 N ATOM 1232 CA GLY A 81 35.830 34.377 23.862 1.00 22.97 C ATOM 1233 C GLY A 81 34.486 34.130 23.183 1.00 26.87 C ATOM 1234 O GLY A 81 33.655 35.011 23.045 1.00 24.87 O ATOM 1235 HA3 GLY A 81 36.595 34.522 23.099 1.00 0.00 H ATOM 1236 HA2 GLY A 81 35.760 35.273 24.479 1.00 0.00 H ATOM 1237 H GLY A 81 36.987 32.623 24.413 1.00 0.00 H ATOM 1238 N VAL A 82 34.294 32.903 22.725 1.00 24.86 N ATOM 1239 CA VAL A 82 33.011 32.514 22.129 1.00 24.69 C ATOM 1240 C VAL A 82 31.931 32.666 23.237 1.00 29.76 C ATOM 1241 O VAL A 82 30.860 33.237 23.003 1.00 29.82 O ATOM 1242 CB VAL A 82 33.092 31.046 21.656 1.00 27.93 C ATOM 1243 CG1 VAL A 82 31.653 30.494 21.353 1.00 29.29 C ATOM 1244 CG2 VAL A 82 34.021 30.937 20.427 1.00 26.30 C ATOM 1245 HA VAL A 82 32.765 33.136 21.268 1.00 0.00 H ATOM 1246 HB VAL A 82 33.519 30.432 22.449 1.00 0.00 H ATOM 1247 HG11 VAL A 82 31.048 30.545 22.258 1.00 0.00 H ATOM 1248 HG12 VAL A 82 31.191 31.097 20.571 1.00 0.00 H ATOM 1249 HG13 VAL A 82 31.725 29.458 21.021 1.00 0.00 H ATOM 1250 HG21 VAL A 82 33.626 31.553 19.619 1.00 0.00 H ATOM 1251 HG22 VAL A 82 35.019 31.283 20.696 1.00 0.00 H ATOM 1252 HG23 VAL A 82 34.071 29.898 20.102 1.00 0.00 H ATOM 1253 H VAL A 82 35.063 32.205 22.788 1.00 0.00 H ATOM 1254 N GLN A 83 32.219 32.171 24.448 1.00 26.79 N ATOM 1255 CA GLN A 83 31.256 32.264 25.544 1.00 25.38 C ATOM 1256 C GLN A 83 30.852 33.712 25.693 1.00 29.87 C ATOM 1257 O GLN A 83 29.672 34.025 25.770 1.00 29.74 O ATOM 1258 CB GLN A 83 31.838 31.787 26.881 1.00 26.69 C ATOM 1259 CG GLN A 83 31.938 30.286 27.117 1.00 20.79 C ATOM 1260 CD GLN A 83 32.500 30.005 28.501 1.00 24.05 C ATOM 1261 OE1 GLN A 83 32.485 30.873 29.361 1.00 24.05 O ATOM 1262 NE2 GLN A 83 32.861 28.760 28.759 1.00 23.82 N ATOM 1263 HA GLN A 83 30.409 31.622 25.302 1.00 0.00 H ATOM 1264 HB2 GLN A 83 32.845 32.197 26.962 1.00 0.00 H ATOM 1265 HB3 GLN A 83 31.214 32.200 27.673 1.00 0.00 H ATOM 1266 HG2 GLN A 83 30.946 29.842 27.035 1.00 0.00 H ATOM 1267 HG3 GLN A 83 32.595 29.847 26.366 1.00 0.00 H ATOM 1268 HE22 GLN A 83 32.860 28.050 27.999 1.00 0.00 H ATOM 1269 HE21 GLN A 83 33.146 28.490 29.722 1.00 0.00 H ATOM 1270 H GLN A 83 33.139 31.715 24.611 1.00 0.00 H ATOM 1271 N ALA A 84 31.825 34.618 25.705 1.00 25.71 N ATOM 1272 CA ALA A 84 31.518 36.045 25.851 1.00 25.00 C ATOM 1273 C ALA A 84 30.725 36.650 24.695 1.00 27.98 C ATOM 1274 O ALA A 84 29.833 37.479 24.912 1.00 27.39 O ATOM 1275 CB ALA A 84 32.808 36.870 26.093 1.00 26.57 C ATOM 1276 HA ALA A 84 30.868 36.100 26.724 1.00 0.00 H ATOM 1277 HB1 ALA A 84 33.295 36.522 27.004 1.00 0.00 H ATOM 1278 HB2 ALA A 84 33.483 36.742 25.247 1.00 0.00 H ATOM 1279 HB3 ALA A 84 32.550 37.924 26.197 1.00 0.00 H ATOM 1280 H ALA A 84 32.814 34.312 25.610 1.00 0.00 H ATOM 1281 N MET A 85 31.095 36.310 23.470 1.00 24.71 N ATOM 1282 CA MET A 85 30.433 36.893 22.304 1.00 24.70 C ATOM 1283 C MET A 85 28.969 36.407 22.291 1.00 30.97 C ATOM 1284 O MET A 85 28.043 37.173 22.003 1.00 31.58 O ATOM 1285 CB MET A 85 31.122 36.461 21.012 1.00 27.19 C ATOM 1286 CG MET A 85 32.527 37.044 20.814 1.00 31.92 C ATOM 1287 SD MET A 85 32.490 38.820 20.598 1.00 36.77 S ATOM 1288 CE MET A 85 31.361 38.940 19.236 1.00 33.29 C ATOM 1289 HA MET A 85 30.482 37.980 22.366 1.00 0.00 H ATOM 1290 HB2 MET A 85 31.202 35.374 21.015 1.00 0.00 H ATOM 1291 HB3 MET A 85 30.501 36.776 20.173 1.00 0.00 H ATOM 1292 HG2 MET A 85 32.975 36.591 19.930 1.00 0.00 H ATOM 1293 HG3 MET A 85 33.133 36.808 21.689 1.00 0.00 H ATOM 1294 HE1 MET A 85 31.766 38.397 18.382 1.00 0.00 H ATOM 1295 HE2 MET A 85 30.402 38.508 19.522 1.00 0.00 H ATOM 1296 HE3 MET A 85 31.224 39.988 18.971 1.00 0.00 H ATOM 1297 H MET A 85 31.863 35.622 23.336 1.00 0.00 H ATOM 1298 N GLN A 86 28.775 35.140 22.627 1.00 28.87 N ATOM 1299 CA GLN A 86 27.426 34.556 22.669 1.00 29.52 C ATOM 1300 C GLN A 86 26.610 35.196 23.757 1.00 33.04 C ATOM 1301 O GLN A 86 25.479 35.567 23.541 1.00 35.34 O ATOM 1302 CB GLN A 86 27.456 33.037 22.808 1.00 29.92 C ATOM 1303 CG GLN A 86 27.767 32.384 21.493 1.00 42.76 C ATOM 1304 CD GLN A 86 27.900 30.882 21.569 1.00 54.49 C ATOM 1305 OE1 GLN A 86 27.797 30.282 22.638 1.00 52.95 O ATOM 1306 NE2 GLN A 86 28.130 30.262 20.419 1.00 46.08 N ATOM 1307 HA GLN A 86 26.947 34.766 21.713 1.00 0.00 H ATOM 1308 HB2 GLN A 86 28.221 32.760 23.534 1.00 0.00 H ATOM 1309 HB3 GLN A 86 26.483 32.691 23.157 1.00 0.00 H ATOM 1310 HG2 GLN A 86 26.966 32.622 20.794 1.00 0.00 H ATOM 1311 HG3 GLN A 86 28.706 32.793 21.121 1.00 0.00 H ATOM 1312 HE22 GLN A 86 28.210 30.811 19.539 1.00 0.00 H ATOM 1313 HE21 GLN A 86 28.231 29.227 20.397 1.00 0.00 H ATOM 1314 H GLN A 86 29.594 34.546 22.866 1.00 0.00 H ATOM 1315 N ASP A 87 27.231 35.433 24.896 1.00 29.92 N ATOM 1316 CA ASP A 87 26.555 36.072 26.012 1.00 28.09 C ATOM 1317 C ASP A 87 26.137 37.501 25.667 1.00 34.68 C ATOM 1318 O ASP A 87 25.098 38.005 26.166 1.00 34.08 O ATOM 1319 CB ASP A 87 27.478 36.062 27.221 1.00 29.44 C ATOM 1320 CG ASP A 87 26.832 36.651 28.465 1.00 30.09 C ATOM 1321 OD1 ASP A 87 25.749 36.182 28.870 1.00 31.67 O ATOM 1322 OD2 ASP A 87 27.486 37.454 29.139 1.00 30.29 O ATOM 1323 HA ASP A 87 25.646 35.516 26.239 1.00 0.00 H ATOM 1324 HB2 ASP A 87 27.764 35.031 27.432 1.00 0.00 H ATOM 1325 HB3 ASP A 87 28.369 36.643 26.983 1.00 0.00 H ATOM 1326 H ASP A 87 28.228 35.156 24.998 1.00 0.00 H ATOM 1327 N SER A 88 26.951 38.182 24.854 1.00 28.96 N ATOM 1328 CA SER A 88 26.650 39.572 24.526 1.00 28.66 C ATOM 1329 C SER A 88 25.411 39.683 23.632 1.00 33.07 C ATOM 1330 O SER A 88 24.746 40.717 23.640 1.00 32.86 O ATOM 1331 CB SER A 88 27.835 40.272 23.834 1.00 29.03 C ATOM 1332 OG SER A 88 27.895 39.926 22.451 1.00 30.58 O ATOM 1333 HA SER A 88 26.454 40.072 25.475 1.00 0.00 H ATOM 1334 HB2 SER A 88 28.762 39.967 24.319 1.00 0.00 H ATOM 1335 HB3 SER A 88 27.716 41.351 23.927 1.00 0.00 H ATOM 1336 HG SER A 88 28.007 38.946 22.362 1.00 0.00 H ATOM 1337 H SER A 88 27.796 37.723 24.457 1.00 0.00 H ATOM 1338 N GLY A 89 25.157 38.661 22.818 1.00 31.43 N ATOM 1339 CA GLY A 89 24.030 38.682 21.891 1.00 33.48 C ATOM 1340 C GLY A 89 24.270 39.588 20.689 1.00 39.37 C ATOM 1341 O GLY A 89 23.366 39.817 19.869 1.00 37.88 O ATOM 1342 HA3 GLY A 89 23.147 39.036 22.424 1.00 0.00 H ATOM 1343 HA2 GLY A 89 23.854 37.668 21.533 1.00 0.00 H ATOM 1344 H GLY A 89 25.777 37.827 22.843 1.00 0.00 H ATOM 1345 N LEU A 90 25.499 40.094 20.561 1.00 35.49 N ATOM 1346 CA LEU A 90 25.836 40.981 19.451 1.00 35.68 C ATOM 1347 C LEU A 90 25.800 40.277 18.110 1.00 38.82 C ATOM 1348 O LEU A 90 26.234 39.131 17.975 1.00 36.20 O ATOM 1349 CB LEU A 90 27.206 41.628 19.668 1.00 36.66 C ATOM 1350 CG LEU A 90 27.714 42.598 18.593 1.00 41.15 C ATOM 1351 CD1 LEU A 90 27.046 43.956 18.750 1.00 40.63 C ATOM 1352 CD2 LEU A 90 29.221 42.736 18.756 1.00 42.79 C ATOM 1353 HA LEU A 90 25.071 41.757 19.431 1.00 0.00 H ATOM 1354 HB2 LEU A 90 27.162 42.178 20.608 1.00 0.00 H ATOM 1355 HB3 LEU A 90 27.937 40.824 19.753 1.00 0.00 H ATOM 1356 HG LEU A 90 27.474 42.216 17.601 1.00 0.00 H ATOM 1357 HD21 LEU A 90 29.444 43.125 19.750 1.00 0.00 H ATOM 1358 HD22 LEU A 90 29.689 41.759 18.633 1.00 0.00 H ATOM 1359 HD23 LEU A 90 29.605 43.422 18.001 1.00 0.00 H ATOM 1360 HD11 LEU A 90 25.967 43.843 18.647 1.00 0.00 H ATOM 1361 HD12 LEU A 90 27.278 44.362 19.735 1.00 0.00 H ATOM 1362 HD13 LEU A 90 27.417 44.633 17.980 1.00 0.00 H ATOM 1363 H LEU A 90 26.228 39.853 21.263 1.00 0.00 H ATOM 1364 N GLU A 91 25.232 40.952 17.116 1.00 38.06 N ATOM 1365 CA GLU A 91 25.173 40.389 15.772 1.00 38.39 C ATOM 1366 C GLU A 91 26.127 41.182 14.906 1.00 41.06 C ATOM 1367 O GLU A 91 25.980 42.403 14.758 1.00 42.59 O ATOM 1368 CB GLU A 91 23.749 40.459 15.203 1.00 40.40 C ATOM 1369 CG GLU A 91 22.910 39.214 15.471 1.00 60.83 C ATOM 1370 CD GLU A 91 21.454 39.542 15.749 1.00104.57 C ATOM 1371 OE1 GLU A 91 20.905 40.436 15.069 1.00108.74 O ATOM 1372 OE2 GLU A 91 20.860 38.911 16.652 1.00110.95 O ATOM 1373 HA GLU A 91 25.456 39.337 15.796 1.00 0.00 H ATOM 1374 HB2 GLU A 91 23.243 41.315 15.649 1.00 0.00 H ATOM 1375 HB3 GLU A 91 23.818 40.600 14.124 1.00 0.00 H ATOM 1376 HG2 GLU A 91 22.961 38.563 14.598 1.00 0.00 H ATOM 1377 HG3 GLU A 91 23.322 38.694 16.335 1.00 0.00 H ATOM 1378 H GLU A 91 24.825 41.892 17.299 1.00 0.00 H ATOM 1379 N ILE A 92 27.113 40.491 14.343 1.00 35.79 N ATOM 1380 CA ILE A 92 28.123 41.140 13.509 1.00 35.28 C ATOM 1381 C ILE A 92 27.551 41.273 12.109 1.00 39.82 C ATOM 1382 O ILE A 92 26.979 40.321 11.600 1.00 40.76 O ATOM 1383 CB ILE A 92 29.402 40.269 13.415 1.00 37.83 C ATOM 1384 CG1 ILE A 92 29.922 39.857 14.810 1.00 38.89 C ATOM 1385 CG2 ILE A 92 30.446 40.952 12.549 1.00 36.37 C ATOM 1386 CD1 ILE A 92 30.023 41.011 15.795 1.00 41.47 C ATOM 1387 HA ILE A 92 28.378 42.107 13.943 1.00 0.00 H ATOM 1388 HB ILE A 92 29.151 39.331 12.920 1.00 0.00 H ATOM 1389 HG12 ILE A 92 29.243 39.111 15.223 1.00 0.00 H ATOM 1390 HG13 ILE A 92 30.913 39.419 14.692 1.00 0.00 H ATOM 1391 HD11 ILE A 92 30.709 41.762 15.403 1.00 0.00 H ATOM 1392 HD12 ILE A 92 29.037 41.455 15.935 1.00 0.00 H ATOM 1393 HD13 ILE A 92 30.395 40.640 16.750 1.00 0.00 H ATOM 1394 HG21 ILE A 92 30.044 41.102 11.547 1.00 0.00 H ATOM 1395 HG22 ILE A 92 30.704 41.917 12.986 1.00 0.00 H ATOM 1396 HG23 ILE A 92 31.337 40.326 12.494 1.00 0.00 H ATOM 1397 H ILE A 92 27.167 39.464 14.500 1.00 0.00 H ATOM 1398 N THR A 93 27.780 42.408 11.460 1.00 35.79 N ATOM 1399 CA THR A 93 27.324 42.611 10.082 1.00 36.07 C ATOM 1400 C THR A 93 28.419 43.260 9.270 1.00 41.22 C ATOM 1401 O THR A 93 29.387 43.774 9.819 1.00 37.96 O ATOM 1402 CB THR A 93 26.117 43.537 10.007 1.00 36.56 C ATOM 1403 OG1 THR A 93 26.527 44.866 10.337 1.00 39.69 O ATOM 1404 CG2 THR A 93 24.995 43.082 10.929 1.00 34.03 C ATOM 1405 HA THR A 93 27.057 41.627 9.696 1.00 0.00 H ATOM 1406 HB THR A 93 25.725 43.511 8.990 1.00 0.00 H ATOM 1407 HG1 THR A 93 25.746 45.472 10.290 1.00 0.00 H ATOM 1408 HG23 THR A 93 24.696 42.068 10.663 1.00 0.00 H ATOM 1409 HG21 THR A 93 25.345 43.100 11.961 1.00 0.00 H ATOM 1410 HG22 THR A 93 24.143 43.753 10.821 1.00 0.00 H ATOM 1411 H THR A 93 28.296 43.172 11.941 1.00 0.00 H ATOM 1412 N GLU A 94 28.177 43.373 7.969 1.00 39.36 N ATOM 1413 CA GLU A 94 29.127 44.012 7.083 1.00 39.31 C ATOM 1414 C GLU A 94 29.342 45.441 7.543 1.00 41.73 C ATOM 1415 O GLU A 94 30.445 45.979 7.439 1.00 41.70 O ATOM 1416 CB GLU A 94 28.615 43.995 5.638 1.00 41.11 C ATOM 1417 CG GLU A 94 29.525 44.729 4.679 1.00 60.13 C ATOM 1418 CD GLU A 94 30.327 43.779 3.819 1.00106.62 C ATOM 1419 OE1 GLU A 94 29.788 42.700 3.480 1.00115.95 O ATOM 1420 OE2 GLU A 94 31.495 44.102 3.498 1.00108.14 O ATOM 1421 HA GLU A 94 30.071 43.467 7.113 1.00 0.00 H ATOM 1422 HB2 GLU A 94 28.530 42.958 5.312 1.00 0.00 H ATOM 1423 HB3 GLU A 94 27.632 44.465 5.612 1.00 0.00 H ATOM 1424 HG2 GLU A 94 28.918 45.362 4.032 1.00 0.00 H ATOM 1425 HG3 GLU A 94 30.213 45.351 5.252 1.00 0.00 H ATOM 1426 H GLU A 94 27.289 42.996 7.580 1.00 0.00 H ATOM 1427 N GLU A 95 28.292 46.035 8.088 1.00 38.73 N ATOM 1428 CA GLU A 95 28.319 47.419 8.552 1.00 40.34 C ATOM 1429 C GLU A 95 29.078 47.572 9.849 1.00 43.10 C ATOM 1430 O GLU A 95 29.681 48.611 10.109 1.00 44.95 O ATOM 1431 CB GLU A 95 26.885 47.883 8.816 1.00 43.05 C ATOM 1432 CG GLU A 95 26.621 49.328 8.486 1.00 62.06 C ATOM 1433 CD GLU A 95 25.517 49.476 7.452 1.00109.13 C ATOM 1434 OE1 GLU A 95 24.679 50.395 7.598 1.00117.06 O ATOM 1435 OE2 GLU A 95 25.476 48.651 6.509 1.00113.38 O ATOM 1436 HA GLU A 95 28.811 48.009 7.778 1.00 0.00 H ATOM 1437 HB2 GLU A 95 26.213 47.269 8.216 1.00 0.00 H ATOM 1438 HB3 GLU A 95 26.668 47.731 9.873 1.00 0.00 H ATOM 1439 HG2 GLU A 95 26.325 49.850 9.396 1.00 0.00 H ATOM 1440 HG3 GLU A 95 27.535 49.774 8.094 1.00 0.00 H ATOM 1441 H GLU A 95 27.410 45.493 8.190 1.00 0.00 H ATOM 1442 N ASN A 96 28.985 46.534 10.673 1.00 37.41 N ATOM 1443 CA ASN A 96 29.568 46.477 12.015 1.00 36.95 C ATOM 1444 C ASN A 96 31.016 46.056 12.096 1.00 35.79 C ATOM 1445 O ASN A 96 31.679 46.386 13.067 1.00 35.20 O ATOM 1446 CB ASN A 96 28.870 45.309 12.769 1.00 36.01 C ATOM 1447 CG ASN A 96 28.057 45.790 13.862 1.00 54.91 C ATOM 1448 OD1 ASN A 96 28.089 46.977 14.170 1.00 70.80 O ATOM 1449 ND2 ASN A 96 27.236 44.928 14.407 1.00 40.41 N ATOM 1450 HA ASN A 96 29.454 47.490 12.402 1.00 0.00 H ATOM 1451 HB2 ASN A 96 28.236 44.765 12.069 1.00 0.00 H ATOM 1452 HB3 ASN A 96 29.632 44.637 13.164 1.00 0.00 H ATOM 1453 HD22 ASN A 96 27.253 43.932 14.107 1.00 0.00 H ATOM 1454 HD21 ASN A 96 26.567 45.239 15.140 1.00 0.00 H ATOM 1455 H ASN A 96 28.459 45.701 10.340 1.00 0.00 H ATOM 1456 N ALA A 97 31.330 45.034 11.302 1.00 31.11 N ATOM 1457 CA ALA A 97 32.570 44.292 11.374 1.00 31.92 C ATOM 1458 C ALA A 97 33.801 45.158 11.607 1.00 34.73 C ATOM 1459 O ALA A 97 34.772 44.765 12.251 1.00 32.76 O ATOM 1460 CB ALA A 97 32.744 43.457 10.115 1.00 32.68 C ATOM 1461 HA ALA A 97 32.491 43.648 12.250 1.00 0.00 H ATOM 1462 HB1 ALA A 97 31.911 42.760 10.025 1.00 0.00 H ATOM 1463 HB2 ALA A 97 32.766 44.114 9.245 1.00 0.00 H ATOM 1464 HB3 ALA A 97 33.680 42.901 10.176 1.00 0.00 H ATOM 1465 H ALA A 97 30.637 44.750 10.581 1.00 0.00 H ATOM 1466 N THR A 98 33.752 46.318 10.993 1.00 31.95 N ATOM 1467 CA THR A 98 34.851 47.245 10.962 1.00 32.35 C ATOM 1468 C THR A 98 35.023 47.970 12.304 1.00 34.92 C ATOM 1469 O THR A 98 36.082 48.541 12.604 1.00 32.83 O ATOM 1470 CB THR A 98 34.514 48.191 9.827 1.00 37.35 C ATOM 1471 OG1 THR A 98 35.433 48.026 8.751 1.00 41.44 O ATOM 1472 CG2 THR A 98 34.354 49.581 10.281 1.00 32.03 C ATOM 1473 HA THR A 98 35.809 46.750 10.801 1.00 0.00 H ATOM 1474 HB THR A 98 33.532 47.926 9.436 1.00 0.00 H ATOM 1475 HG1 THR A 98 35.198 48.651 8.020 1.00 0.00 H ATOM 1476 HG23 THR A 98 33.637 49.614 11.101 1.00 0.00 H ATOM 1477 HG21 THR A 98 35.316 49.964 10.622 1.00 0.00 H ATOM 1478 HG22 THR A 98 33.991 50.192 9.455 1.00 0.00 H ATOM 1479 H THR A 98 32.872 46.580 10.504 1.00 0.00 H ATOM 1480 N ARG A 99 33.969 47.947 13.110 1.00 31.33 N ATOM 1481 CA ARG A 99 33.957 48.670 14.392 1.00 31.01 C ATOM 1482 C ARG A 99 34.061 47.749 15.636 1.00 29.52 C ATOM 1483 O ARG A 99 33.874 48.183 16.765 1.00 25.89 O ATOM 1484 CB ARG A 99 32.711 49.601 14.465 1.00 31.19 C ATOM 1485 CG ARG A 99 32.942 51.033 13.781 1.00 32.84 C ATOM 1486 CD ARG A 99 32.856 52.155 14.830 1.00 33.02 C ATOM 1487 NE ARG A 99 34.098 52.894 15.041 1.00 49.85 N ATOM 1488 CZ ARG A 99 34.238 54.184 14.788 1.00 88.74 C ATOM 1489 NH1 ARG A 99 33.206 54.889 14.334 1.00 94.50 N ATOM 1490 NH2 ARG A 99 35.412 54.765 14.956 1.00 83.78 N ATOM 1491 HA ARG A 99 34.862 49.278 14.420 1.00 0.00 H ATOM 1492 HB2 ARG A 99 31.881 49.107 13.960 1.00 0.00 H ATOM 1493 HB3 ARG A 99 32.457 49.756 15.514 1.00 0.00 H ATOM 1494 HG2 ARG A 99 33.927 51.053 13.315 1.00 0.00 H ATOM 1495 HG3 ARG A 99 32.178 51.194 13.020 1.00 0.00 H ATOM 1496 HD2 ARG A 99 32.561 51.709 15.780 1.00 0.00 H ATOM 1497 HD3 ARG A 99 32.091 52.862 14.509 1.00 0.00 H ATOM 1498 HE ARG A 99 34.920 52.375 15.412 1.00 0.00 H ATOM 1499 HH12 ARG A 99 33.317 55.904 14.135 1.00 0.00 H ATOM 1500 HH11 ARG A 99 32.288 54.426 14.178 1.00 0.00 H ATOM 1501 HH22 ARG A 99 35.523 55.780 14.757 1.00 0.00 H ATOM 1502 HH21 ARG A 99 36.225 54.208 15.287 1.00 0.00 H ATOM 1503 H ARG A 99 33.128 47.403 12.828 1.00 0.00 H ATOM 1504 N ILE A 100 34.357 46.478 15.408 1.00 27.20 N ATOM 1505 CA ILE A 100 34.472 45.501 16.482 1.00 25.22 C ATOM 1506 C ILE A 100 35.849 44.868 16.403 1.00 28.43 C ATOM 1507 O ILE A 100 36.235 44.401 15.341 1.00 27.77 O ATOM 1508 CB ILE A 100 33.390 44.424 16.334 1.00 28.58 C ATOM 1509 CG1 ILE A 100 31.990 45.088 16.294 1.00 29.42 C ATOM 1510 CG2 ILE A 100 33.478 43.439 17.500 1.00 26.71 C ATOM 1511 CD1 ILE A 100 30.857 44.156 15.728 1.00 35.74 C ATOM 1512 HA ILE A 100 34.338 45.990 17.447 1.00 0.00 H ATOM 1513 HB ILE A 100 33.547 43.880 15.402 1.00 0.00 H ATOM 1514 HG12 ILE A 100 31.719 45.380 17.309 1.00 0.00 H ATOM 1515 HG13 ILE A 100 32.049 45.977 15.665 1.00 0.00 H ATOM 1516 HD11 ILE A 100 31.105 43.864 14.708 1.00 0.00 H ATOM 1517 HD12 ILE A 100 30.774 43.266 16.352 1.00 0.00 H ATOM 1518 HD13 ILE A 100 29.909 44.694 15.733 1.00 0.00 H ATOM 1519 HG21 ILE A 100 34.460 42.967 17.501 1.00 0.00 H ATOM 1520 HG22 ILE A 100 33.329 43.974 18.438 1.00 0.00 H ATOM 1521 HG23 ILE A 100 32.707 42.677 17.389 1.00 0.00 H ATOM 1522 H ILE A 100 34.513 46.167 14.428 1.00 0.00 H ATOM 1523 N GLY A 101 36.583 44.850 17.523 1.00 25.10 N ATOM 1524 CA GLY A 101 37.928 44.290 17.567 1.00 24.17 C ATOM 1525 C GLY A 101 38.182 43.438 18.803 1.00 29.07 C ATOM 1526 O GLY A 101 37.242 42.930 19.426 1.00 27.79 O ATOM 1527 HA3 GLY A 101 38.646 45.110 17.558 1.00 0.00 H ATOM 1528 HA2 GLY A 101 38.075 43.670 16.682 1.00 0.00 H ATOM 1529 H GLY A 101 36.178 45.250 18.393 1.00 0.00 H ATOM 1530 N ALA A 102 39.459 43.249 19.135 1.00 24.45 N ATOM 1531 CA ALA A 102 39.873 42.396 20.248 1.00 23.08 C ATOM 1532 C ALA A 102 41.174 42.906 20.854 1.00 26.59 C ATOM 1533 O ALA A 102 42.026 43.441 20.131 1.00 25.19 O ATOM 1534 CB ALA A 102 40.097 40.970 19.741 1.00 23.16 C ATOM 1535 HA ALA A 102 39.090 42.411 21.006 1.00 0.00 H ATOM 1536 HB1 ALA A 102 39.170 40.588 19.314 1.00 0.00 H ATOM 1537 HB2 ALA A 102 40.875 40.975 18.977 1.00 0.00 H ATOM 1538 HB3 ALA A 102 40.406 40.335 20.571 1.00 0.00 H ATOM 1539 H ALA A 102 40.194 43.730 18.578 1.00 0.00 H ATOM 1540 N ALA A 103 41.322 42.748 22.178 1.00 22.06 N ATOM 1541 CA ALA A 103 42.575 43.074 22.891 1.00 19.25 C ATOM 1542 C ALA A 103 42.733 41.903 23.842 1.00 21.96 C ATOM 1543 O ALA A 103 42.107 41.856 24.907 1.00 21.86 O ATOM 1544 CB ALA A 103 42.462 44.418 23.682 1.00 19.60 C ATOM 1545 HA ALA A 103 43.420 43.212 22.217 1.00 0.00 H ATOM 1546 HB1 ALA A 103 42.242 45.229 22.988 1.00 0.00 H ATOM 1547 HB2 ALA A 103 41.661 44.339 24.417 1.00 0.00 H ATOM 1548 HB3 ALA A 103 43.405 44.619 24.191 1.00 0.00 H ATOM 1549 H ALA A 103 40.519 42.380 22.727 1.00 0.00 H ATOM 1550 N ILE A 104 43.441 40.884 23.386 1.00 18.71 N ATOM 1551 CA ILE A 104 43.613 39.679 24.160 1.00 18.17 C ATOM 1552 C ILE A 104 45.065 39.274 24.208 1.00 21.38 C ATOM 1553 O ILE A 104 45.686 39.125 23.179 1.00 22.66 O ATOM 1554 CB ILE A 104 42.770 38.523 23.575 1.00 21.35 C ATOM 1555 CG1 ILE A 104 41.316 38.955 23.335 1.00 21.13 C ATOM 1556 CG2 ILE A 104 42.913 37.256 24.439 1.00 21.95 C ATOM 1557 CD1 ILE A 104 40.470 37.879 22.661 1.00 22.61 C ATOM 1558 HA ILE A 104 43.271 39.887 25.174 1.00 0.00 H ATOM 1559 HB ILE A 104 43.158 38.263 22.590 1.00 0.00 H ATOM 1560 HG12 ILE A 104 40.864 39.199 24.296 1.00 0.00 H ATOM 1561 HG13 ILE A 104 41.318 39.841 22.701 1.00 0.00 H ATOM 1562 HD11 ILE A 104 40.904 37.632 21.692 1.00 0.00 H ATOM 1563 HD12 ILE A 104 40.449 36.989 23.289 1.00 0.00 H ATOM 1564 HD13 ILE A 104 39.455 38.251 22.522 1.00 0.00 H ATOM 1565 HG21 ILE A 104 43.959 36.952 24.466 1.00 0.00 H ATOM 1566 HG22 ILE A 104 42.569 37.467 25.451 1.00 0.00 H ATOM 1567 HG23 ILE A 104 42.312 36.455 24.009 1.00 0.00 H ATOM 1568 H ILE A 104 43.884 40.953 22.448 1.00 0.00 H ATOM 1569 N GLY A 105 45.549 38.926 25.391 1.00 19.22 N ATOM 1570 CA GLY A 105 46.922 38.496 25.550 1.00 18.16 C ATOM 1571 C GLY A 105 47.094 37.315 26.466 1.00 22.59 C ATOM 1572 O GLY A 105 46.136 36.618 26.854 1.00 20.04 O ATOM 1573 HA3 GLY A 105 47.497 39.329 25.954 1.00 0.00 H ATOM 1574 HA2 GLY A 105 47.313 38.228 24.568 1.00 0.00 H ATOM 1575 H GLY A 105 44.928 38.963 26.225 1.00 0.00 H ATOM 1576 N SER A 106 48.348 37.094 26.807 1.00 18.83 N ATOM 1577 CA SER A 106 48.774 35.980 27.643 1.00 20.04 C ATOM 1578 C SER A 106 50.154 36.398 28.193 1.00 25.85 C ATOM 1579 O SER A 106 50.867 37.184 27.549 1.00 23.67 O ATOM 1580 CB SER A 106 48.943 34.753 26.731 1.00 18.53 C ATOM 1581 OG SER A 106 49.443 33.644 27.438 1.00 25.43 O ATOM 1582 HA SER A 106 48.072 35.745 28.443 1.00 0.00 H ATOM 1583 HB2 SER A 106 49.637 35.002 25.928 1.00 0.00 H ATOM 1584 HB3 SER A 106 47.974 34.493 26.305 1.00 0.00 H ATOM 1585 HG SER A 106 48.815 33.408 28.166 1.00 0.00 H ATOM 1586 H SER A 106 49.074 37.752 26.459 1.00 0.00 H ATOM 1587 N GLY A 107 50.524 35.890 29.367 1.00 21.99 N ATOM 1588 CA GLY A 107 51.809 36.224 29.978 1.00 19.93 C ATOM 1589 C GLY A 107 52.944 35.468 29.334 1.00 26.21 C ATOM 1590 O GLY A 107 53.989 36.052 29.002 1.00 26.12 O ATOM 1591 HA3 GLY A 107 51.773 35.973 31.038 1.00 0.00 H ATOM 1592 HA2 GLY A 107 51.987 37.293 29.865 1.00 0.00 H ATOM 1593 H GLY A 107 49.882 35.239 29.862 1.00 0.00 H ATOM 1594 N ILE A 108 52.726 34.174 29.113 1.00 24.08 N ATOM 1595 CA ILE A 108 53.757 33.283 28.605 1.00 25.37 C ATOM 1596 C ILE A 108 53.403 32.567 27.318 1.00 28.73 C ATOM 1597 O ILE A 108 54.283 32.044 26.628 1.00 29.20 O ATOM 1598 CB ILE A 108 54.217 32.300 29.706 1.00 30.57 C ATOM 1599 CG1 ILE A 108 54.253 33.033 31.058 1.00 33.28 C ATOM 1600 CG2 ILE A 108 55.626 31.751 29.374 1.00 32.89 C ATOM 1601 CD1 ILE A 108 54.927 32.256 32.205 1.00 44.13 C ATOM 1602 HA ILE A 108 54.593 33.926 28.330 1.00 0.00 H ATOM 1603 HB ILE A 108 53.517 31.466 29.759 1.00 0.00 H ATOM 1604 HG12 ILE A 108 54.794 33.969 30.920 1.00 0.00 H ATOM 1605 HG13 ILE A 108 53.226 33.248 31.353 1.00 0.00 H ATOM 1606 HD11 ILE A 108 54.393 31.321 32.371 1.00 0.00 H ATOM 1607 HD12 ILE A 108 55.962 32.042 31.938 1.00 0.00 H ATOM 1608 HD13 ILE A 108 54.901 32.857 33.114 1.00 0.00 H ATOM 1609 HG21 ILE A 108 55.595 31.229 28.418 1.00 0.00 H ATOM 1610 HG22 ILE A 108 56.332 32.579 29.315 1.00 0.00 H ATOM 1611 HG23 ILE A 108 55.939 31.060 30.157 1.00 0.00 H ATOM 1612 H ILE A 108 51.782 33.785 29.311 1.00 0.00 H ATOM 1613 N GLY A 109 52.120 32.484 26.990 1.00 24.43 N ATOM 1614 CA GLY A 109 51.772 31.815 25.743 1.00 23.26 C ATOM 1615 C GLY A 109 51.980 30.326 25.688 1.00 24.53 C ATOM 1616 O GLY A 109 51.869 29.632 26.688 1.00 23.85 O ATOM 1617 HA3 GLY A 109 52.373 32.261 24.951 1.00 0.00 H ATOM 1618 HA2 GLY A 109 50.717 32.008 25.549 1.00 0.00 H ATOM 1619 H GLY A 109 51.384 32.885 27.605 1.00 0.00 H ATOM 1620 N GLY A 110 52.267 29.825 24.492 1.00 21.84 N ATOM 1621 CA GLY A 110 52.269 28.403 24.211 1.00 21.04 C ATOM 1622 C GLY A 110 53.351 27.495 24.724 1.00 26.24 C ATOM 1623 O GLY A 110 53.912 26.748 23.933 1.00 24.70 O ATOM 1624 HA3 GLY A 110 52.277 28.305 23.125 1.00 0.00 H ATOM 1625 HA2 GLY A 110 51.330 28.012 24.603 1.00 0.00 H ATOM 1626 H GLY A 110 52.501 30.483 23.722 1.00 0.00 H ATOM 1627 N LEU A 111 53.537 27.427 26.044 1.00 23.63 N ATOM 1628 CA LEU A 111 54.555 26.530 26.612 1.00 22.72 C ATOM 1629 C LEU A 111 54.470 25.095 26.153 1.00 26.66 C ATOM 1630 O LEU A 111 55.488 24.483 25.829 1.00 25.53 O ATOM 1631 CB LEU A 111 54.583 26.578 28.159 1.00 22.99 C ATOM 1632 CG LEU A 111 55.227 27.853 28.731 1.00 27.13 C ATOM 1633 CD1 LEU A 111 55.094 27.971 30.254 1.00 27.32 C ATOM 1634 CD2 LEU A 111 56.719 28.000 28.253 1.00 26.38 C ATOM 1635 HA LEU A 111 55.490 26.927 26.216 1.00 0.00 H ATOM 1636 HB2 LEU A 111 53.557 26.518 28.523 1.00 0.00 H ATOM 1637 HB3 LEU A 111 55.146 25.717 28.519 1.00 0.00 H ATOM 1638 HG LEU A 111 54.662 28.693 28.326 1.00 0.00 H ATOM 1639 HD21 LEU A 111 57.294 27.138 28.590 1.00 0.00 H ATOM 1640 HD22 LEU A 111 56.747 28.054 27.165 1.00 0.00 H ATOM 1641 HD23 LEU A 111 57.146 28.910 28.674 1.00 0.00 H ATOM 1642 HD11 LEU A 111 54.038 27.986 30.525 1.00 0.00 H ATOM 1643 HD12 LEU A 111 55.580 27.117 30.727 1.00 0.00 H ATOM 1644 HD13 LEU A 111 55.570 28.893 30.589 1.00 0.00 H ATOM 1645 H LEU A 111 52.957 28.014 26.677 1.00 0.00 H ATOM 1646 N GLY A 112 53.268 24.530 26.139 1.00 23.65 N ATOM 1647 CA GLY A 112 53.142 23.109 25.790 1.00 22.22 C ATOM 1648 C GLY A 112 53.654 22.785 24.397 1.00 26.32 C ATOM 1649 O GLY A 112 54.305 21.763 24.171 1.00 24.99 O ATOM 1650 HA3 GLY A 112 52.090 22.831 25.846 1.00 0.00 H ATOM 1651 HA2 GLY A 112 53.710 22.523 26.513 1.00 0.00 H ATOM 1652 H GLY A 112 52.423 25.089 26.373 1.00 0.00 H ATOM 1653 N LEU A 113 53.297 23.617 23.426 1.00 24.20 N ATOM 1654 CA LEU A 113 53.716 23.335 22.057 1.00 23.22 C ATOM 1655 C LEU A 113 55.140 23.811 21.787 1.00 24.44 C ATOM 1656 O LEU A 113 55.794 23.347 20.861 1.00 24.08 O ATOM 1657 CB LEU A 113 52.708 23.877 21.034 1.00 24.02 C ATOM 1658 CG LEU A 113 51.408 23.053 20.950 1.00 28.44 C ATOM 1659 CD1 LEU A 113 50.575 23.549 19.817 1.00 28.46 C ATOM 1660 CD2 LEU A 113 51.676 21.555 20.779 1.00 29.27 C ATOM 1661 HA LEU A 113 53.729 22.252 21.937 1.00 0.00 H ATOM 1662 HB2 LEU A 113 52.451 24.899 21.312 1.00 0.00 H ATOM 1663 HB3 LEU A 113 53.180 23.877 20.052 1.00 0.00 H ATOM 1664 HG LEU A 113 50.877 23.181 21.893 1.00 0.00 H ATOM 1665 HD21 LEU A 113 52.239 21.391 19.860 1.00 0.00 H ATOM 1666 HD22 LEU A 113 52.252 21.191 21.630 1.00 0.00 H ATOM 1667 HD23 LEU A 113 50.727 21.021 20.725 1.00 0.00 H ATOM 1668 HD11 LEU A 113 50.330 24.598 19.980 1.00 0.00 H ATOM 1669 HD12 LEU A 113 51.132 23.445 18.886 1.00 0.00 H ATOM 1670 HD13 LEU A 113 49.657 22.965 19.760 1.00 0.00 H ATOM 1671 H LEU A 113 52.726 24.460 23.639 1.00 0.00 H ATOM 1672 N ILE A 114 55.649 24.716 22.610 1.00 22.63 N ATOM 1673 CA ILE A 114 57.069 25.091 22.470 1.00 22.61 C ATOM 1674 C ILE A 114 57.883 23.868 22.900 1.00 28.11 C ATOM 1675 O ILE A 114 58.889 23.508 22.288 1.00 28.32 O ATOM 1676 CB ILE A 114 57.403 26.283 23.381 1.00 26.05 C ATOM 1677 CG1 ILE A 114 56.804 27.555 22.786 1.00 25.34 C ATOM 1678 CG2 ILE A 114 58.904 26.357 23.624 1.00 27.23 C ATOM 1679 CD1 ILE A 114 56.837 28.768 23.721 1.00 29.44 C ATOM 1680 HA ILE A 114 57.295 25.385 21.445 1.00 0.00 H ATOM 1681 HB ILE A 114 56.953 26.156 24.365 1.00 0.00 H ATOM 1682 HG12 ILE A 114 57.362 27.805 21.883 1.00 0.00 H ATOM 1683 HG13 ILE A 114 55.765 27.353 22.525 1.00 0.00 H ATOM 1684 HD11 ILE A 114 56.272 28.543 24.626 1.00 0.00 H ATOM 1685 HD12 ILE A 114 57.870 28.995 23.983 1.00 0.00 H ATOM 1686 HD13 ILE A 114 56.392 29.626 23.217 1.00 0.00 H ATOM 1687 HG21 ILE A 114 59.239 25.437 24.103 1.00 0.00 H ATOM 1688 HG22 ILE A 114 59.419 26.481 22.671 1.00 0.00 H ATOM 1689 HG23 ILE A 114 59.125 27.206 24.271 1.00 0.00 H ATOM 1690 H ILE A 114 55.057 25.155 23.343 1.00 0.00 H ATOM 1691 N GLU A 115 57.463 23.242 23.993 1.00 23.30 N ATOM 1692 CA GLU A 115 58.166 22.066 24.493 1.00 22.17 C ATOM 1693 C GLU A 115 58.068 20.910 23.511 1.00 26.09 C ATOM 1694 O GLU A 115 59.037 20.200 23.254 1.00 26.92 O ATOM 1695 CB GLU A 115 57.594 21.649 25.863 1.00 22.64 C ATOM 1696 CG GLU A 115 57.887 22.632 26.972 1.00 24.60 C ATOM 1697 CD GLU A 115 57.181 22.260 28.262 1.00 30.11 C ATOM 1698 OE1 GLU A 115 56.959 21.062 28.437 1.00 34.28 O ATOM 1699 OE2 GLU A 115 56.914 23.136 29.118 1.00 28.63 O ATOM 1700 HA GLU A 115 59.219 22.324 24.608 1.00 0.00 H ATOM 1701 HB2 GLU A 115 56.513 21.550 25.768 1.00 0.00 H ATOM 1702 HB3 GLU A 115 58.023 20.685 26.136 1.00 0.00 H ATOM 1703 HG2 GLU A 115 58.962 22.650 27.151 1.00 0.00 H ATOM 1704 HG3 GLU A 115 57.555 23.623 26.662 1.00 0.00 H ATOM 1705 H GLU A 115 56.624 23.594 24.498 1.00 0.00 H ATOM 1706 N GLU A 116 56.889 20.722 22.939 1.00 25.08 N ATOM 1707 CA GLU A 116 56.699 19.648 21.980 1.00 23.56 C ATOM 1708 C GLU A 116 57.616 19.862 20.766 1.00 28.92 C ATOM 1709 O GLU A 116 58.303 18.943 20.316 1.00 26.96 O ATOM 1710 CB GLU A 116 55.231 19.610 21.533 1.00 24.40 C ATOM 1711 CG GLU A 116 54.964 18.501 20.474 1.00 30.85 C ATOM 1712 CD GLU A 116 53.487 18.391 20.136 1.00 34.11 C ATOM 1713 OE1 GLU A 116 52.692 18.090 21.036 1.00 39.90 O ATOM 1714 OE2 GLU A 116 53.096 18.789 19.038 1.00 38.97 O ATOM 1715 HA GLU A 116 56.954 18.697 22.449 1.00 0.00 H ATOM 1716 HB2 GLU A 116 54.604 19.421 22.404 1.00 0.00 H ATOM 1717 HB3 GLU A 116 54.970 20.577 21.102 1.00 0.00 H ATOM 1718 HG2 GLU A 116 55.518 18.739 19.566 1.00 0.00 H ATOM 1719 HG3 GLU A 116 55.309 17.545 20.868 1.00 0.00 H ATOM 1720 H GLU A 116 56.093 21.348 23.178 1.00 0.00 H ATOM 1721 N ASN A 117 57.604 21.073 20.217 1.00 25.53 N ATOM 1722 CA ASN A 117 58.430 21.367 19.051 1.00 26.61 C ATOM 1723 C ASN A 117 59.922 21.298 19.359 1.00 29.88 C ATOM 1724 O ASN A 117 60.705 20.748 18.584 1.00 31.63 O ATOM 1725 CB ASN A 117 58.048 22.727 18.451 1.00 25.56 C ATOM 1726 CG ASN A 117 56.833 22.646 17.604 1.00 34.08 C ATOM 1727 OD1 ASN A 117 56.910 22.191 16.460 1.00 31.48 O ATOM 1728 ND2 ASN A 117 55.665 22.966 18.189 1.00 27.27 N ATOM 1729 HA ASN A 117 58.232 20.592 18.311 1.00 0.00 H ATOM 1730 HB2 ASN A 117 57.863 23.430 19.263 1.00 0.00 H ATOM 1731 HB3 ASN A 117 58.877 23.087 17.842 1.00 0.00 H ATOM 1732 HD22 ASN A 117 55.655 23.347 19.157 1.00 0.00 H ATOM 1733 HD21 ASN A 117 54.772 22.833 17.674 1.00 0.00 H ATOM 1734 H ASN A 117 57.001 21.817 20.622 1.00 0.00 H ATOM 1735 N HIS A 118 60.330 21.828 20.501 1.00 24.84 N ATOM 1736 CA HIS A 118 61.753 21.780 20.829 1.00 23.98 C ATOM 1737 C HIS A 118 62.217 20.342 21.069 1.00 30.29 C ATOM 1738 O HIS A 118 63.326 19.980 20.684 1.00 29.86 O ATOM 1739 CB HIS A 118 62.090 22.656 22.023 1.00 23.83 C ATOM 1740 CG HIS A 118 63.559 22.791 22.248 1.00 26.05 C ATOM 1741 ND1 HIS A 118 64.384 23.456 21.362 1.00 27.50 N ATOM 1742 CD2 HIS A 118 64.367 22.252 23.184 1.00 27.64 C ATOM 1743 CE1 HIS A 118 65.637 23.346 21.761 1.00 26.97 C ATOM 1744 NE2 HIS A 118 65.654 22.600 22.851 1.00 28.12 N ATOM 1745 HA HIS A 118 62.291 22.176 19.968 1.00 0.00 H ATOM 1746 HB2 HIS A 118 61.671 23.648 21.856 1.00 0.00 H ATOM 1747 HB3 HIS A 118 61.640 22.218 22.914 1.00 0.00 H ATOM 1748 HD2 HIS A 118 64.058 21.654 24.041 1.00 0.00 H ATOM 1749 HE1 HIS A 118 66.505 23.792 21.276 1.00 0.00 H ATOM 1750 H HIS A 118 59.651 22.270 21.153 1.00 0.00 H ATOM 1751 N THR A 119 61.368 19.527 21.695 1.00 25.24 N ATOM 1752 CA THR A 119 61.669 18.099 21.911 1.00 24.60 C ATOM 1753 C THR A 119 61.883 17.418 20.549 1.00 31.02 C ATOM 1754 O THR A 119 62.822 16.646 20.356 1.00 31.87 O ATOM 1755 CB THR A 119 60.543 17.398 22.746 1.00 28.26 C ATOM 1756 OG1 THR A 119 60.551 17.924 24.086 1.00 29.53 O ATOM 1757 CG2 THR A 119 60.779 15.869 22.824 1.00 27.43 C ATOM 1758 HA THR A 119 62.585 18.008 22.495 1.00 0.00 H ATOM 1759 HB THR A 119 59.588 17.588 22.257 1.00 0.00 H ATOM 1760 HG1 THR A 119 59.841 17.483 24.617 1.00 0.00 H ATOM 1761 HG23 THR A 119 60.777 15.450 21.818 1.00 0.00 H ATOM 1762 HG21 THR A 119 61.742 15.675 23.297 1.00 0.00 H ATOM 1763 HG22 THR A 119 59.984 15.410 23.412 1.00 0.00 H ATOM 1764 H THR A 119 60.465 19.910 22.042 1.00 0.00 H ATOM 1765 N SER A 120 61.022 17.748 19.605 1.00 27.64 N ATOM 1766 CA SER A 120 61.060 17.205 18.250 1.00 27.59 C ATOM 1767 C SER A 120 62.377 17.608 17.554 1.00 35.50 C ATOM 1768 O SER A 120 63.046 16.786 16.913 1.00 35.31 O ATOM 1769 CB SER A 120 59.873 17.762 17.462 1.00 29.24 C ATOM 1770 OG SER A 120 58.675 17.040 17.719 1.00 35.94 O ATOM 1771 HA SER A 120 61.004 16.117 18.292 1.00 0.00 H ATOM 1772 HB2 SER A 120 60.098 17.702 16.397 1.00 0.00 H ATOM 1773 HB3 SER A 120 59.723 18.805 17.742 1.00 0.00 H ATOM 1774 HG SER A 120 57.935 17.432 17.191 1.00 0.00 H ATOM 1775 H SER A 120 60.275 18.433 19.839 1.00 0.00 H ATOM 1776 N LEU A 121 62.737 18.885 17.680 1.00 31.03 N ATOM 1777 CA LEU A 121 63.957 19.406 17.079 1.00 30.20 C ATOM 1778 C LEU A 121 65.162 18.698 17.667 1.00 35.49 C ATOM 1779 O LEU A 121 66.052 18.271 16.940 1.00 33.74 O ATOM 1780 CB LEU A 121 64.073 20.930 17.292 1.00 29.89 C ATOM 1781 CG LEU A 121 65.449 21.567 17.098 1.00 33.17 C ATOM 1782 CD1 LEU A 121 65.789 21.514 15.600 1.00 30.43 C ATOM 1783 CD2 LEU A 121 65.375 23.027 17.569 1.00 34.76 C ATOM 1784 HA LEU A 121 63.920 19.220 16.006 1.00 0.00 H ATOM 1785 HB2 LEU A 121 63.389 21.411 16.593 1.00 0.00 H ATOM 1786 HB3 LEU A 121 63.756 21.142 18.313 1.00 0.00 H ATOM 1787 HG LEU A 121 66.215 21.041 17.668 1.00 0.00 H ATOM 1788 HD21 LEU A 121 64.629 23.560 16.980 1.00 0.00 H ATOM 1789 HD22 LEU A 121 65.095 23.054 18.622 1.00 0.00 H ATOM 1790 HD23 LEU A 121 66.349 23.499 17.438 1.00 0.00 H ATOM 1791 HD11 LEU A 121 65.804 20.476 15.269 1.00 0.00 H ATOM 1792 HD12 LEU A 121 65.035 22.065 15.038 1.00 0.00 H ATOM 1793 HD13 LEU A 121 66.768 21.963 15.435 1.00 0.00 H ATOM 1794 H LEU A 121 62.128 19.529 18.224 1.00 0.00 H ATOM 1795 N MET A 122 65.196 18.565 18.985 1.00 33.63 N ATOM 1796 CA MET A 122 66.321 17.907 19.618 1.00 36.48 C ATOM 1797 C MET A 122 66.424 16.434 19.171 1.00 42.81 C ATOM 1798 O MET A 122 67.515 15.910 18.981 1.00 42.57 O ATOM 1799 CB MET A 122 66.153 17.914 21.123 1.00 40.18 C ATOM 1800 CG MET A 122 66.274 19.245 21.813 1.00 46.38 C ATOM 1801 SD MET A 122 66.393 18.826 23.578 1.00 55.11 S ATOM 1802 CE MET A 122 66.343 20.390 24.309 1.00 53.01 C ATOM 1803 HA MET A 122 67.220 18.450 19.325 1.00 0.00 H ATOM 1804 HB2 MET A 122 65.163 17.515 21.346 1.00 0.00 H ATOM 1805 HB3 MET A 122 66.912 17.254 21.543 1.00 0.00 H ATOM 1806 HG2 MET A 122 65.396 19.862 21.620 1.00 0.00 H ATOM 1807 HG3 MET A 122 67.167 19.773 21.480 1.00 0.00 H ATOM 1808 HE1 MET A 122 67.183 20.985 23.950 1.00 0.00 H ATOM 1809 HE2 MET A 122 65.408 20.883 24.045 1.00 0.00 H ATOM 1810 HE3 MET A 122 66.407 20.286 25.392 1.00 0.00 H ATOM 1811 H MET A 122 64.415 18.933 19.565 1.00 0.00 H ATOM 1812 N ASN A 123 65.280 15.768 19.052 1.00 38.03 N ATOM 1813 CA ASN A 123 65.241 14.350 18.704 1.00 39.05 C ATOM 1814 C ASN A 123 65.527 14.048 17.249 1.00 45.07 C ATOM 1815 O ASN A 123 66.239 13.090 16.968 1.00 46.27 O ATOM 1816 CB ASN A 123 63.884 13.730 19.068 1.00 39.19 C ATOM 1817 CG ASN A 123 63.728 13.480 20.559 1.00 54.40 C ATOM 1818 OD1 ASN A 123 62.611 13.358 21.063 1.00 62.28 O ATOM 1819 ND2 ASN A 123 64.842 13.404 21.267 1.00 39.05 N ATOM 1820 HA ASN A 123 66.046 13.907 19.290 1.00 0.00 H ATOM 1821 HB2 ASN A 123 63.094 14.407 18.744 1.00 0.00 H ATOM 1822 HB3 ASN A 123 63.784 12.780 18.543 1.00 0.00 H ATOM 1823 HD22 ASN A 123 65.764 13.513 20.799 1.00 0.00 H ATOM 1824 HD21 ASN A 123 64.796 13.235 22.292 1.00 0.00 H ATOM 1825 H ASN A 123 64.385 16.272 19.212 1.00 0.00 H ATOM 1826 N GLY A 124 64.909 14.794 16.329 1.00 41.38 N ATOM 1827 CA GLY A 124 65.061 14.544 14.897 1.00 40.73 C ATOM 1828 C GLY A 124 65.450 15.694 13.980 1.00 41.55 C ATOM 1829 O GLY A 124 65.288 15.610 12.757 1.00 39.89 O ATOM 1830 HA3 GLY A 124 64.107 14.159 14.538 1.00 0.00 H ATOM 1831 HA2 GLY A 124 65.826 13.776 14.787 1.00 0.00 H ATOM 1832 H GLY A 124 64.301 15.577 16.642 1.00 0.00 H ATOM 1833 N GLY A 125 65.933 16.790 14.554 1.00 36.29 N ATOM 1834 CA GLY A 125 66.330 17.930 13.750 1.00 35.20 C ATOM 1835 C GLY A 125 65.190 18.819 13.306 1.00 37.71 C ATOM 1836 O GLY A 125 64.003 18.523 13.523 1.00 36.17 O ATOM 1837 HA3 GLY A 125 66.837 17.558 12.860 1.00 0.00 H ATOM 1838 HA2 GLY A 125 67.023 18.534 14.336 1.00 0.00 H ATOM 1839 H GLY A 125 66.027 16.831 15.589 1.00 0.00 H ATOM 1840 N PRO A 126 65.534 19.939 12.660 1.00 34.49 N ATOM 1841 CA PRO A 126 64.515 20.924 12.275 1.00 33.86 C ATOM 1842 C PRO A 126 63.424 20.385 11.372 1.00 37.52 C ATOM 1843 O PRO A 126 62.351 21.000 11.247 1.00 35.61 O ATOM 1844 CB PRO A 126 65.327 22.031 11.591 1.00 35.24 C ATOM 1845 CG PRO A 126 66.598 21.375 11.188 1.00 39.10 C ATOM 1846 CD PRO A 126 66.882 20.330 12.215 1.00 34.49 C ATOM 1847 HA PRO A 126 63.953 21.264 13.145 1.00 0.00 H ATOM 1848 HD3 PRO A 126 67.413 19.484 11.779 1.00 0.00 H ATOM 1849 HD2 PRO A 126 67.466 20.738 13.040 1.00 0.00 H ATOM 1850 HG3 PRO A 126 67.407 22.105 11.161 1.00 0.00 H ATOM 1851 HG2 PRO A 126 66.490 20.917 10.205 1.00 0.00 H ATOM 1852 HB2 PRO A 126 64.798 22.412 10.718 1.00 0.00 H ATOM 1853 HB3 PRO A 126 65.520 22.850 12.284 1.00 0.00 H ATOM 1854 N ARG A 127 63.702 19.249 10.728 1.00 34.63 N ATOM 1855 CA ARG A 127 62.738 18.591 9.841 1.00 34.89 C ATOM 1856 C ARG A 127 61.479 18.225 10.621 1.00 34.89 C ATOM 1857 O ARG A 127 60.412 18.044 10.049 1.00 35.27 O ATOM 1858 CB ARG A 127 63.330 17.257 9.334 1.00 40.03 C ATOM 1859 CG ARG A 127 63.860 17.292 7.927 1.00 66.13 C ATOM 1860 CD ARG A 127 63.033 18.214 7.017 1.00 91.43 C ATOM 1861 NE ARG A 127 63.703 18.420 5.733 1.00104.37 N ATOM 1862 CZ ARG A 127 63.921 17.457 4.840 1.00118.03 C ATOM 1863 NH1 ARG A 127 63.497 16.219 5.071 1.00105.29 N ATOM 1864 NH2 ARG A 127 64.554 17.734 3.709 1.00103.33 N ATOM 1865 HA ARG A 127 62.514 19.272 9.020 1.00 0.00 H ATOM 1866 HB2 ARG A 127 64.148 16.976 9.997 1.00 0.00 H ATOM 1867 HB3 ARG A 127 62.548 16.499 9.382 1.00 0.00 H ATOM 1868 HG2 ARG A 127 64.889 17.651 7.948 1.00 0.00 H ATOM 1869 HG3 ARG A 127 63.837 16.282 7.518 1.00 0.00 H ATOM 1870 HD2 ARG A 127 62.902 19.177 7.510 1.00 0.00 H ATOM 1871 HD3 ARG A 127 62.057 17.761 6.842 1.00 0.00 H ATOM 1872 HE ARG A 127 64.030 19.380 5.503 1.00 0.00 H ATOM 1873 HH12 ARG A 127 63.670 15.471 4.370 1.00 0.00 H ATOM 1874 HH11 ARG A 127 62.992 15.998 5.953 1.00 0.00 H ATOM 1875 HH22 ARG A 127 64.725 16.982 3.011 1.00 0.00 H ATOM 1876 HH21 ARG A 127 64.880 18.703 3.520 1.00 0.00 H ATOM 1877 H ARG A 127 64.638 18.815 10.861 1.00 0.00 H ATOM 1878 N LYS A 128 61.648 17.997 11.908 1.00 29.15 N ATOM 1879 CA LYS A 128 60.544 17.556 12.766 1.00 29.58 C ATOM 1880 C LYS A 128 59.766 18.716 13.418 1.00 35.03 C ATOM 1881 O LYS A 128 58.784 18.505 14.121 1.00 33.56 O ATOM 1882 CB LYS A 128 61.076 16.607 13.845 1.00 31.07 C ATOM 1883 CG LYS A 128 61.537 15.258 13.310 1.00 41.43 C ATOM 1884 CD LYS A 128 60.522 14.721 12.326 1.00 43.73 C ATOM 1885 CE LYS A 128 60.092 13.303 12.651 1.00 54.96 C ATOM 1886 NZ LYS A 128 58.949 12.889 11.780 1.00 70.19 N ATOM 1887 HA LYS A 128 59.834 17.039 12.120 1.00 0.00 H ATOM 1888 HB2 LYS A 128 61.921 17.087 14.338 1.00 0.00 H ATOM 1889 HB3 LYS A 128 60.282 16.435 14.572 1.00 0.00 H ATOM 1890 HG2 LYS A 128 62.498 15.376 12.810 1.00 0.00 H ATOM 1891 HG3 LYS A 128 61.644 14.558 14.138 1.00 0.00 H ATOM 1892 HD2 LYS A 128 59.643 15.366 12.343 1.00 0.00 H ATOM 1893 HD3 LYS A 128 60.961 14.734 11.328 1.00 0.00 H ATOM 1894 HE2 LYS A 128 59.784 13.252 13.695 1.00 0.00 H ATOM 1895 HE3 LYS A 128 60.931 12.627 12.487 1.00 0.00 H ATOM 1896 HZ1 LYS A 128 58.145 13.530 11.937 1.00 0.00 H ATOM 1897 HZ2 LYS A 128 59.241 12.934 10.783 1.00 0.00 H ATOM 1898 HZ3 LYS A 128 58.669 11.916 12.017 1.00 0.00 H ATOM 1899 H LYS A 128 62.590 18.134 12.326 1.00 0.00 H ATOM 1900 N ILE A 129 60.168 19.953 13.150 1.00 30.61 N ATOM 1901 CA ILE A 129 59.407 21.059 13.691 1.00 29.00 C ATOM 1902 C ILE A 129 58.090 21.143 12.924 1.00 31.38 C ATOM 1903 O ILE A 129 58.069 21.063 11.700 1.00 30.23 O ATOM 1904 CB ILE A 129 60.165 22.396 13.576 1.00 31.48 C ATOM 1905 CG1 ILE A 129 61.478 22.346 14.366 1.00 32.45 C ATOM 1906 CG2 ILE A 129 59.252 23.524 14.018 1.00 29.64 C ATOM 1907 CD1 ILE A 129 62.393 23.582 14.116 1.00 28.85 C ATOM 1908 HA ILE A 129 59.234 20.882 14.753 1.00 0.00 H ATOM 1909 HB ILE A 129 60.444 22.580 12.539 1.00 0.00 H ATOM 1910 HG12 ILE A 129 61.241 22.299 15.429 1.00 0.00 H ATOM 1911 HG13 ILE A 129 62.023 21.447 14.076 1.00 0.00 H ATOM 1912 HD11 ILE A 129 62.647 23.636 13.057 1.00 0.00 H ATOM 1913 HD12 ILE A 129 61.865 24.489 14.411 1.00 0.00 H ATOM 1914 HD13 ILE A 129 63.305 23.483 14.705 1.00 0.00 H ATOM 1915 HG21 ILE A 129 58.369 23.546 13.379 1.00 0.00 H ATOM 1916 HG22 ILE A 129 58.950 23.361 15.053 1.00 0.00 H ATOM 1917 HG23 ILE A 129 59.784 24.472 13.939 1.00 0.00 H ATOM 1918 H ILE A 129 61.011 20.123 12.565 1.00 0.00 H ATOM 1919 N SER A 130 56.997 21.377 13.642 1.00 26.92 N ATOM 1920 CA SER A 130 55.674 21.500 13.028 1.00 25.39 C ATOM 1921 C SER A 130 55.519 22.787 12.227 1.00 29.54 C ATOM 1922 O SER A 130 55.941 23.843 12.663 1.00 28.36 O ATOM 1923 CB SER A 130 54.602 21.496 14.132 1.00 24.73 C ATOM 1924 OG SER A 130 53.368 21.913 13.590 1.00 31.81 O ATOM 1925 HA SER A 130 55.557 20.656 12.348 1.00 0.00 H ATOM 1926 HB2 SER A 130 54.898 22.178 14.929 1.00 0.00 H ATOM 1927 HB3 SER A 130 54.500 20.489 14.536 1.00 0.00 H ATOM 1928 HG SER A 130 52.679 21.910 14.301 1.00 0.00 H ATOM 1929 H SER A 130 57.084 21.476 14.674 1.00 0.00 H ATOM 1930 N PRO A 131 54.818 22.726 11.083 1.00 27.24 N ATOM 1931 CA PRO A 131 54.626 23.957 10.318 1.00 26.16 C ATOM 1932 C PRO A 131 53.876 24.958 11.157 1.00 28.76 C ATOM 1933 O PRO A 131 53.870 26.129 10.847 1.00 26.06 O ATOM 1934 CB PRO A 131 53.683 23.510 9.193 1.00 28.13 C ATOM 1935 CG PRO A 131 54.024 22.093 8.962 1.00 32.30 C ATOM 1936 CD PRO A 131 54.457 21.529 10.297 1.00 29.03 C ATOM 1937 HA PRO A 131 55.563 24.405 9.986 1.00 0.00 H ATOM 1938 HD3 PRO A 131 53.641 20.983 10.772 1.00 0.00 H ATOM 1939 HD2 PRO A 131 55.315 20.867 10.180 1.00 0.00 H ATOM 1940 HG3 PRO A 131 54.836 22.014 8.239 1.00 0.00 H ATOM 1941 HG2 PRO A 131 53.154 21.552 8.589 1.00 0.00 H ATOM 1942 HB2 PRO A 131 52.642 23.610 9.500 1.00 0.00 H ATOM 1943 HB3 PRO A 131 53.853 24.099 8.292 1.00 0.00 H ATOM 1944 N PHE A 132 53.131 24.468 12.147 1.00 27.21 N ATOM 1945 CA PHE A 132 52.322 25.352 13.006 1.00 26.75 C ATOM 1946 C PHE A 132 53.057 25.910 14.208 1.00 28.21 C ATOM 1947 O PHE A 132 52.449 26.564 15.043 1.00 29.26 O ATOM 1948 CB PHE A 132 51.056 24.638 13.466 1.00 29.96 C ATOM 1949 CG PHE A 132 50.196 24.185 12.329 1.00 34.31 C ATOM 1950 CD1 PHE A 132 49.761 25.099 11.377 1.00 38.68 C ATOM 1951 CD2 PHE A 132 49.927 22.836 12.144 1.00 38.28 C ATOM 1952 CE1 PHE A 132 49.024 24.690 10.275 1.00 40.42 C ATOM 1953 CE2 PHE A 132 49.174 22.416 11.049 1.00 41.60 C ATOM 1954 CZ PHE A 132 48.735 23.348 10.111 1.00 39.47 C ATOM 1955 HA PHE A 132 52.073 26.208 12.379 1.00 0.00 H ATOM 1956 HB2 PHE A 132 51.342 23.766 14.054 1.00 0.00 H ATOM 1957 HB3 PHE A 132 50.478 25.321 14.089 1.00 0.00 H ATOM 1958 HD2 PHE A 132 50.306 22.103 12.857 1.00 0.00 H ATOM 1959 HE2 PHE A 132 48.929 21.361 10.927 1.00 0.00 H ATOM 1960 HZ PHE A 132 48.162 23.018 9.245 1.00 0.00 H ATOM 1961 HE1 PHE A 132 48.676 25.420 9.545 1.00 0.00 H ATOM 1962 HD1 PHE A 132 50.003 26.155 11.498 1.00 0.00 H ATOM 1963 H PHE A 132 53.120 23.442 12.317 1.00 0.00 H ATOM 1964 N PHE A 133 54.350 25.634 14.325 1.00 24.69 N ATOM 1965 CA PHE A 133 55.085 26.079 15.500 1.00 24.29 C ATOM 1966 C PHE A 133 54.782 27.522 15.907 1.00 29.74 C ATOM 1967 O PHE A 133 54.182 27.771 16.953 1.00 30.40 O ATOM 1968 CB PHE A 133 56.583 25.811 15.382 1.00 25.89 C ATOM 1969 CG PHE A 133 57.392 26.447 16.486 1.00 26.53 C ATOM 1970 CD1 PHE A 133 57.115 26.162 17.817 1.00 27.67 C ATOM 1971 CD2 PHE A 133 58.320 27.438 16.198 1.00 29.13 C ATOM 1972 CE1 PHE A 133 57.826 26.779 18.825 1.00 29.06 C ATOM 1973 CE2 PHE A 133 58.978 28.111 17.209 1.00 32.19 C ATOM 1974 CZ PHE A 133 58.767 27.744 18.527 1.00 29.05 C ATOM 1975 HA PHE A 133 54.715 25.465 16.321 1.00 0.00 H ATOM 1976 HB2 PHE A 133 56.745 24.734 15.410 1.00 0.00 H ATOM 1977 HB3 PHE A 133 56.931 26.205 14.427 1.00 0.00 H ATOM 1978 HD2 PHE A 133 58.533 27.689 15.159 1.00 0.00 H ATOM 1979 HE2 PHE A 133 59.660 28.927 16.970 1.00 0.00 H ATOM 1980 HZ PHE A 133 59.341 28.215 19.325 1.00 0.00 H ATOM 1981 HE1 PHE A 133 57.644 26.503 19.864 1.00 0.00 H ATOM 1982 HD1 PHE A 133 56.331 25.447 18.066 1.00 0.00 H ATOM 1983 H PHE A 133 54.838 25.100 13.578 1.00 0.00 H ATOM 1984 N VAL A 134 55.100 28.472 15.035 1.00 23.45 N ATOM 1985 CA VAL A 134 54.874 29.871 15.356 1.00 21.91 C ATOM 1986 C VAL A 134 53.432 30.268 15.614 1.00 25.70 C ATOM 1987 O VAL A 134 53.114 30.761 16.667 1.00 25.70 O ATOM 1988 CB VAL A 134 55.533 30.787 14.309 1.00 24.51 C ATOM 1989 CG1 VAL A 134 55.328 32.271 14.724 1.00 24.29 C ATOM 1990 CG2 VAL A 134 56.993 30.422 14.196 1.00 22.71 C ATOM 1991 HA VAL A 134 55.358 30.011 16.322 1.00 0.00 H ATOM 1992 HB VAL A 134 55.075 30.655 13.329 1.00 0.00 H ATOM 1993 HG11 VAL A 134 54.261 32.487 14.780 1.00 0.00 H ATOM 1994 HG12 VAL A 134 55.786 32.441 15.699 1.00 0.00 H ATOM 1995 HG13 VAL A 134 55.794 32.922 13.984 1.00 0.00 H ATOM 1996 HG21 VAL A 134 57.476 30.558 15.164 1.00 0.00 H ATOM 1997 HG22 VAL A 134 57.083 29.381 13.886 1.00 0.00 H ATOM 1998 HG23 VAL A 134 57.471 31.065 13.457 1.00 0.00 H ATOM 1999 H VAL A 134 55.513 28.213 14.117 1.00 0.00 H ATOM 2000 N PRO A 135 52.526 30.035 14.646 1.00 21.93 N ATOM 2001 CA PRO A 135 51.154 30.471 14.945 1.00 20.82 C ATOM 2002 C PRO A 135 50.420 29.676 16.042 1.00 24.96 C ATOM 2003 O PRO A 135 49.304 30.021 16.456 1.00 24.84 O ATOM 2004 CB PRO A 135 50.425 30.305 13.603 1.00 22.15 C ATOM 2005 CG PRO A 135 51.205 29.208 12.906 1.00 26.02 C ATOM 2006 CD PRO A 135 52.645 29.482 13.286 1.00 21.92 C ATOM 2007 HA PRO A 135 51.174 31.484 15.347 1.00 0.00 H ATOM 2008 HD3 PRO A 135 53.233 28.564 13.285 1.00 0.00 H ATOM 2009 HD2 PRO A 135 53.100 30.203 12.607 1.00 0.00 H ATOM 2010 HG3 PRO A 135 51.072 29.264 11.826 1.00 0.00 H ATOM 2011 HG2 PRO A 135 50.891 28.225 13.259 1.00 0.00 H ATOM 2012 HB2 PRO A 135 49.388 30.007 13.757 1.00 0.00 H ATOM 2013 HB3 PRO A 135 50.454 31.230 13.027 1.00 0.00 H ATOM 2014 N SER A 136 51.019 28.593 16.486 1.00 22.16 N ATOM 2015 CA SER A 136 50.360 27.794 17.531 1.00 20.75 C ATOM 2016 C SER A 136 50.800 28.199 18.942 1.00 24.97 C ATOM 2017 O SER A 136 50.221 27.715 19.948 1.00 20.00 O ATOM 2018 CB SER A 136 50.669 26.314 17.313 1.00 21.32 C ATOM 2019 OG SER A 136 51.979 26.017 17.785 1.00 25.99 O ATOM 2020 HA SER A 136 49.289 27.979 17.454 1.00 0.00 H ATOM 2021 HB2 SER A 136 50.607 26.085 16.249 1.00 0.00 H ATOM 2022 HB3 SER A 136 49.943 25.709 17.856 1.00 0.00 H ATOM 2023 HG SER A 136 52.639 26.565 17.290 1.00 0.00 H ATOM 2024 H SER A 136 51.943 28.306 16.105 1.00 0.00 H ATOM 2025 N THR A 137 51.855 29.033 19.033 1.00 22.50 N ATOM 2026 CA THR A 137 52.433 29.386 20.341 1.00 20.40 C ATOM 2027 C THR A 137 52.401 30.863 20.697 1.00 25.09 C ATOM 2028 O THR A 137 52.407 31.215 21.880 1.00 22.81 O ATOM 2029 CB THR A 137 53.902 28.889 20.442 1.00 26.78 C ATOM 2030 OG1 THR A 137 54.654 29.465 19.362 1.00 23.23 O ATOM 2031 CG2 THR A 137 53.995 27.363 20.322 1.00 20.63 C ATOM 2032 HA THR A 137 51.785 28.883 21.059 1.00 0.00 H ATOM 2033 HB THR A 137 54.294 29.187 21.414 1.00 0.00 H ATOM 2034 HG1 THR A 137 54.260 29.182 18.499 1.00 0.00 H ATOM 2035 HG23 THR A 137 53.431 26.901 21.132 1.00 0.00 H ATOM 2036 HG21 THR A 137 53.580 27.049 19.364 1.00 0.00 H ATOM 2037 HG22 THR A 137 55.040 27.058 20.385 1.00 0.00 H ATOM 2038 H THR A 137 52.267 29.433 18.166 1.00 0.00 H ATOM 2039 N ILE A 138 52.502 31.739 19.695 1.00 20.89 N ATOM 2040 CA ILE A 138 52.607 33.177 19.992 1.00 19.86 C ATOM 2041 C ILE A 138 51.409 33.815 20.654 1.00 23.15 C ATOM 2042 O ILE A 138 50.277 33.464 20.375 1.00 21.56 O ATOM 2043 CB ILE A 138 53.219 34.040 18.845 1.00 23.73 C ATOM 2044 CG1 ILE A 138 52.269 34.058 17.636 1.00 23.96 C ATOM 2045 CG2 ILE A 138 54.627 33.509 18.451 1.00 25.24 C ATOM 2046 CD1 ILE A 138 52.798 34.957 16.437 1.00 25.65 C ATOM 2047 HA ILE A 138 53.357 33.179 20.783 1.00 0.00 H ATOM 2048 HB ILE A 138 53.341 35.064 19.198 1.00 0.00 H ATOM 2049 HG12 ILE A 138 52.147 33.037 17.276 1.00 0.00 H ATOM 2050 HG13 ILE A 138 51.303 34.446 17.960 1.00 0.00 H ATOM 2051 HD11 ILE A 138 52.915 35.985 16.780 1.00 0.00 H ATOM 2052 HD12 ILE A 138 53.760 34.575 16.095 1.00 0.00 H ATOM 2053 HD13 ILE A 138 52.081 34.925 15.617 1.00 0.00 H ATOM 2054 HG21 ILE A 138 55.286 33.554 19.318 1.00 0.00 H ATOM 2055 HG22 ILE A 138 54.542 32.477 18.110 1.00 0.00 H ATOM 2056 HG23 ILE A 138 55.035 34.125 17.650 1.00 0.00 H ATOM 2057 H ILE A 138 52.506 31.407 18.709 1.00 0.00 H ATOM 2058 N VAL A 139 51.679 34.824 21.480 1.00 19.89 N ATOM 2059 CA VAL A 139 50.670 35.406 22.364 1.00 20.87 C ATOM 2060 C VAL A 139 49.434 35.972 21.703 1.00 24.06 C ATOM 2061 O VAL A 139 48.349 36.021 22.317 1.00 24.01 O ATOM 2062 CB VAL A 139 51.312 36.499 23.289 1.00 26.59 C ATOM 2063 CG1 VAL A 139 50.225 37.353 23.874 1.00 28.31 C ATOM 2064 CG2 VAL A 139 52.145 35.841 24.409 1.00 25.75 C ATOM 2065 HA VAL A 139 50.313 34.551 22.938 1.00 0.00 H ATOM 2066 HB VAL A 139 51.981 37.123 22.696 1.00 0.00 H ATOM 2067 HG11 VAL A 139 49.670 37.835 23.069 1.00 0.00 H ATOM 2068 HG12 VAL A 139 49.550 36.729 24.459 1.00 0.00 H ATOM 2069 HG13 VAL A 139 50.668 38.113 24.517 1.00 0.00 H ATOM 2070 HG21 VAL A 139 51.500 35.202 25.012 1.00 0.00 H ATOM 2071 HG22 VAL A 139 52.940 35.242 23.965 1.00 0.00 H ATOM 2072 HG23 VAL A 139 52.581 36.616 25.039 1.00 0.00 H ATOM 2073 H VAL A 139 52.644 35.213 21.497 1.00 0.00 H ATOM 2074 N ASN A 140 49.599 36.521 20.508 1.00 20.63 N ATOM 2075 CA ASN A 140 48.478 37.228 19.869 1.00 20.17 C ATOM 2076 C ASN A 140 47.504 36.327 19.108 1.00 23.07 C ATOM 2077 O ASN A 140 46.580 36.820 18.459 1.00 22.83 O ATOM 2078 CB ASN A 140 49.022 38.336 18.925 1.00 19.50 C ATOM 2079 CG ASN A 140 49.880 37.778 17.786 1.00 32.67 C ATOM 2080 OD1 ASN A 140 50.890 37.144 18.030 1.00 22.48 O ATOM 2081 ND2 ASN A 140 49.510 38.080 16.537 1.00 23.85 N ATOM 2082 HA ASN A 140 47.900 37.662 20.685 1.00 0.00 H ATOM 2083 HB2 ASN A 140 48.177 38.872 18.494 1.00 0.00 H ATOM 2084 HB3 ASN A 140 49.628 39.027 19.511 1.00 0.00 H ATOM 2085 HD22 ASN A 140 48.639 38.624 16.370 1.00 0.00 H ATOM 2086 HD21 ASN A 140 50.093 37.771 15.733 1.00 0.00 H ATOM 2087 H ASN A 140 50.517 36.452 20.024 1.00 0.00 H ATOM 2088 N MET A 141 47.720 35.019 19.163 1.00 22.13 N ATOM 2089 CA MET A 141 46.927 34.083 18.344 1.00 22.06 C ATOM 2090 C MET A 141 45.461 33.901 18.806 1.00 27.50 C ATOM 2091 O MET A 141 44.626 33.438 18.024 1.00 28.11 O ATOM 2092 CB MET A 141 47.626 32.742 18.231 1.00 24.47 C ATOM 2093 CG MET A 141 48.983 32.796 17.539 1.00 30.22 C ATOM 2094 SD MET A 141 48.745 33.567 15.935 1.00 37.64 S ATOM 2095 CE MET A 141 49.742 32.787 15.179 1.00 35.59 C ATOM 2096 HA MET A 141 46.862 34.547 17.360 1.00 0.00 H ATOM 2097 HB2 MET A 141 47.771 32.347 19.236 1.00 0.00 H ATOM 2098 HB3 MET A 141 46.982 32.068 17.667 1.00 0.00 H ATOM 2099 HG2 MET A 141 49.376 31.787 17.412 1.00 0.00 H ATOM 2100 HG3 MET A 141 49.681 33.384 18.135 1.00 0.00 H ATOM 2101 HE1 MET A 141 50.728 32.938 15.618 1.00 0.00 H ATOM 2102 HE2 MET A 141 49.482 31.729 15.222 1.00 0.00 H ATOM 2103 HE3 MET A 141 49.750 33.119 14.141 1.00 0.00 H ATOM 2104 H MET A 141 48.460 34.648 19.793 1.00 0.00 H ATOM 2105 N VAL A 142 45.160 34.192 20.070 1.00 23.13 N ATOM 2106 CA VAL A 142 43.767 34.118 20.526 1.00 22.25 C ATOM 2107 C VAL A 142 42.982 35.216 19.817 1.00 25.48 C ATOM 2108 O VAL A 142 41.921 34.959 19.269 1.00 25.15 O ATOM 2109 CB VAL A 142 43.564 34.256 22.050 1.00 24.63 C ATOM 2110 CG1 VAL A 142 42.066 34.167 22.332 1.00 23.77 C ATOM 2111 CG2 VAL A 142 44.329 33.179 22.817 1.00 24.70 C ATOM 2112 HA VAL A 142 43.414 33.116 20.280 1.00 0.00 H ATOM 2113 HB VAL A 142 43.956 35.215 22.388 1.00 0.00 H ATOM 2114 HG11 VAL A 142 41.550 34.971 21.807 1.00 0.00 H ATOM 2115 HG12 VAL A 142 41.689 33.205 21.985 1.00 0.00 H ATOM 2116 HG13 VAL A 142 41.893 34.262 23.404 1.00 0.00 H ATOM 2117 HG21 VAL A 142 43.975 32.195 22.509 1.00 0.00 H ATOM 2118 HG22 VAL A 142 45.394 33.268 22.601 1.00 0.00 H ATOM 2119 HG23 VAL A 142 44.162 33.308 23.886 1.00 0.00 H ATOM 2120 H VAL A 142 45.911 34.471 20.733 1.00 0.00 H ATOM 2121 N ALA A 143 43.483 36.450 19.867 1.00 23.09 N ATOM 2122 CA ALA A 143 42.850 37.556 19.148 1.00 21.64 C ATOM 2123 C ALA A 143 42.718 37.212 17.645 1.00 26.35 C ATOM 2124 O ALA A 143 41.729 37.551 17.007 1.00 27.56 O ATOM 2125 CB ALA A 143 43.627 38.902 19.331 1.00 20.70 C ATOM 2126 HA ALA A 143 41.857 37.695 19.575 1.00 0.00 H ATOM 2127 HB1 ALA A 143 43.660 39.160 20.389 1.00 0.00 H ATOM 2128 HB2 ALA A 143 44.643 38.788 18.952 1.00 0.00 H ATOM 2129 HB3 ALA A 143 43.118 39.692 18.779 1.00 0.00 H ATOM 2130 H ALA A 143 44.340 36.630 20.428 1.00 0.00 H ATOM 2131 N GLY A 144 43.747 36.622 17.070 1.00 22.30 N ATOM 2132 CA GLY A 144 43.747 36.303 15.646 1.00 22.87 C ATOM 2133 C GLY A 144 42.653 35.292 15.298 1.00 26.48 C ATOM 2134 O GLY A 144 41.863 35.521 14.381 1.00 24.62 O ATOM 2135 HA3 GLY A 144 44.716 35.883 15.377 1.00 0.00 H ATOM 2136 HA2 GLY A 144 43.578 37.218 15.078 1.00 0.00 H ATOM 2137 H GLY A 144 44.579 36.378 17.645 1.00 0.00 H ATOM 2138 N HIS A 145 42.564 34.204 16.045 1.00 22.79 N ATOM 2139 CA HIS A 145 41.519 33.198 15.731 1.00 22.46 C ATOM 2140 C HIS A 145 40.125 33.756 15.939 1.00 26.13 C ATOM 2141 O HIS A 145 39.224 33.514 15.134 1.00 25.84 O ATOM 2142 CB HIS A 145 41.683 31.918 16.549 1.00 22.05 C ATOM 2143 CG HIS A 145 42.776 31.030 16.044 1.00 25.46 C ATOM 2144 ND1 HIS A 145 42.641 30.257 14.909 1.00 26.17 N ATOM 2145 CD2 HIS A 145 44.045 30.839 16.488 1.00 25.93 C ATOM 2146 CE1 HIS A 145 43.773 29.606 14.688 1.00 26.02 C ATOM 2147 NE2 HIS A 145 44.639 29.938 15.637 1.00 26.27 N ATOM 2148 HA HIS A 145 41.648 32.950 14.677 1.00 0.00 H ATOM 2149 HB2 HIS A 145 41.908 32.192 17.580 1.00 0.00 H ATOM 2150 HB3 HIS A 145 40.745 31.364 16.518 1.00 0.00 H ATOM 2151 HD2 HIS A 145 44.506 31.311 17.356 1.00 0.00 H ATOM 2152 HE1 HIS A 145 43.961 28.915 13.866 1.00 0.00 H ATOM 2153 H HIS A 145 43.217 34.056 16.841 1.00 0.00 H ATOM 2154 N LEU A 146 39.928 34.500 17.023 1.00 23.70 N ATOM 2155 CA LEU A 146 38.583 35.008 17.310 1.00 22.19 C ATOM 2156 C LEU A 146 38.133 36.024 16.264 1.00 26.31 C ATOM 2157 O LEU A 146 36.960 36.055 15.878 1.00 25.86 O ATOM 2158 CB LEU A 146 38.487 35.592 18.718 1.00 22.43 C ATOM 2159 CG LEU A 146 38.364 34.556 19.844 1.00 25.84 C ATOM 2160 CD1 LEU A 146 38.664 35.214 21.185 1.00 22.04 C ATOM 2161 CD2 LEU A 146 36.921 33.926 19.809 1.00 27.80 C ATOM 2162 HA LEU A 146 37.904 34.157 17.261 1.00 0.00 H ATOM 2163 HB2 LEU A 146 39.383 36.185 18.900 1.00 0.00 H ATOM 2164 HB3 LEU A 146 37.611 36.239 18.757 1.00 0.00 H ATOM 2165 HG LEU A 146 39.089 33.754 19.703 1.00 0.00 H ATOM 2166 HD21 LEU A 146 36.179 34.712 19.950 1.00 0.00 H ATOM 2167 HD22 LEU A 146 36.760 33.442 18.846 1.00 0.00 H ATOM 2168 HD23 LEU A 146 36.828 33.189 20.607 1.00 0.00 H ATOM 2169 HD11 LEU A 146 39.677 35.615 21.173 1.00 0.00 H ATOM 2170 HD12 LEU A 146 37.954 36.022 21.359 1.00 0.00 H ATOM 2171 HD13 LEU A 146 38.575 34.473 21.980 1.00 0.00 H ATOM 2172 H LEU A 146 40.720 34.719 17.661 1.00 0.00 H ATOM 2173 N THR A 147 39.056 36.842 15.763 1.00 21.83 N ATOM 2174 CA THR A 147 38.645 37.831 14.752 1.00 20.91 C ATOM 2175 C THR A 147 38.245 37.125 13.486 1.00 27.09 C ATOM 2176 O THR A 147 37.318 37.547 12.798 1.00 28.33 O ATOM 2177 CB THR A 147 39.731 38.898 14.478 1.00 29.42 C ATOM 2178 OG1 THR A 147 40.954 38.254 14.094 1.00 30.40 O ATOM 2179 CG2 THR A 147 39.972 39.699 15.711 1.00 25.03 C ATOM 2180 HA THR A 147 37.787 38.372 15.151 1.00 0.00 H ATOM 2181 HB THR A 147 39.391 39.553 13.675 1.00 0.00 H ATOM 2182 HG1 THR A 147 41.255 37.658 14.825 1.00 0.00 H ATOM 2183 HG23 THR A 147 39.047 40.192 16.009 1.00 0.00 H ATOM 2184 HG21 THR A 147 40.308 39.040 16.511 1.00 0.00 H ATOM 2185 HG22 THR A 147 40.737 40.450 15.511 1.00 0.00 H ATOM 2186 H THR A 147 40.045 36.784 16.078 1.00 0.00 H ATOM 2187 N ILE A 148 38.973 36.065 13.149 1.00 25.07 N ATOM 2188 CA ILE A 148 38.674 35.307 11.947 1.00 25.37 C ATOM 2189 C ILE A 148 37.356 34.572 12.126 1.00 31.00 C ATOM 2190 O ILE A 148 36.490 34.626 11.262 1.00 30.79 O ATOM 2191 CB ILE A 148 39.793 34.328 11.639 1.00 29.20 C ATOM 2192 CG1 ILE A 148 41.071 35.063 11.217 1.00 27.52 C ATOM 2193 CG2 ILE A 148 39.380 33.346 10.524 1.00 33.08 C ATOM 2194 CD1 ILE A 148 42.252 34.095 11.244 1.00 31.48 C ATOM 2195 HA ILE A 148 38.588 35.994 11.105 1.00 0.00 H ATOM 2196 HB ILE A 148 39.990 33.768 12.553 1.00 0.00 H ATOM 2197 HG12 ILE A 148 40.947 35.456 10.208 1.00 0.00 H ATOM 2198 HG13 ILE A 148 41.261 35.886 11.906 1.00 0.00 H ATOM 2199 HD11 ILE A 148 42.376 33.703 12.253 1.00 0.00 H ATOM 2200 HD12 ILE A 148 42.062 33.273 10.554 1.00 0.00 H ATOM 2201 HD13 ILE A 148 43.158 34.621 10.944 1.00 0.00 H ATOM 2202 HG21 ILE A 148 38.502 32.784 10.843 1.00 0.00 H ATOM 2203 HG22 ILE A 148 39.146 33.905 9.618 1.00 0.00 H ATOM 2204 HG23 ILE A 148 40.201 32.657 10.325 1.00 0.00 H ATOM 2205 H ILE A 148 39.767 35.775 13.754 1.00 0.00 H ATOM 2206 N MET A 149 37.185 33.917 13.274 1.00 28.50 N ATOM 2207 CA MET A 149 35.949 33.183 13.554 1.00 26.67 C ATOM 2208 C MET A 149 34.700 34.054 13.484 1.00 31.92 C ATOM 2209 O MET A 149 33.687 33.620 12.948 1.00 31.30 O ATOM 2210 CB MET A 149 36.011 32.466 14.907 1.00 27.46 C ATOM 2211 CG MET A 149 36.829 31.221 14.862 1.00 29.30 C ATOM 2212 SD MET A 149 37.303 30.632 16.518 1.00 31.66 S ATOM 2213 CE MET A 149 35.748 29.933 17.167 1.00 28.37 C ATOM 2214 HA MET A 149 35.869 32.440 12.761 1.00 0.00 H ATOM 2215 HB2 MET A 149 36.447 33.144 15.641 1.00 0.00 H ATOM 2216 HB3 MET A 149 34.997 32.206 15.211 1.00 0.00 H ATOM 2217 HG2 MET A 149 37.735 31.419 14.289 1.00 0.00 H ATOM 2218 HG3 MET A 149 36.251 30.441 14.366 1.00 0.00 H ATOM 2219 HE1 MET A 149 34.987 30.713 17.201 1.00 0.00 H ATOM 2220 HE2 MET A 149 35.414 29.126 16.515 1.00 0.00 H ATOM 2221 HE3 MET A 149 35.917 29.544 18.171 1.00 0.00 H ATOM 2222 H MET A 149 37.944 33.927 13.985 1.00 0.00 H ATOM 2223 N TYR A 150 34.764 35.270 14.021 1.00 28.04 N ATOM 2224 CA TYR A 150 33.603 36.166 14.047 1.00 26.52 C ATOM 2225 C TYR A 150 33.562 37.207 12.936 1.00 30.50 C ATOM 2226 O TYR A 150 32.687 38.074 12.938 1.00 30.05 O ATOM 2227 CB TYR A 150 33.501 36.879 15.415 1.00 26.39 C ATOM 2228 CG TYR A 150 32.944 35.983 16.504 1.00 27.72 C ATOM 2229 CD1 TYR A 150 31.571 35.838 16.671 1.00 29.90 C ATOM 2230 CD2 TYR A 150 33.787 35.154 17.251 1.00 28.58 C ATOM 2231 CE1 TYR A 150 31.052 34.944 17.584 1.00 31.15 C ATOM 2232 CE2 TYR A 150 33.275 34.244 18.182 1.00 28.31 C ATOM 2233 CZ TYR A 150 31.901 34.137 18.330 1.00 35.62 C ATOM 2234 OH TYR A 150 31.358 33.245 19.235 1.00 33.71 O ATOM 2235 HA TYR A 150 32.747 35.512 13.878 1.00 0.00 H ATOM 2236 HB3 TYR A 150 32.848 37.746 15.309 1.00 0.00 H ATOM 2237 HB2 TYR A 150 34.497 37.210 15.711 1.00 0.00 H ATOM 2238 HD2 TYR A 150 34.865 35.218 17.105 1.00 0.00 H ATOM 2239 HE2 TYR A 150 33.946 33.629 18.782 1.00 0.00 H ATOM 2240 HE1 TYR A 150 29.973 34.871 17.720 1.00 0.00 H ATOM 2241 HD1 TYR A 150 30.892 36.442 16.069 1.00 0.00 H ATOM 2242 HH TYR A 150 30.370 33.306 19.204 1.00 0.00 H ATOM 2243 H TYR A 150 35.662 35.594 14.434 1.00 0.00 H ATOM 2244 N GLY A 151 34.586 37.253 12.092 1.00 28.34 N ATOM 2245 CA GLY A 151 34.642 38.274 11.037 1.00 27.49 C ATOM 2246 C GLY A 151 34.890 39.682 11.565 1.00 31.46 C ATOM 2247 O GLY A 151 34.347 40.658 11.048 1.00 30.51 O ATOM 2248 HA3 GLY A 151 33.693 38.269 10.501 1.00 0.00 H ATOM 2249 HA2 GLY A 151 35.448 38.016 10.350 1.00 0.00 H ATOM 2250 H GLY A 151 35.356 36.559 12.179 1.00 0.00 H ATOM 2251 N LEU A 152 35.670 39.798 12.639 1.00 27.76 N ATOM 2252 CA LEU A 152 35.908 41.107 13.251 1.00 26.26 C ATOM 2253 C LEU A 152 37.049 41.789 12.495 1.00 29.52 C ATOM 2254 O LEU A 152 38.156 41.255 12.395 1.00 29.09 O ATOM 2255 CB LEU A 152 36.287 40.949 14.737 1.00 26.06 C ATOM 2256 CG LEU A 152 35.401 40.008 15.576 1.00 27.75 C ATOM 2257 CD1 LEU A 152 35.747 40.073 17.071 1.00 26.62 C ATOM 2258 CD2 LEU A 152 33.935 40.368 15.385 1.00 25.67 C ATOM 2259 HA LEU A 152 35.001 41.709 13.195 1.00 0.00 H ATOM 2260 HB2 LEU A 152 37.308 40.569 14.780 1.00 0.00 H ATOM 2261 HB3 LEU A 152 36.249 41.937 15.196 1.00 0.00 H ATOM 2262 HG LEU A 152 35.587 38.992 15.229 1.00 0.00 H ATOM 2263 HD21 LEU A 152 33.770 41.397 15.705 1.00 0.00 H ATOM 2264 HD22 LEU A 152 33.671 40.267 14.332 1.00 0.00 H ATOM 2265 HD23 LEU A 152 33.317 39.697 15.982 1.00 0.00 H ATOM 2266 HD11 LEU A 152 36.787 39.780 17.215 1.00 0.00 H ATOM 2267 HD12 LEU A 152 35.601 41.091 17.432 1.00 0.00 H ATOM 2268 HD13 LEU A 152 35.097 39.394 17.623 1.00 0.00 H ATOM 2269 H LEU A 152 36.114 38.951 13.047 1.00 0.00 H ATOM 2270 N ARG A 153 36.807 43.002 12.032 1.00 25.34 N ATOM 2271 CA ARG A 153 37.831 43.693 11.252 1.00 24.42 C ATOM 2272 C ARG A 153 38.370 44.943 11.911 1.00 27.01 C ATOM 2273 O ARG A 153 39.186 45.646 11.317 1.00 28.59 O ATOM 2274 CB ARG A 153 37.234 44.031 9.880 1.00 26.42 C ATOM 2275 CG ARG A 153 36.607 42.814 9.225 1.00 35.77 C ATOM 2276 CD ARG A 153 36.709 42.908 7.724 1.00 54.30 C ATOM 2277 NE ARG A 153 35.825 43.942 7.214 1.00 56.72 N ATOM 2278 CZ ARG A 153 36.211 44.950 6.436 1.00 62.79 C ATOM 2279 NH1 ARG A 153 37.475 45.070 6.063 1.00 41.75 N ATOM 2280 NH2 ARG A 153 35.316 45.835 6.016 1.00 43.21 N ATOM 2281 HA ARG A 153 38.687 43.024 11.164 1.00 0.00 H ATOM 2282 HB2 ARG A 153 36.470 44.798 10.006 1.00 0.00 H ATOM 2283 HB3 ARG A 153 38.025 44.412 9.234 1.00 0.00 H ATOM 2284 HG2 ARG A 153 37.125 41.917 9.564 1.00 0.00 H ATOM 2285 HG3 ARG A 153 35.557 42.755 9.510 1.00 0.00 H ATOM 2286 HD2 ARG A 153 36.430 41.950 7.285 1.00 0.00 H ATOM 2287 HD3 ARG A 153 37.736 43.147 7.449 1.00 0.00 H ATOM 2288 HE ARG A 153 34.820 43.891 7.475 1.00 0.00 H ATOM 2289 HH12 ARG A 153 37.765 45.862 5.455 1.00 0.00 H ATOM 2290 HH11 ARG A 153 38.179 44.372 6.378 1.00 0.00 H ATOM 2291 HH22 ARG A 153 35.612 46.625 5.408 1.00 0.00 H ATOM 2292 HH21 ARG A 153 34.319 45.739 6.295 1.00 0.00 H ATOM 2293 H ARG A 153 35.894 43.462 12.221 1.00 0.00 H ATOM 2294 N GLY A 154 37.908 45.249 13.119 1.00 23.15 N ATOM 2295 CA GLY A 154 38.393 46.419 13.832 1.00 22.78 C ATOM 2296 C GLY A 154 39.766 46.139 14.457 1.00 24.13 C ATOM 2297 O GLY A 154 40.381 45.108 14.212 1.00 25.98 O ATOM 2298 HA3 GLY A 154 37.686 46.677 14.620 1.00 0.00 H ATOM 2299 HA2 GLY A 154 38.479 47.253 13.136 1.00 0.00 H ATOM 2300 H GLY A 154 37.188 44.642 13.561 1.00 0.00 H ATOM 2301 N PRO A 155 40.250 47.046 15.302 1.00 22.63 N ATOM 2302 CA PRO A 155 41.576 46.945 15.907 1.00 23.38 C ATOM 2303 C PRO A 155 41.739 45.674 16.688 1.00 28.61 C ATOM 2304 O PRO A 155 40.834 45.275 17.421 1.00 28.11 O ATOM 2305 CB PRO A 155 41.617 48.156 16.884 1.00 24.84 C ATOM 2306 CG PRO A 155 40.560 49.100 16.373 1.00 29.22 C ATOM 2307 CD PRO A 155 39.484 48.187 15.837 1.00 25.50 C ATOM 2308 HA PRO A 155 42.366 46.945 15.156 1.00 0.00 H ATOM 2309 HD3 PRO A 155 38.809 47.868 16.632 1.00 0.00 H ATOM 2310 HD2 PRO A 155 38.910 48.677 15.050 1.00 0.00 H ATOM 2311 HG3 PRO A 155 40.958 49.737 15.583 1.00 0.00 H ATOM 2312 HG2 PRO A 155 40.174 49.723 17.180 1.00 0.00 H ATOM 2313 HB2 PRO A 155 41.388 47.837 17.901 1.00 0.00 H ATOM 2314 HB3 PRO A 155 42.598 48.631 16.866 1.00 0.00 H ATOM 2315 N SER A 156 42.895 45.032 16.529 1.00 25.31 N ATOM 2316 CA SER A 156 43.262 43.889 17.370 1.00 23.83 C ATOM 2317 C SER A 156 44.669 44.105 17.895 1.00 26.36 C ATOM 2318 O SER A 156 45.583 44.374 17.115 1.00 24.28 O ATOM 2319 CB SER A 156 43.182 42.527 16.666 1.00 27.24 C ATOM 2320 OG SER A 156 43.803 42.553 15.399 1.00 39.59 O ATOM 2321 HA SER A 156 42.529 43.848 18.175 1.00 0.00 H ATOM 2322 HB2 SER A 156 42.134 42.256 16.540 1.00 0.00 H ATOM 2323 HB3 SER A 156 43.677 41.780 17.286 1.00 0.00 H ATOM 2324 HG SER A 156 43.355 43.225 14.827 1.00 0.00 H ATOM 2325 H SER A 156 43.554 45.350 15.790 1.00 0.00 H ATOM 2326 N ILE A 157 44.821 44.016 19.221 1.00 23.37 N ATOM 2327 CA ILE A 157 46.122 44.102 19.862 1.00 21.80 C ATOM 2328 C ILE A 157 46.196 42.986 20.885 1.00 25.57 C ATOM 2329 O ILE A 157 45.185 42.342 21.197 1.00 23.35 O ATOM 2330 CB ILE A 157 46.349 45.472 20.535 1.00 24.52 C ATOM 2331 CG1 ILE A 157 45.334 45.702 21.655 1.00 24.67 C ATOM 2332 CG2 ILE A 157 46.295 46.573 19.507 1.00 23.43 C ATOM 2333 CD1 ILE A 157 45.680 46.915 22.556 1.00 26.07 C ATOM 2334 HA ILE A 157 46.906 43.999 19.112 1.00 0.00 H ATOM 2335 HB ILE A 157 47.341 45.480 20.987 1.00 0.00 H ATOM 2336 HG12 ILE A 157 44.355 45.872 21.206 1.00 0.00 H ATOM 2337 HG13 ILE A 157 45.296 44.808 22.277 1.00 0.00 H ATOM 2338 HD11 ILE A 157 46.653 46.755 23.021 1.00 0.00 H ATOM 2339 HD12 ILE A 157 45.711 47.820 21.949 1.00 0.00 H ATOM 2340 HD13 ILE A 157 44.919 47.020 23.329 1.00 0.00 H ATOM 2341 HG21 ILE A 157 47.071 46.409 18.760 1.00 0.00 H ATOM 2342 HG22 ILE A 157 45.318 46.570 19.024 1.00 0.00 H ATOM 2343 HG23 ILE A 157 46.457 47.533 19.996 1.00 0.00 H ATOM 2344 H ILE A 157 43.978 43.880 19.814 1.00 0.00 H ATOM 2345 N SER A 158 47.402 42.735 21.381 1.00 19.54 N ATOM 2346 CA SER A 158 47.594 41.724 22.396 1.00 18.10 C ATOM 2347 C SER A 158 48.704 42.223 23.301 1.00 24.44 C ATOM 2348 O SER A 158 49.847 42.333 22.872 1.00 22.70 O ATOM 2349 CB SER A 158 47.966 40.359 21.818 1.00 18.32 C ATOM 2350 OG SER A 158 47.032 39.953 20.814 1.00 27.05 O ATOM 2351 HA SER A 158 46.658 41.574 22.934 1.00 0.00 H ATOM 2352 HB2 SER A 158 47.970 39.621 22.620 1.00 0.00 H ATOM 2353 HB3 SER A 158 48.961 40.418 21.376 1.00 0.00 H ATOM 2354 HG SER A 158 47.028 40.618 20.080 1.00 0.00 H ATOM 2355 H SER A 158 48.221 43.274 21.034 1.00 0.00 H ATOM 2356 N ILE A 159 48.354 42.536 24.547 1.00 20.70 N ATOM 2357 CA ILE A 159 49.349 42.996 25.516 1.00 20.63 C ATOM 2358 C ILE A 159 49.822 41.816 26.342 1.00 23.94 C ATOM 2359 O ILE A 159 49.012 41.012 26.813 1.00 22.45 O ATOM 2360 CB ILE A 159 48.761 44.106 26.394 1.00 21.53 C ATOM 2361 CG1 ILE A 159 48.432 45.309 25.508 1.00 19.34 C ATOM 2362 CG2 ILE A 159 49.728 44.462 27.523 1.00 19.72 C ATOM 2363 CD1 ILE A 159 47.756 46.460 26.230 1.00 19.99 C ATOM 2364 HA ILE A 159 50.209 43.417 24.995 1.00 0.00 H ATOM 2365 HB ILE A 159 47.840 43.767 26.869 1.00 0.00 H ATOM 2366 HG12 ILE A 159 49.362 45.678 25.076 1.00 0.00 H ATOM 2367 HG13 ILE A 159 47.770 44.973 24.710 1.00 0.00 H ATOM 2368 HD11 ILE A 159 46.815 46.116 26.659 1.00 0.00 H ATOM 2369 HD12 ILE A 159 48.408 46.822 27.025 1.00 0.00 H ATOM 2370 HD13 ILE A 159 47.561 47.267 25.523 1.00 0.00 H ATOM 2371 HG21 ILE A 159 49.907 43.580 28.138 1.00 0.00 H ATOM 2372 HG22 ILE A 159 50.670 44.807 27.097 1.00 0.00 H ATOM 2373 HG23 ILE A 159 49.294 45.252 28.136 1.00 0.00 H ATOM 2374 H ILE A 159 47.358 42.452 24.836 1.00 0.00 H ATOM 2375 N ALA A 160 51.141 41.643 26.401 1.00 19.59 N ATOM 2376 CA ALA A 160 51.756 40.571 27.170 1.00 19.23 C ATOM 2377 C ALA A 160 52.639 41.261 28.221 1.00 25.20 C ATOM 2378 O ALA A 160 53.782 41.627 27.918 1.00 21.70 O ATOM 2379 CB ALA A 160 52.615 39.691 26.254 1.00 18.59 C ATOM 2380 HA ALA A 160 51.008 39.928 27.634 1.00 0.00 H ATOM 2381 HB1 ALA A 160 51.987 39.258 25.475 1.00 0.00 H ATOM 2382 HB2 ALA A 160 53.397 40.298 25.797 1.00 0.00 H ATOM 2383 HB3 ALA A 160 53.070 38.893 26.841 1.00 0.00 H ATOM 2384 H ALA A 160 51.755 42.299 25.878 1.00 0.00 H ATOM 2385 N THR A 161 52.094 41.453 29.430 1.00 23.12 N ATOM 2386 CA THR A 161 52.808 42.096 30.558 1.00 21.23 C ATOM 2387 C THR A 161 52.767 41.147 31.783 1.00 23.18 C ATOM 2388 O THR A 161 52.463 41.560 32.889 1.00 21.10 O ATOM 2389 CB THR A 161 52.216 43.495 30.868 1.00 23.51 C ATOM 2390 OG1 THR A 161 50.776 43.412 30.872 1.00 25.78 O ATOM 2391 CG2 THR A 161 52.610 44.507 29.776 1.00 19.36 C ATOM 2392 HA THR A 161 53.851 42.264 30.290 1.00 0.00 H ATOM 2393 HB THR A 161 52.601 43.818 31.835 1.00 0.00 H ATOM 2394 HG1 THR A 161 50.396 44.304 31.070 1.00 0.00 H ATOM 2395 HG23 THR A 161 53.696 44.598 29.742 1.00 0.00 H ATOM 2396 HG21 THR A 161 52.242 44.159 28.811 1.00 0.00 H ATOM 2397 HG22 THR A 161 52.170 45.477 30.006 1.00 0.00 H ATOM 2398 H THR A 161 51.117 41.133 29.585 1.00 0.00 H ATOM 2399 N ALA A 162 53.057 39.872 31.553 1.00 20.41 N ATOM 2400 CA ALA A 162 53.059 38.867 32.597 1.00 20.62 C ATOM 2401 C ALA A 162 51.714 38.935 33.303 1.00 26.63 C ATOM 2402 O ALA A 162 50.699 39.053 32.623 1.00 26.20 O ATOM 2403 CB ALA A 162 54.256 39.106 33.581 1.00 21.22 C ATOM 2404 HA ALA A 162 53.196 37.869 32.181 1.00 0.00 H ATOM 2405 HB1 ALA A 162 55.195 39.049 33.030 1.00 0.00 H ATOM 2406 HB2 ALA A 162 54.160 40.092 34.036 1.00 0.00 H ATOM 2407 HB3 ALA A 162 54.243 38.343 34.359 1.00 0.00 H ATOM 2408 H ALA A 162 53.293 39.582 30.582 1.00 0.00 H ATOM 2409 N ALA A 163 51.697 38.917 34.639 1.00 21.56 N ATOM 2410 CA ALA A 163 50.437 38.914 35.385 1.00 22.27 C ATOM 2411 C ALA A 163 49.604 40.154 35.251 1.00 25.05 C ATOM 2412 O ALA A 163 48.428 40.169 35.644 1.00 25.19 O ATOM 2413 CB ALA A 163 50.630 38.530 36.919 1.00 22.59 C ATOM 2414 HA ALA A 163 49.865 38.125 34.896 1.00 0.00 H ATOM 2415 HB1 ALA A 163 51.063 37.532 36.991 1.00 0.00 H ATOM 2416 HB2 ALA A 163 51.296 39.252 37.392 1.00 0.00 H ATOM 2417 HB3 ALA A 163 49.662 38.544 37.420 1.00 0.00 H ATOM 2418 H ALA A 163 52.597 38.905 35.160 1.00 0.00 H ATOM 2419 N THR A 164 50.163 41.192 34.644 1.00 19.90 N ATOM 2420 CA THR A 164 49.349 42.393 34.437 1.00 17.20 C ATOM 2421 C THR A 164 48.531 42.351 33.151 1.00 22.94 C ATOM 2422 O THR A 164 47.693 43.202 32.950 1.00 23.48 O ATOM 2423 CB THR A 164 50.211 43.648 34.501 1.00 23.82 C ATOM 2424 OG1 THR A 164 51.124 43.503 35.580 1.00 19.80 O ATOM 2425 CG2 THR A 164 49.366 44.895 34.711 1.00 22.48 C ATOM 2426 HA THR A 164 48.627 42.422 35.253 1.00 0.00 H ATOM 2427 HB THR A 164 50.740 43.765 33.555 1.00 0.00 H ATOM 2428 HG1 THR A 164 51.695 44.310 35.639 1.00 0.00 H ATOM 2429 HG23 THR A 164 48.667 45.003 33.881 1.00 0.00 H ATOM 2430 HG21 THR A 164 48.812 44.804 35.645 1.00 0.00 H ATOM 2431 HG22 THR A 164 50.016 45.769 34.756 1.00 0.00 H ATOM 2432 H THR A 164 51.152 41.155 34.324 1.00 0.00 H ATOM 2433 N SER A 165 48.767 41.355 32.290 1.00 20.48 N ATOM 2434 CA SER A 165 48.163 41.308 30.947 1.00 18.60 C ATOM 2435 C SER A 165 46.648 41.511 30.891 1.00 22.84 C ATOM 2436 O SER A 165 46.139 42.284 30.101 1.00 21.35 O ATOM 2437 CB SER A 165 48.513 39.969 30.285 1.00 19.42 C ATOM 2438 OG SER A 165 49.918 39.856 30.158 1.00 22.44 O ATOM 2439 HA SER A 165 48.587 42.159 30.414 1.00 0.00 H ATOM 2440 HB2 SER A 165 48.054 39.921 29.298 1.00 0.00 H ATOM 2441 HB3 SER A 165 48.137 39.151 30.899 1.00 0.00 H ATOM 2442 HG SER A 165 50.334 39.899 31.055 1.00 0.00 H ATOM 2443 H SER A 165 49.402 40.584 32.580 1.00 0.00 H ATOM 2444 N GLY A 166 45.917 40.742 31.678 1.00 24.11 N ATOM 2445 CA GLY A 166 44.460 40.825 31.624 1.00 23.10 C ATOM 2446 C GLY A 166 43.932 42.207 31.903 1.00 25.04 C ATOM 2447 O GLY A 166 42.967 42.649 31.278 1.00 25.92 O ATOM 2448 HA3 GLY A 166 44.046 40.140 32.364 1.00 0.00 H ATOM 2449 HA2 GLY A 166 44.133 40.523 30.629 1.00 0.00 H ATOM 2450 H GLY A 166 46.378 40.079 32.334 1.00 0.00 H ATOM 2451 N VAL A 167 44.489 42.866 32.910 1.00 20.93 N ATOM 2452 CA VAL A 167 44.052 44.224 33.220 1.00 21.28 C ATOM 2453 C VAL A 167 44.457 45.174 32.090 1.00 24.89 C ATOM 2454 O VAL A 167 43.680 46.035 31.721 1.00 24.69 O ATOM 2455 CB VAL A 167 44.614 44.722 34.568 1.00 25.66 C ATOM 2456 CG1 VAL A 167 44.633 46.248 34.592 1.00 25.59 C ATOM 2457 CG2 VAL A 167 43.796 44.169 35.729 1.00 24.58 C ATOM 2458 HA VAL A 167 42.966 44.209 33.310 1.00 0.00 H ATOM 2459 HB VAL A 167 45.636 44.360 34.679 1.00 0.00 H ATOM 2460 HG11 VAL A 167 45.263 46.615 33.782 1.00 0.00 H ATOM 2461 HG12 VAL A 167 43.618 46.625 34.464 1.00 0.00 H ATOM 2462 HG13 VAL A 167 45.031 46.590 35.547 1.00 0.00 H ATOM 2463 HG21 VAL A 167 42.762 44.500 35.633 1.00 0.00 H ATOM 2464 HG22 VAL A 167 43.833 43.080 35.712 1.00 0.00 H ATOM 2465 HG23 VAL A 167 44.210 44.533 36.669 1.00 0.00 H ATOM 2466 H VAL A 167 45.235 42.416 33.478 1.00 0.00 H ATOM 2467 N HIS A 168 45.689 45.056 31.567 1.00 19.95 N ATOM 2468 CA HIS A 168 46.115 45.987 30.516 1.00 18.05 C ATOM 2469 C HIS A 168 45.251 45.820 29.274 1.00 20.63 C ATOM 2470 O HIS A 168 44.890 46.785 28.597 1.00 22.29 O ATOM 2471 CB HIS A 168 47.596 45.795 30.111 1.00 17.60 C ATOM 2472 CG HIS A 168 48.581 46.437 31.047 1.00 21.20 C ATOM 2473 ND1 HIS A 168 49.849 45.917 31.267 1.00 22.43 N ATOM 2474 CD2 HIS A 168 48.489 47.548 31.818 1.00 23.64 C ATOM 2475 CE1 HIS A 168 50.496 46.694 32.117 1.00 23.19 C ATOM 2476 NE2 HIS A 168 49.705 47.707 32.445 1.00 24.13 N ATOM 2477 HA HIS A 168 46.001 46.988 30.933 1.00 0.00 H ATOM 2478 HB2 HIS A 168 47.805 44.726 30.076 1.00 0.00 H ATOM 2479 HB3 HIS A 168 47.737 46.224 29.119 1.00 0.00 H ATOM 2480 HD2 HIS A 168 47.617 48.194 31.922 1.00 0.00 H ATOM 2481 HE1 HIS A 168 51.508 46.530 32.486 1.00 0.00 H ATOM 2482 H HIS A 168 46.334 44.313 31.904 1.00 0.00 H ATOM 2483 N ASN A 169 45.002 44.578 28.907 1.00 17.17 N ATOM 2484 CA ASN A 169 44.219 44.347 27.690 1.00 18.52 C ATOM 2485 C ASN A 169 42.800 44.885 27.843 1.00 22.92 C ATOM 2486 O ASN A 169 42.258 45.498 26.933 1.00 21.95 O ATOM 2487 CB ASN A 169 44.176 42.857 27.395 1.00 18.26 C ATOM 2488 CG ASN A 169 45.399 42.396 26.664 1.00 24.14 C ATOM 2489 OD1 ASN A 169 45.595 42.765 25.520 1.00 22.87 O ATOM 2490 ND2 ASN A 169 46.216 41.544 27.313 1.00 18.90 N ATOM 2491 HA ASN A 169 44.695 44.875 26.864 1.00 0.00 H ATOM 2492 HB2 ASN A 169 44.102 42.313 28.337 1.00 0.00 H ATOM 2493 HB3 ASN A 169 43.299 42.644 26.784 1.00 0.00 H ATOM 2494 HD22 ASN A 169 46.002 41.261 28.291 1.00 0.00 H ATOM 2495 HD21 ASN A 169 47.061 41.169 26.836 1.00 0.00 H ATOM 2496 H ASN A 169 45.354 43.778 29.470 1.00 0.00 H ATOM 2497 N ILE A 170 42.192 44.646 28.998 1.00 22.09 N ATOM 2498 CA ILE A 170 40.852 45.197 29.247 1.00 22.30 C ATOM 2499 C ILE A 170 40.891 46.734 29.249 1.00 27.22 C ATOM 2500 O ILE A 170 40.041 47.380 28.643 1.00 27.00 O ATOM 2501 CB ILE A 170 40.241 44.626 30.566 1.00 24.96 C ATOM 2502 CG1 ILE A 170 39.858 43.154 30.367 1.00 24.66 C ATOM 2503 CG2 ILE A 170 39.004 45.406 30.968 1.00 23.35 C ATOM 2504 CD1 ILE A 170 39.787 42.348 31.725 1.00 23.53 C ATOM 2505 HA ILE A 170 40.196 44.885 28.434 1.00 0.00 H ATOM 2506 HB ILE A 170 40.989 44.714 31.353 1.00 0.00 H ATOM 2507 HG12 ILE A 170 38.881 43.111 29.885 1.00 0.00 H ATOM 2508 HG13 ILE A 170 40.601 42.685 29.722 1.00 0.00 H ATOM 2509 HD11 ILE A 170 40.761 42.375 32.214 1.00 0.00 H ATOM 2510 HD12 ILE A 170 39.040 42.801 32.376 1.00 0.00 H ATOM 2511 HD13 ILE A 170 39.512 41.314 31.518 1.00 0.00 H ATOM 2512 HG21 ILE A 170 39.271 46.451 31.127 1.00 0.00 H ATOM 2513 HG22 ILE A 170 38.259 45.336 30.176 1.00 0.00 H ATOM 2514 HG23 ILE A 170 38.597 44.989 31.889 1.00 0.00 H ATOM 2515 H ILE A 170 42.662 44.070 29.725 1.00 0.00 H ATOM 2516 N GLY A 171 41.861 47.316 29.951 1.00 21.99 N ATOM 2517 CA GLY A 171 42.005 48.762 30.037 1.00 21.24 C ATOM 2518 C GLY A 171 42.236 49.402 28.678 1.00 26.35 C ATOM 2519 O GLY A 171 41.592 50.382 28.362 1.00 26.90 O ATOM 2520 HA3 GLY A 171 42.853 48.992 30.682 1.00 0.00 H ATOM 2521 HA2 GLY A 171 41.097 49.180 30.471 1.00 0.00 H ATOM 2522 H GLY A 171 42.542 46.715 30.457 1.00 0.00 H ATOM 2523 N HIS A 172 43.134 48.846 27.857 1.00 22.53 N ATOM 2524 CA HIS A 172 43.374 49.433 26.527 1.00 21.63 C ATOM 2525 C HIS A 172 42.259 49.212 25.508 1.00 27.05 C ATOM 2526 O HIS A 172 42.025 50.050 24.625 1.00 24.20 O ATOM 2527 CB HIS A 172 44.776 49.098 26.017 1.00 19.65 C ATOM 2528 CG HIS A 172 45.835 49.870 26.740 1.00 21.25 C ATOM 2529 ND1 HIS A 172 46.021 51.221 26.542 1.00 22.81 N ATOM 2530 CD2 HIS A 172 46.655 49.520 27.755 1.00 21.84 C ATOM 2531 CE1 HIS A 172 46.908 51.672 27.407 1.00 22.29 C ATOM 2532 NE2 HIS A 172 47.334 50.652 28.135 1.00 22.28 N ATOM 2533 HA HIS A 172 43.340 50.514 26.667 1.00 0.00 H ATOM 2534 HB2 HIS A 172 44.957 48.033 26.160 1.00 0.00 H ATOM 2535 HB3 HIS A 172 44.830 49.336 24.955 1.00 0.00 H ATOM 2536 HD2 HIS A 172 46.758 48.526 28.191 1.00 0.00 H ATOM 2537 HE1 HIS A 172 47.234 52.707 27.506 1.00 0.00 H ATOM 2538 H HIS A 172 43.662 48.001 28.157 1.00 0.00 H ATOM 2539 N ALA A 173 41.497 48.136 25.690 1.00 25.07 N ATOM 2540 CA ALA A 173 40.327 47.913 24.827 1.00 23.06 C ATOM 2541 C ALA A 173 39.344 49.055 25.103 1.00 26.11 C ATOM 2542 O ALA A 173 38.751 49.641 24.184 1.00 25.74 O ATOM 2543 CB ALA A 173 39.678 46.539 25.140 1.00 22.31 C ATOM 2544 HA ALA A 173 40.614 47.901 23.776 1.00 0.00 H ATOM 2545 HB1 ALA A 173 40.406 45.747 24.964 1.00 0.00 H ATOM 2546 HB2 ALA A 173 39.360 46.518 26.182 1.00 0.00 H ATOM 2547 HB3 ALA A 173 38.814 46.391 24.492 1.00 0.00 H ATOM 2548 H ALA A 173 41.728 47.454 26.441 1.00 0.00 H ATOM 2549 N ALA A 174 39.195 49.383 26.380 1.00 23.94 N ATOM 2550 CA ALA A 174 38.310 50.480 26.790 1.00 23.64 C ATOM 2551 C ALA A 174 38.825 51.791 26.177 1.00 28.97 C ATOM 2552 O ALA A 174 38.050 52.604 25.647 1.00 26.54 O ATOM 2553 CB ALA A 174 38.263 50.588 28.313 1.00 22.79 C ATOM 2554 HA ALA A 174 37.299 50.283 26.435 1.00 0.00 H ATOM 2555 HB1 ALA A 174 37.887 49.654 28.731 1.00 0.00 H ATOM 2556 HB2 ALA A 174 39.266 50.780 28.693 1.00 0.00 H ATOM 2557 HB3 ALA A 174 37.602 51.407 28.598 1.00 0.00 H ATOM 2558 H ALA A 174 39.716 48.851 27.106 1.00 0.00 H ATOM 2559 N ARG A 175 40.125 52.033 26.308 1.00 26.93 N ATOM 2560 CA ARG A 175 40.699 53.266 25.750 1.00 26.80 C ATOM 2561 C ARG A 175 40.403 53.347 24.261 1.00 29.22 C ATOM 2562 O ARG A 175 40.040 54.407 23.754 1.00 28.39 O ATOM 2563 CB ARG A 175 42.214 53.323 25.977 1.00 25.73 C ATOM 2564 CG ARG A 175 42.594 53.447 27.436 1.00 26.08 C ATOM 2565 CD ARG A 175 42.253 54.832 27.988 1.00 29.17 C ATOM 2566 NE ARG A 175 43.085 55.136 29.149 1.00 28.54 N ATOM 2567 CZ ARG A 175 42.624 55.274 30.386 1.00 34.85 C ATOM 2568 NH1 ARG A 175 41.318 55.138 30.651 1.00 29.48 N ATOM 2569 NH2 ARG A 175 43.475 55.531 31.361 1.00 26.73 N ATOM 2570 HA ARG A 175 40.243 54.113 26.262 1.00 0.00 H ATOM 2571 HB2 ARG A 175 42.659 52.411 25.579 1.00 0.00 H ATOM 2572 HB3 ARG A 175 42.613 54.184 25.441 1.00 0.00 H ATOM 2573 HG2 ARG A 175 42.053 52.694 28.009 1.00 0.00 H ATOM 2574 HG3 ARG A 175 43.666 53.278 27.539 1.00 0.00 H ATOM 2575 HD2 ARG A 175 41.204 54.853 28.282 1.00 0.00 H ATOM 2576 HD3 ARG A 175 42.428 55.580 27.215 1.00 0.00 H ATOM 2577 HE ARG A 175 44.107 55.252 28.996 1.00 0.00 H ATOM 2578 HH12 ARG A 175 40.971 55.249 31.625 1.00 0.00 H ATOM 2579 HH11 ARG A 175 40.651 54.922 29.883 1.00 0.00 H ATOM 2580 HH22 ARG A 175 43.131 55.642 32.336 1.00 0.00 H ATOM 2581 HH21 ARG A 175 44.490 55.622 31.155 1.00 0.00 H ATOM 2582 H ARG A 175 40.735 51.352 26.804 1.00 0.00 H ATOM 2583 N ILE A 176 40.603 52.224 23.559 1.00 25.02 N ATOM 2584 CA ILE A 176 40.372 52.148 22.112 1.00 24.31 C ATOM 2585 C ILE A 176 38.934 52.539 21.766 1.00 30.47 C ATOM 2586 O ILE A 176 38.672 53.269 20.800 1.00 30.17 O ATOM 2587 CB ILE A 176 40.770 50.740 21.579 1.00 26.51 C ATOM 2588 CG1 ILE A 176 42.303 50.625 21.526 1.00 25.86 C ATOM 2589 CG2 ILE A 176 40.191 50.457 20.208 1.00 26.59 C ATOM 2590 CD1 ILE A 176 42.768 49.205 21.304 1.00 22.78 C ATOM 2591 HA ILE A 176 41.011 52.872 21.606 1.00 0.00 H ATOM 2592 HB ILE A 176 40.357 50.001 22.266 1.00 0.00 H ATOM 2593 HG12 ILE A 176 42.673 51.246 20.710 1.00 0.00 H ATOM 2594 HG13 ILE A 176 42.714 50.984 22.469 1.00 0.00 H ATOM 2595 HD11 ILE A 176 42.411 48.576 22.119 1.00 0.00 H ATOM 2596 HD12 ILE A 176 42.370 48.837 20.358 1.00 0.00 H ATOM 2597 HD13 ILE A 176 43.857 49.181 21.275 1.00 0.00 H ATOM 2598 HG21 ILE A 176 39.103 50.504 20.258 1.00 0.00 H ATOM 2599 HG22 ILE A 176 40.556 51.201 19.500 1.00 0.00 H ATOM 2600 HG23 ILE A 176 40.499 49.463 19.883 1.00 0.00 H ATOM 2601 H ILE A 176 40.934 51.374 24.058 1.00 0.00 H ATOM 2602 N ILE A 177 37.987 52.044 22.551 1.00 27.33 N ATOM 2603 CA ILE A 177 36.568 52.368 22.308 1.00 26.30 C ATOM 2604 C ILE A 177 36.348 53.824 22.659 1.00 30.55 C ATOM 2605 O ILE A 177 35.744 54.585 21.917 1.00 32.77 O ATOM 2606 CB ILE A 177 35.633 51.468 23.182 1.00 27.81 C ATOM 2607 CG1 ILE A 177 35.676 50.020 22.673 1.00 25.99 C ATOM 2608 CG2 ILE A 177 34.193 52.047 23.212 1.00 27.53 C ATOM 2609 CD1 ILE A 177 35.162 48.995 23.691 1.00 29.93 C ATOM 2610 HA ILE A 177 36.328 52.185 21.261 1.00 0.00 H ATOM 2611 HB ILE A 177 35.990 51.462 24.212 1.00 0.00 H ATOM 2612 HG12 ILE A 177 35.062 49.952 21.775 1.00 0.00 H ATOM 2613 HG13 ILE A 177 36.708 49.772 22.425 1.00 0.00 H ATOM 2614 HD11 ILE A 177 35.773 49.042 24.592 1.00 0.00 H ATOM 2615 HD12 ILE A 177 34.126 49.222 23.941 1.00 0.00 H ATOM 2616 HD13 ILE A 177 35.223 47.995 23.261 1.00 0.00 H ATOM 2617 HG21 ILE A 177 34.215 53.051 23.635 1.00 0.00 H ATOM 2618 HG22 ILE A 177 33.798 52.088 22.197 1.00 0.00 H ATOM 2619 HG23 ILE A 177 33.558 51.407 23.825 1.00 0.00 H ATOM 2620 H ILE A 177 38.246 51.423 23.344 1.00 0.00 H ATOM 2621 N ALA A 178 36.827 54.221 23.814 1.00 25.25 N ATOM 2622 CA ALA A 178 36.605 55.594 24.223 1.00 24.96 C ATOM 2623 C ALA A 178 37.253 56.594 23.271 1.00 31.57 C ATOM 2624 O ALA A 178 36.759 57.702 23.119 1.00 32.41 O ATOM 2625 CB ALA A 178 37.041 55.819 25.657 1.00 24.82 C ATOM 2626 HA ALA A 178 35.531 55.771 24.174 1.00 0.00 H ATOM 2627 HB1 ALA A 178 36.471 55.164 26.316 1.00 0.00 H ATOM 2628 HB2 ALA A 178 38.104 55.596 25.752 1.00 0.00 H ATOM 2629 HB3 ALA A 178 36.861 56.858 25.931 1.00 0.00 H ATOM 2630 H ALA A 178 37.355 53.564 24.424 1.00 0.00 H ATOM 2631 N TYR A 179 38.353 56.202 22.629 1.00 28.54 N ATOM 2632 CA TYR A 179 39.073 57.085 21.715 1.00 27.64 C ATOM 2633 C TYR A 179 38.249 57.254 20.462 1.00 30.97 C ATOM 2634 O TYR A 179 38.284 58.291 19.832 1.00 28.92 O ATOM 2635 CB TYR A 179 40.450 56.513 21.336 1.00 27.58 C ATOM 2636 CG TYR A 179 41.294 57.448 20.452 1.00 27.37 C ATOM 2637 CD1 TYR A 179 41.973 58.529 21.004 1.00 28.00 C ATOM 2638 CD2 TYR A 179 41.397 57.239 19.083 1.00 28.39 C ATOM 2639 CE1 TYR A 179 42.752 59.383 20.200 1.00 32.35 C ATOM 2640 CE2 TYR A 179 42.143 58.115 18.263 1.00 29.71 C ATOM 2641 CZ TYR A 179 42.828 59.166 18.830 1.00 33.64 C ATOM 2642 OH TYR A 179 43.611 59.988 18.034 1.00 32.92 O ATOM 2643 HA TYR A 179 39.232 58.041 22.214 1.00 0.00 H ATOM 2644 HB3 TYR A 179 40.297 55.578 20.798 1.00 0.00 H ATOM 2645 HB2 TYR A 179 41.004 56.316 22.254 1.00 0.00 H ATOM 2646 HD2 TYR A 179 40.893 56.384 18.633 1.00 0.00 H ATOM 2647 HE2 TYR A 179 42.176 57.959 17.185 1.00 0.00 H ATOM 2648 HE1 TYR A 179 43.295 60.213 20.652 1.00 0.00 H ATOM 2649 HD1 TYR A 179 41.901 58.718 22.075 1.00 0.00 H ATOM 2650 HH TYR A 179 44.030 60.687 18.596 1.00 0.00 H ATOM 2651 H TYR A 179 38.710 55.237 22.784 1.00 0.00 H ATOM 2652 N GLY A 180 37.524 56.209 20.093 1.00 29.82 N ATOM 2653 CA GLY A 180 36.676 56.225 18.915 1.00 28.85 C ATOM 2654 C GLY A 180 37.113 55.224 17.865 1.00 31.29 C ATOM 2655 O GLY A 180 36.517 55.161 16.804 1.00 29.22 O ATOM 2656 HA3 GLY A 180 36.704 57.223 18.478 1.00 0.00 H ATOM 2657 HA2 GLY A 180 35.655 55.991 19.217 1.00 0.00 H ATOM 2658 H GLY A 180 37.564 55.344 20.669 1.00 0.00 H ATOM 2659 N ASP A 181 38.150 54.433 18.142 1.00 25.97 N ATOM 2660 CA ASP A 181 38.632 53.480 17.134 1.00 25.47 C ATOM 2661 C ASP A 181 37.791 52.200 17.032 1.00 30.25 C ATOM 2662 O ASP A 181 37.990 51.370 16.136 1.00 29.41 O ATOM 2663 CB ASP A 181 40.076 53.099 17.428 1.00 27.18 C ATOM 2664 CG ASP A 181 41.076 54.189 17.038 1.00 33.92 C ATOM 2665 OD1 ASP A 181 40.783 55.003 16.109 1.00 31.91 O ATOM 2666 OD2 ASP A 181 42.205 54.130 17.582 1.00 30.85 O ATOM 2667 HA ASP A 181 38.546 53.993 16.176 1.00 0.00 H ATOM 2668 HB2 ASP A 181 40.173 52.905 18.496 1.00 0.00 H ATOM 2669 HB3 ASP A 181 40.316 52.193 16.872 1.00 0.00 H ATOM 2670 H ASP A 181 38.616 54.491 19.070 1.00 0.00 H ATOM 2671 N ALA A 182 36.826 52.043 17.931 1.00 28.25 N ATOM 2672 CA ALA A 182 35.982 50.846 17.923 1.00 26.64 C ATOM 2673 C ALA A 182 34.739 51.142 18.729 1.00 30.92 C ATOM 2674 O ALA A 182 34.740 52.062 19.534 1.00 29.29 O ATOM 2675 CB ALA A 182 36.717 49.702 18.589 1.00 27.09 C ATOM 2676 HA ALA A 182 35.732 50.576 16.897 1.00 0.00 H ATOM 2677 HB1 ALA A 182 37.640 49.499 18.045 1.00 0.00 H ATOM 2678 HB2 ALA A 182 36.952 49.973 19.618 1.00 0.00 H ATOM 2679 HB3 ALA A 182 36.086 48.813 18.581 1.00 0.00 H ATOM 2680 H ALA A 182 36.668 52.779 18.649 1.00 0.00 H ATOM 2681 N ASP A 183 33.685 50.352 18.534 1.00 28.92 N ATOM 2682 CA ASP A 183 32.478 50.510 19.361 1.00 28.26 C ATOM 2683 C ASP A 183 32.398 49.304 20.307 1.00 29.37 C ATOM 2684 O ASP A 183 31.689 49.336 21.305 1.00 26.73 O ATOM 2685 CB ASP A 183 31.223 50.501 18.482 1.00 30.06 C ATOM 2686 CG ASP A 183 31.130 51.713 17.579 1.00 31.18 C ATOM 2687 OD1 ASP A 183 31.514 52.824 18.020 1.00 31.33 O ATOM 2688 OD2 ASP A 183 30.680 51.530 16.436 1.00 33.97 O ATOM 2689 HA ASP A 183 32.532 51.453 19.906 1.00 0.00 H ATOM 2690 HB2 ASP A 183 31.238 49.605 17.862 1.00 0.00 H ATOM 2691 HB3 ASP A 183 30.345 50.479 19.128 1.00 0.00 H ATOM 2692 H ASP A 183 33.715 49.621 17.795 1.00 0.00 H ATOM 2693 N VAL A 184 33.050 48.208 19.913 1.00 26.95 N ATOM 2694 CA VAL A 184 33.020 46.949 20.672 1.00 26.48 C ATOM 2695 C VAL A 184 34.383 46.306 20.651 1.00 27.57 C ATOM 2696 O VAL A 184 35.059 46.306 19.626 1.00 25.85 O ATOM 2697 CB VAL A 184 32.022 45.953 20.054 1.00 31.45 C ATOM 2698 CG1 VAL A 184 31.967 44.648 20.869 1.00 31.66 C ATOM 2699 CG2 VAL A 184 30.639 46.589 19.935 1.00 32.26 C ATOM 2700 HA VAL A 184 32.717 47.187 21.692 1.00 0.00 H ATOM 2701 HB VAL A 184 32.367 45.699 19.052 1.00 0.00 H ATOM 2702 HG11 VAL A 184 32.955 44.189 20.884 1.00 0.00 H ATOM 2703 HG12 VAL A 184 31.653 44.871 21.889 1.00 0.00 H ATOM 2704 HG13 VAL A 184 31.254 43.964 20.409 1.00 0.00 H ATOM 2705 HG21 VAL A 184 30.286 46.877 20.925 1.00 0.00 H ATOM 2706 HG22 VAL A 184 30.700 47.472 19.299 1.00 0.00 H ATOM 2707 HG23 VAL A 184 29.947 45.871 19.496 1.00 0.00 H ATOM 2708 H VAL A 184 33.602 48.246 19.033 1.00 0.00 H ATOM 2709 N MET A 185 34.763 45.686 21.759 1.00 24.49 N ATOM 2710 CA MET A 185 36.035 44.951 21.780 1.00 22.09 C ATOM 2711 C MET A 185 35.839 43.739 22.669 1.00 24.49 C ATOM 2712 O MET A 185 35.273 43.869 23.722 1.00 25.65 O ATOM 2713 CB MET A 185 37.162 45.849 22.370 1.00 22.62 C ATOM 2714 CG MET A 185 37.501 47.123 21.529 1.00 24.79 C ATOM 2715 SD MET A 185 38.456 46.655 20.076 1.00 28.54 S ATOM 2716 CE MET A 185 40.058 46.286 20.864 1.00 26.43 C ATOM 2717 HA MET A 185 36.323 44.657 20.771 1.00 0.00 H ATOM 2718 HB2 MET A 185 36.852 46.172 23.364 1.00 0.00 H ATOM 2719 HB3 MET A 185 38.067 45.247 22.451 1.00 0.00 H ATOM 2720 HG2 MET A 185 38.083 47.815 22.138 1.00 0.00 H ATOM 2721 HG3 MET A 185 36.576 47.607 21.215 1.00 0.00 H ATOM 2722 HE1 MET A 185 40.426 47.178 21.370 1.00 0.00 H ATOM 2723 HE2 MET A 185 39.928 45.483 21.589 1.00 0.00 H ATOM 2724 HE3 MET A 185 40.774 45.977 20.102 1.00 0.00 H ATOM 2725 H MET A 185 34.164 45.720 22.609 1.00 0.00 H ATOM 2726 N VAL A 186 36.321 42.584 22.249 1.00 20.74 N ATOM 2727 CA VAL A 186 36.399 41.405 23.111 1.00 21.86 C ATOM 2728 C VAL A 186 37.824 41.501 23.697 1.00 25.25 C ATOM 2729 O VAL A 186 38.810 41.558 22.943 1.00 25.24 O ATOM 2730 CB VAL A 186 36.258 40.074 22.338 1.00 28.75 C ATOM 2731 CG1 VAL A 186 36.053 38.909 23.344 1.00 27.43 C ATOM 2732 CG2 VAL A 186 35.119 40.142 21.385 1.00 31.48 C ATOM 2733 HA VAL A 186 35.594 41.398 23.845 1.00 0.00 H ATOM 2734 HB VAL A 186 37.169 39.897 21.766 1.00 0.00 H ATOM 2735 HG11 VAL A 186 36.912 38.852 24.012 1.00 0.00 H ATOM 2736 HG12 VAL A 186 35.149 39.089 23.927 1.00 0.00 H ATOM 2737 HG13 VAL A 186 35.954 37.971 22.797 1.00 0.00 H ATOM 2738 HG21 VAL A 186 34.197 40.331 21.935 1.00 0.00 H ATOM 2739 HG22 VAL A 186 35.291 40.949 20.673 1.00 0.00 H ATOM 2740 HG23 VAL A 186 35.037 39.195 20.851 1.00 0.00 H ATOM 2741 H VAL A 186 36.658 42.510 21.268 1.00 0.00 H ATOM 2742 N ALA A 187 37.928 41.518 25.023 1.00 22.91 N ATOM 2743 CA ALA A 187 39.196 41.723 25.722 1.00 21.71 C ATOM 2744 C ALA A 187 39.406 40.722 26.856 1.00 26.02 C ATOM 2745 O ALA A 187 38.455 40.358 27.557 1.00 22.44 O ATOM 2746 CB ALA A 187 39.189 43.176 26.312 1.00 21.88 C ATOM 2747 HA ALA A 187 40.010 41.578 25.012 1.00 0.00 H ATOM 2748 HB1 ALA A 187 39.083 43.896 25.500 1.00 0.00 H ATOM 2749 HB2 ALA A 187 38.354 43.282 27.004 1.00 0.00 H ATOM 2750 HB3 ALA A 187 40.125 43.357 26.840 1.00 0.00 H ATOM 2751 H ALA A 187 37.067 41.379 25.589 1.00 0.00 H ATOM 2752 N GLY A 188 40.660 40.367 27.132 1.00 23.14 N ATOM 2753 CA GLY A 188 40.900 39.431 28.215 1.00 22.12 C ATOM 2754 C GLY A 188 42.262 38.801 28.123 1.00 23.28 C ATOM 2755 O GLY A 188 43.183 39.411 27.566 1.00 19.06 O ATOM 2756 HA3 GLY A 188 40.145 38.646 28.176 1.00 0.00 H ATOM 2757 HA2 GLY A 188 40.821 39.962 29.164 1.00 0.00 H ATOM 2758 H GLY A 188 41.453 40.754 26.581 1.00 0.00 H ATOM 2759 N GLY A 189 42.386 37.583 28.645 1.00 20.17 N ATOM 2760 CA GLY A 189 43.654 36.880 28.640 1.00 20.54 C ATOM 2761 C GLY A 189 43.425 35.401 28.794 1.00 24.04 C ATOM 2762 O GLY A 189 42.397 34.969 29.303 1.00 22.62 O ATOM 2763 HA3 GLY A 189 44.268 37.238 29.466 1.00 0.00 H ATOM 2764 HA2 GLY A 189 44.168 37.069 27.698 1.00 0.00 H ATOM 2765 H GLY A 189 41.553 37.124 29.067 1.00 0.00 H ATOM 2766 N ALA A 190 44.425 34.626 28.412 1.00 20.40 N ATOM 2767 CA ALA A 190 44.337 33.180 28.472 1.00 21.12 C ATOM 2768 C ALA A 190 45.729 32.677 28.833 1.00 22.11 C ATOM 2769 O ALA A 190 46.739 33.248 28.407 1.00 22.04 O ATOM 2770 CB ALA A 190 43.892 32.634 27.074 1.00 22.10 C ATOM 2771 HA ALA A 190 43.608 32.844 29.209 1.00 0.00 H ATOM 2772 HB1 ALA A 190 42.918 33.050 26.816 1.00 0.00 H ATOM 2773 HB2 ALA A 190 44.624 32.926 26.321 1.00 0.00 H ATOM 2774 HB3 ALA A 190 43.825 31.547 27.115 1.00 0.00 H ATOM 2775 H ALA A 190 45.299 35.065 28.059 1.00 0.00 H ATOM 2776 N GLU A 191 45.779 31.599 29.601 1.00 19.02 N ATOM 2777 CA GLU A 191 47.042 31.014 30.034 1.00 18.93 C ATOM 2778 C GLU A 191 46.921 29.530 30.307 1.00 23.62 C ATOM 2779 O GLU A 191 45.949 29.072 30.918 1.00 23.11 O ATOM 2780 CB GLU A 191 47.483 31.712 31.351 1.00 20.29 C ATOM 2781 CG GLU A 191 49.009 31.636 31.593 1.00 18.75 C ATOM 2782 CD GLU A 191 49.778 32.711 30.803 1.00 23.84 C ATOM 2783 OE1 GLU A 191 49.507 33.910 30.969 1.00 24.81 O ATOM 2784 OE2 GLU A 191 50.708 32.351 30.067 1.00 25.31 O ATOM 2785 HA GLU A 191 47.768 31.156 29.234 1.00 0.00 H ATOM 2786 HB2 GLU A 191 47.190 32.761 31.304 1.00 0.00 H ATOM 2787 HB3 GLU A 191 46.974 31.231 32.187 1.00 0.00 H ATOM 2788 HG2 GLU A 191 49.203 31.775 32.656 1.00 0.00 H ATOM 2789 HG3 GLU A 191 49.365 30.653 31.286 1.00 0.00 H ATOM 2790 H GLU A 191 44.889 31.156 29.905 1.00 0.00 H ATOM 2791 N LYS A 192 47.953 28.785 29.944 1.00 21.04 N ATOM 2792 CA LYS A 192 48.063 27.369 30.302 1.00 20.43 C ATOM 2793 C LYS A 192 49.548 27.074 30.528 1.00 24.03 C ATOM 2794 O LYS A 192 50.202 26.404 29.719 1.00 23.99 O ATOM 2795 CB LYS A 192 47.498 26.456 29.224 1.00 20.86 C ATOM 2796 CG LYS A 192 46.945 25.145 29.787 1.00 20.30 C ATOM 2797 CD LYS A 192 48.032 24.151 30.215 1.00 25.00 C ATOM 2798 CE LYS A 192 47.393 22.781 30.603 1.00 23.92 C ATOM 2799 NZ LYS A 192 48.425 21.910 31.189 1.00 30.15 N ATOM 2800 HA LYS A 192 47.478 27.175 31.201 1.00 0.00 H ATOM 2801 HB2 LYS A 192 46.693 26.981 28.709 1.00 0.00 H ATOM 2802 HB3 LYS A 192 48.291 26.223 28.514 1.00 0.00 H ATOM 2803 HG2 LYS A 192 46.328 25.376 30.656 1.00 0.00 H ATOM 2804 HG3 LYS A 192 46.329 24.674 29.021 1.00 0.00 H ATOM 2805 HD2 LYS A 192 48.728 24.002 29.390 1.00 0.00 H ATOM 2806 HD3 LYS A 192 48.569 24.553 31.074 1.00 0.00 H ATOM 2807 HE2 LYS A 192 46.979 22.307 29.713 1.00 0.00 H ATOM 2808 HE3 LYS A 192 46.597 22.943 31.330 1.00 0.00 H ATOM 2809 HZ1 LYS A 192 49.183 21.756 30.494 1.00 0.00 H ATOM 2810 HZ2 LYS A 192 48.819 22.364 32.038 1.00 0.00 H ATOM 2811 HZ3 LYS A 192 48.000 20.997 31.448 1.00 0.00 H ATOM 2812 H LYS A 192 48.713 29.221 29.384 1.00 0.00 H ATOM 2813 N ALA A 193 50.045 27.550 31.658 1.00 20.45 N ATOM 2814 CA ALA A 193 51.458 27.436 32.001 1.00 20.98 C ATOM 2815 C ALA A 193 51.792 26.271 32.955 1.00 25.88 C ATOM 2816 O ALA A 193 52.927 26.138 33.410 1.00 25.95 O ATOM 2817 CB ALA A 193 51.975 28.801 32.534 1.00 21.89 C ATOM 2818 HA ALA A 193 51.988 27.182 31.083 1.00 0.00 H ATOM 2819 HB1 ALA A 193 51.848 29.562 31.764 1.00 0.00 H ATOM 2820 HB2 ALA A 193 51.407 29.082 33.421 1.00 0.00 H ATOM 2821 HB3 ALA A 193 53.031 28.713 32.790 1.00 0.00 H ATOM 2822 H ALA A 193 49.404 28.023 32.327 1.00 0.00 H ATOM 2823 N SER A 194 50.835 25.361 33.155 1.00 23.05 N ATOM 2824 CA SER A 194 51.056 24.196 34.007 1.00 22.87 C ATOM 2825 C SER A 194 51.737 23.098 33.199 1.00 27.70 C ATOM 2826 O SER A 194 51.157 22.031 32.950 1.00 26.20 O ATOM 2827 CB SER A 194 49.724 23.696 34.611 1.00 24.07 C ATOM 2828 OG SER A 194 48.757 23.408 33.593 1.00 28.58 O ATOM 2829 HA SER A 194 51.705 24.478 34.836 1.00 0.00 H ATOM 2830 HB2 SER A 194 49.324 24.465 35.271 1.00 0.00 H ATOM 2831 HB3 SER A 194 49.914 22.789 35.185 1.00 0.00 H ATOM 2832 HG SER A 194 48.575 24.229 33.071 1.00 0.00 H ATOM 2833 H SER A 194 49.911 25.485 32.693 1.00 0.00 H ATOM 2834 N THR A 195 52.986 23.366 32.805 1.00 24.17 N ATOM 2835 CA THR A 195 53.774 22.442 32.010 1.00 22.92 C ATOM 2836 C THR A 195 55.147 22.321 32.690 1.00 24.93 C ATOM 2837 O THR A 195 55.482 23.101 33.582 1.00 25.25 O ATOM 2838 CB THR A 195 54.006 23.014 30.604 1.00 30.58 C ATOM 2839 OG1 THR A 195 54.953 24.098 30.718 1.00 26.09 O ATOM 2840 CG2 THR A 195 52.701 23.526 29.988 1.00 22.75 C ATOM 2841 HA THR A 195 53.258 21.485 31.933 1.00 0.00 H ATOM 2842 HB THR A 195 54.389 22.229 29.952 1.00 0.00 H ATOM 2843 HG1 THR A 195 55.802 23.755 31.094 1.00 0.00 H ATOM 2844 HG23 THR A 195 51.992 22.702 29.905 1.00 0.00 H ATOM 2845 HG21 THR A 195 52.282 24.306 30.624 1.00 0.00 H ATOM 2846 HG22 THR A 195 52.904 23.933 28.997 1.00 0.00 H ATOM 2847 H THR A 195 53.411 24.275 33.080 1.00 0.00 H ATOM 2848 N PRO A 196 55.973 21.379 32.231 1.00 22.20 N ATOM 2849 CA PRO A 196 57.322 21.211 32.814 1.00 23.36 C ATOM 2850 C PRO A 196 58.098 22.529 32.884 1.00 25.82 C ATOM 2851 O PRO A 196 58.622 22.859 33.943 1.00 24.91 O ATOM 2852 CB PRO A 196 57.991 20.223 31.856 1.00 24.31 C ATOM 2853 CG PRO A 196 56.833 19.341 31.401 1.00 28.67 C ATOM 2854 CD PRO A 196 55.632 20.271 31.313 1.00 24.17 C ATOM 2855 HA PRO A 196 57.288 20.863 33.846 1.00 0.00 H ATOM 2856 HD3 PRO A 196 55.498 20.637 30.295 1.00 0.00 H ATOM 2857 HD2 PRO A 196 54.723 19.764 31.637 1.00 0.00 H ATOM 2858 HG3 PRO A 196 56.650 18.547 32.125 1.00 0.00 H ATOM 2859 HG2 PRO A 196 57.048 18.900 30.427 1.00 0.00 H ATOM 2860 HB2 PRO A 196 58.443 20.742 31.011 1.00 0.00 H ATOM 2861 HB3 PRO A 196 58.752 19.635 32.369 1.00 0.00 H ATOM 2862 N LEU A 197 58.076 23.330 31.809 1.00 23.11 N ATOM 2863 CA LEU A 197 58.759 24.638 31.819 1.00 23.07 C ATOM 2864 C LEU A 197 58.110 25.673 32.728 1.00 26.36 C ATOM 2865 O LEU A 197 58.818 26.435 33.405 1.00 26.14 O ATOM 2866 CB LEU A 197 58.957 25.234 30.403 1.00 23.44 C ATOM 2867 CG LEU A 197 60.099 24.687 29.517 1.00 27.39 C ATOM 2868 CD1 LEU A 197 60.004 25.246 28.085 1.00 26.31 C ATOM 2869 CD2 LEU A 197 61.477 24.966 30.119 1.00 27.84 C ATOM 2870 HA LEU A 197 59.740 24.409 32.236 1.00 0.00 H ATOM 2871 HB2 LEU A 197 58.026 25.080 29.857 1.00 0.00 H ATOM 2872 HB3 LEU A 197 59.131 26.303 30.527 1.00 0.00 H ATOM 2873 HG LEU A 197 59.978 23.605 29.472 1.00 0.00 H ATOM 2874 HD21 LEU A 197 61.614 26.042 30.226 1.00 0.00 H ATOM 2875 HD22 LEU A 197 61.548 24.491 31.097 1.00 0.00 H ATOM 2876 HD23 LEU A 197 62.248 24.563 29.462 1.00 0.00 H ATOM 2877 HD11 LEU A 197 59.050 24.955 27.645 1.00 0.00 H ATOM 2878 HD12 LEU A 197 60.075 26.333 28.115 1.00 0.00 H ATOM 2879 HD13 LEU A 197 60.820 24.844 27.485 1.00 0.00 H ATOM 2880 H LEU A 197 57.569 23.024 30.954 1.00 0.00 H ATOM 2881 N GLY A 198 56.772 25.740 32.736 1.00 21.99 N ATOM 2882 CA GLY A 198 56.071 26.691 33.601 1.00 20.00 C ATOM 2883 C GLY A 198 56.272 26.328 35.072 1.00 26.05 C ATOM 2884 O GLY A 198 56.707 27.150 35.878 1.00 24.41 O ATOM 2885 HA3 GLY A 198 55.006 26.670 33.369 1.00 0.00 H ATOM 2886 HA2 GLY A 198 56.461 27.693 33.422 1.00 0.00 H ATOM 2887 H GLY A 198 56.223 25.108 32.119 1.00 0.00 H ATOM 2888 N VAL A 199 55.982 25.075 35.422 1.00 24.54 N ATOM 2889 CA VAL A 199 56.156 24.612 36.812 1.00 23.45 C ATOM 2890 C VAL A 199 57.662 24.572 37.203 1.00 27.07 C ATOM 2891 O VAL A 199 58.074 25.045 38.256 1.00 25.61 O ATOM 2892 CB VAL A 199 55.462 23.260 37.056 1.00 25.28 C ATOM 2893 CG1 VAL A 199 55.663 22.808 38.543 1.00 25.95 C ATOM 2894 CG2 VAL A 199 53.947 23.380 36.696 1.00 23.53 C ATOM 2895 HA VAL A 199 55.667 25.335 37.465 1.00 0.00 H ATOM 2896 HB VAL A 199 55.908 22.498 36.417 1.00 0.00 H ATOM 2897 HG11 VAL A 199 56.728 22.705 38.749 1.00 0.00 H ATOM 2898 HG12 VAL A 199 55.233 23.555 39.210 1.00 0.00 H ATOM 2899 HG13 VAL A 199 55.167 21.850 38.701 1.00 0.00 H ATOM 2900 HG21 VAL A 199 53.486 24.144 37.322 1.00 0.00 H ATOM 2901 HG22 VAL A 199 53.845 23.657 35.647 1.00 0.00 H ATOM 2902 HG23 VAL A 199 53.457 22.422 36.869 1.00 0.00 H ATOM 2903 H VAL A 199 55.627 24.413 34.703 1.00 0.00 H ATOM 2904 N GLY A 200 58.472 24.024 36.335 1.00 26.07 N ATOM 2905 CA GLY A 200 59.893 23.957 36.621 1.00 25.53 C ATOM 2906 C GLY A 200 60.524 25.347 36.623 1.00 27.76 C ATOM 2907 O GLY A 200 61.446 25.585 37.381 1.00 25.02 O ATOM 2908 HA3 GLY A 200 60.380 23.347 35.861 1.00 0.00 H ATOM 2909 HA2 GLY A 200 60.037 23.500 37.600 1.00 0.00 H ATOM 2910 H GLY A 200 58.100 23.638 35.444 1.00 0.00 H ATOM 2911 N GLY A 201 60.069 26.236 35.741 1.00 23.60 N ATOM 2912 CA GLY A 201 60.628 27.585 35.585 1.00 22.96 C ATOM 2913 C GLY A 201 60.316 28.532 36.717 1.00 26.62 C ATOM 2914 O GLY A 201 61.195 29.217 37.247 1.00 23.85 O ATOM 2915 HA3 GLY A 201 60.231 28.013 34.665 1.00 0.00 H ATOM 2916 HA2 GLY A 201 61.711 27.497 35.505 1.00 0.00 H ATOM 2917 H GLY A 201 59.274 25.959 35.130 1.00 0.00 H ATOM 2918 N PHE A 202 59.046 28.572 37.115 1.00 22.42 N ATOM 2919 CA PHE A 202 58.677 29.410 38.250 1.00 21.31 C ATOM 2920 C PHE A 202 59.229 28.754 39.542 1.00 24.76 C ATOM 2921 O PHE A 202 59.540 29.442 40.487 1.00 23.61 O ATOM 2922 CB PHE A 202 57.150 29.571 38.352 1.00 21.84 C ATOM 2923 CG PHE A 202 56.583 30.626 37.426 1.00 21.85 C ATOM 2924 CD1 PHE A 202 56.837 31.972 37.645 1.00 23.81 C ATOM 2925 CD2 PHE A 202 55.875 30.256 36.300 1.00 23.15 C ATOM 2926 CE1 PHE A 202 56.343 32.944 36.783 1.00 24.30 C ATOM 2927 CE2 PHE A 202 55.333 31.220 35.447 1.00 24.84 C ATOM 2928 CZ PHE A 202 55.578 32.567 35.682 1.00 23.05 C ATOM 2929 HA PHE A 202 59.104 30.404 38.115 1.00 0.00 H ATOM 2930 HB2 PHE A 202 56.686 28.615 38.109 1.00 0.00 H ATOM 2931 HB3 PHE A 202 56.901 29.844 39.377 1.00 0.00 H ATOM 2932 HD2 PHE A 202 55.737 29.199 36.074 1.00 0.00 H ATOM 2933 HE2 PHE A 202 54.719 30.916 34.599 1.00 0.00 H ATOM 2934 HZ PHE A 202 55.174 33.324 35.009 1.00 0.00 H ATOM 2935 HE1 PHE A 202 56.554 33.997 36.968 1.00 0.00 H ATOM 2936 HD1 PHE A 202 57.433 32.272 38.507 1.00 0.00 H ATOM 2937 H PHE A 202 58.323 28.011 36.621 1.00 0.00 H ATOM 2938 N GLY A 203 59.340 27.430 39.559 1.00 25.23 N ATOM 2939 CA GLY A 203 59.944 26.692 40.669 1.00 24.45 C ATOM 2940 C GLY A 203 61.417 27.087 40.830 1.00 29.57 C ATOM 2941 O GLY A 203 61.856 27.345 41.960 1.00 28.82 O ATOM 2942 HA3 GLY A 203 59.878 25.623 40.469 1.00 0.00 H ATOM 2943 HA2 GLY A 203 59.407 26.922 41.589 1.00 0.00 H ATOM 2944 H GLY A 203 58.980 26.892 38.745 1.00 0.00 H ATOM 2945 N ALA A 204 62.150 27.208 39.703 1.00 26.50 N ATOM 2946 CA ALA A 204 63.574 27.601 39.696 1.00 25.05 C ATOM 2947 C ALA A 204 63.795 28.982 40.279 1.00 30.29 C ATOM 2948 O ALA A 204 64.821 29.245 40.912 1.00 30.58 O ATOM 2949 CB ALA A 204 64.179 27.487 38.267 1.00 26.15 C ATOM 2950 HA ALA A 204 64.100 26.900 40.344 1.00 0.00 H ATOM 2951 HB1 ALA A 204 64.099 26.456 37.921 1.00 0.00 H ATOM 2952 HB2 ALA A 204 63.632 28.142 37.589 1.00 0.00 H ATOM 2953 HB3 ALA A 204 65.228 27.783 38.293 1.00 0.00 H ATOM 2954 H ALA A 204 61.688 27.014 38.792 1.00 0.00 H ATOM 2955 N ALA A 205 62.797 29.842 40.126 1.00 25.45 N ATOM 2956 CA ALA A 205 62.824 31.171 40.699 1.00 25.73 C ATOM 2957 C ALA A 205 62.420 31.214 42.199 1.00 28.38 C ATOM 2958 O ALA A 205 62.394 32.277 42.827 1.00 27.70 O ATOM 2959 CB ALA A 205 61.953 32.104 39.884 1.00 26.30 C ATOM 2960 HA ALA A 205 63.861 31.504 40.661 1.00 0.00 H ATOM 2961 HB1 ALA A 205 62.326 32.146 38.861 1.00 0.00 H ATOM 2962 HB2 ALA A 205 60.928 31.734 39.883 1.00 0.00 H ATOM 2963 HB3 ALA A 205 61.980 33.101 40.324 1.00 0.00 H ATOM 2964 H ALA A 205 61.965 29.551 39.574 1.00 0.00 H ATOM 2965 N ARG A 206 62.107 30.060 42.770 1.00 25.03 N ATOM 2966 CA ARG A 206 61.706 30.013 44.186 1.00 24.36 C ATOM 2967 C ARG A 206 60.446 30.831 44.429 1.00 28.52 C ATOM 2968 O ARG A 206 60.230 31.390 45.521 1.00 26.87 O ATOM 2969 CB ARG A 206 62.857 30.469 45.095 1.00 23.17 C ATOM 2970 CG ARG A 206 64.082 29.528 44.985 1.00 28.41 C ATOM 2971 CD ARG A 206 65.164 30.000 45.978 1.00 29.15 C ATOM 2972 NE ARG A 206 65.711 31.290 45.551 1.00 37.10 N ATOM 2973 CZ ARG A 206 65.764 32.378 46.312 1.00 47.96 C ATOM 2974 NH1 ARG A 206 65.261 32.357 47.546 1.00 30.53 N ATOM 2975 NH2 ARG A 206 66.296 33.492 45.823 1.00 39.72 N ATOM 2976 HA ARG A 206 61.475 28.978 44.437 1.00 0.00 H ATOM 2977 HB2 ARG A 206 63.158 31.476 44.806 1.00 0.00 H ATOM 2978 HB3 ARG A 206 62.509 30.477 46.128 1.00 0.00 H ATOM 2979 HG2 ARG A 206 63.783 28.508 45.226 1.00 0.00 H ATOM 2980 HG3 ARG A 206 64.478 29.559 43.970 1.00 0.00 H ATOM 2981 HD2 ARG A 206 65.966 29.263 46.015 1.00 0.00 H ATOM 2982 HD3 ARG A 206 64.723 30.105 46.969 1.00 0.00 H ATOM 2983 HE ARG A 206 66.085 31.359 44.583 1.00 0.00 H ATOM 2984 HH12 ARG A 206 65.304 33.210 48.140 1.00 0.00 H ATOM 2985 HH11 ARG A 206 64.826 31.488 47.915 1.00 0.00 H ATOM 2986 HH22 ARG A 206 66.342 34.348 46.411 1.00 0.00 H ATOM 2987 HH21 ARG A 206 66.667 33.508 44.852 1.00 0.00 H ATOM 2988 H ARG A 206 62.145 29.182 42.214 1.00 0.00 H ATOM 2989 N ALA A 207 59.598 30.881 43.405 1.00 25.34 N ATOM 2990 CA ALA A 207 58.356 31.658 43.491 1.00 23.75 C ATOM 2991 C ALA A 207 57.091 30.856 43.824 1.00 24.37 C ATOM 2992 O ALA A 207 56.061 31.441 44.133 1.00 23.55 O ATOM 2993 CB ALA A 207 58.152 32.465 42.191 1.00 24.38 C ATOM 2994 HA ALA A 207 58.494 32.320 44.346 1.00 0.00 H ATOM 2995 HB1 ALA A 207 58.993 33.144 42.050 1.00 0.00 H ATOM 2996 HB2 ALA A 207 58.091 31.780 41.345 1.00 0.00 H ATOM 2997 HB3 ALA A 207 57.228 33.039 42.262 1.00 0.00 H ATOM 2998 H ALA A 207 59.818 30.362 42.531 1.00 0.00 H ATOM 2999 N LEU A 208 57.158 29.534 43.723 1.00 22.61 N ATOM 3000 CA LEU A 208 55.988 28.678 43.949 1.00 21.66 C ATOM 3001 C LEU A 208 55.921 28.050 45.348 1.00 28.90 C ATOM 3002 O LEU A 208 56.951 27.664 45.928 1.00 24.79 O ATOM 3003 CB LEU A 208 55.995 27.541 42.935 1.00 20.74 C ATOM 3004 CG LEU A 208 55.917 27.982 41.453 1.00 22.46 C ATOM 3005 CD1 LEU A 208 56.072 26.730 40.546 1.00 20.72 C ATOM 3006 CD2 LEU A 208 54.612 28.802 41.127 1.00 21.15 C ATOM 3007 HA LEU A 208 55.122 29.331 43.844 1.00 0.00 H ATOM 3008 HB2 LEU A 208 56.915 26.973 43.071 1.00 0.00 H ATOM 3009 HB3 LEU A 208 55.139 26.898 43.142 1.00 0.00 H ATOM 3010 HG LEU A 208 56.737 28.671 41.252 1.00 0.00 H ATOM 3011 HD21 LEU A 208 53.736 28.188 41.339 1.00 0.00 H ATOM 3012 HD22 LEU A 208 54.585 29.700 41.744 1.00 0.00 H ATOM 3013 HD23 LEU A 208 54.615 29.083 40.074 1.00 0.00 H ATOM 3014 HD11 LEU A 208 57.036 26.259 40.741 1.00 0.00 H ATOM 3015 HD12 LEU A 208 55.271 26.024 40.763 1.00 0.00 H ATOM 3016 HD13 LEU A 208 56.018 27.032 39.500 1.00 0.00 H ATOM 3017 H LEU A 208 58.067 29.092 43.476 1.00 0.00 H ATOM 3018 N SER A 209 54.690 27.862 45.834 1.00 25.19 N ATOM 3019 CA SER A 209 54.464 27.150 47.075 1.00 23.71 C ATOM 3020 C SER A 209 54.850 25.717 46.791 1.00 25.96 C ATOM 3021 O SER A 209 54.642 25.232 45.696 1.00 25.70 O ATOM 3022 CB SER A 209 52.969 27.187 47.458 1.00 26.00 C ATOM 3023 OG SER A 209 52.696 26.177 48.425 1.00 30.43 O ATOM 3024 HA SER A 209 55.035 27.593 47.891 1.00 0.00 H ATOM 3025 HB2 SER A 209 52.363 27.012 46.569 1.00 0.00 H ATOM 3026 HB3 SER A 209 52.726 28.164 47.875 1.00 0.00 H ATOM 3027 HG SER A 209 53.246 26.337 49.232 1.00 0.00 H ATOM 3028 H SER A 209 53.874 28.236 45.308 1.00 0.00 H ATOM 3029 N THR A 210 55.430 25.031 47.773 1.00 23.41 N ATOM 3030 CA THR A 210 55.760 23.625 47.605 1.00 24.16 C ATOM 3031 C THR A 210 54.975 22.784 48.630 1.00 29.27 C ATOM 3032 O THR A 210 55.441 21.738 49.062 1.00 27.44 O ATOM 3033 CB THR A 210 57.279 23.393 47.830 1.00 34.62 C ATOM 3034 OG1 THR A 210 57.670 24.036 49.055 1.00 32.37 O ATOM 3035 CG2 THR A 210 58.085 24.006 46.678 1.00 36.25 C ATOM 3036 HA THR A 210 55.495 23.327 46.591 1.00 0.00 H ATOM 3037 HB THR A 210 57.473 22.321 47.877 1.00 0.00 H ATOM 3038 HG1 THR A 210 58.638 23.893 49.207 1.00 0.00 H ATOM 3039 HG23 THR A 210 57.799 23.528 45.741 1.00 0.00 H ATOM 3040 HG21 THR A 210 57.878 25.075 46.620 1.00 0.00 H ATOM 3041 HG22 THR A 210 59.149 23.850 46.857 1.00 0.00 H ATOM 3042 H THR A 210 55.650 25.506 48.671 1.00 0.00 H ATOM 3043 N ARG A 211 53.787 23.224 49.022 1.00 28.75 N ATOM 3044 CA ARG A 211 53.021 22.480 50.035 1.00 27.78 C ATOM 3045 C ARG A 211 52.316 21.327 49.378 1.00 32.04 C ATOM 3046 O ARG A 211 51.088 21.326 49.255 1.00 33.94 O ATOM 3047 CB ARG A 211 51.977 23.409 50.649 1.00 28.77 C ATOM 3048 CG ARG A 211 51.276 22.823 51.882 1.00 34.92 C ATOM 3049 CD ARG A 211 50.544 23.902 52.626 1.00 33.97 C ATOM 3050 NE ARG A 211 51.460 24.540 53.558 1.00 48.87 N ATOM 3051 CZ ARG A 211 51.410 25.812 53.894 1.00 57.86 C ATOM 3052 NH1 ARG A 211 50.461 26.586 53.406 1.00 67.30 N ATOM 3053 NH2 ARG A 211 52.301 26.301 54.726 1.00 33.82 N ATOM 3054 HA ARG A 211 53.696 22.110 50.807 1.00 0.00 H ATOM 3055 HB2 ARG A 211 52.471 24.336 50.942 1.00 0.00 H ATOM 3056 HB3 ARG A 211 51.221 23.624 49.894 1.00 0.00 H ATOM 3057 HG2 ARG A 211 50.566 22.060 51.564 1.00 0.00 H ATOM 3058 HG3 ARG A 211 52.020 22.373 52.540 1.00 0.00 H ATOM 3059 HD2 ARG A 211 49.709 23.466 53.174 1.00 0.00 H ATOM 3060 HD3 ARG A 211 50.167 24.642 51.920 1.00 0.00 H ATOM 3061 HE ARG A 211 52.203 23.953 53.987 1.00 0.00 H ATOM 3062 HH12 ARG A 211 50.422 27.591 53.671 1.00 0.00 H ATOM 3063 HH11 ARG A 211 49.752 26.192 52.756 1.00 0.00 H ATOM 3064 HH22 ARG A 211 52.266 27.305 54.995 1.00 0.00 H ATOM 3065 HH21 ARG A 211 53.042 25.684 55.116 1.00 0.00 H ATOM 3066 H ARG A 211 53.396 24.096 48.613 1.00 0.00 H ATOM 3067 N ASN A 212 53.075 20.360 48.888 1.00 28.36 N ATOM 3068 CA ASN A 212 52.463 19.242 48.172 1.00 27.62 C ATOM 3069 C ASN A 212 51.490 18.395 49.000 1.00 34.06 C ATOM 3070 O ASN A 212 50.576 17.784 48.461 1.00 32.50 O ATOM 3071 CB ASN A 212 53.569 18.367 47.593 1.00 29.85 C ATOM 3072 CG ASN A 212 54.465 19.148 46.665 1.00 45.18 C ATOM 3073 OD1 ASN A 212 53.971 19.807 45.753 1.00 33.84 O ATOM 3074 ND2 ASN A 212 55.750 19.215 46.983 1.00 37.37 N ATOM 3075 HA ASN A 212 51.847 19.679 47.386 1.00 0.00 H ATOM 3076 HB2 ASN A 212 54.169 17.967 48.411 1.00 0.00 H ATOM 3077 HB3 ASN A 212 53.117 17.544 47.039 1.00 0.00 H ATOM 3078 HD22 ASN A 212 56.123 18.638 47.763 1.00 0.00 H ATOM 3079 HD21 ASN A 212 56.385 19.845 46.452 1.00 0.00 H ATOM 3080 H ASN A 212 54.107 20.395 49.012 1.00 0.00 H ATOM 3081 N ASP A 213 51.705 18.352 50.309 1.00 33.46 N ATOM 3082 CA ASP A 213 50.882 17.519 51.193 1.00 34.45 C ATOM 3083 C ASP A 213 49.497 18.083 51.466 1.00 38.33 C ATOM 3084 O ASP A 213 48.638 17.386 51.993 1.00 36.35 O ATOM 3085 CB ASP A 213 51.617 17.195 52.505 1.00 36.19 C ATOM 3086 CG ASP A 213 51.833 18.414 53.380 1.00 53.14 C ATOM 3087 OD1 ASP A 213 52.612 18.310 54.352 1.00 59.40 O ATOM 3088 OD2 ASP A 213 51.218 19.467 53.133 1.00 55.65 O ATOM 3089 HA ASP A 213 50.719 16.591 50.645 1.00 0.00 H ATOM 3090 HB2 ASP A 213 51.028 16.467 53.063 1.00 0.00 H ATOM 3091 HB3 ASP A 213 52.589 16.765 52.262 1.00 0.00 H ATOM 3092 H ASP A 213 52.474 18.921 50.717 1.00 0.00 H ATOM 3093 N ASN A 214 49.281 19.345 51.094 1.00 33.43 N ATOM 3094 CA ASN A 214 47.968 19.953 51.236 1.00 32.18 C ATOM 3095 C ASN A 214 47.747 21.010 50.133 1.00 32.05 C ATOM 3096 O ASN A 214 47.733 22.202 50.405 1.00 31.29 O ATOM 3097 CB ASN A 214 47.881 20.611 52.605 1.00 33.87 C ATOM 3098 CG ASN A 214 46.460 20.825 53.051 1.00 46.50 C ATOM 3099 OD1 ASN A 214 46.201 21.009 54.237 1.00 39.41 O ATOM 3100 ND2 ASN A 214 45.532 20.848 52.096 1.00 30.36 N ATOM 3101 HA ASN A 214 47.198 19.187 51.140 1.00 0.00 H ATOM 3102 HB2 ASN A 214 48.384 19.974 53.332 1.00 0.00 H ATOM 3103 HB3 ASN A 214 48.384 21.577 52.562 1.00 0.00 H ATOM 3104 HD22 ASN A 214 45.802 20.686 51.105 1.00 0.00 H ATOM 3105 HD21 ASN A 214 44.538 21.028 52.342 1.00 0.00 H ATOM 3106 H ASN A 214 50.063 19.903 50.696 1.00 0.00 H ATOM 3107 N PRO A 215 47.623 20.572 48.874 1.00 30.15 N ATOM 3108 CA PRO A 215 47.488 21.525 47.757 1.00 29.89 C ATOM 3109 C PRO A 215 46.435 22.586 47.943 1.00 31.86 C ATOM 3110 O PRO A 215 46.625 23.706 47.479 1.00 31.10 O ATOM 3111 CB PRO A 215 47.141 20.633 46.564 1.00 31.08 C ATOM 3112 CG PRO A 215 47.762 19.316 46.905 1.00 36.10 C ATOM 3113 CD PRO A 215 47.554 19.175 48.401 1.00 32.06 C ATOM 3114 HA PRO A 215 48.406 22.103 47.646 1.00 0.00 H ATOM 3115 HD3 PRO A 215 46.583 18.733 48.623 1.00 0.00 H ATOM 3116 HD2 PRO A 215 48.340 18.568 48.852 1.00 0.00 H ATOM 3117 HG3 PRO A 215 48.824 19.316 46.662 1.00 0.00 H ATOM 3118 HG2 PRO A 215 47.268 18.506 46.369 1.00 0.00 H ATOM 3119 HB2 PRO A 215 46.061 20.536 46.454 1.00 0.00 H ATOM 3120 HB3 PRO A 215 47.564 21.035 45.643 1.00 0.00 H ATOM 3121 N GLN A 216 45.287 22.237 48.538 1.00 27.36 N ATOM 3122 CA GLN A 216 44.214 23.234 48.718 1.00 25.45 C ATOM 3123 C GLN A 216 44.473 24.301 49.785 1.00 27.96 C ATOM 3124 O GLN A 216 43.829 25.349 49.790 1.00 28.59 O ATOM 3125 CB GLN A 216 42.864 22.567 48.916 1.00 27.59 C ATOM 3126 CG GLN A 216 42.570 21.478 47.898 1.00 40.19 C ATOM 3127 CD GLN A 216 41.132 21.019 47.988 1.00 74.09 C ATOM 3128 OE1 GLN A 216 40.632 20.317 47.112 1.00 72.10 O ATOM 3129 NE2 GLN A 216 40.452 21.422 49.058 1.00 72.66 N ATOM 3130 HA GLN A 216 44.204 23.790 47.780 1.00 0.00 H ATOM 3131 HB2 GLN A 216 42.841 22.124 49.912 1.00 0.00 H ATOM 3132 HB3 GLN A 216 42.088 23.329 48.840 1.00 0.00 H ATOM 3133 HG2 GLN A 216 42.758 21.867 46.897 1.00 0.00 H ATOM 3134 HG3 GLN A 216 43.227 20.629 48.086 1.00 0.00 H ATOM 3135 HE22 GLN A 216 40.915 22.016 49.775 1.00 0.00 H ATOM 3136 HE21 GLN A 216 39.457 21.143 49.177 1.00 0.00 H ATOM 3137 H GLN A 216 45.152 21.262 48.874 1.00 0.00 H ATOM 3138 N ALA A 217 45.442 24.063 50.667 1.00 25.46 N ATOM 3139 CA ALA A 217 45.788 25.046 51.702 1.00 26.39 C ATOM 3140 C ALA A 217 47.014 25.840 51.269 1.00 29.79 C ATOM 3141 O ALA A 217 47.456 26.758 51.947 1.00 28.69 O ATOM 3142 CB ALA A 217 46.127 24.323 53.000 1.00 28.55 C ATOM 3143 HA ALA A 217 44.939 25.714 51.849 1.00 0.00 H ATOM 3144 HB1 ALA A 217 45.265 23.741 53.326 1.00 0.00 H ATOM 3145 HB2 ALA A 217 46.974 23.658 52.833 1.00 0.00 H ATOM 3146 HB3 ALA A 217 46.383 25.055 53.766 1.00 0.00 H ATOM 3147 H ALA A 217 45.963 23.164 50.622 1.00 0.00 H ATOM 3148 N ALA A 218 47.604 25.443 50.155 1.00 28.43 N ATOM 3149 CA ALA A 218 48.829 26.087 49.675 1.00 28.45 C ATOM 3150 C ALA A 218 48.734 27.610 49.473 1.00 30.09 C ATOM 3151 O ALA A 218 49.569 28.383 49.969 1.00 29.18 O ATOM 3152 CB ALA A 218 49.273 25.397 48.379 1.00 28.90 C ATOM 3153 HA ALA A 218 49.570 25.965 50.465 1.00 0.00 H ATOM 3154 HB1 ALA A 218 49.462 24.342 48.577 1.00 0.00 H ATOM 3155 HB2 ALA A 218 48.487 25.492 47.630 1.00 0.00 H ATOM 3156 HB3 ALA A 218 50.185 25.868 48.012 1.00 0.00 H ATOM 3157 H ALA A 218 47.191 24.660 49.610 1.00 0.00 H ATOM 3158 N SER A 219 47.751 28.030 48.679 1.00 26.90 N ATOM 3159 CA SER A 219 47.569 29.444 48.347 1.00 25.25 C ATOM 3160 C SER A 219 46.852 30.092 49.514 1.00 31.26 C ATOM 3161 O SER A 219 45.668 29.833 49.758 1.00 28.97 O ATOM 3162 CB SER A 219 46.712 29.576 47.079 1.00 26.68 C ATOM 3163 OG SER A 219 46.659 30.922 46.656 1.00 28.78 O ATOM 3164 HA SER A 219 48.531 29.924 48.165 1.00 0.00 H ATOM 3165 HB2 SER A 219 45.702 29.226 47.291 1.00 0.00 H ATOM 3166 HB3 SER A 219 47.147 28.967 46.286 1.00 0.00 H ATOM 3167 HG SER A 219 46.104 30.988 45.839 1.00 0.00 H ATOM 3168 H SER A 219 47.091 27.331 48.282 1.00 0.00 H ATOM 3169 N ARG A 220 47.574 30.937 50.238 1.00 27.27 N ATOM 3170 CA ARG A 220 47.079 31.487 51.466 1.00 26.05 C ATOM 3171 C ARG A 220 47.588 32.890 51.652 1.00 29.93 C ATOM 3172 O ARG A 220 48.459 33.144 52.481 1.00 29.16 O ATOM 3173 CB ARG A 220 47.493 30.543 52.625 1.00 24.61 C ATOM 3174 CG ARG A 220 49.012 30.334 52.829 1.00 26.23 C ATOM 3175 CD ARG A 220 49.283 29.827 54.286 1.00 48.03 C ATOM 3176 NE ARG A 220 48.460 28.657 54.393 1.00 45.80 N ATOM 3177 CZ ARG A 220 47.512 28.381 55.269 1.00 38.69 C ATOM 3178 NH1 ARG A 220 47.404 28.952 56.460 1.00 36.68 N ATOM 3179 NH2 ARG A 220 46.755 27.356 54.970 1.00 31.38 N ATOM 3180 HA ARG A 220 45.991 31.555 51.450 1.00 0.00 H ATOM 3181 HB2 ARG A 220 47.087 30.954 53.549 1.00 0.00 H ATOM 3182 HB3 ARG A 220 47.046 29.567 52.435 1.00 0.00 H ATOM 3183 HG2 ARG A 220 49.376 29.596 52.114 1.00 0.00 H ATOM 3184 HG3 ARG A 220 49.533 31.278 52.671 1.00 0.00 H ATOM 3185 HD2 ARG A 220 48.991 30.578 55.021 1.00 0.00 H ATOM 3186 HD3 ARG A 220 50.335 29.577 54.422 1.00 0.00 H ATOM 3187 HE ARG A 220 48.635 27.922 53.679 1.00 0.00 H ATOM 3188 HH12 ARG A 220 46.628 28.682 57.098 1.00 0.00 H ATOM 3189 HH11 ARG A 220 48.095 29.670 56.757 1.00 0.00 H ATOM 3190 HH22 ARG A 220 45.985 27.074 55.610 1.00 0.00 H ATOM 3191 HH21 ARG A 220 46.923 26.824 54.093 1.00 0.00 H ATOM 3192 H ARG A 220 48.522 31.207 49.907 1.00 0.00 H ATOM 3193 N PRO A 221 47.053 33.836 50.847 1.00 25.56 N ATOM 3194 CA PRO A 221 47.474 35.241 50.832 1.00 23.95 C ATOM 3195 C PRO A 221 47.355 35.895 52.202 1.00 30.92 C ATOM 3196 O PRO A 221 46.340 35.772 52.877 1.00 31.76 O ATOM 3197 CB PRO A 221 46.495 35.892 49.824 1.00 23.83 C ATOM 3198 CG PRO A 221 46.082 34.746 48.933 1.00 27.18 C ATOM 3199 CD PRO A 221 45.968 33.585 49.871 1.00 25.60 C ATOM 3200 HA PRO A 221 48.523 35.355 50.559 1.00 0.00 H ATOM 3201 HD3 PRO A 221 44.995 33.572 50.362 1.00 0.00 H ATOM 3202 HD2 PRO A 221 46.122 32.642 49.347 1.00 0.00 H ATOM 3203 HG3 PRO A 221 46.837 34.556 48.170 1.00 0.00 H ATOM 3204 HG2 PRO A 221 45.126 34.953 48.453 1.00 0.00 H ATOM 3205 HB2 PRO A 221 45.632 36.315 50.338 1.00 0.00 H ATOM 3206 HB3 PRO A 221 46.992 36.673 49.248 1.00 0.00 H ATOM 3207 N TRP A 222 48.404 36.609 52.586 1.00 27.97 N ATOM 3208 CA TRP A 222 48.475 37.315 53.877 1.00 28.22 C ATOM 3209 C TRP A 222 48.606 36.423 55.115 1.00 32.22 C ATOM 3210 O TRP A 222 48.729 36.940 56.223 1.00 32.90 O ATOM 3211 CB TRP A 222 47.375 38.375 54.027 1.00 27.08 C ATOM 3212 CG TRP A 222 47.372 39.383 52.889 1.00 28.22 C ATOM 3213 CD1 TRP A 222 48.337 40.316 52.614 1.00 30.43 C ATOM 3214 CD2 TRP A 222 46.387 39.503 51.839 1.00 28.09 C ATOM 3215 NE1 TRP A 222 47.985 41.044 51.488 1.00 29.97 N ATOM 3216 CE2 TRP A 222 46.819 40.537 50.973 1.00 30.35 C ATOM 3217 CE3 TRP A 222 45.175 38.845 51.553 1.00 29.15 C ATOM 3218 CZ2 TRP A 222 46.078 40.940 49.861 1.00 29.66 C ATOM 3219 CZ3 TRP A 222 44.433 39.253 50.422 1.00 29.38 C ATOM 3220 CH2 TRP A 222 44.910 40.259 49.579 1.00 29.49 C ATOM 3221 HA TRP A 222 49.431 37.837 53.835 1.00 0.00 H ATOM 3222 HB2 TRP A 222 46.408 37.873 54.051 1.00 0.00 H ATOM 3223 HB3 TRP A 222 47.530 38.908 54.965 1.00 0.00 H ATOM 3224 HE1 TRP A 222 48.519 41.846 51.097 1.00 0.00 H ATOM 3225 HD1 TRP A 222 49.247 40.464 53.195 1.00 0.00 H ATOM 3226 HZ2 TRP A 222 46.411 41.767 49.234 1.00 0.00 H ATOM 3227 HH2 TRP A 222 44.349 40.512 48.680 1.00 0.00 H ATOM 3228 HZ3 TRP A 222 43.477 38.777 50.205 1.00 0.00 H ATOM 3229 HE3 TRP A 222 44.817 38.037 52.191 1.00 0.00 H ATOM 3230 H TRP A 222 49.219 36.674 51.943 1.00 0.00 H ATOM 3231 N ASP A 223 48.635 35.105 54.922 1.00 28.93 N ATOM 3232 CA ASP A 223 48.797 34.164 56.037 1.00 29.83 C ATOM 3233 C ASP A 223 50.278 33.983 56.348 1.00 37.52 C ATOM 3234 O ASP A 223 51.119 33.905 55.435 1.00 35.89 O ATOM 3235 CB ASP A 223 48.200 32.797 55.713 1.00 30.37 C ATOM 3236 CG ASP A 223 48.302 31.821 56.897 1.00 32.54 C ATOM 3237 OD1 ASP A 223 47.356 31.793 57.690 1.00 32.60 O ATOM 3238 OD2 ASP A 223 49.248 30.993 56.955 1.00 31.22 O ATOM 3239 HA ASP A 223 48.271 34.581 56.896 1.00 0.00 H ATOM 3240 HB2 ASP A 223 47.149 32.926 55.454 1.00 0.00 H ATOM 3241 HB3 ASP A 223 48.734 32.374 54.862 1.00 0.00 H ATOM 3242 H ASP A 223 48.540 34.733 53.955 1.00 0.00 H ATOM 3243 N LYS A 224 50.608 33.896 57.636 1.00 34.17 N ATOM 3244 CA LYS A 224 52.017 33.777 58.026 1.00 33.91 C ATOM 3245 C LYS A 224 52.751 32.572 57.465 1.00 34.41 C ATOM 3246 O LYS A 224 53.987 32.568 57.373 1.00 34.74 O ATOM 3247 CB LYS A 224 52.170 33.829 59.552 1.00 36.32 C ATOM 3248 CG LYS A 224 51.786 35.175 60.172 1.00 40.06 C ATOM 3249 CD LYS A 224 51.369 34.935 61.619 1.00 55.70 C ATOM 3250 CE LYS A 224 51.756 36.060 62.554 1.00 64.60 C ATOM 3251 NZ LYS A 224 51.362 35.710 63.961 1.00 68.93 N ATOM 3252 HA LYS A 224 52.498 34.642 57.568 1.00 0.00 H ATOM 3253 HB2 LYS A 224 51.534 33.058 59.987 1.00 0.00 H ATOM 3254 HB3 LYS A 224 53.211 33.622 59.799 1.00 0.00 H ATOM 3255 HG2 LYS A 224 52.640 35.852 60.142 1.00 0.00 H ATOM 3256 HG3 LYS A 224 50.957 35.613 59.617 1.00 0.00 H ATOM 3257 HD2 LYS A 224 50.286 34.817 61.651 1.00 0.00 H ATOM 3258 HD3 LYS A 224 51.844 34.018 61.967 1.00 0.00 H ATOM 3259 HE2 LYS A 224 51.245 36.974 62.252 1.00 0.00 H ATOM 3260 HE3 LYS A 224 52.834 36.215 62.508 1.00 0.00 H ATOM 3261 HZ1 LYS A 224 50.333 35.563 64.005 1.00 0.00 H ATOM 3262 HZ2 LYS A 224 51.850 34.838 64.250 1.00 0.00 H ATOM 3263 HZ3 LYS A 224 51.631 36.487 64.598 1.00 0.00 H ATOM 3264 H LYS A 224 49.866 33.912 58.365 1.00 0.00 H ATOM 3265 N GLU A 225 52.020 31.503 57.179 1.00 29.07 N ATOM 3266 CA GLU A 225 52.669 30.315 56.670 1.00 27.91 C ATOM 3267 C GLU A 225 52.778 30.238 55.136 1.00 32.79 C ATOM 3268 O GLU A 225 53.171 29.198 54.593 1.00 30.90 O ATOM 3269 CB GLU A 225 51.988 29.079 57.214 1.00 28.52 C ATOM 3270 CG GLU A 225 52.168 28.955 58.734 1.00 40.57 C ATOM 3271 CD GLU A 225 51.500 27.714 59.272 1.00 57.05 C ATOM 3272 OE1 GLU A 225 52.131 26.641 59.223 1.00 60.13 O ATOM 3273 OE2 GLU A 225 50.313 27.796 59.655 1.00 53.34 O ATOM 3274 HA GLU A 225 53.698 30.372 57.024 1.00 0.00 H ATOM 3275 HB2 GLU A 225 50.923 29.133 56.987 1.00 0.00 H ATOM 3276 HB3 GLU A 225 52.416 28.199 56.734 1.00 0.00 H ATOM 3277 HG2 GLU A 225 53.233 28.911 58.962 1.00 0.00 H ATOM 3278 HG3 GLU A 225 51.730 29.830 59.215 1.00 0.00 H ATOM 3279 H GLU A 225 50.990 31.519 57.319 1.00 0.00 H ATOM 3280 N ARG A 226 52.430 31.326 54.445 1.00 30.79 N ATOM 3281 CA ARG A 226 52.507 31.338 52.974 1.00 30.72 C ATOM 3282 C ARG A 226 53.931 31.123 52.464 1.00 35.51 C ATOM 3283 O ARG A 226 54.901 31.566 53.093 1.00 33.92 O ATOM 3284 CB ARG A 226 51.906 32.624 52.405 1.00 28.82 C ATOM 3285 CG ARG A 226 52.789 33.872 52.523 1.00 29.25 C ATOM 3286 CD ARG A 226 51.912 35.058 52.227 1.00 21.89 C ATOM 3287 NE ARG A 226 52.504 36.379 52.406 1.00 28.85 N ATOM 3288 CZ ARG A 226 52.485 37.070 53.540 1.00 37.93 C ATOM 3289 NH1 ARG A 226 51.961 36.536 54.636 1.00 32.32 N ATOM 3290 NH2 ARG A 226 52.983 38.298 53.575 1.00 26.74 N ATOM 3291 HA ARG A 226 51.914 30.495 52.618 1.00 0.00 H ATOM 3292 HB2 ARG A 226 51.697 32.459 51.348 1.00 0.00 H ATOM 3293 HB3 ARG A 226 50.973 32.821 52.932 1.00 0.00 H ATOM 3294 HG2 ARG A 226 53.197 33.949 53.531 1.00 0.00 H ATOM 3295 HG3 ARG A 226 53.607 33.822 51.805 1.00 0.00 H ATOM 3296 HD2 ARG A 226 51.042 34.996 52.881 1.00 0.00 H ATOM 3297 HD3 ARG A 226 51.591 34.979 51.188 1.00 0.00 H ATOM 3298 HE ARG A 226 52.975 36.811 51.586 1.00 0.00 H ATOM 3299 HH12 ARG A 226 51.947 37.078 55.523 1.00 0.00 H ATOM 3300 HH11 ARG A 226 51.564 35.575 54.608 1.00 0.00 H ATOM 3301 HH22 ARG A 226 52.969 38.840 54.463 1.00 0.00 H ATOM 3302 HH21 ARG A 226 53.388 38.720 52.715 1.00 0.00 H ATOM 3303 H ARG A 226 52.101 32.173 54.950 1.00 0.00 H ATOM 3304 N ASP A 227 54.056 30.395 51.355 1.00 30.82 N ATOM 3305 CA ASP A 227 55.360 30.075 50.806 1.00 28.59 C ATOM 3306 C ASP A 227 55.466 30.197 49.274 1.00 29.63 C ATOM 3307 O ASP A 227 56.235 29.468 48.660 1.00 26.87 O ATOM 3308 CB ASP A 227 55.796 28.671 51.248 1.00 29.36 C ATOM 3309 CG ASP A 227 54.989 27.561 50.587 1.00 30.49 C ATOM 3310 OD1 ASP A 227 53.750 27.674 50.469 1.00 30.60 O ATOM 3311 OD2 ASP A 227 55.581 26.516 50.272 1.00 30.11 O ATOM 3312 HA ASP A 227 56.032 30.832 51.210 1.00 0.00 H ATOM 3313 HB2 ASP A 227 56.847 28.537 50.992 1.00 0.00 H ATOM 3314 HB3 ASP A 227 55.674 28.593 52.328 1.00 0.00 H ATOM 3315 H ASP A 227 53.202 30.049 50.873 1.00 0.00 H ATOM 3316 N GLY A 228 54.729 31.120 48.664 1.00 28.28 N ATOM 3317 CA GLY A 228 54.802 31.314 47.214 1.00 27.43 C ATOM 3318 C GLY A 228 53.457 31.113 46.538 1.00 30.23 C ATOM 3319 O GLY A 228 52.502 30.654 47.159 1.00 25.50 O ATOM 3320 HA3 GLY A 228 55.513 30.600 46.800 1.00 0.00 H ATOM 3321 HA2 GLY A 228 55.148 32.328 47.013 1.00 0.00 H ATOM 3322 H GLY A 228 54.089 31.716 49.227 1.00 0.00 H ATOM 3323 N PHE A 229 53.371 31.451 45.253 1.00 26.95 N ATOM 3324 CA PHE A 229 52.086 31.346 44.554 1.00 24.99 C ATOM 3325 C PHE A 229 51.808 29.976 44.020 1.00 26.56 C ATOM 3326 O PHE A 229 52.660 29.073 44.084 1.00 25.84 O ATOM 3327 CB PHE A 229 51.896 32.461 43.502 1.00 25.65 C ATOM 3328 CG PHE A 229 52.690 32.258 42.223 1.00 27.34 C ATOM 3329 CD1 PHE A 229 52.125 31.600 41.132 1.00 27.87 C ATOM 3330 CD2 PHE A 229 53.923 32.885 42.047 1.00 29.42 C ATOM 3331 CE1 PHE A 229 52.816 31.447 39.927 1.00 28.18 C ATOM 3332 CE2 PHE A 229 54.616 32.752 40.848 1.00 30.81 C ATOM 3333 CZ PHE A 229 54.060 32.036 39.782 1.00 28.08 C ATOM 3334 HA PHE A 229 51.320 31.511 45.312 1.00 0.00 H ATOM 3335 HB2 PHE A 229 50.838 32.509 43.243 1.00 0.00 H ATOM 3336 HB3 PHE A 229 52.203 33.407 43.948 1.00 0.00 H ATOM 3337 HD2 PHE A 229 54.347 33.483 42.854 1.00 0.00 H ATOM 3338 HE2 PHE A 229 55.599 33.209 40.738 1.00 0.00 H ATOM 3339 HZ PHE A 229 54.604 31.943 38.842 1.00 0.00 H ATOM 3340 HE1 PHE A 229 52.380 30.871 39.111 1.00 0.00 H ATOM 3341 HD1 PHE A 229 51.117 31.194 41.221 1.00 0.00 H ATOM 3342 H PHE A 229 54.214 31.789 44.746 1.00 0.00 H ATOM 3343 N VAL A 230 50.546 29.777 43.666 1.00 23.03 N ATOM 3344 CA VAL A 230 50.074 28.530 43.104 1.00 22.68 C ATOM 3345 C VAL A 230 49.673 28.834 41.651 1.00 25.00 C ATOM 3346 O VAL A 230 48.940 29.784 41.389 1.00 22.54 O ATOM 3347 CB VAL A 230 48.866 27.999 43.890 1.00 26.60 C ATOM 3348 CG1 VAL A 230 48.338 26.724 43.203 1.00 26.16 C ATOM 3349 CG2 VAL A 230 49.288 27.734 45.331 1.00 27.06 C ATOM 3350 HA VAL A 230 50.848 27.764 43.152 1.00 0.00 H ATOM 3351 HB VAL A 230 48.059 28.732 43.904 1.00 0.00 H ATOM 3352 HG11 VAL A 230 48.037 26.961 42.183 1.00 0.00 H ATOM 3353 HG12 VAL A 230 49.125 25.970 43.185 1.00 0.00 H ATOM 3354 HG13 VAL A 230 47.480 26.343 43.757 1.00 0.00 H ATOM 3355 HG21 VAL A 230 50.089 26.995 45.344 1.00 0.00 H ATOM 3356 HG22 VAL A 230 49.641 28.662 45.781 1.00 0.00 H ATOM 3357 HG23 VAL A 230 48.435 27.357 45.895 1.00 0.00 H ATOM 3358 H VAL A 230 49.865 30.552 43.798 1.00 0.00 H ATOM 3359 N LEU A 231 50.191 28.059 40.715 1.00 24.50 N ATOM 3360 CA LEU A 231 49.927 28.319 39.291 1.00 27.16 C ATOM 3361 C LEU A 231 48.503 27.849 38.974 1.00 28.15 C ATOM 3362 O LEU A 231 48.096 26.798 39.448 1.00 28.14 O ATOM 3363 CB LEU A 231 50.902 27.480 38.468 1.00 28.26 C ATOM 3364 CG LEU A 231 51.663 27.852 37.187 1.00 37.43 C ATOM 3365 CD1 LEU A 231 51.678 29.330 36.835 1.00 39.08 C ATOM 3366 CD2 LEU A 231 53.089 27.315 37.337 1.00 41.37 C ATOM 3367 HA LEU A 231 50.041 29.379 39.063 1.00 0.00 H ATOM 3368 HB2 LEU A 231 51.684 27.203 39.175 1.00 0.00 H ATOM 3369 HB3 LEU A 231 50.331 26.593 38.194 1.00 0.00 H ATOM 3370 HG LEU A 231 51.131 27.399 36.351 1.00 0.00 H ATOM 3371 HD21 LEU A 231 53.558 27.771 38.209 1.00 0.00 H ATOM 3372 HD22 LEU A 231 53.057 26.233 37.465 1.00 0.00 H ATOM 3373 HD23 LEU A 231 53.664 27.560 36.444 1.00 0.00 H ATOM 3374 HD11 LEU A 231 50.655 29.679 36.696 1.00 0.00 H ATOM 3375 HD12 LEU A 231 52.148 29.890 37.644 1.00 0.00 H ATOM 3376 HD13 LEU A 231 52.242 29.477 35.914 1.00 0.00 H ATOM 3377 H LEU A 231 50.792 27.256 40.988 1.00 0.00 H ATOM 3378 N GLY A 232 47.754 28.643 38.218 1.00 24.12 N ATOM 3379 CA GLY A 232 46.404 28.338 37.777 1.00 24.74 C ATOM 3380 C GLY A 232 46.261 28.576 36.271 1.00 26.77 C ATOM 3381 O GLY A 232 46.913 29.466 35.720 1.00 26.69 O ATOM 3382 HA3 GLY A 232 45.700 28.978 38.309 1.00 0.00 H ATOM 3383 HA2 GLY A 232 46.182 27.294 37.997 1.00 0.00 H ATOM 3384 H GLY A 232 48.164 29.551 37.919 1.00 0.00 H ATOM 3385 N ASP A 233 45.453 27.758 35.597 1.00 24.23 N ATOM 3386 CA ASP A 233 45.234 27.878 34.142 1.00 22.61 C ATOM 3387 C ASP A 233 43.813 28.383 33.889 1.00 25.91 C ATOM 3388 O ASP A 233 42.908 28.170 34.719 1.00 21.49 O ATOM 3389 CB ASP A 233 45.287 26.518 33.434 1.00 24.20 C ATOM 3390 CG ASP A 233 46.581 25.751 33.662 1.00 28.60 C ATOM 3391 OD1 ASP A 233 47.661 26.356 33.732 1.00 25.00 O ATOM 3392 OD2 ASP A 233 46.528 24.506 33.591 1.00 25.87 O ATOM 3393 HA ASP A 233 46.012 28.543 33.768 1.00 0.00 H ATOM 3394 HB2 ASP A 233 44.459 25.910 33.798 1.00 0.00 H ATOM 3395 HB3 ASP A 233 45.171 26.684 32.363 1.00 0.00 H ATOM 3396 H ASP A 233 44.957 27.006 36.116 1.00 0.00 H ATOM 3397 N GLY A 234 43.580 28.969 32.712 1.00 21.95 N ATOM 3398 CA GLY A 234 42.231 29.399 32.356 1.00 22.74 C ATOM 3399 C GLY A 234 42.160 30.555 31.403 1.00 24.93 C ATOM 3400 O GLY A 234 43.130 30.904 30.751 1.00 23.04 O ATOM 3401 HA3 GLY A 234 41.715 29.685 33.273 1.00 0.00 H ATOM 3402 HA2 GLY A 234 41.717 28.553 31.900 1.00 0.00 H ATOM 3403 H GLY A 234 44.364 29.120 32.045 1.00 0.00 H ATOM 3404 N ALA A 235 41.006 31.197 31.346 1.00 21.20 N ATOM 3405 CA ALA A 235 40.866 32.338 30.460 1.00 19.30 C ATOM 3406 C ALA A 235 39.675 33.127 30.908 1.00 25.40 C ATOM 3407 O ALA A 235 38.730 32.554 31.420 1.00 24.34 O ATOM 3408 CB ALA A 235 40.682 31.879 29.023 1.00 19.09 C ATOM 3409 HA ALA A 235 41.765 32.953 30.499 1.00 0.00 H ATOM 3410 HB1 ALA A 235 41.550 31.296 28.715 1.00 0.00 H ATOM 3411 HB2 ALA A 235 39.785 31.263 28.952 1.00 0.00 H ATOM 3412 HB3 ALA A 235 40.579 32.750 28.375 1.00 0.00 H ATOM 3413 H ALA A 235 40.204 30.887 31.932 1.00 0.00 H ATOM 3414 N GLY A 236 39.737 34.443 30.750 1.00 22.94 N ATOM 3415 CA GLY A 236 38.629 35.302 31.118 1.00 22.66 C ATOM 3416 C GLY A 236 38.485 36.261 29.961 1.00 26.02 C ATOM 3417 O GLY A 236 39.488 36.776 29.458 1.00 23.92 O ATOM 3418 HA3 GLY A 236 38.850 35.841 32.039 1.00 0.00 H ATOM 3419 HA2 GLY A 236 37.718 34.719 31.250 1.00 0.00 H ATOM 3420 H GLY A 236 40.600 34.867 30.353 1.00 0.00 H ATOM 3421 N MET A 237 37.256 36.489 29.525 1.00 22.26 N ATOM 3422 CA MET A 237 36.969 37.438 28.427 1.00 20.67 C ATOM 3423 C MET A 237 35.734 38.271 28.718 1.00 26.68 C ATOM 3424 O MET A 237 34.748 37.780 29.279 1.00 25.84 O ATOM 3425 CB MET A 237 36.747 36.722 27.120 1.00 22.76 C ATOM 3426 CG MET A 237 37.845 35.788 26.752 1.00 24.58 C ATOM 3427 SD MET A 237 39.198 36.713 25.994 1.00 26.56 S ATOM 3428 CE MET A 237 40.431 35.507 26.154 1.00 22.41 C ATOM 3429 HA MET A 237 37.843 38.085 28.351 1.00 0.00 H ATOM 3430 HB2 MET A 237 35.821 36.152 27.193 1.00 0.00 H ATOM 3431 HB3 MET A 237 36.651 37.468 26.331 1.00 0.00 H ATOM 3432 HG2 MET A 237 37.470 35.048 26.045 1.00 0.00 H ATOM 3433 HG3 MET A 237 38.207 35.283 27.647 1.00 0.00 H ATOM 3434 HE1 MET A 237 40.571 35.270 27.209 1.00 0.00 H ATOM 3435 HE2 MET A 237 40.131 34.608 25.615 1.00 0.00 H ATOM 3436 HE3 MET A 237 41.365 35.886 25.738 1.00 0.00 H ATOM 3437 H MET A 237 36.464 35.983 29.970 1.00 0.00 H ATOM 3438 N LEU A 238 35.789 39.535 28.314 1.00 23.65 N ATOM 3439 CA LEU A 238 34.682 40.462 28.500 1.00 24.54 C ATOM 3440 C LEU A 238 34.431 41.109 27.152 1.00 29.43 C ATOM 3441 O LEU A 238 35.369 41.420 26.413 1.00 28.38 O ATOM 3442 CB LEU A 238 35.074 41.597 29.479 1.00 24.11 C ATOM 3443 CG LEU A 238 35.358 41.345 30.969 1.00 27.69 C ATOM 3444 CD1 LEU A 238 36.551 40.443 31.163 1.00 28.91 C ATOM 3445 CD2 LEU A 238 35.621 42.674 31.665 1.00 27.46 C ATOM 3446 HA LEU A 238 33.816 39.929 28.893 1.00 0.00 H ATOM 3447 HB2 LEU A 238 35.978 42.049 29.071 1.00 0.00 H ATOM 3448 HB3 LEU A 238 34.260 42.321 29.445 1.00 0.00 H ATOM 3449 HG LEU A 238 34.485 40.854 31.399 1.00 0.00 H ATOM 3450 HD21 LEU A 238 36.483 43.159 31.206 1.00 0.00 H ATOM 3451 HD22 LEU A 238 34.745 43.315 31.564 1.00 0.00 H ATOM 3452 HD23 LEU A 238 35.822 42.496 32.721 1.00 0.00 H ATOM 3453 HD11 LEU A 238 36.362 39.484 30.682 1.00 0.00 H ATOM 3454 HD12 LEU A 238 37.432 40.907 30.718 1.00 0.00 H ATOM 3455 HD13 LEU A 238 36.719 40.289 32.229 1.00 0.00 H ATOM 3456 H LEU A 238 36.654 39.875 27.848 1.00 0.00 H ATOM 3457 N VAL A 239 33.165 41.354 26.840 1.00 26.62 N ATOM 3458 CA VAL A 239 32.841 42.139 25.673 1.00 24.90 C ATOM 3459 C VAL A 239 32.655 43.547 26.241 1.00 27.75 C ATOM 3460 O VAL A 239 31.815 43.741 27.120 1.00 25.72 O ATOM 3461 CB VAL A 239 31.554 41.650 24.975 1.00 27.88 C ATOM 3462 CG1 VAL A 239 31.100 42.714 23.954 1.00 27.37 C ATOM 3463 CG2 VAL A 239 31.810 40.312 24.298 1.00 27.02 C ATOM 3464 HA VAL A 239 33.612 42.076 24.905 1.00 0.00 H ATOM 3465 HB VAL A 239 30.761 41.508 25.709 1.00 0.00 H ATOM 3466 HG11 VAL A 239 30.904 43.653 24.472 1.00 0.00 H ATOM 3467 HG12 VAL A 239 31.886 42.864 23.214 1.00 0.00 H ATOM 3468 HG13 VAL A 239 30.191 42.375 23.457 1.00 0.00 H ATOM 3469 HG21 VAL A 239 32.601 40.427 23.557 1.00 0.00 H ATOM 3470 HG22 VAL A 239 32.115 39.580 25.046 1.00 0.00 H ATOM 3471 HG23 VAL A 239 30.897 39.974 23.808 1.00 0.00 H ATOM 3472 H VAL A 239 32.402 40.979 27.439 1.00 0.00 H ATOM 3473 N LEU A 240 33.457 44.519 25.774 1.00 23.46 N ATOM 3474 CA LEU A 240 33.331 45.908 26.208 1.00 23.59 C ATOM 3475 C LEU A 240 32.650 46.613 25.053 1.00 26.61 C ATOM 3476 O LEU A 240 32.814 46.212 23.920 1.00 27.36 O ATOM 3477 CB LEU A 240 34.711 46.549 26.445 1.00 24.69 C ATOM 3478 CG LEU A 240 35.622 45.833 27.469 1.00 29.93 C ATOM 3479 CD1 LEU A 240 36.916 46.634 27.609 1.00 29.87 C ATOM 3480 CD2 LEU A 240 34.944 45.762 28.798 1.00 28.84 C ATOM 3481 HA LEU A 240 32.779 45.980 27.145 1.00 0.00 H ATOM 3482 HB2 LEU A 240 35.236 46.574 25.490 1.00 0.00 H ATOM 3483 HB3 LEU A 240 34.550 47.568 26.796 1.00 0.00 H ATOM 3484 HG LEU A 240 35.834 44.821 27.125 1.00 0.00 H ATOM 3485 HD21 LEU A 240 34.732 46.771 29.151 1.00 0.00 H ATOM 3486 HD22 LEU A 240 34.011 45.207 28.699 1.00 0.00 H ATOM 3487 HD23 LEU A 240 35.596 45.256 29.510 1.00 0.00 H ATOM 3488 HD11 LEU A 240 37.414 46.689 26.641 1.00 0.00 H ATOM 3489 HD12 LEU A 240 36.683 47.640 27.957 1.00 0.00 H ATOM 3490 HD13 LEU A 240 37.570 46.142 28.329 1.00 0.00 H ATOM 3491 H LEU A 240 34.192 44.274 25.080 1.00 0.00 H ATOM 3492 N GLU A 241 31.888 47.656 25.336 1.00 25.88 N ATOM 3493 CA GLU A 241 31.062 48.274 24.301 1.00 26.52 C ATOM 3494 C GLU A 241 30.704 49.731 24.641 1.00 30.77 C ATOM 3495 O GLU A 241 30.371 50.034 25.763 1.00 29.81 O ATOM 3496 CB GLU A 241 29.770 47.456 24.193 1.00 27.02 C ATOM 3497 CG GLU A 241 28.869 47.820 23.011 1.00 30.89 C ATOM 3498 CD GLU A 241 27.730 46.835 22.829 1.00 41.11 C ATOM 3499 OE1 GLU A 241 26.884 47.073 21.946 1.00 34.67 O ATOM 3500 OE2 GLU A 241 27.704 45.797 23.530 1.00 30.86 O ATOM 3501 HA GLU A 241 31.619 48.284 23.364 1.00 0.00 H ATOM 3502 HB2 GLU A 241 30.042 46.405 24.099 1.00 0.00 H ATOM 3503 HB3 GLU A 241 29.200 47.602 25.110 1.00 0.00 H ATOM 3504 HG2 GLU A 241 28.451 48.812 23.181 1.00 0.00 H ATOM 3505 HG3 GLU A 241 29.471 47.832 22.102 1.00 0.00 H ATOM 3506 H GLU A 241 31.876 48.039 26.303 1.00 0.00 H ATOM 3507 N GLU A 242 30.769 50.619 23.656 1.00 28.83 N ATOM 3508 CA GLU A 242 30.417 52.005 23.888 1.00 28.67 C ATOM 3509 C GLU A 242 28.966 52.049 24.402 1.00 34.62 C ATOM 3510 O GLU A 242 28.110 51.287 23.955 1.00 33.39 O ATOM 3511 CB GLU A 242 30.582 52.835 22.611 1.00 29.13 C ATOM 3512 CG GLU A 242 30.366 54.308 22.890 1.00 29.74 C ATOM 3513 CD GLU A 242 28.897 54.687 22.736 1.00 40.75 C ATOM 3514 OE1 GLU A 242 28.194 54.020 21.944 1.00 34.42 O ATOM 3515 OE2 GLU A 242 28.452 55.652 23.383 1.00 34.72 O ATOM 3516 HA GLU A 242 31.084 52.441 24.632 1.00 0.00 H ATOM 3517 HB2 GLU A 242 31.589 52.690 22.219 1.00 0.00 H ATOM 3518 HB3 GLU A 242 29.854 52.501 21.872 1.00 0.00 H ATOM 3519 HG2 GLU A 242 30.686 54.528 23.909 1.00 0.00 H ATOM 3520 HG3 GLU A 242 30.960 54.894 22.189 1.00 0.00 H ATOM 3521 H GLU A 242 31.075 50.317 22.709 1.00 0.00 H ATOM 3522 N TYR A 243 28.714 52.911 25.375 1.00 32.26 N ATOM 3523 CA TYR A 243 27.420 52.941 26.040 1.00 34.52 C ATOM 3524 C TYR A 243 26.191 53.115 25.141 1.00 37.75 C ATOM 3525 O TYR A 243 25.258 52.322 25.212 1.00 36.89 O ATOM 3526 CB TYR A 243 27.430 53.935 27.197 1.00 36.71 C ATOM 3527 CG TYR A 243 26.194 53.905 28.083 1.00 42.67 C ATOM 3528 CD1 TYR A 243 25.649 52.710 28.531 1.00 45.21 C ATOM 3529 CD2 TYR A 243 25.625 55.081 28.531 1.00 45.77 C ATOM 3530 CE1 TYR A 243 24.552 52.693 29.399 1.00 48.20 C ATOM 3531 CE2 TYR A 243 24.521 55.081 29.377 1.00 48.27 C ATOM 3532 CZ TYR A 243 23.985 53.891 29.806 1.00 58.80 C ATOM 3533 OH TYR A 243 22.877 53.916 30.633 1.00 64.16 O ATOM 3534 HA TYR A 243 27.293 51.930 26.427 1.00 0.00 H ATOM 3535 HB3 TYR A 243 27.523 54.938 26.780 1.00 0.00 H ATOM 3536 HB2 TYR A 243 28.298 53.720 27.820 1.00 0.00 H ATOM 3537 HD2 TYR A 243 26.052 56.033 28.214 1.00 0.00 H ATOM 3538 HE2 TYR A 243 24.081 56.025 29.700 1.00 0.00 H ATOM 3539 HE1 TYR A 243 24.146 51.745 29.753 1.00 0.00 H ATOM 3540 HD1 TYR A 243 26.084 51.767 28.200 1.00 0.00 H ATOM 3541 HH TYR A 243 23.099 54.404 31.465 1.00 0.00 H ATOM 3542 H TYR A 243 29.455 53.579 25.669 1.00 0.00 H ATOM 3543 N GLU A 244 26.193 54.123 24.276 1.00 32.78 N ATOM 3544 CA GLU A 244 25.012 54.337 23.432 1.00 31.41 C ATOM 3545 C GLU A 244 24.746 53.217 22.459 1.00 38.36 C ATOM 3546 O GLU A 244 23.590 52.941 22.110 1.00 38.87 O ATOM 3547 CB GLU A 244 25.068 55.679 22.731 1.00 32.17 C ATOM 3548 CG GLU A 244 25.305 56.806 23.691 1.00 38.97 C ATOM 3549 CD GLU A 244 24.074 57.143 24.504 1.00 56.36 C ATOM 3550 OE1 GLU A 244 22.996 56.562 24.252 1.00 43.41 O ATOM 3551 OE2 GLU A 244 24.184 58.032 25.366 1.00 53.25 O ATOM 3552 HA GLU A 244 24.161 54.341 24.113 1.00 0.00 H ATOM 3553 HB2 GLU A 244 25.878 55.662 22.002 1.00 0.00 H ATOM 3554 HB3 GLU A 244 24.122 55.847 22.217 1.00 0.00 H ATOM 3555 HG2 GLU A 244 26.107 56.523 24.372 1.00 0.00 H ATOM 3556 HG3 GLU A 244 25.604 57.689 23.127 1.00 0.00 H ATOM 3557 H GLU A 244 27.019 54.751 24.198 1.00 0.00 H ATOM 3558 N HIS A 245 25.827 52.574 22.011 1.00 33.27 N ATOM 3559 CA HIS A 245 25.742 51.451 21.108 1.00 32.75 C ATOM 3560 C HIS A 245 25.094 50.260 21.838 1.00 36.04 C ATOM 3561 O HIS A 245 24.316 49.508 21.243 1.00 34.60 O ATOM 3562 CB HIS A 245 27.170 51.074 20.637 1.00 33.08 C ATOM 3563 CG HIS A 245 27.206 50.019 19.578 1.00 34.51 C ATOM 3564 ND1 HIS A 245 27.177 48.671 19.872 1.00 35.47 N ATOM 3565 CD2 HIS A 245 27.329 50.109 18.233 1.00 36.18 C ATOM 3566 CE1 HIS A 245 27.234 47.976 18.748 1.00 34.89 C ATOM 3567 NE2 HIS A 245 27.339 48.823 17.738 1.00 35.51 N ATOM 3568 HA HIS A 245 25.133 51.711 20.242 1.00 0.00 H ATOM 3569 HB2 HIS A 245 27.649 51.971 20.243 1.00 0.00 H ATOM 3570 HB3 HIS A 245 27.731 50.713 21.499 1.00 0.00 H ATOM 3571 HD2 HIS A 245 27.406 51.027 17.650 1.00 0.00 H ATOM 3572 HE1 HIS A 245 27.200 46.889 18.668 1.00 0.00 H ATOM 3573 H HIS A 245 26.766 52.894 22.324 1.00 0.00 H ATOM 3574 N ALA A 246 25.458 50.056 23.111 1.00 34.05 N ATOM 3575 CA ALA A 246 24.892 48.944 23.893 1.00 33.50 C ATOM 3576 C ALA A 246 23.360 49.102 24.015 1.00 38.68 C ATOM 3577 O ALA A 246 22.605 48.233 23.568 1.00 36.47 O ATOM 3578 CB ALA A 246 25.542 48.861 25.289 1.00 33.60 C ATOM 3579 HA ALA A 246 25.107 48.013 23.368 1.00 0.00 H ATOM 3580 HB1 ALA A 246 26.615 48.701 25.180 1.00 0.00 H ATOM 3581 HB2 ALA A 246 25.365 49.792 25.827 1.00 0.00 H ATOM 3582 HB3 ALA A 246 25.104 48.031 25.843 1.00 0.00 H ATOM 3583 H ALA A 246 26.151 50.693 23.554 1.00 0.00 H ATOM 3584 N LYS A 247 22.920 50.226 24.584 1.00 37.18 N ATOM 3585 CA LYS A 247 21.477 50.520 24.731 1.00 38.04 C ATOM 3586 C LYS A 247 20.673 50.367 23.423 1.00 43.44 C ATOM 3587 O LYS A 247 19.678 49.656 23.362 1.00 43.91 O ATOM 3588 CB LYS A 247 21.294 51.951 25.225 1.00 40.58 C ATOM 3589 CG LYS A 247 21.851 52.236 26.618 1.00 52.67 C ATOM 3590 CD LYS A 247 22.140 53.719 26.764 1.00 64.25 C ATOM 3591 CE LYS A 247 21.234 54.368 27.795 1.00 86.73 C ATOM 3592 NZ LYS A 247 21.254 55.859 27.700 1.00 97.19 N ATOM 3593 HA LYS A 247 21.095 49.788 25.443 1.00 0.00 H ATOM 3594 HB2 LYS A 247 21.791 52.617 24.520 1.00 0.00 H ATOM 3595 HB3 LYS A 247 20.226 52.169 25.238 1.00 0.00 H ATOM 3596 HG2 LYS A 247 21.121 51.934 27.369 1.00 0.00 H ATOM 3597 HG3 LYS A 247 22.772 51.672 26.762 1.00 0.00 H ATOM 3598 HD2 LYS A 247 23.177 53.848 27.073 1.00 0.00 H ATOM 3599 HD3 LYS A 247 21.986 54.206 25.801 1.00 0.00 H ATOM 3600 HE2 LYS A 247 21.567 54.074 28.791 1.00 0.00 H ATOM 3601 HE3 LYS A 247 20.214 54.019 27.636 1.00 0.00 H ATOM 3602 HZ1 LYS A 247 22.223 56.202 27.857 1.00 0.00 H ATOM 3603 HZ2 LYS A 247 20.931 56.149 26.755 1.00 0.00 H ATOM 3604 HZ3 LYS A 247 20.622 56.260 28.422 1.00 0.00 H ATOM 3605 H LYS A 247 23.613 50.917 24.935 1.00 0.00 H ATOM 3606 N LYS A 248 21.094 51.081 22.390 1.00 40.63 N ATOM 3607 CA LYS A 248 20.414 51.062 21.103 1.00 40.27 C ATOM 3608 C LYS A 248 20.115 49.655 20.612 1.00 45.32 C ATOM 3609 O LYS A 248 19.126 49.436 19.906 1.00 44.17 O ATOM 3610 CB LYS A 248 21.225 51.843 20.064 1.00 42.59 C ATOM 3611 CG LYS A 248 20.650 51.839 18.663 1.00 64.00 C ATOM 3612 CD LYS A 248 21.359 52.856 17.770 1.00 81.96 C ATOM 3613 CE LYS A 248 22.219 53.822 18.595 1.00102.86 C ATOM 3614 NZ LYS A 248 21.803 55.255 18.471 1.00113.49 N ATOM 3615 HA LYS A 248 19.449 51.548 21.244 1.00 0.00 H ATOM 3616 HB2 LYS A 248 21.294 52.878 20.398 1.00 0.00 H ATOM 3617 HB3 LYS A 248 22.224 51.410 20.020 1.00 0.00 H ATOM 3618 HG2 LYS A 248 20.769 50.845 18.233 1.00 0.00 H ATOM 3619 HG3 LYS A 248 19.590 52.088 18.713 1.00 0.00 H ATOM 3620 HD2 LYS A 248 21.999 52.325 17.065 1.00 0.00 H ATOM 3621 HD3 LYS A 248 20.611 53.428 17.220 1.00 0.00 H ATOM 3622 HE2 LYS A 248 23.253 53.733 18.261 1.00 0.00 H ATOM 3623 HE3 LYS A 248 22.151 53.533 19.644 1.00 0.00 H ATOM 3624 HZ1 LYS A 248 21.873 55.550 17.476 1.00 0.00 H ATOM 3625 HZ2 LYS A 248 20.821 55.359 18.797 1.00 0.00 H ATOM 3626 HZ3 LYS A 248 22.427 55.848 19.054 1.00 0.00 H ATOM 3627 H LYS A 248 21.940 51.676 22.502 1.00 0.00 H ATOM 3628 N ARG A 249 20.946 48.684 20.979 1.00 40.38 N ATOM 3629 CA ARG A 249 20.678 47.307 20.549 1.00 39.96 C ATOM 3630 C ARG A 249 20.009 46.484 21.644 1.00 43.78 C ATOM 3631 O ARG A 249 19.830 45.264 21.500 1.00 44.35 O ATOM 3632 CB ARG A 249 21.953 46.584 20.097 1.00 43.10 C ATOM 3633 CG ARG A 249 23.000 46.427 21.198 1.00 34.15 C ATOM 3634 CD ARG A 249 24.259 45.711 20.667 1.00 46.68 C ATOM 3635 NE ARG A 249 24.123 44.298 20.951 1.00 61.81 N ATOM 3636 CZ ARG A 249 24.742 43.653 21.926 1.00 68.37 C ATOM 3637 NH1 ARG A 249 25.667 44.246 22.654 1.00 56.74 N ATOM 3638 NH2 ARG A 249 24.466 42.381 22.123 1.00 60.87 N ATOM 3639 HA ARG A 249 19.998 47.393 19.701 1.00 0.00 H ATOM 3640 HB2 ARG A 249 21.677 45.591 19.742 1.00 0.00 H ATOM 3641 HB3 ARG A 249 22.397 47.151 19.279 1.00 0.00 H ATOM 3642 HG2 ARG A 249 23.280 47.414 21.567 1.00 0.00 H ATOM 3643 HG3 ARG A 249 22.575 45.842 22.014 1.00 0.00 H ATOM 3644 HD2 ARG A 249 25.146 46.105 21.163 1.00 0.00 H ATOM 3645 HD3 ARG A 249 24.347 45.866 19.592 1.00 0.00 H ATOM 3646 HE ARG A 249 23.488 43.746 20.340 1.00 0.00 H ATOM 3647 HH12 ARG A 249 26.143 43.723 23.417 1.00 0.00 H ATOM 3648 HH11 ARG A 249 25.921 45.237 22.466 1.00 0.00 H ATOM 3649 HH22 ARG A 249 24.943 41.857 22.885 1.00 0.00 H ATOM 3650 HH21 ARG A 249 23.771 41.900 21.517 1.00 0.00 H ATOM 3651 H ARG A 249 21.778 48.898 21.565 1.00 0.00 H ATOM 3652 N GLY A 250 19.662 47.140 22.740 1.00 39.42 N ATOM 3653 CA GLY A 250 19.026 46.461 23.858 1.00 40.74 C ATOM 3654 C GLY A 250 19.928 45.424 24.524 1.00 43.43 C ATOM 3655 O GLY A 250 19.484 44.323 24.861 1.00 43.32 O ATOM 3656 HA3 GLY A 250 18.130 45.958 23.494 1.00 0.00 H ATOM 3657 HA2 GLY A 250 18.746 47.206 24.602 1.00 0.00 H ATOM 3658 H GLY A 250 19.848 48.161 22.803 1.00 0.00 H ATOM 3659 N ALA A 251 21.200 45.775 24.696 1.00 36.60 N ATOM 3660 CA ALA A 251 22.159 44.873 25.332 1.00 36.51 C ATOM 3661 C ALA A 251 21.945 44.760 26.847 1.00 38.22 C ATOM 3662 O ALA A 251 21.563 45.711 27.507 1.00 36.85 O ATOM 3663 CB ALA A 251 23.599 45.347 25.050 1.00 36.99 C ATOM 3664 HA ALA A 251 21.998 43.884 24.902 1.00 0.00 H ATOM 3665 HB1 ALA A 251 23.773 45.355 23.974 1.00 0.00 H ATOM 3666 HB2 ALA A 251 23.734 46.353 25.449 1.00 0.00 H ATOM 3667 HB3 ALA A 251 24.304 44.667 25.529 1.00 0.00 H ATOM 3668 H ALA A 251 21.519 46.710 24.371 1.00 0.00 H ATOM 3669 N LYS A 252 22.288 43.613 27.410 1.00 35.68 N ATOM 3670 CA LYS A 252 22.261 43.494 28.858 1.00 35.86 C ATOM 3671 C LYS A 252 23.593 44.073 29.308 1.00 37.32 C ATOM 3672 O LYS A 252 24.623 43.863 28.660 1.00 36.02 O ATOM 3673 CB LYS A 252 22.099 42.043 29.298 1.00 38.81 C ATOM 3674 CG LYS A 252 23.300 41.181 29.140 1.00 49.13 C ATOM 3675 CD LYS A 252 23.105 39.905 29.946 1.00 47.29 C ATOM 3676 CE LYS A 252 24.193 38.918 29.620 1.00 38.33 C ATOM 3677 NZ LYS A 252 23.775 37.551 29.985 1.00 34.14 N ATOM 3678 HA LYS A 252 21.414 44.019 29.300 1.00 0.00 H ATOM 3679 HB2 LYS A 252 21.823 42.042 30.352 1.00 0.00 H ATOM 3680 HB3 LYS A 252 21.292 41.604 28.712 1.00 0.00 H ATOM 3681 HG2 LYS A 252 23.435 40.932 28.088 1.00 0.00 H ATOM 3682 HG3 LYS A 252 24.181 41.711 29.502 1.00 0.00 H ATOM 3683 HD2 LYS A 252 23.138 40.141 31.010 1.00 0.00 H ATOM 3684 HD3 LYS A 252 22.136 39.468 29.702 1.00 0.00 H ATOM 3685 HE2 LYS A 252 25.093 39.179 30.176 1.00 0.00 H ATOM 3686 HE3 LYS A 252 24.404 38.956 28.551 1.00 0.00 H ATOM 3687 HZ1 LYS A 252 23.576 37.511 31.005 1.00 0.00 H ATOM 3688 HZ2 LYS A 252 22.918 37.298 29.453 1.00 0.00 H ATOM 3689 HZ3 LYS A 252 24.538 36.883 29.753 1.00 0.00 H ATOM 3690 H LYS A 252 22.574 42.804 26.822 1.00 0.00 H ATOM 3691 N ILE A 253 23.557 44.914 30.326 1.00 32.21 N ATOM 3692 CA ILE A 253 24.758 45.611 30.748 1.00 32.95 C ATOM 3693 C ILE A 253 25.143 45.187 32.148 1.00 37.31 C ATOM 3694 O ILE A 253 24.396 45.417 33.096 1.00 37.22 O ATOM 3695 CB ILE A 253 24.550 47.116 30.661 1.00 35.76 C ATOM 3696 CG1 ILE A 253 24.230 47.512 29.216 1.00 35.60 C ATOM 3697 CG2 ILE A 253 25.781 47.872 31.170 1.00 36.46 C ATOM 3698 CD1 ILE A 253 23.905 48.991 29.086 1.00 38.81 C ATOM 3699 HA ILE A 253 25.578 45.347 30.080 1.00 0.00 H ATOM 3700 HB ILE A 253 23.708 47.389 31.298 1.00 0.00 H ATOM 3701 HG12 ILE A 253 25.093 47.285 28.590 1.00 0.00 H ATOM 3702 HG13 ILE A 253 23.373 46.932 28.874 1.00 0.00 H ATOM 3703 HD11 ILE A 253 23.038 49.227 29.703 1.00 0.00 H ATOM 3704 HD12 ILE A 253 24.760 49.580 29.418 1.00 0.00 H ATOM 3705 HD13 ILE A 253 23.685 49.223 28.044 1.00 0.00 H ATOM 3706 HG21 ILE A 253 25.966 47.604 32.210 1.00 0.00 H ATOM 3707 HG22 ILE A 253 26.647 47.603 30.565 1.00 0.00 H ATOM 3708 HG23 ILE A 253 25.603 48.945 31.096 1.00 0.00 H ATOM 3709 H ILE A 253 22.661 45.078 30.829 1.00 0.00 H ATOM 3710 N TYR A 254 26.298 44.549 32.285 1.00 30.15 N ATOM 3711 CA TYR A 254 26.721 44.101 33.609 1.00 28.75 C ATOM 3712 C TYR A 254 27.206 45.211 34.533 1.00 33.01 C ATOM 3713 O TYR A 254 26.939 45.185 35.721 1.00 34.54 O ATOM 3714 CB TYR A 254 27.785 43.001 33.506 1.00 27.37 C ATOM 3715 CG TYR A 254 27.317 41.689 32.966 1.00 26.72 C ATOM 3716 CD1 TYR A 254 26.832 40.700 33.820 1.00 28.56 C ATOM 3717 CD2 TYR A 254 27.533 41.356 31.640 1.00 27.49 C ATOM 3718 CE1 TYR A 254 26.493 39.447 33.336 1.00 27.39 C ATOM 3719 CE2 TYR A 254 27.208 40.118 31.161 1.00 29.50 C ATOM 3720 CZ TYR A 254 26.680 39.166 32.020 1.00 31.70 C ATOM 3721 OH TYR A 254 26.378 37.919 31.535 1.00 31.75 O ATOM 3722 HA TYR A 254 25.817 43.703 34.069 1.00 0.00 H ATOM 3723 HB3 TYR A 254 28.185 42.828 34.505 1.00 0.00 H ATOM 3724 HB2 TYR A 254 28.581 43.365 32.856 1.00 0.00 H ATOM 3725 HD2 TYR A 254 27.970 42.094 30.967 1.00 0.00 H ATOM 3726 HE2 TYR A 254 27.363 39.880 30.109 1.00 0.00 H ATOM 3727 HE1 TYR A 254 26.080 38.693 34.006 1.00 0.00 H ATOM 3728 HD1 TYR A 254 26.718 40.915 34.882 1.00 0.00 H ATOM 3729 HH TYR A 254 27.199 37.498 31.175 1.00 0.00 H ATOM 3730 H TYR A 254 26.898 44.369 31.455 1.00 0.00 H ATOM 3731 N ALA A 255 28.003 46.130 34.001 1.00 29.36 N ATOM 3732 CA ALA A 255 28.627 47.182 34.794 1.00 27.90 C ATOM 3733 C ALA A 255 29.273 48.146 33.815 1.00 30.07 C ATOM 3734 O ALA A 255 29.319 47.881 32.624 1.00 29.72 O ATOM 3735 CB ALA A 255 29.731 46.561 35.711 1.00 28.91 C ATOM 3736 HA ALA A 255 27.893 47.687 35.422 1.00 0.00 H ATOM 3737 HB1 ALA A 255 29.278 45.825 36.376 1.00 0.00 H ATOM 3738 HB2 ALA A 255 30.486 46.077 35.092 1.00 0.00 H ATOM 3739 HB3 ALA A 255 30.196 47.350 36.303 1.00 0.00 H ATOM 3740 H ALA A 255 28.189 46.098 32.978 1.00 0.00 H ATOM 3741 N GLU A 256 29.767 49.267 34.318 1.00 26.82 N ATOM 3742 CA GLU A 256 30.463 50.220 33.469 1.00 26.99 C ATOM 3743 C GLU A 256 31.924 50.213 33.888 1.00 30.11 C ATOM 3744 O GLU A 256 32.209 50.094 35.075 1.00 29.13 O ATOM 3745 CB GLU A 256 29.929 51.623 33.700 1.00 27.97 C ATOM 3746 CG GLU A 256 30.600 52.678 32.836 1.00 30.82 C ATOM 3747 CD GLU A 256 30.042 54.052 33.140 1.00 46.82 C ATOM 3748 OE1 GLU A 256 29.099 54.125 33.953 1.00 39.51 O ATOM 3749 OE2 GLU A 256 30.517 55.048 32.563 1.00 32.25 O ATOM 3750 HA GLU A 256 30.328 49.947 32.422 1.00 0.00 H ATOM 3751 HB2 GLU A 256 28.861 51.626 33.482 1.00 0.00 H ATOM 3752 HB3 GLU A 256 30.085 51.884 34.747 1.00 0.00 H ATOM 3753 HG2 GLU A 256 31.672 52.675 33.034 1.00 0.00 H ATOM 3754 HG3 GLU A 256 30.425 52.445 31.786 1.00 0.00 H ATOM 3755 H GLU A 256 29.656 49.468 35.332 1.00 0.00 H ATOM 3756 N LEU A 257 32.843 50.364 32.929 1.00 27.65 N ATOM 3757 CA LEU A 257 34.292 50.426 33.251 1.00 26.16 C ATOM 3758 C LEU A 257 34.618 51.917 33.323 1.00 28.40 C ATOM 3759 O LEU A 257 34.519 52.602 32.301 1.00 28.74 O ATOM 3760 CB LEU A 257 35.113 49.768 32.128 1.00 26.62 C ATOM 3761 CG LEU A 257 36.522 49.320 32.545 1.00 32.96 C ATOM 3762 CD1 LEU A 257 37.294 48.707 31.384 1.00 33.72 C ATOM 3763 CD2 LEU A 257 37.277 50.451 33.113 1.00 39.30 C ATOM 3764 HA LEU A 257 34.528 49.904 34.178 1.00 0.00 H ATOM 3765 HB2 LEU A 257 34.568 48.892 31.776 1.00 0.00 H ATOM 3766 HB3 LEU A 257 35.211 50.485 31.313 1.00 0.00 H ATOM 3767 HG LEU A 257 36.402 48.549 33.306 1.00 0.00 H ATOM 3768 HD21 LEU A 257 37.363 51.241 32.366 1.00 0.00 H ATOM 3769 HD22 LEU A 257 36.753 50.833 33.989 1.00 0.00 H ATOM 3770 HD23 LEU A 257 38.272 50.113 33.402 1.00 0.00 H ATOM 3771 HD11 LEU A 257 36.756 47.835 31.011 1.00 0.00 H ATOM 3772 HD12 LEU A 257 37.393 49.443 30.586 1.00 0.00 H ATOM 3773 HD13 LEU A 257 38.284 48.405 31.726 1.00 0.00 H ATOM 3774 H LEU A 257 32.538 50.440 31.938 1.00 0.00 H ATOM 3775 N VAL A 258 34.969 52.431 34.506 1.00 23.88 N ATOM 3776 CA VAL A 258 35.155 53.881 34.673 1.00 24.84 C ATOM 3777 C VAL A 258 36.580 54.407 34.838 1.00 30.08 C ATOM 3778 O VAL A 258 36.846 55.592 34.597 1.00 29.77 O ATOM 3779 CB VAL A 258 34.274 54.415 35.846 1.00 28.91 C ATOM 3780 CG1 VAL A 258 32.773 54.232 35.525 1.00 28.29 C ATOM 3781 CG2 VAL A 258 34.611 53.686 37.140 1.00 28.87 C ATOM 3782 HA VAL A 258 34.841 54.270 33.704 1.00 0.00 H ATOM 3783 HB VAL A 258 34.484 55.477 35.970 1.00 0.00 H ATOM 3784 HG11 VAL A 258 32.527 54.784 34.618 1.00 0.00 H ATOM 3785 HG12 VAL A 258 32.561 53.173 35.377 1.00 0.00 H ATOM 3786 HG13 VAL A 258 32.176 54.610 36.355 1.00 0.00 H ATOM 3787 HG21 VAL A 258 34.425 52.619 37.014 1.00 0.00 H ATOM 3788 HG22 VAL A 258 35.661 53.847 37.383 1.00 0.00 H ATOM 3789 HG23 VAL A 258 33.987 54.072 37.946 1.00 0.00 H ATOM 3790 H VAL A 258 35.112 51.798 35.319 1.00 0.00 H ATOM 3791 N GLY A 259 37.475 53.563 35.336 1.00 26.66 N ATOM 3792 CA GLY A 259 38.835 53.986 35.604 1.00 26.57 C ATOM 3793 C GLY A 259 39.863 52.918 35.277 1.00 29.15 C ATOM 3794 O GLY A 259 39.613 51.710 35.446 1.00 27.81 O ATOM 3795 HA3 GLY A 259 38.919 54.237 36.661 1.00 0.00 H ATOM 3796 HA2 GLY A 259 39.049 54.870 35.003 1.00 0.00 H ATOM 3797 H GLY A 259 37.196 52.582 35.537 1.00 0.00 H ATOM 3798 N PHE A 260 41.011 53.376 34.787 1.00 25.49 N ATOM 3799 CA PHE A 260 42.139 52.495 34.414 1.00 23.85 C ATOM 3800 C PHE A 260 43.435 53.243 34.735 1.00 28.93 C ATOM 3801 O PHE A 260 43.647 54.356 34.260 1.00 27.82 O ATOM 3802 CB PHE A 260 42.027 52.123 32.917 1.00 24.26 C ATOM 3803 CG PHE A 260 43.242 51.400 32.338 1.00 23.73 C ATOM 3804 CD1 PHE A 260 43.906 50.417 33.051 1.00 24.90 C ATOM 3805 CD2 PHE A 260 43.651 51.669 31.028 1.00 23.82 C ATOM 3806 CE1 PHE A 260 44.978 49.721 32.472 1.00 23.71 C ATOM 3807 CE2 PHE A 260 44.714 50.989 30.444 1.00 23.68 C ATOM 3808 CZ PHE A 260 45.369 50.022 31.150 1.00 21.59 C ATOM 3809 HA PHE A 260 42.126 51.560 34.975 1.00 0.00 H ATOM 3810 HB2 PHE A 260 41.158 51.477 32.793 1.00 0.00 H ATOM 3811 HB3 PHE A 260 41.878 53.042 32.350 1.00 0.00 H ATOM 3812 HD2 PHE A 260 43.124 52.429 30.451 1.00 0.00 H ATOM 3813 HE2 PHE A 260 45.023 51.227 29.426 1.00 0.00 H ATOM 3814 HZ PHE A 260 46.196 49.481 30.691 1.00 0.00 H ATOM 3815 HE1 PHE A 260 45.505 48.954 33.039 1.00 0.00 H ATOM 3816 HD1 PHE A 260 43.594 50.182 34.069 1.00 0.00 H ATOM 3817 H PHE A 260 41.121 54.402 34.660 1.00 0.00 H ATOM 3818 N GLY A 261 44.258 52.644 35.599 1.00 26.86 N ATOM 3819 CA GLY A 261 45.517 53.210 36.035 1.00 26.05 C ATOM 3820 C GLY A 261 46.688 52.275 35.797 1.00 29.12 C ATOM 3821 O GLY A 261 46.583 51.050 35.925 1.00 26.58 O ATOM 3822 HA3 GLY A 261 45.453 53.426 37.101 1.00 0.00 H ATOM 3823 HA2 GLY A 261 45.692 54.136 35.488 1.00 0.00 H ATOM 3824 H GLY A 261 43.979 51.718 35.981 1.00 0.00 H ATOM 3825 N MET A 262 47.823 52.870 35.451 1.00 26.09 N ATOM 3826 CA MET A 262 49.050 52.125 35.194 1.00 23.59 C ATOM 3827 C MET A 262 50.219 52.730 35.964 1.00 26.58 C ATOM 3828 O MET A 262 50.213 53.905 36.242 1.00 26.39 O ATOM 3829 CB MET A 262 49.382 52.213 33.684 1.00 24.66 C ATOM 3830 CG MET A 262 48.394 51.462 32.810 1.00 25.29 C ATOM 3831 SD MET A 262 48.661 51.856 31.072 1.00 27.90 S ATOM 3832 CE MET A 262 47.666 53.296 30.868 1.00 24.12 C ATOM 3833 HA MET A 262 48.901 51.092 35.509 1.00 0.00 H ATOM 3834 HB2 MET A 262 49.378 53.262 33.389 1.00 0.00 H ATOM 3835 HB3 MET A 262 50.376 51.795 33.522 1.00 0.00 H ATOM 3836 HG2 MET A 262 47.379 51.745 33.090 1.00 0.00 H ATOM 3837 HG3 MET A 262 48.525 50.390 32.959 1.00 0.00 H ATOM 3838 HE1 MET A 262 46.628 53.055 31.098 1.00 0.00 H ATOM 3839 HE2 MET A 262 48.017 54.077 31.543 1.00 0.00 H ATOM 3840 HE3 MET A 262 47.740 53.644 29.838 1.00 0.00 H ATOM 3841 H MET A 262 47.838 53.906 35.360 1.00 0.00 H ATOM 3842 N SER A 263 51.250 51.931 36.239 1.00 23.94 N ATOM 3843 CA SER A 263 52.471 52.454 36.845 1.00 24.11 C ATOM 3844 C SER A 263 53.571 51.427 36.677 1.00 30.48 C ATOM 3845 O SER A 263 53.310 50.290 36.255 1.00 29.84 O ATOM 3846 CB SER A 263 52.265 52.704 38.341 1.00 25.74 C ATOM 3847 OG SER A 263 52.277 51.475 39.050 1.00 30.63 O ATOM 3848 HA SER A 263 52.734 53.394 36.359 1.00 0.00 H ATOM 3849 HB2 SER A 263 51.306 53.199 38.495 1.00 0.00 H ATOM 3850 HB3 SER A 263 53.066 53.342 38.713 1.00 0.00 H ATOM 3851 HG SER A 263 52.143 51.651 40.015 1.00 0.00 H ATOM 3852 H SER A 263 51.183 50.917 36.018 1.00 0.00 H ATOM 3853 N SER A 264 54.790 51.817 37.046 1.00 25.60 N ATOM 3854 CA SER A 264 55.922 50.903 37.040 1.00 25.97 C ATOM 3855 C SER A 264 56.635 51.052 38.406 1.00 26.15 C ATOM 3856 O SER A 264 56.681 52.148 38.945 1.00 23.81 O ATOM 3857 CB SER A 264 56.874 51.254 35.897 1.00 29.31 C ATOM 3858 OG SER A 264 56.246 51.135 34.629 1.00 28.87 O ATOM 3859 HA SER A 264 55.593 49.875 36.891 1.00 0.00 H ATOM 3860 HB2 SER A 264 57.730 50.580 35.931 1.00 0.00 H ATOM 3861 HB3 SER A 264 57.216 52.281 36.026 1.00 0.00 H ATOM 3862 HG SER A 264 55.937 50.203 34.501 1.00 0.00 H ATOM 3863 H SER A 264 54.937 52.802 37.347 1.00 0.00 H ATOM 3864 N ASP A 265 57.118 49.955 38.989 1.00 22.36 N ATOM 3865 CA ASP A 265 57.765 50.025 40.296 1.00 23.49 C ATOM 3866 C ASP A 265 59.174 50.617 40.161 1.00 31.41 C ATOM 3867 O ASP A 265 59.671 51.216 41.115 1.00 30.68 O ATOM 3868 CB ASP A 265 57.959 48.624 40.918 1.00 25.68 C ATOM 3869 CG ASP A 265 56.708 48.040 41.489 1.00 26.95 C ATOM 3870 OD1 ASP A 265 55.690 48.764 41.651 1.00 26.67 O ATOM 3871 OD2 ASP A 265 56.750 46.801 41.680 1.00 24.61 O ATOM 3872 HA ASP A 265 57.117 50.638 40.922 1.00 0.00 H ATOM 3873 HB2 ASP A 265 58.330 47.952 40.144 1.00 0.00 H ATOM 3874 HB3 ASP A 265 58.698 48.701 41.716 1.00 0.00 H ATOM 3875 H ASP A 265 57.033 49.037 38.507 1.00 0.00 H ATOM 3876 N ALA A 266 59.843 50.352 39.025 1.00 29.24 N ATOM 3877 CA ALA A 266 61.235 50.791 38.787 1.00 27.13 C ATOM 3878 C ALA A 266 62.107 50.337 39.953 1.00 31.71 C ATOM 3879 O ALA A 266 62.924 51.096 40.459 1.00 32.30 O ATOM 3880 CB ALA A 266 61.311 52.323 38.662 1.00 27.26 C ATOM 3881 HA ALA A 266 61.588 50.349 37.856 1.00 0.00 H ATOM 3882 HB1 ALA A 266 60.691 52.649 37.827 1.00 0.00 H ATOM 3883 HB2 ALA A 266 60.951 52.780 39.584 1.00 0.00 H ATOM 3884 HB3 ALA A 266 62.345 52.621 38.487 1.00 0.00 H ATOM 3885 H ALA A 266 59.359 49.813 38.279 1.00 0.00 H ATOM 3886 N TYR A 267 61.920 49.103 40.393 1.00 28.09 N ATOM 3887 CA TYR A 267 62.618 48.603 41.569 1.00 28.10 C ATOM 3888 C TYR A 267 63.402 47.330 41.321 1.00 33.48 C ATOM 3889 O TYR A 267 64.615 47.337 41.379 1.00 35.84 O ATOM 3890 CB TYR A 267 61.625 48.461 42.755 1.00 28.16 C ATOM 3891 CG TYR A 267 62.209 47.838 44.000 1.00 33.27 C ATOM 3892 CD1 TYR A 267 63.105 48.546 44.813 1.00 37.16 C ATOM 3893 CD2 TYR A 267 61.851 46.558 44.389 1.00 33.83 C ATOM 3894 CE1 TYR A 267 63.666 47.958 45.957 1.00 38.88 C ATOM 3895 CE2 TYR A 267 62.428 45.952 45.498 1.00 36.17 C ATOM 3896 CZ TYR A 267 63.315 46.667 46.299 1.00 47.16 C ATOM 3897 OH TYR A 267 63.841 46.074 47.438 1.00 47.95 O ATOM 3898 HA TYR A 267 63.375 49.343 41.830 1.00 0.00 H ATOM 3899 HB3 TYR A 267 60.790 47.843 42.426 1.00 0.00 H ATOM 3900 HB2 TYR A 267 61.260 49.455 43.013 1.00 0.00 H ATOM 3901 HD2 TYR A 267 61.101 46.015 43.813 1.00 0.00 H ATOM 3902 HE2 TYR A 267 62.187 44.917 45.741 1.00 0.00 H ATOM 3903 HE1 TYR A 267 64.373 48.516 46.571 1.00 0.00 H ATOM 3904 HD1 TYR A 267 63.370 49.571 44.552 1.00 0.00 H ATOM 3905 HH TYR A 267 63.104 45.828 48.051 1.00 0.00 H ATOM 3906 H TYR A 267 61.261 48.477 39.888 1.00 0.00 H ATOM 3907 N HIS A 268 62.723 46.221 41.060 1.00 27.90 N ATOM 3908 CA HIS A 268 63.420 44.965 40.853 1.00 27.97 C ATOM 3909 C HIS A 268 62.567 44.157 39.886 1.00 30.34 C ATOM 3910 O HIS A 268 61.344 44.293 39.877 1.00 28.11 O ATOM 3911 CB HIS A 268 63.557 44.236 42.192 1.00 30.66 C ATOM 3912 CG HIS A 268 64.149 42.862 42.091 1.00 35.11 C ATOM 3913 ND1 HIS A 268 65.423 42.565 42.538 1.00 38.62 N ATOM 3914 CD2 HIS A 268 63.620 41.691 41.664 1.00 36.72 C ATOM 3915 CE1 HIS A 268 65.656 41.272 42.371 1.00 37.32 C ATOM 3916 NE2 HIS A 268 64.578 40.720 41.841 1.00 37.20 N ATOM 3917 HA HIS A 268 64.422 45.114 40.451 1.00 0.00 H ATOM 3918 HB2 HIS A 268 64.194 44.835 42.843 1.00 0.00 H ATOM 3919 HB3 HIS A 268 62.565 44.149 42.636 1.00 0.00 H ATOM 3920 HD2 HIS A 268 62.620 41.545 41.256 1.00 0.00 H ATOM 3921 HE1 HIS A 268 66.579 40.752 42.627 1.00 0.00 H ATOM 3922 H HIS A 268 61.685 46.252 41.003 1.00 0.00 H ATOM 3923 N MET A 269 63.214 43.336 39.083 1.00 28.56 N ATOM 3924 CA MET A 269 62.539 42.562 38.038 1.00 33.02 C ATOM 3925 C MET A 269 61.478 41.582 38.539 1.00 35.66 C ATOM 3926 O MET A 269 60.452 41.372 37.861 1.00 33.22 O ATOM 3927 CB MET A 269 63.556 41.934 37.029 1.00 37.42 C ATOM 3928 CG MET A 269 64.208 40.569 37.417 1.00 46.04 C ATOM 3929 SD MET A 269 65.724 39.916 36.400 1.00 53.36 S ATOM 3930 CE MET A 269 67.011 41.249 36.967 1.00 49.71 C ATOM 3931 HA MET A 269 61.950 43.289 37.479 1.00 0.00 H ATOM 3932 HB2 MET A 269 63.032 41.789 36.084 1.00 0.00 H ATOM 3933 HB3 MET A 269 64.363 42.653 36.888 1.00 0.00 H ATOM 3934 HG2 MET A 269 63.427 39.812 37.345 1.00 0.00 H ATOM 3935 HG3 MET A 269 64.534 40.656 38.453 1.00 0.00 H ATOM 3936 HE1 MET A 269 66.656 42.239 36.681 1.00 0.00 H ATOM 3937 HE2 MET A 269 67.128 41.202 38.050 1.00 0.00 H ATOM 3938 HE3 MET A 269 67.970 41.053 36.488 1.00 0.00 H ATOM 3939 H MET A 269 64.243 43.234 39.195 1.00 0.00 H ATOM 3940 N THR A 270 61.725 40.970 39.703 1.00 28.67 N ATOM 3941 CA THR A 270 60.824 39.928 40.214 1.00 28.84 C ATOM 3942 C THR A 270 60.311 40.131 41.657 1.00 31.54 C ATOM 3943 O THR A 270 59.846 39.189 42.291 1.00 29.84 O ATOM 3944 CB THR A 270 61.454 38.552 40.078 1.00 35.30 C ATOM 3945 OG1 THR A 270 62.696 38.544 40.785 1.00 29.84 O ATOM 3946 CG2 THR A 270 61.721 38.217 38.609 1.00 33.59 C ATOM 3947 HA THR A 270 59.939 40.011 39.582 1.00 0.00 H ATOM 3948 HB THR A 270 60.769 37.810 40.488 1.00 0.00 H ATOM 3949 HG1 THR A 270 63.298 39.229 40.400 1.00 0.00 H ATOM 3950 HG23 THR A 270 60.779 38.220 38.060 1.00 0.00 H ATOM 3951 HG21 THR A 270 62.393 38.962 38.184 1.00 0.00 H ATOM 3952 HG22 THR A 270 62.180 37.231 38.540 1.00 0.00 H ATOM 3953 H THR A 270 62.566 41.236 40.254 1.00 0.00 H ATOM 3954 N SER A 271 60.383 41.359 42.152 1.00 27.82 N ATOM 3955 CA SER A 271 59.913 41.648 43.495 1.00 27.74 C ATOM 3956 C SER A 271 59.485 43.108 43.557 1.00 30.84 C ATOM 3957 O SER A 271 60.088 43.971 42.926 1.00 29.61 O ATOM 3958 CB SER A 271 61.054 41.410 44.511 1.00 35.13 C ATOM 3959 OG SER A 271 60.538 41.561 45.827 1.00 55.15 O ATOM 3960 HA SER A 271 59.074 40.997 43.739 1.00 0.00 H ATOM 3961 HB2 SER A 271 61.850 42.136 44.344 1.00 0.00 H ATOM 3962 HB3 SER A 271 61.451 40.402 44.387 1.00 0.00 H ATOM 3963 HG SER A 271 61.263 41.410 46.484 1.00 0.00 H ATOM 3964 H SER A 271 60.781 42.124 41.571 1.00 0.00 H ATOM 3965 N PRO A 272 58.430 43.402 44.325 1.00 27.79 N ATOM 3966 CA PRO A 272 57.982 44.791 44.464 1.00 26.78 C ATOM 3967 C PRO A 272 58.765 45.450 45.602 1.00 30.07 C ATOM 3968 O PRO A 272 59.362 44.767 46.425 1.00 29.89 O ATOM 3969 CB PRO A 272 56.517 44.630 44.902 1.00 28.45 C ATOM 3970 CG PRO A 272 56.499 43.347 45.649 1.00 32.11 C ATOM 3971 CD PRO A 272 57.501 42.450 44.967 1.00 28.77 C ATOM 3972 HA PRO A 272 58.113 45.391 43.563 1.00 0.00 H ATOM 3973 HD3 PRO A 272 58.022 41.824 45.692 1.00 0.00 H ATOM 3974 HD2 PRO A 272 57.016 41.816 44.224 1.00 0.00 H ATOM 3975 HG3 PRO A 272 55.505 42.901 45.611 1.00 0.00 H ATOM 3976 HG2 PRO A 272 56.783 43.510 46.688 1.00 0.00 H ATOM 3977 HB2 PRO A 272 56.212 45.456 45.544 1.00 0.00 H ATOM 3978 HB3 PRO A 272 55.857 44.583 44.036 1.00 0.00 H ATOM 3979 N PRO A 273 58.775 46.784 45.653 1.00 25.67 N ATOM 3980 CA PRO A 273 59.454 47.439 46.789 1.00 26.74 C ATOM 3981 C PRO A 273 58.584 47.282 48.046 1.00 34.31 C ATOM 3982 O PRO A 273 57.340 47.245 47.948 1.00 32.29 O ATOM 3983 CB PRO A 273 59.472 48.922 46.372 1.00 26.79 C ATOM 3984 CG PRO A 273 58.230 49.064 45.531 1.00 30.29 C ATOM 3985 CD PRO A 273 58.196 47.769 44.717 1.00 25.09 C ATOM 3986 HA PRO A 273 60.442 47.033 47.005 1.00 0.00 H ATOM 3987 HD3 PRO A 273 57.175 47.501 44.446 1.00 0.00 H ATOM 3988 HD2 PRO A 273 58.800 47.856 43.814 1.00 0.00 H ATOM 3989 HG3 PRO A 273 58.300 49.933 44.877 1.00 0.00 H ATOM 3990 HG2 PRO A 273 57.343 49.153 46.158 1.00 0.00 H ATOM 3991 HB2 PRO A 273 59.429 49.573 47.245 1.00 0.00 H ATOM 3992 HB3 PRO A 273 60.365 49.153 45.791 1.00 0.00 H ATOM 3993 N GLU A 274 59.213 47.238 49.228 1.00 33.51 N ATOM 3994 CA GLU A 274 58.460 47.055 50.487 1.00 33.66 C ATOM 3995 C GLU A 274 57.344 48.068 50.649 1.00 37.79 C ATOM 3996 O GLU A 274 56.274 47.776 51.184 1.00 36.46 O ATOM 3997 CB GLU A 274 59.399 47.086 51.691 1.00 35.55 C ATOM 3998 CG GLU A 274 60.288 45.852 51.762 1.00 44.69 C ATOM 3999 CD GLU A 274 61.189 45.862 52.992 1.00 76.33 C ATOM 4000 OE1 GLU A 274 60.996 45.007 53.886 1.00 83.43 O ATOM 4001 OE2 GLU A 274 62.085 46.730 53.062 1.00 66.49 O ATOM 4002 HA GLU A 274 57.991 46.073 50.434 1.00 0.00 H ATOM 4003 HB2 GLU A 274 60.032 47.971 51.620 1.00 0.00 H ATOM 4004 HB3 GLU A 274 58.801 47.141 52.601 1.00 0.00 H ATOM 4005 HG2 GLU A 274 59.656 44.965 51.797 1.00 0.00 H ATOM 4006 HG3 GLU A 274 60.912 45.817 50.869 1.00 0.00 H ATOM 4007 H GLU A 274 60.248 47.334 49.260 1.00 0.00 H ATOM 4008 N ASN A 275 57.648 49.260 50.160 1.00 36.20 N ATOM 4009 CA ASN A 275 56.799 50.457 50.099 1.00 37.03 C ATOM 4010 C ASN A 275 55.425 50.232 49.446 1.00 38.00 C ATOM 4011 O ASN A 275 54.470 50.998 49.685 1.00 35.99 O ATOM 4012 CB ASN A 275 57.549 51.369 49.088 1.00 44.09 C ATOM 4013 CG ASN A 275 57.323 52.811 49.324 1.00 78.77 C ATOM 4014 OD1 ASN A 275 58.105 53.640 48.872 1.00 63.61 O ATOM 4015 ND2 ASN A 275 56.220 53.142 49.983 1.00 83.92 N ATOM 4016 HA ASN A 275 56.635 50.824 51.112 1.00 0.00 H ATOM 4017 HB2 ASN A 275 58.617 51.168 49.167 1.00 0.00 H ATOM 4018 HB3 ASN A 275 57.208 51.125 48.082 1.00 0.00 H ATOM 4019 HD22 ASN A 275 55.589 52.400 50.347 1.00 0.00 H ATOM 4020 HD21 ASN A 275 55.986 54.144 50.136 1.00 0.00 H ATOM 4021 H ASN A 275 58.607 49.362 49.771 1.00 0.00 H ATOM 4022 N GLY A 276 55.409 49.364 48.434 1.00 31.96 N ATOM 4023 CA GLY A 276 54.236 49.171 47.571 1.00 30.39 C ATOM 4024 C GLY A 276 53.914 50.428 46.766 1.00 33.38 C ATOM 4025 O GLY A 276 52.793 50.614 46.283 1.00 32.18 O ATOM 4026 HA3 GLY A 276 53.377 48.920 48.193 1.00 0.00 H ATOM 4027 HA2 GLY A 276 54.436 48.351 46.881 1.00 0.00 H ATOM 4028 H GLY A 276 56.263 48.800 48.248 1.00 0.00 H ATOM 4029 N ALA A 277 54.898 51.313 46.603 1.00 29.91 N ATOM 4030 CA ALA A 277 54.662 52.598 45.923 1.00 29.38 C ATOM 4031 C ALA A 277 54.106 52.451 44.504 1.00 32.33 C ATOM 4032 O ALA A 277 53.371 53.314 44.028 1.00 31.39 O ATOM 4033 CB ALA A 277 55.965 53.437 45.910 1.00 30.56 C ATOM 4034 HA ALA A 277 53.891 53.114 46.495 1.00 0.00 H ATOM 4035 HB1 ALA A 277 56.284 53.626 46.935 1.00 0.00 H ATOM 4036 HB2 ALA A 277 56.744 52.888 45.381 1.00 0.00 H ATOM 4037 HB3 ALA A 277 55.780 54.385 45.405 1.00 0.00 H ATOM 4038 H ALA A 277 55.849 51.092 46.962 1.00 0.00 H ATOM 4039 N GLY A 278 54.512 51.396 43.792 1.00 30.48 N ATOM 4040 CA GLY A 278 54.051 51.210 42.424 1.00 29.49 C ATOM 4041 C GLY A 278 52.577 50.861 42.415 1.00 30.74 C ATOM 4042 O GLY A 278 51.779 51.470 41.683 1.00 29.82 O ATOM 4043 HA3 GLY A 278 54.616 50.402 41.959 1.00 0.00 H ATOM 4044 HA2 GLY A 278 54.207 52.131 41.862 1.00 0.00 H ATOM 4045 H GLY A 278 55.161 50.704 44.218 1.00 0.00 H ATOM 4046 N ALA A 279 52.222 49.892 43.258 1.00 25.70 N ATOM 4047 CA ALA A 279 50.842 49.467 43.426 1.00 27.02 C ATOM 4048 C ALA A 279 49.990 50.668 43.804 1.00 30.70 C ATOM 4049 O ALA A 279 48.902 50.868 43.265 1.00 28.74 O ATOM 4050 CB ALA A 279 50.753 48.367 44.535 1.00 28.59 C ATOM 4051 HA ALA A 279 50.473 49.046 42.491 1.00 0.00 H ATOM 4052 HB1 ALA A 279 51.360 47.510 44.244 1.00 0.00 H ATOM 4053 HB2 ALA A 279 51.122 48.772 45.477 1.00 0.00 H ATOM 4054 HB3 ALA A 279 49.715 48.055 44.653 1.00 0.00 H ATOM 4055 H ALA A 279 52.961 49.421 43.818 1.00 0.00 H ATOM 4056 N ALA A 280 50.481 51.467 44.749 1.00 28.13 N ATOM 4057 CA ALA A 280 49.728 52.644 45.179 1.00 28.81 C ATOM 4058 C ALA A 280 49.472 53.593 44.005 1.00 32.62 C ATOM 4059 O ALA A 280 48.336 54.020 43.775 1.00 32.76 O ATOM 4060 CB ALA A 280 50.466 53.373 46.346 1.00 28.88 C ATOM 4061 HA ALA A 280 48.758 52.311 45.549 1.00 0.00 H ATOM 4062 HB1 ALA A 280 50.570 52.692 47.190 1.00 0.00 H ATOM 4063 HB2 ALA A 280 51.453 53.689 46.009 1.00 0.00 H ATOM 4064 HB3 ALA A 280 49.888 54.246 46.650 1.00 0.00 H ATOM 4065 H ALA A 280 51.402 51.253 45.182 1.00 0.00 H ATOM 4066 N LEU A 281 50.528 53.948 43.265 1.00 28.23 N ATOM 4067 CA LEU A 281 50.369 54.865 42.132 1.00 26.56 C ATOM 4068 C LEU A 281 49.363 54.356 41.103 1.00 30.34 C ATOM 4069 O LEU A 281 48.598 55.137 40.551 1.00 33.14 O ATOM 4070 CB LEU A 281 51.725 55.086 41.462 1.00 26.85 C ATOM 4071 CG LEU A 281 51.821 56.001 40.255 1.00 31.21 C ATOM 4072 CD1 LEU A 281 51.373 57.406 40.590 1.00 33.11 C ATOM 4073 CD2 LEU A 281 53.286 56.000 39.774 1.00 31.97 C ATOM 4074 HA LEU A 281 49.981 55.805 42.524 1.00 0.00 H ATOM 4075 HB2 LEU A 281 52.392 55.492 42.222 1.00 0.00 H ATOM 4076 HB3 LEU A 281 52.087 54.107 41.148 1.00 0.00 H ATOM 4077 HG LEU A 281 51.161 55.637 39.467 1.00 0.00 H ATOM 4078 HD21 LEU A 281 53.930 56.363 40.575 1.00 0.00 H ATOM 4079 HD22 LEU A 281 53.577 54.985 39.503 1.00 0.00 H ATOM 4080 HD23 LEU A 281 53.382 56.651 38.905 1.00 0.00 H ATOM 4081 HD11 LEU A 281 50.337 57.385 40.927 1.00 0.00 H ATOM 4082 HD12 LEU A 281 52.006 57.809 41.381 1.00 0.00 H ATOM 4083 HD13 LEU A 281 51.455 58.033 39.703 1.00 0.00 H ATOM 4084 H LEU A 281 51.469 53.571 43.495 1.00 0.00 H ATOM 4085 N ALA A 282 49.347 53.050 40.833 1.00 25.69 N ATOM 4086 CA ALA A 282 48.392 52.517 39.853 1.00 25.66 C ATOM 4087 C ALA A 282 46.955 52.702 40.330 1.00 29.10 C ATOM 4088 O ALA A 282 46.077 53.054 39.551 1.00 28.78 O ATOM 4089 CB ALA A 282 48.676 51.056 39.539 1.00 26.18 C ATOM 4090 HA ALA A 282 48.517 53.085 38.931 1.00 0.00 H ATOM 4091 HB1 ALA A 282 49.682 50.963 39.129 1.00 0.00 H ATOM 4092 HB2 ALA A 282 48.599 50.468 40.453 1.00 0.00 H ATOM 4093 HB3 ALA A 282 47.950 50.695 38.811 1.00 0.00 H ATOM 4094 H ALA A 282 50.010 52.410 41.316 1.00 0.00 H ATOM 4095 N MET A 283 46.716 52.431 41.608 1.00 25.83 N ATOM 4096 CA MET A 283 45.371 52.597 42.176 1.00 26.05 C ATOM 4097 C MET A 283 45.005 54.066 42.174 1.00 31.02 C ATOM 4098 O MET A 283 43.895 54.441 41.796 1.00 30.75 O ATOM 4099 CB MET A 283 45.332 52.051 43.608 1.00 28.09 C ATOM 4100 CG MET A 283 45.425 50.536 43.672 1.00 30.30 C ATOM 4101 SD MET A 283 45.121 49.905 45.347 1.00 34.92 S ATOM 4102 CE MET A 283 46.666 50.274 46.189 1.00 31.08 C ATOM 4103 HA MET A 283 44.654 52.042 41.571 1.00 0.00 H ATOM 4104 HB2 MET A 283 46.169 52.474 44.164 1.00 0.00 H ATOM 4105 HB3 MET A 283 44.396 52.361 44.072 1.00 0.00 H ATOM 4106 HG2 MET A 283 46.423 50.231 43.357 1.00 0.00 H ATOM 4107 HG3 MET A 283 44.685 50.109 42.995 1.00 0.00 H ATOM 4108 HE1 MET A 283 47.485 49.760 45.685 1.00 0.00 H ATOM 4109 HE2 MET A 283 46.842 51.349 46.167 1.00 0.00 H ATOM 4110 HE3 MET A 283 46.605 49.935 47.223 1.00 0.00 H ATOM 4111 H MET A 283 47.491 52.097 42.215 1.00 0.00 H ATOM 4112 N ALA A 284 45.954 54.904 42.587 1.00 28.87 N ATOM 4113 CA ALA A 284 45.739 56.348 42.591 1.00 27.86 C ATOM 4114 C ALA A 284 45.378 56.822 41.184 1.00 34.75 C ATOM 4115 O ALA A 284 44.519 57.684 41.014 1.00 33.96 O ATOM 4116 CB ALA A 284 47.007 57.061 43.064 1.00 28.25 C ATOM 4117 HA ALA A 284 44.920 56.583 43.271 1.00 0.00 H ATOM 4118 HB1 ALA A 284 47.253 56.730 44.073 1.00 0.00 H ATOM 4119 HB2 ALA A 284 47.830 56.821 42.391 1.00 0.00 H ATOM 4120 HB3 ALA A 284 46.838 58.138 43.064 1.00 0.00 H ATOM 4121 H ALA A 284 46.865 54.523 42.913 1.00 0.00 H ATOM 4122 N ASN A 285 46.073 56.295 40.172 1.00 30.46 N ATOM 4123 CA ASN A 285 45.803 56.702 38.796 1.00 29.33 C ATOM 4124 C ASN A 285 44.415 56.247 38.325 1.00 30.77 C ATOM 4125 O ASN A 285 43.713 56.972 37.614 1.00 30.40 O ATOM 4126 CB ASN A 285 46.915 56.197 37.857 1.00 27.14 C ATOM 4127 CG ASN A 285 48.214 56.980 38.030 1.00 42.40 C ATOM 4128 OD1 ASN A 285 48.200 58.100 38.534 1.00 32.53 O ATOM 4129 ND2 ASN A 285 49.334 56.402 37.598 1.00 27.22 N ATOM 4130 HA ASN A 285 45.800 57.792 38.765 1.00 0.00 H ATOM 4131 HB2 ASN A 285 47.107 55.146 38.073 1.00 0.00 H ATOM 4132 HB3 ASN A 285 46.578 56.299 36.826 1.00 0.00 H ATOM 4133 HD22 ASN A 285 49.300 55.451 37.177 1.00 0.00 H ATOM 4134 HD21 ASN A 285 50.242 56.901 37.681 1.00 0.00 H ATOM 4135 H ASN A 285 46.812 55.589 40.366 1.00 0.00 H ATOM 4136 N ALA A 286 44.012 55.045 38.711 1.00 26.05 N ATOM 4137 CA ALA A 286 42.696 54.564 38.313 1.00 24.96 C ATOM 4138 C ALA A 286 41.620 55.436 38.968 1.00 31.21 C ATOM 4139 O ALA A 286 40.622 55.756 38.330 1.00 29.12 O ATOM 4140 CB ALA A 286 42.512 53.105 38.718 1.00 26.13 C ATOM 4141 HA ALA A 286 42.606 54.628 37.229 1.00 0.00 H ATOM 4142 HB1 ALA A 286 43.273 52.495 38.231 1.00 0.00 H ATOM 4143 HB2 ALA A 286 42.609 53.015 39.800 1.00 0.00 H ATOM 4144 HB3 ALA A 286 41.522 52.766 38.411 1.00 0.00 H ATOM 4145 H ALA A 286 44.632 54.448 39.295 1.00 0.00 H ATOM 4146 N LEU A 287 41.806 55.778 40.253 1.00 29.84 N ATOM 4147 CA LEU A 287 40.820 56.623 40.957 1.00 29.89 C ATOM 4148 C LEU A 287 40.680 57.976 40.288 1.00 32.55 C ATOM 4149 O LEU A 287 39.557 58.453 40.055 1.00 31.82 O ATOM 4150 CB LEU A 287 41.158 56.808 42.456 1.00 28.81 C ATOM 4151 CG LEU A 287 41.074 55.545 43.304 1.00 32.26 C ATOM 4152 CD1 LEU A 287 41.952 55.650 44.552 1.00 31.96 C ATOM 4153 CD2 LEU A 287 39.627 55.132 43.635 1.00 33.48 C ATOM 4154 HA LEU A 287 39.868 56.095 40.896 1.00 0.00 H ATOM 4155 HB2 LEU A 287 42.175 57.194 42.527 1.00 0.00 H ATOM 4156 HB3 LEU A 287 40.463 57.539 42.870 1.00 0.00 H ATOM 4157 HG LEU A 287 41.473 54.735 42.694 1.00 0.00 H ATOM 4158 HD21 LEU A 287 39.139 55.934 44.189 1.00 0.00 H ATOM 4159 HD22 LEU A 287 39.083 54.945 42.709 1.00 0.00 H ATOM 4160 HD23 LEU A 287 39.639 54.226 44.241 1.00 0.00 H ATOM 4161 HD11 LEU A 287 42.990 55.798 44.253 1.00 0.00 H ATOM 4162 HD12 LEU A 287 41.623 56.495 45.156 1.00 0.00 H ATOM 4163 HD13 LEU A 287 41.867 54.731 45.133 1.00 0.00 H ATOM 4164 H LEU A 287 42.652 55.445 40.757 1.00 0.00 H ATOM 4165 N ARG A 288 41.813 58.591 39.944 1.00 30.01 N ATOM 4166 CA ARG A 288 41.765 59.896 39.286 1.00 29.63 C ATOM 4167 C ARG A 288 41.125 59.777 37.920 1.00 32.80 C ATOM 4168 O ARG A 288 40.360 60.638 37.513 1.00 33.29 O ATOM 4169 CB ARG A 288 43.164 60.551 39.231 1.00 36.61 C ATOM 4170 CG ARG A 288 43.281 61.771 38.317 1.00 48.36 C ATOM 4171 CD ARG A 288 44.724 62.268 38.265 1.00 58.30 C ATOM 4172 NE ARG A 288 45.389 62.101 39.554 1.00 72.77 N ATOM 4173 CZ ARG A 288 46.457 61.338 39.757 1.00 91.10 C ATOM 4174 NH1 ARG A 288 46.994 60.655 38.749 1.00 81.94 N ATOM 4175 NH2 ARG A 288 46.985 61.258 40.974 1.00 74.67 N ATOM 4176 HA ARG A 288 41.139 60.562 39.880 1.00 0.00 H ATOM 4177 HB2 ARG A 288 43.431 60.861 40.242 1.00 0.00 H ATOM 4178 HB3 ARG A 288 43.874 59.800 38.883 1.00 0.00 H ATOM 4179 HG2 ARG A 288 42.959 61.498 37.312 1.00 0.00 H ATOM 4180 HG3 ARG A 288 42.641 62.567 38.698 1.00 0.00 H ATOM 4181 HD2 ARG A 288 44.727 63.325 37.998 1.00 0.00 H ATOM 4182 HD3 ARG A 288 45.268 61.702 37.509 1.00 0.00 H ATOM 4183 HE ARG A 288 44.999 62.615 40.370 1.00 0.00 H ATOM 4184 HH12 ARG A 288 47.830 60.059 38.912 1.00 0.00 H ATOM 4185 HH11 ARG A 288 46.577 60.718 37.798 1.00 0.00 H ATOM 4186 HH22 ARG A 288 47.821 60.662 41.140 1.00 0.00 H ATOM 4187 HH21 ARG A 288 46.562 61.791 41.760 1.00 0.00 H ATOM 4188 H ARG A 288 42.730 58.142 40.144 1.00 0.00 H ATOM 4189 N ASP A 289 41.387 58.673 37.227 1.00 29.38 N ATOM 4190 CA ASP A 289 40.805 58.447 35.913 1.00 29.01 C ATOM 4191 C ASP A 289 39.280 58.342 36.026 1.00 31.76 C ATOM 4192 O ASP A 289 38.553 58.806 35.138 1.00 31.58 O ATOM 4193 CB ASP A 289 41.389 57.150 35.288 1.00 30.42 C ATOM 4194 CG ASP A 289 41.022 56.987 33.828 1.00 33.03 C ATOM 4195 OD1 ASP A 289 41.042 57.990 33.089 1.00 34.99 O ATOM 4196 OD2 ASP A 289 40.753 55.844 33.402 1.00 33.21 O ATOM 4197 HA ASP A 289 41.051 59.289 35.266 1.00 0.00 H ATOM 4198 HB2 ASP A 289 42.475 57.180 35.373 1.00 0.00 H ATOM 4199 HB3 ASP A 289 41.006 56.293 35.842 1.00 0.00 H ATOM 4200 H ASP A 289 42.021 57.956 37.633 1.00 0.00 H ATOM 4201 N ALA A 290 38.816 57.674 37.086 1.00 28.65 N ATOM 4202 CA ALA A 290 37.382 57.500 37.355 1.00 28.78 C ATOM 4203 C ALA A 290 36.724 58.775 37.950 1.00 37.29 C ATOM 4204 O ALA A 290 35.493 58.897 37.958 1.00 38.73 O ATOM 4205 CB ALA A 290 37.170 56.339 38.304 1.00 29.02 C ATOM 4206 HA ALA A 290 36.904 57.300 36.396 1.00 0.00 H ATOM 4207 HB1 ALA A 290 37.564 55.428 37.855 1.00 0.00 H ATOM 4208 HB2 ALA A 290 37.690 56.538 39.241 1.00 0.00 H ATOM 4209 HB3 ALA A 290 36.104 56.219 38.497 1.00 0.00 H ATOM 4210 H ALA A 290 39.500 57.259 37.750 1.00 0.00 H ATOM 4211 N GLY A 291 37.526 59.681 38.496 1.00 33.13 N ATOM 4212 CA GLY A 291 37.025 60.920 39.086 1.00 33.83 C ATOM 4213 C GLY A 291 36.401 60.718 40.456 1.00 39.59 C ATOM 4214 O GLY A 291 35.515 61.463 40.857 1.00 41.49 O ATOM 4215 HA3 GLY A 291 36.272 61.342 38.420 1.00 0.00 H ATOM 4216 HA2 GLY A 291 37.856 61.619 39.182 1.00 0.00 H ATOM 4217 H GLY A 291 38.550 59.502 38.504 1.00 0.00 H ATOM 4218 N ILE A 292 36.866 59.710 41.188 1.00 35.09 N ATOM 4219 CA ILE A 292 36.298 59.391 42.489 1.00 34.18 C ATOM 4220 C ILE A 292 37.383 59.287 43.542 1.00 38.60 C ATOM 4221 O ILE A 292 38.566 59.229 43.219 1.00 37.51 O ATOM 4222 CB ILE A 292 35.526 58.060 42.402 1.00 36.56 C ATOM 4223 CG1 ILE A 292 36.464 56.930 41.964 1.00 36.76 C ATOM 4224 CG2 ILE A 292 34.382 58.173 41.427 1.00 35.05 C ATOM 4225 CD1 ILE A 292 36.048 55.597 42.503 1.00 42.92 C ATOM 4226 HA ILE A 292 35.618 60.192 42.777 1.00 0.00 H ATOM 4227 HB ILE A 292 35.127 57.833 43.390 1.00 0.00 H ATOM 4228 HG12 ILE A 292 36.468 56.881 40.875 1.00 0.00 H ATOM 4229 HG13 ILE A 292 37.470 57.153 42.320 1.00 0.00 H ATOM 4230 HD11 ILE A 292 36.049 55.631 43.592 1.00 0.00 H ATOM 4231 HD12 ILE A 292 35.046 55.359 42.146 1.00 0.00 H ATOM 4232 HD13 ILE A 292 36.747 54.834 42.161 1.00 0.00 H ATOM 4233 HG21 ILE A 292 33.700 58.956 41.758 1.00 0.00 H ATOM 4234 HG22 ILE A 292 34.771 58.421 40.440 1.00 0.00 H ATOM 4235 HG23 ILE A 292 33.850 57.223 41.381 1.00 0.00 H ATOM 4236 H ILE A 292 37.653 59.137 40.822 1.00 0.00 H ATOM 4237 N GLU A 293 36.971 59.190 44.802 1.00 36.09 N ATOM 4238 CA GLU A 293 37.917 59.046 45.904 1.00 36.52 C ATOM 4239 C GLU A 293 37.981 57.605 46.376 1.00 38.07 C ATOM 4240 O GLU A 293 37.004 56.870 46.258 1.00 35.88 O ATOM 4241 CB GLU A 293 37.497 59.941 47.075 1.00 38.73 C ATOM 4242 CG GLU A 293 37.537 61.431 46.715 1.00 58.69 C ATOM 4243 CD GLU A 293 37.694 62.305 47.935 1.00103.87 C ATOM 4244 OE1 GLU A 293 38.661 63.100 47.973 1.00114.97 O ATOM 4245 OE2 GLU A 293 36.875 62.160 48.873 1.00104.17 O ATOM 4246 HA GLU A 293 38.902 59.345 45.546 1.00 0.00 H ATOM 4247 HB2 GLU A 293 36.481 59.679 47.370 1.00 0.00 H ATOM 4248 HB3 GLU A 293 38.173 59.764 47.911 1.00 0.00 H ATOM 4249 HG2 GLU A 293 38.378 61.609 46.044 1.00 0.00 H ATOM 4250 HG3 GLU A 293 36.608 61.696 46.209 1.00 0.00 H ATOM 4251 H GLU A 293 35.952 59.217 45.007 1.00 0.00 H ATOM 4252 N ALA A 294 39.108 57.244 46.988 1.00 34.71 N ATOM 4253 CA ALA A 294 39.319 55.905 47.501 1.00 35.02 C ATOM 4254 C ALA A 294 38.185 55.426 48.418 1.00 40.14 C ATOM 4255 O ALA A 294 37.877 54.238 48.447 1.00 38.36 O ATOM 4256 CB ALA A 294 40.691 55.809 48.203 1.00 35.68 C ATOM 4257 HA ALA A 294 39.314 55.231 46.645 1.00 0.00 H ATOM 4258 HB1 ALA A 294 41.480 56.045 47.489 1.00 0.00 H ATOM 4259 HB2 ALA A 294 40.724 56.517 49.031 1.00 0.00 H ATOM 4260 HB3 ALA A 294 40.834 54.797 48.582 1.00 0.00 H ATOM 4261 H ALA A 294 39.864 57.949 47.102 1.00 0.00 H ATOM 4262 N SER A 295 37.549 56.358 49.139 1.00 38.26 N ATOM 4263 CA SER A 295 36.451 56.017 50.060 1.00 38.84 C ATOM 4264 C SER A 295 35.219 55.454 49.346 1.00 40.53 C ATOM 4265 O SER A 295 34.374 54.780 49.955 1.00 40.53 O ATOM 4266 CB SER A 295 36.049 57.238 50.908 1.00 44.25 C ATOM 4267 OG SER A 295 35.314 58.190 50.144 1.00 50.29 O ATOM 4268 HA SER A 295 36.835 55.230 50.709 1.00 0.00 H ATOM 4269 HB2 SER A 295 36.951 57.714 51.293 1.00 0.00 H ATOM 4270 HB3 SER A 295 35.433 56.902 51.742 1.00 0.00 H ATOM 4271 HG SER A 295 35.073 58.959 50.720 1.00 0.00 H ATOM 4272 H SER A 295 37.839 57.352 49.046 1.00 0.00 H ATOM 4273 N GLN A 296 35.111 55.719 48.051 1.00 34.41 N ATOM 4274 CA GLN A 296 33.967 55.214 47.315 1.00 32.63 C ATOM 4275 C GLN A 296 34.133 53.777 46.829 1.00 37.39 C ATOM 4276 O GLN A 296 33.191 53.188 46.300 1.00 37.15 O ATOM 4277 CB GLN A 296 33.617 56.147 46.169 1.00 32.76 C ATOM 4278 CG GLN A 296 33.380 57.546 46.633 1.00 39.85 C ATOM 4279 CD GLN A 296 33.189 58.494 45.491 1.00 50.35 C ATOM 4280 OE1 GLN A 296 34.023 59.365 45.247 1.00 47.38 O ATOM 4281 NE2 GLN A 296 32.088 58.336 44.782 1.00 37.89 N ATOM 4282 HA GLN A 296 33.136 55.188 48.020 1.00 0.00 H ATOM 4283 HB2 GLN A 296 34.439 56.149 45.454 1.00 0.00 H ATOM 4284 HB3 GLN A 296 32.714 55.781 45.681 1.00 0.00 H ATOM 4285 HG2 GLN A 296 32.487 57.563 47.257 1.00 0.00 H ATOM 4286 HG3 GLN A 296 34.238 57.872 47.221 1.00 0.00 H ATOM 4287 HE22 GLN A 296 31.414 57.584 45.029 1.00 0.00 H ATOM 4288 HE21 GLN A 296 31.894 58.964 43.976 1.00 0.00 H ATOM 4289 H GLN A 296 35.839 56.283 47.568 1.00 0.00 H ATOM 4290 N ILE A 297 35.330 53.212 46.994 1.00 31.98 N ATOM 4291 CA ILE A 297 35.548 51.830 46.576 1.00 29.71 C ATOM 4292 C ILE A 297 35.001 50.905 47.661 1.00 33.24 C ATOM 4293 O ILE A 297 35.405 51.013 48.817 1.00 32.05 O ATOM 4294 CB ILE A 297 37.054 51.523 46.362 1.00 30.63 C ATOM 4295 CG1 ILE A 297 37.639 52.340 45.203 1.00 29.87 C ATOM 4296 CG2 ILE A 297 37.262 50.031 46.208 1.00 28.92 C ATOM 4297 CD1 ILE A 297 36.945 52.130 43.860 1.00 26.18 C ATOM 4298 HA ILE A 297 35.036 51.672 45.627 1.00 0.00 H ATOM 4299 HB ILE A 297 37.609 51.836 47.246 1.00 0.00 H ATOM 4300 HG12 ILE A 297 37.566 53.396 45.461 1.00 0.00 H ATOM 4301 HG13 ILE A 297 38.688 52.066 45.090 1.00 0.00 H ATOM 4302 HD11 ILE A 297 37.018 51.081 43.575 1.00 0.00 H ATOM 4303 HD12 ILE A 297 35.896 52.412 43.947 1.00 0.00 H ATOM 4304 HD13 ILE A 297 37.427 52.748 43.103 1.00 0.00 H ATOM 4305 HG21 ILE A 297 36.916 49.522 47.108 1.00 0.00 H ATOM 4306 HG22 ILE A 297 36.697 49.674 45.347 1.00 0.00 H ATOM 4307 HG23 ILE A 297 38.322 49.827 46.058 1.00 0.00 H ATOM 4308 H ILE A 297 36.108 53.755 47.420 1.00 0.00 H ATOM 4309 N GLY A 298 34.175 49.927 47.286 1.00 28.80 N ATOM 4310 CA GLY A 298 33.688 49.000 48.287 1.00 28.55 C ATOM 4311 C GLY A 298 34.512 47.731 48.468 1.00 33.51 C ATOM 4312 O GLY A 298 34.527 47.143 49.542 1.00 31.29 O ATOM 4313 HA3 GLY A 298 32.676 48.706 48.008 1.00 0.00 H ATOM 4314 HA2 GLY A 298 33.662 49.522 49.243 1.00 0.00 H ATOM 4315 H GLY A 298 33.885 49.832 46.292 1.00 0.00 H ATOM 4316 N TYR A 299 35.174 47.282 47.400 1.00 29.42 N ATOM 4317 CA TYR A 299 35.877 46.004 47.422 1.00 27.32 C ATOM 4318 C TYR A 299 37.037 46.071 46.414 1.00 30.46 C ATOM 4319 O TYR A 299 36.894 46.619 45.319 1.00 26.08 O ATOM 4320 CB TYR A 299 34.896 44.915 46.968 1.00 27.00 C ATOM 4321 CG TYR A 299 35.536 43.615 46.560 1.00 26.22 C ATOM 4322 CD1 TYR A 299 36.404 42.945 47.434 1.00 27.47 C ATOM 4323 CD2 TYR A 299 35.310 43.057 45.289 1.00 25.25 C ATOM 4324 CE1 TYR A 299 37.010 41.750 47.068 1.00 25.56 C ATOM 4325 CE2 TYR A 299 35.900 41.833 44.931 1.00 23.51 C ATOM 4326 CZ TYR A 299 36.766 41.209 45.811 1.00 26.77 C ATOM 4327 OH TYR A 299 37.323 39.977 45.507 1.00 25.87 O ATOM 4328 HA TYR A 299 36.256 45.787 48.421 1.00 0.00 H ATOM 4329 HB3 TYR A 299 34.335 45.298 46.116 1.00 0.00 H ATOM 4330 HB2 TYR A 299 34.211 44.712 47.791 1.00 0.00 H ATOM 4331 HD2 TYR A 299 34.672 43.578 44.576 1.00 0.00 H ATOM 4332 HE2 TYR A 299 35.677 41.378 43.966 1.00 0.00 H ATOM 4333 HE1 TYR A 299 37.675 41.238 47.764 1.00 0.00 H ATOM 4334 HD1 TYR A 299 36.607 43.369 48.417 1.00 0.00 H ATOM 4335 HH TYR A 299 37.912 39.690 46.249 1.00 0.00 H ATOM 4336 H TYR A 299 35.189 47.856 46.533 1.00 0.00 H ATOM 4337 N VAL A 300 38.186 45.543 46.829 1.00 28.15 N ATOM 4338 CA VAL A 300 39.388 45.517 46.015 1.00 26.76 C ATOM 4339 C VAL A 300 39.675 44.056 45.811 1.00 29.10 C ATOM 4340 O VAL A 300 39.897 43.327 46.791 1.00 28.32 O ATOM 4341 CB VAL A 300 40.602 46.167 46.770 1.00 29.80 C ATOM 4342 CG1 VAL A 300 41.926 45.986 45.975 1.00 28.35 C ATOM 4343 CG2 VAL A 300 40.371 47.638 47.057 1.00 28.95 C ATOM 4344 HA VAL A 300 39.248 46.071 45.087 1.00 0.00 H ATOM 4345 HB VAL A 300 40.690 45.645 47.723 1.00 0.00 H ATOM 4346 HG11 VAL A 300 42.128 44.923 45.845 1.00 0.00 H ATOM 4347 HG12 VAL A 300 41.830 46.461 44.999 1.00 0.00 H ATOM 4348 HG13 VAL A 300 42.745 46.448 46.526 1.00 0.00 H ATOM 4349 HG21 VAL A 300 40.228 48.172 46.118 1.00 0.00 H ATOM 4350 HG22 VAL A 300 39.483 47.750 47.679 1.00 0.00 H ATOM 4351 HG23 VAL A 300 41.236 48.045 47.580 1.00 0.00 H ATOM 4352 H VAL A 300 38.225 45.129 47.782 1.00 0.00 H ATOM 4353 N ASN A 301 39.676 43.608 44.556 1.00 23.65 N ATOM 4354 CA ASN A 301 40.079 42.229 44.285 1.00 22.25 C ATOM 4355 C ASN A 301 41.583 42.383 44.072 1.00 26.32 C ATOM 4356 O ASN A 301 42.043 43.005 43.111 1.00 27.10 O ATOM 4357 CB ASN A 301 39.356 41.631 43.067 1.00 22.32 C ATOM 4358 CG ASN A 301 39.789 40.241 42.787 1.00 33.97 C ATOM 4359 OD1 ASN A 301 39.084 39.264 43.081 1.00 31.58 O ATOM 4360 ND2 ASN A 301 41.003 40.118 42.304 1.00 22.04 N ATOM 4361 HA ASN A 301 39.824 41.530 45.081 1.00 0.00 H ATOM 4362 HB2 ASN A 301 38.283 41.633 43.259 1.00 0.00 H ATOM 4363 HB3 ASN A 301 39.569 42.248 42.194 1.00 0.00 H ATOM 4364 HD22 ASN A 301 41.558 40.966 42.071 1.00 0.00 H ATOM 4365 HD21 ASN A 301 41.410 39.173 42.154 1.00 0.00 H ATOM 4366 H ASN A 301 39.392 44.234 43.776 1.00 0.00 H ATOM 4367 N ALA A 302 42.338 41.925 45.056 1.00 25.02 N ATOM 4368 CA ALA A 302 43.781 42.095 45.081 1.00 25.20 C ATOM 4369 C ALA A 302 44.582 41.245 44.103 1.00 27.98 C ATOM 4370 O ALA A 302 44.151 40.198 43.634 1.00 28.15 O ATOM 4371 CB ALA A 302 44.290 41.860 46.525 1.00 26.55 C ATOM 4372 HA ALA A 302 43.952 43.117 44.743 1.00 0.00 H ATOM 4373 HB1 ALA A 302 43.822 42.581 47.196 1.00 0.00 H ATOM 4374 HB2 ALA A 302 44.032 40.849 46.840 1.00 0.00 H ATOM 4375 HB3 ALA A 302 45.372 41.986 46.552 1.00 0.00 H ATOM 4376 H ALA A 302 41.881 41.423 45.844 1.00 0.00 H ATOM 4377 N HIS A 303 45.809 41.667 43.868 1.00 24.08 N ATOM 4378 CA HIS A 303 46.708 40.849 43.104 1.00 23.62 C ATOM 4379 C HIS A 303 46.998 39.648 44.019 1.00 27.60 C ATOM 4380 O HIS A 303 46.903 38.514 43.600 1.00 26.75 O ATOM 4381 CB HIS A 303 47.979 41.656 42.826 1.00 24.86 C ATOM 4382 CG HIS A 303 48.981 40.915 42.014 1.00 30.27 C ATOM 4383 ND1 HIS A 303 48.660 40.310 40.820 1.00 33.96 N ATOM 4384 CD2 HIS A 303 50.279 40.631 42.247 1.00 32.60 C ATOM 4385 CE1 HIS A 303 49.715 39.659 40.367 1.00 33.08 C ATOM 4386 NE2 HIS A 303 50.707 39.843 41.211 1.00 33.18 N ATOM 4387 HA HIS A 303 46.309 40.528 42.142 1.00 0.00 H ATOM 4388 HB2 HIS A 303 47.702 42.564 42.290 1.00 0.00 H ATOM 4389 HB3 HIS A 303 48.435 41.923 43.779 1.00 0.00 H ATOM 4390 HD2 HIS A 303 50.874 40.965 43.097 1.00 0.00 H ATOM 4391 HE1 HIS A 303 49.757 39.070 39.451 1.00 0.00 H ATOM 4392 H HIS A 303 46.124 42.588 44.234 1.00 0.00 H ATOM 4393 N GLY A 304 47.292 39.906 45.297 1.00 25.97 N ATOM 4394 CA GLY A 304 47.504 38.878 46.331 1.00 25.25 C ATOM 4395 C GLY A 304 47.802 37.459 45.900 1.00 27.90 C ATOM 4396 O GLY A 304 46.940 36.570 45.958 1.00 25.86 O ATOM 4397 HA3 GLY A 304 46.600 38.845 46.940 1.00 0.00 H ATOM 4398 HA2 GLY A 304 48.342 39.209 46.945 1.00 0.00 H ATOM 4399 H GLY A 304 47.377 40.903 45.582 1.00 0.00 H ATOM 4400 N THR A 305 49.051 37.232 45.494 1.00 23.62 N ATOM 4401 CA THR A 305 49.466 35.960 44.959 1.00 22.25 C ATOM 4402 C THR A 305 49.871 34.902 45.964 1.00 27.07 C ATOM 4403 O THR A 305 50.032 33.738 45.589 1.00 25.50 O ATOM 4404 CB THR A 305 50.598 36.168 43.948 1.00 32.26 C ATOM 4405 OG1 THR A 305 51.734 36.717 44.641 1.00 31.58 O ATOM 4406 CG2 THR A 305 50.156 37.169 42.843 1.00 24.09 C ATOM 4407 HA THR A 305 48.567 35.560 44.490 1.00 0.00 H ATOM 4408 HB THR A 305 50.849 35.213 43.486 1.00 0.00 H ATOM 4409 HG1 THR A 305 51.483 37.583 45.050 1.00 0.00 H ATOM 4410 HG23 THR A 305 49.295 36.764 42.311 1.00 0.00 H ATOM 4411 HG21 THR A 305 49.886 38.120 43.303 1.00 0.00 H ATOM 4412 HG22 THR A 305 50.978 37.323 42.144 1.00 0.00 H ATOM 4413 H THR A 305 49.750 37.999 45.566 1.00 0.00 H ATOM 4414 N SER A 306 50.058 35.294 47.222 1.00 24.43 N ATOM 4415 CA SER A 306 50.491 34.351 48.269 1.00 22.53 C ATOM 4416 C SER A 306 51.998 34.210 48.387 1.00 27.25 C ATOM 4417 O SER A 306 52.505 33.173 48.808 1.00 26.34 O ATOM 4418 CB SER A 306 49.780 32.987 48.230 1.00 26.37 C ATOM 4419 OG SER A 306 49.820 32.337 49.515 1.00 26.61 O ATOM 4420 HA SER A 306 50.159 34.827 49.192 1.00 0.00 H ATOM 4421 HB2 SER A 306 50.273 32.351 47.495 1.00 0.00 H ATOM 4422 HB3 SER A 306 48.740 33.137 47.940 1.00 0.00 H ATOM 4423 HG SER A 306 50.763 32.193 49.782 1.00 0.00 H ATOM 4424 H SER A 306 49.895 36.290 47.473 1.00 0.00 H ATOM 4425 N THR A 307 52.713 35.287 48.070 1.00 25.61 N ATOM 4426 CA THR A 307 54.160 35.299 48.251 1.00 25.81 C ATOM 4427 C THR A 307 54.448 36.120 49.515 1.00 28.84 C ATOM 4428 O THR A 307 53.717 37.059 49.851 1.00 27.32 O ATOM 4429 CB THR A 307 54.908 35.900 47.045 1.00 22.11 C ATOM 4430 OG1 THR A 307 54.545 37.276 46.906 1.00 24.13 O ATOM 4431 CG2 THR A 307 54.597 35.097 45.742 1.00 20.01 C ATOM 4432 HA THR A 307 54.517 34.273 48.344 1.00 0.00 H ATOM 4433 HB THR A 307 55.983 35.833 47.216 1.00 0.00 H ATOM 4434 HG1 THR A 307 55.024 37.666 46.132 1.00 0.00 H ATOM 4435 HG23 THR A 307 54.885 34.055 45.881 1.00 0.00 H ATOM 4436 HG21 THR A 307 53.530 35.155 45.527 1.00 0.00 H ATOM 4437 HG22 THR A 307 55.160 35.523 44.911 1.00 0.00 H ATOM 4438 H THR A 307 52.235 36.128 47.689 1.00 0.00 H ATOM 4439 N PRO A 308 55.551 35.809 50.196 1.00 26.34 N ATOM 4440 CA PRO A 308 55.820 36.593 51.410 1.00 26.48 C ATOM 4441 C PRO A 308 55.922 38.099 51.171 1.00 31.36 C ATOM 4442 O PRO A 308 55.220 38.888 51.829 1.00 31.11 O ATOM 4443 CB PRO A 308 57.130 36.004 51.932 1.00 28.13 C ATOM 4444 CG PRO A 308 57.123 34.563 51.437 1.00 32.71 C ATOM 4445 CD PRO A 308 56.428 34.625 50.071 1.00 28.89 C ATOM 4446 HA PRO A 308 54.997 36.519 52.121 1.00 0.00 H ATOM 4447 HD3 PRO A 308 57.153 34.757 49.268 1.00 0.00 H ATOM 4448 HD2 PRO A 308 55.845 33.723 49.887 1.00 0.00 H ATOM 4449 HG3 PRO A 308 56.568 33.923 52.123 1.00 0.00 H ATOM 4450 HG2 PRO A 308 58.141 34.186 51.334 1.00 0.00 H ATOM 4451 HB2 PRO A 308 57.985 36.546 51.528 1.00 0.00 H ATOM 4452 HB3 PRO A 308 57.161 36.038 53.021 1.00 0.00 H ATOM 4453 N ALA A 309 56.767 38.512 50.224 1.00 27.37 N ATOM 4454 CA ALA A 309 56.966 39.950 49.958 1.00 26.54 C ATOM 4455 C ALA A 309 55.899 40.623 49.126 1.00 28.33 C ATOM 4456 O ALA A 309 55.689 41.828 49.244 1.00 28.68 O ATOM 4457 CB ALA A 309 58.334 40.199 49.303 1.00 27.53 C ATOM 4458 HA ALA A 309 56.905 40.405 50.946 1.00 0.00 H ATOM 4459 HB1 ALA A 309 59.123 39.852 49.970 1.00 0.00 H ATOM 4460 HB2 ALA A 309 58.388 39.656 48.360 1.00 0.00 H ATOM 4461 HB3 ALA A 309 58.457 41.266 49.117 1.00 0.00 H ATOM 4462 H ALA A 309 57.293 37.810 49.665 1.00 0.00 H ATOM 4463 N GLY A 310 55.317 39.891 48.187 1.00 26.51 N ATOM 4464 CA GLY A 310 54.286 40.474 47.337 1.00 25.97 C ATOM 4465 C GLY A 310 53.040 40.857 48.107 1.00 28.65 C ATOM 4466 O GLY A 310 52.530 41.971 47.955 1.00 28.18 O ATOM 4467 HA3 GLY A 310 54.013 39.748 46.571 1.00 0.00 H ATOM 4468 HA2 GLY A 310 54.690 41.367 46.861 1.00 0.00 H ATOM 4469 H GLY A 310 55.597 38.898 48.056 1.00 0.00 H ATOM 4470 N ASP A 311 52.546 39.952 48.955 1.00 25.79 N ATOM 4471 CA ASP A 311 51.329 40.266 49.717 1.00 25.43 C ATOM 4472 C ASP A 311 51.522 41.461 50.638 1.00 30.37 C ATOM 4473 O ASP A 311 50.639 42.299 50.762 1.00 29.38 O ATOM 4474 CB ASP A 311 50.828 39.074 50.532 1.00 27.75 C ATOM 4475 CG ASP A 311 50.467 37.893 49.680 1.00 33.06 C ATOM 4476 OD1 ASP A 311 50.515 38.008 48.431 1.00 35.59 O ATOM 4477 OD2 ASP A 311 50.142 36.838 50.266 1.00 28.80 O ATOM 4478 HA ASP A 311 50.575 40.516 48.971 1.00 0.00 H ATOM 4479 HB2 ASP A 311 51.612 38.774 51.228 1.00 0.00 H ATOM 4480 HB3 ASP A 311 49.945 39.382 51.092 1.00 0.00 H ATOM 4481 H ASP A 311 53.018 39.033 49.075 1.00 0.00 H ATOM 4482 N LYS A 312 52.698 41.563 51.247 1.00 28.03 N ATOM 4483 CA LYS A 312 52.962 42.673 52.174 1.00 28.16 C ATOM 4484 C LYS A 312 52.993 43.994 51.442 1.00 30.97 C ATOM 4485 O LYS A 312 52.481 44.986 51.934 1.00 29.52 O ATOM 4486 CB LYS A 312 54.314 42.484 52.895 1.00 30.73 C ATOM 4487 CG LYS A 312 54.305 41.467 54.033 1.00 44.15 C ATOM 4488 CD LYS A 312 55.712 41.328 54.621 1.00 48.51 C ATOM 4489 CE LYS A 312 55.873 40.020 55.378 1.00 57.53 C ATOM 4490 NZ LYS A 312 55.187 40.100 56.694 1.00 60.06 N ATOM 4491 HA LYS A 312 52.154 42.676 52.905 1.00 0.00 H ATOM 4492 HB2 LYS A 312 55.048 42.159 52.157 1.00 0.00 H ATOM 4493 HB3 LYS A 312 54.616 43.448 53.305 1.00 0.00 H ATOM 4494 HG2 LYS A 312 53.619 41.802 54.811 1.00 0.00 H ATOM 4495 HG3 LYS A 312 53.976 40.501 53.651 1.00 0.00 H ATOM 4496 HD2 LYS A 312 56.440 41.360 53.810 1.00 0.00 H ATOM 4497 HD3 LYS A 312 55.894 42.158 55.304 1.00 0.00 H ATOM 4498 HE2 LYS A 312 56.933 39.823 55.536 1.00 0.00 H ATOM 4499 HE3 LYS A 312 55.438 39.210 54.793 1.00 0.00 H ATOM 4500 HZ1 LYS A 312 55.603 40.871 57.254 1.00 0.00 H ATOM 4501 HZ2 LYS A 312 54.174 40.285 56.545 1.00 0.00 H ATOM 4502 HZ3 LYS A 312 55.305 39.199 57.200 1.00 0.00 H ATOM 4503 H LYS A 312 53.437 40.853 51.067 1.00 0.00 H ATOM 4504 N ALA A 313 53.620 44.021 50.268 1.00 29.52 N ATOM 4505 CA ALA A 313 53.704 45.282 49.510 1.00 28.95 C ATOM 4506 C ALA A 313 52.333 45.833 49.149 1.00 30.40 C ATOM 4507 O ALA A 313 52.082 47.029 49.246 1.00 30.49 O ATOM 4508 CB ALA A 313 54.595 45.113 48.243 1.00 29.91 C ATOM 4509 HA ALA A 313 54.175 46.016 50.164 1.00 0.00 H ATOM 4510 HB1 ALA A 313 55.600 44.818 48.544 1.00 0.00 H ATOM 4511 HB2 ALA A 313 54.167 44.345 47.599 1.00 0.00 H ATOM 4512 HB3 ALA A 313 54.639 46.059 47.703 1.00 0.00 H ATOM 4513 H ALA A 313 54.050 43.154 49.887 1.00 0.00 H ATOM 4514 N GLU A 314 51.422 44.964 48.729 1.00 27.49 N ATOM 4515 CA GLU A 314 50.074 45.443 48.341 1.00 25.28 C ATOM 4516 C GLU A 314 49.253 45.914 49.552 1.00 29.30 C ATOM 4517 O GLU A 314 48.465 46.845 49.448 1.00 29.51 O ATOM 4518 CB GLU A 314 49.290 44.328 47.618 1.00 25.42 C ATOM 4519 CG GLU A 314 48.039 44.853 46.950 1.00 26.75 C ATOM 4520 CD GLU A 314 47.368 43.814 46.100 1.00 35.91 C ATOM 4521 OE1 GLU A 314 47.738 42.627 46.180 1.00 27.36 O ATOM 4522 OE2 GLU A 314 46.480 44.183 45.331 1.00 31.58 O ATOM 4523 HA GLU A 314 50.226 46.292 47.674 1.00 0.00 H ATOM 4524 HB2 GLU A 314 49.933 43.881 46.859 1.00 0.00 H ATOM 4525 HB3 GLU A 314 49.007 43.568 48.346 1.00 0.00 H ATOM 4526 HG2 GLU A 314 47.341 45.180 47.720 1.00 0.00 H ATOM 4527 HG3 GLU A 314 48.307 45.701 46.320 1.00 0.00 H ATOM 4528 H GLU A 314 51.653 43.952 48.672 1.00 0.00 H ATOM 4529 N ALA A 315 49.389 45.227 50.679 1.00 28.32 N ATOM 4530 CA ALA A 315 48.682 45.634 51.908 1.00 27.63 C ATOM 4531 C ALA A 315 49.184 47.029 52.272 1.00 31.77 C ATOM 4532 O ALA A 315 48.406 47.904 52.608 1.00 32.32 O ATOM 4533 CB ALA A 315 48.978 44.644 53.042 1.00 29.22 C ATOM 4534 HA ALA A 315 47.603 45.642 51.752 1.00 0.00 H ATOM 4535 HB1 ALA A 315 48.643 43.649 52.750 1.00 0.00 H ATOM 4536 HB2 ALA A 315 50.050 44.626 53.236 1.00 0.00 H ATOM 4537 HB3 ALA A 315 48.450 44.957 53.943 1.00 0.00 H ATOM 4538 H ALA A 315 50.004 44.388 50.696 1.00 0.00 H ATOM 4539 N GLN A 316 50.486 47.277 52.130 1.00 30.43 N ATOM 4540 CA GLN A 316 51.013 48.635 52.384 1.00 29.77 C ATOM 4541 C GLN A 316 50.416 49.659 51.406 1.00 33.26 C ATOM 4542 O GLN A 316 49.979 50.746 51.792 1.00 33.67 O ATOM 4543 CB GLN A 316 52.541 48.642 52.277 1.00 31.19 C ATOM 4544 CG GLN A 316 53.162 49.897 52.819 1.00 51.65 C ATOM 4545 CD GLN A 316 52.584 50.273 54.180 1.00 61.06 C ATOM 4546 OE1 GLN A 316 52.709 49.515 55.149 1.00 50.73 O ATOM 4547 NE2 GLN A 316 51.895 51.414 54.239 1.00 45.08 N ATOM 4548 HA GLN A 316 50.722 48.920 53.395 1.00 0.00 H ATOM 4549 HB2 GLN A 316 52.932 47.792 52.835 1.00 0.00 H ATOM 4550 HB3 GLN A 316 52.816 48.544 51.227 1.00 0.00 H ATOM 4551 HG2 GLN A 316 54.236 49.744 52.922 1.00 0.00 H ATOM 4552 HG3 GLN A 316 52.978 50.713 52.120 1.00 0.00 H ATOM 4553 HE22 GLN A 316 51.818 52.019 53.397 1.00 0.00 H ATOM 4554 HE21 GLN A 316 51.435 51.698 55.127 1.00 0.00 H ATOM 4555 H GLN A 316 51.132 46.515 51.840 1.00 0.00 H ATOM 4556 N ALA A 317 50.367 49.307 50.126 1.00 30.13 N ATOM 4557 CA ALA A 317 49.792 50.193 49.116 1.00 29.10 C ATOM 4558 C ALA A 317 48.304 50.475 49.369 1.00 31.13 C ATOM 4559 O ALA A 317 47.813 51.575 49.103 1.00 30.89 O ATOM 4560 CB ALA A 317 49.989 49.591 47.724 1.00 30.63 C ATOM 4561 HA ALA A 317 50.314 51.147 49.180 1.00 0.00 H ATOM 4562 HB1 ALA A 317 51.055 49.467 47.530 1.00 0.00 H ATOM 4563 HB2 ALA A 317 49.495 48.621 47.676 1.00 0.00 H ATOM 4564 HB3 ALA A 317 49.558 50.257 46.977 1.00 0.00 H ATOM 4565 H ALA A 317 50.745 48.382 49.837 1.00 0.00 H ATOM 4566 N VAL A 318 47.559 49.465 49.798 1.00 27.69 N ATOM 4567 CA VAL A 318 46.126 49.672 50.096 1.00 27.87 C ATOM 4568 C VAL A 318 46.018 50.643 51.304 1.00 34.88 C ATOM 4569 O VAL A 318 45.286 51.633 51.280 1.00 33.55 O ATOM 4570 CB VAL A 318 45.405 48.324 50.406 1.00 32.24 C ATOM 4571 CG1 VAL A 318 44.015 48.614 51.010 1.00 31.84 C ATOM 4572 CG2 VAL A 318 45.246 47.482 49.134 1.00 31.61 C ATOM 4573 HA VAL A 318 45.633 50.099 49.223 1.00 0.00 H ATOM 4574 HB VAL A 318 46.011 47.762 51.117 1.00 0.00 H ATOM 4575 HG11 VAL A 318 44.132 49.185 51.931 1.00 0.00 H ATOM 4576 HG12 VAL A 318 43.423 49.189 50.297 1.00 0.00 H ATOM 4577 HG13 VAL A 318 43.511 47.672 51.227 1.00 0.00 H ATOM 4578 HG21 VAL A 318 44.655 48.036 48.405 1.00 0.00 H ATOM 4579 HG22 VAL A 318 46.230 47.266 48.718 1.00 0.00 H ATOM 4580 HG23 VAL A 318 44.740 46.548 49.379 1.00 0.00 H ATOM 4581 H VAL A 318 47.984 48.525 49.925 1.00 0.00 H ATOM 4582 N LYS A 319 46.831 50.409 52.327 1.00 35.07 N ATOM 4583 CA LYS A 319 46.837 51.317 53.488 1.00 34.88 C ATOM 4584 C LYS A 319 47.095 52.740 53.057 1.00 41.07 C ATOM 4585 O LYS A 319 46.438 53.676 53.516 1.00 40.23 O ATOM 4586 CB LYS A 319 47.930 50.917 54.480 1.00 36.77 C ATOM 4587 CG LYS A 319 47.439 50.008 55.586 1.00 56.35 C ATOM 4588 CD LYS A 319 48.560 49.079 56.065 1.00 64.56 C ATOM 4589 CE LYS A 319 48.014 47.760 56.603 1.00 51.47 C ATOM 4590 NZ LYS A 319 49.040 46.720 56.499 1.00 56.72 N ATOM 4591 HA LYS A 319 45.857 51.244 53.960 1.00 0.00 H ATOM 4592 HB2 LYS A 319 48.720 50.401 53.934 1.00 0.00 H ATOM 4593 HB3 LYS A 319 48.335 51.823 54.932 1.00 0.00 H ATOM 4594 HG2 LYS A 319 47.096 50.616 56.423 1.00 0.00 H ATOM 4595 HG3 LYS A 319 46.611 49.406 55.213 1.00 0.00 H ATOM 4596 HD2 LYS A 319 49.227 48.870 55.228 1.00 0.00 H ATOM 4597 HD3 LYS A 319 49.118 49.579 56.857 1.00 0.00 H ATOM 4598 HE2 LYS A 319 47.140 47.466 56.022 1.00 0.00 H ATOM 4599 HE3 LYS A 319 47.729 47.885 57.648 1.00 0.00 H ATOM 4600 HZ1 LYS A 319 49.311 46.600 55.502 1.00 0.00 H ATOM 4601 HZ2 LYS A 319 49.873 47.000 57.054 1.00 0.00 H ATOM 4602 HZ3 LYS A 319 48.662 45.824 56.867 1.00 0.00 H ATOM 4603 H LYS A 319 47.464 49.584 52.309 1.00 0.00 H ATOM 4604 N THR A 320 48.093 52.900 52.189 1.00 38.83 N ATOM 4605 CA THR A 320 48.500 54.209 51.693 1.00 36.57 C ATOM 4606 C THR A 320 47.384 54.942 50.959 1.00 37.98 C ATOM 4607 O THR A 320 47.176 56.122 51.153 1.00 35.56 O ATOM 4608 CB THR A 320 49.721 54.065 50.770 1.00 40.10 C ATOM 4609 OG1 THR A 320 50.833 53.562 51.519 1.00 41.28 O ATOM 4610 CG2 THR A 320 50.080 55.395 50.124 1.00 34.64 C ATOM 4611 HA THR A 320 48.756 54.810 52.566 1.00 0.00 H ATOM 4612 HB THR A 320 49.472 53.363 49.974 1.00 0.00 H ATOM 4613 HG1 THR A 320 50.601 52.678 51.899 1.00 0.00 H ATOM 4614 HG23 THR A 320 49.225 55.765 49.558 1.00 0.00 H ATOM 4615 HG21 THR A 320 50.343 56.115 50.899 1.00 0.00 H ATOM 4616 HG22 THR A 320 50.928 55.255 49.454 1.00 0.00 H ATOM 4617 H THR A 320 48.602 52.058 51.852 1.00 0.00 H ATOM 4618 N ILE A 321 46.692 54.244 50.072 1.00 35.14 N ATOM 4619 CA ILE A 321 45.652 54.865 49.250 1.00 33.25 C ATOM 4620 C ILE A 321 44.359 55.076 50.027 1.00 37.21 C ATOM 4621 O ILE A 321 43.635 56.044 49.806 1.00 36.67 O ATOM 4622 CB ILE A 321 45.380 53.985 47.980 1.00 35.51 C ATOM 4623 CG1 ILE A 321 46.649 53.884 47.132 1.00 34.69 C ATOM 4624 CG2 ILE A 321 44.165 54.503 47.181 1.00 35.60 C ATOM 4625 CD1 ILE A 321 47.177 55.214 46.641 1.00 35.39 C ATOM 4626 HA ILE A 321 46.014 55.847 48.946 1.00 0.00 H ATOM 4627 HB ILE A 321 45.118 52.976 48.299 1.00 0.00 H ATOM 4628 HG12 ILE A 321 47.425 53.409 47.733 1.00 0.00 H ATOM 4629 HG13 ILE A 321 46.431 53.261 46.264 1.00 0.00 H ATOM 4630 HD11 ILE A 321 46.419 55.700 46.026 1.00 0.00 H ATOM 4631 HD12 ILE A 321 47.413 55.848 47.496 1.00 0.00 H ATOM 4632 HD13 ILE A 321 48.077 55.050 46.049 1.00 0.00 H ATOM 4633 HG21 ILE A 321 43.278 54.479 47.814 1.00 0.00 H ATOM 4634 HG22 ILE A 321 44.354 55.527 46.858 1.00 0.00 H ATOM 4635 HG23 ILE A 321 44.008 53.868 46.309 1.00 0.00 H ATOM 4636 H ILE A 321 46.892 53.230 49.956 1.00 0.00 H ATOM 4637 N PHE A 322 44.021 54.109 50.863 1.00 35.84 N ATOM 4638 CA PHE A 322 42.756 54.163 51.577 1.00 36.67 C ATOM 4639 C PHE A 322 42.778 54.942 52.886 1.00 46.66 C ATOM 4640 O PHE A 322 41.733 55.397 53.344 1.00 45.36 O ATOM 4641 CB PHE A 322 42.145 52.771 51.711 1.00 37.47 C ATOM 4642 CG PHE A 322 41.673 52.221 50.404 1.00 38.79 C ATOM 4643 CD1 PHE A 322 42.598 51.819 49.441 1.00 41.03 C ATOM 4644 CD2 PHE A 322 40.326 52.263 50.069 1.00 40.35 C ATOM 4645 CE1 PHE A 322 42.181 51.411 48.192 1.00 42.03 C ATOM 4646 CE2 PHE A 322 39.899 51.842 48.837 1.00 43.96 C ATOM 4647 CZ PHE A 322 40.829 51.418 47.884 1.00 42.07 C ATOM 4648 HA PHE A 322 42.093 54.762 50.953 1.00 0.00 H ATOM 4649 HB2 PHE A 322 42.897 52.098 52.122 1.00 0.00 H ATOM 4650 HB3 PHE A 322 41.297 52.826 52.393 1.00 0.00 H ATOM 4651 HD2 PHE A 322 39.601 52.635 50.793 1.00 0.00 H ATOM 4652 HE2 PHE A 322 38.835 51.838 48.600 1.00 0.00 H ATOM 4653 HZ PHE A 322 40.492 51.093 46.900 1.00 0.00 H ATOM 4654 HE1 PHE A 322 42.910 51.085 47.450 1.00 0.00 H ATOM 4655 HD1 PHE A 322 43.662 51.827 49.678 1.00 0.00 H ATOM 4656 H PHE A 322 44.664 53.305 51.011 1.00 0.00 H ATOM 4657 N GLY A 323 43.977 55.155 53.431 1.00 49.09 N ATOM 4658 CA GLY A 323 44.200 55.906 54.661 1.00 51.15 C ATOM 4659 C GLY A 323 43.180 55.575 55.738 1.00 59.91 C ATOM 4660 O GLY A 323 43.153 54.449 56.256 1.00 57.89 O ATOM 4661 HA3 GLY A 323 44.139 56.971 54.437 1.00 0.00 H ATOM 4662 HA2 GLY A 323 45.196 55.672 55.038 1.00 0.00 H ATOM 4663 H GLY A 323 44.808 54.759 52.946 1.00 0.00 H ATOM 4664 N GLU A 324 42.321 56.554 56.035 1.00 61.21 N ATOM 4665 CA GLU A 324 41.243 56.429 57.024 1.00 62.77 C ATOM 4666 C GLU A 324 40.301 55.257 56.735 1.00 65.16 C ATOM 4667 O GLU A 324 39.997 54.453 57.620 1.00 64.58 O ATOM 4668 CB GLU A 324 40.412 57.722 57.031 1.00 65.37 C ATOM 4669 CG GLU A 324 40.258 58.366 58.396 1.00 85.23 C ATOM 4670 CD GLU A 324 41.516 59.093 58.841 1.00127.85 C ATOM 4671 OE1 GLU A 324 41.727 60.248 58.402 1.00131.45 O ATOM 4672 OE2 GLU A 324 42.297 58.503 59.624 1.00129.69 O ATOM 4673 HA GLU A 324 41.717 56.248 57.989 1.00 0.00 H ATOM 4674 HB2 GLU A 324 40.895 58.440 56.368 1.00 0.00 H ATOM 4675 HB3 GLU A 324 39.417 57.489 56.650 1.00 0.00 H ATOM 4676 HG2 GLU A 324 39.436 59.081 58.355 1.00 0.00 H ATOM 4677 HG3 GLU A 324 40.026 57.590 59.125 1.00 0.00 H ATOM 4678 H GLU A 324 42.422 57.460 55.535 1.00 0.00 H ATOM 4679 N ALA A 325 39.810 55.198 55.499 1.00 60.24 N ATOM 4680 CA ALA A 325 38.887 54.151 55.068 1.00 59.69 C ATOM 4681 C ALA A 325 39.514 52.756 54.909 1.00 61.88 C ATOM 4682 O ALA A 325 38.804 51.787 54.646 1.00 61.58 O ATOM 4683 CB ALA A 325 38.199 54.566 53.752 1.00 60.44 C ATOM 4684 HA ALA A 325 38.162 54.055 55.876 1.00 0.00 H ATOM 4685 HB1 ALA A 325 37.645 55.492 53.909 1.00 0.00 H ATOM 4686 HB2 ALA A 325 38.954 54.719 52.981 1.00 0.00 H ATOM 4687 HB3 ALA A 325 37.513 53.779 53.438 1.00 0.00 H ATOM 4688 H ALA A 325 40.095 55.926 54.813 1.00 0.00 H ATOM 4689 N ALA A 326 40.837 52.665 55.010 1.00 57.50 N ATOM 4690 CA ALA A 326 41.550 51.401 54.817 1.00 56.89 C ATOM 4691 C ALA A 326 40.878 50.180 55.446 1.00 61.40 C ATOM 4692 O ALA A 326 40.755 49.136 54.802 1.00 61.24 O ATOM 4693 CB ALA A 326 43.008 51.521 55.274 1.00 57.33 C ATOM 4694 HA ALA A 326 41.518 51.218 53.743 1.00 0.00 H ATOM 4695 HB1 ALA A 326 43.506 52.298 54.694 1.00 0.00 H ATOM 4696 HB2 ALA A 326 43.036 51.782 56.332 1.00 0.00 H ATOM 4697 HB3 ALA A 326 43.515 50.569 55.120 1.00 0.00 H ATOM 4698 H ALA A 326 41.384 53.521 55.234 1.00 0.00 H ATOM 4699 N SER A 327 40.438 50.312 56.696 1.00 58.00 N ATOM 4700 CA SER A 327 39.779 49.208 57.402 1.00 57.35 C ATOM 4701 C SER A 327 38.334 48.971 56.937 1.00 58.76 C ATOM 4702 O SER A 327 37.797 47.869 57.113 1.00 59.84 O ATOM 4703 CB SER A 327 39.815 49.443 58.924 1.00 61.43 C ATOM 4704 OG SER A 327 39.389 50.755 59.253 1.00 66.93 O ATOM 4705 HA SER A 327 40.341 48.307 57.157 1.00 0.00 H ATOM 4706 HB2 SER A 327 40.835 49.300 59.282 1.00 0.00 H ATOM 4707 HB3 SER A 327 39.157 48.723 59.410 1.00 0.00 H ATOM 4708 HG SER A 327 39.423 50.875 60.235 1.00 0.00 H ATOM 4709 H SER A 327 40.565 51.221 57.184 1.00 0.00 H ATOM 4710 N ARG A 328 37.720 50.003 56.348 1.00 51.39 N ATOM 4711 CA ARG A 328 36.333 49.956 55.855 1.00 49.60 C ATOM 4712 C ARG A 328 36.150 49.330 54.452 1.00 51.03 C ATOM 4713 O ARG A 328 35.058 48.881 54.097 1.00 51.26 O ATOM 4714 CB ARG A 328 35.745 51.366 55.872 1.00 49.08 C ATOM 4715 CG ARG A 328 34.366 51.491 55.272 1.00 65.60 C ATOM 4716 CD ARG A 328 33.700 52.807 55.698 1.00 87.29 C ATOM 4717 NE ARG A 328 32.726 53.286 54.714 1.00108.46 N ATOM 4718 CZ ARG A 328 32.946 54.281 53.855 1.00128.40 C ATOM 4719 NH1 ARG A 328 34.112 54.914 53.853 1.00120.02 N ATOM 4720 NH2 ARG A 328 32.000 54.644 52.994 1.00113.16 N ATOM 4721 HA ARG A 328 35.802 49.290 56.534 1.00 0.00 H ATOM 4722 HB2 ARG A 328 35.694 51.699 56.909 1.00 0.00 H ATOM 4723 HB3 ARG A 328 36.417 52.019 55.315 1.00 0.00 H ATOM 4724 HG2 ARG A 328 34.446 51.467 54.185 1.00 0.00 H ATOM 4725 HG3 ARG A 328 33.753 50.655 55.609 1.00 0.00 H ATOM 4726 HD2 ARG A 328 34.473 53.566 55.824 1.00 0.00 H ATOM 4727 HD3 ARG A 328 33.189 52.649 56.648 1.00 0.00 H ATOM 4728 HE ARG A 328 31.798 52.817 54.684 1.00 0.00 H ATOM 4729 HH12 ARG A 328 34.281 55.690 53.182 1.00 0.00 H ATOM 4730 HH11 ARG A 328 34.857 54.634 54.523 1.00 0.00 H ATOM 4731 HH22 ARG A 328 32.176 55.421 52.325 1.00 0.00 H ATOM 4732 HH21 ARG A 328 31.084 54.151 52.989 1.00 0.00 H ATOM 4733 H ARG A 328 38.252 50.889 56.232 1.00 0.00 H ATOM 4734 N VAL A 329 37.196 49.345 53.629 1.00 43.43 N ATOM 4735 CA VAL A 329 37.095 48.736 52.302 1.00 39.93 C ATOM 4736 C VAL A 329 37.373 47.253 52.478 1.00 38.68 C ATOM 4737 O VAL A 329 38.213 46.875 53.295 1.00 37.38 O ATOM 4738 CB VAL A 329 38.107 49.368 51.316 1.00 42.60 C ATOM 4739 CG1 VAL A 329 39.518 49.095 51.772 1.00 41.02 C ATOM 4740 CG2 VAL A 329 37.885 48.834 49.896 1.00 42.46 C ATOM 4741 HA VAL A 329 36.104 48.902 51.880 1.00 0.00 H ATOM 4742 HB VAL A 329 37.949 50.446 51.301 1.00 0.00 H ATOM 4743 HG11 VAL A 329 39.668 49.525 52.762 1.00 0.00 H ATOM 4744 HG12 VAL A 329 39.683 48.018 51.813 1.00 0.00 H ATOM 4745 HG13 VAL A 329 40.219 49.545 51.069 1.00 0.00 H ATOM 4746 HG21 VAL A 329 38.016 47.752 49.891 1.00 0.00 H ATOM 4747 HG22 VAL A 329 36.874 49.080 49.571 1.00 0.00 H ATOM 4748 HG23 VAL A 329 38.607 49.292 49.220 1.00 0.00 H ATOM 4749 H VAL A 329 38.087 49.790 53.929 1.00 0.00 H ATOM 4750 N LEU A 330 36.672 46.406 51.733 1.00 32.95 N ATOM 4751 CA LEU A 330 36.954 44.981 51.787 1.00 30.71 C ATOM 4752 C LEU A 330 38.011 44.688 50.710 1.00 33.27 C ATOM 4753 O LEU A 330 37.942 45.229 49.596 1.00 29.99 O ATOM 4754 CB LEU A 330 35.704 44.170 51.479 1.00 31.45 C ATOM 4755 CG LEU A 330 34.496 44.345 52.403 1.00 36.95 C ATOM 4756 CD1 LEU A 330 33.388 43.392 51.946 1.00 37.01 C ATOM 4757 CD2 LEU A 330 34.893 44.090 53.851 1.00 40.13 C ATOM 4758 HA LEU A 330 37.302 44.709 52.784 1.00 0.00 H ATOM 4759 HB2 LEU A 330 35.384 44.435 50.471 1.00 0.00 H ATOM 4760 HB3 LEU A 330 35.984 43.117 51.505 1.00 0.00 H ATOM 4761 HG LEU A 330 34.127 45.369 52.348 1.00 0.00 H ATOM 4762 HD21 LEU A 330 35.271 43.072 53.949 1.00 0.00 H ATOM 4763 HD22 LEU A 330 35.669 44.797 54.143 1.00 0.00 H ATOM 4764 HD23 LEU A 330 34.022 44.219 54.493 1.00 0.00 H ATOM 4765 HD11 LEU A 330 33.108 43.628 50.920 1.00 0.00 H ATOM 4766 HD12 LEU A 330 33.750 42.365 51.998 1.00 0.00 H ATOM 4767 HD13 LEU A 330 32.521 43.507 52.596 1.00 0.00 H ATOM 4768 H LEU A 330 35.920 46.763 51.110 1.00 0.00 H ATOM 4769 N VAL A 331 38.955 43.806 51.043 1.00 29.86 N ATOM 4770 CA VAL A 331 40.023 43.379 50.135 1.00 27.96 C ATOM 4771 C VAL A 331 40.017 41.865 50.127 1.00 31.02 C ATOM 4772 O VAL A 331 40.046 41.261 51.188 1.00 32.75 O ATOM 4773 CB VAL A 331 41.423 43.825 50.684 1.00 32.14 C ATOM 4774 CG1 VAL A 331 42.537 43.380 49.725 1.00 31.45 C ATOM 4775 CG2 VAL A 331 41.483 45.322 50.933 1.00 31.76 C ATOM 4776 HA VAL A 331 39.860 43.813 49.149 1.00 0.00 H ATOM 4777 HB VAL A 331 41.575 43.336 51.646 1.00 0.00 H ATOM 4778 HG11 VAL A 331 42.520 42.294 49.630 1.00 0.00 H ATOM 4779 HG12 VAL A 331 42.376 43.834 48.747 1.00 0.00 H ATOM 4780 HG13 VAL A 331 43.502 43.697 50.120 1.00 0.00 H ATOM 4781 HG21 VAL A 331 41.297 45.852 49.999 1.00 0.00 H ATOM 4782 HG22 VAL A 331 40.725 45.598 51.666 1.00 0.00 H ATOM 4783 HG23 VAL A 331 42.470 45.587 51.312 1.00 0.00 H ATOM 4784 H VAL A 331 38.932 43.399 52.000 1.00 0.00 H ATOM 4785 N SER A 332 40.023 41.216 48.965 1.00 25.69 N ATOM 4786 CA SER A 332 40.147 39.767 48.993 1.00 24.52 C ATOM 4787 C SER A 332 40.967 39.260 47.839 1.00 29.09 C ATOM 4788 O SER A 332 40.973 39.881 46.790 1.00 29.03 O ATOM 4789 CB SER A 332 38.794 39.053 49.122 1.00 25.99 C ATOM 4790 OG SER A 332 38.192 38.755 47.869 1.00 30.91 O ATOM 4791 HA SER A 332 40.692 39.516 49.903 1.00 0.00 H ATOM 4792 HB2 SER A 332 38.117 39.694 49.687 1.00 0.00 H ATOM 4793 HB3 SER A 332 38.946 38.119 49.664 1.00 0.00 H ATOM 4794 HG SER A 332 37.327 38.298 48.020 1.00 0.00 H ATOM 4795 H SER A 332 39.941 41.729 48.064 1.00 0.00 H ATOM 4796 N SER A 333 41.671 38.142 48.034 1.00 24.85 N ATOM 4797 CA SER A 333 42.384 37.548 46.924 1.00 24.82 C ATOM 4798 C SER A 333 41.698 36.243 46.563 1.00 28.00 C ATOM 4799 O SER A 333 41.727 35.290 47.342 1.00 27.43 O ATOM 4800 CB SER A 333 43.868 37.294 47.213 1.00 26.30 C ATOM 4801 OG SER A 333 44.405 36.496 46.155 1.00 28.75 O ATOM 4802 HA SER A 333 42.357 38.257 46.096 1.00 0.00 H ATOM 4803 HB2 SER A 333 43.974 36.767 48.161 1.00 0.00 H ATOM 4804 HB3 SER A 333 44.401 38.243 47.265 1.00 0.00 H ATOM 4805 HG SER A 333 45.364 36.323 46.328 1.00 0.00 H ATOM 4806 H SER A 333 41.706 37.702 48.976 1.00 0.00 H ATOM 4807 N THR A 334 41.105 36.187 45.369 1.00 23.73 N ATOM 4808 CA THR A 334 40.462 34.949 44.899 1.00 22.93 C ATOM 4809 C THR A 334 41.482 33.928 44.439 1.00 25.76 C ATOM 4810 O THR A 334 41.131 32.787 44.168 1.00 25.33 O ATOM 4811 CB THR A 334 39.417 35.227 43.788 1.00 25.49 C ATOM 4812 OG1 THR A 334 39.959 36.190 42.894 1.00 25.05 O ATOM 4813 CG2 THR A 334 38.168 35.827 44.407 1.00 21.86 C ATOM 4814 HA THR A 334 39.931 34.527 45.752 1.00 0.00 H ATOM 4815 HB THR A 334 39.175 34.297 43.273 1.00 0.00 H ATOM 4816 HG1 THR A 334 40.793 35.836 42.495 1.00 0.00 H ATOM 4817 HG23 THR A 334 37.727 35.110 45.100 1.00 0.00 H ATOM 4818 HG21 THR A 334 38.432 36.738 44.944 1.00 0.00 H ATOM 4819 HG22 THR A 334 37.451 36.062 43.620 1.00 0.00 H ATOM 4820 H THR A 334 41.097 37.031 44.761 1.00 0.00 H ATOM 4821 N LYS A 335 42.755 34.332 44.352 1.00 22.00 N ATOM 4822 CA LYS A 335 43.805 33.371 44.017 1.00 20.34 C ATOM 4823 C LYS A 335 43.950 32.361 45.173 1.00 24.78 C ATOM 4824 O LYS A 335 44.500 31.283 44.991 1.00 23.77 O ATOM 4825 CB LYS A 335 45.159 34.063 43.761 1.00 22.98 C ATOM 4826 CG LYS A 335 45.161 35.084 42.629 1.00 24.34 C ATOM 4827 CD LYS A 335 46.601 35.562 42.338 1.00 23.78 C ATOM 4828 CE LYS A 335 46.686 36.411 41.045 1.00 22.30 C ATOM 4829 NZ LYS A 335 45.919 37.700 41.169 1.00 23.36 N ATOM 4830 HA LYS A 335 43.518 32.861 43.098 1.00 0.00 H ATOM 4831 HB2 LYS A 335 45.456 34.574 44.677 1.00 0.00 H ATOM 4832 HB3 LYS A 335 45.892 33.293 43.522 1.00 0.00 H ATOM 4833 HG2 LYS A 335 44.746 34.626 41.731 1.00 0.00 H ATOM 4834 HG3 LYS A 335 44.549 35.939 42.915 1.00 0.00 H ATOM 4835 HD2 LYS A 335 46.947 36.165 43.177 1.00 0.00 H ATOM 4836 HD3 LYS A 335 47.245 34.690 42.228 1.00 0.00 H ATOM 4837 HE2 LYS A 335 46.275 35.834 40.217 1.00 0.00 H ATOM 4838 HE3 LYS A 335 47.732 36.641 40.842 1.00 0.00 H ATOM 4839 HZ1 LYS A 335 44.918 37.490 41.356 1.00 0.00 H ATOM 4840 HZ2 LYS A 335 46.309 38.260 41.954 1.00 0.00 H ATOM 4841 HZ3 LYS A 335 46.002 38.238 40.283 1.00 0.00 H ATOM 4842 H LYS A 335 42.997 35.329 44.523 1.00 0.00 H ATOM 4843 N SER A 336 43.393 32.661 46.344 1.00 24.01 N ATOM 4844 CA SER A 336 43.387 31.668 47.462 1.00 23.44 C ATOM 4845 C SER A 336 42.637 30.406 47.033 1.00 27.97 C ATOM 4846 O SER A 336 42.889 29.330 47.554 1.00 29.56 O ATOM 4847 CB SER A 336 42.695 32.263 48.704 1.00 26.19 C ATOM 4848 OG SER A 336 41.386 32.696 48.381 1.00 28.86 O ATOM 4849 HA SER A 336 44.420 31.420 47.707 1.00 0.00 H ATOM 4850 HB2 SER A 336 43.275 33.112 49.066 1.00 0.00 H ATOM 4851 HB3 SER A 336 42.640 31.503 49.483 1.00 0.00 H ATOM 4852 HG SER A 336 41.434 33.389 47.675 1.00 0.00 H ATOM 4853 H SER A 336 42.958 33.595 46.483 1.00 0.00 H ATOM 4854 N MET A 337 41.750 30.527 46.037 1.00 22.80 N ATOM 4855 CA MET A 337 40.979 29.358 45.558 1.00 23.07 C ATOM 4856 C MET A 337 41.361 28.922 44.140 1.00 27.22 C ATOM 4857 O MET A 337 41.359 27.758 43.762 1.00 27.21 O ATOM 4858 CB MET A 337 39.487 29.761 45.520 1.00 25.23 C ATOM 4859 CG MET A 337 38.859 30.021 46.900 1.00 27.09 C ATOM 4860 SD MET A 337 37.177 30.752 46.841 1.00 28.78 S ATOM 4861 CE MET A 337 37.518 32.488 46.840 1.00 23.61 C ATOM 4862 HA MET A 337 41.190 28.530 46.235 1.00 0.00 H ATOM 4863 HB2 MET A 337 39.395 30.671 44.927 1.00 0.00 H ATOM 4864 HB3 MET A 337 38.930 28.958 45.038 1.00 0.00 H ATOM 4865 HG2 MET A 337 39.509 30.704 47.448 1.00 0.00 H ATOM 4866 HG3 MET A 337 38.800 29.072 47.433 1.00 0.00 H ATOM 4867 HE1 MET A 337 38.063 32.750 47.747 1.00 0.00 H ATOM 4868 HE2 MET A 337 38.120 32.738 45.967 1.00 0.00 H ATOM 4869 HE3 MET A 337 36.579 33.041 46.806 1.00 0.00 H ATOM 4870 H MET A 337 41.601 31.456 45.594 1.00 0.00 H ATOM 4871 N THR A 338 41.592 29.924 43.320 1.00 25.25 N ATOM 4872 CA THR A 338 41.796 29.762 41.888 1.00 25.60 C ATOM 4873 C THR A 338 43.289 29.535 41.507 1.00 29.76 C ATOM 4874 O THR A 338 43.625 28.905 40.496 1.00 28.32 O ATOM 4875 CB THR A 338 41.244 31.090 41.381 1.00 30.21 C ATOM 4876 OG1 THR A 338 40.005 30.980 40.666 1.00 36.29 O ATOM 4877 CG2 THR A 338 42.194 31.982 40.888 1.00 19.96 C ATOM 4878 HA THR A 338 41.316 28.882 41.460 1.00 0.00 H ATOM 4879 HB THR A 338 40.932 31.622 42.280 1.00 0.00 H ATOM 4880 HG1 THR A 338 39.714 31.879 40.372 1.00 0.00 H ATOM 4881 HG23 THR A 338 43.077 31.960 41.527 1.00 0.00 H ATOM 4882 HG21 THR A 338 42.470 31.693 39.874 1.00 0.00 H ATOM 4883 HG22 THR A 338 41.775 32.988 40.879 1.00 0.00 H ATOM 4884 H THR A 338 41.631 30.885 43.716 1.00 0.00 H ATOM 4885 N GLY A 339 44.191 29.988 42.362 1.00 26.75 N ATOM 4886 CA GLY A 339 45.596 29.944 42.012 1.00 26.33 C ATOM 4887 C GLY A 339 45.831 31.172 41.134 1.00 28.44 C ATOM 4888 O GLY A 339 44.929 32.015 40.950 1.00 27.67 O ATOM 4889 HA3 GLY A 339 45.824 29.031 41.462 1.00 0.00 H ATOM 4890 HA2 GLY A 339 46.215 29.991 42.908 1.00 0.00 H ATOM 4891 H GLY A 339 43.893 30.374 43.281 1.00 0.00 H ATOM 4892 N HIS A 340 47.041 31.301 40.613 1.00 23.76 N ATOM 4893 CA HIS A 340 47.453 32.498 39.832 1.00 23.06 C ATOM 4894 C HIS A 340 47.376 32.191 38.346 1.00 25.46 C ATOM 4895 O HIS A 340 48.178 31.398 37.836 1.00 24.69 O ATOM 4896 CB HIS A 340 48.921 32.800 40.194 1.00 23.14 C ATOM 4897 CG HIS A 340 49.421 34.143 39.743 1.00 25.28 C ATOM 4898 ND1 HIS A 340 48.711 34.969 38.895 1.00 26.08 N ATOM 4899 CD2 HIS A 340 50.544 34.821 40.074 1.00 24.38 C ATOM 4900 CE1 HIS A 340 49.388 36.089 38.707 1.00 24.08 C ATOM 4901 NE2 HIS A 340 50.503 36.023 39.414 1.00 24.64 N ATOM 4902 HA HIS A 340 46.803 33.343 40.059 1.00 0.00 H ATOM 4903 HB2 HIS A 340 49.020 32.748 41.278 1.00 0.00 H ATOM 4904 HB3 HIS A 340 49.547 32.034 39.736 1.00 0.00 H ATOM 4905 HD2 HIS A 340 51.334 34.476 40.741 1.00 0.00 H ATOM 4906 HE1 HIS A 340 49.080 36.923 38.077 1.00 0.00 H ATOM 4907 H HIS A 340 47.731 30.536 40.755 1.00 0.00 H ATOM 4908 N LEU A 341 46.364 32.753 37.679 1.00 21.97 N ATOM 4909 CA LEU A 341 46.139 32.561 36.238 1.00 21.00 C ATOM 4910 C LEU A 341 47.081 33.401 35.352 1.00 21.69 C ATOM 4911 O LEU A 341 46.936 33.442 34.134 1.00 20.12 O ATOM 4912 CB LEU A 341 44.644 32.831 35.871 1.00 19.61 C ATOM 4913 CG LEU A 341 43.792 31.536 35.926 1.00 24.17 C ATOM 4914 CD1 LEU A 341 43.581 31.138 37.381 1.00 24.29 C ATOM 4915 CD2 LEU A 341 42.419 31.708 35.249 1.00 24.27 C ATOM 4916 HA LEU A 341 46.376 31.518 36.029 1.00 0.00 H ATOM 4917 HB2 LEU A 341 44.233 33.554 36.576 1.00 0.00 H ATOM 4918 HB3 LEU A 341 44.597 33.242 34.862 1.00 0.00 H ATOM 4919 HG LEU A 341 44.335 30.762 35.383 1.00 0.00 H ATOM 4920 HD21 LEU A 341 41.864 32.499 35.753 1.00 0.00 H ATOM 4921 HD22 LEU A 341 42.562 31.973 34.202 1.00 0.00 H ATOM 4922 HD23 LEU A 341 41.863 30.773 35.315 1.00 0.00 H ATOM 4923 HD11 LEU A 341 44.548 30.961 37.852 1.00 0.00 H ATOM 4924 HD12 LEU A 341 43.062 31.941 37.904 1.00 0.00 H ATOM 4925 HD13 LEU A 341 42.982 30.228 37.424 1.00 0.00 H ATOM 4926 H LEU A 341 45.701 33.357 38.206 1.00 0.00 H ATOM 4927 N LEU A 342 48.070 34.037 35.963 1.00 20.75 N ATOM 4928 CA LEU A 342 49.067 34.833 35.226 1.00 20.01 C ATOM 4929 C LEU A 342 48.459 35.845 34.239 1.00 23.72 C ATOM 4930 O LEU A 342 47.731 36.757 34.648 1.00 24.24 O ATOM 4931 CB LEU A 342 50.117 33.935 34.557 1.00 19.72 C ATOM 4932 CG LEU A 342 50.849 32.951 35.496 1.00 26.21 C ATOM 4933 CD1 LEU A 342 51.693 31.965 34.706 1.00 26.92 C ATOM 4934 CD2 LEU A 342 51.745 33.681 36.568 1.00 25.29 C ATOM 4935 HA LEU A 342 49.572 35.441 35.977 1.00 0.00 H ATOM 4936 HB2 LEU A 342 49.617 33.352 33.784 1.00 0.00 H ATOM 4937 HB3 LEU A 342 50.866 34.580 34.097 1.00 0.00 H ATOM 4938 HG LEU A 342 50.070 32.410 36.033 1.00 0.00 H ATOM 4939 HD21 LEU A 342 52.500 34.282 36.060 1.00 0.00 H ATOM 4940 HD22 LEU A 342 51.119 34.327 37.184 1.00 0.00 H ATOM 4941 HD23 LEU A 342 52.234 32.938 37.198 1.00 0.00 H ATOM 4942 HD11 LEU A 342 51.051 31.395 34.035 1.00 0.00 H ATOM 4943 HD12 LEU A 342 52.436 32.510 34.124 1.00 0.00 H ATOM 4944 HD13 LEU A 342 52.196 31.286 35.394 1.00 0.00 H ATOM 4945 H LEU A 342 48.145 33.972 36.998 1.00 0.00 H ATOM 4946 N GLY A 343 48.699 35.664 32.942 1.00 19.33 N ATOM 4947 CA GLY A 343 48.177 36.636 31.972 1.00 19.59 C ATOM 4948 C GLY A 343 46.641 36.643 31.893 1.00 25.29 C ATOM 4949 O GLY A 343 46.056 37.523 31.256 1.00 24.04 O ATOM 4950 HA3 GLY A 343 48.574 36.391 30.987 1.00 0.00 H ATOM 4951 HA2 GLY A 343 48.514 37.631 32.262 1.00 0.00 H ATOM 4952 H GLY A 343 49.250 34.843 32.619 1.00 0.00 H ATOM 4953 N ALA A 344 45.991 35.631 32.480 1.00 20.75 N ATOM 4954 CA ALA A 344 44.514 35.582 32.505 1.00 18.91 C ATOM 4955 C ALA A 344 43.983 36.032 33.874 1.00 22.50 C ATOM 4956 O ALA A 344 42.796 36.196 34.055 1.00 22.75 O ATOM 4957 CB ALA A 344 44.032 34.118 32.189 1.00 19.35 C ATOM 4958 HA ALA A 344 44.124 36.262 31.747 1.00 0.00 H ATOM 4959 HB1 ALA A 344 44.389 33.824 31.202 1.00 0.00 H ATOM 4960 HB2 ALA A 344 44.431 33.435 32.939 1.00 0.00 H ATOM 4961 HB3 ALA A 344 42.943 34.083 32.208 1.00 0.00 H ATOM 4962 H ALA A 344 46.535 34.865 32.927 1.00 0.00 H ATOM 4963 N ALA A 345 44.859 36.189 34.869 1.00 20.85 N ATOM 4964 CA ALA A 345 44.412 36.547 36.221 1.00 19.12 C ATOM 4965 C ALA A 345 43.626 37.840 36.258 1.00 24.52 C ATOM 4966 O ALA A 345 42.611 37.927 36.926 1.00 26.00 O ATOM 4967 CB ALA A 345 45.617 36.660 37.192 1.00 18.69 C ATOM 4968 HA ALA A 345 43.750 35.742 36.540 1.00 0.00 H ATOM 4969 HB1 ALA A 345 46.137 35.703 37.237 1.00 0.00 H ATOM 4970 HB2 ALA A 345 46.300 37.430 36.833 1.00 0.00 H ATOM 4971 HB3 ALA A 345 45.257 36.926 38.186 1.00 0.00 H ATOM 4972 H ALA A 345 45.874 36.056 34.684 1.00 0.00 H ATOM 4973 N GLY A 346 44.116 38.876 35.592 1.00 22.12 N ATOM 4974 CA GLY A 346 43.461 40.173 35.616 1.00 21.38 C ATOM 4975 C GLY A 346 42.127 40.162 34.894 1.00 25.21 C ATOM 4976 O GLY A 346 41.233 40.965 35.194 1.00 26.48 O ATOM 4977 HA3 GLY A 346 44.113 40.903 35.136 1.00 0.00 H ATOM 4978 HA2 GLY A 346 43.295 40.462 36.654 1.00 0.00 H ATOM 4979 H GLY A 346 44.989 38.758 35.040 1.00 0.00 H ATOM 4980 N ALA A 347 42.006 39.264 33.922 1.00 21.28 N ATOM 4981 CA ALA A 347 40.763 39.073 33.159 1.00 20.15 C ATOM 4982 C ALA A 347 39.690 38.337 34.017 1.00 25.18 C ATOM 4983 O ALA A 347 38.548 38.798 34.115 1.00 25.88 O ATOM 4984 CB ALA A 347 41.062 38.281 31.841 1.00 20.35 C ATOM 4985 HA ALA A 347 40.362 40.052 32.896 1.00 0.00 H ATOM 4986 HB1 ALA A 347 41.774 38.842 31.235 1.00 0.00 H ATOM 4987 HB2 ALA A 347 41.484 37.308 32.091 1.00 0.00 H ATOM 4988 HB3 ALA A 347 40.136 38.144 31.283 1.00 0.00 H ATOM 4989 H ALA A 347 42.827 38.669 33.690 1.00 0.00 H ATOM 4990 N VAL A 348 40.008 37.172 34.589 1.00 21.40 N ATOM 4991 CA VAL A 348 38.994 36.498 35.419 1.00 20.21 C ATOM 4992 C VAL A 348 38.668 37.352 36.645 1.00 26.28 C ATOM 4993 O VAL A 348 37.525 37.400 37.096 1.00 28.72 O ATOM 4994 CB VAL A 348 39.342 35.049 35.810 1.00 22.49 C ATOM 4995 CG1 VAL A 348 39.511 34.199 34.570 1.00 22.45 C ATOM 4996 CG2 VAL A 348 40.601 34.979 36.695 1.00 23.23 C ATOM 4997 HA VAL A 348 38.105 36.403 34.795 1.00 0.00 H ATOM 4998 HB VAL A 348 38.513 34.656 36.398 1.00 0.00 H ATOM 4999 HG11 VAL A 348 38.582 34.202 34.000 1.00 0.00 H ATOM 5000 HG12 VAL A 348 40.316 34.607 33.958 1.00 0.00 H ATOM 5001 HG13 VAL A 348 39.757 33.178 34.862 1.00 0.00 H ATOM 5002 HG21 VAL A 348 41.448 35.400 36.153 1.00 0.00 H ATOM 5003 HG22 VAL A 348 40.433 35.549 37.609 1.00 0.00 H ATOM 5004 HG23 VAL A 348 40.809 33.939 36.947 1.00 0.00 H ATOM 5005 H VAL A 348 40.949 36.751 34.452 1.00 0.00 H ATOM 5006 N GLU A 349 39.676 38.006 37.202 1.00 22.38 N ATOM 5007 CA GLU A 349 39.488 38.833 38.400 1.00 19.93 C ATOM 5008 C GLU A 349 38.665 40.093 38.171 1.00 26.13 C ATOM 5009 O GLU A 349 37.977 40.560 39.080 1.00 26.76 O ATOM 5010 CB GLU A 349 40.818 39.095 39.085 1.00 21.19 C ATOM 5011 CG GLU A 349 41.421 37.762 39.612 1.00 17.95 C ATOM 5012 CD GLU A 349 42.902 37.844 39.936 1.00 29.33 C ATOM 5013 OE1 GLU A 349 43.414 38.962 40.102 1.00 25.70 O ATOM 5014 OE2 GLU A 349 43.483 36.789 40.240 1.00 28.25 O ATOM 5015 HA GLU A 349 38.872 38.252 39.086 1.00 0.00 H ATOM 5016 HB2 GLU A 349 41.508 39.546 38.372 1.00 0.00 H ATOM 5017 HB3 GLU A 349 40.665 39.777 39.921 1.00 0.00 H ATOM 5018 HG2 GLU A 349 40.886 37.477 40.518 1.00 0.00 H ATOM 5019 HG3 GLU A 349 41.278 36.995 38.851 1.00 0.00 H ATOM 5020 H GLU A 349 40.624 37.932 36.780 1.00 0.00 H ATOM 5021 N SER A 350 38.697 40.617 36.944 1.00 20.82 N ATOM 5022 CA SER A 350 37.852 41.747 36.566 1.00 21.46 C ATOM 5023 C SER A 350 36.409 41.211 36.530 1.00 26.96 C ATOM 5024 O SER A 350 35.470 41.901 36.927 1.00 26.10 O ATOM 5025 CB SER A 350 38.233 42.249 35.162 1.00 22.48 C ATOM 5026 OG SER A 350 39.364 43.117 35.250 1.00 27.69 O ATOM 5027 HA SER A 350 37.967 42.572 37.268 1.00 0.00 H ATOM 5028 HB2 SER A 350 37.392 42.792 34.731 1.00 0.00 H ATOM 5029 HB3 SER A 350 38.478 41.398 34.527 1.00 0.00 H ATOM 5030 HG SER A 350 40.128 42.623 35.641 1.00 0.00 H ATOM 5031 H SER A 350 39.342 40.209 36.237 1.00 0.00 H ATOM 5032 N ILE A 351 36.235 39.979 36.043 1.00 24.05 N ATOM 5033 CA ILE A 351 34.901 39.390 36.036 1.00 23.79 C ATOM 5034 C ILE A 351 34.385 39.301 37.480 1.00 27.89 C ATOM 5035 O ILE A 351 33.237 39.649 37.745 1.00 26.75 O ATOM 5036 CB ILE A 351 34.847 38.027 35.278 1.00 26.74 C ATOM 5037 CG1 ILE A 351 35.241 38.235 33.800 1.00 26.81 C ATOM 5038 CG2 ILE A 351 33.412 37.450 35.311 1.00 26.28 C ATOM 5039 CD1 ILE A 351 35.235 36.951 32.947 1.00 26.00 C ATOM 5040 HA ILE A 351 34.232 40.039 35.471 1.00 0.00 H ATOM 5041 HB ILE A 351 35.538 37.339 35.766 1.00 0.00 H ATOM 5042 HG12 ILE A 351 34.539 38.941 33.357 1.00 0.00 H ATOM 5043 HG13 ILE A 351 36.245 38.657 33.772 1.00 0.00 H ATOM 5044 HD11 ILE A 351 35.942 36.235 33.365 1.00 0.00 H ATOM 5045 HD12 ILE A 351 34.234 36.519 32.950 1.00 0.00 H ATOM 5046 HD13 ILE A 351 35.524 37.194 31.925 1.00 0.00 H ATOM 5047 HG21 ILE A 351 33.108 37.294 36.346 1.00 0.00 H ATOM 5048 HG22 ILE A 351 32.729 38.151 34.832 1.00 0.00 H ATOM 5049 HG23 ILE A 351 33.392 36.499 34.778 1.00 0.00 H ATOM 5050 H ILE A 351 37.046 39.444 35.671 1.00 0.00 H ATOM 5051 N TYR A 352 35.237 38.860 38.412 1.00 25.40 N ATOM 5052 CA TYR A 352 34.820 38.712 39.824 1.00 24.97 C ATOM 5053 C TYR A 352 34.422 40.061 40.371 1.00 27.23 C ATOM 5054 O TYR A 352 33.461 40.192 41.127 1.00 26.64 O ATOM 5055 CB TYR A 352 35.913 38.079 40.722 1.00 22.57 C ATOM 5056 CG TYR A 352 36.428 36.755 40.203 1.00 22.50 C ATOM 5057 CD1 TYR A 352 35.694 36.011 39.270 1.00 23.40 C ATOM 5058 CD2 TYR A 352 37.727 36.329 40.509 1.00 22.46 C ATOM 5059 CE1 TYR A 352 36.215 34.810 38.737 1.00 25.48 C ATOM 5060 CE2 TYR A 352 38.272 35.178 39.916 1.00 21.61 C ATOM 5061 CZ TYR A 352 37.523 34.413 39.067 1.00 27.69 C ATOM 5062 OH TYR A 352 38.101 33.254 38.536 1.00 21.03 O ATOM 5063 HA TYR A 352 33.973 38.026 39.838 1.00 0.00 H ATOM 5064 HB3 TYR A 352 35.494 37.921 41.716 1.00 0.00 H ATOM 5065 HB2 TYR A 352 36.751 38.773 40.788 1.00 0.00 H ATOM 5066 HD2 TYR A 352 38.325 36.900 41.219 1.00 0.00 H ATOM 5067 HE2 TYR A 352 39.301 34.893 40.135 1.00 0.00 H ATOM 5068 HE1 TYR A 352 35.606 34.195 38.074 1.00 0.00 H ATOM 5069 HD1 TYR A 352 34.712 36.362 38.952 1.00 0.00 H ATOM 5070 HH TYR A 352 37.449 32.803 37.943 1.00 0.00 H ATOM 5071 H TYR A 352 36.211 38.617 38.139 1.00 0.00 H ATOM 5072 N SER A 353 35.186 41.064 39.999 1.00 23.49 N ATOM 5073 CA SER A 353 34.941 42.433 40.443 1.00 23.25 C ATOM 5074 C SER A 353 33.616 42.979 39.895 1.00 29.01 C ATOM 5075 O SER A 353 32.965 43.835 40.512 1.00 28.09 O ATOM 5076 CB SER A 353 36.115 43.332 39.995 1.00 24.49 C ATOM 5077 OG SER A 353 37.344 42.921 40.619 1.00 29.47 O ATOM 5078 HA SER A 353 34.868 42.433 41.531 1.00 0.00 H ATOM 5079 HB2 SER A 353 35.901 44.364 40.273 1.00 0.00 H ATOM 5080 HB3 SER A 353 36.224 43.264 38.913 1.00 0.00 H ATOM 5081 HG SER A 353 37.545 41.985 40.366 1.00 0.00 H ATOM 5082 H SER A 353 35.991 40.876 39.368 1.00 0.00 H ATOM 5083 N ILE A 354 33.232 42.501 38.722 1.00 26.51 N ATOM 5084 CA ILE A 354 31.990 42.959 38.099 1.00 25.66 C ATOM 5085 C ILE A 354 30.816 42.243 38.765 1.00 30.19 C ATOM 5086 O ILE A 354 29.826 42.868 39.141 1.00 30.56 O ATOM 5087 CB ILE A 354 31.993 42.706 36.579 1.00 26.83 C ATOM 5088 CG1 ILE A 354 32.877 43.722 35.861 1.00 26.78 C ATOM 5089 CG2 ILE A 354 30.556 42.863 35.996 1.00 24.34 C ATOM 5090 CD1 ILE A 354 33.506 43.193 34.546 1.00 27.66 C ATOM 5091 HA ILE A 354 31.896 44.036 38.241 1.00 0.00 H ATOM 5092 HB ILE A 354 32.368 41.694 36.425 1.00 0.00 H ATOM 5093 HG12 ILE A 354 32.271 44.597 35.624 1.00 0.00 H ATOM 5094 HG13 ILE A 354 33.683 44.012 36.535 1.00 0.00 H ATOM 5095 HD11 ILE A 354 34.126 42.324 34.765 1.00 0.00 H ATOM 5096 HD12 ILE A 354 32.713 42.910 33.854 1.00 0.00 H ATOM 5097 HD13 ILE A 354 34.119 43.975 34.098 1.00 0.00 H ATOM 5098 HG21 ILE A 354 29.891 42.144 36.474 1.00 0.00 H ATOM 5099 HG22 ILE A 354 30.197 43.874 36.186 1.00 0.00 H ATOM 5100 HG23 ILE A 354 30.579 42.680 34.922 1.00 0.00 H ATOM 5101 H ILE A 354 33.819 41.792 38.238 1.00 0.00 H ATOM 5102 N LEU A 355 30.938 40.933 38.930 1.00 27.85 N ATOM 5103 CA LEU A 355 29.868 40.134 39.561 1.00 26.15 C ATOM 5104 C LEU A 355 29.636 40.534 41.019 1.00 31.84 C ATOM 5105 O LEU A 355 28.514 40.455 41.524 1.00 31.74 O ATOM 5106 CB LEU A 355 30.169 38.636 39.432 1.00 24.61 C ATOM 5107 CG LEU A 355 30.223 38.107 37.993 1.00 26.10 C ATOM 5108 CD1 LEU A 355 30.552 36.629 37.953 1.00 26.08 C ATOM 5109 CD2 LEU A 355 28.951 38.392 37.191 1.00 25.06 C ATOM 5110 HA LEU A 355 28.941 40.344 39.028 1.00 0.00 H ATOM 5111 HB2 LEU A 355 31.134 38.443 39.900 1.00 0.00 H ATOM 5112 HB3 LEU A 355 29.392 38.088 39.965 1.00 0.00 H ATOM 5113 HG LEU A 355 31.030 38.660 37.511 1.00 0.00 H ATOM 5114 HD21 LEU A 355 28.100 37.920 37.682 1.00 0.00 H ATOM 5115 HD22 LEU A 355 28.790 39.469 37.138 1.00 0.00 H ATOM 5116 HD23 LEU A 355 29.060 37.990 36.184 1.00 0.00 H ATOM 5117 HD11 LEU A 355 31.524 36.462 38.418 1.00 0.00 H ATOM 5118 HD12 LEU A 355 29.787 36.073 38.496 1.00 0.00 H ATOM 5119 HD13 LEU A 355 30.581 36.292 36.917 1.00 0.00 H ATOM 5120 H LEU A 355 31.805 40.458 38.608 1.00 0.00 H ATOM 5121 N ALA A 356 30.681 40.970 41.710 1.00 27.45 N ATOM 5122 CA ALA A 356 30.505 41.416 43.098 1.00 27.42 C ATOM 5123 C ALA A 356 29.510 42.591 43.134 1.00 32.78 C ATOM 5124 O ALA A 356 28.734 42.749 44.090 1.00 31.33 O ATOM 5125 CB ALA A 356 31.836 41.834 43.719 1.00 27.88 C ATOM 5126 HA ALA A 356 30.113 40.584 43.683 1.00 0.00 H ATOM 5127 HB1 ALA A 356 32.521 40.987 43.711 1.00 0.00 H ATOM 5128 HB2 ALA A 356 32.263 42.654 43.142 1.00 0.00 H ATOM 5129 HB3 ALA A 356 31.670 42.159 44.746 1.00 0.00 H ATOM 5130 H ALA A 356 31.623 40.996 41.270 1.00 0.00 H ATOM 5131 N LEU A 357 29.566 43.432 42.106 1.00 28.64 N ATOM 5132 CA LEU A 357 28.677 44.589 41.991 1.00 28.19 C ATOM 5133 C LEU A 357 27.262 44.084 41.752 1.00 34.13 C ATOM 5134 O LEU A 357 26.312 44.546 42.396 1.00 32.73 O ATOM 5135 CB LEU A 357 29.088 45.502 40.807 1.00 27.32 C ATOM 5136 CG LEU A 357 30.274 46.458 41.062 1.00 30.81 C ATOM 5137 CD1 LEU A 357 30.704 47.206 39.774 1.00 29.15 C ATOM 5138 CD2 LEU A 357 30.004 47.454 42.205 1.00 27.73 C ATOM 5139 HA LEU A 357 28.740 45.171 42.910 1.00 0.00 H ATOM 5140 HB2 LEU A 357 29.353 44.859 39.968 1.00 0.00 H ATOM 5141 HB3 LEU A 357 28.223 46.109 40.539 1.00 0.00 H ATOM 5142 HG LEU A 357 31.102 45.823 41.377 1.00 0.00 H ATOM 5143 HD21 LEU A 357 29.134 48.062 41.958 1.00 0.00 H ATOM 5144 HD22 LEU A 357 29.815 46.904 43.127 1.00 0.00 H ATOM 5145 HD23 LEU A 357 30.873 48.099 42.336 1.00 0.00 H ATOM 5146 HD11 LEU A 357 31.007 46.481 39.018 1.00 0.00 H ATOM 5147 HD12 LEU A 357 29.866 47.794 39.400 1.00 0.00 H ATOM 5148 HD13 LEU A 357 31.541 47.867 40.001 1.00 0.00 H ATOM 5149 H LEU A 357 30.267 43.262 41.357 1.00 0.00 H ATOM 5150 N ARG A 358 27.113 43.195 40.775 1.00 30.56 N ATOM 5151 CA ARG A 358 25.795 42.667 40.450 1.00 30.81 C ATOM 5152 C ARG A 358 25.132 42.020 41.661 1.00 35.26 C ATOM 5153 O ARG A 358 23.960 42.267 41.954 1.00 34.16 O ATOM 5154 CB ARG A 358 25.881 41.645 39.307 1.00 29.52 C ATOM 5155 CG ARG A 358 24.499 41.029 38.926 1.00 32.89 C ATOM 5156 CD ARG A 358 24.604 39.810 38.017 1.00 28.37 C ATOM 5157 NE ARG A 358 25.101 38.622 38.722 1.00 32.01 N ATOM 5158 CZ ARG A 358 25.390 37.458 38.139 1.00 38.30 C ATOM 5159 NH1 ARG A 358 25.246 37.307 36.833 1.00 27.41 N ATOM 5160 NH2 ARG A 358 25.793 36.427 38.868 1.00 25.86 N ATOM 5161 HA ARG A 358 25.184 43.512 40.133 1.00 0.00 H ATOM 5162 HB2 ARG A 358 26.293 42.142 38.429 1.00 0.00 H ATOM 5163 HB3 ARG A 358 26.547 40.838 39.613 1.00 0.00 H ATOM 5164 HG2 ARG A 358 23.989 40.733 39.843 1.00 0.00 H ATOM 5165 HG3 ARG A 358 23.911 41.791 38.414 1.00 0.00 H ATOM 5166 HD2 ARG A 358 25.286 40.042 37.199 1.00 0.00 H ATOM 5167 HD3 ARG A 358 23.616 39.589 37.613 1.00 0.00 H ATOM 5168 HE ARG A 358 25.238 38.693 39.751 1.00 0.00 H ATOM 5169 HH12 ARG A 358 25.474 36.396 36.387 1.00 0.00 H ATOM 5170 HH11 ARG A 358 24.905 38.100 36.252 1.00 0.00 H ATOM 5171 HH22 ARG A 358 26.017 35.521 38.409 1.00 0.00 H ATOM 5172 HH21 ARG A 358 25.885 36.524 39.899 1.00 0.00 H ATOM 5173 H ARG A 358 27.944 42.874 40.238 1.00 0.00 H ATOM 5174 N ASP A 359 25.880 41.160 42.346 1.00 31.12 N ATOM 5175 CA ASP A 359 25.336 40.360 43.435 1.00 29.11 C ATOM 5176 C ASP A 359 25.469 40.932 44.840 1.00 31.46 C ATOM 5177 O ASP A 359 24.970 40.333 45.803 1.00 30.04 O ATOM 5178 CB ASP A 359 25.928 38.950 43.384 1.00 28.35 C ATOM 5179 CG ASP A 359 25.460 38.166 42.167 1.00 34.01 C ATOM 5180 OD1 ASP A 359 24.521 38.602 41.469 1.00 33.18 O ATOM 5181 OD2 ASP A 359 25.991 37.073 41.927 1.00 33.63 O ATOM 5182 HA ASP A 359 24.261 40.356 43.255 1.00 0.00 H ATOM 5183 HB2 ASP A 359 27.015 39.028 43.354 1.00 0.00 H ATOM 5184 HB3 ASP A 359 25.628 38.412 44.283 1.00 0.00 H ATOM 5185 H ASP A 359 26.884 41.055 42.097 1.00 0.00 H ATOM 5186 N GLN A 360 26.186 42.044 44.965 1.00 28.17 N ATOM 5187 CA GLN A 360 26.445 42.659 46.256 1.00 28.22 C ATOM 5188 C GLN A 360 26.975 41.618 47.231 1.00 32.86 C ATOM 5189 O GLN A 360 26.565 41.558 48.391 1.00 29.94 O ATOM 5190 CB GLN A 360 25.197 43.357 46.801 1.00 29.84 C ATOM 5191 CG GLN A 360 24.740 44.560 45.951 1.00 22.06 C ATOM 5192 CD GLN A 360 25.691 45.744 46.001 1.00 36.82 C ATOM 5193 OE1 GLN A 360 25.871 46.370 47.049 1.00 29.99 O ATOM 5194 NE2 GLN A 360 26.268 46.092 44.848 1.00 28.77 N ATOM 5195 HA GLN A 360 27.207 43.428 46.128 1.00 0.00 H ATOM 5196 HB2 GLN A 360 24.384 42.632 46.837 1.00 0.00 H ATOM 5197 HB3 GLN A 360 25.412 43.710 47.810 1.00 0.00 H ATOM 5198 HG2 GLN A 360 24.651 44.234 44.915 1.00 0.00 H ATOM 5199 HG3 GLN A 360 23.765 44.886 46.313 1.00 0.00 H ATOM 5200 HE22 GLN A 360 26.088 45.536 43.988 1.00 0.00 H ATOM 5201 HE21 GLN A 360 26.897 46.919 44.810 1.00 0.00 H ATOM 5202 H GLN A 360 26.575 42.489 44.110 1.00 0.00 H ATOM 5203 N ALA A 361 27.926 40.814 46.738 1.00 28.58 N ATOM 5204 CA ALA A 361 28.527 39.723 47.490 1.00 28.43 C ATOM 5205 C ALA A 361 30.018 39.682 47.140 1.00 32.05 C ATOM 5206 O ALA A 361 30.390 39.810 45.973 1.00 28.77 O ATOM 5207 CB ALA A 361 27.876 38.427 47.093 1.00 29.34 C ATOM 5208 HA ALA A 361 28.392 39.870 48.562 1.00 0.00 H ATOM 5209 HB1 ALA A 361 26.809 38.476 47.310 1.00 0.00 H ATOM 5210 HB2 ALA A 361 28.023 38.260 46.026 1.00 0.00 H ATOM 5211 HB3 ALA A 361 28.325 37.609 47.656 1.00 0.00 H ATOM 5212 H ALA A 361 28.253 40.979 45.764 1.00 0.00 H ATOM 5213 N VAL A 362 30.853 39.494 48.156 1.00 29.55 N ATOM 5214 CA VAL A 362 32.310 39.532 47.991 1.00 30.23 C ATOM 5215 C VAL A 362 32.927 38.205 48.415 1.00 35.19 C ATOM 5216 O VAL A 362 32.686 37.739 49.533 1.00 36.75 O ATOM 5217 CB VAL A 362 32.835 40.713 48.806 1.00 33.39 C ATOM 5218 CG1 VAL A 362 34.276 40.590 49.107 1.00 34.00 C ATOM 5219 CG2 VAL A 362 32.481 42.031 48.122 1.00 32.56 C ATOM 5220 HA VAL A 362 32.587 39.672 46.946 1.00 0.00 H ATOM 5221 HB VAL A 362 32.336 40.704 49.775 1.00 0.00 H ATOM 5222 HG11 VAL A 362 34.450 39.679 49.680 1.00 0.00 H ATOM 5223 HG12 VAL A 362 34.838 40.546 48.174 1.00 0.00 H ATOM 5224 HG13 VAL A 362 34.600 41.454 49.688 1.00 0.00 H ATOM 5225 HG21 VAL A 362 32.931 42.056 47.129 1.00 0.00 H ATOM 5226 HG22 VAL A 362 31.398 42.114 48.034 1.00 0.00 H ATOM 5227 HG23 VAL A 362 32.863 42.861 48.716 1.00 0.00 H ATOM 5228 H VAL A 362 30.460 39.314 49.102 1.00 0.00 H ATOM 5229 N PRO A 363 33.647 37.529 47.492 1.00 28.94 N ATOM 5230 CA PRO A 363 34.278 36.230 47.727 1.00 26.57 C ATOM 5231 C PRO A 363 35.416 36.364 48.735 1.00 27.15 C ATOM 5232 O PRO A 363 36.019 37.426 48.888 1.00 26.78 O ATOM 5233 CB PRO A 363 34.795 35.840 46.328 1.00 29.06 C ATOM 5234 CG PRO A 363 35.137 37.152 45.694 1.00 33.39 C ATOM 5235 CD PRO A 363 34.199 38.199 46.291 1.00 30.48 C ATOM 5236 HA PRO A 363 33.606 35.483 48.149 1.00 0.00 H ATOM 5237 HD3 PRO A 363 34.746 39.101 46.565 1.00 0.00 H ATOM 5238 HD2 PRO A 363 33.406 38.456 45.589 1.00 0.00 H ATOM 5239 HG3 PRO A 363 34.995 37.094 44.615 1.00 0.00 H ATOM 5240 HG2 PRO A 363 36.173 37.412 45.909 1.00 0.00 H ATOM 5241 HB2 PRO A 363 35.677 35.203 46.403 1.00 0.00 H ATOM 5242 HB3 PRO A 363 34.023 35.323 45.759 1.00 0.00 H ATOM 5243 N PRO A 364 35.680 35.297 49.485 1.00 24.77 N ATOM 5244 CA PRO A 364 36.666 35.339 50.576 1.00 26.48 C ATOM 5245 C PRO A 364 38.100 35.085 50.163 1.00 31.88 C ATOM 5246 O PRO A 364 38.348 34.459 49.137 1.00 30.58 O ATOM 5247 CB PRO A 364 36.247 34.140 51.432 1.00 27.31 C ATOM 5248 CG PRO A 364 35.793 33.128 50.399 1.00 30.35 C ATOM 5249 CD PRO A 364 35.003 33.986 49.405 1.00 25.98 C ATOM 5250 HA PRO A 364 36.662 36.327 51.036 1.00 0.00 H ATOM 5251 HD3 PRO A 364 35.063 33.574 48.397 1.00 0.00 H ATOM 5252 HD2 PRO A 364 33.957 34.066 49.701 1.00 0.00 H ATOM 5253 HG3 PRO A 364 35.159 32.365 50.850 1.00 0.00 H ATOM 5254 HG2 PRO A 364 36.646 32.651 49.915 1.00 0.00 H ATOM 5255 HB2 PRO A 364 37.088 33.759 52.012 1.00 0.00 H ATOM 5256 HB3 PRO A 364 35.433 34.405 52.106 1.00 0.00 H ATOM 5257 N THR A 365 39.034 35.461 51.037 1.00 29.03 N ATOM 5258 CA THR A 365 40.412 35.012 50.907 1.00 27.92 C ATOM 5259 C THR A 365 40.383 33.766 51.805 1.00 32.88 C ATOM 5260 O THR A 365 40.328 33.915 53.039 1.00 31.63 O ATOM 5261 CB THR A 365 41.436 36.000 51.507 1.00 28.13 C ATOM 5262 OG1 THR A 365 41.333 37.271 50.867 1.00 26.01 O ATOM 5263 CG2 THR A 365 42.858 35.468 51.300 1.00 24.13 C ATOM 5264 HA THR A 365 40.708 34.878 49.867 1.00 0.00 H ATOM 5265 HB THR A 365 41.225 36.105 52.571 1.00 0.00 H ATOM 5266 HG1 THR A 365 40.420 37.632 50.998 1.00 0.00 H ATOM 5267 HG23 THR A 365 42.955 34.496 51.783 1.00 0.00 H ATOM 5268 HG21 THR A 365 43.055 35.366 50.233 1.00 0.00 H ATOM 5269 HG22 THR A 365 43.573 36.165 51.737 1.00 0.00 H ATOM 5270 H THR A 365 38.773 36.086 51.826 1.00 0.00 H ATOM 5271 N ILE A 366 40.353 32.557 51.228 1.00 28.31 N ATOM 5272 CA ILE A 366 40.354 31.350 52.075 1.00 27.74 C ATOM 5273 C ILE A 366 41.772 31.082 52.591 1.00 33.00 C ATOM 5274 O ILE A 366 42.732 31.677 52.087 1.00 29.37 O ATOM 5275 CB ILE A 366 39.764 30.107 51.353 1.00 29.83 C ATOM 5276 CG1 ILE A 366 40.722 29.574 50.280 1.00 27.64 C ATOM 5277 CG2 ILE A 366 38.388 30.452 50.751 1.00 31.25 C ATOM 5278 CD1 ILE A 366 40.269 28.211 49.611 1.00 29.94 C ATOM 5279 HA ILE A 366 39.696 31.539 52.923 1.00 0.00 H ATOM 5280 HB ILE A 366 39.633 29.313 52.088 1.00 0.00 H ATOM 5281 HG12 ILE A 366 40.807 30.326 49.496 1.00 0.00 H ATOM 5282 HG13 ILE A 366 41.697 29.419 50.741 1.00 0.00 H ATOM 5283 HD11 ILE A 366 40.191 27.440 50.377 1.00 0.00 H ATOM 5284 HD12 ILE A 366 39.300 28.348 49.131 1.00 0.00 H ATOM 5285 HD13 ILE A 366 41.006 27.911 48.866 1.00 0.00 H ATOM 5286 HG21 ILE A 366 37.711 30.760 51.548 1.00 0.00 H ATOM 5287 HG22 ILE A 366 38.500 31.265 50.034 1.00 0.00 H ATOM 5288 HG23 ILE A 366 37.983 29.574 50.247 1.00 0.00 H ATOM 5289 H ILE A 366 40.329 32.471 50.192 1.00 0.00 H ATOM 5290 N ASN A 367 41.893 30.206 53.600 1.00 29.36 N ATOM 5291 CA ASN A 367 43.194 29.830 54.167 1.00 28.26 C ATOM 5292 C ASN A 367 43.898 30.894 54.985 1.00 28.70 C ATOM 5293 O ASN A 367 45.046 30.702 55.393 1.00 30.69 O ATOM 5294 CB ASN A 367 44.151 29.342 53.076 1.00 29.06 C ATOM 5295 CG ASN A 367 43.671 28.100 52.412 1.00 39.13 C ATOM 5296 OD1 ASN A 367 43.044 27.250 53.045 1.00 31.46 O ATOM 5297 ND2 ASN A 367 43.920 27.992 51.112 1.00 28.54 N ATOM 5298 HA ASN A 367 42.940 29.032 54.865 1.00 0.00 H ATOM 5299 HB2 ASN A 367 44.252 30.124 52.324 1.00 0.00 H ATOM 5300 HB3 ASN A 367 45.124 29.145 53.526 1.00 0.00 H ATOM 5301 HD22 ASN A 367 44.454 28.737 50.621 1.00 0.00 H ATOM 5302 HD21 ASN A 367 43.581 27.162 50.585 1.00 0.00 H ATOM 5303 H ASN A 367 41.032 29.777 53.996 1.00 0.00 H ATOM 5304 N LEU A 368 43.238 32.015 55.210 1.00 25.30 N ATOM 5305 CA LEU A 368 43.820 33.095 55.988 1.00 25.96 C ATOM 5306 C LEU A 368 43.682 32.788 57.491 1.00 36.28 C ATOM 5307 O LEU A 368 43.020 33.509 58.238 1.00 35.60 O ATOM 5308 CB LEU A 368 43.088 34.384 55.663 1.00 25.75 C ATOM 5309 CG LEU A 368 43.822 35.635 56.144 1.00 30.09 C ATOM 5310 CD1 LEU A 368 45.305 35.399 56.337 1.00 29.19 C ATOM 5311 CD2 LEU A 368 43.562 36.861 55.293 1.00 31.07 C ATOM 5312 HA LEU A 368 44.877 33.196 55.742 1.00 0.00 H ATOM 5313 HB2 LEU A 368 42.965 34.449 54.582 1.00 0.00 H ATOM 5314 HB3 LEU A 368 42.107 34.354 56.138 1.00 0.00 H ATOM 5315 HG LEU A 368 43.394 35.851 57.123 1.00 0.00 H ATOM 5316 HD21 LEU A 368 43.886 36.667 54.271 1.00 0.00 H ATOM 5317 HD22 LEU A 368 42.496 37.087 55.300 1.00 0.00 H ATOM 5318 HD23 LEU A 368 44.117 37.707 55.698 1.00 0.00 H ATOM 5319 HD11 LEU A 368 45.453 34.616 57.080 1.00 0.00 H ATOM 5320 HD12 LEU A 368 45.749 35.092 55.390 1.00 0.00 H ATOM 5321 HD13 LEU A 368 45.777 36.320 56.679 1.00 0.00 H ATOM 5322 H LEU A 368 42.280 32.127 54.822 1.00 0.00 H ATOM 5323 N ASP A 369 44.320 31.711 57.919 1.00 36.14 N ATOM 5324 CA ASP A 369 44.237 31.254 59.300 1.00 36.69 C ATOM 5325 C ASP A 369 44.922 32.155 60.314 1.00 43.45 C ATOM 5326 O ASP A 369 44.351 32.444 61.363 1.00 44.06 O ATOM 5327 CB ASP A 369 44.777 29.837 59.390 1.00 36.65 C ATOM 5328 CG ASP A 369 44.039 28.901 58.487 1.00 43.43 C ATOM 5329 OD1 ASP A 369 42.788 28.982 58.460 1.00 42.29 O ATOM 5330 OD2 ASP A 369 44.688 28.104 57.779 1.00 46.86 O ATOM 5331 HA ASP A 369 43.182 31.286 59.571 1.00 0.00 H ATOM 5332 HB2 ASP A 369 45.830 29.842 59.108 1.00 0.00 H ATOM 5333 HB3 ASP A 369 44.679 29.487 60.417 1.00 0.00 H ATOM 5334 H ASP A 369 44.901 31.172 57.246 1.00 0.00 H ATOM 5335 N ASN A 370 46.145 32.584 59.999 1.00 39.09 N ATOM 5336 CA ASN A 370 46.954 33.412 60.891 1.00 38.15 C ATOM 5337 C ASN A 370 47.607 34.569 60.108 1.00 42.48 C ATOM 5338 O ASN A 370 48.776 34.497 59.716 1.00 43.41 O ATOM 5339 CB ASN A 370 48.047 32.540 61.557 1.00 35.33 C ATOM 5340 CG ASN A 370 47.468 31.447 62.448 1.00 51.02 C ATOM 5341 OD1 ASN A 370 46.901 31.739 63.498 1.00 43.66 O ATOM 5342 ND2 ASN A 370 47.599 30.182 62.026 1.00 34.73 N ATOM 5343 HA ASN A 370 46.310 33.837 61.661 1.00 0.00 H ATOM 5344 HB2 ASN A 370 48.644 32.072 60.775 1.00 0.00 H ATOM 5345 HB3 ASN A 370 48.685 33.183 62.164 1.00 0.00 H ATOM 5346 HD22 ASN A 370 48.087 29.981 61.130 1.00 0.00 H ATOM 5347 HD21 ASN A 370 47.213 29.402 62.595 1.00 0.00 H ATOM 5348 H ASN A 370 46.541 32.317 59.075 1.00 0.00 H ATOM 5349 N PRO A 371 46.866 35.665 59.908 1.00 38.22 N ATOM 5350 CA PRO A 371 47.289 36.847 59.146 1.00 37.88 C ATOM 5351 C PRO A 371 48.572 37.450 59.669 1.00 43.99 C ATOM 5352 O PRO A 371 48.846 37.361 60.867 1.00 44.07 O ATOM 5353 CB PRO A 371 46.156 37.848 59.380 1.00 39.61 C ATOM 5354 CG PRO A 371 45.034 37.058 59.986 1.00 43.98 C ATOM 5355 CD PRO A 371 45.632 35.899 60.677 1.00 39.52 C ATOM 5356 HA PRO A 371 47.473 36.592 58.102 1.00 0.00 H ATOM 5357 HD3 PRO A 371 45.856 36.134 61.718 1.00 0.00 H ATOM 5358 HD2 PRO A 371 44.972 35.033 60.635 1.00 0.00 H ATOM 5359 HG3 PRO A 371 44.354 36.716 59.205 1.00 0.00 H ATOM 5360 HG2 PRO A 371 44.486 37.675 60.698 1.00 0.00 H ATOM 5361 HB2 PRO A 371 46.479 38.635 60.062 1.00 0.00 H ATOM 5362 HB3 PRO A 371 45.841 38.293 58.436 1.00 0.00 H ATOM 5363 N ASP A 372 49.342 38.075 58.775 1.00 38.67 N ATOM 5364 CA ASP A 372 50.550 38.790 59.160 1.00 38.74 C ATOM 5365 C ASP A 372 50.153 39.728 60.311 1.00 45.31 C ATOM 5366 O ASP A 372 49.029 40.226 60.357 1.00 40.94 O ATOM 5367 CB ASP A 372 51.028 39.676 58.004 1.00 39.46 C ATOM 5368 CG ASP A 372 51.826 38.916 56.954 1.00 39.22 C ATOM 5369 OD1 ASP A 372 51.982 37.673 57.072 1.00 33.79 O ATOM 5370 OD2 ASP A 372 52.343 39.595 56.036 1.00 38.30 O ATOM 5371 HA ASP A 372 51.335 38.085 59.433 1.00 0.00 H ATOM 5372 HB2 ASP A 372 50.156 40.118 57.523 1.00 0.00 H ATOM 5373 HB3 ASP A 372 51.657 40.467 58.411 1.00 0.00 H ATOM 5374 H ASP A 372 49.070 38.050 57.772 1.00 0.00 H ATOM 5375 N GLU A 373 51.086 40.001 61.213 1.00 48.36 N ATOM 5376 CA GLU A 373 50.787 40.845 62.368 1.00 51.37 C ATOM 5377 C GLU A 373 50.148 42.212 62.109 1.00 63.35 C ATOM 5378 O GLU A 373 48.923 42.307 61.914 1.00 66.60 O ATOM 5379 CB GLU A 373 51.971 40.916 63.335 1.00 52.65 C ATOM 5380 CG GLU A 373 52.097 39.678 64.207 1.00 60.04 C ATOM 5381 CD GLU A 373 50.776 39.293 64.835 1.00 80.21 C ATOM 5382 OE1 GLU A 373 50.497 38.079 64.946 1.00 63.48 O ATOM 5383 OE2 GLU A 373 50.004 40.213 65.197 1.00 81.93 O ATOM 5384 HA GLU A 373 49.965 40.315 62.848 1.00 0.00 H ATOM 5385 HB2 GLU A 373 52.887 41.029 62.756 1.00 0.00 H ATOM 5386 HB3 GLU A 373 51.842 41.785 63.980 1.00 0.00 H ATOM 5387 HG2 GLU A 373 52.451 38.849 63.594 1.00 0.00 H ATOM 5388 HG3 GLU A 373 52.819 39.876 64.999 1.00 0.00 H ATOM 5389 H GLU A 373 52.043 39.610 61.097 1.00 0.00 H ATOM 5390 N GLY A 374 50.965 43.260 62.111 1.00 61.62 N ATOM 5391 CA GLY A 374 50.537 44.647 61.963 1.00 62.78 C ATOM 5392 C GLY A 374 49.481 45.027 60.935 1.00 70.96 C ATOM 5393 O GLY A 374 49.277 46.216 60.687 1.00 70.53 O ATOM 5394 HA3 GLY A 374 51.429 45.225 61.722 1.00 0.00 H ATOM 5395 HA2 GLY A 374 50.154 44.961 62.934 1.00 0.00 H ATOM 5396 H GLY A 374 51.983 43.079 62.226 1.00 0.00 H ATOM 5397 N CYS A 375 48.810 44.031 60.356 1.00 71.28 N ATOM 5398 CA CYS A 375 47.759 44.229 59.341 1.00 72.50 C ATOM 5399 C CYS A 375 46.449 44.697 59.985 1.00 68.52 C ATOM 5400 O CYS A 375 45.902 44.015 60.838 1.00 68.82 O ATOM 5401 CB CYS A 375 47.471 42.899 58.598 1.00 75.41 C ATOM 5402 SG CYS A 375 48.342 42.572 57.006 1.00 80.92 S ATOM 5403 HA CYS A 375 48.121 44.987 58.646 1.00 0.00 H ATOM 5404 HB2 CYS A 375 46.401 42.871 58.391 1.00 0.00 H ATOM 5405 HB3 CYS A 375 47.729 42.088 59.279 1.00 0.00 H ATOM 5406 HG CYS A 375 48.022 43.560 56.097 1.00 0.00 H ATOM 5407 H CYS A 375 49.042 43.057 60.637 1.00 0.00 H ATOM 5408 N ASP A 376 45.924 45.819 59.515 1.00 59.04 N ATOM 5409 CA ASP A 376 44.684 46.393 60.015 1.00 57.11 C ATOM 5410 C ASP A 376 43.513 46.149 59.045 1.00 54.36 C ATOM 5411 O ASP A 376 42.345 46.339 59.398 1.00 53.36 O ATOM 5412 CB ASP A 376 44.913 47.902 60.209 1.00 60.30 C ATOM 5413 CG ASP A 376 43.627 48.702 60.285 1.00 80.11 C ATOM 5414 OD1 ASP A 376 42.808 48.422 61.187 1.00 84.16 O ATOM 5415 OD2 ASP A 376 43.489 49.684 59.517 1.00 87.14 O ATOM 5416 HA ASP A 376 44.416 45.917 60.958 1.00 0.00 H ATOM 5417 HB2 ASP A 376 45.468 48.051 61.135 1.00 0.00 H ATOM 5418 HB3 ASP A 376 45.502 48.273 59.370 1.00 0.00 H ATOM 5419 H ASP A 376 46.424 46.315 58.750 1.00 0.00 H ATOM 5420 N LEU A 377 43.834 45.727 57.820 1.00 45.04 N ATOM 5421 CA LEU A 377 42.835 45.516 56.752 1.00 40.77 C ATOM 5422 C LEU A 377 41.854 44.353 56.891 1.00 39.17 C ATOM 5423 O LEU A 377 42.173 43.296 57.448 1.00 39.46 O ATOM 5424 CB LEU A 377 43.538 45.420 55.379 1.00 39.64 C ATOM 5425 CG LEU A 377 44.619 46.470 55.069 1.00 41.87 C ATOM 5426 CD1 LEU A 377 45.333 46.161 53.747 1.00 39.60 C ATOM 5427 CD2 LEU A 377 43.983 47.854 55.033 1.00 44.80 C ATOM 5428 HA LEU A 377 42.202 46.398 56.849 1.00 0.00 H ATOM 5429 HB2 LEU A 377 44.007 44.438 55.318 1.00 0.00 H ATOM 5430 HB3 LEU A 377 42.770 45.503 54.610 1.00 0.00 H ATOM 5431 HG LEU A 377 45.372 46.442 55.856 1.00 0.00 H ATOM 5432 HD21 LEU A 377 43.216 47.880 54.259 1.00 0.00 H ATOM 5433 HD22 LEU A 377 43.531 48.070 56.001 1.00 0.00 H ATOM 5434 HD23 LEU A 377 44.748 48.599 54.813 1.00 0.00 H ATOM 5435 HD11 LEU A 377 45.808 45.182 53.812 1.00 0.00 H ATOM 5436 HD12 LEU A 377 44.606 46.160 52.935 1.00 0.00 H ATOM 5437 HD13 LEU A 377 46.090 46.922 53.558 1.00 0.00 H ATOM 5438 H LEU A 377 44.834 45.538 57.607 1.00 0.00 H ATOM 5439 N ASP A 378 40.699 44.510 56.258 1.00 32.26 N ATOM 5440 CA ASP A 378 39.683 43.463 56.223 1.00 31.83 C ATOM 5441 C ASP A 378 39.849 42.666 54.925 1.00 33.40 C ATOM 5442 O ASP A 378 39.360 43.073 53.879 1.00 32.28 O ATOM 5443 CB ASP A 378 38.272 44.095 56.254 1.00 33.45 C ATOM 5444 CG ASP A 378 37.166 43.060 56.424 1.00 38.37 C ATOM 5445 OD1 ASP A 378 37.451 41.853 56.279 1.00 36.35 O ATOM 5446 OD2 ASP A 378 35.996 43.460 56.656 1.00 41.71 O ATOM 5447 HA ASP A 378 39.799 42.810 57.088 1.00 0.00 H ATOM 5448 HB2 ASP A 378 38.223 44.798 57.086 1.00 0.00 H ATOM 5449 HB3 ASP A 378 38.109 44.630 55.318 1.00 0.00 H ATOM 5450 H ASP A 378 40.511 45.409 55.770 1.00 0.00 H ATOM 5451 N PHE A 379 40.550 41.544 55.016 1.00 30.90 N ATOM 5452 CA PHE A 379 40.836 40.657 53.882 1.00 30.06 C ATOM 5453 C PHE A 379 39.750 39.635 53.611 1.00 33.59 C ATOM 5454 O PHE A 379 39.975 38.667 52.881 1.00 30.62 O ATOM 5455 CB PHE A 379 42.141 39.919 54.120 1.00 30.94 C ATOM 5456 CG PHE A 379 43.349 40.814 54.146 1.00 32.77 C ATOM 5457 CD1 PHE A 379 43.772 41.462 52.999 1.00 35.73 C ATOM 5458 CD2 PHE A 379 44.079 40.979 55.318 1.00 35.06 C ATOM 5459 CE1 PHE A 379 44.846 42.321 53.024 1.00 37.47 C ATOM 5460 CE2 PHE A 379 45.219 41.773 55.343 1.00 38.20 C ATOM 5461 CZ PHE A 379 45.613 42.450 54.198 1.00 36.74 C ATOM 5462 HA PHE A 379 40.896 41.305 53.008 1.00 0.00 H ATOM 5463 HB2 PHE A 379 42.075 39.403 55.078 1.00 0.00 H ATOM 5464 HB3 PHE A 379 42.272 39.187 53.323 1.00 0.00 H ATOM 5465 HD2 PHE A 379 43.752 40.479 56.230 1.00 0.00 H ATOM 5466 HE2 PHE A 379 45.802 41.864 56.260 1.00 0.00 H ATOM 5467 HZ PHE A 379 46.506 43.075 54.207 1.00 0.00 H ATOM 5468 HE1 PHE A 379 45.103 42.900 52.137 1.00 0.00 H ATOM 5469 HD1 PHE A 379 43.246 41.289 52.060 1.00 0.00 H ATOM 5470 H PHE A 379 40.921 41.276 55.950 1.00 0.00 H ATOM 5471 N VAL A 380 38.555 39.861 54.166 1.00 31.62 N ATOM 5472 CA VAL A 380 37.418 38.932 53.969 1.00 29.58 C ATOM 5473 C VAL A 380 37.819 37.485 54.184 1.00 33.09 C ATOM 5474 O VAL A 380 37.536 36.631 53.357 1.00 34.58 O ATOM 5475 CB VAL A 380 36.766 39.137 52.575 1.00 31.86 C ATOM 5476 CG1 VAL A 380 35.407 38.438 52.507 1.00 31.67 C ATOM 5477 CG2 VAL A 380 36.614 40.641 52.287 1.00 30.17 C ATOM 5478 HA VAL A 380 36.673 39.169 54.728 1.00 0.00 H ATOM 5479 HB VAL A 380 37.412 38.695 51.816 1.00 0.00 H ATOM 5480 HG11 VAL A 380 35.540 37.370 52.681 1.00 0.00 H ATOM 5481 HG12 VAL A 380 34.748 38.853 53.270 1.00 0.00 H ATOM 5482 HG13 VAL A 380 34.968 38.595 51.522 1.00 0.00 H ATOM 5483 HG21 VAL A 380 35.982 41.094 53.051 1.00 0.00 H ATOM 5484 HG22 VAL A 380 37.596 41.113 52.299 1.00 0.00 H ATOM 5485 HG23 VAL A 380 36.156 40.778 51.307 1.00 0.00 H ATOM 5486 H VAL A 380 38.420 40.710 54.751 1.00 0.00 H ATOM 5487 N PRO A 381 38.476 37.184 55.317 1.00 31.74 N ATOM 5488 CA PRO A 381 38.931 35.803 55.536 1.00 31.74 C ATOM 5489 C PRO A 381 37.837 34.739 55.614 1.00 35.85 C ATOM 5490 O PRO A 381 36.770 34.959 56.174 1.00 36.95 O ATOM 5491 CB PRO A 381 39.657 35.889 56.877 1.00 33.51 C ATOM 5492 CG PRO A 381 38.947 37.039 57.589 1.00 38.03 C ATOM 5493 CD PRO A 381 38.692 38.035 56.505 1.00 32.94 C ATOM 5494 HA PRO A 381 39.530 35.477 54.686 1.00 0.00 H ATOM 5495 HD3 PRO A 381 37.809 38.635 56.724 1.00 0.00 H ATOM 5496 HD2 PRO A 381 39.551 38.692 56.366 1.00 0.00 H ATOM 5497 HG3 PRO A 381 39.582 37.465 58.365 1.00 0.00 H ATOM 5498 HG2 PRO A 381 38.011 36.701 58.033 1.00 0.00 H ATOM 5499 HB2 PRO A 381 39.554 34.960 57.437 1.00 0.00 H ATOM 5500 HB3 PRO A 381 40.715 36.111 56.735 1.00 0.00 H ATOM 5501 N HIS A 382 38.125 33.581 55.034 1.00 30.50 N ATOM 5502 CA HIS A 382 37.280 32.416 55.167 1.00 30.38 C ATOM 5503 C HIS A 382 35.939 32.310 54.460 1.00 33.10 C ATOM 5504 O HIS A 382 35.680 31.326 53.797 1.00 32.72 O ATOM 5505 CB HIS A 382 37.115 32.110 56.662 1.00 30.20 C ATOM 5506 CG HIS A 382 38.410 32.000 57.385 1.00 33.60 C ATOM 5507 ND1 HIS A 382 39.399 31.127 56.992 1.00 35.51 N ATOM 5508 CD2 HIS A 382 38.887 32.654 58.470 1.00 34.53 C ATOM 5509 CE1 HIS A 382 40.424 31.233 57.824 1.00 34.96 C ATOM 5510 NE2 HIS A 382 40.136 32.151 58.728 1.00 34.55 N ATOM 5511 HA HIS A 382 37.838 31.676 54.593 1.00 0.00 H ATOM 5512 HB2 HIS A 382 36.531 32.910 57.117 1.00 0.00 H ATOM 5513 HB3 HIS A 382 36.579 31.166 56.766 1.00 0.00 H ATOM 5514 HD2 HIS A 382 38.374 33.434 59.033 1.00 0.00 H ATOM 5515 HE1 HIS A 382 41.349 30.659 57.771 1.00 0.00 H ATOM 5516 H HIS A 382 38.991 33.509 54.462 1.00 0.00 H ATOM 5517 N GLU A 383 35.068 33.283 54.690 1.00 33.79 N ATOM 5518 CA GLU A 383 33.683 33.264 54.187 1.00 32.69 C ATOM 5519 C GLU A 383 33.351 34.493 53.354 1.00 32.49 C ATOM 5520 O GLU A 383 33.782 35.586 53.687 1.00 31.66 O ATOM 5521 CB GLU A 383 32.716 33.316 55.410 1.00 34.25 C ATOM 5522 CG GLU A 383 32.761 32.125 56.281 1.00 40.39 C ATOM 5523 CD GLU A 383 32.152 30.932 55.606 1.00 55.48 C ATOM 5524 OE1 GLU A 383 31.096 31.095 54.942 1.00 51.23 O ATOM 5525 OE2 GLU A 383 32.752 29.843 55.711 1.00 56.47 O ATOM 5526 HA GLU A 383 33.576 32.366 53.579 1.00 0.00 H ATOM 5527 HB2 GLU A 383 32.975 34.187 56.012 1.00 0.00 H ATOM 5528 HB3 GLU A 383 31.698 33.425 55.035 1.00 0.00 H ATOM 5529 HG2 GLU A 383 33.800 31.903 56.526 1.00 0.00 H ATOM 5530 HG3 GLU A 383 32.210 32.334 57.198 1.00 0.00 H ATOM 5531 H GLU A 383 35.378 34.100 55.254 1.00 0.00 H ATOM 5532 N ALA A 384 32.509 34.316 52.332 1.00 29.30 N ATOM 5533 CA ALA A 384 32.031 35.428 51.510 1.00 28.45 C ATOM 5534 C ALA A 384 31.327 36.419 52.409 1.00 35.10 C ATOM 5535 O ALA A 384 30.852 36.048 53.487 1.00 33.70 O ATOM 5536 CB ALA A 384 31.040 34.916 50.453 1.00 28.85 C ATOM 5537 HA ALA A 384 32.875 35.899 51.006 1.00 0.00 H ATOM 5538 HB1 ALA A 384 31.537 34.186 49.814 1.00 0.00 H ATOM 5539 HB2 ALA A 384 30.191 34.447 50.950 1.00 0.00 H ATOM 5540 HB3 ALA A 384 30.692 35.753 49.848 1.00 0.00 H ATOM 5541 H ALA A 384 32.182 33.353 52.113 1.00 0.00 H ATOM 5542 N ARG A 385 31.219 37.661 51.941 1.00 32.40 N ATOM 5543 CA ARG A 385 30.617 38.739 52.706 1.00 32.40 C ATOM 5544 C ARG A 385 29.475 39.413 51.922 1.00 38.62 C ATOM 5545 O ARG A 385 29.579 39.655 50.725 1.00 36.25 O ATOM 5546 CB ARG A 385 31.707 39.757 53.055 1.00 32.68 C ATOM 5547 CG ARG A 385 31.335 40.871 54.055 1.00 35.33 C ATOM 5548 CD ARG A 385 31.545 40.446 55.507 1.00 40.95 C ATOM 5549 NE ARG A 385 32.867 39.906 55.814 1.00 43.33 N ATOM 5550 CZ ARG A 385 33.929 40.652 56.091 1.00 53.09 C ATOM 5551 NH1 ARG A 385 33.833 41.974 56.037 1.00 42.24 N ATOM 5552 NH2 ARG A 385 35.091 40.078 56.407 1.00 45.79 N ATOM 5553 HA ARG A 385 30.182 38.332 53.619 1.00 0.00 H ATOM 5554 HB2 ARG A 385 32.549 39.206 53.475 1.00 0.00 H ATOM 5555 HB3 ARG A 385 32.016 40.238 52.127 1.00 0.00 H ATOM 5556 HG2 ARG A 385 31.955 41.744 53.853 1.00 0.00 H ATOM 5557 HG3 ARG A 385 30.286 41.131 53.915 1.00 0.00 H ATOM 5558 HD2 ARG A 385 30.805 39.682 55.745 1.00 0.00 H ATOM 5559 HD3 ARG A 385 31.382 41.318 56.140 1.00 0.00 H ATOM 5560 HE ARG A 385 32.983 38.873 55.816 1.00 0.00 H ATOM 5561 HH12 ARG A 385 34.661 42.565 56.253 1.00 0.00 H ATOM 5562 HH11 ARG A 385 32.929 42.420 55.779 1.00 0.00 H ATOM 5563 HH22 ARG A 385 35.920 40.667 56.623 1.00 0.00 H ATOM 5564 HH21 ARG A 385 35.168 39.041 56.437 1.00 0.00 H ATOM 5565 H ARG A 385 31.581 37.868 50.988 1.00 0.00 H ATOM 5566 N GLN A 386 28.366 39.688 52.606 1.00 35.47 N ATOM 5567 CA GLN A 386 27.231 40.390 51.999 1.00 33.89 C ATOM 5568 C GLN A 386 27.564 41.874 52.076 1.00 37.47 C ATOM 5569 O GLN A 386 28.019 42.333 53.115 1.00 39.45 O ATOM 5570 CB GLN A 386 25.999 40.155 52.892 1.00 35.40 C ATOM 5571 CG GLN A 386 24.809 41.029 52.585 1.00 36.16 C ATOM 5572 CD GLN A 386 24.150 40.630 51.297 1.00 35.30 C ATOM 5573 OE1 GLN A 386 23.597 39.522 51.176 1.00 35.61 O ATOM 5574 NE2 GLN A 386 24.215 41.513 50.305 1.00 35.40 N ATOM 5575 HA GLN A 386 27.043 40.055 50.979 1.00 0.00 H ATOM 5576 HB2 GLN A 386 25.693 39.115 52.778 1.00 0.00 H ATOM 5577 HB3 GLN A 386 26.292 40.335 53.926 1.00 0.00 H ATOM 5578 HG2 GLN A 386 24.086 40.940 53.396 1.00 0.00 H ATOM 5579 HG3 GLN A 386 25.140 42.064 52.507 1.00 0.00 H ATOM 5580 HE22 GLN A 386 24.688 42.427 50.453 1.00 0.00 H ATOM 5581 HE21 GLN A 386 23.793 41.289 49.381 1.00 0.00 H ATOM 5582 H GLN A 386 28.303 39.396 53.602 1.00 0.00 H ATOM 5583 N VAL A 387 27.326 42.639 51.014 1.00 31.62 N ATOM 5584 CA VAL A 387 27.514 44.075 51.105 1.00 30.48 C ATOM 5585 C VAL A 387 26.204 44.753 50.743 1.00 34.79 C ATOM 5586 O VAL A 387 25.314 44.124 50.176 1.00 33.25 O ATOM 5587 CB VAL A 387 28.706 44.614 50.276 1.00 33.32 C ATOM 5588 CG1 VAL A 387 30.025 44.027 50.800 1.00 32.29 C ATOM 5589 CG2 VAL A 387 28.481 44.378 48.775 1.00 32.50 C ATOM 5590 HA VAL A 387 27.787 44.315 52.133 1.00 0.00 H ATOM 5591 HB VAL A 387 28.776 45.695 50.399 1.00 0.00 H ATOM 5592 HG11 VAL A 387 30.158 44.311 51.844 1.00 0.00 H ATOM 5593 HG12 VAL A 387 29.995 42.940 50.719 1.00 0.00 H ATOM 5594 HG13 VAL A 387 30.854 44.414 50.208 1.00 0.00 H ATOM 5595 HG21 VAL A 387 28.378 43.309 48.588 1.00 0.00 H ATOM 5596 HG22 VAL A 387 27.573 44.892 48.460 1.00 0.00 H ATOM 5597 HG23 VAL A 387 29.333 44.766 48.216 1.00 0.00 H ATOM 5598 H VAL A 387 27.007 42.210 50.122 1.00 0.00 H ATOM 5599 N SER A 388 26.098 46.041 51.041 1.00 34.27 N ATOM 5600 CA SER A 388 24.849 46.741 50.799 1.00 36.79 C ATOM 5601 C SER A 388 24.720 47.685 49.576 1.00 44.39 C ATOM 5602 O SER A 388 24.006 47.387 48.597 1.00 50.66 O ATOM 5603 CB SER A 388 24.332 47.367 52.116 1.00 42.39 C ATOM 5604 OG SER A 388 23.145 48.117 51.900 1.00 57.94 O ATOM 5605 HA SER A 388 24.187 45.946 50.456 1.00 0.00 H ATOM 5606 HB2 SER A 388 25.100 48.026 52.522 1.00 0.00 H ATOM 5607 HB3 SER A 388 24.124 46.570 52.830 1.00 0.00 H ATOM 5608 HG SER A 388 23.329 48.845 51.255 1.00 0.00 H ATOM 5609 H SER A 388 26.909 46.549 51.448 1.00 0.00 H ATOM 5610 N GLY A 389 25.292 48.864 49.659 1.00 34.29 N ATOM 5611 CA GLY A 389 25.178 49.808 48.568 1.00 34.40 C ATOM 5612 C GLY A 389 26.557 50.032 47.969 1.00 37.65 C ATOM 5613 O GLY A 389 27.095 51.148 47.998 1.00 37.14 O ATOM 5614 HA3 GLY A 389 24.782 50.753 48.940 1.00 0.00 H ATOM 5615 HA2 GLY A 389 24.508 49.409 47.807 1.00 0.00 H ATOM 5616 H GLY A 389 25.829 49.120 50.512 1.00 0.00 H ATOM 5617 N MET A 390 27.167 48.935 47.516 1.00 31.80 N ATOM 5618 CA MET A 390 28.481 49.006 46.895 1.00 30.39 C ATOM 5619 C MET A 390 28.294 49.474 45.452 1.00 34.79 C ATOM 5620 O MET A 390 27.564 48.848 44.700 1.00 36.26 O ATOM 5621 CB MET A 390 29.148 47.628 46.913 1.00 31.09 C ATOM 5622 CG MET A 390 30.548 47.633 46.277 1.00 31.71 C ATOM 5623 SD MET A 390 31.479 46.180 46.722 1.00 31.11 S ATOM 5624 CE MET A 390 30.602 44.893 45.902 1.00 25.79 C ATOM 5625 HA MET A 390 29.119 49.701 47.442 1.00 0.00 H ATOM 5626 HB2 MET A 390 29.237 47.298 47.948 1.00 0.00 H ATOM 5627 HB3 MET A 390 28.518 46.929 46.363 1.00 0.00 H ATOM 5628 HG2 MET A 390 31.088 48.517 46.617 1.00 0.00 H ATOM 5629 HG3 MET A 390 30.444 47.668 45.193 1.00 0.00 H ATOM 5630 HE1 MET A 390 29.575 44.865 46.267 1.00 0.00 H ATOM 5631 HE2 MET A 390 30.602 45.082 44.828 1.00 0.00 H ATOM 5632 HE3 MET A 390 31.087 43.938 46.104 1.00 0.00 H ATOM 5633 H MET A 390 26.695 48.013 47.608 1.00 0.00 H ATOM 5634 N GLU A 391 28.917 50.595 45.083 1.00 32.24 N ATOM 5635 CA GLU A 391 28.808 51.114 43.721 1.00 32.29 C ATOM 5636 C GLU A 391 30.075 50.968 42.857 1.00 35.39 C ATOM 5637 O GLU A 391 30.015 51.104 41.630 1.00 35.55 O ATOM 5638 CB GLU A 391 28.406 52.591 43.733 1.00 34.23 C ATOM 5639 CG GLU A 391 26.973 52.825 43.224 1.00 56.99 C ATOM 5640 CD GLU A 391 26.879 53.920 42.159 1.00 97.51 C ATOM 5641 OE1 GLU A 391 27.515 54.987 42.330 1.00 92.57 O ATOM 5642 OE2 GLU A 391 26.135 53.724 41.168 1.00 98.87 O ATOM 5643 HA GLU A 391 28.040 50.491 43.263 1.00 0.00 H ATOM 5644 HB2 GLU A 391 28.478 52.963 44.755 1.00 0.00 H ATOM 5645 HB3 GLU A 391 29.096 53.145 43.097 1.00 0.00 H ATOM 5646 HG2 GLU A 391 26.601 51.894 42.797 1.00 0.00 H ATOM 5647 HG3 GLU A 391 26.348 53.110 44.070 1.00 0.00 H ATOM 5648 H GLU A 391 29.492 51.110 45.779 1.00 0.00 H ATOM 5649 N TYR A 392 31.217 50.758 43.505 1.00 30.76 N ATOM 5650 CA TYR A 392 32.504 50.681 42.806 1.00 30.76 C ATOM 5651 C TYR A 392 33.369 49.529 43.317 1.00 32.57 C ATOM 5652 O TYR A 392 33.482 49.324 44.536 1.00 30.97 O ATOM 5653 CB TYR A 392 33.308 51.980 43.016 1.00 31.89 C ATOM 5654 CG TYR A 392 32.656 53.254 42.488 1.00 32.85 C ATOM 5655 CD1 TYR A 392 32.850 53.672 41.175 1.00 33.07 C ATOM 5656 CD2 TYR A 392 31.856 54.044 43.322 1.00 34.03 C ATOM 5657 CE1 TYR A 392 32.281 54.847 40.709 1.00 30.43 C ATOM 5658 CE2 TYR A 392 31.270 55.222 42.855 1.00 34.18 C ATOM 5659 CZ TYR A 392 31.500 55.621 41.564 1.00 39.84 C ATOM 5660 OH TYR A 392 30.902 56.771 41.108 1.00 41.70 O ATOM 5661 HA TYR A 392 32.271 50.524 41.753 1.00 0.00 H ATOM 5662 HB3 TYR A 392 34.270 51.864 42.516 1.00 0.00 H ATOM 5663 HB2 TYR A 392 33.469 52.105 44.087 1.00 0.00 H ATOM 5664 HD2 TYR A 392 31.688 53.734 44.353 1.00 0.00 H ATOM 5665 HE2 TYR A 392 30.636 55.819 43.511 1.00 0.00 H ATOM 5666 HE1 TYR A 392 32.444 55.164 39.679 1.00 0.00 H ATOM 5667 HD1 TYR A 392 33.458 53.067 40.503 1.00 0.00 H ATOM 5668 HH TYR A 392 31.162 56.925 40.165 1.00 0.00 H ATOM 5669 H TYR A 392 31.197 50.645 44.539 1.00 0.00 H ATOM 5670 N THR A 393 34.015 48.806 42.391 1.00 28.28 N ATOM 5671 CA THR A 393 34.967 47.778 42.792 1.00 28.58 C ATOM 5672 C THR A 393 36.285 48.106 42.084 1.00 31.04 C ATOM 5673 O THR A 393 36.290 48.790 41.055 1.00 26.65 O ATOM 5674 CB THR A 393 34.508 46.368 42.451 1.00 36.18 C ATOM 5675 OG1 THR A 393 34.191 46.302 41.059 1.00 33.59 O ATOM 5676 CG2 THR A 393 33.286 45.956 43.298 1.00 34.02 C ATOM 5677 HA THR A 393 35.073 47.786 43.877 1.00 0.00 H ATOM 5678 HB THR A 393 35.316 45.672 42.679 1.00 0.00 H ATOM 5679 HG1 THR A 393 33.892 45.386 40.833 1.00 0.00 H ATOM 5680 HG23 THR A 393 33.543 46.011 44.356 1.00 0.00 H ATOM 5681 HG21 THR A 393 32.456 46.631 43.089 1.00 0.00 H ATOM 5682 HG22 THR A 393 32.998 44.935 43.046 1.00 0.00 H ATOM 5683 H THR A 393 33.836 48.980 41.381 1.00 0.00 H ATOM 5684 N LEU A 394 37.399 47.636 42.640 1.00 28.46 N ATOM 5685 CA LEU A 394 38.689 47.904 42.023 1.00 27.36 C ATOM 5686 C LEU A 394 39.432 46.596 41.892 1.00 29.61 C ATOM 5687 O LEU A 394 39.492 45.837 42.852 1.00 30.91 O ATOM 5688 CB LEU A 394 39.493 48.885 42.882 1.00 27.86 C ATOM 5689 CG LEU A 394 40.838 49.398 42.324 1.00 31.55 C ATOM 5690 CD1 LEU A 394 41.080 50.822 42.843 1.00 32.26 C ATOM 5691 CD2 LEU A 394 41.957 48.493 42.724 1.00 32.04 C ATOM 5692 HA LEU A 394 38.546 48.353 41.040 1.00 0.00 H ATOM 5693 HB2 LEU A 394 38.861 49.755 43.059 1.00 0.00 H ATOM 5694 HB3 LEU A 394 39.702 48.391 43.831 1.00 0.00 H ATOM 5695 HG LEU A 394 40.798 49.410 41.235 1.00 0.00 H ATOM 5696 HD21 LEU A 394 42.019 48.453 43.811 1.00 0.00 H ATOM 5697 HD22 LEU A 394 41.772 47.493 42.332 1.00 0.00 H ATOM 5698 HD23 LEU A 394 42.894 48.875 42.319 1.00 0.00 H ATOM 5699 HD11 LEU A 394 40.270 51.471 42.510 1.00 0.00 H ATOM 5700 HD12 LEU A 394 41.113 50.810 43.932 1.00 0.00 H ATOM 5701 HD13 LEU A 394 42.028 51.193 42.454 1.00 0.00 H ATOM 5702 H LEU A 394 37.347 47.077 43.516 1.00 0.00 H ATOM 5703 N CYS A 395 40.038 46.355 40.723 1.00 25.20 N ATOM 5704 CA CYS A 395 40.782 45.129 40.483 1.00 24.00 C ATOM 5705 C CYS A 395 42.255 45.464 40.236 1.00 26.63 C ATOM 5706 O CYS A 395 42.549 46.209 39.322 1.00 23.57 O ATOM 5707 CB CYS A 395 40.230 44.422 39.251 1.00 24.94 C ATOM 5708 SG CYS A 395 41.051 42.837 38.861 1.00 29.48 S ATOM 5709 HA CYS A 395 40.686 44.481 41.354 1.00 0.00 H ATOM 5710 HB2 CYS A 395 40.347 45.087 38.395 1.00 0.00 H ATOM 5711 HB3 CYS A 395 39.170 44.226 39.416 1.00 0.00 H ATOM 5712 HG CYS A 395 40.475 42.287 37.734 1.00 0.00 H ATOM 5713 H CYS A 395 39.975 47.065 39.965 1.00 0.00 H ATOM 5714 N ASN A 396 43.160 44.896 41.041 1.00 24.06 N ATOM 5715 CA ASN A 396 44.613 45.064 40.856 1.00 23.65 C ATOM 5716 C ASN A 396 45.266 43.857 40.195 1.00 25.08 C ATOM 5717 O ASN A 396 44.932 42.706 40.494 1.00 25.80 O ATOM 5718 CB ASN A 396 45.333 45.182 42.198 1.00 25.53 C ATOM 5719 CG ASN A 396 45.226 46.528 42.802 1.00 30.62 C ATOM 5720 OD1 ASN A 396 44.919 47.505 42.133 1.00 28.58 O ATOM 5721 ND2 ASN A 396 45.424 46.586 44.102 1.00 30.45 N ATOM 5722 HA ASN A 396 44.705 45.959 40.241 1.00 0.00 H ATOM 5723 HB2 ASN A 396 44.901 44.457 42.888 1.00 0.00 H ATOM 5724 HB3 ASN A 396 46.388 44.953 42.047 1.00 0.00 H ATOM 5725 HD22 ASN A 396 45.684 45.727 44.627 1.00 0.00 H ATOM 5726 HD21 ASN A 396 45.321 47.491 44.604 1.00 0.00 H ATOM 5727 H ASN A 396 42.824 44.310 41.832 1.00 0.00 H ATOM 5728 N SER A 397 46.293 44.127 39.393 1.00 22.05 N ATOM 5729 CA SER A 397 47.081 43.073 38.765 1.00 21.50 C ATOM 5730 C SER A 397 48.505 43.637 38.568 1.00 25.88 C ATOM 5731 O SER A 397 48.661 44.737 38.039 1.00 25.35 O ATOM 5732 CB SER A 397 46.416 42.668 37.429 1.00 27.61 C ATOM 5733 OG SER A 397 46.389 41.273 37.311 1.00 40.89 O ATOM 5734 HA SER A 397 47.134 42.172 39.377 1.00 0.00 H ATOM 5735 HB2 SER A 397 46.984 43.090 36.600 1.00 0.00 H ATOM 5736 HB3 SER A 397 45.396 43.053 37.402 1.00 0.00 H ATOM 5737 HG SER A 397 47.315 40.923 37.334 1.00 0.00 H ATOM 5738 H SER A 397 46.541 45.120 39.209 1.00 0.00 H ATOM 5739 N PHE A 398 49.513 42.953 39.117 1.00 24.47 N ATOM 5740 CA PHE A 398 50.913 43.421 39.014 1.00 24.17 C ATOM 5741 C PHE A 398 51.719 42.362 38.309 1.00 27.40 C ATOM 5742 O PHE A 398 51.316 41.211 38.272 1.00 27.22 O ATOM 5743 CB PHE A 398 51.511 43.741 40.408 1.00 24.94 C ATOM 5744 CG PHE A 398 50.558 44.499 41.315 1.00 25.74 C ATOM 5745 CD1 PHE A 398 49.817 45.562 40.828 1.00 26.63 C ATOM 5746 CD2 PHE A 398 50.461 44.185 42.666 1.00 27.63 C ATOM 5747 CE1 PHE A 398 48.929 46.275 41.671 1.00 28.60 C ATOM 5748 CE2 PHE A 398 49.561 44.877 43.509 1.00 30.30 C ATOM 5749 CZ PHE A 398 48.795 45.924 43.012 1.00 27.03 C ATOM 5750 HA PHE A 398 50.942 44.349 38.443 1.00 0.00 H ATOM 5751 HB2 PHE A 398 51.777 42.802 40.894 1.00 0.00 H ATOM 5752 HB3 PHE A 398 52.409 44.344 40.269 1.00 0.00 H ATOM 5753 HD2 PHE A 398 51.087 43.395 43.081 1.00 0.00 H ATOM 5754 HE2 PHE A 398 49.468 44.587 44.556 1.00 0.00 H ATOM 5755 HZ PHE A 398 48.102 46.461 43.660 1.00 0.00 H ATOM 5756 HE1 PHE A 398 48.347 47.104 41.267 1.00 0.00 H ATOM 5757 HD1 PHE A 398 49.918 45.854 39.783 1.00 0.00 H ATOM 5758 H PHE A 398 49.309 42.071 39.629 1.00 0.00 H ATOM 5759 N GLY A 399 52.843 42.735 37.701 1.00 24.92 N ATOM 5760 CA GLY A 399 53.575 41.729 36.958 1.00 23.84 C ATOM 5761 C GLY A 399 55.086 41.842 37.034 1.00 26.03 C ATOM 5762 O GLY A 399 55.623 42.887 37.399 1.00 23.66 O ATOM 5763 HA3 GLY A 399 53.283 41.804 35.910 1.00 0.00 H ATOM 5764 HA2 GLY A 399 53.290 40.750 37.344 1.00 0.00 H ATOM 5765 H GLY A 399 53.184 43.716 37.757 1.00 0.00 H ATOM 5766 N PHE A 400 55.764 40.748 36.703 1.00 22.51 N ATOM 5767 CA PHE A 400 57.236 40.740 36.689 1.00 22.20 C ATOM 5768 C PHE A 400 57.605 41.916 35.830 1.00 27.11 C ATOM 5769 O PHE A 400 56.873 42.243 34.899 1.00 24.34 O ATOM 5770 CB PHE A 400 57.773 39.480 36.023 1.00 22.89 C ATOM 5771 CG PHE A 400 57.850 38.289 36.933 1.00 24.47 C ATOM 5772 CD1 PHE A 400 57.417 38.376 38.242 1.00 27.53 C ATOM 5773 CD2 PHE A 400 58.380 37.082 36.474 1.00 25.12 C ATOM 5774 CE1 PHE A 400 57.548 37.298 39.103 1.00 29.12 C ATOM 5775 CE2 PHE A 400 58.520 36.007 37.326 1.00 29.05 C ATOM 5776 CZ PHE A 400 58.067 36.103 38.653 1.00 27.97 C ATOM 5777 HA PHE A 400 57.642 40.780 37.700 1.00 0.00 H ATOM 5778 HB2 PHE A 400 57.120 39.230 35.187 1.00 0.00 H ATOM 5779 HB3 PHE A 400 58.775 39.691 35.650 1.00 0.00 H ATOM 5780 HD2 PHE A 400 58.686 36.988 35.432 1.00 0.00 H ATOM 5781 HE2 PHE A 400 58.981 35.085 36.971 1.00 0.00 H ATOM 5782 HZ PHE A 400 58.125 35.242 39.319 1.00 0.00 H ATOM 5783 HE1 PHE A 400 57.238 37.396 40.144 1.00 0.00 H ATOM 5784 HD1 PHE A 400 56.968 39.302 38.601 1.00 0.00 H ATOM 5785 H PHE A 400 55.246 39.883 36.450 1.00 0.00 H ATOM 5786 N GLY A 401 58.717 42.576 36.149 1.00 24.53 N ATOM 5787 CA GLY A 401 59.112 43.788 35.449 1.00 24.20 C ATOM 5788 C GLY A 401 58.605 45.024 36.176 1.00 28.22 C ATOM 5789 O GLY A 401 58.809 46.152 35.741 1.00 29.04 O ATOM 5790 HA3 GLY A 401 58.696 43.770 34.442 1.00 0.00 H ATOM 5791 HA2 GLY A 401 60.200 43.829 35.391 1.00 0.00 H ATOM 5792 H GLY A 401 59.318 42.216 36.918 1.00 0.00 H ATOM 5793 N GLY A 402 57.885 44.830 37.275 1.00 24.02 N ATOM 5794 CA GLY A 402 57.394 45.976 38.008 1.00 22.61 C ATOM 5795 C GLY A 402 56.260 46.712 37.342 1.00 26.62 C ATOM 5796 O GLY A 402 55.969 47.845 37.690 1.00 28.52 O ATOM 5797 HA3 GLY A 402 58.221 46.674 38.140 1.00 0.00 H ATOM 5798 HA2 GLY A 402 57.050 45.633 38.984 1.00 0.00 H ATOM 5799 H GLY A 402 57.677 43.866 37.604 1.00 0.00 H ATOM 5800 N THR A 403 55.546 46.047 36.437 1.00 23.17 N ATOM 5801 CA THR A 403 54.462 46.702 35.721 1.00 21.69 C ATOM 5802 C THR A 403 53.127 46.473 36.417 1.00 26.00 C ATOM 5803 O THR A 403 52.721 45.316 36.648 1.00 25.89 O ATOM 5804 CB THR A 403 54.442 46.262 34.226 1.00 26.38 C ATOM 5805 OG1 THR A 403 53.387 46.942 33.546 1.00 28.98 O ATOM 5806 CG2 THR A 403 54.246 44.775 34.096 1.00 23.47 C ATOM 5807 HA THR A 403 54.638 47.778 35.733 1.00 0.00 H ATOM 5808 HB THR A 403 55.403 46.519 33.781 1.00 0.00 H ATOM 5809 HG1 THR A 403 53.536 47.919 33.602 1.00 0.00 H ATOM 5810 HG23 THR A 403 55.052 44.257 34.616 1.00 0.00 H ATOM 5811 HG21 THR A 403 53.289 44.496 34.537 1.00 0.00 H ATOM 5812 HG22 THR A 403 54.255 44.499 33.041 1.00 0.00 H ATOM 5813 H THR A 403 55.765 45.050 36.240 1.00 0.00 H ATOM 5814 N ASN A 404 52.424 47.574 36.682 1.00 23.51 N ATOM 5815 CA ASN A 404 51.197 47.553 37.470 1.00 23.90 C ATOM 5816 C ASN A 404 49.959 48.085 36.757 1.00 25.98 C ATOM 5817 O ASN A 404 50.050 48.972 35.937 1.00 24.11 O ATOM 5818 CB ASN A 404 51.405 48.366 38.747 1.00 22.46 C ATOM 5819 CG ASN A 404 52.657 47.977 39.489 1.00 31.61 C ATOM 5820 OD1 ASN A 404 52.854 46.821 39.843 1.00 30.35 O ATOM 5821 ND2 ASN A 404 53.423 48.970 39.880 1.00 26.69 N ATOM 5822 HA ASN A 404 51.002 46.500 37.673 1.00 0.00 H ATOM 5823 HB2 ASN A 404 51.471 49.421 38.482 1.00 0.00 H ATOM 5824 HB3 ASN A 404 50.548 48.210 39.403 1.00 0.00 H ATOM 5825 HD22 ASN A 404 53.224 49.939 39.558 1.00 0.00 H ATOM 5826 HD21 ASN A 404 54.229 48.788 40.512 1.00 0.00 H ATOM 5827 H ASN A 404 52.764 48.485 36.312 1.00 0.00 H ATOM 5828 N GLY A 405 48.784 47.593 37.125 1.00 24.41 N ATOM 5829 CA GLY A 405 47.575 48.111 36.498 1.00 22.37 C ATOM 5830 C GLY A 405 46.383 47.954 37.450 1.00 26.38 C ATOM 5831 O GLY A 405 46.309 46.993 38.218 1.00 25.84 O ATOM 5832 HA3 GLY A 405 47.379 47.558 35.579 1.00 0.00 H ATOM 5833 HA2 GLY A 405 47.713 49.166 36.263 1.00 0.00 H ATOM 5834 H GLY A 405 48.726 46.849 37.850 1.00 0.00 H ATOM 5835 N SER A 406 45.450 48.906 37.395 1.00 23.09 N ATOM 5836 CA SER A 406 44.240 48.847 38.233 1.00 21.93 C ATOM 5837 C SER A 406 43.051 49.274 37.355 1.00 27.20 C ATOM 5838 O SER A 406 43.152 50.220 36.583 1.00 26.86 O ATOM 5839 CB SER A 406 44.358 49.793 39.443 1.00 23.46 C ATOM 5840 OG SER A 406 45.404 49.390 40.330 1.00 25.89 O ATOM 5841 HA SER A 406 44.104 47.836 38.617 1.00 0.00 H ATOM 5842 HB2 SER A 406 43.413 49.791 39.987 1.00 0.00 H ATOM 5843 HB3 SER A 406 44.567 50.801 39.085 1.00 0.00 H ATOM 5844 HG SER A 406 45.218 48.477 40.665 1.00 0.00 H ATOM 5845 H SER A 406 45.580 49.708 36.746 1.00 0.00 H ATOM 5846 N LEU A 407 41.932 48.572 37.507 1.00 23.71 N ATOM 5847 CA LEU A 407 40.701 48.862 36.795 1.00 22.82 C ATOM 5848 C LEU A 407 39.624 49.161 37.839 1.00 27.78 C ATOM 5849 O LEU A 407 39.544 48.489 38.879 1.00 25.76 O ATOM 5850 CB LEU A 407 40.236 47.605 36.031 1.00 22.12 C ATOM 5851 CG LEU A 407 41.035 47.237 34.784 1.00 24.61 C ATOM 5852 CD1 LEU A 407 40.507 45.948 34.204 1.00 22.88 C ATOM 5853 CD2 LEU A 407 40.937 48.379 33.765 1.00 23.81 C ATOM 5854 HA LEU A 407 40.861 49.693 36.108 1.00 0.00 H ATOM 5855 HB2 LEU A 407 40.286 46.761 36.719 1.00 0.00 H ATOM 5856 HB3 LEU A 407 39.201 47.764 35.728 1.00 0.00 H ATOM 5857 HG LEU A 407 42.083 47.090 35.043 1.00 0.00 H ATOM 5858 HD21 LEU A 407 39.892 48.536 33.497 1.00 0.00 H ATOM 5859 HD22 LEU A 407 41.342 49.291 34.203 1.00 0.00 H ATOM 5860 HD23 LEU A 407 41.507 48.118 32.873 1.00 0.00 H ATOM 5861 HD11 LEU A 407 40.603 45.153 34.943 1.00 0.00 H ATOM 5862 HD12 LEU A 407 39.458 46.074 33.937 1.00 0.00 H ATOM 5863 HD13 LEU A 407 41.081 45.690 33.314 1.00 0.00 H ATOM 5864 H LEU A 407 41.939 47.772 38.172 1.00 0.00 H ATOM 5865 N ILE A 408 38.731 50.095 37.518 1.00 28.07 N ATOM 5866 CA ILE A 408 37.623 50.414 38.427 1.00 27.08 C ATOM 5867 C ILE A 408 36.314 50.238 37.670 1.00 29.47 C ATOM 5868 O ILE A 408 36.118 50.844 36.623 1.00 26.23 O ATOM 5869 CB ILE A 408 37.719 51.854 39.007 1.00 29.48 C ATOM 5870 CG1 ILE A 408 38.940 51.991 39.903 1.00 29.64 C ATOM 5871 CG2 ILE A 408 36.467 52.174 39.822 1.00 29.92 C ATOM 5872 CD1 ILE A 408 39.189 53.409 40.335 1.00 30.09 C ATOM 5873 HA ILE A 408 37.673 49.735 39.278 1.00 0.00 H ATOM 5874 HB ILE A 408 37.806 52.551 38.173 1.00 0.00 H ATOM 5875 HG12 ILE A 408 38.791 51.377 40.791 1.00 0.00 H ATOM 5876 HG13 ILE A 408 39.814 51.634 39.358 1.00 0.00 H ATOM 5877 HD11 ILE A 408 39.349 54.033 39.455 1.00 0.00 H ATOM 5878 HD12 ILE A 408 38.325 53.775 40.890 1.00 0.00 H ATOM 5879 HD13 ILE A 408 40.073 53.444 40.972 1.00 0.00 H ATOM 5880 HG21 ILE A 408 35.589 52.103 39.180 1.00 0.00 H ATOM 5881 HG22 ILE A 408 36.377 51.462 40.642 1.00 0.00 H ATOM 5882 HG23 ILE A 408 36.545 53.184 40.223 1.00 0.00 H ATOM 5883 H ILE A 408 38.819 50.603 36.615 1.00 0.00 H ATOM 5884 N PHE A 409 35.436 49.409 38.228 1.00 25.66 N ATOM 5885 CA PHE A 409 34.124 49.142 37.671 1.00 26.04 C ATOM 5886 C PHE A 409 33.071 49.854 38.529 1.00 29.80 C ATOM 5887 O PHE A 409 33.239 49.999 39.739 1.00 28.72 O ATOM 5888 CB PHE A 409 33.880 47.630 37.665 1.00 27.25 C ATOM 5889 CG PHE A 409 34.800 46.889 36.722 1.00 27.82 C ATOM 5890 CD1 PHE A 409 34.588 46.934 35.354 1.00 29.61 C ATOM 5891 CD2 PHE A 409 35.951 46.268 37.201 1.00 29.72 C ATOM 5892 CE1 PHE A 409 35.464 46.272 34.474 1.00 30.70 C ATOM 5893 CE2 PHE A 409 36.840 45.618 36.324 1.00 30.74 C ATOM 5894 CZ PHE A 409 36.594 45.628 34.968 1.00 28.66 C ATOM 5895 HA PHE A 409 34.060 49.511 36.647 1.00 0.00 H ATOM 5896 HB2 PHE A 409 34.035 47.248 38.674 1.00 0.00 H ATOM 5897 HB3 PHE A 409 32.849 47.445 37.363 1.00 0.00 H ATOM 5898 HD2 PHE A 409 36.166 46.286 38.269 1.00 0.00 H ATOM 5899 HE2 PHE A 409 37.720 45.108 36.716 1.00 0.00 H ATOM 5900 HZ PHE A 409 37.283 45.133 34.284 1.00 0.00 H ATOM 5901 HE1 PHE A 409 35.257 46.264 33.404 1.00 0.00 H ATOM 5902 HD1 PHE A 409 33.737 47.486 34.956 1.00 0.00 H ATOM 5903 H PHE A 409 35.704 48.927 39.110 1.00 0.00 H ATOM 5904 N LYS A 410 31.989 50.282 37.893 1.00 28.84 N ATOM 5905 CA LYS A 410 30.923 51.001 38.593 1.00 30.56 C ATOM 5906 C LYS A 410 29.598 50.290 38.339 1.00 35.10 C ATOM 5907 O LYS A 410 29.321 49.887 37.217 1.00 33.17 O ATOM 5908 CB LYS A 410 30.803 52.417 38.031 1.00 32.53 C ATOM 5909 CG LYS A 410 29.736 53.274 38.708 1.00 30.81 C ATOM 5910 CD LYS A 410 29.595 54.608 37.977 1.00 39.51 C ATOM 5911 CE LYS A 410 28.824 55.649 38.807 1.00 43.99 C ATOM 5912 NZ LYS A 410 28.568 56.852 37.972 1.00 48.18 N ATOM 5913 HA LYS A 410 31.154 51.033 39.658 1.00 0.00 H ATOM 5914 HB2 LYS A 410 31.766 52.914 38.149 1.00 0.00 H ATOM 5915 HB3 LYS A 410 30.561 52.344 36.971 1.00 0.00 H ATOM 5916 HG2 LYS A 410 28.782 52.747 38.686 1.00 0.00 H ATOM 5917 HG3 LYS A 410 30.024 53.458 39.743 1.00 0.00 H ATOM 5918 HD2 LYS A 410 30.590 54.997 37.762 1.00 0.00 H ATOM 5919 HD3 LYS A 410 29.062 54.441 37.041 1.00 0.00 H ATOM 5920 HE2 LYS A 410 29.415 55.930 39.679 1.00 0.00 H ATOM 5921 HE3 LYS A 410 27.875 55.224 39.134 1.00 0.00 H ATOM 5922 HZ1 LYS A 410 29.474 57.256 37.661 1.00 0.00 H ATOM 5923 HZ2 LYS A 410 28.004 56.582 37.141 1.00 0.00 H ATOM 5924 HZ3 LYS A 410 28.047 57.557 38.532 1.00 0.00 H ATOM 5925 H LYS A 410 31.895 50.103 36.873 1.00 0.00 H ATOM 5926 N LYS A 411 28.775 50.158 39.374 1.00 32.67 N ATOM 5927 CA LYS A 411 27.497 49.489 39.207 1.00 33.07 C ATOM 5928 C LYS A 411 26.625 50.336 38.291 1.00 39.44 C ATOM 5929 O LYS A 411 26.539 51.542 38.462 1.00 38.78 O ATOM 5930 CB LYS A 411 26.806 49.293 40.557 1.00 36.91 C ATOM 5931 CG LYS A 411 25.450 48.584 40.449 1.00 46.68 C ATOM 5932 CD LYS A 411 24.834 48.299 41.821 1.00 59.18 C ATOM 5933 CE LYS A 411 23.814 47.165 41.747 1.00 63.97 C ATOM 5934 NZ LYS A 411 22.531 47.663 41.179 1.00 74.87 N ATOM 5935 HA LYS A 411 27.657 48.504 38.768 1.00 0.00 H ATOM 5936 HB2 LYS A 411 27.458 48.697 41.196 1.00 0.00 H ATOM 5937 HB3 LYS A 411 26.650 50.272 41.011 1.00 0.00 H ATOM 5938 HG2 LYS A 411 24.767 49.217 39.882 1.00 0.00 H ATOM 5939 HG3 LYS A 411 25.589 47.639 39.923 1.00 0.00 H ATOM 5940 HD2 LYS A 411 25.627 48.019 42.515 1.00 0.00 H ATOM 5941 HD3 LYS A 411 24.338 49.200 42.182 1.00 0.00 H ATOM 5942 HE2 LYS A 411 23.637 46.774 42.749 1.00 0.00 H ATOM 5943 HE3 LYS A 411 24.205 46.370 41.112 1.00 0.00 H ATOM 5944 HZ1 LYS A 411 22.156 48.420 41.785 1.00 0.00 H ATOM 5945 HZ2 LYS A 411 22.698 48.034 40.222 1.00 0.00 H ATOM 5946 HZ3 LYS A 411 21.846 46.881 41.134 1.00 0.00 H ATOM 5947 H LYS A 411 29.047 50.534 40.305 1.00 0.00 H ATOM 5948 N ILE A 412 25.999 49.693 37.310 1.00 39.49 N ATOM 5949 CA ILE A 412 25.112 50.356 36.351 1.00 48.59 C ATOM 5950 C ILE A 412 25.655 51.533 35.534 1.00 75.96 C ATOM 5951 O ILE A 412 25.396 51.549 34.303 1.00 78.05 O ATOM 5952 CB ILE A 412 23.713 50.600 36.925 1.00 52.42 C ATOM 5953 CG1 ILE A 412 22.981 49.264 37.034 1.00 53.36 C ATOM 5954 CG2 ILE A 412 22.918 51.539 36.015 1.00 53.92 C ATOM 5955 CD1 ILE A 412 23.330 48.439 38.265 1.00 61.70 C ATOM 5956 HA ILE A 412 25.038 49.604 35.565 1.00 0.00 H ATOM 5957 OXT ILE A 412 26.343 52.419 36.102 1.00 93.96 O ATOM 5958 HB ILE A 412 23.807 51.060 37.909 1.00 0.00 H ATOM 5959 HG12 ILE A 412 21.910 49.465 37.054 1.00 0.00 H ATOM 5960 HG13 ILE A 412 23.222 48.673 36.151 1.00 0.00 H ATOM 5961 HD11 ILE A 412 24.396 48.213 38.259 1.00 0.00 H ATOM 5962 HD12 ILE A 412 23.083 49.006 39.163 1.00 0.00 H ATOM 5963 HD13 ILE A 412 22.760 47.510 38.252 1.00 0.00 H ATOM 5964 HG21 ILE A 412 23.440 52.492 35.934 1.00 0.00 H ATOM 5965 HG22 ILE A 412 22.823 51.090 35.026 1.00 0.00 H ATOM 5966 HG23 ILE A 412 21.927 51.701 36.439 1.00 0.00 H ATOM 5967 H ILE A 412 26.146 48.668 37.219 1.00 0.00 H TER 5968 ILE A 412 ATOM 5969 N LYS B 2 44.463 69.906 23.490 1.00 49.84 N ATOM 5970 CA LYS B 2 44.647 68.663 22.725 1.00 49.43 C ATOM 5971 C LYS B 2 46.142 68.388 22.642 1.00 48.20 C ATOM 5972 O LYS B 2 46.909 69.258 22.231 1.00 48.83 O ATOM 5973 CB LYS B 2 44.037 68.769 21.325 1.00 52.48 C ATOM 5974 CG LYS B 2 44.821 68.003 20.279 1.00 69.00 C ATOM 5975 CD LYS B 2 43.935 67.028 19.530 1.00 82.69 C ATOM 5976 CE LYS B 2 44.741 65.842 19.034 1.00 97.95 C ATOM 5977 NZ LYS B 2 46.032 65.727 19.773 1.00112.54 N ATOM 5978 HA LYS B 2 44.134 67.843 23.227 1.00 0.00 H ATOM 5979 HB2 LYS B 2 43.022 68.374 21.357 1.00 0.00 H ATOM 5980 HB3 LYS B 2 44.008 69.820 21.037 1.00 0.00 H ATOM 5981 HG2 LYS B 2 45.251 68.710 19.569 1.00 0.00 H ATOM 5982 HG3 LYS B 2 45.622 67.450 20.770 1.00 0.00 H ATOM 5983 HD2 LYS B 2 43.149 66.673 20.197 1.00 0.00 H ATOM 5984 HD3 LYS B 2 43.484 67.536 18.678 1.00 0.00 H ATOM 5985 HE2 LYS B 2 44.948 65.971 17.972 1.00 0.00 H ATOM 5986 HE3 LYS B 2 44.162 64.930 19.182 1.00 0.00 H ATOM 5987 HZ1 LYS B 2 46.590 66.593 19.631 1.00 0.00 H ATOM 5988 HZ2 LYS B 2 45.839 65.600 20.787 1.00 0.00 H ATOM 5989 HZ3 LYS B 2 46.564 64.908 19.414 1.00 0.00 H ATOM 5990 HN3 LYS B 2 44.948 70.686 23.003 1.00 0.00 H ATOM 5991 HN2 LYS B 2 44.863 69.788 24.443 1.00 0.00 H ATOM 5992 HN1 LYS B 2 43.448 70.120 23.563 1.00 0.00 H ATOM 5993 N ARG B 3 46.565 67.219 23.116 1.00 39.53 N ATOM 5994 CA ARG B 3 47.980 66.945 23.219 1.00 36.96 C ATOM 5995 C ARG B 3 48.609 66.316 22.000 1.00 38.89 C ATOM 5996 O ARG B 3 48.215 65.229 21.550 1.00 38.84 O ATOM 5997 CB ARG B 3 48.287 66.169 24.498 1.00 37.41 C ATOM 5998 CG ARG B 3 47.856 66.895 25.762 1.00 37.36 C ATOM 5999 CD ARG B 3 47.636 65.966 26.936 1.00 37.03 C ATOM 6000 NE ARG B 3 48.779 65.100 27.254 1.00 28.69 N ATOM 6001 CZ ARG B 3 49.717 65.396 28.141 1.00 41.76 C ATOM 6002 NH1 ARG B 3 49.715 66.587 28.715 1.00 32.48 N ATOM 6003 NH2 ARG B 3 50.685 64.524 28.414 1.00 36.77 N ATOM 6004 HA ARG B 3 48.460 67.922 23.274 1.00 0.00 H ATOM 6005 HB2 ARG B 3 47.768 65.212 24.455 1.00 0.00 H ATOM 6006 HB3 ARG B 3 49.362 65.996 24.548 1.00 0.00 H ATOM 6007 HG2 ARG B 3 48.629 67.615 26.029 1.00 0.00 H ATOM 6008 HG3 ARG B 3 46.925 67.423 25.558 1.00 0.00 H ATOM 6009 HD2 ARG B 3 46.780 65.330 26.711 1.00 0.00 H ATOM 6010 HD3 ARG B 3 47.415 66.573 27.814 1.00 0.00 H ATOM 6011 HE ARG B 3 48.857 64.194 26.749 1.00 0.00 H ATOM 6012 HH12 ARG B 3 50.447 66.829 29.413 1.00 0.00 H ATOM 6013 HH11 ARG B 3 48.981 67.282 28.469 1.00 0.00 H ATOM 6014 HH22 ARG B 3 51.418 64.763 29.112 1.00 0.00 H ATOM 6015 HH21 ARG B 3 50.708 63.604 27.930 1.00 0.00 H ATOM 6016 H ARG B 3 45.875 66.500 23.413 1.00 0.00 H ATOM 6017 N ARG B 4 49.600 67.017 21.452 1.00 32.53 N ATOM 6018 CA ARG B 4 50.325 66.519 20.297 1.00 30.77 C ATOM 6019 C ARG B 4 51.521 65.712 20.786 1.00 31.33 C ATOM 6020 O ARG B 4 52.063 65.986 21.847 1.00 31.81 O ATOM 6021 CB ARG B 4 50.767 67.694 19.412 1.00 30.48 C ATOM 6022 CG ARG B 4 49.587 68.570 18.975 1.00 32.87 C ATOM 6023 CD ARG B 4 50.072 69.908 18.436 1.00 39.70 C ATOM 6024 NE ARG B 4 51.094 69.733 17.412 1.00 47.04 N ATOM 6025 CZ ARG B 4 51.672 70.727 16.745 1.00 62.04 C ATOM 6026 NH1 ARG B 4 51.325 71.985 16.997 1.00 43.51 N ATOM 6027 NH2 ARG B 4 52.598 70.460 15.827 1.00 43.39 N ATOM 6028 HA ARG B 4 49.685 65.874 19.694 1.00 0.00 H ATOM 6029 HB2 ARG B 4 51.472 68.309 19.972 1.00 0.00 H ATOM 6030 HB3 ARG B 4 51.258 67.298 18.523 1.00 0.00 H ATOM 6031 HG2 ARG B 4 49.028 68.053 18.195 1.00 0.00 H ATOM 6032 HG3 ARG B 4 48.936 68.745 19.832 1.00 0.00 H ATOM 6033 HD2 ARG B 4 50.489 70.491 19.257 1.00 0.00 H ATOM 6034 HD3 ARG B 4 49.226 70.444 18.005 1.00 0.00 H ATOM 6035 HE ARG B 4 51.392 68.762 17.187 1.00 0.00 H ATOM 6036 HH12 ARG B 4 51.777 72.763 16.476 1.00 0.00 H ATOM 6037 HH11 ARG B 4 50.602 72.191 17.715 1.00 0.00 H ATOM 6038 HH22 ARG B 4 53.051 71.237 15.304 1.00 0.00 H ATOM 6039 HH21 ARG B 4 52.868 69.475 15.632 1.00 0.00 H ATOM 6040 H ARG B 4 49.859 67.938 21.859 1.00 0.00 H ATOM 6041 N VAL B 5 51.956 64.754 19.973 1.00 26.03 N ATOM 6042 CA VAL B 5 53.074 63.874 20.309 1.00 23.89 C ATOM 6043 C VAL B 5 54.182 64.016 19.265 1.00 28.18 C ATOM 6044 O VAL B 5 53.946 63.871 18.072 1.00 29.07 O ATOM 6045 CB VAL B 5 52.567 62.390 20.410 1.00 25.96 C ATOM 6046 CG1 VAL B 5 53.734 61.434 20.743 1.00 25.34 C ATOM 6047 CG2 VAL B 5 51.433 62.277 21.476 1.00 24.76 C ATOM 6048 HA VAL B 5 53.488 64.159 21.276 1.00 0.00 H ATOM 6049 HB VAL B 5 52.160 62.097 19.443 1.00 0.00 H ATOM 6050 HG11 VAL B 5 54.488 61.496 19.958 1.00 0.00 H ATOM 6051 HG12 VAL B 5 54.176 61.721 21.697 1.00 0.00 H ATOM 6052 HG13 VAL B 5 53.358 60.413 20.808 1.00 0.00 H ATOM 6053 HG21 VAL B 5 51.817 62.590 22.447 1.00 0.00 H ATOM 6054 HG22 VAL B 5 50.601 62.919 21.189 1.00 0.00 H ATOM 6055 HG23 VAL B 5 51.092 61.243 21.534 1.00 0.00 H ATOM 6056 H VAL B 5 51.480 64.625 19.057 1.00 0.00 H ATOM 6057 N VAL B 6 55.413 64.239 19.717 1.00 25.49 N ATOM 6058 CA VAL B 6 56.542 64.358 18.795 1.00 24.72 C ATOM 6059 C VAL B 6 57.590 63.329 19.187 1.00 29.86 C ATOM 6060 O VAL B 6 57.496 62.743 20.254 1.00 29.58 O ATOM 6061 CB VAL B 6 57.142 65.795 18.816 1.00 29.02 C ATOM 6062 CG1 VAL B 6 56.186 66.797 18.153 1.00 28.29 C ATOM 6063 CG2 VAL B 6 57.443 66.210 20.231 1.00 28.31 C ATOM 6064 HA VAL B 6 56.200 64.172 17.777 1.00 0.00 H ATOM 6065 HB VAL B 6 58.071 65.789 18.247 1.00 0.00 H ATOM 6066 HG11 VAL B 6 56.015 66.503 17.117 1.00 0.00 H ATOM 6067 HG12 VAL B 6 55.238 66.804 18.692 1.00 0.00 H ATOM 6068 HG13 VAL B 6 56.629 67.793 18.181 1.00 0.00 H ATOM 6069 HG21 VAL B 6 56.523 66.198 20.815 1.00 0.00 H ATOM 6070 HG22 VAL B 6 58.161 65.516 20.667 1.00 0.00 H ATOM 6071 HG23 VAL B 6 57.862 67.216 20.232 1.00 0.00 H ATOM 6072 H VAL B 6 55.575 64.330 20.740 1.00 0.00 H ATOM 6073 N VAL B 7 58.585 63.130 18.321 1.00 26.89 N ATOM 6074 CA VAL B 7 59.669 62.187 18.543 1.00 26.52 C ATOM 6075 C VAL B 7 60.906 62.972 18.895 1.00 31.14 C ATOM 6076 O VAL B 7 61.322 63.847 18.137 1.00 28.74 O ATOM 6077 CB VAL B 7 59.923 61.343 17.285 1.00 29.25 C ATOM 6078 CG1 VAL B 7 61.059 60.341 17.545 1.00 28.92 C ATOM 6079 CG2 VAL B 7 58.638 60.690 16.817 1.00 28.59 C ATOM 6080 HA VAL B 7 59.405 61.507 19.353 1.00 0.00 H ATOM 6081 HB VAL B 7 60.253 61.985 16.468 1.00 0.00 H ATOM 6082 HG11 VAL B 7 61.968 60.884 17.803 1.00 0.00 H ATOM 6083 HG12 VAL B 7 60.780 59.684 18.369 1.00 0.00 H ATOM 6084 HG13 VAL B 7 61.231 59.748 16.647 1.00 0.00 H ATOM 6085 HG21 VAL B 7 58.252 60.044 17.606 1.00 0.00 H ATOM 6086 HG22 VAL B 7 57.904 61.461 16.585 1.00 0.00 H ATOM 6087 HG23 VAL B 7 58.838 60.096 15.925 1.00 0.00 H ATOM 6088 H VAL B 7 58.585 63.680 17.438 1.00 0.00 H ATOM 6089 N THR B 8 61.499 62.663 20.038 1.00 29.54 N ATOM 6090 CA THR B 8 62.623 63.450 20.524 1.00 29.21 C ATOM 6091 C THR B 8 63.898 62.676 20.763 1.00 32.33 C ATOM 6092 O THR B 8 64.879 63.250 21.225 1.00 32.16 O ATOM 6093 CB THR B 8 62.228 64.214 21.805 1.00 32.81 C ATOM 6094 OG1 THR B 8 61.868 63.280 22.829 1.00 29.01 O ATOM 6095 CG2 THR B 8 61.059 65.128 21.540 1.00 29.39 C ATOM 6096 HA THR B 8 62.851 64.141 19.713 1.00 0.00 H ATOM 6097 HB THR B 8 63.080 64.812 22.127 1.00 0.00 H ATOM 6098 HG1 THR B 8 61.615 63.773 23.649 1.00 0.00 H ATOM 6099 HG23 THR B 8 61.327 65.842 20.761 1.00 0.00 H ATOM 6100 HG21 THR B 8 60.204 64.536 21.214 1.00 0.00 H ATOM 6101 HG22 THR B 8 60.804 65.664 22.454 1.00 0.00 H ATOM 6102 H THR B 8 61.159 61.852 20.593 1.00 0.00 H ATOM 6103 N GLY B 9 63.890 61.376 20.486 1.00 27.36 N ATOM 6104 CA GLY B 9 65.079 60.553 20.682 1.00 25.68 C ATOM 6105 C GLY B 9 64.942 59.269 19.894 1.00 28.31 C ATOM 6106 O GLY B 9 63.815 58.803 19.687 1.00 27.57 O ATOM 6107 HA3 GLY B 9 65.188 60.319 21.741 1.00 0.00 H ATOM 6108 HA2 GLY B 9 65.958 61.098 20.339 1.00 0.00 H ATOM 6109 H GLY B 9 63.020 60.937 20.123 1.00 0.00 H ATOM 6110 N LEU B 10 66.063 58.772 19.367 1.00 23.39 N ATOM 6111 CA LEU B 10 66.091 57.550 18.549 1.00 23.26 C ATOM 6112 C LEU B 10 67.212 56.606 18.983 1.00 28.60 C ATOM 6113 O LEU B 10 68.285 57.052 19.383 1.00 26.60 O ATOM 6114 CB LEU B 10 66.284 57.898 17.056 1.00 23.38 C ATOM 6115 CG LEU B 10 65.310 58.884 16.410 1.00 27.64 C ATOM 6116 CD1 LEU B 10 65.794 59.348 15.043 1.00 27.27 C ATOM 6117 CD2 LEU B 10 63.895 58.309 16.295 1.00 27.51 C ATOM 6118 HA LEU B 10 65.133 57.050 18.693 1.00 0.00 H ATOM 6119 HB2 LEU B 10 67.285 58.315 16.948 1.00 0.00 H ATOM 6120 HB3 LEU B 10 66.218 56.965 16.496 1.00 0.00 H ATOM 6121 HG LEU B 10 65.273 59.747 17.074 1.00 0.00 H ATOM 6122 HD21 LEU B 10 63.919 57.407 15.684 1.00 0.00 H ATOM 6123 HD22 LEU B 10 63.521 58.066 17.290 1.00 0.00 H ATOM 6124 HD23 LEU B 10 63.241 59.047 15.830 1.00 0.00 H ATOM 6125 HD11 LEU B 10 66.760 59.842 15.149 1.00 0.00 H ATOM 6126 HD12 LEU B 10 65.896 58.486 14.383 1.00 0.00 H ATOM 6127 HD13 LEU B 10 65.072 60.047 14.621 1.00 0.00 H ATOM 6128 H LEU B 10 66.958 59.272 19.543 1.00 0.00 H ATOM 6129 N GLY B 11 66.969 55.293 18.897 1.00 23.01 N ATOM 6130 CA GLY B 11 67.960 54.279 19.254 1.00 21.20 C ATOM 6131 C GLY B 11 67.768 53.074 18.342 1.00 24.01 C ATOM 6132 O GLY B 11 66.633 52.759 17.979 1.00 23.21 O ATOM 6133 HA3 GLY B 11 67.823 53.980 20.293 1.00 0.00 H ATOM 6134 HA2 GLY B 11 68.964 54.683 19.123 1.00 0.00 H ATOM 6135 H GLY B 11 66.035 54.980 18.562 1.00 0.00 H ATOM 6136 N MET B 12 68.839 52.407 17.930 1.00 21.71 N ATOM 6137 CA MET B 12 68.662 51.303 16.985 1.00 21.53 C ATOM 6138 C MET B 12 69.852 50.395 16.834 1.00 27.82 C ATOM 6139 O MET B 12 71.016 50.840 16.861 1.00 28.84 O ATOM 6140 CB MET B 12 68.327 51.902 15.602 1.00 23.94 C ATOM 6141 CG MET B 12 68.323 50.909 14.453 1.00 27.05 C ATOM 6142 SD MET B 12 67.185 51.399 13.143 1.00 29.98 S ATOM 6143 CE MET B 12 67.757 53.032 12.670 1.00 28.74 C ATOM 6144 HA MET B 12 67.862 50.683 17.389 1.00 0.00 H ATOM 6145 HB2 MET B 12 67.337 52.355 15.661 1.00 0.00 H ATOM 6146 HB3 MET B 12 69.065 52.673 15.380 1.00 0.00 H ATOM 6147 HG2 MET B 12 68.024 49.932 14.833 1.00 0.00 H ATOM 6148 HG3 MET B 12 69.329 50.844 14.040 1.00 0.00 H ATOM 6149 HE1 MET B 12 67.706 53.697 13.532 1.00 0.00 H ATOM 6150 HE2 MET B 12 68.787 52.967 12.320 1.00 0.00 H ATOM 6151 HE3 MET B 12 67.124 53.420 11.872 1.00 0.00 H ATOM 6152 H MET B 12 69.787 52.664 18.272 1.00 0.00 H ATOM 6153 N LEU B 13 69.558 49.107 16.666 1.00 23.08 N ATOM 6154 CA LEU B 13 70.566 48.094 16.370 1.00 22.91 C ATOM 6155 C LEU B 13 69.914 47.377 15.208 1.00 27.73 C ATOM 6156 O LEU B 13 68.746 47.048 15.294 1.00 25.41 O ATOM 6157 CB LEU B 13 70.772 47.107 17.521 1.00 22.85 C ATOM 6158 CG LEU B 13 71.346 47.691 18.825 1.00 27.76 C ATOM 6159 CD1 LEU B 13 71.228 46.673 19.956 1.00 28.78 C ATOM 6160 CD2 LEU B 13 72.822 48.024 18.620 1.00 28.35 C ATOM 6161 HA LEU B 13 71.552 48.519 16.183 1.00 0.00 H ATOM 6162 HB2 LEU B 13 69.805 46.661 17.754 1.00 0.00 H ATOM 6163 HB3 LEU B 13 71.455 46.331 17.175 1.00 0.00 H ATOM 6164 HG LEU B 13 70.786 48.589 19.085 1.00 0.00 H ATOM 6165 HD21 LEU B 13 73.365 47.116 18.355 1.00 0.00 H ATOM 6166 HD22 LEU B 13 72.920 48.755 17.817 1.00 0.00 H ATOM 6167 HD23 LEU B 13 73.231 48.438 19.542 1.00 0.00 H ATOM 6168 HD11 LEU B 13 70.178 46.422 20.109 1.00 0.00 H ATOM 6169 HD12 LEU B 13 71.784 45.773 19.693 1.00 0.00 H ATOM 6170 HD13 LEU B 13 71.638 47.100 20.871 1.00 0.00 H ATOM 6171 H LEU B 13 68.565 48.810 16.750 1.00 0.00 H ATOM 6172 N SER B 14 70.633 47.232 14.096 1.00 22.99 N ATOM 6173 CA SER B 14 70.071 46.567 12.923 1.00 23.57 C ATOM 6174 C SER B 14 71.159 45.785 12.194 1.00 27.22 C ATOM 6175 O SER B 14 72.343 45.862 12.531 1.00 27.09 O ATOM 6176 CB SER B 14 69.421 47.576 11.983 1.00 24.66 C ATOM 6177 OG SER B 14 70.417 48.137 11.142 1.00 32.23 O ATOM 6178 HA SER B 14 69.300 45.873 13.258 1.00 0.00 H ATOM 6179 HB2 SER B 14 68.948 48.366 12.566 1.00 0.00 H ATOM 6180 HB3 SER B 14 68.668 47.075 11.374 1.00 0.00 H ATOM 6181 HG SER B 14 71.099 48.591 11.698 1.00 0.00 H ATOM 6182 H SER B 14 71.606 47.597 14.063 1.00 0.00 H ATOM 6183 N PRO B 15 70.761 44.983 11.207 1.00 24.80 N ATOM 6184 CA PRO B 15 71.801 44.198 10.525 1.00 23.29 C ATOM 6185 C PRO B 15 72.743 45.081 9.669 1.00 29.28 C ATOM 6186 O PRO B 15 73.733 44.580 9.118 1.00 28.81 O ATOM 6187 CB PRO B 15 70.983 43.301 9.610 1.00 24.46 C ATOM 6188 CG PRO B 15 69.657 43.113 10.387 1.00 28.28 C ATOM 6189 CD PRO B 15 69.401 44.476 10.930 1.00 25.23 C ATOM 6190 HA PRO B 15 72.449 43.675 11.228 1.00 0.00 H ATOM 6191 HD3 PRO B 15 68.891 45.101 10.197 1.00 0.00 H ATOM 6192 HD2 PRO B 15 68.806 44.430 11.842 1.00 0.00 H ATOM 6193 HG3 PRO B 15 69.771 42.385 11.190 1.00 0.00 H ATOM 6194 HG2 PRO B 15 68.853 42.797 9.723 1.00 0.00 H ATOM 6195 HB2 PRO B 15 70.807 43.781 8.647 1.00 0.00 H ATOM 6196 HB3 PRO B 15 71.482 42.345 9.452 1.00 0.00 H ATOM 6197 N VAL B 16 72.375 46.349 9.476 1.00 25.99 N ATOM 6198 CA VAL B 16 73.208 47.269 8.664 1.00 25.95 C ATOM 6199 C VAL B 16 73.864 48.367 9.510 1.00 30.57 C ATOM 6200 O VAL B 16 74.489 49.267 8.960 1.00 31.22 O ATOM 6201 CB VAL B 16 72.517 47.825 7.386 1.00 27.13 C ATOM 6202 CG1 VAL B 16 72.132 46.667 6.387 1.00 25.16 C ATOM 6203 CG2 VAL B 16 71.322 48.699 7.721 1.00 26.99 C ATOM 6204 HA VAL B 16 74.010 46.640 8.279 1.00 0.00 H ATOM 6205 HB VAL B 16 73.243 48.463 6.881 1.00 0.00 H ATOM 6206 HG11 VAL B 16 73.034 46.132 6.088 1.00 0.00 H ATOM 6207 HG12 VAL B 16 71.446 45.978 6.879 1.00 0.00 H ATOM 6208 HG13 VAL B 16 71.652 47.093 5.506 1.00 0.00 H ATOM 6209 HG21 VAL B 16 70.590 48.114 8.277 1.00 0.00 H ATOM 6210 HG22 VAL B 16 71.650 49.544 8.327 1.00 0.00 H ATOM 6211 HG23 VAL B 16 70.871 49.065 6.799 1.00 0.00 H ATOM 6212 H VAL B 16 71.492 46.697 9.901 1.00 0.00 H ATOM 6213 N GLY B 17 73.811 48.229 10.835 1.00 24.26 N ATOM 6214 CA GLY B 17 74.450 49.210 11.701 1.00 24.96 C ATOM 6215 C GLY B 17 74.007 49.196 13.150 1.00 29.42 C ATOM 6216 O GLY B 17 72.864 48.825 13.456 1.00 26.98 O ATOM 6217 HA3 GLY B 17 74.241 50.200 11.296 1.00 0.00 H ATOM 6218 HA2 GLY B 17 75.524 49.028 11.677 1.00 0.00 H ATOM 6219 H GLY B 17 73.311 47.418 11.252 1.00 0.00 H ATOM 6220 N ASN B 18 74.912 49.600 14.042 1.00 22.86 N ATOM 6221 CA ASN B 18 74.632 49.596 15.476 1.00 24.05 C ATOM 6222 C ASN B 18 74.307 50.940 16.083 1.00 26.15 C ATOM 6223 O ASN B 18 74.336 51.101 17.295 1.00 25.63 O ATOM 6224 CB ASN B 18 75.721 48.874 16.271 1.00 25.62 C ATOM 6225 CG ASN B 18 75.845 47.431 15.884 1.00 36.90 C ATOM 6226 OD1 ASN B 18 74.969 46.888 15.232 1.00 37.78 O ATOM 6227 ND2 ASN B 18 76.922 46.792 16.298 1.00 36.60 N ATOM 6228 HA ASN B 18 73.704 49.029 15.556 1.00 0.00 H ATOM 6229 HB2 ASN B 18 76.675 49.369 16.089 1.00 0.00 H ATOM 6230 HB3 ASN B 18 75.479 48.933 17.332 1.00 0.00 H ATOM 6231 HD22 ASN B 18 77.644 47.295 16.852 1.00 0.00 H ATOM 6232 HD21 ASN B 18 77.049 45.785 16.070 1.00 0.00 H ATOM 6233 H ASN B 18 75.841 49.926 13.708 1.00 0.00 H ATOM 6234 N THR B 19 73.955 51.888 15.227 1.00 23.00 N ATOM 6235 CA THR B 19 73.483 53.191 15.663 1.00 22.46 C ATOM 6236 C THR B 19 72.428 53.598 14.657 1.00 24.10 C ATOM 6237 O THR B 19 72.342 53.026 13.590 1.00 24.63 O ATOM 6238 CB THR B 19 74.630 54.256 15.681 1.00 30.97 C ATOM 6239 OG1 THR B 19 75.099 54.453 14.337 1.00 28.97 O ATOM 6240 CG2 THR B 19 75.778 53.809 16.575 1.00 30.22 C ATOM 6241 HA THR B 19 73.098 53.135 16.681 1.00 0.00 H ATOM 6242 HB THR B 19 74.241 55.192 16.083 1.00 0.00 H ATOM 6243 HG1 THR B 19 75.825 55.126 14.337 1.00 0.00 H ATOM 6244 HG23 THR B 19 75.410 53.663 17.591 1.00 0.00 H ATOM 6245 HG21 THR B 19 76.187 52.872 16.197 1.00 0.00 H ATOM 6246 HG22 THR B 19 76.556 54.573 16.575 1.00 0.00 H ATOM 6247 H THR B 19 74.019 51.693 14.208 1.00 0.00 H ATOM 6248 N VAL B 20 71.683 54.646 14.966 1.00 22.91 N ATOM 6249 CA VAL B 20 70.662 55.184 14.064 1.00 22.10 C ATOM 6250 C VAL B 20 71.280 55.728 12.761 1.00 29.05 C ATOM 6251 O VAL B 20 70.894 55.330 11.644 1.00 25.81 O ATOM 6252 CB VAL B 20 69.834 56.293 14.782 1.00 26.34 C ATOM 6253 CG1 VAL B 20 68.883 57.014 13.808 1.00 25.44 C ATOM 6254 CG2 VAL B 20 69.036 55.690 15.952 1.00 25.09 C ATOM 6255 HA VAL B 20 69.996 54.365 13.793 1.00 0.00 H ATOM 6256 HB VAL B 20 70.537 57.031 15.169 1.00 0.00 H ATOM 6257 HG11 VAL B 20 69.465 57.480 13.012 1.00 0.00 H ATOM 6258 HG12 VAL B 20 68.190 56.291 13.378 1.00 0.00 H ATOM 6259 HG13 VAL B 20 68.324 57.779 14.347 1.00 0.00 H ATOM 6260 HG21 VAL B 20 68.356 54.927 15.572 1.00 0.00 H ATOM 6261 HG22 VAL B 20 69.725 55.240 16.667 1.00 0.00 H ATOM 6262 HG23 VAL B 20 68.463 56.477 16.443 1.00 0.00 H ATOM 6263 H VAL B 20 71.828 55.107 15.887 1.00 0.00 H ATOM 6264 N GLU B 21 72.246 56.630 12.899 1.00 27.58 N ATOM 6265 CA GLU B 21 72.883 57.224 11.716 1.00 26.68 C ATOM 6266 C GLU B 21 73.663 56.266 10.815 1.00 28.77 C ATOM 6267 O GLU B 21 73.592 56.381 9.589 1.00 28.77 O ATOM 6268 CB GLU B 21 73.719 58.464 12.097 1.00 27.82 C ATOM 6269 CG GLU B 21 72.928 59.476 12.950 1.00 27.10 C ATOM 6270 CD GLU B 21 71.824 60.167 12.196 1.00 29.22 C ATOM 6271 OE1 GLU B 21 71.816 60.139 10.950 1.00 28.21 O ATOM 6272 OE2 GLU B 21 70.926 60.739 12.846 1.00 37.01 O ATOM 6273 HA GLU B 21 72.046 57.532 11.089 1.00 0.00 H ATOM 6274 HB2 GLU B 21 74.591 58.137 12.663 1.00 0.00 H ATOM 6275 HB3 GLU B 21 74.046 58.959 11.183 1.00 0.00 H ATOM 6276 HG2 GLU B 21 72.489 58.946 13.795 1.00 0.00 H ATOM 6277 HG3 GLU B 21 73.621 60.233 13.318 1.00 0.00 H ATOM 6278 H GLU B 21 72.553 56.917 13.850 1.00 0.00 H ATOM 6279 N SER B 22 74.394 55.318 11.396 1.00 25.63 N ATOM 6280 CA SER B 22 75.118 54.345 10.575 1.00 26.61 C ATOM 6281 C SER B 22 74.145 53.434 9.835 1.00 31.88 C ATOM 6282 O SER B 22 74.356 53.085 8.671 1.00 31.36 O ATOM 6283 CB SER B 22 76.100 53.532 11.421 1.00 31.87 C ATOM 6284 OG SER B 22 75.432 52.706 12.355 1.00 35.39 O ATOM 6285 HA SER B 22 75.698 54.894 9.833 1.00 0.00 H ATOM 6286 HB2 SER B 22 76.753 54.218 11.960 1.00 0.00 H ATOM 6287 HB3 SER B 22 76.699 52.905 10.761 1.00 0.00 H ATOM 6288 HG SER B 22 74.890 53.269 12.963 1.00 0.00 H ATOM 6289 H SER B 22 74.451 55.268 12.433 1.00 0.00 H ATOM 6290 N THR B 23 73.055 53.051 10.506 1.00 26.60 N ATOM 6291 CA THR B 23 72.059 52.224 9.849 1.00 23.33 C ATOM 6292 C THR B 23 71.445 53.005 8.684 1.00 25.41 C ATOM 6293 O THR B 23 71.282 52.482 7.598 1.00 25.77 O ATOM 6294 CB THR B 23 70.948 51.830 10.843 1.00 23.68 C ATOM 6295 OG1 THR B 23 71.450 50.840 11.751 1.00 21.80 O ATOM 6296 CG2 THR B 23 69.723 51.307 10.089 1.00 25.73 C ATOM 6297 HA THR B 23 72.538 51.317 9.479 1.00 0.00 H ATOM 6298 HB THR B 23 70.643 52.708 11.413 1.00 0.00 H ATOM 6299 HG1 THR B 23 72.222 51.211 12.247 1.00 0.00 H ATOM 6300 HG23 THR B 23 69.362 52.077 9.407 1.00 0.00 H ATOM 6301 HG21 THR B 23 69.999 50.418 9.522 1.00 0.00 H ATOM 6302 HG22 THR B 23 68.939 51.055 10.803 1.00 0.00 H ATOM 6303 H THR B 23 72.921 53.344 11.495 1.00 0.00 H ATOM 6304 N TRP B 24 71.055 54.243 8.926 1.00 24.00 N ATOM 6305 CA TRP B 24 70.419 55.060 7.880 1.00 24.21 C ATOM 6306 C TRP B 24 71.361 55.311 6.705 1.00 28.29 C ATOM 6307 O TRP B 24 70.963 55.234 5.538 1.00 28.73 O ATOM 6308 CB TRP B 24 69.887 56.373 8.492 1.00 23.49 C ATOM 6309 CG TRP B 24 69.168 57.334 7.544 1.00 23.96 C ATOM 6310 CD1 TRP B 24 69.517 58.640 7.309 1.00 26.68 C ATOM 6311 CD2 TRP B 24 67.921 57.133 6.839 1.00 24.28 C ATOM 6312 NE1 TRP B 24 68.611 59.239 6.484 1.00 24.83 N ATOM 6313 CE2 TRP B 24 67.646 58.330 6.135 1.00 26.88 C ATOM 6314 CE3 TRP B 24 67.045 56.047 6.684 1.00 24.91 C ATOM 6315 CZ2 TRP B 24 66.481 58.502 5.373 1.00 26.12 C ATOM 6316 CZ3 TRP B 24 65.924 56.209 5.885 1.00 25.33 C ATOM 6317 CH2 TRP B 24 65.620 57.438 5.292 1.00 25.86 C ATOM 6318 HA TRP B 24 69.572 54.507 7.474 1.00 0.00 H ATOM 6319 HB2 TRP B 24 69.188 56.108 9.286 1.00 0.00 H ATOM 6320 HB3 TRP B 24 70.736 56.905 8.920 1.00 0.00 H ATOM 6321 HE1 TRP B 24 68.647 60.230 6.169 1.00 0.00 H ATOM 6322 HD1 TRP B 24 70.397 59.131 7.724 1.00 0.00 H ATOM 6323 HZ2 TRP B 24 66.269 59.443 4.866 1.00 0.00 H ATOM 6324 HH2 TRP B 24 64.679 57.553 4.754 1.00 0.00 H ATOM 6325 HZ3 TRP B 24 65.264 55.358 5.715 1.00 0.00 H ATOM 6326 HE3 TRP B 24 67.242 55.097 7.181 1.00 0.00 H ATOM 6327 H TRP B 24 71.200 54.648 9.873 1.00 0.00 H ATOM 6328 N LYS B 25 72.629 55.550 6.998 1.00 26.78 N ATOM 6329 CA LYS B 25 73.598 55.736 5.904 1.00 26.11 C ATOM 6330 C LYS B 25 73.654 54.490 5.000 1.00 29.28 C ATOM 6331 O LYS B 25 73.703 54.593 3.777 1.00 27.26 O ATOM 6332 CB LYS B 25 74.980 56.020 6.490 1.00 27.59 C ATOM 6333 CG LYS B 25 76.064 56.311 5.449 1.00 38.16 C ATOM 6334 CD LYS B 25 77.394 56.566 6.142 1.00 42.66 C ATOM 6335 CE LYS B 25 78.467 56.955 5.130 1.00 49.15 C ATOM 6336 NZ LYS B 25 79.815 57.157 5.747 1.00 43.38 N ATOM 6337 HA LYS B 25 73.278 56.582 5.295 1.00 0.00 H ATOM 6338 HB2 LYS B 25 74.900 56.885 7.149 1.00 0.00 H ATOM 6339 HB3 LYS B 25 75.289 55.150 7.070 1.00 0.00 H ATOM 6340 HG2 LYS B 25 76.163 55.455 4.781 1.00 0.00 H ATOM 6341 HG3 LYS B 25 75.783 57.191 4.871 1.00 0.00 H ATOM 6342 HD2 LYS B 25 77.272 57.375 6.863 1.00 0.00 H ATOM 6343 HD3 LYS B 25 77.705 55.660 6.663 1.00 0.00 H ATOM 6344 HE2 LYS B 25 78.165 57.883 4.645 1.00 0.00 H ATOM 6345 HE3 LYS B 25 78.542 56.164 4.384 1.00 0.00 H ATOM 6346 HZ1 LYS B 25 79.760 57.917 6.455 1.00 0.00 H ATOM 6347 HZ2 LYS B 25 80.121 56.275 6.206 1.00 0.00 H ATOM 6348 HZ3 LYS B 25 80.498 57.419 5.007 1.00 0.00 H ATOM 6349 H LYS B 25 72.938 55.606 7.989 1.00 0.00 H ATOM 6350 N ALA B 26 73.682 53.311 5.615 1.00 26.37 N ATOM 6351 CA ALA B 26 73.773 52.064 4.857 1.00 25.97 C ATOM 6352 C ALA B 26 72.550 51.825 4.011 1.00 27.52 C ATOM 6353 O ALA B 26 72.662 51.372 2.877 1.00 28.14 O ATOM 6354 CB ALA B 26 74.060 50.856 5.800 1.00 26.14 C ATOM 6355 HA ALA B 26 74.615 52.162 4.172 1.00 0.00 H ATOM 6356 HB1 ALA B 26 75.004 51.019 6.320 1.00 0.00 H ATOM 6357 HB2 ALA B 26 73.254 50.765 6.528 1.00 0.00 H ATOM 6358 HB3 ALA B 26 74.122 49.942 5.209 1.00 0.00 H ATOM 6359 H ALA B 26 73.638 53.275 6.653 1.00 0.00 H ATOM 6360 N LEU B 27 71.380 52.189 4.538 1.00 25.80 N ATOM 6361 CA LEU B 27 70.112 52.021 3.812 1.00 25.74 C ATOM 6362 C LEU B 27 70.017 52.940 2.581 1.00 29.74 C ATOM 6363 O LEU B 27 69.576 52.520 1.508 1.00 27.71 O ATOM 6364 CB LEU B 27 68.898 52.258 4.720 1.00 26.04 C ATOM 6365 CG LEU B 27 68.677 51.214 5.854 1.00 28.96 C ATOM 6366 CD1 LEU B 27 67.507 51.663 6.738 1.00 28.79 C ATOM 6367 CD2 LEU B 27 68.416 49.794 5.279 1.00 26.11 C ATOM 6368 HA LEU B 27 70.101 50.986 3.471 1.00 0.00 H ATOM 6369 HB2 LEU B 27 69.016 53.236 5.186 1.00 0.00 H ATOM 6370 HB3 LEU B 27 68.007 52.261 4.092 1.00 0.00 H ATOM 6371 HG LEU B 27 69.585 51.157 6.455 1.00 0.00 H ATOM 6372 HD21 LEU B 27 67.525 49.816 4.651 1.00 0.00 H ATOM 6373 HD22 LEU B 27 69.274 49.481 4.684 1.00 0.00 H ATOM 6374 HD23 LEU B 27 68.266 49.093 6.100 1.00 0.00 H ATOM 6375 HD11 LEU B 27 67.736 52.634 7.176 1.00 0.00 H ATOM 6376 HD12 LEU B 27 66.604 51.740 6.132 1.00 0.00 H ATOM 6377 HD13 LEU B 27 67.352 50.932 7.532 1.00 0.00 H ATOM 6378 H LEU B 27 71.364 52.604 5.491 1.00 0.00 H ATOM 6379 N LEU B 28 70.392 54.202 2.737 1.00 27.48 N ATOM 6380 CA LEU B 28 70.359 55.112 1.585 1.00 26.89 C ATOM 6381 C LEU B 28 71.371 54.656 0.499 1.00 30.43 C ATOM 6382 O LEU B 28 71.180 54.944 -0.679 1.00 32.42 O ATOM 6383 CB LEU B 28 70.659 56.535 2.033 1.00 26.04 C ATOM 6384 CG LEU B 28 69.542 57.228 2.816 1.00 28.62 C ATOM 6385 CD1 LEU B 28 69.990 58.642 3.286 1.00 29.80 C ATOM 6386 CD2 LEU B 28 68.219 57.276 2.030 1.00 26.26 C ATOM 6387 HA LEU B 28 69.360 55.087 1.150 1.00 0.00 H ATOM 6388 HB2 LEU B 28 71.546 56.508 2.666 1.00 0.00 H ATOM 6389 HB3 LEU B 28 70.866 57.131 1.144 1.00 0.00 H ATOM 6390 HG LEU B 28 69.346 56.627 3.704 1.00 0.00 H ATOM 6391 HD21 LEU B 28 68.370 57.824 1.100 1.00 0.00 H ATOM 6392 HD22 LEU B 28 67.894 56.260 1.806 1.00 0.00 H ATOM 6393 HD23 LEU B 28 67.460 57.778 2.630 1.00 0.00 H ATOM 6394 HD11 LEU B 28 70.865 58.549 3.929 1.00 0.00 H ATOM 6395 HD12 LEU B 28 70.239 59.250 2.417 1.00 0.00 H ATOM 6396 HD13 LEU B 28 69.178 59.113 3.840 1.00 0.00 H ATOM 6397 H LEU B 28 70.707 54.545 3.667 1.00 0.00 H ATOM 6398 N ALA B 29 72.413 53.929 0.915 1.00 25.42 N ATOM 6399 CA ALA B 29 73.449 53.388 0.018 1.00 25.27 C ATOM 6400 C ALA B 29 73.096 52.010 -0.567 1.00 33.45 C ATOM 6401 O ALA B 29 73.884 51.440 -1.330 1.00 34.93 O ATOM 6402 CB ALA B 29 74.804 53.336 0.718 1.00 24.50 C ATOM 6403 HA ALA B 29 73.504 54.078 -0.824 1.00 0.00 H ATOM 6404 HB1 ALA B 29 75.094 54.342 1.022 1.00 0.00 H ATOM 6405 HB2 ALA B 29 74.733 52.696 1.598 1.00 0.00 H ATOM 6406 HB3 ALA B 29 75.550 52.933 0.033 1.00 0.00 H ATOM 6407 H ALA B 29 72.497 53.734 1.933 1.00 0.00 H ATOM 6408 N GLY B 30 71.913 51.490 -0.244 1.00 29.14 N ATOM 6409 CA GLY B 30 71.436 50.203 -0.756 1.00 27.97 C ATOM 6410 C GLY B 30 72.225 48.990 -0.282 1.00 30.52 C ATOM 6411 O GLY B 30 72.233 47.945 -0.951 1.00 30.50 O ATOM 6412 HA3 GLY B 30 71.483 50.233 -1.845 1.00 0.00 H ATOM 6413 HA2 GLY B 30 70.400 50.077 -0.442 1.00 0.00 H ATOM 6414 H GLY B 30 71.298 52.024 0.403 1.00 0.00 H ATOM 6415 N GLN B 31 72.884 49.108 0.869 1.00 25.80 N ATOM 6416 CA GLN B 31 73.692 47.992 1.393 1.00 25.46 C ATOM 6417 C GLN B 31 72.824 46.917 2.055 1.00 32.74 C ATOM 6418 O GLN B 31 71.966 47.231 2.858 1.00 31.62 O ATOM 6419 CB GLN B 31 74.633 48.488 2.470 1.00 25.77 C ATOM 6420 CG GLN B 31 75.700 49.450 1.976 1.00 63.29 C ATOM 6421 CD GLN B 31 76.476 50.098 3.112 1.00 90.87 C ATOM 6422 OE1 GLN B 31 76.662 49.503 4.182 1.00 89.86 O ATOM 6423 NE2 GLN B 31 76.938 51.320 2.883 1.00 83.84 N ATOM 6424 HA GLN B 31 74.227 47.577 0.539 1.00 0.00 H ATOM 6425 HB2 GLN B 31 74.042 48.996 3.232 1.00 0.00 H ATOM 6426 HB3 GLN B 31 75.130 47.625 2.913 1.00 0.00 H ATOM 6427 HG2 GLN B 31 76.399 48.902 1.344 1.00 0.00 H ATOM 6428 HG3 GLN B 31 75.220 50.233 1.390 1.00 0.00 H ATOM 6429 HE22 GLN B 31 76.757 51.781 1.969 1.00 0.00 H ATOM 6430 HE21 GLN B 31 77.481 51.817 3.618 1.00 0.00 H ATOM 6431 H GLN B 31 72.828 49.998 1.404 1.00 0.00 H ATOM 6432 N SER B 32 73.164 45.656 1.834 1.00 30.97 N ATOM 6433 CA SER B 32 72.443 44.541 2.437 1.00 30.15 C ATOM 6434 C SER B 32 73.110 44.154 3.734 1.00 31.08 C ATOM 6435 O SER B 32 74.334 44.168 3.849 1.00 29.30 O ATOM 6436 CB SER B 32 72.461 43.336 1.476 1.00 32.91 C ATOM 6437 OG SER B 32 71.921 42.184 2.102 1.00 36.05 O ATOM 6438 HA SER B 32 71.412 44.839 2.630 1.00 0.00 H ATOM 6439 HB2 SER B 32 73.489 43.132 1.178 1.00 0.00 H ATOM 6440 HB3 SER B 32 71.868 43.574 0.593 1.00 0.00 H ATOM 6441 HG SER B 32 70.985 42.364 2.371 1.00 0.00 H ATOM 6442 H SER B 32 73.971 45.455 1.210 1.00 0.00 H ATOM 6443 N GLY B 33 72.319 43.773 4.720 1.00 25.67 N ATOM 6444 CA GLY B 33 72.907 43.342 5.978 1.00 24.49 C ATOM 6445 C GLY B 33 72.751 41.842 6.173 1.00 26.82 C ATOM 6446 O GLY B 33 73.050 41.305 7.226 1.00 26.93 O ATOM 6447 HA3 GLY B 33 72.412 43.861 6.799 1.00 0.00 H ATOM 6448 HA2 GLY B 33 73.968 43.593 5.979 1.00 0.00 H ATOM 6449 H GLY B 33 71.286 43.781 4.598 1.00 0.00 H ATOM 6450 N ILE B 34 72.336 41.158 5.124 1.00 25.24 N ATOM 6451 CA ILE B 34 72.150 39.699 5.187 1.00 26.33 C ATOM 6452 C ILE B 34 73.440 38.882 5.021 1.00 32.90 C ATOM 6453 O ILE B 34 74.225 39.114 4.102 1.00 30.81 O ATOM 6454 CB ILE B 34 71.118 39.259 4.157 1.00 28.42 C ATOM 6455 CG1 ILE B 34 69.915 40.188 4.231 1.00 28.17 C ATOM 6456 CG2 ILE B 34 70.727 37.789 4.402 1.00 28.48 C ATOM 6457 CD1 ILE B 34 69.351 40.326 5.645 1.00 28.96 C ATOM 6458 HA ILE B 34 71.798 39.491 6.197 1.00 0.00 H ATOM 6459 HB ILE B 34 71.535 39.321 3.152 1.00 0.00 H ATOM 6460 HG12 ILE B 34 70.216 41.175 3.879 1.00 0.00 H ATOM 6461 HG13 ILE B 34 69.132 39.795 3.582 1.00 0.00 H ATOM 6462 HD11 ILE B 34 69.036 39.347 6.006 1.00 0.00 H ATOM 6463 HD12 ILE B 34 70.121 40.728 6.304 1.00 0.00 H ATOM 6464 HD13 ILE B 34 68.496 41.001 5.629 1.00 0.00 H ATOM 6465 HG21 ILE B 34 71.613 37.160 4.316 1.00 0.00 H ATOM 6466 HG22 ILE B 34 70.304 37.689 5.402 1.00 0.00 H ATOM 6467 HG23 ILE B 34 69.989 37.482 3.661 1.00 0.00 H ATOM 6468 H ILE B 34 72.136 41.659 4.235 1.00 0.00 H ATOM 6469 N SER B 35 73.634 37.887 5.880 1.00 27.98 N ATOM 6470 CA SER B 35 74.771 37.029 5.725 1.00 29.16 C ATOM 6471 C SER B 35 74.447 35.602 6.188 1.00 34.43 C ATOM 6472 O SER B 35 73.363 35.330 6.723 1.00 33.22 O ATOM 6473 CB SER B 35 75.995 37.608 6.475 1.00 32.48 C ATOM 6474 OG SER B 35 75.810 37.508 7.872 1.00 38.43 O ATOM 6475 HA SER B 35 75.024 36.978 4.666 1.00 0.00 H ATOM 6476 HB2 SER B 35 76.120 38.656 6.203 1.00 0.00 H ATOM 6477 HB3 SER B 35 76.888 37.051 6.190 1.00 0.00 H ATOM 6478 HG SER B 35 75.001 38.016 8.134 1.00 0.00 H ATOM 6479 H SER B 35 72.964 37.732 6.660 1.00 0.00 H ATOM 6480 N LEU B 36 75.397 34.703 5.964 1.00 30.02 N ATOM 6481 CA LEU B 36 75.288 33.306 6.374 1.00 29.80 C ATOM 6482 C LEU B 36 75.383 33.169 7.890 1.00 32.16 C ATOM 6483 O LEU B 36 76.234 33.787 8.553 1.00 29.56 O ATOM 6484 CB LEU B 36 76.408 32.468 5.717 1.00 29.61 C ATOM 6485 CG LEU B 36 76.241 32.215 4.220 1.00 33.19 C ATOM 6486 CD1 LEU B 36 77.481 31.539 3.665 1.00 33.78 C ATOM 6487 CD2 LEU B 36 74.984 31.357 3.952 1.00 32.79 C ATOM 6488 HA LEU B 36 74.315 32.939 6.049 1.00 0.00 H ATOM 6489 HB2 LEU B 36 77.352 32.991 5.867 1.00 0.00 H ATOM 6490 HB3 LEU B 36 76.445 31.502 6.220 1.00 0.00 H ATOM 6491 HG LEU B 36 76.111 33.172 3.715 1.00 0.00 H ATOM 6492 HD21 LEU B 36 75.083 30.400 4.464 1.00 0.00 H ATOM 6493 HD22 LEU B 36 74.103 31.880 4.323 1.00 0.00 H ATOM 6494 HD23 LEU B 36 74.883 31.188 2.880 1.00 0.00 H ATOM 6495 HD11 LEU B 36 78.346 32.182 3.826 1.00 0.00 H ATOM 6496 HD12 LEU B 36 77.634 30.588 4.175 1.00 0.00 H ATOM 6497 HD13 LEU B 36 77.351 31.364 2.597 1.00 0.00 H ATOM 6498 H LEU B 36 76.261 35.008 5.473 1.00 0.00 H ATOM 6499 N ILE B 37 74.548 32.298 8.451 1.00 27.87 N ATOM 6500 CA ILE B 37 74.552 32.126 9.886 1.00 27.01 C ATOM 6501 C ILE B 37 75.776 31.314 10.283 1.00 31.97 C ATOM 6502 O ILE B 37 76.112 30.337 9.619 1.00 33.47 O ATOM 6503 CB ILE B 37 73.244 31.417 10.342 1.00 28.45 C ATOM 6504 CG1 ILE B 37 72.075 32.410 10.380 1.00 27.36 C ATOM 6505 CG2 ILE B 37 73.462 30.735 11.679 1.00 26.35 C ATOM 6506 CD1 ILE B 37 70.686 31.709 10.265 1.00 26.25 C ATOM 6507 HA ILE B 37 74.595 33.098 10.376 1.00 0.00 H ATOM 6508 HB ILE B 37 72.981 30.646 9.618 1.00 0.00 H ATOM 6509 HG12 ILE B 37 72.113 32.958 11.322 1.00 0.00 H ATOM 6510 HG13 ILE B 37 72.183 33.109 9.550 1.00 0.00 H ATOM 6511 HD11 ILE B 37 70.632 31.165 9.322 1.00 0.00 H ATOM 6512 HD12 ILE B 37 70.562 31.014 11.095 1.00 0.00 H ATOM 6513 HD13 ILE B 37 69.897 32.461 10.298 1.00 0.00 H ATOM 6514 HG21 ILE B 37 74.257 29.995 11.583 1.00 0.00 H ATOM 6515 HG22 ILE B 37 73.745 31.479 12.423 1.00 0.00 H ATOM 6516 HG23 ILE B 37 72.540 30.242 11.989 1.00 0.00 H ATOM 6517 H ILE B 37 73.896 31.744 7.860 1.00 0.00 H ATOM 6518 N ASP B 38 76.406 31.665 11.393 1.00 31.01 N ATOM 6519 CA ASP B 38 77.542 30.889 11.878 1.00 32.76 C ATOM 6520 C ASP B 38 77.427 30.439 13.318 1.00 35.32 C ATOM 6521 O ASP B 38 78.226 29.631 13.775 1.00 37.64 O ATOM 6522 CB ASP B 38 78.880 31.622 11.660 1.00 37.20 C ATOM 6523 CG ASP B 38 78.974 32.939 12.416 1.00 62.81 C ATOM 6524 OD1 ASP B 38 79.887 33.735 12.103 1.00 67.96 O ATOM 6525 OD2 ASP B 38 78.151 33.192 13.318 1.00 75.13 O ATOM 6526 HA ASP B 38 77.525 29.985 11.270 1.00 0.00 H ATOM 6527 HB2 ASP B 38 79.689 30.972 11.994 1.00 0.00 H ATOM 6528 HB3 ASP B 38 78.994 31.825 10.595 1.00 0.00 H ATOM 6529 H ASP B 38 76.088 32.501 11.924 1.00 0.00 H ATOM 6530 N HIS B 39 76.466 30.977 14.058 1.00 28.90 N ATOM 6531 CA HIS B 39 76.374 30.682 15.500 1.00 27.20 C ATOM 6532 C HIS B 39 75.659 29.365 15.853 1.00 32.28 C ATOM 6533 O HIS B 39 75.613 28.956 17.014 1.00 32.31 O ATOM 6534 CB HIS B 39 75.782 31.879 16.256 1.00 27.23 C ATOM 6535 CG HIS B 39 74.375 32.190 15.860 1.00 29.59 C ATOM 6536 ND1 HIS B 39 74.057 32.872 14.706 1.00 30.65 N ATOM 6537 CD2 HIS B 39 73.199 31.902 16.465 1.00 30.81 C ATOM 6538 CE1 HIS B 39 72.746 32.985 14.610 1.00 29.72 C ATOM 6539 NE2 HIS B 39 72.201 32.397 15.661 1.00 30.02 N ATOM 6540 HA HIS B 39 77.399 30.520 15.833 1.00 0.00 H ATOM 6541 HB2 HIS B 39 75.801 31.658 17.323 1.00 0.00 H ATOM 6542 HB3 HIS B 39 76.400 32.755 16.056 1.00 0.00 H ATOM 6543 HD2 HIS B 39 73.068 31.377 17.411 1.00 0.00 H ATOM 6544 HE1 HIS B 39 72.205 33.479 13.803 1.00 0.00 H ATOM 6545 H HIS B 39 75.771 31.613 13.617 1.00 0.00 H ATOM 6546 N PHE B 40 75.107 28.705 14.840 1.00 30.91 N ATOM 6547 CA PHE B 40 74.576 27.358 14.982 1.00 30.30 C ATOM 6548 C PHE B 40 74.789 26.575 13.677 1.00 34.36 C ATOM 6549 O PHE B 40 74.932 27.164 12.609 1.00 33.62 O ATOM 6550 CB PHE B 40 73.135 27.285 15.560 1.00 31.42 C ATOM 6551 CG PHE B 40 72.028 27.742 14.609 1.00 30.36 C ATOM 6552 CD1 PHE B 40 71.396 26.829 13.759 1.00 29.96 C ATOM 6553 CD2 PHE B 40 71.520 29.036 14.681 1.00 27.11 C ATOM 6554 CE1 PHE B 40 70.325 27.209 12.973 1.00 28.32 C ATOM 6555 CE2 PHE B 40 70.455 29.436 13.869 1.00 27.88 C ATOM 6556 CZ PHE B 40 69.864 28.526 13.000 1.00 26.14 C ATOM 6557 HA PHE B 40 75.150 26.857 15.762 1.00 0.00 H ATOM 6558 HB2 PHE B 40 72.935 26.250 15.838 1.00 0.00 H ATOM 6559 HB3 PHE B 40 73.096 27.913 16.450 1.00 0.00 H ATOM 6560 HD2 PHE B 40 71.959 29.747 15.381 1.00 0.00 H ATOM 6561 HE2 PHE B 40 70.088 30.461 13.917 1.00 0.00 H ATOM 6562 HZ PHE B 40 69.049 28.838 12.347 1.00 0.00 H ATOM 6563 HE1 PHE B 40 69.838 26.477 12.329 1.00 0.00 H ATOM 6564 HD1 PHE B 40 71.754 25.800 13.716 1.00 0.00 H ATOM 6565 H PHE B 40 75.053 29.169 13.911 1.00 0.00 H ATOM 6566 N ASP B 41 74.880 25.253 13.777 1.00 30.02 N ATOM 6567 CA ASP B 41 75.078 24.405 12.609 1.00 29.15 C ATOM 6568 C ASP B 41 73.808 24.379 11.737 1.00 32.09 C ATOM 6569 O ASP B 41 72.769 23.837 12.125 1.00 33.24 O ATOM 6570 CB ASP B 41 75.479 23.002 13.094 1.00 31.72 C ATOM 6571 CG ASP B 41 75.842 22.044 11.944 1.00 40.57 C ATOM 6572 OD1 ASP B 41 75.571 22.357 10.766 1.00 40.87 O ATOM 6573 OD2 ASP B 41 76.330 20.937 12.240 1.00 48.12 O ATOM 6574 HA ASP B 41 75.876 24.801 11.980 1.00 0.00 H ATOM 6575 HB2 ASP B 41 76.342 23.096 13.753 1.00 0.00 H ATOM 6576 HB3 ASP B 41 74.644 22.576 13.650 1.00 0.00 H ATOM 6577 H ASP B 41 74.808 24.811 14.716 1.00 0.00 H ATOM 6578 N THR B 42 73.880 25.003 10.568 1.00 27.35 N ATOM 6579 CA THR B 42 72.738 25.118 9.660 1.00 26.94 C ATOM 6580 C THR B 42 72.666 23.975 8.623 1.00 31.42 C ATOM 6581 O THR B 42 71.877 24.054 7.691 1.00 29.72 O ATOM 6582 CB THR B 42 72.725 26.491 8.941 1.00 29.88 C ATOM 6583 OG1 THR B 42 73.921 26.625 8.151 1.00 32.26 O ATOM 6584 CG2 THR B 42 72.705 27.642 9.945 1.00 24.44 C ATOM 6585 HA THR B 42 71.852 25.036 10.289 1.00 0.00 H ATOM 6586 HB THR B 42 71.830 26.534 8.321 1.00 0.00 H ATOM 6587 HG1 THR B 42 73.915 27.502 7.691 1.00 0.00 H ATOM 6588 HG23 THR B 42 71.809 27.570 10.561 1.00 0.00 H ATOM 6589 HG21 THR B 42 73.589 27.584 10.580 1.00 0.00 H ATOM 6590 HG22 THR B 42 72.703 28.591 9.408 1.00 0.00 H ATOM 6591 H THR B 42 74.786 25.428 10.285 1.00 0.00 H ATOM 6592 N SER B 43 73.518 22.952 8.748 1.00 29.00 N ATOM 6593 CA SER B 43 73.530 21.853 7.741 1.00 29.84 C ATOM 6594 C SER B 43 72.139 21.343 7.388 1.00 35.27 C ATOM 6595 O SER B 43 71.799 21.240 6.232 1.00 35.64 O ATOM 6596 CB SER B 43 74.369 20.653 8.227 1.00 31.18 C ATOM 6597 OG SER B 43 75.672 21.064 8.637 1.00 41.91 O ATOM 6598 HA SER B 43 73.974 22.294 6.849 1.00 0.00 H ATOM 6599 HB2 SER B 43 74.463 19.933 7.414 1.00 0.00 H ATOM 6600 HB3 SER B 43 73.863 20.184 9.070 1.00 0.00 H ATOM 6601 HG SER B 43 75.593 21.715 9.379 1.00 0.00 H ATOM 6602 H SER B 43 74.176 22.923 9.553 1.00 0.00 H ATOM 6603 N ALA B 44 71.338 21.024 8.400 1.00 32.85 N ATOM 6604 CA ALA B 44 69.987 20.480 8.180 1.00 31.97 C ATOM 6605 C ALA B 44 68.882 21.502 7.887 1.00 34.79 C ATOM 6606 O ALA B 44 67.741 21.115 7.613 1.00 30.76 O ATOM 6607 CB ALA B 44 69.582 19.599 9.366 1.00 32.62 C ATOM 6608 HA ALA B 44 70.072 19.901 7.260 1.00 0.00 H ATOM 6609 HB1 ALA B 44 70.290 18.777 9.465 1.00 0.00 H ATOM 6610 HB2 ALA B 44 69.587 20.195 10.278 1.00 0.00 H ATOM 6611 HB3 ALA B 44 68.582 19.200 9.196 1.00 0.00 H ATOM 6612 H ALA B 44 71.675 21.162 9.374 1.00 0.00 H ATOM 6613 N TYR B 45 69.210 22.799 7.938 1.00 31.99 N ATOM 6614 CA TYR B 45 68.224 23.856 7.703 1.00 30.34 C ATOM 6615 C TYR B 45 68.039 24.254 6.248 1.00 33.06 C ATOM 6616 O TYR B 45 68.995 24.501 5.516 1.00 33.03 O ATOM 6617 CB TYR B 45 68.538 25.113 8.573 1.00 29.59 C ATOM 6618 CG TYR B 45 68.406 24.835 10.070 1.00 27.97 C ATOM 6619 CD1 TYR B 45 69.333 24.043 10.733 1.00 28.90 C ATOM 6620 CD2 TYR B 45 67.315 25.308 10.798 1.00 27.49 C ATOM 6621 CE1 TYR B 45 69.171 23.724 12.090 1.00 29.73 C ATOM 6622 CE2 TYR B 45 67.162 25.015 12.156 1.00 27.05 C ATOM 6623 CZ TYR B 45 68.086 24.221 12.787 1.00 30.59 C ATOM 6624 OH TYR B 45 67.939 23.926 14.118 1.00 28.45 O ATOM 6625 HA TYR B 45 67.272 23.419 8.006 1.00 0.00 H ATOM 6626 HB3 TYR B 45 67.844 25.909 8.302 1.00 0.00 H ATOM 6627 HB2 TYR B 45 69.558 25.436 8.366 1.00 0.00 H ATOM 6628 HD2 TYR B 45 66.565 25.920 10.297 1.00 0.00 H ATOM 6629 HE2 TYR B 45 66.313 25.415 12.711 1.00 0.00 H ATOM 6630 HE1 TYR B 45 69.898 23.086 12.593 1.00 0.00 H ATOM 6631 HD1 TYR B 45 70.200 23.663 10.192 1.00 0.00 H ATOM 6632 HH TYR B 45 68.687 23.347 14.411 1.00 0.00 H ATOM 6633 H TYR B 45 70.193 23.063 8.151 1.00 0.00 H ATOM 6634 N ALA B 46 66.793 24.410 5.846 1.00 27.91 N ATOM 6635 CA ALA B 46 66.530 24.840 4.496 1.00 27.23 C ATOM 6636 C ALA B 46 67.019 26.262 4.273 1.00 31.34 C ATOM 6637 O ALA B 46 67.326 26.616 3.135 1.00 28.48 O ATOM 6638 CB ALA B 46 65.045 24.718 4.151 1.00 26.71 C ATOM 6639 HA ALA B 46 67.083 24.180 3.827 1.00 0.00 H ATOM 6640 HB1 ALA B 46 64.735 23.678 4.250 1.00 0.00 H ATOM 6641 HB2 ALA B 46 64.463 25.339 4.832 1.00 0.00 H ATOM 6642 HB3 ALA B 46 64.883 25.051 3.126 1.00 0.00 H ATOM 6643 H ALA B 46 66.005 24.224 6.499 1.00 0.00 H ATOM 6644 N THR B 47 66.976 27.097 5.327 1.00 26.80 N ATOM 6645 CA THR B 47 67.413 28.500 5.246 1.00 27.00 C ATOM 6646 C THR B 47 68.665 28.635 6.083 1.00 31.13 C ATOM 6647 O THR B 47 68.713 28.140 7.209 1.00 30.33 O ATOM 6648 CB THR B 47 66.314 29.440 5.731 1.00 30.31 C ATOM 6649 OG1 THR B 47 65.232 29.356 4.817 1.00 23.56 O ATOM 6650 CG2 THR B 47 66.802 30.895 5.786 1.00 26.77 C ATOM 6651 HA THR B 47 67.624 28.776 4.213 1.00 0.00 H ATOM 6652 HB THR B 47 66.015 29.145 6.737 1.00 0.00 H ATOM 6653 HG1 THR B 47 64.898 28.424 4.787 1.00 0.00 H ATOM 6654 HG23 THR B 47 67.634 30.972 6.486 1.00 0.00 H ATOM 6655 HG21 THR B 47 67.130 31.204 4.794 1.00 0.00 H ATOM 6656 HG22 THR B 47 65.987 31.538 6.117 1.00 0.00 H ATOM 6657 H THR B 47 66.620 26.737 6.235 1.00 0.00 H ATOM 6658 N LYS B 48 69.730 29.196 5.519 1.00 26.69 N ATOM 6659 CA LYS B 48 70.994 29.192 6.265 1.00 25.69 C ATOM 6660 C LYS B 48 71.594 30.566 6.443 1.00 28.76 C ATOM 6661 O LYS B 48 72.778 30.703 6.743 1.00 29.40 O ATOM 6662 CB LYS B 48 72.011 28.289 5.535 1.00 28.07 C ATOM 6663 CG LYS B 48 71.438 26.904 5.168 1.00 28.92 C ATOM 6664 CD LYS B 48 72.352 26.123 4.212 1.00 33.35 C ATOM 6665 CE LYS B 48 71.599 24.927 3.607 1.00 28.88 C ATOM 6666 NZ LYS B 48 71.610 23.811 4.596 1.00 28.35 N ATOM 6667 HA LYS B 48 70.769 28.813 7.262 1.00 0.00 H ATOM 6668 HB2 LYS B 48 72.324 28.789 4.618 1.00 0.00 H ATOM 6669 HB3 LYS B 48 72.876 28.146 6.183 1.00 0.00 H ATOM 6670 HG2 LYS B 48 71.311 26.324 6.082 1.00 0.00 H ATOM 6671 HG3 LYS B 48 70.468 27.042 4.690 1.00 0.00 H ATOM 6672 HD2 LYS B 48 72.681 26.783 3.410 1.00 0.00 H ATOM 6673 HD3 LYS B 48 73.221 25.760 4.762 1.00 0.00 H ATOM 6674 HE2 LYS B 48 72.091 24.609 2.688 1.00 0.00 H ATOM 6675 HE3 LYS B 48 70.571 25.213 3.387 1.00 0.00 H ATOM 6676 HZ1 LYS B 48 72.593 23.543 4.804 1.00 0.00 H ATOM 6677 HZ2 LYS B 48 71.141 24.120 5.471 1.00 0.00 H ATOM 6678 HZ3 LYS B 48 71.103 22.994 4.200 1.00 0.00 H ATOM 6679 H LYS B 48 69.669 29.626 4.574 1.00 0.00 H ATOM 6680 N PHE B 49 70.769 31.580 6.255 1.00 24.38 N ATOM 6681 CA PHE B 49 71.243 32.954 6.350 1.00 23.95 C ATOM 6682 C PHE B 49 70.201 33.819 7.062 1.00 27.40 C ATOM 6683 O PHE B 49 69.037 33.416 7.200 1.00 26.34 O ATOM 6684 CB PHE B 49 71.479 33.495 4.934 1.00 24.51 C ATOM 6685 CG PHE B 49 70.278 33.388 4.035 1.00 24.66 C ATOM 6686 CD1 PHE B 49 70.081 32.266 3.256 1.00 25.74 C ATOM 6687 CD2 PHE B 49 69.332 34.398 3.995 1.00 25.56 C ATOM 6688 CE1 PHE B 49 69.001 32.165 2.406 1.00 26.34 C ATOM 6689 CE2 PHE B 49 68.232 34.318 3.130 1.00 27.57 C ATOM 6690 CZ PHE B 49 68.060 33.181 2.349 1.00 26.38 C ATOM 6691 HA PHE B 49 72.172 32.982 6.920 1.00 0.00 H ATOM 6692 HB2 PHE B 49 71.760 34.546 5.010 1.00 0.00 H ATOM 6693 HB3 PHE B 49 72.297 32.933 4.483 1.00 0.00 H ATOM 6694 HD2 PHE B 49 69.444 35.266 4.644 1.00 0.00 H ATOM 6695 HE2 PHE B 49 67.518 35.140 3.070 1.00 0.00 H ATOM 6696 HZ PHE B 49 67.192 33.089 1.697 1.00 0.00 H ATOM 6697 HE1 PHE B 49 68.886 31.283 1.776 1.00 0.00 H ATOM 6698 HD1 PHE B 49 70.794 31.443 3.314 1.00 0.00 H ATOM 6699 H PHE B 49 69.769 31.395 6.037 1.00 0.00 H ATOM 6700 N ALA B 50 70.623 34.998 7.506 1.00 22.74 N ATOM 6701 CA ALA B 50 69.702 35.934 8.167 1.00 22.02 C ATOM 6702 C ALA B 50 70.387 37.296 8.260 1.00 27.02 C ATOM 6703 O ALA B 50 71.571 37.406 7.977 1.00 25.42 O ATOM 6704 CB ALA B 50 69.421 35.427 9.599 1.00 22.29 C ATOM 6705 HA ALA B 50 68.771 36.010 7.606 1.00 0.00 H ATOM 6706 HB1 ALA B 50 68.970 34.436 9.550 1.00 0.00 H ATOM 6707 HB2 ALA B 50 70.357 35.374 10.155 1.00 0.00 H ATOM 6708 HB3 ALA B 50 68.738 36.114 10.099 1.00 0.00 H ATOM 6709 H ALA B 50 71.621 35.263 7.384 1.00 0.00 H ATOM 6710 N GLY B 51 69.658 38.322 8.703 1.00 23.66 N ATOM 6711 CA GLY B 51 70.248 39.635 8.951 1.00 22.81 C ATOM 6712 C GLY B 51 70.654 39.690 10.420 1.00 27.44 C ATOM 6713 O GLY B 51 69.805 39.781 11.308 1.00 25.32 O ATOM 6714 HA3 GLY B 51 69.519 40.417 8.737 1.00 0.00 H ATOM 6715 HA2 GLY B 51 71.124 39.774 8.318 1.00 0.00 H ATOM 6716 H GLY B 51 68.642 38.183 8.876 1.00 0.00 H ATOM 6717 N LEU B 52 71.943 39.520 10.687 1.00 25.97 N ATOM 6718 CA LEU B 52 72.449 39.526 12.043 1.00 26.33 C ATOM 6719 C LEU B 52 72.975 40.885 12.494 1.00 28.81 C ATOM 6720 O LEU B 52 73.413 41.695 11.682 1.00 27.81 O ATOM 6721 CB LEU B 52 73.562 38.473 12.181 1.00 27.46 C ATOM 6722 CG LEU B 52 73.061 37.097 11.717 1.00 32.38 C ATOM 6723 CD1 LEU B 52 74.200 36.125 11.531 1.00 34.29 C ATOM 6724 CD2 LEU B 52 71.978 36.533 12.656 1.00 31.38 C ATOM 6725 HA LEU B 52 71.605 39.288 12.691 1.00 0.00 H ATOM 6726 HB2 LEU B 52 74.415 38.769 11.570 1.00 0.00 H ATOM 6727 HB3 LEU B 52 73.869 38.410 13.225 1.00 0.00 H ATOM 6728 HG LEU B 52 72.594 37.239 10.742 1.00 0.00 H ATOM 6729 HD21 LEU B 52 72.389 36.426 13.660 1.00 0.00 H ATOM 6730 HD22 LEU B 52 71.129 37.216 12.680 1.00 0.00 H ATOM 6731 HD23 LEU B 52 71.653 35.559 12.290 1.00 0.00 H ATOM 6732 HD11 LEU B 52 74.888 36.513 10.780 1.00 0.00 H ATOM 6733 HD12 LEU B 52 74.727 35.999 12.477 1.00 0.00 H ATOM 6734 HD13 LEU B 52 73.805 35.163 11.203 1.00 0.00 H ATOM 6735 H LEU B 52 72.608 39.379 9.900 1.00 0.00 H ATOM 6736 N VAL B 53 72.951 41.113 13.804 1.00 25.30 N ATOM 6737 CA VAL B 53 73.552 42.309 14.396 1.00 24.12 C ATOM 6738 C VAL B 53 75.039 41.966 14.500 1.00 27.37 C ATOM 6739 O VAL B 53 75.408 40.955 15.098 1.00 26.84 O ATOM 6740 CB VAL B 53 72.910 42.660 15.793 1.00 25.17 C ATOM 6741 CG1 VAL B 53 73.807 43.648 16.592 1.00 24.44 C ATOM 6742 CG2 VAL B 53 71.546 43.299 15.577 1.00 24.99 C ATOM 6743 HA VAL B 53 73.383 43.203 13.796 1.00 0.00 H ATOM 6744 HB VAL B 53 72.813 41.736 16.363 1.00 0.00 H ATOM 6745 HG11 VAL B 53 74.783 43.194 16.762 1.00 0.00 H ATOM 6746 HG12 VAL B 53 73.927 44.570 16.022 1.00 0.00 H ATOM 6747 HG13 VAL B 53 73.337 43.870 17.550 1.00 0.00 H ATOM 6748 HG21 VAL B 53 71.662 44.210 14.990 1.00 0.00 H ATOM 6749 HG22 VAL B 53 70.900 42.602 15.044 1.00 0.00 H ATOM 6750 HG23 VAL B 53 71.103 43.541 16.543 1.00 0.00 H ATOM 6751 H VAL B 53 72.491 40.420 14.427 1.00 0.00 H ATOM 6752 N LYS B 54 75.894 42.753 13.853 1.00 25.09 N ATOM 6753 CA LYS B 54 77.331 42.480 13.912 1.00 25.64 C ATOM 6754 C LYS B 54 78.002 43.135 15.102 1.00 30.44 C ATOM 6755 O LYS B 54 77.713 44.286 15.421 1.00 29.21 O ATOM 6756 CB LYS B 54 78.020 42.901 12.612 1.00 29.56 C ATOM 6757 CG LYS B 54 78.059 41.734 11.635 1.00 46.98 C ATOM 6758 CD LYS B 54 77.266 41.966 10.350 1.00 48.24 C ATOM 6759 CE LYS B 54 75.875 42.471 10.569 1.00 42.50 C ATOM 6760 NZ LYS B 54 75.031 42.132 9.383 1.00 31.65 N ATOM 6761 HA LYS B 54 77.438 41.403 14.038 1.00 0.00 H ATOM 6762 HB2 LYS B 54 77.469 43.728 12.164 1.00 0.00 H ATOM 6763 HB3 LYS B 54 79.039 43.221 12.831 1.00 0.00 H ATOM 6764 HG2 LYS B 54 79.099 41.547 11.366 1.00 0.00 H ATOM 6765 HG3 LYS B 54 77.651 40.856 12.135 1.00 0.00 H ATOM 6766 HD2 LYS B 54 77.803 42.696 9.744 1.00 0.00 H ATOM 6767 HD3 LYS B 54 77.206 41.021 9.810 1.00 0.00 H ATOM 6768 HE2 LYS B 54 75.897 43.553 10.703 1.00 0.00 H ATOM 6769 HE3 LYS B 54 75.455 42.005 11.460 1.00 0.00 H ATOM 6770 HZ1 LYS B 54 75.433 42.578 8.534 1.00 0.00 H ATOM 6771 HZ2 LYS B 54 75.011 41.100 9.257 1.00 0.00 H ATOM 6772 HZ3 LYS B 54 74.064 42.483 9.535 1.00 0.00 H ATOM 6773 H LYS B 54 75.541 43.563 13.305 1.00 0.00 H ATOM 6774 N ASP B 55 78.877 42.384 15.767 1.00 30.04 N ATOM 6775 CA ASP B 55 79.629 42.878 16.914 1.00 31.43 C ATOM 6776 C ASP B 55 78.812 43.644 17.953 1.00 35.19 C ATOM 6777 O ASP B 55 79.204 44.727 18.398 1.00 35.43 O ATOM 6778 CB ASP B 55 80.851 43.696 16.443 1.00 34.95 C ATOM 6779 CG ASP B 55 81.730 42.909 15.468 1.00 42.10 C ATOM 6780 OD1 ASP B 55 82.074 41.767 15.805 1.00 47.25 O ATOM 6781 OD2 ASP B 55 81.950 43.360 14.330 1.00 45.38 O ATOM 6782 HA ASP B 55 79.963 41.986 17.444 1.00 0.00 H ATOM 6783 HB2 ASP B 55 80.499 44.601 15.947 1.00 0.00 H ATOM 6784 HB3 ASP B 55 81.448 43.969 17.313 1.00 0.00 H ATOM 6785 H ASP B 55 79.031 41.404 15.455 1.00 0.00 H ATOM 6786 N PHE B 56 77.692 43.062 18.371 1.00 29.14 N ATOM 6787 CA PHE B 56 76.885 43.662 19.419 1.00 27.91 C ATOM 6788 C PHE B 56 77.768 43.848 20.638 1.00 32.70 C ATOM 6789 O PHE B 56 78.497 42.944 21.031 1.00 32.84 O ATOM 6790 CB PHE B 56 75.745 42.721 19.824 1.00 28.30 C ATOM 6791 CG PHE B 56 74.939 43.234 20.989 1.00 28.39 C ATOM 6792 CD1 PHE B 56 74.288 44.444 20.906 1.00 29.33 C ATOM 6793 CD2 PHE B 56 74.846 42.507 22.170 1.00 29.83 C ATOM 6794 CE1 PHE B 56 73.544 44.928 21.980 1.00 28.83 C ATOM 6795 CE2 PHE B 56 74.055 42.952 23.228 1.00 30.23 C ATOM 6796 CZ PHE B 56 73.441 44.166 23.151 1.00 28.19 C ATOM 6797 HA PHE B 56 76.474 44.605 19.058 1.00 0.00 H ATOM 6798 HB2 PHE B 56 75.079 42.595 18.970 1.00 0.00 H ATOM 6799 HB3 PHE B 56 76.172 41.756 20.096 1.00 0.00 H ATOM 6800 HD2 PHE B 56 75.400 41.574 22.270 1.00 0.00 H ATOM 6801 HE2 PHE B 56 73.928 42.331 24.114 1.00 0.00 H ATOM 6802 HZ PHE B 56 72.870 44.544 23.999 1.00 0.00 H ATOM 6803 HE1 PHE B 56 73.045 45.894 21.909 1.00 0.00 H ATOM 6804 HD1 PHE B 56 74.355 45.030 19.990 1.00 0.00 H ATOM 6805 H PHE B 56 77.390 42.164 17.941 1.00 0.00 H ATOM 6806 N ASN B 57 77.646 44.995 21.280 1.00 33.26 N ATOM 6807 CA ASN B 57 78.439 45.294 22.474 1.00 34.28 C ATOM 6808 C ASN B 57 77.600 46.007 23.535 1.00 38.20 C ATOM 6809 O ASN B 57 77.044 47.078 23.272 1.00 39.76 O ATOM 6810 CB ASN B 57 79.624 46.195 22.102 1.00 40.79 C ATOM 6811 CG ASN B 57 80.696 46.215 23.183 1.00 62.08 C ATOM 6812 OD1 ASN B 57 81.710 45.528 23.075 1.00 74.57 O ATOM 6813 ND2 ASN B 57 80.415 46.900 24.281 1.00 39.02 N ATOM 6814 HA ASN B 57 78.794 44.347 22.880 1.00 0.00 H ATOM 6815 HB2 ASN B 57 80.066 45.828 21.176 1.00 0.00 H ATOM 6816 HB3 ASN B 57 79.259 47.211 21.951 1.00 0.00 H ATOM 6817 HD22 ASN B 57 79.546 47.469 24.331 1.00 0.00 H ATOM 6818 HD21 ASN B 57 81.063 46.869 25.094 1.00 0.00 H ATOM 6819 H ASN B 57 76.970 45.703 20.929 1.00 0.00 H ATOM 6820 N CYS B 58 77.531 45.449 24.741 1.00 33.30 N ATOM 6821 CA CYS B 58 76.782 46.114 25.793 1.00 34.94 C ATOM 6822 C CYS B 58 77.632 46.298 27.062 1.00 41.59 C ATOM 6823 O CYS B 58 77.123 46.729 28.102 1.00 38.35 O ATOM 6824 CB CYS B 58 75.522 45.320 26.123 1.00 36.48 C ATOM 6825 SG CYS B 58 75.872 43.711 26.873 1.00 41.87 S ATOM 6826 HA CYS B 58 76.503 47.103 25.428 1.00 0.00 H ATOM 6827 HB2 CYS B 58 74.962 45.159 25.202 1.00 0.00 H ATOM 6828 HB3 CYS B 58 74.917 45.902 26.818 1.00 0.00 H ATOM 6829 HG CYS B 58 76.628 42.954 26.001 1.00 0.00 H ATOM 6830 H CYS B 58 78.009 44.545 24.929 1.00 0.00 H ATOM 6831 N GLU B 59 78.926 46.012 26.961 1.00 43.86 N ATOM 6832 CA GLU B 59 79.841 46.069 28.119 1.00 46.45 C ATOM 6833 C GLU B 59 79.693 47.248 29.075 1.00 51.89 C ATOM 6834 O GLU B 59 79.647 47.081 30.305 1.00 53.83 O ATOM 6835 CB GLU B 59 81.304 45.873 27.704 1.00 48.75 C ATOM 6836 CG GLU B 59 81.938 44.621 28.315 1.00 63.88 C ATOM 6837 CD GLU B 59 81.052 43.389 28.170 1.00 92.16 C ATOM 6838 OE1 GLU B 59 80.134 43.408 27.325 1.00 86.11 O ATOM 6839 OE2 GLU B 59 81.268 42.398 28.900 1.00 93.95 O ATOM 6840 HA GLU B 59 79.509 45.221 28.717 1.00 0.00 H ATOM 6841 HB2 GLU B 59 81.349 45.790 26.618 1.00 0.00 H ATOM 6842 HB3 GLU B 59 81.876 46.744 28.025 1.00 0.00 H ATOM 6843 HG2 GLU B 59 82.888 44.430 27.815 1.00 0.00 H ATOM 6844 HG3 GLU B 59 82.117 44.801 29.375 1.00 0.00 H ATOM 6845 H GLU B 59 79.308 45.738 26.033 1.00 0.00 H ATOM 6846 N ASP B 60 79.582 48.429 28.502 1.00 46.33 N ATOM 6847 CA ASP B 60 79.441 49.661 29.260 1.00 47.36 C ATOM 6848 C ASP B 60 77.994 49.993 29.672 1.00 45.79 C ATOM 6849 O ASP B 60 77.740 50.980 30.360 1.00 44.05 O ATOM 6850 CB ASP B 60 79.923 50.784 28.335 1.00 51.51 C ATOM 6851 CG ASP B 60 79.581 50.512 26.862 1.00 71.45 C ATOM 6852 OD1 ASP B 60 79.413 49.323 26.494 1.00 71.72 O ATOM 6853 OD2 ASP B 60 79.470 51.487 26.077 1.00 81.36 O ATOM 6854 HA ASP B 60 80.009 49.553 30.184 1.00 0.00 H ATOM 6855 HB2 ASP B 60 79.449 51.717 28.639 1.00 0.00 H ATOM 6856 HB3 ASP B 60 81.004 50.879 28.432 1.00 0.00 H ATOM 6857 H ASP B 60 79.596 48.482 27.463 1.00 0.00 H ATOM 6858 N ILE B 61 77.039 49.222 29.170 1.00 38.55 N ATOM 6859 CA ILE B 61 75.624 49.534 29.365 1.00 36.42 C ATOM 6860 C ILE B 61 74.902 48.600 30.320 1.00 34.38 C ATOM 6861 O ILE B 61 74.099 49.044 31.129 1.00 32.96 O ATOM 6862 CB ILE B 61 74.941 49.589 27.982 1.00 39.35 C ATOM 6863 CG1 ILE B 61 75.590 50.699 27.143 1.00 40.72 C ATOM 6864 CG2 ILE B 61 73.439 49.745 28.108 1.00 36.79 C ATOM 6865 CD1 ILE B 61 76.145 50.224 25.807 1.00 50.68 C ATOM 6866 HA ILE B 61 75.563 50.505 29.856 1.00 0.00 H ATOM 6867 HB ILE B 61 75.092 48.642 27.464 1.00 0.00 H ATOM 6868 HG12 ILE B 61 74.840 51.465 26.949 1.00 0.00 H ATOM 6869 HG13 ILE B 61 76.408 51.131 27.720 1.00 0.00 H ATOM 6870 HD11 ILE B 61 76.908 49.465 25.981 1.00 0.00 H ATOM 6871 HD12 ILE B 61 75.338 49.800 25.210 1.00 0.00 H ATOM 6872 HD13 ILE B 61 76.586 51.069 25.277 1.00 0.00 H ATOM 6873 HG21 ILE B 61 73.032 48.898 28.660 1.00 0.00 H ATOM 6874 HG22 ILE B 61 73.214 50.669 28.641 1.00 0.00 H ATOM 6875 HG23 ILE B 61 72.994 49.780 27.114 1.00 0.00 H ATOM 6876 H ILE B 61 77.303 48.376 28.625 1.00 0.00 H ATOM 6877 N ILE B 62 75.209 47.309 30.222 1.00 29.09 N ATOM 6878 CA ILE B 62 74.582 46.309 31.069 1.00 28.84 C ATOM 6879 C ILE B 62 75.678 45.611 31.860 1.00 34.29 C ATOM 6880 O ILE B 62 76.601 45.062 31.263 1.00 31.98 O ATOM 6881 CB ILE B 62 73.843 45.242 30.190 1.00 30.10 C ATOM 6882 CG1 ILE B 62 72.801 45.907 29.282 1.00 28.23 C ATOM 6883 CG2 ILE B 62 73.246 44.143 31.076 1.00 28.93 C ATOM 6884 CD1 ILE B 62 72.160 44.941 28.213 1.00 26.32 C ATOM 6885 HA ILE B 62 73.860 46.788 31.731 1.00 0.00 H ATOM 6886 HB ILE B 62 74.565 44.762 29.529 1.00 0.00 H ATOM 6887 HG12 ILE B 62 72.002 46.300 29.910 1.00 0.00 H ATOM 6888 HG13 ILE B 62 73.283 46.729 28.754 1.00 0.00 H ATOM 6889 HD11 ILE B 62 72.943 44.547 27.565 1.00 0.00 H ATOM 6890 HD12 ILE B 62 71.660 44.117 28.723 1.00 0.00 H ATOM 6891 HD13 ILE B 62 71.435 45.493 27.615 1.00 0.00 H ATOM 6892 HG21 ILE B 62 74.045 43.654 31.634 1.00 0.00 H ATOM 6893 HG22 ILE B 62 72.534 44.586 31.772 1.00 0.00 H ATOM 6894 HG23 ILE B 62 72.736 43.410 30.450 1.00 0.00 H ATOM 6895 H ILE B 62 75.916 47.008 29.521 1.00 0.00 H ATOM 6896 N SER B 63 75.540 45.576 33.186 1.00 32.75 N ATOM 6897 CA SER B 63 76.552 44.931 34.036 1.00 34.11 C ATOM 6898 C SER B 63 76.669 43.455 33.710 1.00 41.05 C ATOM 6899 O SER B 63 75.766 42.869 33.109 1.00 41.18 O ATOM 6900 CB SER B 63 76.191 45.096 35.514 1.00 38.96 C ATOM 6901 OG SER B 63 75.246 44.116 35.895 1.00 44.91 O ATOM 6902 HA SER B 63 77.509 45.414 33.841 1.00 0.00 H ATOM 6903 HB2 SER B 63 75.767 46.087 35.674 1.00 0.00 H ATOM 6904 HB3 SER B 63 77.090 44.985 36.120 1.00 0.00 H ATOM 6905 HG SER B 63 75.020 44.232 36.852 1.00 0.00 H ATOM 6906 H SER B 63 74.704 46.011 33.626 1.00 0.00 H ATOM 6907 N ARG B 64 77.781 42.839 34.085 1.00 38.24 N ATOM 6908 CA ARG B 64 77.919 41.412 33.814 1.00 40.12 C ATOM 6909 C ARG B 64 76.988 40.543 34.670 1.00 42.89 C ATOM 6910 O ARG B 64 76.494 39.506 34.225 1.00 42.03 O ATOM 6911 CB ARG B 64 79.378 40.967 33.841 1.00 47.11 C ATOM 6912 CG ARG B 64 80.059 41.354 32.516 1.00 74.28 C ATOM 6913 CD ARG B 64 81.564 41.261 32.577 1.00100.96 C ATOM 6914 NE ARG B 64 82.204 42.492 32.123 1.00120.39 N ATOM 6915 CZ ARG B 64 83.460 42.820 32.409 1.00141.43 C ATOM 6916 NH1 ARG B 64 84.199 42.007 33.152 1.00130.06 N ATOM 6917 NH2 ARG B 64 83.974 43.956 31.956 1.00132.85 N ATOM 6918 HA ARG B 64 77.577 41.251 32.792 1.00 0.00 H ATOM 6919 HB2 ARG B 64 79.891 41.455 34.669 1.00 0.00 H ATOM 6920 HB3 ARG B 64 79.426 39.886 33.972 1.00 0.00 H ATOM 6921 HG2 ARG B 64 79.701 40.686 31.733 1.00 0.00 H ATOM 6922 HG3 ARG B 64 79.784 42.380 32.270 1.00 0.00 H ATOM 6923 HD2 ARG B 64 81.893 40.438 31.943 1.00 0.00 H ATOM 6924 HD3 ARG B 64 81.864 41.066 33.607 1.00 0.00 H ATOM 6925 HE ARG B 64 81.645 43.150 31.543 1.00 0.00 H ATOM 6926 HH12 ARG B 64 85.182 42.259 33.378 1.00 0.00 H ATOM 6927 HH11 ARG B 64 83.795 41.117 33.508 1.00 0.00 H ATOM 6928 HH22 ARG B 64 84.957 44.209 32.182 1.00 0.00 H ATOM 6929 HH21 ARG B 64 83.394 44.594 31.375 1.00 0.00 H ATOM 6930 H ARG B 64 78.541 43.363 34.564 1.00 0.00 H ATOM 6931 N LYS B 65 76.684 41.023 35.870 1.00 38.91 N ATOM 6932 CA LYS B 65 75.753 40.322 36.722 1.00 39.47 C ATOM 6933 C LYS B 65 74.366 40.341 36.068 1.00 39.56 C ATOM 6934 O LYS B 65 73.624 39.380 36.194 1.00 37.84 O ATOM 6935 CB LYS B 65 75.703 40.936 38.132 1.00 43.20 C ATOM 6936 CG LYS B 65 76.703 40.313 39.109 1.00 64.67 C ATOM 6937 CD LYS B 65 78.146 40.734 38.752 1.00 79.52 C ATOM 6938 CE LYS B 65 79.231 39.682 39.070 1.00 85.77 C ATOM 6939 NZ LYS B 65 78.781 38.255 39.057 1.00 82.82 N ATOM 6940 HA LYS B 65 76.089 39.291 36.837 1.00 0.00 H ATOM 6941 HB2 LYS B 65 75.918 42.002 38.052 1.00 0.00 H ATOM 6942 HB3 LYS B 65 74.699 40.798 38.532 1.00 0.00 H ATOM 6943 HG2 LYS B 65 76.472 40.647 40.120 1.00 0.00 H ATOM 6944 HG3 LYS B 65 76.624 39.227 39.059 1.00 0.00 H ATOM 6945 HD2 LYS B 65 78.182 40.945 37.683 1.00 0.00 H ATOM 6946 HD3 LYS B 65 78.381 41.641 39.308 1.00 0.00 H ATOM 6947 HE2 LYS B 65 79.626 39.899 40.062 1.00 0.00 H ATOM 6948 HE3 LYS B 65 80.026 39.788 38.332 1.00 0.00 H ATOM 6949 HZ1 LYS B 65 78.032 38.123 39.766 1.00 0.00 H ATOM 6950 HZ2 LYS B 65 78.414 38.017 38.114 1.00 0.00 H ATOM 6951 HZ3 LYS B 65 79.586 37.637 39.283 1.00 0.00 H ATOM 6952 H LYS B 65 77.119 41.909 36.198 1.00 0.00 H ATOM 6953 N GLU B 66 74.043 41.423 35.352 1.00 33.92 N ATOM 6954 CA GLU B 66 72.743 41.546 34.698 1.00 32.91 C ATOM 6955 C GLU B 66 72.628 40.835 33.352 1.00 35.54 C ATOM 6956 O GLU B 66 71.578 40.287 33.033 1.00 33.92 O ATOM 6957 CB GLU B 66 72.314 43.007 34.594 1.00 33.58 C ATOM 6958 CG GLU B 66 71.968 43.634 35.945 1.00 37.63 C ATOM 6959 CD GLU B 66 70.858 42.898 36.659 1.00 49.93 C ATOM 6960 OE1 GLU B 66 69.695 42.984 36.211 1.00 41.72 O ATOM 6961 OE2 GLU B 66 71.139 42.220 37.668 1.00 38.50 O ATOM 6962 HA GLU B 66 72.049 41.016 35.351 1.00 0.00 H ATOM 6963 HB2 GLU B 66 73.129 43.576 34.147 1.00 0.00 H ATOM 6964 HB3 GLU B 66 71.436 43.065 33.950 1.00 0.00 H ATOM 6965 HG2 GLU B 66 72.858 43.621 36.575 1.00 0.00 H ATOM 6966 HG3 GLU B 66 71.655 44.665 35.782 1.00 0.00 H ATOM 6967 H GLU B 66 74.734 42.195 35.259 1.00 0.00 H ATOM 6968 N GLN B 67 73.693 40.836 32.552 1.00 30.79 N ATOM 6969 CA GLN B 67 73.636 40.169 31.256 1.00 29.60 C ATOM 6970 C GLN B 67 73.190 38.721 31.320 1.00 34.12 C ATOM 6971 O GLN B 67 72.505 38.238 30.416 1.00 33.36 O ATOM 6972 CB GLN B 67 74.978 40.232 30.533 1.00 30.53 C ATOM 6973 CG GLN B 67 75.465 41.661 30.289 1.00 43.14 C ATOM 6974 CD GLN B 67 76.814 41.699 29.601 1.00 46.60 C ATOM 6975 OE1 GLN B 67 77.122 40.825 28.803 1.00 33.85 O ATOM 6976 NE2 GLN B 67 77.626 42.703 29.924 1.00 36.03 N ATOM 6977 HA GLN B 67 72.878 40.723 30.702 1.00 0.00 H ATOM 6978 HB2 GLN B 67 75.721 39.711 31.136 1.00 0.00 H ATOM 6979 HB3 GLN B 67 74.877 39.731 29.570 1.00 0.00 H ATOM 6980 HG2 GLN B 67 74.737 42.178 29.663 1.00 0.00 H ATOM 6981 HG3 GLN B 67 75.546 42.173 31.248 1.00 0.00 H ATOM 6982 HE22 GLN B 67 77.317 43.422 30.609 1.00 0.00 H ATOM 6983 HE21 GLN B 67 78.570 42.768 29.492 1.00 0.00 H ATOM 6984 H GLN B 67 74.567 41.313 32.852 1.00 0.00 H ATOM 6985 N ARG B 68 73.681 38.003 32.334 1.00 29.37 N ATOM 6986 CA ARG B 68 73.379 36.583 32.502 1.00 30.14 C ATOM 6987 C ARG B 68 71.872 36.340 32.700 1.00 31.91 C ATOM 6988 O ARG B 68 71.402 35.209 32.612 1.00 32.18 O ATOM 6989 CB ARG B 68 74.137 36.075 33.751 1.00 35.76 C ATOM 6990 CG ARG B 68 73.986 34.585 34.024 1.00 68.68 C ATOM 6991 CD ARG B 68 73.214 34.306 35.323 1.00 90.59 C ATOM 6992 NE ARG B 68 72.169 33.287 35.166 1.00100.73 N ATOM 6993 CZ ARG B 68 72.347 32.096 34.592 1.00112.23 C ATOM 6994 NH1 ARG B 68 73.532 31.762 34.094 1.00 97.29 N ATOM 6995 NH2 ARG B 68 71.334 31.236 34.508 1.00 92.60 N ATOM 6996 HA ARG B 68 73.688 36.051 31.602 1.00 0.00 H ATOM 6997 HB2 ARG B 68 75.197 36.290 33.616 1.00 0.00 H ATOM 6998 HB3 ARG B 68 73.765 36.619 34.619 1.00 0.00 H ATOM 6999 HG2 ARG B 68 73.450 34.128 33.192 1.00 0.00 H ATOM 7000 HG3 ARG B 68 74.978 34.140 34.103 1.00 0.00 H ATOM 7001 HD2 ARG B 68 72.747 35.233 35.655 1.00 0.00 H ATOM 7002 HD3 ARG B 68 73.920 33.965 36.080 1.00 0.00 H ATOM 7003 HE ARG B 68 71.220 33.510 35.529 1.00 0.00 H ATOM 7004 HH12 ARG B 68 73.665 30.832 33.648 1.00 0.00 H ATOM 7005 HH11 ARG B 68 74.327 32.430 34.150 1.00 0.00 H ATOM 7006 HH22 ARG B 68 71.475 30.308 34.060 1.00 0.00 H ATOM 7007 HH21 ARG B 68 70.401 31.492 34.890 1.00 0.00 H ATOM 7008 H ARG B 68 74.299 38.470 33.027 1.00 0.00 H ATOM 7009 N LYS B 69 71.138 37.387 33.045 1.00 26.23 N ATOM 7010 CA LYS B 69 69.705 37.255 33.343 1.00 25.47 C ATOM 7011 C LYS B 69 68.792 37.585 32.146 1.00 26.99 C ATOM 7012 O LYS B 69 67.574 37.726 32.306 1.00 25.51 O ATOM 7013 CB LYS B 69 69.351 38.215 34.481 1.00 27.21 C ATOM 7014 CG LYS B 69 70.294 38.172 35.700 1.00 30.59 C ATOM 7015 CD LYS B 69 69.655 38.945 36.872 1.00 35.17 C ATOM 7016 CE LYS B 69 70.602 39.087 38.086 1.00 37.73 C ATOM 7017 NZ LYS B 69 70.102 40.151 39.000 1.00 35.29 N ATOM 7018 HA LYS B 69 69.535 36.211 33.607 1.00 0.00 H ATOM 7019 HB2 LYS B 69 69.363 39.229 34.082 1.00 0.00 H ATOM 7020 HB3 LYS B 69 68.345 37.973 34.825 1.00 0.00 H ATOM 7021 HG2 LYS B 69 70.460 37.136 35.995 1.00 0.00 H ATOM 7022 HG3 LYS B 69 71.247 38.631 35.439 1.00 0.00 H ATOM 7023 HD2 LYS B 69 69.383 39.942 36.524 1.00 0.00 H ATOM 7024 HD3 LYS B 69 68.758 38.415 37.191 1.00 0.00 H ATOM 7025 HE2 LYS B 69 71.600 39.351 37.737 1.00 0.00 H ATOM 7026 HE3 LYS B 69 70.645 38.140 38.624 1.00 0.00 H ATOM 7027 HZ1 LYS B 69 70.063 41.056 38.488 1.00 0.00 H ATOM 7028 HZ2 LYS B 69 69.150 39.899 39.335 1.00 0.00 H ATOM 7029 HZ3 LYS B 69 70.745 40.239 39.813 1.00 0.00 H ATOM 7030 H LYS B 69 71.586 38.324 33.106 1.00 0.00 H ATOM 7031 N MET B 70 69.377 37.779 30.973 1.00 24.39 N ATOM 7032 CA MET B 70 68.618 38.272 29.807 1.00 23.19 C ATOM 7033 C MET B 70 68.891 37.559 28.511 1.00 25.49 C ATOM 7034 O MET B 70 70.043 37.469 28.103 1.00 24.60 O ATOM 7035 CB MET B 70 69.019 39.718 29.513 1.00 25.32 C ATOM 7036 CG MET B 70 69.235 40.629 30.725 1.00 27.74 C ATOM 7037 SD MET B 70 69.933 42.224 30.186 1.00 27.65 S ATOM 7038 CE MET B 70 69.503 43.256 31.628 1.00 24.12 C ATOM 7039 HA MET B 70 67.577 38.122 30.094 1.00 0.00 H ATOM 7040 HB2 MET B 70 69.950 39.695 28.946 1.00 0.00 H ATOM 7041 HB3 MET B 70 68.233 40.162 28.901 1.00 0.00 H ATOM 7042 HG2 MET B 70 69.924 40.149 31.420 1.00 0.00 H ATOM 7043 HG3 MET B 70 68.281 40.801 31.222 1.00 0.00 H ATOM 7044 HE1 MET B 70 68.421 43.265 31.757 1.00 0.00 H ATOM 7045 HE2 MET B 70 69.973 42.844 32.521 1.00 0.00 H ATOM 7046 HE3 MET B 70 69.859 44.273 31.465 1.00 0.00 H ATOM 7047 H MET B 70 70.393 37.580 30.872 1.00 0.00 H ATOM 7048 N ASP B 71 67.829 37.250 27.761 1.00 22.78 N ATOM 7049 CA ASP B 71 68.011 36.699 26.427 1.00 21.51 C ATOM 7050 C ASP B 71 68.598 37.836 25.578 1.00 24.61 C ATOM 7051 O ASP B 71 68.462 38.989 25.917 1.00 23.24 O ATOM 7052 CB ASP B 71 66.663 36.324 25.811 1.00 21.66 C ATOM 7053 CG ASP B 71 66.819 35.715 24.431 1.00 23.08 C ATOM 7054 OD1 ASP B 71 67.111 34.497 24.343 1.00 22.04 O ATOM 7055 OD2 ASP B 71 66.646 36.446 23.431 1.00 24.93 O ATOM 7056 HA ASP B 71 68.644 35.813 26.466 1.00 0.00 H ATOM 7057 HB2 ASP B 71 66.167 35.602 26.461 1.00 0.00 H ATOM 7058 HB3 ASP B 71 66.050 37.222 25.733 1.00 0.00 H ATOM 7059 H ASP B 71 66.870 37.404 28.132 1.00 0.00 H ATOM 7060 N ALA B 72 69.171 37.504 24.440 1.00 26.04 N ATOM 7061 CA ALA B 72 69.723 38.514 23.532 1.00 25.86 C ATOM 7062 C ALA B 72 68.724 39.579 23.154 1.00 26.67 C ATOM 7063 O ALA B 72 69.107 40.743 22.990 1.00 23.82 O ATOM 7064 CB ALA B 72 70.276 37.838 22.244 1.00 26.50 C ATOM 7065 HA ALA B 72 70.530 39.007 24.074 1.00 0.00 H ATOM 7066 HB1 ALA B 72 71.063 37.134 22.514 1.00 0.00 H ATOM 7067 HB2 ALA B 72 69.469 37.307 21.739 1.00 0.00 H ATOM 7068 HB3 ALA B 72 70.682 38.601 21.580 1.00 0.00 H ATOM 7069 H ALA B 72 69.234 36.499 24.179 1.00 0.00 H ATOM 7070 N PHE B 73 67.449 39.215 22.937 1.00 21.02 N ATOM 7071 CA PHE B 73 66.512 40.252 22.494 1.00 18.86 C ATOM 7072 C PHE B 73 66.370 41.357 23.527 1.00 22.42 C ATOM 7073 O PHE B 73 66.151 42.518 23.190 1.00 22.43 O ATOM 7074 CB PHE B 73 65.144 39.695 22.061 1.00 19.68 C ATOM 7075 CG PHE B 73 64.139 39.611 23.178 1.00 19.59 C ATOM 7076 CD1 PHE B 73 64.150 38.522 24.043 1.00 20.42 C ATOM 7077 CD2 PHE B 73 63.128 40.574 23.296 1.00 20.44 C ATOM 7078 CE1 PHE B 73 63.177 38.410 25.062 1.00 21.23 C ATOM 7079 CE2 PHE B 73 62.185 40.479 24.293 1.00 22.53 C ATOM 7080 CZ PHE B 73 62.242 39.403 25.208 1.00 19.33 C ATOM 7081 HA PHE B 73 66.951 40.689 21.597 1.00 0.00 H ATOM 7082 HB2 PHE B 73 64.740 40.343 21.283 1.00 0.00 H ATOM 7083 HB3 PHE B 73 65.293 38.694 21.657 1.00 0.00 H ATOM 7084 HD2 PHE B 73 63.088 41.405 22.592 1.00 0.00 H ATOM 7085 HE2 PHE B 73 61.398 41.229 24.377 1.00 0.00 H ATOM 7086 HZ PHE B 73 61.536 39.362 26.038 1.00 0.00 H ATOM 7087 HE1 PHE B 73 63.170 37.544 25.724 1.00 0.00 H ATOM 7088 HD1 PHE B 73 64.913 37.751 23.935 1.00 0.00 H ATOM 7089 H PHE B 73 67.138 38.233 23.078 1.00 0.00 H ATOM 7090 N ILE B 74 66.451 40.983 24.795 1.00 20.06 N ATOM 7091 CA ILE B 74 66.352 41.975 25.878 1.00 18.84 C ATOM 7092 C ILE B 74 67.607 42.854 25.870 1.00 22.71 C ATOM 7093 O ILE B 74 67.544 44.055 26.077 1.00 24.96 O ATOM 7094 CB ILE B 74 66.146 41.246 27.231 1.00 22.23 C ATOM 7095 CG1 ILE B 74 64.716 40.639 27.262 1.00 23.54 C ATOM 7096 CG2 ILE B 74 66.367 42.201 28.420 1.00 23.13 C ATOM 7097 CD1 ILE B 74 64.528 39.549 28.344 1.00 24.95 C ATOM 7098 HA ILE B 74 65.491 42.627 25.728 1.00 0.00 H ATOM 7099 HB ILE B 74 66.882 40.447 27.324 1.00 0.00 H ATOM 7100 HG12 ILE B 74 64.005 41.442 27.455 1.00 0.00 H ATOM 7101 HG13 ILE B 74 64.508 40.197 26.288 1.00 0.00 H ATOM 7102 HD11 ILE B 74 65.225 38.732 28.159 1.00 0.00 H ATOM 7103 HD12 ILE B 74 64.721 39.978 29.327 1.00 0.00 H ATOM 7104 HD13 ILE B 74 63.506 39.173 28.305 1.00 0.00 H ATOM 7105 HG21 ILE B 74 67.384 42.591 28.387 1.00 0.00 H ATOM 7106 HG22 ILE B 74 65.658 43.026 28.358 1.00 0.00 H ATOM 7107 HG23 ILE B 74 66.215 41.659 29.353 1.00 0.00 H ATOM 7108 H ILE B 74 66.586 39.978 25.028 1.00 0.00 H ATOM 7109 N GLN B 75 68.758 42.230 25.724 1.00 20.86 N ATOM 7110 CA GLN B 75 70.020 42.992 25.685 1.00 21.67 C ATOM 7111 C GLN B 75 69.983 43.997 24.523 1.00 24.51 C ATOM 7112 O GLN B 75 70.312 45.170 24.705 1.00 23.16 O ATOM 7113 CB GLN B 75 71.167 42.021 25.510 1.00 22.56 C ATOM 7114 CG GLN B 75 71.335 41.131 26.721 1.00 20.54 C ATOM 7115 CD GLN B 75 72.516 40.199 26.580 1.00 35.44 C ATOM 7116 OE1 GLN B 75 73.370 40.410 25.738 1.00 32.33 O ATOM 7117 NE2 GLN B 75 72.540 39.135 27.369 1.00 32.72 N ATOM 7118 HA GLN B 75 70.154 43.546 26.614 1.00 0.00 H ATOM 7119 HB2 GLN B 75 70.973 41.398 24.637 1.00 0.00 H ATOM 7120 HB3 GLN B 75 72.087 42.585 25.355 1.00 0.00 H ATOM 7121 HG2 GLN B 75 71.484 41.758 27.600 1.00 0.00 H ATOM 7122 HG3 GLN B 75 70.431 40.536 26.849 1.00 0.00 H ATOM 7123 HE22 GLN B 75 71.790 38.994 28.075 1.00 0.00 H ATOM 7124 HE21 GLN B 75 73.309 38.441 27.282 1.00 0.00 H ATOM 7125 H GLN B 75 68.777 41.194 25.636 1.00 0.00 H ATOM 7126 N TYR B 76 69.517 43.567 23.348 1.00 21.34 N ATOM 7127 CA TYR B 76 69.400 44.499 22.199 1.00 21.25 C ATOM 7128 C TYR B 76 68.427 45.587 22.535 1.00 24.98 C ATOM 7129 O TYR B 76 68.639 46.761 22.199 1.00 24.98 O ATOM 7130 CB TYR B 76 68.837 43.834 20.944 1.00 21.97 C ATOM 7131 CG TYR B 76 69.720 42.842 20.243 1.00 24.26 C ATOM 7132 CD1 TYR B 76 71.011 42.569 20.687 1.00 24.66 C ATOM 7133 CD2 TYR B 76 69.202 42.071 19.203 1.00 24.23 C ATOM 7134 CE1 TYR B 76 71.785 41.589 20.063 1.00 23.83 C ATOM 7135 CE2 TYR B 76 69.978 41.145 18.556 1.00 25.27 C ATOM 7136 CZ TYR B 76 71.260 40.892 18.988 1.00 25.67 C ATOM 7137 OH TYR B 76 71.986 39.917 18.334 1.00 27.31 O ATOM 7138 HA TYR B 76 70.410 44.861 22.009 1.00 0.00 H ATOM 7139 HB3 TYR B 76 68.599 44.624 20.232 1.00 0.00 H ATOM 7140 HB2 TYR B 76 67.921 43.316 21.229 1.00 0.00 H ATOM 7141 HD2 TYR B 76 68.164 42.207 18.900 1.00 0.00 H ATOM 7142 HE2 TYR B 76 69.578 40.607 17.696 1.00 0.00 H ATOM 7143 HE1 TYR B 76 72.793 41.375 20.419 1.00 0.00 H ATOM 7144 HD1 TYR B 76 71.421 43.126 21.530 1.00 0.00 H ATOM 7145 HH TYR B 76 72.883 39.842 18.747 1.00 0.00 H ATOM 7146 H TYR B 76 69.234 42.572 23.237 1.00 0.00 H ATOM 7147 N GLY B 77 67.277 45.209 23.085 1.00 21.44 N ATOM 7148 CA GLY B 77 66.286 46.245 23.356 1.00 20.54 C ATOM 7149 C GLY B 77 66.790 47.276 24.348 1.00 23.17 C ATOM 7150 O GLY B 77 66.497 48.460 24.222 1.00 21.89 O ATOM 7151 HA3 GLY B 77 65.390 45.776 23.762 1.00 0.00 H ATOM 7152 HA2 GLY B 77 66.040 46.748 22.421 1.00 0.00 H ATOM 7153 H GLY B 77 67.091 44.212 23.314 1.00 0.00 H ATOM 7154 N ILE B 78 67.502 46.819 25.376 1.00 21.00 N ATOM 7155 CA ILE B 78 68.026 47.760 26.408 1.00 19.68 C ATOM 7156 C ILE B 78 69.046 48.712 25.779 1.00 23.71 C ATOM 7157 O ILE B 78 68.993 49.919 25.990 1.00 25.84 O ATOM 7158 CB ILE B 78 68.657 47.000 27.626 1.00 21.33 C ATOM 7159 CG1 ILE B 78 67.578 46.332 28.527 1.00 19.10 C ATOM 7160 CG2 ILE B 78 69.541 47.984 28.532 1.00 22.05 C ATOM 7161 CD1 ILE B 78 68.222 45.219 29.414 1.00 20.09 C ATOM 7162 HA ILE B 78 67.185 48.338 26.790 1.00 0.00 H ATOM 7163 HB ILE B 78 69.290 46.222 27.199 1.00 0.00 H ATOM 7164 HG12 ILE B 78 67.128 47.089 29.170 1.00 0.00 H ATOM 7165 HG13 ILE B 78 66.808 45.888 27.896 1.00 0.00 H ATOM 7166 HD11 ILE B 78 68.670 44.459 28.773 1.00 0.00 H ATOM 7167 HD12 ILE B 78 68.991 45.661 30.048 1.00 0.00 H ATOM 7168 HD13 ILE B 78 67.453 44.763 30.037 1.00 0.00 H ATOM 7169 HG21 ILE B 78 70.346 48.405 27.930 1.00 0.00 H ATOM 7170 HG22 ILE B 78 68.912 48.789 28.913 1.00 0.00 H ATOM 7171 HG23 ILE B 78 69.964 47.425 29.367 1.00 0.00 H ATOM 7172 H ILE B 78 67.694 45.800 25.460 1.00 0.00 H ATOM 7173 N VAL B 79 69.972 48.169 24.986 1.00 22.79 N ATOM 7174 CA VAL B 79 71.001 49.001 24.351 1.00 22.68 C ATOM 7175 C VAL B 79 70.352 50.062 23.464 1.00 28.04 C ATOM 7176 O VAL B 79 70.619 51.265 23.599 1.00 27.75 O ATOM 7177 CB VAL B 79 72.081 48.164 23.666 1.00 26.05 C ATOM 7178 CG1 VAL B 79 72.972 49.029 22.766 1.00 26.21 C ATOM 7179 CG2 VAL B 79 72.939 47.395 24.715 1.00 25.53 C ATOM 7180 HA VAL B 79 71.544 49.545 25.124 1.00 0.00 H ATOM 7181 HB VAL B 79 71.578 47.433 23.033 1.00 0.00 H ATOM 7182 HG11 VAL B 79 72.360 49.502 21.998 1.00 0.00 H ATOM 7183 HG12 VAL B 79 73.458 49.797 23.368 1.00 0.00 H ATOM 7184 HG13 VAL B 79 73.729 48.401 22.295 1.00 0.00 H ATOM 7185 HG21 VAL B 79 73.420 48.109 25.383 1.00 0.00 H ATOM 7186 HG22 VAL B 79 72.295 46.732 25.293 1.00 0.00 H ATOM 7187 HG23 VAL B 79 73.699 46.808 24.200 1.00 0.00 H ATOM 7188 H VAL B 79 69.964 47.143 24.816 1.00 0.00 H ATOM 7189 N ALA B 80 69.417 49.653 22.616 1.00 24.19 N ATOM 7190 CA ALA B 80 68.706 50.635 21.780 1.00 22.56 C ATOM 7191 C ALA B 80 67.884 51.641 22.594 1.00 25.10 C ATOM 7192 O ALA B 80 67.735 52.802 22.210 1.00 24.95 O ATOM 7193 CB ALA B 80 67.828 49.917 20.707 1.00 23.52 C ATOM 7194 HA ALA B 80 69.471 51.220 21.269 1.00 0.00 H ATOM 7195 HB1 ALA B 80 68.465 49.306 20.068 1.00 0.00 H ATOM 7196 HB2 ALA B 80 67.095 49.282 21.205 1.00 0.00 H ATOM 7197 HB3 ALA B 80 67.313 50.663 20.102 1.00 0.00 H ATOM 7198 H ALA B 80 69.187 48.641 22.542 1.00 0.00 H ATOM 7199 N GLY B 81 67.335 51.214 23.727 1.00 23.95 N ATOM 7200 CA GLY B 81 66.536 52.105 24.571 1.00 22.97 C ATOM 7201 C GLY B 81 67.422 53.145 25.250 1.00 26.87 C ATOM 7202 O GLY B 81 67.074 54.306 25.388 1.00 24.87 O ATOM 7203 HA3 GLY B 81 66.028 51.515 25.334 1.00 0.00 H ATOM 7204 HA2 GLY B 81 65.796 52.614 23.954 1.00 0.00 H ATOM 7205 H GLY B 81 67.476 50.226 24.020 1.00 0.00 H ATOM 7206 N VAL B 82 68.580 52.698 25.708 1.00 24.86 N ATOM 7207 CA VAL B 82 69.559 53.615 26.304 1.00 24.69 C ATOM 7208 C VAL B 82 69.967 54.626 25.196 1.00 29.76 C ATOM 7209 O VAL B 82 70.008 55.839 25.430 1.00 29.82 O ATOM 7210 CB VAL B 82 70.789 52.811 26.777 1.00 27.93 C ATOM 7211 CG1 VAL B 82 71.987 53.781 27.080 1.00 29.29 C ATOM 7212 CG2 VAL B 82 70.419 51.952 28.006 1.00 26.30 C ATOM 7213 HA VAL B 82 69.144 54.139 27.164 1.00 0.00 H ATOM 7214 HB VAL B 82 71.107 52.134 25.984 1.00 0.00 H ATOM 7215 HG11 VAL B 82 72.246 54.331 26.175 1.00 0.00 H ATOM 7216 HG12 VAL B 82 71.696 54.482 27.862 1.00 0.00 H ATOM 7217 HG13 VAL B 82 72.848 53.201 27.413 1.00 0.00 H ATOM 7218 HG21 VAL B 82 70.083 52.602 28.814 1.00 0.00 H ATOM 7219 HG22 VAL B 82 69.620 51.261 27.737 1.00 0.00 H ATOM 7220 HG23 VAL B 82 71.294 51.389 28.331 1.00 0.00 H ATOM 7221 H VAL B 82 68.800 51.683 25.645 1.00 0.00 H ATOM 7222 N GLN B 83 70.252 54.129 23.985 1.00 26.79 N ATOM 7223 CA GLN B 83 70.653 55.010 22.889 1.00 25.38 C ATOM 7224 C GLN B 83 69.601 56.084 22.740 1.00 29.87 C ATOM 7225 O GLN B 83 69.919 57.262 22.663 1.00 29.74 O ATOM 7226 CB GLN B 83 70.775 54.267 21.552 1.00 26.69 C ATOM 7227 CG GLN B 83 72.025 53.430 21.316 1.00 20.79 C ATOM 7228 CD GLN B 83 71.987 52.803 19.932 1.00 24.05 C ATOM 7229 OE1 GLN B 83 71.243 53.250 19.072 1.00 24.05 O ATOM 7230 NE2 GLN B 83 72.885 51.868 19.674 1.00 23.82 N ATOM 7231 HA GLN B 83 71.632 55.423 23.131 1.00 0.00 H ATOM 7232 HB2 GLN B 83 69.917 53.600 21.471 1.00 0.00 H ATOM 7233 HB3 GLN B 83 70.729 55.014 20.759 1.00 0.00 H ATOM 7234 HG2 GLN B 83 72.906 54.067 21.398 1.00 0.00 H ATOM 7235 HG3 GLN B 83 72.077 52.642 22.067 1.00 0.00 H ATOM 7236 HE22 GLN B 83 73.500 51.514 20.434 1.00 0.00 H ATOM 7237 HE21 GLN B 83 72.977 51.487 18.711 1.00 0.00 H ATOM 7238 H GLN B 83 70.187 53.104 23.822 1.00 0.00 H ATOM 7239 N ALA B 84 68.329 55.694 22.728 1.00 25.71 N ATOM 7240 CA ALA B 84 67.247 56.673 22.582 1.00 25.00 C ATOM 7241 C ALA B 84 67.120 57.663 23.738 1.00 27.98 C ATOM 7242 O ALA B 84 66.848 58.849 23.521 1.00 27.39 O ATOM 7243 CB ALA B 84 65.888 55.968 22.340 1.00 26.57 C ATOM 7244 HA ALA B 84 67.524 57.264 21.709 1.00 0.00 H ATOM 7245 HB1 ALA B 84 65.946 55.372 21.429 1.00 0.00 H ATOM 7246 HB2 ALA B 84 65.661 55.319 23.186 1.00 0.00 H ATOM 7247 HB3 ALA B 84 65.104 56.718 22.236 1.00 0.00 H ATOM 7248 H ALA B 84 68.100 54.684 22.823 1.00 0.00 H ATOM 7249 N MET B 85 67.229 57.172 24.963 1.00 24.71 N ATOM 7250 CA MET B 85 67.055 58.037 26.129 1.00 24.70 C ATOM 7251 C MET B 85 68.208 59.062 26.142 1.00 30.97 C ATOM 7252 O MET B 85 68.008 60.247 26.430 1.00 31.58 O ATOM 7253 CB MET B 85 67.085 57.224 27.421 1.00 27.19 C ATOM 7254 CG MET B 85 65.877 56.299 27.619 1.00 31.92 C ATOM 7255 SD MET B 85 64.358 57.219 27.835 1.00 36.77 S ATOM 7256 CE MET B 85 64.819 58.257 29.197 1.00 33.29 C ATOM 7257 HA MET B 85 66.089 58.538 26.067 1.00 0.00 H ATOM 7258 HB2 MET B 85 67.986 56.611 27.417 1.00 0.00 H ATOM 7259 HB3 MET B 85 67.123 57.919 28.260 1.00 0.00 H ATOM 7260 HG2 MET B 85 66.045 55.684 28.503 1.00 0.00 H ATOM 7261 HG3 MET B 85 65.778 55.656 26.744 1.00 0.00 H ATOM 7262 HE1 MET B 85 65.087 57.635 30.052 1.00 0.00 H ATOM 7263 HE2 MET B 85 65.673 58.871 28.911 1.00 0.00 H ATOM 7264 HE3 MET B 85 63.980 58.900 29.462 1.00 0.00 H ATOM 7265 H MET B 85 67.440 56.163 25.097 1.00 0.00 H ATOM 7266 N GLN B 86 69.402 58.596 25.806 1.00 28.87 N ATOM 7267 CA GLN B 86 70.583 59.472 25.764 1.00 29.52 C ATOM 7268 C GLN B 86 70.436 60.499 24.676 1.00 33.04 C ATOM 7269 O GLN B 86 70.681 61.664 24.892 1.00 35.34 O ATOM 7270 CB GLN B 86 71.883 58.687 25.625 1.00 29.92 C ATOM 7271 CG GLN B 86 72.293 58.091 26.940 1.00 42.76 C ATOM 7272 CD GLN B 86 73.527 57.225 26.864 1.00 54.49 C ATOM 7273 OE1 GLN B 86 74.099 57.014 25.795 1.00 52.95 O ATOM 7274 NE2 GLN B 86 73.949 56.716 28.014 1.00 46.08 N ATOM 7275 HA GLN B 86 70.642 59.992 26.720 1.00 0.00 H ATOM 7276 HB2 GLN B 86 71.741 57.886 24.899 1.00 0.00 H ATOM 7277 HB3 GLN B 86 72.669 59.357 25.276 1.00 0.00 H ATOM 7278 HG2 GLN B 86 72.487 58.904 27.639 1.00 0.00 H ATOM 7279 HG3 GLN B 86 71.469 57.482 27.312 1.00 0.00 H ATOM 7280 HE22 GLN B 86 73.434 56.921 28.894 1.00 0.00 H ATOM 7281 HE21 GLN B 86 74.795 56.112 28.036 1.00 0.00 H ATOM 7282 H GLN B 86 69.506 57.589 25.567 1.00 0.00 H ATOM 7283 N ASP B 87 69.921 60.080 23.537 1.00 29.92 N ATOM 7284 CA ASP B 87 69.705 60.985 22.421 1.00 28.09 C ATOM 7285 C ASP B 87 68.677 62.061 22.766 1.00 34.68 C ATOM 7286 O ASP B 87 68.760 63.213 22.267 1.00 34.08 O ATOM 7287 CB ASP B 87 69.252 60.181 21.212 1.00 29.44 C ATOM 7288 CG ASP B 87 69.065 61.034 19.968 1.00 30.09 C ATOM 7289 OD1 ASP B 87 70.013 61.738 19.563 1.00 31.67 O ATOM 7290 OD2 ASP B 87 68.043 60.870 19.294 1.00 30.29 O ATOM 7291 HA ASP B 87 70.642 61.494 22.194 1.00 0.00 H ATOM 7292 HB2 ASP B 87 70.001 59.418 21.001 1.00 0.00 H ATOM 7293 HB3 ASP B 87 68.303 59.700 21.450 1.00 0.00 H ATOM 7294 H ASP B 87 69.663 59.078 23.435 1.00 0.00 H ATOM 7295 N SER B 88 67.680 61.697 23.579 1.00 28.96 N ATOM 7296 CA SER B 88 66.627 62.653 23.907 1.00 28.66 C ATOM 7297 C SER B 88 67.150 63.781 24.801 1.00 33.07 C ATOM 7298 O SER B 88 66.587 64.874 24.793 1.00 32.86 O ATOM 7299 CB SER B 88 65.428 61.976 24.599 1.00 29.03 C ATOM 7300 OG SER B 88 65.698 61.751 25.982 1.00 30.58 O ATOM 7301 HA SER B 88 66.293 63.073 22.958 1.00 0.00 H ATOM 7302 HB2 SER B 88 65.229 61.020 24.114 1.00 0.00 H ATOM 7303 HB3 SER B 88 64.553 62.619 24.506 1.00 0.00 H ATOM 7304 HG SER B 88 66.490 61.164 26.071 1.00 0.00 H ATOM 7305 H SER B 88 67.655 60.736 23.976 1.00 0.00 H ATOM 7306 N GLY B 89 68.162 63.490 25.615 1.00 31.43 N ATOM 7307 CA GLY B 89 68.707 64.477 26.542 1.00 33.48 C ATOM 7308 C GLY B 89 67.803 64.722 27.744 1.00 39.37 C ATOM 7309 O GLY B 89 68.056 65.619 28.564 1.00 37.88 O ATOM 7310 HA3 GLY B 89 68.841 65.418 26.009 1.00 0.00 H ATOM 7311 HA2 GLY B 89 69.674 64.122 26.900 1.00 0.00 H ATOM 7312 H GLY B 89 68.575 62.536 25.590 1.00 0.00 H ATOM 7313 N LEU B 90 66.750 63.910 27.872 1.00 35.49 N ATOM 7314 CA LEU B 90 65.813 64.062 28.982 1.00 35.68 C ATOM 7315 C LEU B 90 66.441 63.741 30.323 1.00 38.82 C ATOM 7316 O LEU B 90 67.217 62.792 30.458 1.00 36.20 O ATOM 7317 CB LEU B 90 64.568 63.199 28.765 1.00 36.66 C ATOM 7318 CG LEU B 90 63.474 63.244 29.840 1.00 41.15 C ATOM 7319 CD1 LEU B 90 62.632 64.502 29.683 1.00 40.63 C ATOM 7320 CD2 LEU B 90 62.601 62.008 29.677 1.00 42.79 C ATOM 7321 HA LEU B 90 65.523 65.113 29.002 1.00 0.00 H ATOM 7322 HB2 LEU B 90 64.114 63.512 27.825 1.00 0.00 H ATOM 7323 HB3 LEU B 90 64.899 62.164 28.680 1.00 0.00 H ATOM 7324 HG LEU B 90 63.925 63.260 30.832 1.00 0.00 H ATOM 7325 HD21 LEU B 90 62.153 62.010 28.683 1.00 0.00 H ATOM 7326 HD22 LEU B 90 63.213 61.114 29.799 1.00 0.00 H ATOM 7327 HD23 LEU B 90 61.815 62.018 30.432 1.00 0.00 H ATOM 7328 HD11 LEU B 90 63.270 65.380 29.786 1.00 0.00 H ATOM 7329 HD12 LEU B 90 62.165 64.504 28.698 1.00 0.00 H ATOM 7330 HD13 LEU B 90 61.860 64.520 30.453 1.00 0.00 H ATOM 7331 H LEU B 90 66.595 63.158 27.170 1.00 0.00 H ATOM 7332 N GLU B 91 66.141 64.570 31.317 1.00 38.06 N ATOM 7333 CA GLU B 91 66.658 64.340 32.661 1.00 38.39 C ATOM 7334 C GLU B 91 65.494 63.910 33.527 1.00 41.06 C ATOM 7335 O GLU B 91 64.510 64.648 33.675 1.00 42.59 O ATOM 7336 CB GLU B 91 67.309 65.608 33.230 1.00 40.40 C ATOM 7337 CG GLU B 91 68.807 65.713 32.962 1.00 60.83 C ATOM 7338 CD GLU B 91 69.251 67.137 32.684 1.00104.57 C ATOM 7339 OE1 GLU B 91 68.751 68.060 33.364 1.00108.74 O ATOM 7340 OE2 GLU B 91 70.094 67.336 31.781 1.00110.95 O ATOM 7341 HA GLU B 91 67.428 63.569 32.637 1.00 0.00 H ATOM 7342 HB2 GLU B 91 66.820 66.474 32.784 1.00 0.00 H ATOM 7343 HB3 GLU B 91 67.152 65.619 34.309 1.00 0.00 H ATOM 7344 HG2 GLU B 91 69.345 65.343 33.835 1.00 0.00 H ATOM 7345 HG3 GLU B 91 69.052 65.096 32.098 1.00 0.00 H ATOM 7346 H GLU B 91 65.531 65.392 31.135 1.00 0.00 H ATOM 7347 N ILE B 92 65.599 62.711 34.090 1.00 35.79 N ATOM 7348 CA ILE B 92 64.532 62.161 34.924 1.00 35.28 C ATOM 7349 C ILE B 92 64.703 62.723 36.324 1.00 39.82 C ATOM 7350 O ILE B 92 65.814 62.742 36.833 1.00 40.76 O ATOM 7351 CB ILE B 92 64.647 60.618 35.018 1.00 37.83 C ATOM 7352 CG1 ILE B 92 64.744 59.961 33.623 1.00 38.89 C ATOM 7353 CG2 ILE B 92 63.533 60.055 35.884 1.00 36.37 C ATOM 7354 CD1 ILE B 92 63.694 60.451 32.638 1.00 41.47 C ATOM 7355 HA ILE B 92 63.567 62.423 34.490 1.00 0.00 H ATOM 7356 HB ILE B 92 65.585 60.367 35.514 1.00 0.00 H ATOM 7357 HG12 ILE B 92 65.730 60.176 33.210 1.00 0.00 H ATOM 7358 HG13 ILE B 92 64.628 58.884 33.742 1.00 0.00 H ATOM 7359 HD11 ILE B 92 62.700 60.233 33.030 1.00 0.00 H ATOM 7360 HD12 ILE B 92 63.803 61.526 32.498 1.00 0.00 H ATOM 7361 HD13 ILE B 92 63.829 59.943 31.683 1.00 0.00 H ATOM 7362 HG21 ILE B 92 63.604 60.478 36.886 1.00 0.00 H ATOM 7363 HG22 ILE B 92 62.569 60.313 35.447 1.00 0.00 H ATOM 7364 HG23 ILE B 92 63.630 58.971 35.939 1.00 0.00 H ATOM 7365 H ILE B 92 66.461 62.150 33.934 1.00 0.00 H ATOM 7366 N THR B 93 63.606 63.092 36.973 1.00 35.79 N ATOM 7367 CA THR B 93 63.658 63.588 38.351 1.00 36.07 C ATOM 7368 C THR B 93 62.548 62.965 39.163 1.00 41.22 C ATOM 7369 O THR B 93 61.619 62.383 38.614 1.00 37.96 O ATOM 7370 CB THR B 93 63.459 65.097 38.426 1.00 36.56 C ATOM 7371 OG1 THR B 93 62.103 65.406 38.096 1.00 39.69 O ATOM 7372 CG2 THR B 93 64.414 65.841 37.504 1.00 34.03 C ATOM 7373 HA THR B 93 64.643 63.327 38.737 1.00 0.00 H ATOM 7374 HB THR B 93 63.678 65.424 39.443 1.00 0.00 H ATOM 7375 HG1 THR B 93 61.968 66.386 38.143 1.00 0.00 H ATOM 7376 HG23 THR B 93 65.441 65.593 37.771 1.00 0.00 H ATOM 7377 HG21 THR B 93 64.224 65.547 36.472 1.00 0.00 H ATOM 7378 HG22 THR B 93 64.258 66.914 37.611 1.00 0.00 H ATOM 7379 H THR B 93 62.686 63.028 36.492 1.00 0.00 H ATOM 7380 N GLU B 94 62.571 63.231 40.464 1.00 39.36 N ATOM 7381 CA GLU B 94 61.543 62.727 41.350 1.00 39.31 C ATOM 7382 C GLU B 94 60.198 63.256 40.890 1.00 41.73 C ATOM 7383 O GLU B 94 59.181 62.569 40.994 1.00 41.70 O ATOM 7384 CB GLU B 94 61.814 63.162 42.795 1.00 41.11 C ATOM 7385 CG GLU B 94 60.723 62.741 43.754 1.00 60.13 C ATOM 7386 CD GLU B 94 61.145 61.572 44.614 1.00106.62 C ATOM 7387 OE1 GLU B 94 62.349 61.499 44.953 1.00115.95 O ATOM 7388 OE2 GLU B 94 60.281 60.722 44.935 1.00108.14 O ATOM 7389 HA GLU B 94 61.543 61.637 41.320 1.00 0.00 H ATOM 7390 HB2 GLU B 94 62.754 62.717 43.121 1.00 0.00 H ATOM 7391 HB3 GLU B 94 61.899 64.248 42.821 1.00 0.00 H ATOM 7392 HG2 GLU B 94 60.478 63.584 44.401 1.00 0.00 H ATOM 7393 HG3 GLU B 94 59.841 62.456 43.181 1.00 0.00 H ATOM 7394 H GLU B 94 63.341 63.812 40.853 1.00 0.00 H ATOM 7395 N GLU B 95 60.209 64.462 40.345 1.00 38.73 N ATOM 7396 CA GLU B 95 58.996 65.131 39.881 1.00 40.34 C ATOM 7397 C GLU B 95 58.484 64.550 38.584 1.00 43.10 C ATOM 7398 O GLU B 95 57.283 64.547 38.324 1.00 44.95 O ATOM 7399 CB GLU B 95 59.312 66.605 39.617 1.00 43.05 C ATOM 7400 CG GLU B 95 58.192 67.556 39.947 1.00 62.06 C ATOM 7401 CD GLU B 95 58.616 68.586 40.981 1.00109.13 C ATOM 7402 OE1 GLU B 95 58.239 69.771 40.835 1.00117.06 O ATOM 7403 OE2 GLU B 95 59.351 68.209 41.924 1.00113.38 O ATOM 7404 HA GLU B 95 58.239 65.000 40.655 1.00 0.00 H ATOM 7405 HB2 GLU B 95 60.179 66.880 40.217 1.00 0.00 H ATOM 7406 HB3 GLU B 95 59.553 66.717 38.560 1.00 0.00 H ATOM 7407 HG2 GLU B 95 57.887 68.073 39.037 1.00 0.00 H ATOM 7408 HG3 GLU B 95 57.349 66.987 40.340 1.00 0.00 H ATOM 7409 H GLU B 95 61.119 64.954 40.243 1.00 0.00 H ATOM 7410 N ASN B 96 59.430 64.111 37.760 1.00 37.41 N ATOM 7411 CA ASN B 96 59.188 63.578 36.418 1.00 36.95 C ATOM 7412 C ASN B 96 58.828 62.114 36.337 1.00 35.79 C ATOM 7413 O ASN B 96 58.211 61.704 35.366 1.00 35.20 O ATOM 7414 CB ASN B 96 60.548 63.598 35.664 1.00 36.01 C ATOM 7415 CG ASN B 96 60.538 64.543 34.571 1.00 54.91 C ATOM 7416 OD1 ASN B 96 59.494 65.109 34.263 1.00 70.80 O ATOM 7417 ND2 ASN B 96 61.695 64.823 34.026 1.00 40.41 N ATOM 7418 HA ASN B 96 58.369 64.184 36.031 1.00 0.00 H ATOM 7419 HB2 ASN B 96 61.336 63.875 36.364 1.00 0.00 H ATOM 7420 HB3 ASN B 96 60.748 62.602 35.269 1.00 0.00 H ATOM 7421 HD22 ASN B 96 62.549 64.311 34.326 1.00 0.00 H ATOM 7422 HD21 ASN B 96 61.760 65.558 33.293 1.00 0.00 H ATOM 7423 H ASN B 96 60.415 64.149 38.093 1.00 0.00 H ATOM 7424 N ALA B 97 59.556 61.331 37.131 1.00 31.11 N ATOM 7425 CA ALA B 97 59.579 59.886 37.059 1.00 31.92 C ATOM 7426 C ALA B 97 58.214 59.253 36.826 1.00 34.73 C ATOM 7427 O ALA B 97 58.068 58.215 36.182 1.00 32.76 O ATOM 7428 CB ALA B 97 60.215 59.318 38.318 1.00 32.68 C ATOM 7429 HA ALA B 97 60.176 59.633 36.183 1.00 0.00 H ATOM 7430 HB1 ALA B 97 61.235 59.691 38.408 1.00 0.00 H ATOM 7431 HB2 ALA B 97 59.635 59.627 39.188 1.00 0.00 H ATOM 7432 HB3 ALA B 97 60.229 58.230 38.257 1.00 0.00 H ATOM 7433 H ALA B 97 60.149 61.790 37.852 1.00 0.00 H ATOM 7434 N THR B 98 57.233 59.875 37.440 1.00 31.95 N ATOM 7435 CA THR B 98 55.881 59.387 37.471 1.00 32.35 C ATOM 7436 C THR B 98 55.167 59.600 36.129 1.00 34.92 C ATOM 7437 O THR B 98 54.143 58.969 35.829 1.00 32.83 O ATOM 7438 CB THR B 98 55.230 60.152 38.606 1.00 37.35 C ATOM 7439 OG1 THR B 98 54.914 59.273 39.682 1.00 41.44 O ATOM 7440 CG2 THR B 98 54.107 60.985 38.152 1.00 32.03 C ATOM 7441 HA THR B 98 55.831 58.310 37.632 1.00 0.00 H ATOM 7442 HB THR B 98 55.950 60.871 38.998 1.00 0.00 H ATOM 7443 HG1 THR B 98 54.490 59.788 40.414 1.00 0.00 H ATOM 7444 HG23 THR B 98 54.437 61.622 37.332 1.00 0.00 H ATOM 7445 HG21 THR B 98 53.295 60.343 37.811 1.00 0.00 H ATOM 7446 HG22 THR B 98 53.759 61.605 38.978 1.00 0.00 H ATOM 7447 H THR B 98 57.446 60.768 37.929 1.00 0.00 H ATOM 7448 N ARG B 99 55.714 60.502 35.323 1.00 31.33 N ATOM 7449 CA ARG B 99 55.094 60.873 34.041 1.00 31.01 C ATOM 7450 C ARG B 99 55.840 60.323 32.797 1.00 29.52 C ATOM 7451 O ARG B 99 55.557 60.702 31.668 1.00 25.89 O ATOM 7452 CB ARG B 99 54.911 62.418 33.968 1.00 31.19 C ATOM 7453 CG ARG B 99 53.555 62.934 34.652 1.00 32.84 C ATOM 7454 CD ARG B 99 52.626 63.569 33.603 1.00 33.02 C ATOM 7455 NE ARG B 99 51.365 62.863 33.392 1.00 49.85 N ATOM 7456 CZ ARG B 99 50.178 63.387 33.645 1.00 88.74 C ATOM 7457 NH1 ARG B 99 50.084 64.633 34.099 1.00 94.50 N ATOM 7458 NH2 ARG B 99 49.088 62.661 33.477 1.00 83.78 N ATOM 7459 HA ARG B 99 54.116 60.393 34.013 1.00 0.00 H ATOM 7460 HB2 ARG B 99 55.754 62.890 34.473 1.00 0.00 H ATOM 7461 HB3 ARG B 99 54.904 62.716 32.920 1.00 0.00 H ATOM 7462 HG2 ARG B 99 53.045 62.091 35.118 1.00 0.00 H ATOM 7463 HG3 ARG B 99 53.797 63.676 35.412 1.00 0.00 H ATOM 7464 HD2 ARG B 99 53.159 63.602 32.653 1.00 0.00 H ATOM 7465 HD3 ARG B 99 52.396 64.585 33.924 1.00 0.00 H ATOM 7466 HE ARG B 99 51.403 61.892 33.021 1.00 0.00 H ATOM 7467 HH12 ARG B 99 49.150 65.045 34.298 1.00 0.00 H ATOM 7468 HH11 ARG B 99 50.944 65.196 34.255 1.00 0.00 H ATOM 7469 HH22 ARG B 99 48.154 63.072 33.676 1.00 0.00 H ATOM 7470 HH21 ARG B 99 49.164 61.678 33.146 1.00 0.00 H ATOM 7471 H ARG B 99 56.605 60.959 35.605 1.00 0.00 H ATOM 7472 N ILE B 100 56.792 59.431 33.025 1.00 27.20 N ATOM 7473 CA ILE B 100 57.581 58.843 31.951 1.00 25.22 C ATOM 7474 C ILE B 100 57.441 57.334 32.030 1.00 28.43 C ATOM 7475 O ILE B 100 57.652 56.766 33.092 1.00 27.77 O ATOM 7476 CB ILE B 100 59.055 59.242 32.099 1.00 28.58 C ATOM 7477 CG1 ILE B 100 59.180 60.786 32.139 1.00 29.42 C ATOM 7478 CG2 ILE B 100 59.864 58.673 30.933 1.00 26.71 C ATOM 7479 CD1 ILE B 100 60.553 61.301 32.705 1.00 35.74 C ATOM 7480 HA ILE B 100 57.225 59.203 30.986 1.00 0.00 H ATOM 7481 HB ILE B 100 59.447 58.835 33.031 1.00 0.00 H ATOM 7482 HG12 ILE B 100 59.063 61.166 31.124 1.00 0.00 H ATOM 7483 HG13 ILE B 100 58.381 61.179 32.767 1.00 0.00 H ATOM 7484 HD11 ILE B 100 60.682 60.940 33.725 1.00 0.00 H ATOM 7485 HD12 ILE B 100 61.365 60.928 32.081 1.00 0.00 H ATOM 7486 HD13 ILE B 100 60.561 62.391 32.700 1.00 0.00 H ATOM 7487 HG21 ILE B 100 59.782 57.586 30.932 1.00 0.00 H ATOM 7488 HG22 ILE B 100 59.475 59.069 29.995 1.00 0.00 H ATOM 7489 HG23 ILE B 100 60.910 58.960 31.044 1.00 0.00 H ATOM 7490 H ILE B 100 56.983 59.140 34.005 1.00 0.00 H ATOM 7491 N GLY B 101 57.089 56.689 30.910 1.00 25.10 N ATOM 7492 CA GLY B 101 56.902 55.245 30.866 1.00 24.17 C ATOM 7493 C GLY B 101 57.513 54.599 29.630 1.00 29.07 C ATOM 7494 O GLY B 101 58.422 55.159 29.007 1.00 27.79 O ATOM 7495 HA3 GLY B 101 55.833 55.033 30.875 1.00 0.00 H ATOM 7496 HA2 GLY B 101 57.365 54.808 31.751 1.00 0.00 H ATOM 7497 H GLY B 101 56.944 57.239 30.040 1.00 0.00 H ATOM 7498 N ALA B 102 57.038 53.398 29.298 1.00 24.45 N ATOM 7499 CA ALA B 102 57.569 52.613 28.185 1.00 23.08 C ATOM 7500 C ALA B 102 56.477 51.741 27.579 1.00 26.59 C ATOM 7501 O ALA B 102 55.588 51.271 28.302 1.00 25.19 O ATOM 7502 CB ALA B 102 58.692 51.706 28.692 1.00 23.16 C ATOM 7503 HA ALA B 102 57.947 53.299 27.427 1.00 0.00 H ATOM 7504 HB1 ALA B 102 59.487 52.318 29.118 1.00 0.00 H ATOM 7505 HB2 ALA B 102 58.299 51.035 29.456 1.00 0.00 H ATOM 7506 HB3 ALA B 102 59.088 51.121 27.862 1.00 0.00 H ATOM 7507 H ALA B 102 56.255 53.002 29.856 1.00 0.00 H ATOM 7508 N ALA B 103 56.540 51.534 26.255 1.00 22.06 N ATOM 7509 CA ALA B 103 55.631 50.612 25.542 1.00 19.25 C ATOM 7510 C ALA B 103 56.566 49.890 24.591 1.00 21.96 C ATOM 7511 O ALA B 103 56.920 50.408 23.526 1.00 21.86 O ATOM 7512 CB ALA B 103 54.524 51.382 24.751 1.00 19.60 C ATOM 7513 HA ALA B 103 55.089 49.949 26.216 1.00 0.00 H ATOM 7514 HB1 ALA B 103 53.932 51.978 25.445 1.00 0.00 H ATOM 7515 HB2 ALA B 103 54.993 52.037 24.016 1.00 0.00 H ATOM 7516 HB3 ALA B 103 53.878 50.666 24.242 1.00 0.00 H ATOM 7517 H ALA B 103 57.260 52.045 25.706 1.00 0.00 H ATOM 7518 N ILE B 104 57.095 48.767 25.047 1.00 18.71 N ATOM 7519 CA ILE B 104 58.053 48.016 24.273 1.00 18.17 C ATOM 7520 C ILE B 104 57.677 46.556 24.225 1.00 21.38 C ATOM 7521 O ILE B 104 57.496 45.943 25.254 1.00 22.66 O ATOM 7522 CB ILE B 104 59.475 48.168 24.858 1.00 21.35 C ATOM 7523 CG1 ILE B 104 59.828 49.643 25.098 1.00 21.13 C ATOM 7524 CG2 ILE B 104 60.501 47.410 23.994 1.00 21.95 C ATOM 7525 CD1 ILE B 104 61.183 49.838 25.772 1.00 22.61 C ATOM 7526 HA ILE B 104 58.045 48.416 23.259 1.00 0.00 H ATOM 7527 HB ILE B 104 59.506 47.702 25.843 1.00 0.00 H ATOM 7528 HG12 ILE B 104 59.843 50.156 24.137 1.00 0.00 H ATOM 7529 HG13 ILE B 104 59.059 50.084 25.732 1.00 0.00 H ATOM 7530 HD11 ILE B 104 61.181 49.339 26.741 1.00 0.00 H ATOM 7531 HD12 ILE B 104 61.965 49.411 25.144 1.00 0.00 H ATOM 7532 HD13 ILE B 104 61.368 50.903 25.911 1.00 0.00 H ATOM 7533 HG21 ILE B 104 60.241 46.352 23.968 1.00 0.00 H ATOM 7534 HG22 ILE B 104 60.490 47.814 22.981 1.00 0.00 H ATOM 7535 HG23 ILE B 104 61.495 47.530 24.424 1.00 0.00 H ATOM 7536 H ILE B 104 56.814 48.417 25.985 1.00 0.00 H ATOM 7537 N GLY B 105 57.737 45.962 23.042 1.00 19.22 N ATOM 7538 CA GLY B 105 57.422 44.559 22.883 1.00 18.16 C ATOM 7539 C GLY B 105 58.359 43.819 21.967 1.00 22.59 C ATOM 7540 O GLY B 105 59.442 44.300 21.579 1.00 20.04 O ATOM 7541 HA3 GLY B 105 56.413 44.478 22.479 1.00 0.00 H ATOM 7542 HA2 GLY B 105 57.458 44.086 23.865 1.00 0.00 H ATOM 7543 H GLY B 105 58.017 46.517 22.208 1.00 0.00 H ATOM 7544 N SER B 106 57.924 42.623 21.626 1.00 18.83 N ATOM 7545 CA SER B 106 58.675 41.697 20.790 1.00 20.04 C ATOM 7546 C SER B 106 57.623 40.711 20.240 1.00 25.85 C ATOM 7547 O SER B 106 56.586 40.486 20.884 1.00 23.67 O ATOM 7548 CB SER B 106 59.654 40.937 21.702 1.00 18.53 C ATOM 7549 OG SER B 106 60.364 39.949 20.995 1.00 25.43 O ATOM 7550 HA SER B 106 59.229 42.188 19.990 1.00 0.00 H ATOM 7551 HB2 SER B 106 59.092 40.461 22.506 1.00 0.00 H ATOM 7552 HB3 SER B 106 60.364 41.646 22.127 1.00 0.00 H ATOM 7553 HG SER B 106 60.882 40.374 20.267 1.00 0.00 H ATOM 7554 H SER B 106 56.991 42.323 21.974 1.00 0.00 H ATOM 7555 N GLY B 107 57.878 40.136 19.066 1.00 21.99 N ATOM 7556 CA GLY B 107 56.947 39.190 18.455 1.00 19.93 C ATOM 7557 C GLY B 107 57.034 37.829 19.099 1.00 26.21 C ATOM 7558 O GLY B 107 56.006 37.216 19.431 1.00 26.12 O ATOM 7559 HA3 GLY B 107 57.183 39.096 17.395 1.00 0.00 H ATOM 7560 HA2 GLY B 107 55.932 39.570 18.567 1.00 0.00 H ATOM 7561 H GLY B 107 58.763 40.366 18.571 1.00 0.00 H ATOM 7562 N ILE B 108 58.263 37.371 19.320 1.00 24.08 N ATOM 7563 CA ILE B 108 58.520 36.033 19.828 1.00 25.37 C ATOM 7564 C ILE B 108 59.317 35.981 21.115 1.00 28.73 C ATOM 7565 O ILE B 108 59.330 34.958 21.805 1.00 29.20 O ATOM 7566 CB ILE B 108 59.141 35.143 18.727 1.00 30.57 C ATOM 7567 CG1 ILE B 108 58.488 35.478 17.375 1.00 33.28 C ATOM 7568 CG2 ILE B 108 58.912 33.648 19.059 1.00 32.89 C ATOM 7569 CD1 ILE B 108 58.824 34.506 16.228 1.00 44.13 C ATOM 7570 HA ILE B 108 57.545 35.630 20.103 1.00 0.00 H ATOM 7571 HB ILE B 108 60.213 35.332 18.674 1.00 0.00 H ATOM 7572 HG12 ILE B 108 57.407 35.477 17.513 1.00 0.00 H ATOM 7573 HG13 ILE B 108 58.815 36.475 17.080 1.00 0.00 H ATOM 7574 HD11 ILE B 108 59.901 34.501 16.061 1.00 0.00 H ATOM 7575 HD12 ILE B 108 58.492 33.503 16.495 1.00 0.00 H ATOM 7576 HD13 ILE B 108 58.316 34.829 15.319 1.00 0.00 H ATOM 7577 HG21 ILE B 108 59.380 33.414 20.015 1.00 0.00 H ATOM 7578 HG22 ILE B 108 57.842 33.450 19.118 1.00 0.00 H ATOM 7579 HG23 ILE B 108 59.354 33.031 18.276 1.00 0.00 H ATOM 7580 H ILE B 108 59.072 37.994 19.122 1.00 0.00 H ATOM 7581 N GLY B 109 60.030 37.051 21.443 1.00 24.43 N ATOM 7582 CA GLY B 109 60.783 37.018 22.690 1.00 23.26 C ATOM 7583 C GLY B 109 61.969 36.093 22.745 1.00 24.53 C ATOM 7584 O GLY B 109 62.625 35.842 21.745 1.00 23.85 O ATOM 7585 HA3 GLY B 109 60.096 36.720 23.482 1.00 0.00 H ATOM 7586 HA2 GLY B 109 61.144 38.028 22.884 1.00 0.00 H ATOM 7587 H GLY B 109 60.051 37.889 20.828 1.00 0.00 H ATOM 7588 N GLY B 110 62.259 35.594 23.941 1.00 21.84 N ATOM 7589 CA GLY B 110 63.490 34.881 24.222 1.00 21.04 C ATOM 7590 C GLY B 110 63.735 33.490 23.709 1.00 26.24 C ATOM 7591 O GLY B 110 64.102 32.631 24.500 1.00 24.70 O ATOM 7592 HA3 GLY B 110 63.571 34.826 25.308 1.00 0.00 H ATOM 7593 HA2 GLY B 110 64.298 35.499 23.830 1.00 0.00 H ATOM 7594 H GLY B 110 61.572 35.720 24.711 1.00 0.00 H ATOM 7595 N LEU B 111 63.701 33.295 22.389 1.00 23.63 N ATOM 7596 CA LEU B 111 63.969 31.965 21.821 1.00 22.72 C ATOM 7597 C LEU B 111 65.254 31.321 22.280 1.00 26.66 C ATOM 7598 O LEU B 111 65.275 30.134 22.604 1.00 25.53 O ATOM 7599 CB LEU B 111 63.913 31.965 20.274 1.00 22.99 C ATOM 7600 CG LEU B 111 62.487 32.045 19.702 1.00 27.13 C ATOM 7601 CD1 LEU B 111 62.451 32.219 18.179 1.00 27.32 C ATOM 7602 CD2 LEU B 111 61.614 30.826 20.180 1.00 26.38 C ATOM 7603 HA LEU B 111 63.158 31.354 22.217 1.00 0.00 H ATOM 7604 HB2 LEU B 111 64.478 32.823 19.910 1.00 0.00 H ATOM 7605 HB3 LEU B 111 64.377 31.047 19.913 1.00 0.00 H ATOM 7606 HG LEU B 111 62.043 32.954 20.107 1.00 0.00 H ATOM 7607 HD21 LEU B 111 62.074 29.897 19.842 1.00 0.00 H ATOM 7608 HD22 LEU B 111 61.554 30.828 21.268 1.00 0.00 H ATOM 7609 HD23 LEU B 111 60.612 30.911 19.759 1.00 0.00 H ATOM 7610 HD11 LEU B 111 62.966 33.141 17.908 1.00 0.00 H ATOM 7611 HD12 LEU B 111 62.947 31.372 17.706 1.00 0.00 H ATOM 7612 HD13 LEU B 111 61.415 32.268 17.845 1.00 0.00 H ATOM 7613 H LEU B 111 63.483 34.091 21.756 1.00 0.00 H ATOM 7614 N GLY B 112 66.344 32.080 22.294 1.00 23.65 N ATOM 7615 CA GLY B 112 67.638 31.478 22.643 1.00 22.22 C ATOM 7616 C GLY B 112 67.663 30.873 24.036 1.00 26.32 C ATOM 7617 O GLY B 112 68.222 29.798 24.262 1.00 24.99 O ATOM 7618 HA3 GLY B 112 68.405 32.250 22.587 1.00 0.00 H ATOM 7619 HA2 GLY B 112 67.861 30.693 21.920 1.00 0.00 H ATOM 7620 H GLY B 112 66.282 33.091 22.060 1.00 0.00 H ATOM 7621 N LEU B 113 67.121 31.598 25.007 1.00 24.20 N ATOM 7622 CA LEU B 113 67.155 31.094 26.376 1.00 23.22 C ATOM 7623 C LEU B 113 66.031 30.099 26.646 1.00 24.44 C ATOM 7624 O LEU B 113 66.106 29.301 27.572 1.00 24.08 O ATOM 7625 CB LEU B 113 67.190 32.238 27.399 1.00 24.02 C ATOM 7626 CG LEU B 113 68.553 32.952 27.483 1.00 28.44 C ATOM 7627 CD1 LEU B 113 68.540 33.921 28.616 1.00 28.46 C ATOM 7628 CD2 LEU B 113 69.717 31.971 27.654 1.00 29.27 C ATOM 7629 HA LEU B 113 68.086 30.540 26.496 1.00 0.00 H ATOM 7630 HB2 LEU B 113 66.433 32.972 27.121 1.00 0.00 H ATOM 7631 HB3 LEU B 113 66.954 31.829 28.381 1.00 0.00 H ATOM 7632 HG LEU B 113 68.707 33.476 26.540 1.00 0.00 H ATOM 7633 HD21 LEU B 113 69.578 31.401 28.573 1.00 0.00 H ATOM 7634 HD22 LEU B 113 69.745 31.290 26.803 1.00 0.00 H ATOM 7635 HD23 LEU B 113 70.653 32.526 27.708 1.00 0.00 H ATOM 7636 HD11 LEU B 113 67.753 34.658 28.453 1.00 0.00 H ATOM 7637 HD12 LEU B 113 68.352 33.387 29.547 1.00 0.00 H ATOM 7638 HD13 LEU B 113 69.505 34.424 28.673 1.00 0.00 H ATOM 7639 H LEU B 113 66.677 32.514 24.795 1.00 0.00 H ATOM 7640 N ILE B 114 64.993 30.111 25.823 1.00 22.63 N ATOM 7641 CA ILE B 114 63.958 29.068 25.963 1.00 22.61 C ATOM 7642 C ILE B 114 64.610 27.752 25.533 1.00 28.11 C ATOM 7643 O ILE B 114 64.419 26.701 26.145 1.00 28.32 O ATOM 7644 CB ILE B 114 62.759 29.375 25.052 1.00 26.05 C ATOM 7645 CG1 ILE B 114 61.957 30.530 25.647 1.00 25.34 C ATOM 7646 CG2 ILE B 114 61.944 28.112 24.809 1.00 27.23 C ATOM 7647 CD1 ILE B 114 60.890 31.108 24.712 1.00 29.44 C ATOM 7648 HA ILE B 114 63.591 29.019 26.988 1.00 0.00 H ATOM 7649 HB ILE B 114 63.094 29.701 24.068 1.00 0.00 H ATOM 7650 HG12 ILE B 114 61.462 30.172 26.550 1.00 0.00 H ATOM 7651 HG13 ILE B 114 62.651 31.329 25.907 1.00 0.00 H ATOM 7652 HD11 ILE B 114 61.367 31.484 23.807 1.00 0.00 H ATOM 7653 HD12 ILE B 114 60.177 30.327 24.450 1.00 0.00 H ATOM 7654 HD13 ILE B 114 60.370 31.923 25.216 1.00 0.00 H ATOM 7655 HG21 ILE B 114 62.573 27.362 24.330 1.00 0.00 H ATOM 7656 HG22 ILE B 114 61.579 27.728 25.762 1.00 0.00 H ATOM 7657 HG23 ILE B 114 61.098 28.346 24.162 1.00 0.00 H ATOM 7658 H ILE B 114 64.909 30.844 25.090 1.00 0.00 H ATOM 7659 N GLU B 115 65.362 27.803 24.440 1.00 23.30 N ATOM 7660 CA GLU B 115 66.029 26.606 23.940 1.00 22.17 C ATOM 7661 C GLU B 115 67.079 26.113 24.922 1.00 26.09 C ATOM 7662 O GLU B 115 67.210 24.919 25.179 1.00 26.92 O ATOM 7663 CB GLU B 115 66.676 26.893 22.570 1.00 22.64 C ATOM 7664 CG GLU B 115 65.679 27.131 21.461 1.00 24.60 C ATOM 7665 CD GLU B 115 66.354 27.556 20.171 1.00 30.11 C ATOM 7666 OE1 GLU B 115 67.502 27.149 19.996 1.00 34.28 O ATOM 7667 OE2 GLU B 115 65.729 28.225 19.315 1.00 28.63 O ATOM 7668 HA GLU B 115 65.279 25.823 23.825 1.00 0.00 H ATOM 7669 HB2 GLU B 115 67.303 27.780 22.665 1.00 0.00 H ATOM 7670 HB3 GLU B 115 67.296 26.039 22.297 1.00 0.00 H ATOM 7671 HG2 GLU B 115 65.125 26.209 21.282 1.00 0.00 H ATOM 7672 HG3 GLU B 115 64.988 27.914 21.771 1.00 0.00 H ATOM 7673 H GLU B 115 65.477 28.705 23.935 1.00 0.00 H ATOM 7674 N GLU B 116 67.832 27.040 25.494 1.00 25.08 N ATOM 7675 CA GLU B 116 68.857 26.667 26.453 1.00 23.56 C ATOM 7676 C GLU B 116 68.213 25.980 27.667 1.00 28.92 C ATOM 7677 O GLU B 116 68.665 24.926 28.117 1.00 26.96 O ATOM 7678 CB GLU B 116 69.624 27.920 26.900 1.00 24.40 C ATOM 7679 CG GLU B 116 70.718 27.596 27.959 1.00 30.85 C ATOM 7680 CD GLU B 116 71.551 28.820 28.297 1.00 34.11 C ATOM 7681 OE1 GLU B 116 72.210 29.358 27.397 1.00 39.90 O ATOM 7682 OE2 GLU B 116 71.402 29.358 29.395 1.00 38.97 O ATOM 7683 HA GLU B 116 69.553 25.971 25.985 1.00 0.00 H ATOM 7684 HB2 GLU B 116 70.101 28.369 26.029 1.00 0.00 H ATOM 7685 HB3 GLU B 116 68.917 28.629 27.331 1.00 0.00 H ATOM 7686 HG2 GLU B 116 70.235 27.235 28.867 1.00 0.00 H ATOM 7687 HG3 GLU B 116 71.374 26.820 27.564 1.00 0.00 H ATOM 7688 H GLU B 116 67.688 28.042 25.255 1.00 0.00 H ATOM 7689 N ASN B 117 67.170 26.596 28.216 1.00 25.53 N ATOM 7690 CA ASN B 117 66.503 26.028 29.382 1.00 26.61 C ATOM 7691 C ASN B 117 65.816 24.701 29.074 1.00 29.88 C ATOM 7692 O ASN B 117 65.901 23.748 29.849 1.00 31.63 O ATOM 7693 CB ASN B 117 65.516 27.039 29.982 1.00 25.56 C ATOM 7694 CG ASN B 117 66.194 28.050 30.829 1.00 34.08 C ATOM 7695 OD1 ASN B 117 66.549 27.756 31.973 1.00 31.48 O ATOM 7696 ND2 ASN B 117 66.500 29.222 30.244 1.00 27.27 N ATOM 7697 HA ASN B 117 67.274 25.812 30.122 1.00 0.00 H ATOM 7698 HB2 ASN B 117 65.000 27.551 29.170 1.00 0.00 H ATOM 7699 HB3 ASN B 117 64.789 26.501 30.591 1.00 0.00 H ATOM 7700 HD22 ASN B 117 66.176 29.420 29.276 1.00 0.00 H ATOM 7701 HD21 ASN B 117 67.061 29.930 30.760 1.00 0.00 H ATOM 7702 H ASN B 117 66.827 27.490 27.810 1.00 0.00 H ATOM 7703 N HIS B 118 65.153 24.613 27.932 1.00 24.84 N ATOM 7704 CA HIS B 118 64.484 23.356 27.604 1.00 23.98 C ATOM 7705 C HIS B 118 65.497 22.236 27.364 1.00 30.29 C ATOM 7706 O HIS B 118 65.256 21.094 27.749 1.00 29.86 O ATOM 7707 CB HIS B 118 63.556 23.503 26.410 1.00 23.83 C ATOM 7708 CG HIS B 118 62.705 22.298 26.185 1.00 26.05 C ATOM 7709 ND1 HIS B 118 61.717 21.916 27.071 1.00 27.50 N ATOM 7710 CD2 HIS B 118 62.768 21.329 25.249 1.00 27.64 C ATOM 7711 CE1 HIS B 118 61.185 20.776 26.672 1.00 26.97 C ATOM 7712 NE2 HIS B 118 61.823 20.388 25.582 1.00 28.12 N ATOM 7713 HA HIS B 118 63.873 23.087 28.466 1.00 0.00 H ATOM 7714 HB2 HIS B 118 62.906 24.362 26.578 1.00 0.00 H ATOM 7715 HB3 HIS B 118 64.160 23.674 25.519 1.00 0.00 H ATOM 7716 HD2 HIS B 118 63.440 21.298 24.392 1.00 0.00 H ATOM 7717 HE1 HIS B 118 60.364 20.248 27.156 1.00 0.00 H ATOM 7718 H HIS B 118 65.109 25.423 27.281 1.00 0.00 H ATOM 7719 N THR B 119 66.627 22.563 26.738 1.00 25.24 N ATOM 7720 CA THR B 119 67.713 21.589 26.522 1.00 24.60 C ATOM 7721 C THR B 119 68.196 21.063 27.884 1.00 31.02 C ATOM 7722 O THR B 119 68.395 19.864 28.077 1.00 31.87 O ATOM 7723 CB THR B 119 68.883 22.213 25.687 1.00 28.26 C ATOM 7724 OG1 THR B 119 68.424 22.469 24.347 1.00 29.53 O ATOM 7725 CG2 THR B 119 70.090 21.244 25.609 1.00 27.43 C ATOM 7726 HA THR B 119 67.334 20.751 25.938 1.00 0.00 H ATOM 7727 HB THR B 119 69.196 23.135 26.176 1.00 0.00 H ATOM 7728 HG1 THR B 119 69.161 22.863 23.817 1.00 0.00 H ATOM 7729 HG23 THR B 119 70.454 21.037 26.615 1.00 0.00 H ATOM 7730 HG21 THR B 119 69.777 20.313 25.135 1.00 0.00 H ATOM 7731 HG22 THR B 119 70.885 21.703 25.021 1.00 0.00 H ATOM 7732 H THR B 119 66.747 23.536 26.391 1.00 0.00 H ATOM 7733 N SER B 120 68.341 21.974 28.828 1.00 27.64 N ATOM 7734 CA SER B 120 68.792 21.669 30.183 1.00 27.59 C ATOM 7735 C SER B 120 67.784 20.730 30.879 1.00 35.50 C ATOM 7736 O SER B 120 68.162 19.740 31.520 1.00 35.31 O ATOM 7737 CB SER B 120 68.903 22.976 30.971 1.00 29.24 C ATOM 7738 OG SER B 120 70.127 23.652 30.714 1.00 35.94 O ATOM 7739 HA SER B 120 69.762 21.173 30.142 1.00 0.00 H ATOM 7740 HB2 SER B 120 68.842 22.751 32.036 1.00 0.00 H ATOM 7741 HB3 SER B 120 68.075 23.628 30.690 1.00 0.00 H ATOM 7742 HG SER B 120 70.157 24.489 31.242 1.00 0.00 H ATOM 7743 H SER B 120 68.122 22.963 28.594 1.00 0.00 H ATOM 7744 N LEU B 121 66.499 21.057 30.753 1.00 31.03 N ATOM 7745 CA LEU B 121 65.437 20.261 31.354 1.00 30.20 C ATOM 7746 C LEU B 121 65.448 18.863 30.766 1.00 35.49 C ATOM 7747 O LEU B 121 65.373 17.879 31.493 1.00 33.74 O ATOM 7748 CB LEU B 121 64.060 20.922 31.141 1.00 29.89 C ATOM 7749 CG LEU B 121 62.820 20.049 31.335 1.00 33.17 C ATOM 7750 CD1 LEU B 121 62.696 19.728 32.833 1.00 30.43 C ATOM 7751 CD2 LEU B 121 61.593 20.843 30.864 1.00 34.76 C ATOM 7752 HA LEU B 121 65.616 20.200 32.427 1.00 0.00 H ATOM 7753 HB2 LEU B 121 63.986 21.755 31.840 1.00 0.00 H ATOM 7754 HB3 LEU B 121 64.035 21.303 30.120 1.00 0.00 H ATOM 7755 HG LEU B 121 62.892 19.123 30.765 1.00 0.00 H ATOM 7756 HD21 LEU B 121 61.504 21.756 31.453 1.00 0.00 H ATOM 7757 HD22 LEU B 121 61.710 21.099 29.811 1.00 0.00 H ATOM 7758 HD23 LEU B 121 60.697 20.236 30.995 1.00 0.00 H ATOM 7759 HD11 LEU B 121 63.588 19.196 33.164 1.00 0.00 H ATOM 7760 HD12 LEU B 121 62.596 20.656 33.395 1.00 0.00 H ATOM 7761 HD13 LEU B 121 61.817 19.105 32.998 1.00 0.00 H ATOM 7762 H LEU B 121 66.246 21.906 30.209 1.00 0.00 H ATOM 7763 N MET B 122 65.546 18.767 29.448 1.00 33.63 N ATOM 7764 CA MET B 122 65.554 17.464 28.815 1.00 36.48 C ATOM 7765 C MET B 122 66.778 16.638 29.262 1.00 42.81 C ATOM 7766 O MET B 122 66.686 15.431 29.452 1.00 42.57 O ATOM 7767 CB MET B 122 65.632 17.613 27.310 1.00 40.18 C ATOM 7768 CG MET B 122 64.418 18.174 26.620 1.00 46.38 C ATOM 7769 SD MET B 122 64.722 17.861 24.855 1.00 55.11 S ATOM 7770 CE MET B 122 63.392 18.686 24.124 1.00 53.01 C ATOM 7771 HA MET B 122 64.634 16.957 29.108 1.00 0.00 H ATOM 7772 HB2 MET B 122 66.472 18.271 27.087 1.00 0.00 H ATOM 7773 HB3 MET B 122 65.824 16.626 26.890 1.00 0.00 H ATOM 7774 HG2 MET B 122 64.323 19.243 26.812 1.00 0.00 H ATOM 7775 HG3 MET B 122 63.514 17.664 26.953 1.00 0.00 H ATOM 7776 HE1 MET B 122 62.457 18.256 24.484 1.00 0.00 H ATOM 7777 HE2 MET B 122 63.432 19.743 24.388 1.00 0.00 H ATOM 7778 HE3 MET B 122 63.450 18.578 23.041 1.00 0.00 H ATOM 7779 H MET B 122 65.617 19.627 28.868 1.00 0.00 H ATOM 7780 N ASN B 123 67.927 17.296 29.381 1.00 38.03 N ATOM 7781 CA ASN B 123 69.174 16.621 29.729 1.00 39.05 C ATOM 7782 C ASN B 123 69.293 16.222 31.184 1.00 45.07 C ATOM 7783 O ASN B 123 69.766 15.126 31.465 1.00 46.27 O ATOM 7784 CB ASN B 123 70.389 17.486 29.365 1.00 39.19 C ATOM 7785 CG ASN B 123 70.684 17.496 27.874 1.00 54.40 C ATOM 7786 OD1 ASN B 123 71.348 18.402 27.370 1.00 62.28 O ATOM 7787 ND2 ASN B 123 70.193 16.493 27.166 1.00 39.05 N ATOM 7788 HA ASN B 123 69.155 15.702 29.143 1.00 0.00 H ATOM 7789 HB2 ASN B 123 70.197 18.509 29.689 1.00 0.00 H ATOM 7790 HB3 ASN B 123 71.262 17.098 29.890 1.00 0.00 H ATOM 7791 HD22 ASN B 123 69.637 15.749 27.634 1.00 0.00 H ATOM 7792 HD21 ASN B 123 70.363 16.448 26.141 1.00 0.00 H ATOM 7793 H ASN B 123 67.938 18.324 29.221 1.00 0.00 H ATOM 7794 N GLY B 124 68.956 17.130 32.104 1.00 41.38 N ATOM 7795 CA GLY B 124 69.096 16.874 33.536 1.00 40.73 C ATOM 7796 C GLY B 124 67.906 17.112 34.453 1.00 41.55 C ATOM 7797 O GLY B 124 68.059 17.210 35.676 1.00 39.89 O ATOM 7798 HA3 GLY B 124 69.907 17.508 33.895 1.00 0.00 H ATOM 7799 HA2 GLY B 124 69.379 15.827 33.646 1.00 0.00 H ATOM 7800 H GLY B 124 68.582 18.049 31.791 1.00 0.00 H ATOM 7801 N GLY B 125 66.715 17.241 33.879 1.00 36.29 N ATOM 7802 CA GLY B 125 65.529 17.468 34.683 1.00 35.20 C ATOM 7803 C GLY B 125 65.329 18.899 35.127 1.00 37.71 C ATOM 7804 O GLY B 125 66.179 19.779 34.910 1.00 36.17 O ATOM 7805 HA3 GLY B 125 65.598 16.843 35.573 1.00 0.00 H ATOM 7806 HA2 GLY B 125 64.660 17.170 34.097 1.00 0.00 H ATOM 7807 H GLY B 125 66.632 17.179 32.844 1.00 0.00 H ATOM 7808 N PRO B 126 64.187 19.162 35.773 1.00 34.49 N ATOM 7809 CA PRO B 126 63.844 20.537 36.158 1.00 33.86 C ATOM 7810 C PRO B 126 64.856 21.212 37.061 1.00 37.52 C ATOM 7811 O PRO B 126 64.860 22.449 37.186 1.00 35.61 O ATOM 7812 CB PRO B 126 62.479 20.387 36.842 1.00 35.24 C ATOM 7813 CG PRO B 126 62.412 18.958 37.245 1.00 39.10 C ATOM 7814 CD PRO B 126 63.175 18.190 36.218 1.00 34.49 C ATOM 7815 HA PRO B 126 63.831 21.194 35.288 1.00 0.00 H ATOM 7816 HD3 PRO B 126 63.642 17.307 36.654 1.00 0.00 H ATOM 7817 HD2 PRO B 126 62.530 17.888 35.393 1.00 0.00 H ATOM 7818 HG3 PRO B 126 61.375 18.623 37.273 1.00 0.00 H ATOM 7819 HG2 PRO B 126 62.863 18.823 38.228 1.00 0.00 H ATOM 7820 HB2 PRO B 126 62.413 21.036 37.715 1.00 0.00 H ATOM 7821 HB3 PRO B 126 61.673 20.629 36.149 1.00 0.00 H ATOM 7822 N ARG B 127 65.701 20.403 37.705 1.00 34.63 N ATOM 7823 CA ARG B 127 66.753 20.909 38.592 1.00 34.89 C ATOM 7824 C ARG B 127 67.699 21.816 37.812 1.00 34.89 C ATOM 7825 O ARG B 127 68.389 22.650 38.384 1.00 35.27 O ATOM 7826 CB ARG B 127 67.612 19.729 39.099 1.00 40.03 C ATOM 7827 CG ARG B 127 67.317 19.288 40.506 1.00 66.13 C ATOM 7828 CD ARG B 127 66.932 20.465 41.416 1.00 91.43 C ATOM 7829 NE ARG B 127 66.418 19.988 42.700 1.00104.37 N ATOM 7830 CZ ARG B 127 67.143 19.317 43.593 1.00118.03 C ATOM 7831 NH1 ARG B 127 68.427 19.066 43.362 1.00105.29 N ATOM 7832 NH2 ARG B 127 66.587 18.908 44.724 1.00103.33 N ATOM 7833 HA ARG B 127 66.275 21.444 39.413 1.00 0.00 H ATOM 7834 HB2 ARG B 127 67.446 18.880 38.436 1.00 0.00 H ATOM 7835 HB3 ARG B 127 68.659 20.027 39.050 1.00 0.00 H ATOM 7836 HG2 ARG B 127 66.492 18.576 40.485 1.00 0.00 H ATOM 7837 HG3 ARG B 127 68.203 18.803 40.915 1.00 0.00 H ATOM 7838 HD2 ARG B 127 66.164 21.061 40.923 1.00 0.00 H ATOM 7839 HD3 ARG B 127 67.812 21.083 41.591 1.00 0.00 H ATOM 7840 HE ARG B 127 65.423 20.186 42.930 1.00 0.00 H ATOM 7841 HH12 ARG B 127 68.989 18.542 44.063 1.00 0.00 H ATOM 7842 HH11 ARG B 127 68.871 19.394 42.480 1.00 0.00 H ATOM 7843 HH22 ARG B 127 67.153 18.384 45.422 1.00 0.00 H ATOM 7844 HH21 ARG B 127 65.585 19.111 44.914 1.00 0.00 H ATOM 7845 H ARG B 127 65.609 19.376 37.572 1.00 0.00 H ATOM 7846 N LYS B 128 67.812 21.556 36.525 1.00 29.15 N ATOM 7847 CA LYS B 128 68.746 22.291 35.667 1.00 29.58 C ATOM 7848 C LYS B 128 68.130 23.545 35.015 1.00 35.03 C ATOM 7849 O LYS B 128 68.804 24.290 34.312 1.00 33.56 O ATOM 7850 CB LYS B 128 69.302 21.356 34.588 1.00 31.07 C ATOM 7851 CG LYS B 128 70.240 20.282 35.123 1.00 41.43 C ATOM 7852 CD LYS B 128 71.212 20.893 36.107 1.00 43.73 C ATOM 7853 CE LYS B 128 72.655 20.556 35.782 1.00 54.96 C ATOM 7854 NZ LYS B 128 73.585 21.339 36.653 1.00 70.19 N ATOM 7855 HA LYS B 128 69.549 22.646 36.313 1.00 0.00 H ATOM 7856 HB2 LYS B 128 68.464 20.864 34.095 1.00 0.00 H ATOM 7857 HB3 LYS B 128 69.848 21.957 33.861 1.00 0.00 H ATOM 7858 HG2 LYS B 128 69.657 19.509 35.623 1.00 0.00 H ATOM 7859 HG3 LYS B 128 70.794 19.840 34.295 1.00 0.00 H ATOM 7860 HD2 LYS B 128 71.093 21.976 36.090 1.00 0.00 H ATOM 7861 HD3 LYS B 128 70.981 20.519 37.105 1.00 0.00 H ATOM 7862 HE2 LYS B 128 72.853 20.797 34.738 1.00 0.00 H ATOM 7863 HE3 LYS B 128 72.821 19.491 35.946 1.00 0.00 H ATOM 7864 HZ1 LYS B 128 73.431 22.356 36.496 1.00 0.00 H ATOM 7865 HZ2 LYS B 128 73.400 21.109 37.650 1.00 0.00 H ATOM 7866 HZ3 LYS B 128 74.568 21.095 36.416 1.00 0.00 H ATOM 7867 H LYS B 128 67.222 20.809 36.106 1.00 0.00 H ATOM 7868 N ILE B 129 66.858 23.816 35.283 1.00 30.61 N ATOM 7869 CA ILE B 129 66.281 25.028 34.742 1.00 29.00 C ATOM 7870 C ILE B 129 66.867 26.210 35.509 1.00 31.38 C ATOM 7871 O ILE B 129 66.946 26.188 36.733 1.00 30.23 O ATOM 7872 CB ILE B 129 64.744 25.040 34.857 1.00 31.48 C ATOM 7873 CG1 ILE B 129 64.131 23.878 34.067 1.00 32.45 C ATOM 7874 CG2 ILE B 129 64.224 26.394 34.415 1.00 29.64 C ATOM 7875 CD1 ILE B 129 62.603 23.703 34.317 1.00 28.85 C ATOM 7876 HA ILE B 129 66.520 25.090 33.680 1.00 0.00 H ATOM 7877 HB ILE B 129 64.445 24.890 35.894 1.00 0.00 H ATOM 7878 HG12 ILE B 129 64.290 24.060 33.004 1.00 0.00 H ATOM 7879 HG13 ILE B 129 64.637 22.957 34.356 1.00 0.00 H ATOM 7880 HD11 ILE B 129 62.429 23.510 35.376 1.00 0.00 H ATOM 7881 HD12 ILE B 129 62.081 24.613 34.022 1.00 0.00 H ATOM 7882 HD13 ILE B 129 62.233 22.864 33.728 1.00 0.00 H ATOM 7883 HG21 ILE B 129 64.646 27.170 35.053 1.00 0.00 H ATOM 7884 HG22 ILE B 129 64.516 26.574 33.380 1.00 0.00 H ATOM 7885 HG23 ILE B 129 63.137 26.408 34.494 1.00 0.00 H ATOM 7886 H ILE B 129 66.289 23.172 35.869 1.00 0.00 H ATOM 7887 N SER B 130 67.210 27.274 34.791 1.00 26.92 N ATOM 7888 CA SER B 130 67.766 28.481 35.405 1.00 25.39 C ATOM 7889 C SER B 130 66.728 29.259 36.206 1.00 29.54 C ATOM 7890 O SER B 130 65.603 29.421 35.770 1.00 28.36 O ATOM 7891 CB SER B 130 68.305 29.407 34.301 1.00 24.73 C ATOM 7892 OG SER B 130 68.561 30.685 34.843 1.00 31.81 O ATOM 7893 HA SER B 130 68.556 28.161 36.085 1.00 0.00 H ATOM 7894 HB2 SER B 130 67.566 29.491 33.504 1.00 0.00 H ATOM 7895 HB3 SER B 130 69.228 28.992 33.897 1.00 0.00 H ATOM 7896 HG SER B 130 68.908 31.280 34.132 1.00 0.00 H ATOM 7897 H SER B 130 67.079 27.249 33.760 1.00 0.00 H ATOM 7898 N PRO B 131 67.132 29.835 37.350 1.00 27.24 N ATOM 7899 CA PRO B 131 66.162 30.617 38.115 1.00 26.16 C ATOM 7900 C PRO B 131 65.670 31.767 37.276 1.00 28.76 C ATOM 7901 O PRO B 131 64.659 32.358 37.586 1.00 26.06 O ATOM 7902 CB PRO B 131 67.020 31.210 39.240 1.00 28.13 C ATOM 7903 CG PRO B 131 68.077 30.206 39.471 1.00 32.30 C ATOM 7904 CD PRO B 131 68.349 29.549 38.136 1.00 29.03 C ATOM 7905 HA PRO B 131 65.306 30.029 38.446 1.00 0.00 H ATOM 7906 HD3 PRO B 131 69.229 29.982 37.661 1.00 0.00 H ATOM 7907 HD2 PRO B 131 68.493 28.475 38.253 1.00 0.00 H ATOM 7908 HG3 PRO B 131 67.739 29.463 40.194 1.00 0.00 H ATOM 7909 HG2 PRO B 131 68.980 30.689 39.844 1.00 0.00 H ATOM 7910 HB2 PRO B 131 67.453 32.162 38.933 1.00 0.00 H ATOM 7911 HB3 PRO B 131 66.425 31.357 40.141 1.00 0.00 H ATOM 7912 N PHE B 132 66.467 32.167 36.286 1.00 27.21 N ATOM 7913 CA PHE B 132 66.106 33.310 35.427 1.00 26.75 C ATOM 7914 C PHE B 132 65.255 32.952 34.225 1.00 28.21 C ATOM 7915 O PHE B 132 64.992 33.806 33.390 1.00 29.26 O ATOM 7916 CB PHE B 132 67.357 34.049 34.967 1.00 29.96 C ATOM 7917 CG PHE B 132 68.179 34.568 36.104 1.00 34.31 C ATOM 7918 CD1 PHE B 132 67.605 35.401 37.056 1.00 38.68 C ATOM 7919 CD2 PHE B 132 69.482 34.126 36.289 1.00 38.28 C ATOM 7920 CE1 PHE B 132 68.328 35.835 38.158 1.00 40.42 C ATOM 7921 CE2 PHE B 132 70.222 34.568 37.384 1.00 41.60 C ATOM 7922 CZ PHE B 132 69.635 35.414 38.322 1.00 39.47 C ATOM 7923 HA PHE B 132 65.489 33.954 36.054 1.00 0.00 H ATOM 7924 HB2 PHE B 132 67.969 33.365 34.379 1.00 0.00 H ATOM 7925 HB3 PHE B 132 67.055 34.891 34.344 1.00 0.00 H ATOM 7926 HD2 PHE B 132 69.927 33.432 35.576 1.00 0.00 H ATOM 7927 HE2 PHE B 132 71.258 34.252 37.506 1.00 0.00 H ATOM 7928 HZ PHE B 132 70.208 35.745 39.188 1.00 0.00 H ATOM 7929 HE1 PHE B 132 67.870 36.502 38.888 1.00 0.00 H ATOM 7930 HD1 PHE B 132 66.569 35.719 36.935 1.00 0.00 H ATOM 7931 H PHE B 132 67.361 31.663 36.116 1.00 0.00 H ATOM 7932 N PHE B 133 64.847 31.695 34.108 1.00 24.69 N ATOM 7933 CA PHE B 133 64.094 31.281 32.933 1.00 24.29 C ATOM 7934 C PHE B 133 62.996 32.264 32.526 1.00 29.74 C ATOM 7935 O PHE B 133 63.081 32.909 31.480 1.00 30.40 O ATOM 7936 CB PHE B 133 63.578 29.849 33.051 1.00 25.89 C ATOM 7937 CG PHE B 133 62.622 29.467 31.947 1.00 26.53 C ATOM 7938 CD1 PHE B 133 63.008 29.564 30.616 1.00 27.67 C ATOM 7939 CD2 PHE B 133 61.300 29.159 32.235 1.00 29.13 C ATOM 7940 CE1 PHE B 133 62.118 29.257 29.608 1.00 29.06 C ATOM 7941 CE2 PHE B 133 60.388 28.925 31.224 1.00 32.19 C ATOM 7942 CZ PHE B 133 60.812 28.924 29.906 1.00 29.05 C ATOM 7943 HA PHE B 133 64.810 31.295 32.111 1.00 0.00 H ATOM 7944 HB2 PHE B 133 64.430 29.170 33.022 1.00 0.00 H ATOM 7945 HB3 PHE B 133 63.064 29.744 34.006 1.00 0.00 H ATOM 7946 HD2 PHE B 133 60.976 29.101 33.274 1.00 0.00 H ATOM 7947 HE2 PHE B 133 59.340 28.742 31.463 1.00 0.00 H ATOM 7948 HZ PHE B 133 60.118 28.662 29.108 1.00 0.00 H ATOM 7949 HE1 PHE B 133 62.448 29.277 28.569 1.00 0.00 H ATOM 7950 HD1 PHE B 133 64.020 29.884 30.367 1.00 0.00 H ATOM 7951 H PHE B 133 65.065 31.006 34.856 1.00 0.00 H ATOM 7952 N VAL B 134 62.014 32.464 33.398 1.00 23.45 N ATOM 7953 CA VAL B 134 60.916 33.359 33.077 1.00 21.91 C ATOM 7954 C VAL B 134 61.293 34.807 32.819 1.00 25.70 C ATOM 7955 O VAL B 134 61.025 35.328 31.766 1.00 25.70 O ATOM 7956 CB VAL B 134 59.793 33.247 34.124 1.00 24.51 C ATOM 7957 CG1 VAL B 134 58.611 34.166 33.709 1.00 24.29 C ATOM 7958 CG2 VAL B 134 59.379 31.800 34.237 1.00 22.71 C ATOM 7959 HA VAL B 134 60.553 33.009 32.111 1.00 0.00 H ATOM 7960 HB VAL B 134 60.136 33.578 35.104 1.00 0.00 H ATOM 7961 HG11 VAL B 134 58.957 35.198 33.653 1.00 0.00 H ATOM 7962 HG12 VAL B 134 58.235 33.854 32.735 1.00 0.00 H ATOM 7963 HG13 VAL B 134 57.815 34.088 34.449 1.00 0.00 H ATOM 7964 HG21 VAL B 134 59.020 31.449 33.269 1.00 0.00 H ATOM 7965 HG22 VAL B 134 60.236 31.201 34.547 1.00 0.00 H ATOM 7966 HG23 VAL B 134 58.583 31.708 34.976 1.00 0.00 H ATOM 7967 H VAL B 134 62.032 31.977 34.317 1.00 0.00 H ATOM 7968 N PRO B 135 61.948 35.475 33.787 1.00 21.93 N ATOM 7969 CA PRO B 135 62.256 36.881 33.488 1.00 20.82 C ATOM 7970 C PRO B 135 63.312 37.119 32.391 1.00 24.96 C ATOM 7971 O PRO B 135 63.571 38.258 31.977 1.00 24.84 O ATOM 7972 CB PRO B 135 62.765 37.429 34.830 1.00 22.15 C ATOM 7973 CG PRO B 135 63.325 36.205 35.527 1.00 26.02 C ATOM 7974 CD PRO B 135 62.367 35.095 35.147 1.00 21.92 C ATOM 7975 HA PRO B 135 61.369 37.371 33.087 1.00 0.00 H ATOM 7976 HD3 PRO B 135 62.868 34.127 35.148 1.00 0.00 H ATOM 7977 HD2 PRO B 135 61.515 35.062 35.826 1.00 0.00 H ATOM 7978 HG3 PRO B 135 63.343 36.348 36.607 1.00 0.00 H ATOM 7979 HG2 PRO B 135 64.333 35.985 35.174 1.00 0.00 H ATOM 7980 HB2 PRO B 135 63.541 38.178 34.675 1.00 0.00 H ATOM 7981 HB3 PRO B 135 61.950 37.866 35.406 1.00 0.00 H ATOM 7982 N SER B 136 63.950 36.059 31.947 1.00 22.16 N ATOM 7983 CA SER B 136 64.972 36.230 30.902 1.00 20.75 C ATOM 7984 C SER B 136 64.401 36.051 29.491 1.00 24.97 C ATOM 7985 O SER B 136 65.110 36.311 28.485 1.00 20.00 O ATOM 7986 CB SER B 136 66.099 35.222 31.120 1.00 21.32 C ATOM 7987 OG SER B 136 65.701 33.940 30.648 1.00 25.99 O ATOM 7988 HA SER B 136 65.348 37.250 30.980 1.00 0.00 H ATOM 7989 HB2 SER B 136 66.328 35.160 32.184 1.00 0.00 H ATOM 7990 HB3 SER B 136 66.986 35.548 30.577 1.00 0.00 H ATOM 7991 HG SER B 136 64.896 33.643 31.142 1.00 0.00 H ATOM 7992 H SER B 136 63.736 35.115 32.328 1.00 0.00 H ATOM 7993 N THR B 137 63.151 35.555 29.400 1.00 22.50 N ATOM 7994 CA THR B 137 62.556 35.231 28.092 1.00 20.40 C ATOM 7995 C THR B 137 61.293 35.997 27.736 1.00 25.09 C ATOM 7996 O THR B 137 60.986 36.168 26.553 1.00 22.81 O ATOM 7997 CB THR B 137 62.252 33.710 27.991 1.00 26.78 C ATOM 7998 OG1 THR B 137 61.378 33.347 29.071 1.00 23.23 O ATOM 7999 CG2 THR B 137 63.527 32.867 28.111 1.00 20.63 C ATOM 8000 HA THR B 137 63.315 35.541 27.374 1.00 0.00 H ATOM 8001 HB THR B 137 61.798 33.519 27.019 1.00 0.00 H ATOM 8002 HG1 THR B 137 61.821 33.547 29.934 1.00 0.00 H ATOM 8003 HG23 THR B 137 64.209 33.124 27.300 1.00 0.00 H ATOM 8004 HG21 THR B 137 64.006 33.070 29.069 1.00 0.00 H ATOM 8005 HG22 THR B 137 63.269 31.810 28.049 1.00 0.00 H ATOM 8006 H THR B 137 62.598 35.399 30.267 1.00 0.00 H ATOM 8007 N ILE B 138 60.484 36.347 28.738 1.00 20.89 N ATOM 8008 CA ILE B 138 59.186 36.976 28.441 1.00 19.86 C ATOM 8009 C ILE B 138 59.233 38.332 27.779 1.00 23.15 C ATOM 8010 O ILE B 138 60.103 39.137 28.058 1.00 21.56 O ATOM 8011 CB ILE B 138 58.133 36.877 29.588 1.00 23.73 C ATOM 8012 CG1 ILE B 138 58.592 37.709 30.797 1.00 23.96 C ATOM 8013 CG2 ILE B 138 57.889 35.392 29.982 1.00 25.24 C ATOM 8014 CD1 ILE B 138 57.549 37.700 31.996 1.00 25.65 C ATOM 8015 HA ILE B 138 58.809 36.329 27.649 1.00 0.00 H ATOM 8016 HB ILE B 138 57.185 37.283 29.235 1.00 0.00 H ATOM 8017 HG12 ILE B 138 59.538 37.304 31.157 1.00 0.00 H ATOM 8018 HG13 ILE B 138 58.739 38.739 30.473 1.00 0.00 H ATOM 8019 HD11 ILE B 138 56.600 38.112 31.653 1.00 0.00 H ATOM 8020 HD12 ILE B 138 57.399 36.676 32.338 1.00 0.00 H ATOM 8021 HD13 ILE B 138 57.935 38.306 32.816 1.00 0.00 H ATOM 8022 HG21 ILE B 138 57.520 34.843 29.115 1.00 0.00 H ATOM 8023 HG22 ILE B 138 58.825 34.949 30.322 1.00 0.00 H ATOM 8024 HG23 ILE B 138 57.151 35.347 30.783 1.00 0.00 H ATOM 8025 H ILE B 138 60.769 36.176 29.724 1.00 0.00 H ATOM 8026 N VAL B 139 58.224 38.603 26.953 1.00 19.89 N ATOM 8027 CA VAL B 139 58.224 39.768 26.069 1.00 20.87 C ATOM 8028 C VAL B 139 58.352 41.121 26.730 1.00 24.06 C ATOM 8029 O VAL B 139 58.852 42.085 26.116 1.00 24.01 O ATOM 8030 CB VAL B 139 56.957 39.758 25.144 1.00 26.59 C ATOM 8031 CG1 VAL B 139 56.761 41.127 24.559 1.00 28.31 C ATOM 8032 CG2 VAL B 139 57.110 38.708 24.024 1.00 25.75 C ATOM 8033 HA VAL B 139 59.143 39.651 25.494 1.00 0.00 H ATOM 8034 HB VAL B 139 56.082 39.490 25.737 1.00 0.00 H ATOM 8035 HG11 VAL B 139 56.621 41.848 25.364 1.00 0.00 H ATOM 8036 HG12 VAL B 139 57.639 41.400 23.974 1.00 0.00 H ATOM 8037 HG13 VAL B 139 55.881 41.123 23.916 1.00 0.00 H ATOM 8038 HG21 VAL B 139 57.986 38.947 23.421 1.00 0.00 H ATOM 8039 HG22 VAL B 139 57.231 37.720 24.468 1.00 0.00 H ATOM 8040 HG23 VAL B 139 56.220 38.718 23.394 1.00 0.00 H ATOM 8041 H VAL B 139 57.405 37.962 26.936 1.00 0.00 H ATOM 8042 N ASN B 140 57.794 41.253 27.925 1.00 20.63 N ATOM 8043 CA ASN B 140 57.743 42.577 28.564 1.00 20.17 C ATOM 8044 C ASN B 140 59.010 42.970 29.325 1.00 23.07 C ATOM 8045 O ASN B 140 59.045 44.017 29.974 1.00 22.83 O ATOM 8046 CB ASN B 140 56.511 42.660 29.508 1.00 19.50 C ATOM 8047 CG ASN B 140 56.565 41.638 30.647 1.00 32.67 C ATOM 8048 OD1 ASN B 140 56.609 40.446 30.403 1.00 22.48 O ATOM 8049 ND2 ASN B 140 56.489 42.109 31.896 1.00 23.85 N ATOM 8050 HA ASN B 140 57.657 43.295 27.748 1.00 0.00 H ATOM 8051 HB2 ASN B 140 56.469 43.660 29.939 1.00 0.00 H ATOM 8052 HB3 ASN B 140 55.610 42.481 28.921 1.00 0.00 H ATOM 8053 HD22 ASN B 140 56.453 43.135 32.064 1.00 0.00 H ATOM 8054 HD21 ASN B 140 56.466 41.450 32.700 1.00 0.00 H ATOM 8055 H ASN B 140 57.394 40.424 28.409 1.00 0.00 H ATOM 8056 N MET B 141 60.035 42.129 29.270 1.00 22.13 N ATOM 8057 CA MET B 141 61.242 42.348 30.089 1.00 22.06 C ATOM 8058 C MET B 141 62.132 43.526 29.627 1.00 27.50 C ATOM 8059 O MET B 141 62.951 44.018 30.409 1.00 28.11 O ATOM 8060 CB MET B 141 62.054 41.072 30.202 1.00 24.47 C ATOM 8061 CG MET B 141 61.328 39.924 30.894 1.00 30.22 C ATOM 8062 SD MET B 141 60.780 40.515 32.498 1.00 37.64 S ATOM 8063 CE MET B 141 60.957 39.262 33.254 1.00 35.59 C ATOM 8064 HA MET B 141 60.873 42.636 31.073 1.00 0.00 H ATOM 8065 HB2 MET B 141 62.324 40.749 29.197 1.00 0.00 H ATOM 8066 HB3 MET B 141 62.960 41.293 30.767 1.00 0.00 H ATOM 8067 HG2 MET B 141 62.004 39.079 31.020 1.00 0.00 H ATOM 8068 HG3 MET B 141 60.469 39.614 30.298 1.00 0.00 H ATOM 8069 HE1 MET B 141 60.333 38.483 32.816 1.00 0.00 H ATOM 8070 HE2 MET B 141 62.003 38.958 33.211 1.00 0.00 H ATOM 8071 HE3 MET B 141 60.666 39.421 34.292 1.00 0.00 H ATOM 8072 H MET B 141 59.987 41.303 28.640 1.00 0.00 H ATOM 8073 N VAL B 142 62.031 43.932 28.363 1.00 23.13 N ATOM 8074 CA VAL B 142 62.791 45.102 27.907 1.00 22.25 C ATOM 8075 C VAL B 142 62.233 46.331 28.616 1.00 25.48 C ATOM 8076 O VAL B 142 62.986 47.121 29.164 1.00 25.15 O ATOM 8077 CB VAL B 142 62.773 45.347 26.383 1.00 24.63 C ATOM 8078 CG1 VAL B 142 63.599 46.599 26.101 1.00 23.77 C ATOM 8079 CG2 VAL B 142 63.324 44.146 25.616 1.00 24.70 C ATOM 8080 HA VAL B 142 63.835 44.907 28.154 1.00 0.00 H ATOM 8081 HB VAL B 142 61.746 45.487 26.045 1.00 0.00 H ATOM 8082 HG11 VAL B 142 63.161 47.448 26.626 1.00 0.00 H ATOM 8083 HG12 VAL B 142 64.621 46.444 26.447 1.00 0.00 H ATOM 8084 HG13 VAL B 142 63.603 46.796 25.029 1.00 0.00 H ATOM 8085 HG21 VAL B 142 64.353 43.961 25.924 1.00 0.00 H ATOM 8086 HG22 VAL B 142 62.715 43.268 25.832 1.00 0.00 H ATOM 8087 HG23 VAL B 142 63.296 44.355 24.547 1.00 0.00 H ATOM 8088 H VAL B 142 61.414 43.421 27.700 1.00 0.00 H ATOM 8089 N ALA B 143 60.914 46.514 28.566 1.00 23.09 N ATOM 8090 CA ALA B 143 60.273 47.615 29.285 1.00 21.64 C ATOM 8091 C ALA B 143 60.636 47.557 30.788 1.00 26.35 C ATOM 8092 O ALA B 143 60.837 48.583 31.426 1.00 27.56 O ATOM 8093 CB ALA B 143 58.718 47.615 29.102 1.00 20.70 C ATOM 8094 HA ALA B 143 60.650 48.544 28.858 1.00 0.00 H ATOM 8095 HB1 ALA B 143 58.478 47.716 28.044 1.00 0.00 H ATOM 8096 HB2 ALA B 143 58.309 46.679 29.481 1.00 0.00 H ATOM 8097 HB3 ALA B 143 58.288 48.451 29.654 1.00 0.00 H ATOM 8098 H ALA B 143 60.329 45.862 28.005 1.00 0.00 H ATOM 8099 N GLY B 144 60.633 46.371 31.363 1.00 22.30 N ATOM 8100 CA GLY B 144 60.909 46.212 32.787 1.00 22.87 C ATOM 8101 C GLY B 144 62.332 46.654 33.135 1.00 26.48 C ATOM 8102 O GLY B 144 62.528 47.452 34.052 1.00 24.62 O ATOM 8103 HA3 GLY B 144 60.788 45.163 33.057 1.00 0.00 H ATOM 8104 HA2 GLY B 144 60.201 46.816 33.355 1.00 0.00 H ATOM 8105 H GLY B 144 60.429 45.529 30.788 1.00 0.00 H ATOM 8106 N HIS B 145 63.319 46.187 32.388 1.00 22.79 N ATOM 8107 CA HIS B 145 64.712 46.589 32.702 1.00 22.46 C ATOM 8108 C HIS B 145 64.926 48.075 32.494 1.00 26.13 C ATOM 8109 O HIS B 145 65.586 48.734 33.299 1.00 25.84 O ATOM 8110 CB HIS B 145 65.739 45.807 31.884 1.00 22.05 C ATOM 8111 CG HIS B 145 65.961 44.416 32.389 1.00 25.46 C ATOM 8112 ND1 HIS B 145 66.698 44.146 33.524 1.00 26.17 N ATOM 8113 CD2 HIS B 145 65.492 43.221 31.945 1.00 25.93 C ATOM 8114 CE1 HIS B 145 66.696 42.841 33.745 1.00 26.02 C ATOM 8115 NE2 HIS B 145 65.975 42.257 32.796 1.00 26.27 N ATOM 8116 HA HIS B 145 64.862 46.353 33.756 1.00 0.00 H ATOM 8117 HB2 HIS B 145 65.390 45.750 30.853 1.00 0.00 H ATOM 8118 HB3 HIS B 145 66.688 46.343 31.916 1.00 0.00 H ATOM 8119 HD2 HIS B 145 64.853 43.058 31.077 1.00 0.00 H ATOM 8120 HE1 HIS B 145 67.201 42.332 34.567 1.00 0.00 H ATOM 8121 H HIS B 145 63.121 45.547 31.592 1.00 0.00 H ATOM 8122 N LEU B 146 64.380 48.617 31.410 1.00 23.70 N ATOM 8123 CA LEU B 146 64.613 50.036 31.123 1.00 22.19 C ATOM 8124 C LEU B 146 63.958 50.934 32.169 1.00 26.31 C ATOM 8125 O LEU B 146 64.517 51.965 32.555 1.00 25.86 O ATOM 8126 CB LEU B 146 64.155 50.411 29.715 1.00 22.43 C ATOM 8127 CG LEU B 146 65.114 50.000 28.589 1.00 25.84 C ATOM 8128 CD1 LEU B 146 64.394 50.069 27.248 1.00 22.04 C ATOM 8129 CD2 LEU B 146 66.381 50.935 28.624 1.00 27.80 C ATOM 8130 HA LEU B 146 65.690 50.198 31.172 1.00 0.00 H ATOM 8131 HB2 LEU B 146 63.194 49.931 29.533 1.00 0.00 H ATOM 8132 HB3 LEU B 146 64.032 51.493 29.676 1.00 0.00 H ATOM 8133 HG LEU B 146 65.446 48.971 28.730 1.00 0.00 H ATOM 8134 HD21 LEU B 146 66.071 51.970 28.483 1.00 0.00 H ATOM 8135 HD22 LEU B 146 66.880 50.832 29.587 1.00 0.00 H ATOM 8136 HD23 LEU B 146 67.065 50.647 27.826 1.00 0.00 H ATOM 8137 HD11 LEU B 146 63.540 49.392 27.260 1.00 0.00 H ATOM 8138 HD12 LEU B 146 64.049 51.088 27.074 1.00 0.00 H ATOM 8139 HD13 LEU B 146 65.080 49.776 26.453 1.00 0.00 H ATOM 8140 H LEU B 146 63.794 48.041 30.772 1.00 0.00 H ATOM 8141 N THR B 147 62.788 50.544 32.670 1.00 21.83 N ATOM 8142 CA THR B 147 62.137 51.394 33.681 1.00 20.91 C ATOM 8143 C THR B 147 62.948 51.388 34.947 1.00 27.09 C ATOM 8144 O THR B 147 63.046 52.401 35.635 1.00 28.33 O ATOM 8145 CB THR B 147 60.670 50.987 33.955 1.00 29.42 C ATOM 8146 OG1 THR B 147 60.616 49.606 34.339 1.00 30.40 O ATOM 8147 CG2 THR B 147 59.856 51.179 32.722 1.00 25.03 C ATOM 8148 HA THR B 147 62.097 52.407 33.282 1.00 0.00 H ATOM 8149 HB THR B 147 60.273 51.609 34.758 1.00 0.00 H ATOM 8150 HG1 THR B 147 60.982 49.047 33.608 1.00 0.00 H ATOM 8151 HG23 THR B 147 59.892 52.227 32.424 1.00 0.00 H ATOM 8152 HG21 THR B 147 60.259 50.558 31.922 1.00 0.00 H ATOM 8153 HG22 THR B 147 58.824 50.892 32.921 1.00 0.00 H ATOM 8154 H THR B 147 62.343 49.658 32.354 1.00 0.00 H ATOM 8155 N ILE B 148 63.502 50.227 35.284 1.00 25.07 N ATOM 8156 CA ILE B 148 64.308 50.107 36.486 1.00 25.37 C ATOM 8157 C ILE B 148 65.604 50.881 36.307 1.00 31.00 C ATOM 8158 O ILE B 148 65.990 51.658 37.171 1.00 30.79 O ATOM 8159 CB ILE B 148 64.597 48.648 36.794 1.00 29.20 C ATOM 8160 CG1 ILE B 148 63.321 47.909 37.216 1.00 27.52 C ATOM 8161 CG2 ILE B 148 65.653 48.515 37.909 1.00 33.08 C ATOM 8162 CD1 ILE B 148 63.569 46.402 37.189 1.00 31.48 C ATOM 8163 HA ILE B 148 63.755 50.525 37.327 1.00 0.00 H ATOM 8164 HB ILE B 148 64.984 48.197 35.880 1.00 0.00 H ATOM 8165 HG12 ILE B 148 63.042 48.213 38.225 1.00 0.00 H ATOM 8166 HG13 ILE B 148 62.513 48.156 36.527 1.00 0.00 H ATOM 8167 HD11 ILE B 148 63.847 46.099 36.180 1.00 0.00 H ATOM 8168 HD12 ILE B 148 64.376 46.155 37.879 1.00 0.00 H ATOM 8169 HD13 ILE B 148 62.660 45.880 37.489 1.00 0.00 H ATOM 8170 HG21 ILE B 148 66.578 48.995 37.590 1.00 0.00 H ATOM 8171 HG22 ILE B 148 65.286 48.997 38.815 1.00 0.00 H ATOM 8172 HG23 ILE B 148 65.839 47.459 38.107 1.00 0.00 H ATOM 8173 H ILE B 148 63.356 49.394 34.679 1.00 0.00 H ATOM 8174 N MET B 149 66.257 50.701 35.159 1.00 28.50 N ATOM 8175 CA MET B 149 67.510 51.405 34.879 1.00 26.67 C ATOM 8176 C MET B 149 67.380 52.922 34.949 1.00 31.92 C ATOM 8177 O MET B 149 68.263 53.582 35.485 1.00 31.30 O ATOM 8178 CB MET B 149 68.100 50.993 33.526 1.00 27.46 C ATOM 8179 CG MET B 149 68.769 49.662 33.571 1.00 29.30 C ATOM 8180 SD MET B 149 69.042 48.957 31.915 1.00 31.66 S ATOM 8181 CE MET B 149 70.425 49.954 31.266 1.00 28.37 C ATOM 8182 HA MET B 149 68.193 51.103 35.673 1.00 0.00 H ATOM 8183 HB2 MET B 149 67.295 50.954 32.792 1.00 0.00 H ATOM 8184 HB3 MET B 149 68.832 51.741 33.222 1.00 0.00 H ATOM 8185 HG2 MET B 149 68.144 48.976 34.144 1.00 0.00 H ATOM 8186 HG3 MET B 149 69.733 49.773 34.067 1.00 0.00 H ATOM 8187 HE1 MET B 149 70.130 51.003 31.232 1.00 0.00 H ATOM 8188 HE2 MET B 149 71.291 49.840 31.918 1.00 0.00 H ATOM 8189 HE3 MET B 149 70.677 49.613 30.262 1.00 0.00 H ATOM 8190 H MET B 149 65.869 50.048 34.449 1.00 0.00 H ATOM 8191 N TYR B 150 66.295 53.475 34.412 1.00 28.04 N ATOM 8192 CA TYR B 150 66.100 54.928 34.386 1.00 26.52 C ATOM 8193 C TYR B 150 65.219 55.484 35.497 1.00 30.50 C ATOM 8194 O TYR B 150 64.905 56.675 35.495 1.00 30.05 O ATOM 8195 CB TYR B 150 65.533 55.373 33.018 1.00 26.39 C ATOM 8196 CG TYR B 150 66.588 55.407 31.929 1.00 27.72 C ATOM 8197 CD1 TYR B 150 67.400 56.524 31.762 1.00 29.90 C ATOM 8198 CD2 TYR B 150 66.884 54.263 31.182 1.00 28.58 C ATOM 8199 CE1 TYR B 150 68.434 56.526 30.849 1.00 31.15 C ATOM 8200 CE2 TYR B 150 67.928 54.251 30.251 1.00 28.31 C ATOM 8201 CZ TYR B 150 68.708 55.388 30.103 1.00 35.62 C ATOM 8202 OH TYR B 150 69.752 55.412 29.198 1.00 33.71 O ATOM 8203 HA TYR B 150 67.094 55.342 34.554 1.00 0.00 H ATOM 8204 HB3 TYR B 150 65.109 56.372 33.124 1.00 0.00 H ATOM 8205 HB2 TYR B 150 64.749 54.676 32.722 1.00 0.00 H ATOM 8206 HD2 TYR B 150 66.289 53.362 31.328 1.00 0.00 H ATOM 8207 HE2 TYR B 150 68.125 53.362 29.652 1.00 0.00 H ATOM 8208 HE1 TYR B 150 69.037 57.423 30.713 1.00 0.00 H ATOM 8209 HD1 TYR B 150 67.216 57.414 32.364 1.00 0.00 H ATOM 8210 HH TYR B 150 70.193 56.298 29.229 1.00 0.00 H ATOM 8211 H TYR B 150 65.565 52.859 33.999 1.00 0.00 H ATOM 8212 N GLY B 151 64.667 54.620 36.341 1.00 28.34 N ATOM 8213 CA GLY B 151 63.755 55.082 37.396 1.00 27.49 C ATOM 8214 C GLY B 151 62.411 55.572 36.868 1.00 31.46 C ATOM 8215 O GLY B 151 61.838 56.530 37.385 1.00 30.51 O ATOM 8216 HA3 GLY B 151 64.234 55.901 37.932 1.00 0.00 H ATOM 8217 HA2 GLY B 151 63.575 54.255 38.083 1.00 0.00 H ATOM 8218 H GLY B 151 64.882 53.606 36.254 1.00 0.00 H ATOM 8219 N LEU B 152 61.921 54.954 35.794 1.00 27.76 N ATOM 8220 CA LEU B 152 60.668 55.402 35.182 1.00 26.26 C ATOM 8221 C LEU B 152 59.507 54.755 35.938 1.00 29.52 C ATOM 8222 O LEU B 152 59.416 53.529 36.038 1.00 29.09 O ATOM 8223 CB LEU B 152 60.616 54.995 33.696 1.00 26.06 C ATOM 8224 CG LEU B 152 61.874 55.292 32.857 1.00 27.75 C ATOM 8225 CD1 LEU B 152 61.644 55.025 31.362 1.00 26.62 C ATOM 8226 CD2 LEU B 152 62.295 56.742 33.048 1.00 25.67 C ATOM 8227 HA LEU B 152 60.600 56.488 35.239 1.00 0.00 H ATOM 8228 HB2 LEU B 152 60.435 53.921 33.653 1.00 0.00 H ATOM 8229 HB3 LEU B 152 59.780 55.522 33.237 1.00 0.00 H ATOM 8230 HG LEU B 152 62.661 54.623 33.203 1.00 0.00 H ATOM 8231 HD21 LEU B 152 61.486 57.399 32.728 1.00 0.00 H ATOM 8232 HD22 LEU B 152 62.515 56.920 34.101 1.00 0.00 H ATOM 8233 HD23 LEU B 152 63.185 56.942 32.451 1.00 0.00 H ATOM 8234 HD11 LEU B 152 61.377 53.978 31.218 1.00 0.00 H ATOM 8235 HD12 LEU B 152 60.835 55.660 31.001 1.00 0.00 H ATOM 8236 HD13 LEU B 152 62.557 55.248 30.810 1.00 0.00 H ATOM 8237 H LEU B 152 62.433 54.146 35.386 1.00 0.00 H ATOM 8238 N ARG B 153 58.578 55.571 36.401 1.00 25.34 N ATOM 8239 CA ARG B 153 57.467 55.030 37.181 1.00 24.42 C ATOM 8240 C ARG B 153 56.115 55.188 36.522 1.00 27.01 C ATOM 8241 O ARG B 153 55.098 54.833 37.116 1.00 28.59 O ATOM 8242 CB ARG B 153 57.473 55.716 38.553 1.00 26.42 C ATOM 8243 CG ARG B 153 58.840 55.651 39.208 1.00 35.77 C ATOM 8244 CD ARG B 153 58.708 55.609 40.709 1.00 54.30 C ATOM 8245 NE ARG B 153 58.255 56.892 41.219 1.00 56.72 N ATOM 8246 CZ ARG B 153 57.189 57.062 41.997 1.00 62.79 C ATOM 8247 NH1 ARG B 153 56.453 56.027 42.370 1.00 41.75 N ATOM 8248 NH2 ARG B 153 56.870 58.279 42.417 1.00 43.21 N ATOM 8249 HA ARG B 153 57.618 53.954 37.269 1.00 0.00 H ATOM 8250 HB2 ARG B 153 57.191 56.761 38.427 1.00 0.00 H ATOM 8251 HB3 ARG B 153 56.748 55.221 39.199 1.00 0.00 H ATOM 8252 HG2 ARG B 153 59.358 54.754 38.868 1.00 0.00 H ATOM 8253 HG3 ARG B 153 59.416 56.531 38.923 1.00 0.00 H ATOM 8254 HD2 ARG B 153 59.677 55.371 41.148 1.00 0.00 H ATOM 8255 HD3 ARG B 153 57.987 54.839 40.984 1.00 0.00 H ATOM 8256 HE ARG B 153 58.802 57.737 40.958 1.00 0.00 H ATOM 8257 HH12 ARG B 153 55.622 56.172 42.978 1.00 0.00 H ATOM 8258 HH11 ARG B 153 56.706 55.069 42.055 1.00 0.00 H ATOM 8259 HH22 ARG B 153 56.038 58.418 43.025 1.00 0.00 H ATOM 8260 HH21 ARG B 153 57.452 59.095 42.138 1.00 0.00 H ATOM 8261 H ARG B 153 58.637 56.592 36.212 1.00 0.00 H ATOM 8262 N GLY B 154 56.081 55.741 35.314 1.00 23.15 N ATOM 8263 CA GLY B 154 54.825 55.906 34.601 1.00 22.78 C ATOM 8264 C GLY B 154 54.382 54.577 33.976 1.00 24.13 C ATOM 8265 O GLY B 154 54.967 53.529 34.221 1.00 25.98 O ATOM 8266 HA3 GLY B 154 54.955 56.648 33.813 1.00 0.00 H ATOM 8267 HA2 GLY B 154 54.059 56.248 35.297 1.00 0.00 H ATOM 8268 H GLY B 154 56.967 56.061 34.872 1.00 0.00 H ATOM 8269 N PRO B 155 53.354 54.612 33.131 1.00 22.63 N ATOM 8270 CA PRO B 155 52.778 53.413 32.526 1.00 23.38 C ATOM 8271 C PRO B 155 53.798 52.636 31.745 1.00 28.61 C ATOM 8272 O PRO B 155 54.596 53.220 31.012 1.00 28.11 O ATOM 8273 CB PRO B 155 51.709 53.983 31.549 1.00 24.84 C ATOM 8274 CG PRO B 155 51.420 55.370 32.060 1.00 29.22 C ATOM 8275 CD PRO B 155 52.749 55.846 32.596 1.00 25.50 C ATOM 8276 HA PRO B 155 52.383 52.729 33.277 1.00 0.00 H ATOM 8277 HD3 PRO B 155 53.363 56.271 31.801 1.00 0.00 H ATOM 8278 HD2 PRO B 155 52.611 56.588 33.383 1.00 0.00 H ATOM 8279 HG3 PRO B 155 50.670 55.344 32.851 1.00 0.00 H ATOM 8280 HG2 PRO B 155 51.073 56.016 31.253 1.00 0.00 H ATOM 8281 HB2 PRO B 155 52.100 54.022 30.532 1.00 0.00 H ATOM 8282 HB3 PRO B 155 50.807 53.371 31.567 1.00 0.00 H ATOM 8283 N SER B 156 53.776 51.314 31.904 1.00 25.31 N ATOM 8284 CA SER B 156 54.582 50.425 31.063 1.00 23.83 C ATOM 8285 C SER B 156 53.691 49.314 30.538 1.00 26.36 C ATOM 8286 O SER B 156 53.002 48.657 31.318 1.00 24.28 O ATOM 8287 CB SER B 156 55.801 49.813 31.767 1.00 27.24 C ATOM 8288 OG SER B 156 55.468 49.288 33.034 1.00 39.59 O ATOM 8289 HA SER B 156 54.984 51.040 30.258 1.00 0.00 H ATOM 8290 HB2 SER B 156 56.560 50.585 31.893 1.00 0.00 H ATOM 8291 HB3 SER B 156 56.201 49.011 31.147 1.00 0.00 H ATOM 8292 HG SER B 156 55.110 50.012 33.606 1.00 0.00 H ATOM 8293 H SER B 156 53.172 50.902 32.644 1.00 0.00 H ATOM 8294 N ILE B 157 53.693 49.138 29.212 1.00 23.37 N ATOM 8295 CA ILE B 157 52.968 48.054 28.571 1.00 21.80 C ATOM 8296 C ILE B 157 53.897 47.432 27.548 1.00 25.57 C ATOM 8297 O ILE B 157 54.960 47.986 27.236 1.00 23.35 O ATOM 8298 CB ILE B 157 51.668 48.543 27.898 1.00 24.52 C ATOM 8299 CG1 ILE B 157 51.976 49.537 26.778 1.00 24.67 C ATOM 8300 CG2 ILE B 157 50.741 49.140 28.926 1.00 23.43 C ATOM 8301 CD1 ILE B 157 50.752 49.844 25.877 1.00 26.07 C ATOM 8302 HA ILE B 157 52.666 47.323 29.321 1.00 0.00 H ATOM 8303 HB ILE B 157 51.165 47.688 27.446 1.00 0.00 H ATOM 8304 HG12 ILE B 157 52.318 50.469 27.227 1.00 0.00 H ATOM 8305 HG13 ILE B 157 52.769 49.123 26.156 1.00 0.00 H ATOM 8306 HD11 ILE B 157 50.404 48.922 25.412 1.00 0.00 H ATOM 8307 HD12 ILE B 157 49.953 50.270 26.484 1.00 0.00 H ATOM 8308 HD13 ILE B 157 51.041 50.556 25.104 1.00 0.00 H ATOM 8309 HG21 ILE B 157 50.494 48.385 29.673 1.00 0.00 H ATOM 8310 HG22 ILE B 157 51.232 49.984 29.409 1.00 0.00 H ATOM 8311 HG23 ILE B 157 49.829 49.480 28.436 1.00 0.00 H ATOM 8312 H ILE B 157 54.232 49.800 28.619 1.00 0.00 H ATOM 8313 N SER B 158 53.511 46.262 27.052 1.00 19.54 N ATOM 8314 CA SER B 158 54.291 45.590 26.037 1.00 18.10 C ATOM 8315 C SER B 158 53.304 44.879 25.132 1.00 24.44 C ATOM 8316 O SER B 158 52.637 43.944 25.561 1.00 22.70 O ATOM 8317 CB SER B 158 55.287 44.586 26.615 1.00 18.32 C ATOM 8318 OG SER B 158 56.106 45.192 27.619 1.00 27.05 O ATOM 8319 HA SER B 158 54.890 46.325 25.499 1.00 0.00 H ATOM 8320 HB2 SER B 158 55.924 44.214 25.813 1.00 0.00 H ATOM 8321 HB3 SER B 158 54.738 43.754 27.057 1.00 0.00 H ATOM 8322 HG SER B 158 55.532 45.528 28.353 1.00 0.00 H ATOM 8323 H SER B 158 52.635 45.823 27.399 1.00 0.00 H ATOM 8324 N ILE B 159 53.208 45.338 23.886 1.00 20.70 N ATOM 8325 CA ILE B 159 52.312 44.707 22.917 1.00 20.63 C ATOM 8326 C ILE B 159 53.097 43.707 22.091 1.00 23.94 C ATOM 8327 O ILE B 159 54.199 44.007 21.620 1.00 22.45 O ATOM 8328 CB ILE B 159 51.645 45.771 22.039 1.00 21.53 C ATOM 8329 CG1 ILE B 159 50.767 46.657 22.925 1.00 19.34 C ATOM 8330 CG2 ILE B 159 50.853 45.111 20.910 1.00 19.72 C ATOM 8331 CD1 ILE B 159 50.108 47.818 22.203 1.00 19.99 C ATOM 8332 HA ILE B 159 51.517 44.174 23.438 1.00 0.00 H ATOM 8333 HB ILE B 159 52.399 46.399 21.564 1.00 0.00 H ATOM 8334 HG12 ILE B 159 49.982 46.035 23.357 1.00 0.00 H ATOM 8335 HG13 ILE B 159 51.389 47.062 23.724 1.00 0.00 H ATOM 8336 HD11 ILE B 159 50.877 48.461 21.775 1.00 0.00 H ATOM 8337 HD12 ILE B 159 49.469 47.434 21.408 1.00 0.00 H ATOM 8338 HD13 ILE B 159 49.506 48.389 22.910 1.00 0.00 H ATOM 8339 HG21 ILE B 159 51.527 44.515 20.295 1.00 0.00 H ATOM 8340 HG22 ILE B 159 50.083 44.468 21.336 1.00 0.00 H ATOM 8341 HG23 ILE B 159 50.386 45.882 20.297 1.00 0.00 H ATOM 8342 H ILE B 159 53.779 46.158 23.597 1.00 0.00 H ATOM 8343 N ALA B 160 52.588 42.478 22.032 1.00 19.59 N ATOM 8344 CA ALA B 160 53.209 41.410 21.263 1.00 19.23 C ATOM 8345 C ALA B 160 52.169 40.990 20.212 1.00 25.20 C ATOM 8346 O ALA B 160 51.281 40.183 20.515 1.00 21.70 O ATOM 8347 CB ALA B 160 53.541 40.226 22.179 1.00 18.59 C ATOM 8348 HA ALA B 160 54.140 41.737 20.799 1.00 0.00 H ATOM 8349 HB1 ALA B 160 54.229 40.553 22.959 1.00 0.00 H ATOM 8350 HB2 ALA B 160 52.624 39.853 22.635 1.00 0.00 H ATOM 8351 HB3 ALA B 160 54.005 39.433 21.592 1.00 0.00 H ATOM 8352 H ALA B 160 51.713 42.274 22.556 1.00 0.00 H ATOM 8353 N THR B 161 52.276 41.558 19.003 1.00 23.12 N ATOM 8354 CA THR B 161 51.362 41.261 17.875 1.00 21.23 C ATOM 8355 C THR B 161 52.204 40.822 16.650 1.00 23.18 C ATOM 8356 O THR B 161 51.998 41.292 15.544 1.00 21.10 O ATOM 8357 CB THR B 161 50.446 42.473 17.565 1.00 23.51 C ATOM 8358 OG1 THR B 161 51.238 43.679 17.561 1.00 25.78 O ATOM 8359 CG2 THR B 161 49.373 42.638 18.657 1.00 19.36 C ATOM 8360 HA THR B 161 50.695 40.442 18.144 1.00 0.00 H ATOM 8361 HB THR B 161 49.973 42.301 16.598 1.00 0.00 H ATOM 8362 HG1 THR B 161 50.655 44.454 17.363 1.00 0.00 H ATOM 8363 HG23 THR B 161 48.751 41.743 18.692 1.00 0.00 H ATOM 8364 HG21 THR B 161 49.858 42.783 19.622 1.00 0.00 H ATOM 8365 HG22 THR B 161 48.753 43.504 18.427 1.00 0.00 H ATOM 8366 H THR B 161 53.042 42.244 18.848 1.00 0.00 H ATOM 8367 N ALA B 162 53.163 39.933 16.880 1.00 20.41 N ATOM 8368 CA ALA B 162 54.033 39.429 15.836 1.00 20.62 C ATOM 8369 C ALA B 162 54.646 40.628 15.130 1.00 26.63 C ATOM 8370 O ALA B 162 55.052 41.566 15.810 1.00 26.20 O ATOM 8371 CB ALA B 162 53.227 38.512 14.852 1.00 21.22 C ATOM 8372 HA ALA B 162 54.829 38.812 16.252 1.00 0.00 H ATOM 8373 HB1 ALA B 162 52.807 37.671 15.403 1.00 0.00 H ATOM 8374 HB2 ALA B 162 52.421 39.089 14.397 1.00 0.00 H ATOM 8375 HB3 ALA B 162 53.894 38.141 14.074 1.00 0.00 H ATOM 8376 H ALA B 162 53.296 39.583 17.850 1.00 0.00 H ATOM 8377 N ALA B 163 54.670 40.634 13.794 1.00 21.56 N ATOM 8378 CA ALA B 163 55.303 41.723 13.048 1.00 22.27 C ATOM 8379 C ALA B 163 54.646 43.065 13.182 1.00 25.05 C ATOM 8380 O ALA B 163 55.221 44.091 12.789 1.00 25.19 O ATOM 8381 CB ALA B 163 55.539 41.364 11.514 1.00 22.59 C ATOM 8382 HA ALA B 163 56.272 41.823 13.537 1.00 0.00 H ATOM 8383 HB1 ALA B 163 56.186 40.490 11.442 1.00 0.00 H ATOM 8384 HB2 ALA B 163 54.581 41.148 11.041 1.00 0.00 H ATOM 8385 HB3 ALA B 163 56.011 42.209 11.013 1.00 0.00 H ATOM 8386 H ALA B 163 54.230 39.849 13.273 1.00 0.00 H ATOM 8387 N THR B 164 53.467 43.100 13.789 1.00 19.90 N ATOM 8388 CA THR B 164 52.834 44.405 13.996 1.00 17.20 C ATOM 8389 C THR B 164 53.279 45.093 15.282 1.00 22.94 C ATOM 8390 O THR B 164 52.962 46.244 15.483 1.00 23.48 O ATOM 8391 CB THR B 164 51.316 44.286 13.932 1.00 23.82 C ATOM 8392 OG1 THR B 164 50.985 43.423 12.853 1.00 19.80 O ATOM 8393 CG2 THR B 164 50.659 45.641 13.722 1.00 22.48 C ATOM 8394 HA THR B 164 53.170 45.045 13.180 1.00 0.00 H ATOM 8395 HB THR B 164 50.950 43.886 14.878 1.00 0.00 H ATOM 8396 HG1 THR B 164 50.001 43.332 12.794 1.00 0.00 H ATOM 8397 HG23 THR B 164 50.915 46.300 14.552 1.00 0.00 H ATOM 8398 HG21 THR B 164 51.015 46.075 12.788 1.00 0.00 H ATOM 8399 HG22 THR B 164 49.577 45.516 13.677 1.00 0.00 H ATOM 8400 H THR B 164 53.005 42.225 14.109 1.00 0.00 H ATOM 8401 N SER B 165 54.024 44.390 16.143 1.00 20.48 N ATOM 8402 CA SER B 165 54.367 44.890 17.486 1.00 18.60 C ATOM 8403 C SER B 165 54.948 46.303 17.542 1.00 22.84 C ATOM 8404 O SER B 165 54.533 47.131 18.332 1.00 21.35 O ATOM 8405 CB SER B 165 55.351 43.917 18.148 1.00 19.42 C ATOM 8406 OG SER B 165 54.747 42.644 18.275 1.00 22.44 O ATOM 8407 HA SER B 165 53.418 44.949 18.019 1.00 0.00 H ATOM 8408 HB2 SER B 165 55.622 44.290 19.136 1.00 0.00 H ATOM 8409 HB3 SER B 165 56.248 43.834 17.534 1.00 0.00 H ATOM 8410 HG SER B 165 54.502 42.305 17.378 1.00 0.00 H ATOM 8411 H SER B 165 54.374 43.455 15.853 1.00 0.00 H ATOM 8412 N GLY B 166 55.980 46.552 16.755 1.00 24.11 N ATOM 8413 CA GLY B 166 56.636 47.855 16.809 1.00 23.10 C ATOM 8414 C GLY B 166 55.704 49.003 16.530 1.00 25.04 C ATOM 8415 O GLY B 166 55.803 50.060 17.155 1.00 25.92 O ATOM 8416 HA3 GLY B 166 57.436 47.871 16.069 1.00 0.00 H ATOM 8417 HA2 GLY B 166 57.061 47.988 17.804 1.00 0.00 H ATOM 8418 H GLY B 166 56.324 45.822 16.099 1.00 0.00 H ATOM 8419 N VAL B 167 54.855 48.850 15.523 1.00 20.93 N ATOM 8420 CA VAL B 167 53.897 49.908 15.213 1.00 21.28 C ATOM 8421 C VAL B 167 52.872 50.032 16.343 1.00 24.89 C ATOM 8422 O VAL B 167 52.514 51.136 16.712 1.00 24.69 O ATOM 8423 CB VAL B 167 53.185 49.670 13.865 1.00 25.66 C ATOM 8424 CG1 VAL B 167 51.854 50.417 13.841 1.00 25.59 C ATOM 8425 CG2 VAL B 167 54.072 50.102 12.704 1.00 24.58 C ATOM 8426 HA VAL B 167 54.453 50.841 15.123 1.00 0.00 H ATOM 8427 HB VAL B 167 52.988 48.604 13.755 1.00 0.00 H ATOM 8428 HG11 VAL B 167 51.221 50.055 14.651 1.00 0.00 H ATOM 8429 HG12 VAL B 167 52.035 51.484 13.969 1.00 0.00 H ATOM 8430 HG13 VAL B 167 51.358 50.243 12.886 1.00 0.00 H ATOM 8431 HG21 VAL B 167 54.302 51.163 12.799 1.00 0.00 H ATOM 8432 HG22 VAL B 167 54.997 49.526 12.721 1.00 0.00 H ATOM 8433 HG23 VAL B 167 53.550 49.925 11.764 1.00 0.00 H ATOM 8434 H VAL B 167 54.871 47.979 14.955 1.00 0.00 H ATOM 8435 N HIS B 168 52.358 48.906 16.866 1.00 19.95 N ATOM 8436 CA HIS B 168 51.339 49.003 17.917 1.00 18.05 C ATOM 8437 C HIS B 168 51.915 49.668 19.159 1.00 20.63 C ATOM 8438 O HIS B 168 51.260 50.463 19.836 1.00 22.29 O ATOM 8439 CB HIS B 168 50.764 47.624 18.322 1.00 17.60 C ATOM 8440 CG HIS B 168 49.716 47.092 17.386 1.00 21.20 C ATOM 8441 ND1 HIS B 168 49.532 45.734 17.166 1.00 22.43 N ATOM 8442 CD2 HIS B 168 48.800 47.727 16.615 1.00 23.64 C ATOM 8443 CE1 HIS B 168 48.536 45.562 16.316 1.00 23.19 C ATOM 8444 NE2 HIS B 168 48.054 46.754 15.988 1.00 24.13 N ATOM 8445 HA HIS B 168 50.530 49.603 17.500 1.00 0.00 H ATOM 8446 HB2 HIS B 168 51.585 46.908 18.357 1.00 0.00 H ATOM 8447 HB3 HIS B 168 50.321 47.716 19.314 1.00 0.00 H ATOM 8448 HD2 HIS B 168 48.677 48.805 16.511 1.00 0.00 H ATOM 8449 HE1 HIS B 168 48.172 44.603 15.947 1.00 0.00 H ATOM 8450 H HIS B 168 52.679 47.976 16.529 1.00 0.00 H ATOM 8451 N ASN B 169 53.115 49.262 19.526 1.00 17.17 N ATOM 8452 CA ASN B 169 53.707 49.825 20.743 1.00 18.52 C ATOM 8453 C ASN B 169 53.950 51.323 20.590 1.00 22.92 C ATOM 8454 O ASN B 169 53.691 52.099 21.500 1.00 21.95 O ATOM 8455 CB ASN B 169 55.019 49.117 21.038 1.00 18.26 C ATOM 8456 CG ASN B 169 54.806 47.827 21.769 1.00 24.14 C ATOM 8457 OD1 ASN B 169 54.389 47.842 22.913 1.00 22.87 O ATOM 8458 ND2 ASN B 169 55.136 46.694 21.120 1.00 18.90 N ATOM 8459 HA ASN B 169 53.012 49.677 21.570 1.00 0.00 H ATOM 8460 HB2 ASN B 169 55.527 48.909 20.096 1.00 0.00 H ATOM 8461 HB3 ASN B 169 55.642 49.770 21.649 1.00 0.00 H ATOM 8462 HD22 ASN B 169 55.488 46.738 20.142 1.00 0.00 H ATOM 8463 HD21 ASN B 169 55.039 45.775 21.597 1.00 0.00 H ATOM 8464 H ASN B 169 53.631 48.556 18.963 1.00 0.00 H ATOM 8465 N ILE B 170 54.461 51.730 19.435 1.00 22.09 N ATOM 8466 CA ILE B 170 54.654 53.166 19.186 1.00 22.30 C ATOM 8467 C ILE B 170 53.304 53.901 19.184 1.00 27.22 C ATOM 8468 O ILE B 170 53.169 54.960 19.790 1.00 27.00 O ATOM 8469 CB ILE B 170 55.454 53.409 17.867 1.00 24.96 C ATOM 8470 CG1 ILE B 170 56.920 53.005 18.066 1.00 24.66 C ATOM 8471 CG2 ILE B 170 55.397 54.871 17.465 1.00 23.35 C ATOM 8472 CD1 ILE B 170 57.654 52.663 16.708 1.00 23.53 C ATOM 8473 HA ILE B 170 55.252 53.578 19.999 1.00 0.00 H ATOM 8474 HB ILE B 170 55.003 52.805 17.080 1.00 0.00 H ATOM 8475 HG12 ILE B 170 57.446 53.829 18.548 1.00 0.00 H ATOM 8476 HG13 ILE B 170 56.955 52.127 18.711 1.00 0.00 H ATOM 8477 HD11 ILE B 170 57.144 51.833 16.220 1.00 0.00 H ATOM 8478 HD12 ILE B 170 57.635 53.537 16.056 1.00 0.00 H ATOM 8479 HD13 ILE B 170 58.687 52.385 16.915 1.00 0.00 H ATOM 8480 HG21 ILE B 170 54.359 55.163 17.306 1.00 0.00 H ATOM 8481 HG22 ILE B 170 55.830 55.482 18.257 1.00 0.00 H ATOM 8482 HG23 ILE B 170 55.961 55.015 16.544 1.00 0.00 H ATOM 8483 H ILE B 170 54.724 51.035 18.708 1.00 0.00 H ATOM 8484 N GLY B 171 52.315 53.351 18.482 1.00 21.99 N ATOM 8485 CA GLY B 171 50.990 53.950 18.396 1.00 21.24 C ATOM 8486 C GLY B 171 50.321 54.070 19.755 1.00 26.35 C ATOM 8487 O GLY B 171 49.794 55.117 20.071 1.00 26.90 O ATOM 8488 HA3 GLY B 171 50.366 53.330 17.752 1.00 0.00 H ATOM 8489 HA2 GLY B 171 51.083 54.945 17.962 1.00 0.00 H ATOM 8490 H GLY B 171 52.495 52.460 17.976 1.00 0.00 H ATOM 8491 N HIS B 172 50.353 53.014 20.576 1.00 22.53 N ATOM 8492 CA HIS B 172 49.725 53.100 21.906 1.00 21.63 C ATOM 8493 C HIS B 172 50.474 53.955 22.925 1.00 27.05 C ATOM 8494 O HIS B 172 49.865 54.576 23.808 1.00 24.20 O ATOM 8495 CB HIS B 172 49.314 51.718 22.416 1.00 19.65 C ATOM 8496 CG HIS B 172 48.116 51.187 21.693 1.00 21.25 C ATOM 8497 ND1 HIS B 172 46.853 51.701 21.891 1.00 22.81 N ATOM 8498 CD2 HIS B 172 48.009 50.302 20.678 1.00 21.84 C ATOM 8499 CE1 HIS B 172 46.019 51.159 21.026 1.00 22.29 C ATOM 8500 NE2 HIS B 172 46.689 50.280 20.298 1.00 22.28 N ATOM 8501 HA HIS B 172 48.806 53.670 21.767 1.00 0.00 H ATOM 8502 HB2 HIS B 172 50.146 51.028 22.273 1.00 0.00 H ATOM 8503 HB3 HIS B 172 49.081 51.790 23.478 1.00 0.00 H ATOM 8504 HD2 HIS B 172 48.818 49.716 20.242 1.00 0.00 H ATOM 8505 HE1 HIS B 172 44.959 51.394 20.927 1.00 0.00 H ATOM 8506 H HIS B 172 50.820 52.135 20.276 1.00 0.00 H ATOM 8507 N ALA B 173 51.786 54.077 22.743 1.00 25.07 N ATOM 8508 CA ALA B 173 52.565 54.978 23.606 1.00 23.06 C ATOM 8509 C ALA B 173 52.067 56.401 23.330 1.00 26.11 C ATOM 8510 O ALA B 173 51.856 57.207 24.249 1.00 25.74 O ATOM 8511 CB ALA B 173 54.079 54.853 23.293 1.00 22.31 C ATOM 8512 HA ALA B 173 52.433 54.723 24.657 1.00 0.00 H ATOM 8513 HB1 ALA B 173 54.401 53.827 23.468 1.00 0.00 H ATOM 8514 HB2 ALA B 173 54.256 55.118 22.251 1.00 0.00 H ATOM 8515 HB3 ALA B 173 54.640 55.527 23.941 1.00 0.00 H ATOM 8516 H ALA B 173 52.260 53.536 21.992 1.00 0.00 H ATOM 8517 N ALA B 174 51.858 56.694 22.053 1.00 23.94 N ATOM 8518 CA ALA B 174 51.350 58.009 21.643 1.00 23.64 C ATOM 8519 C ALA B 174 49.957 58.218 22.256 1.00 28.97 C ATOM 8520 O ALA B 174 49.641 59.296 22.786 1.00 26.54 O ATOM 8521 CB ALA B 174 51.280 58.103 20.120 1.00 22.79 C ATOM 8522 HA ALA B 174 52.026 58.787 21.998 1.00 0.00 H ATOM 8523 HB1 ALA B 174 52.277 57.961 19.702 1.00 0.00 H ATOM 8524 HB2 ALA B 174 50.612 57.330 19.740 1.00 0.00 H ATOM 8525 HB3 ALA B 174 50.901 59.085 19.835 1.00 0.00 H ATOM 8526 H ALA B 174 52.058 55.977 21.327 1.00 0.00 H ATOM 8527 N ARG B 175 49.098 57.213 22.125 1.00 26.93 N ATOM 8528 CA ARG B 175 47.743 57.333 22.683 1.00 26.80 C ATOM 8529 C ARG B 175 47.821 57.630 24.172 1.00 29.22 C ATOM 8530 O ARG B 175 47.084 58.474 24.679 1.00 28.39 O ATOM 8531 CB ARG B 175 46.936 56.049 22.456 1.00 25.73 C ATOM 8532 CG ARG B 175 46.639 55.782 20.997 1.00 26.08 C ATOM 8533 CD ARG B 175 45.610 56.770 20.445 1.00 29.17 C ATOM 8534 NE ARG B 175 44.930 56.201 19.284 1.00 28.54 N ATOM 8535 CZ ARG B 175 45.041 56.670 18.047 1.00 34.85 C ATOM 8536 NH1 ARG B 175 45.812 57.733 17.782 1.00 29.48 N ATOM 8537 NH2 ARG B 175 44.393 56.061 17.072 1.00 26.73 N ATOM 8538 HA ARG B 175 47.237 58.152 22.172 1.00 0.00 H ATOM 8539 HB2 ARG B 175 47.504 55.208 22.854 1.00 0.00 H ATOM 8540 HB3 ARG B 175 45.991 56.134 22.992 1.00 0.00 H ATOM 8541 HG2 ARG B 175 47.562 55.874 20.425 1.00 0.00 H ATOM 8542 HG3 ARG B 175 46.249 54.769 20.894 1.00 0.00 H ATOM 8543 HD2 ARG B 175 46.116 57.689 20.150 1.00 0.00 H ATOM 8544 HD3 ARG B 175 44.875 56.993 21.218 1.00 0.00 H ATOM 8545 HE ARG B 175 44.318 55.374 19.437 1.00 0.00 H ATOM 8546 HH12 ARG B 175 45.889 58.089 16.808 1.00 0.00 H ATOM 8547 HH11 ARG B 175 46.333 58.202 18.550 1.00 0.00 H ATOM 8548 HH22 ARG B 175 44.469 56.415 16.097 1.00 0.00 H ATOM 8549 HH21 ARG B 175 43.807 55.227 17.279 1.00 0.00 H ATOM 8550 H ARG B 175 49.383 56.344 21.629 1.00 0.00 H ATOM 8551 N ILE B 176 48.693 56.895 24.874 1.00 25.02 N ATOM 8552 CA ILE B 176 48.874 57.057 26.321 1.00 24.31 C ATOM 8553 C ILE B 176 49.255 58.498 26.667 1.00 30.47 C ATOM 8554 O ILE B 176 48.754 59.090 27.633 1.00 30.17 O ATOM 8555 CB ILE B 176 49.895 56.008 26.854 1.00 26.51 C ATOM 8556 CG1 ILE B 176 49.228 54.623 26.907 1.00 25.86 C ATOM 8557 CG2 ILE B 176 50.429 56.368 28.225 1.00 26.59 C ATOM 8558 CD1 ILE B 176 50.225 53.510 27.129 1.00 22.78 C ATOM 8559 HA ILE B 176 47.928 56.866 26.827 1.00 0.00 H ATOM 8560 HB ILE B 176 50.741 55.996 26.167 1.00 0.00 H ATOM 8561 HG12 ILE B 176 48.505 54.614 27.723 1.00 0.00 H ATOM 8562 HG13 ILE B 176 48.711 54.447 25.964 1.00 0.00 H ATOM 8563 HD11 ILE B 176 50.949 53.504 26.314 1.00 0.00 H ATOM 8564 HD12 ILE B 176 50.743 53.671 28.075 1.00 0.00 H ATOM 8565 HD13 ILE B 176 49.701 52.555 27.158 1.00 0.00 H ATOM 8566 HG21 ILE B 176 50.932 57.334 28.176 1.00 0.00 H ATOM 8567 HG22 ILE B 176 49.602 56.424 28.933 1.00 0.00 H ATOM 8568 HG23 ILE B 176 51.136 55.605 28.550 1.00 0.00 H ATOM 8569 H ILE B 176 49.263 56.183 24.375 1.00 0.00 H ATOM 8570 N ILE B 177 50.157 59.070 25.882 1.00 27.33 N ATOM 8571 CA ILE B 177 50.586 60.461 26.125 1.00 26.30 C ATOM 8572 C ILE B 177 49.435 61.380 25.774 1.00 30.55 C ATOM 8573 O ILE B 177 49.078 62.283 26.516 1.00 32.77 O ATOM 8574 CB ILE B 177 51.833 60.821 25.251 1.00 27.81 C ATOM 8575 CG1 ILE B 177 53.065 60.060 25.760 1.00 25.99 C ATOM 8576 CG2 ILE B 177 52.051 62.358 25.221 1.00 27.53 C ATOM 8577 CD1 ILE B 177 54.210 59.992 24.742 1.00 29.93 C ATOM 8578 HA ILE B 177 50.865 60.577 27.172 1.00 0.00 H ATOM 8579 HB ILE B 177 51.660 60.509 24.221 1.00 0.00 H ATOM 8580 HG12 ILE B 177 53.431 60.558 26.658 1.00 0.00 H ATOM 8581 HG13 ILE B 177 52.763 59.042 26.008 1.00 0.00 H ATOM 8582 HD11 ILE B 177 53.864 59.486 23.841 1.00 0.00 H ATOM 8583 HD12 ILE B 177 54.532 61.003 24.491 1.00 0.00 H ATOM 8584 HD13 ILE B 177 55.045 59.439 25.173 1.00 0.00 H ATOM 8585 HG21 ILE B 177 51.170 62.840 24.798 1.00 0.00 H ATOM 8586 HG22 ILE B 177 52.213 62.721 26.236 1.00 0.00 H ATOM 8587 HG23 ILE B 177 52.923 62.588 24.608 1.00 0.00 H ATOM 8588 H ILE B 177 50.565 58.535 25.089 1.00 0.00 H ATOM 8589 N ALA B 178 48.852 61.163 24.619 1.00 25.25 N ATOM 8590 CA ALA B 178 47.774 62.042 24.210 1.00 24.96 C ATOM 8591 C ALA B 178 46.584 61.981 25.162 1.00 31.57 C ATOM 8592 O ALA B 178 45.871 62.963 25.314 1.00 32.41 O ATOM 8593 CB ALA B 178 47.361 61.777 22.776 1.00 24.82 C ATOM 8594 HA ALA B 178 48.158 63.061 24.259 1.00 0.00 H ATOM 8595 HB1 ALA B 178 48.213 61.943 22.117 1.00 0.00 H ATOM 8596 HB2 ALA B 178 47.023 60.745 22.681 1.00 0.00 H ATOM 8597 HB3 ALA B 178 46.551 62.453 22.502 1.00 0.00 H ATOM 8598 H ALA B 178 49.157 60.377 24.010 1.00 0.00 H ATOM 8599 N TYR B 179 46.373 60.832 25.804 1.00 28.54 N ATOM 8600 CA TYR B 179 45.248 60.650 26.718 1.00 27.64 C ATOM 8601 C TYR B 179 45.514 61.449 27.971 1.00 30.97 C ATOM 8602 O TYR B 179 44.599 61.937 28.601 1.00 28.92 O ATOM 8603 CB TYR B 179 45.055 59.172 27.097 1.00 27.58 C ATOM 8604 CG TYR B 179 43.824 58.908 27.981 1.00 27.37 C ATOM 8605 CD1 TYR B 179 42.548 58.861 27.429 1.00 28.00 C ATOM 8606 CD2 TYR B 179 43.953 58.715 29.350 1.00 28.39 C ATOM 8607 CE1 TYR B 179 41.419 58.613 28.233 1.00 32.35 C ATOM 8608 CE2 TYR B 179 42.821 58.507 30.170 1.00 29.71 C ATOM 8609 CZ TYR B 179 41.569 58.439 29.603 1.00 33.64 C ATOM 8610 OH TYR B 179 40.465 58.172 30.399 1.00 32.92 O ATOM 8611 HA TYR B 179 44.340 60.990 26.219 1.00 0.00 H ATOM 8612 HB3 TYR B 179 45.942 58.837 27.635 1.00 0.00 H ATOM 8613 HB2 TYR B 179 44.949 58.594 26.179 1.00 0.00 H ATOM 8614 HD2 TYR B 179 44.946 58.724 29.800 1.00 0.00 H ATOM 8615 HE2 TYR B 179 42.939 58.401 31.248 1.00 0.00 H ATOM 8616 HE1 TYR B 179 40.429 58.558 27.781 1.00 0.00 H ATOM 8617 HD1 TYR B 179 42.420 59.019 26.358 1.00 0.00 H ATOM 8618 HH TYR B 179 39.650 58.159 29.837 1.00 0.00 H ATOM 8619 H TYR B 179 47.030 60.041 25.649 1.00 0.00 H ATOM 8620 N GLY B 180 46.782 61.554 28.340 1.00 29.82 N ATOM 8621 CA GLY B 180 47.192 62.296 29.518 1.00 28.85 C ATOM 8622 C GLY B 180 47.840 61.417 30.568 1.00 31.29 C ATOM 8623 O GLY B 180 48.193 61.902 31.629 1.00 29.22 O ATOM 8624 HA3 GLY B 180 46.313 62.771 29.955 1.00 0.00 H ATOM 8625 HA2 GLY B 180 47.906 63.063 29.216 1.00 0.00 H ATOM 8626 H GLY B 180 47.511 61.087 27.764 1.00 0.00 H ATOM 8627 N ASP B 181 48.007 60.124 30.291 1.00 25.97 N ATOM 8628 CA ASP B 181 48.591 59.230 31.299 1.00 25.47 C ATOM 8629 C ASP B 181 50.120 59.318 31.401 1.00 30.25 C ATOM 8630 O ASP B 181 50.739 58.731 32.297 1.00 29.41 O ATOM 8631 CB ASP B 181 48.199 57.789 31.005 1.00 27.18 C ATOM 8632 CG ASP B 181 46.755 57.468 31.395 1.00 33.92 C ATOM 8633 OD1 ASP B 181 46.197 58.129 32.324 1.00 31.91 O ATOM 8634 OD2 ASP B 181 46.242 56.461 30.851 1.00 30.85 O ATOM 8635 HA ASP B 181 48.189 59.561 32.257 1.00 0.00 H ATOM 8636 HB2 ASP B 181 48.319 57.608 29.937 1.00 0.00 H ATOM 8637 HB3 ASP B 181 48.864 57.128 31.561 1.00 0.00 H ATOM 8638 H ASP B 181 47.724 59.749 29.363 1.00 0.00 H ATOM 8639 N ALA B 182 50.738 60.075 30.502 1.00 28.25 N ATOM 8640 CA ALA B 182 52.197 60.208 30.510 1.00 26.64 C ATOM 8641 C ALA B 182 52.562 61.432 29.704 1.00 30.92 C ATOM 8642 O ALA B 182 51.765 61.891 28.899 1.00 29.29 O ATOM 8643 CB ALA B 182 52.820 58.999 29.844 1.00 27.09 C ATOM 8644 HA ALA B 182 52.556 60.290 31.536 1.00 0.00 H ATOM 8645 HB1 ALA B 182 52.534 58.099 30.388 1.00 0.00 H ATOM 8646 HB2 ALA B 182 52.467 58.931 28.815 1.00 0.00 H ATOM 8647 HB3 ALA B 182 53.905 59.101 29.851 1.00 0.00 H ATOM 8648 H ALA B 182 50.180 60.579 29.784 1.00 0.00 H ATOM 8649 N ASP B 183 53.773 61.950 29.899 1.00 28.92 N ATOM 8650 CA ASP B 183 54.240 63.074 29.072 1.00 28.26 C ATOM 8651 C ASP B 183 55.325 62.541 28.126 1.00 29.37 C ATOM 8652 O ASP B 183 55.651 63.171 27.128 1.00 26.73 O ATOM 8653 CB ASP B 183 54.875 64.157 29.951 1.00 30.06 C ATOM 8654 CG ASP B 183 53.872 64.843 30.854 1.00 31.18 C ATOM 8655 OD1 ASP B 183 52.718 65.066 30.413 1.00 31.33 O ATOM 8656 OD2 ASP B 183 54.256 65.141 31.997 1.00 33.97 O ATOM 8657 HA ASP B 183 53.397 63.498 28.527 1.00 0.00 H ATOM 8658 HB2 ASP B 183 55.644 63.696 30.571 1.00 0.00 H ATOM 8659 HB3 ASP B 183 55.332 64.907 29.305 1.00 0.00 H ATOM 8660 H ASP B 183 54.391 61.559 30.638 1.00 0.00 H ATOM 8661 N VAL B 184 55.948 61.428 28.520 1.00 26.95 N ATOM 8662 CA VAL B 184 57.053 60.824 27.761 1.00 26.48 C ATOM 8663 C VAL B 184 56.928 59.323 27.782 1.00 27.57 C ATOM 8664 O VAL B 184 56.590 58.737 28.807 1.00 25.85 O ATOM 8665 CB VAL B 184 58.414 61.191 28.379 1.00 31.45 C ATOM 8666 CG1 VAL B 184 59.572 60.586 27.564 1.00 31.66 C ATOM 8667 CG2 VAL B 184 58.555 62.706 28.498 1.00 32.26 C ATOM 8668 HA VAL B 184 56.999 61.204 26.741 1.00 0.00 H ATOM 8669 HB VAL B 184 58.461 60.766 29.382 1.00 0.00 H ATOM 8670 HG11 VAL B 184 59.476 59.500 27.549 1.00 0.00 H ATOM 8671 HG12 VAL B 184 59.536 60.969 26.544 1.00 0.00 H ATOM 8672 HG13 VAL B 184 60.521 60.862 28.024 1.00 0.00 H ATOM 8673 HG21 VAL B 184 58.482 63.155 27.508 1.00 0.00 H ATOM 8674 HG22 VAL B 184 57.760 63.095 29.134 1.00 0.00 H ATOM 8675 HG23 VAL B 184 59.523 62.946 28.937 1.00 0.00 H ATOM 8676 H VAL B 184 55.639 60.969 29.401 1.00 0.00 H ATOM 8677 N MET B 185 57.275 58.684 26.674 1.00 24.49 N ATOM 8678 CA MET B 185 57.276 57.214 26.653 1.00 22.09 C ATOM 8679 C MET B 185 58.423 56.778 25.764 1.00 24.49 C ATOM 8680 O MET B 185 58.594 57.333 24.711 1.00 25.65 O ATOM 8681 CB MET B 185 55.935 56.687 26.063 1.00 22.62 C ATOM 8682 CG MET B 185 54.662 57.031 26.904 1.00 24.79 C ATOM 8683 SD MET B 185 54.590 55.970 28.357 1.00 28.54 S ATOM 8684 CE MET B 185 54.108 54.398 27.569 1.00 26.43 C ATOM 8685 HA MET B 185 57.387 56.818 27.662 1.00 0.00 H ATOM 8686 HB2 MET B 185 55.810 57.117 25.069 1.00 0.00 H ATOM 8687 HB3 MET B 185 56.004 55.602 25.982 1.00 0.00 H ATOM 8688 HG2 MET B 185 53.772 56.873 26.295 1.00 0.00 H ATOM 8689 HG3 MET B 185 54.706 58.074 27.218 1.00 0.00 H ATOM 8690 HE1 MET B 185 53.151 54.525 27.063 1.00 0.00 H ATOM 8691 HE2 MET B 185 54.868 54.108 26.844 1.00 0.00 H ATOM 8692 HE3 MET B 185 54.017 53.624 28.331 1.00 0.00 H ATOM 8693 H MET B 185 57.545 59.219 25.824 1.00 0.00 H ATOM 8694 N VAL B 186 59.183 55.783 26.184 1.00 20.74 N ATOM 8695 CA VAL B 186 60.165 55.126 25.322 1.00 21.86 C ATOM 8696 C VAL B 186 59.369 53.940 24.736 1.00 25.25 C ATOM 8697 O VAL B 186 58.827 53.115 25.490 1.00 25.24 O ATOM 8698 CB VAL B 186 61.388 54.583 26.095 1.00 28.75 C ATOM 8699 CG1 VAL B 186 62.499 54.178 25.089 1.00 27.43 C ATOM 8700 CG2 VAL B 186 61.898 55.603 27.048 1.00 31.48 C ATOM 8701 HA VAL B 186 60.574 55.820 24.587 1.00 0.00 H ATOM 8702 HB VAL B 186 61.086 53.706 26.667 1.00 0.00 H ATOM 8703 HG11 VAL B 186 62.118 53.405 24.421 1.00 0.00 H ATOM 8704 HG12 VAL B 186 62.795 55.050 24.506 1.00 0.00 H ATOM 8705 HG13 VAL B 186 63.361 53.795 25.636 1.00 0.00 H ATOM 8706 HG21 VAL B 186 62.195 56.496 26.498 1.00 0.00 H ATOM 8707 HG22 VAL B 186 61.113 55.857 27.760 1.00 0.00 H ATOM 8708 HG23 VAL B 186 62.759 55.201 27.582 1.00 0.00 H ATOM 8709 H VAL B 186 59.079 55.454 27.165 1.00 0.00 H ATOM 8710 N ALA B 187 59.302 53.858 23.410 1.00 22.91 N ATOM 8711 CA ALA B 187 58.491 52.863 22.711 1.00 21.71 C ATOM 8712 C ALA B 187 59.253 52.181 21.577 1.00 26.02 C ATOM 8713 O ALA B 187 60.043 52.822 20.876 1.00 22.44 O ATOM 8714 CB ALA B 187 57.236 53.595 22.121 1.00 21.88 C ATOM 8715 HA ALA B 187 58.210 52.086 23.421 1.00 0.00 H ATOM 8716 HB1 ALA B 187 56.665 54.046 22.933 1.00 0.00 H ATOM 8717 HB2 ALA B 187 57.562 54.372 21.429 1.00 0.00 H ATOM 8718 HB3 ALA B 187 56.612 52.874 21.593 1.00 0.00 H ATOM 8719 H ALA B 187 59.853 54.534 22.844 1.00 0.00 H ATOM 8720 N GLY B 188 58.933 50.917 21.301 1.00 23.14 N ATOM 8721 CA GLY B 188 59.624 50.241 20.218 1.00 22.12 C ATOM 8722 C GLY B 188 59.488 48.747 20.310 1.00 23.28 C ATOM 8723 O GLY B 188 58.500 48.254 20.867 1.00 19.06 O ATOM 8724 HA3 GLY B 188 60.682 50.502 20.258 1.00 0.00 H ATOM 8725 HA2 GLY B 188 59.204 50.575 19.269 1.00 0.00 H ATOM 8726 H GLY B 188 58.201 50.424 21.852 1.00 0.00 H ATOM 8727 N GLY B 189 60.481 48.030 19.788 1.00 20.17 N ATOM 8728 CA GLY B 189 60.456 46.581 19.793 1.00 20.54 C ATOM 8729 C GLY B 189 61.851 46.039 19.639 1.00 24.04 C ATOM 8730 O GLY B 189 62.739 46.714 19.130 1.00 22.62 O ATOM 8731 HA3 GLY B 189 59.839 46.228 18.967 1.00 0.00 H ATOM 8732 HA2 GLY B 189 60.035 46.231 20.735 1.00 0.00 H ATOM 8733 H GLY B 189 61.295 48.522 19.366 1.00 0.00 H ATOM 8734 N ALA B 190 62.023 44.786 20.021 1.00 20.40 N ATOM 8735 CA ALA B 190 63.319 44.139 19.961 1.00 21.12 C ATOM 8736 C ALA B 190 63.058 42.682 19.600 1.00 22.11 C ATOM 8737 O ALA B 190 62.059 42.093 20.026 1.00 22.04 O ATOM 8738 CB ALA B 190 64.014 44.252 21.359 1.00 22.10 C ATOM 8739 HA ALA B 190 63.975 44.602 19.224 1.00 0.00 H ATOM 8740 HB1 ALA B 190 64.140 45.304 21.617 1.00 0.00 H ATOM 8741 HB2 ALA B 190 63.395 43.764 22.112 1.00 0.00 H ATOM 8742 HB3 ALA B 190 64.989 43.767 21.319 1.00 0.00 H ATOM 8743 H ALA B 190 61.206 44.249 20.375 1.00 0.00 H ATOM 8744 N GLU B 191 63.967 42.100 18.832 1.00 19.02 N ATOM 8745 CA GLU B 191 63.842 40.714 18.399 1.00 18.93 C ATOM 8746 C GLU B 191 65.188 40.076 18.126 1.00 23.62 C ATOM 8747 O GLU B 191 66.070 40.689 17.515 1.00 23.11 O ATOM 8748 CB GLU B 191 63.017 40.681 17.082 1.00 20.29 C ATOM 8749 CG GLU B 191 62.320 39.321 16.840 1.00 18.75 C ATOM 8750 CD GLU B 191 61.004 39.193 17.630 1.00 23.84 C ATOM 8751 OE1 GLU B 191 60.102 40.027 17.464 1.00 24.81 O ATOM 8752 OE2 GLU B 191 60.851 38.207 18.366 1.00 25.31 O ATOM 8753 HA GLU B 191 63.356 40.157 19.200 1.00 0.00 H ATOM 8754 HB2 GLU B 191 62.255 41.459 17.129 1.00 0.00 H ATOM 8755 HB3 GLU B 191 63.688 40.882 16.246 1.00 0.00 H ATOM 8756 HG2 GLU B 191 62.102 39.222 15.777 1.00 0.00 H ATOM 8757 HG3 GLU B 191 62.994 38.521 17.148 1.00 0.00 H ATOM 8758 H GLU B 191 64.796 42.650 18.528 1.00 0.00 H ATOM 8759 N LYS B 192 65.317 38.810 18.489 1.00 21.04 N ATOM 8760 CA LYS B 192 66.488 38.007 18.131 1.00 20.43 C ATOM 8761 C LYS B 192 66.001 36.573 17.905 1.00 24.03 C ATOM 8762 O LYS B 192 66.254 35.672 18.714 1.00 23.99 O ATOM 8763 CB LYS B 192 67.561 38.040 19.209 1.00 20.86 C ATOM 8764 CG LYS B 192 68.973 37.863 18.646 1.00 20.30 C ATOM 8765 CD LYS B 192 69.291 36.425 18.218 1.00 25.00 C ATOM 8766 CE LYS B 192 70.797 36.293 17.830 1.00 23.92 C ATOM 8767 NZ LYS B 192 71.035 34.964 17.244 1.00 30.15 N ATOM 8768 HA LYS B 192 66.948 38.416 17.232 1.00 0.00 H ATOM 8769 HB2 LYS B 192 67.509 38.999 19.724 1.00 0.00 H ATOM 8770 HB3 LYS B 192 67.366 37.237 19.920 1.00 0.00 H ATOM 8771 HG2 LYS B 192 69.081 38.513 17.777 1.00 0.00 H ATOM 8772 HG3 LYS B 192 69.689 38.160 19.412 1.00 0.00 H ATOM 8773 HD2 LYS B 192 69.072 35.748 19.043 1.00 0.00 H ATOM 8774 HD3 LYS B 192 68.674 36.161 17.359 1.00 0.00 H ATOM 8775 HE2 LYS B 192 71.414 36.414 18.720 1.00 0.00 H ATOM 8776 HE3 LYS B 192 71.055 37.063 17.103 1.00 0.00 H ATOM 8777 HZ1 LYS B 192 70.789 34.231 17.939 1.00 0.00 H ATOM 8778 HZ2 LYS B 192 70.445 34.850 16.395 1.00 0.00 H ATOM 8779 HZ3 LYS B 192 72.038 34.875 16.985 1.00 0.00 H ATOM 8780 H LYS B 192 64.559 38.369 19.049 1.00 0.00 H ATOM 8781 N ALA B 193 65.341 36.381 16.775 1.00 20.45 N ATOM 8782 CA ALA B 193 64.733 35.100 16.432 1.00 20.98 C ATOM 8783 C ALA B 193 65.575 34.228 15.478 1.00 25.88 C ATOM 8784 O ALA B 193 65.122 33.179 15.023 1.00 25.95 O ATOM 8785 CB ALA B 193 63.292 35.335 15.899 1.00 21.89 C ATOM 8786 HA ALA B 193 64.688 34.514 17.350 1.00 0.00 H ATOM 8787 HB1 ALA B 193 62.697 35.825 16.669 1.00 0.00 H ATOM 8788 HB2 ALA B 193 63.333 35.967 15.012 1.00 0.00 H ATOM 8789 HB3 ALA B 193 62.840 34.377 15.643 1.00 0.00 H ATOM 8790 H ALA B 193 65.252 37.173 16.106 1.00 0.00 H ATOM 8791 N SER B 194 66.841 34.602 15.278 1.00 23.05 N ATOM 8792 CA SER B 194 67.740 33.828 14.426 1.00 22.87 C ATOM 8793 C SER B 194 68.350 32.690 15.234 1.00 27.70 C ATOM 8794 O SER B 194 69.564 32.658 15.483 1.00 26.20 O ATOM 8795 CB SER B 194 68.839 34.732 13.822 1.00 24.07 C ATOM 8796 OG SER B 194 69.572 35.425 14.840 1.00 28.58 O ATOM 8797 HA SER B 194 67.171 33.407 13.597 1.00 0.00 H ATOM 8798 HB2 SER B 194 68.372 35.463 13.162 1.00 0.00 H ATOM 8799 HB3 SER B 194 69.529 34.114 13.247 1.00 0.00 H ATOM 8800 HG SER B 194 68.952 35.993 15.363 1.00 0.00 H ATOM 8801 H SER B 194 67.195 35.464 15.739 1.00 0.00 H ATOM 8802 N THR B 195 67.493 31.742 15.628 1.00 24.17 N ATOM 8803 CA THR B 195 67.900 30.598 16.423 1.00 22.92 C ATOM 8804 C THR B 195 67.318 29.348 15.743 1.00 24.93 C ATOM 8805 O THR B 195 66.475 29.448 14.851 1.00 25.25 O ATOM 8806 CB THR B 195 67.288 30.683 17.829 1.00 30.58 C ATOM 8807 OG1 THR B 195 65.876 30.404 17.715 1.00 26.09 O ATOM 8808 CG2 THR B 195 67.497 32.069 18.445 1.00 22.75 C ATOM 8809 HA THR B 195 68.987 30.567 16.500 1.00 0.00 H ATOM 8810 HB THR B 195 67.776 29.959 18.482 1.00 0.00 H ATOM 8811 HG1 THR B 195 65.749 29.497 17.339 1.00 0.00 H ATOM 8812 HG23 THR B 195 68.565 32.271 18.527 1.00 0.00 H ATOM 8813 HG21 THR B 195 67.031 32.822 17.809 1.00 0.00 H ATOM 8814 HG22 THR B 195 67.043 32.097 19.436 1.00 0.00 H ATOM 8815 H THR B 195 66.494 31.828 15.353 1.00 0.00 H ATOM 8816 N PRO B 196 67.721 28.162 16.202 1.00 22.20 N ATOM 8817 CA PRO B 196 67.192 26.909 15.619 1.00 23.36 C ATOM 8818 C PRO B 196 65.662 26.896 15.549 1.00 25.82 C ATOM 8819 O PRO B 196 65.115 26.608 14.490 1.00 24.91 O ATOM 8820 CB PRO B 196 67.713 25.836 16.577 1.00 24.31 C ATOM 8821 CG PRO B 196 69.056 26.398 17.032 1.00 28.67 C ATOM 8822 CD PRO B 196 68.851 27.903 17.120 1.00 24.17 C ATOM 8823 HA PRO B 196 67.511 26.764 14.587 1.00 0.00 H ATOM 8824 HD3 PRO B 196 68.601 28.202 18.138 1.00 0.00 H ATOM 8825 HD2 PRO B 196 69.745 28.436 16.796 1.00 0.00 H ATOM 8826 HG3 PRO B 196 69.835 26.160 16.308 1.00 0.00 H ATOM 8827 HG2 PRO B 196 69.330 25.992 18.006 1.00 0.00 H ATOM 8828 HB2 PRO B 196 67.037 25.705 17.422 1.00 0.00 H ATOM 8829 HB3 PRO B 196 67.841 24.883 16.064 1.00 0.00 H ATOM 8830 N LEU B 197 64.980 27.316 16.624 1.00 23.11 N ATOM 8831 CA LEU B 197 63.505 27.378 16.614 1.00 23.07 C ATOM 8832 C LEU B 197 62.934 28.458 15.705 1.00 26.36 C ATOM 8833 O LEU B 197 61.920 28.226 15.028 1.00 26.14 O ATOM 8834 CB LEU B 197 62.890 27.505 18.030 1.00 23.44 C ATOM 8835 CG LEU B 197 62.793 26.242 18.916 1.00 27.39 C ATOM 8836 CD1 LEU B 197 62.356 26.604 20.348 1.00 26.31 C ATOM 8837 CD2 LEU B 197 61.862 25.189 18.314 1.00 27.84 C ATOM 8838 HA LEU B 197 63.213 26.414 16.197 1.00 0.00 H ATOM 8839 HB2 LEU B 197 63.489 28.234 18.576 1.00 0.00 H ATOM 8840 HB3 LEU B 197 61.877 27.888 17.906 1.00 0.00 H ATOM 8841 HG LEU B 197 63.791 25.805 18.961 1.00 0.00 H ATOM 8842 HD21 LEU B 197 60.862 25.608 18.208 1.00 0.00 H ATOM 8843 HD22 LEU B 197 62.238 24.891 17.335 1.00 0.00 H ATOM 8844 HD23 LEU B 197 61.825 24.320 18.971 1.00 0.00 H ATOM 8845 HD11 LEU B 197 63.085 27.285 20.788 1.00 0.00 H ATOM 8846 HD12 LEU B 197 61.379 27.086 20.317 1.00 0.00 H ATOM 8847 HD13 LEU B 197 62.296 25.696 20.949 1.00 0.00 H ATOM 8848 H LEU B 197 65.498 27.603 17.479 1.00 0.00 H ATOM 8849 N GLY B 198 63.544 29.650 15.697 1.00 21.99 N ATOM 8850 CA GLY B 198 63.071 30.733 14.832 1.00 20.00 C ATOM 8851 C GLY B 198 63.285 30.377 13.361 1.00 26.05 C ATOM 8852 O GLY B 198 62.356 30.411 12.555 1.00 24.41 O ATOM 8853 HA3 GLY B 198 63.622 31.644 15.064 1.00 0.00 H ATOM 8854 HA2 GLY B 198 62.008 30.897 15.011 1.00 0.00 H ATOM 8855 H GLY B 198 64.366 29.809 16.314 1.00 0.00 H ATOM 8856 N VAL B 199 64.515 30.002 13.011 1.00 24.54 N ATOM 8857 CA VAL B 199 64.829 29.620 11.621 1.00 23.45 C ATOM 8858 C VAL B 199 64.111 28.295 11.230 1.00 27.07 C ATOM 8859 O VAL B 199 63.495 28.175 10.177 1.00 25.61 O ATOM 8860 CB VAL B 199 66.347 29.545 11.377 1.00 25.28 C ATOM 8861 CG1 VAL B 199 66.638 29.145 9.890 1.00 25.95 C ATOM 8862 CG2 VAL B 199 67.001 30.917 11.737 1.00 23.53 C ATOM 8863 HA VAL B 199 64.447 30.405 10.969 1.00 0.00 H ATOM 8864 HB VAL B 199 66.783 28.778 12.017 1.00 0.00 H ATOM 8865 HG11 VAL B 199 66.195 28.171 9.684 1.00 0.00 H ATOM 8866 HG12 VAL B 199 66.206 29.891 9.223 1.00 0.00 H ATOM 8867 HG13 VAL B 199 67.715 29.096 9.732 1.00 0.00 H ATOM 8868 HG21 VAL B 199 66.570 31.699 11.111 1.00 0.00 H ATOM 8869 HG22 VAL B 199 66.812 31.144 12.786 1.00 0.00 H ATOM 8870 HG23 VAL B 199 68.076 30.862 11.564 1.00 0.00 H ATOM 8871 H VAL B 199 65.266 29.978 13.730 1.00 0.00 H ATOM 8872 N GLY B 200 64.181 27.320 12.098 1.00 26.07 N ATOM 8873 CA GLY B 200 63.528 26.056 11.812 1.00 25.53 C ATOM 8874 C GLY B 200 62.009 26.204 11.810 1.00 27.76 C ATOM 8875 O GLY B 200 61.342 25.525 11.052 1.00 25.02 O ATOM 8876 HA3 GLY B 200 63.813 25.329 12.572 1.00 0.00 H ATOM 8877 HA2 GLY B 200 63.852 25.702 10.833 1.00 0.00 H ATOM 8878 H GLY B 200 64.702 27.450 12.989 1.00 0.00 H ATOM 8879 N GLY B 201 61.467 27.043 12.692 1.00 23.60 N ATOM 8880 CA GLY B 201 60.019 27.233 12.848 1.00 22.96 C ATOM 8881 C GLY B 201 59.355 27.977 11.716 1.00 26.62 C ATOM 8882 O GLY B 201 58.322 27.558 11.186 1.00 23.85 O ATOM 8883 HA3 GLY B 201 59.847 27.791 13.768 1.00 0.00 H ATOM 8884 HA2 GLY B 201 59.554 26.250 12.928 1.00 0.00 H ATOM 8885 H GLY B 201 62.104 27.593 13.303 1.00 0.00 H ATOM 8886 N PHE B 202 59.955 29.097 11.318 1.00 22.42 N ATOM 8887 CA PHE B 202 59.414 29.835 10.183 1.00 21.31 C ATOM 8888 C PHE B 202 59.706 29.029 8.891 1.00 24.76 C ATOM 8889 O PHE B 202 58.955 29.104 7.946 1.00 23.61 O ATOM 8890 CB PHE B 202 60.038 31.238 10.081 1.00 21.84 C ATOM 8891 CG PHE B 202 59.408 32.257 11.007 1.00 21.85 C ATOM 8892 CD1 PHE B 202 58.115 32.710 10.788 1.00 23.81 C ATOM 8893 CD2 PHE B 202 60.082 32.685 12.133 1.00 23.15 C ATOM 8894 CE1 PHE B 202 57.520 33.624 11.650 1.00 24.30 C ATOM 8895 CE2 PHE B 202 59.518 33.636 12.986 1.00 24.84 C ATOM 8896 CZ PHE B 202 58.229 34.098 12.751 1.00 23.05 C ATOM 8897 HA PHE B 202 58.340 29.962 10.318 1.00 0.00 H ATOM 8898 HB2 PHE B 202 61.098 31.161 10.324 1.00 0.00 H ATOM 8899 HB3 PHE B 202 59.926 31.590 9.055 1.00 0.00 H ATOM 8900 HD2 PHE B 202 61.067 32.276 12.359 1.00 0.00 H ATOM 8901 HE2 PHE B 202 60.088 34.015 13.834 1.00 0.00 H ATOM 8902 HZ PHE B 202 57.776 34.826 13.424 1.00 0.00 H ATOM 8903 HE1 PHE B 202 56.503 33.968 11.465 1.00 0.00 H ATOM 8904 HD1 PHE B 202 57.557 32.343 9.926 1.00 0.00 H ATOM 8905 H PHE B 202 60.802 29.442 11.812 1.00 0.00 H ATOM 8906 N GLY B 203 60.797 28.271 8.874 1.00 25.23 N ATOM 8907 CA GLY B 203 61.134 27.379 7.764 1.00 24.45 C ATOM 8908 C GLY B 203 60.056 26.301 7.603 1.00 29.57 C ATOM 8909 O GLY B 203 59.612 26.050 6.473 1.00 28.82 O ATOM 8910 HA3 GLY B 203 62.093 26.902 7.964 1.00 0.00 H ATOM 8911 HA2 GLY B 203 61.203 27.959 6.844 1.00 0.00 H ATOM 8912 H GLY B 203 61.442 28.314 9.688 1.00 0.00 H ATOM 8913 N ALA B 204 59.584 25.727 8.730 1.00 26.50 N ATOM 8914 CA ALA B 204 58.532 24.690 8.737 1.00 25.05 C ATOM 8915 C ALA B 204 57.225 25.189 8.154 1.00 30.29 C ATOM 8916 O ALA B 204 56.485 24.432 7.521 1.00 30.58 O ATOM 8917 CB ALA B 204 58.328 24.109 10.166 1.00 26.15 C ATOM 8918 HA ALA B 204 58.877 23.884 8.089 1.00 0.00 H ATOM 8919 HB1 ALA B 204 59.260 23.663 10.512 1.00 0.00 H ATOM 8920 HB2 ALA B 204 58.033 24.910 10.844 1.00 0.00 H ATOM 8921 HB3 ALA B 204 57.548 23.348 10.140 1.00 0.00 H ATOM 8922 H ALA B 204 59.982 26.031 9.641 1.00 0.00 H ATOM 8923 N ALA B 205 56.980 26.483 8.307 1.00 25.45 N ATOM 8924 CA ALA B 205 55.815 27.124 7.734 1.00 25.73 C ATOM 8925 C ALA B 205 55.980 27.496 6.234 1.00 28.38 C ATOM 8926 O ALA B 205 55.072 28.050 5.606 1.00 27.70 O ATOM 8927 CB ALA B 205 55.443 28.345 8.549 1.00 26.30 C ATOM 8928 HA ALA B 205 55.008 26.392 7.772 1.00 0.00 H ATOM 8929 HB1 ALA B 205 55.220 28.043 9.572 1.00 0.00 H ATOM 8930 HB2 ALA B 205 56.276 29.048 8.549 1.00 0.00 H ATOM 8931 HB3 ALA B 205 54.566 28.820 8.110 1.00 0.00 H ATOM 8932 H ALA B 205 57.648 27.058 8.858 1.00 0.00 H ATOM 8933 N ARG B 206 57.136 27.190 5.663 1.00 25.03 N ATOM 8934 CA ARG B 206 57.377 27.514 4.247 1.00 24.36 C ATOM 8935 C ARG B 206 57.299 29.014 4.004 1.00 28.52 C ATOM 8936 O ARG B 206 56.922 29.480 2.912 1.00 26.87 O ATOM 8937 CB ARG B 206 56.407 26.745 3.338 1.00 23.17 C ATOM 8938 CG ARG B 206 56.609 25.213 3.448 1.00 28.41 C ATOM 8939 CD ARG B 206 55.659 24.512 2.455 1.00 29.15 C ATOM 8940 NE ARG B 206 54.269 24.684 2.882 1.00 37.10 N ATOM 8941 CZ ARG B 206 53.300 25.182 2.121 1.00 47.96 C ATOM 8942 NH1 ARG B 206 53.569 25.607 0.887 1.00 30.53 N ATOM 8943 NH2 ARG B 206 52.069 25.278 2.610 1.00 39.72 N ATOM 8944 HA ARG B 206 58.389 27.197 3.996 1.00 0.00 H ATOM 8945 HB2 ARG B 206 55.384 26.988 3.627 1.00 0.00 H ATOM 8946 HB3 ARG B 206 56.574 27.050 2.305 1.00 0.00 H ATOM 8947 HG2 ARG B 206 57.642 24.961 3.207 1.00 0.00 H ATOM 8948 HG3 ARG B 206 56.384 24.886 4.463 1.00 0.00 H ATOM 8949 HD2 ARG B 206 55.896 23.449 2.418 1.00 0.00 H ATOM 8950 HD3 ARG B 206 55.788 24.947 1.464 1.00 0.00 H ATOM 8951 HE ARG B 206 54.022 24.396 3.850 1.00 0.00 H ATOM 8952 HH12 ARG B 206 52.809 25.996 0.294 1.00 0.00 H ATOM 8953 HH11 ARG B 206 54.539 25.549 0.517 1.00 0.00 H ATOM 8954 HH22 ARG B 206 51.305 25.666 2.022 1.00 0.00 H ATOM 8955 HH21 ARG B 206 51.869 24.965 3.581 1.00 0.00 H ATOM 8956 H ARG B 206 57.878 26.718 6.219 1.00 0.00 H ATOM 8957 N ALA B 207 57.679 29.773 5.028 1.00 25.34 N ATOM 8958 CA ALA B 207 57.627 31.237 4.942 1.00 23.75 C ATOM 8959 C ALA B 207 58.954 31.932 4.609 1.00 24.37 C ATOM 8960 O ALA B 207 58.963 33.116 4.300 1.00 23.55 O ATOM 8961 CB ALA B 207 57.031 31.817 6.242 1.00 24.38 C ATOM 8962 HA ALA B 207 56.985 31.448 4.087 1.00 0.00 H ATOM 8963 HB1 ALA B 207 56.023 31.428 6.383 1.00 0.00 H ATOM 8964 HB2 ALA B 207 57.655 31.527 7.087 1.00 0.00 H ATOM 8965 HB3 ALA B 207 56.996 32.904 6.171 1.00 0.00 H ATOM 8966 H ALA B 207 58.018 29.323 5.902 1.00 0.00 H ATOM 8967 N LEU B 208 60.066 31.213 4.710 1.00 22.61 N ATOM 8968 CA LEU B 208 61.392 31.798 4.484 1.00 21.66 C ATOM 8969 C LEU B 208 61.969 31.542 3.085 1.00 28.90 C ATOM 8970 O LEU B 208 61.789 30.457 2.505 1.00 24.79 O ATOM 8971 CB LEU B 208 62.373 31.224 5.498 1.00 20.74 C ATOM 8972 CG LEU B 208 62.030 31.512 6.980 1.00 22.46 C ATOM 8973 CD1 LEU B 208 63.037 30.751 7.887 1.00 20.72 C ATOM 8974 CD2 LEU B 208 61.973 33.052 7.306 1.00 21.15 C ATOM 8975 HA LEU B 208 61.259 32.875 4.589 1.00 0.00 H ATOM 8976 HB2 LEU B 208 62.405 30.143 5.363 1.00 0.00 H ATOM 8977 HB3 LEU B 208 63.357 31.644 5.291 1.00 0.00 H ATOM 8978 HG LEU B 208 61.023 31.147 7.182 1.00 0.00 H ATOM 8979 HD21 LEU B 208 62.943 33.503 7.095 1.00 0.00 H ATOM 8980 HD22 LEU B 208 61.209 33.525 6.689 1.00 0.00 H ATOM 8981 HD23 LEU B 208 61.728 33.190 8.359 1.00 0.00 H ATOM 8982 HD11 LEU B 208 62.963 29.681 7.692 1.00 0.00 H ATOM 8983 HD12 LEU B 208 64.049 31.092 7.670 1.00 0.00 H ATOM 8984 HD13 LEU B 208 62.803 30.948 8.933 1.00 0.00 H ATOM 8985 H LEU B 208 59.995 30.205 4.957 1.00 0.00 H ATOM 8986 N SER B 209 62.748 32.514 2.599 1.00 25.19 N ATOM 8987 CA SER B 209 63.477 32.354 1.358 1.00 23.71 C ATOM 8988 C SER B 209 64.525 31.303 1.642 1.00 25.96 C ATOM 8989 O SER B 209 65.049 31.241 2.737 1.00 25.70 O ATOM 8990 CB SER B 209 64.193 33.667 0.975 1.00 26.00 C ATOM 8991 OG SER B 209 65.204 33.398 0.008 1.00 30.43 O ATOM 8992 HA SER B 209 62.807 32.082 0.542 1.00 0.00 H ATOM 8993 HB2 SER B 209 64.648 34.104 1.864 1.00 0.00 H ATOM 8994 HB3 SER B 209 63.469 34.367 0.558 1.00 0.00 H ATOM 8995 HG SER B 209 64.790 33.002 -0.799 1.00 0.00 H ATOM 8996 H SER B 209 62.832 33.407 3.125 1.00 0.00 H ATOM 8997 N THR B 210 64.829 30.458 0.660 1.00 23.41 N ATOM 8998 CA THR B 210 65.882 29.469 0.828 1.00 24.16 C ATOM 8999 C THR B 210 67.003 29.728 -0.197 1.00 29.27 C ATOM 9000 O THR B 210 67.676 28.802 -0.629 1.00 27.44 O ATOM 9001 CB THR B 210 65.324 28.038 0.603 1.00 34.62 C ATOM 9002 OG1 THR B 210 64.571 28.020 -0.622 1.00 32.37 O ATOM 9003 CG2 THR B 210 64.390 27.646 1.755 1.00 36.25 C ATOM 9004 HA THR B 210 66.272 29.550 1.843 1.00 0.00 H ATOM 9005 HB THR B 210 66.155 27.335 0.556 1.00 0.00 H ATOM 9006 HG1 THR B 210 64.211 27.110 -0.773 1.00 0.00 H ATOM 9007 HG23 THR B 210 64.947 27.655 2.692 1.00 0.00 H ATOM 9008 HG21 THR B 210 63.568 28.359 1.813 1.00 0.00 H ATOM 9009 HG22 THR B 210 63.994 26.646 1.576 1.00 0.00 H ATOM 9010 H THR B 210 64.307 30.505 -0.238 1.00 0.00 H ATOM 9011 N ARG B 211 67.216 30.977 -0.589 1.00 28.75 N ATOM 9012 CA ARG B 211 68.243 31.269 -1.602 1.00 27.78 C ATOM 9013 C ARG B 211 69.594 31.303 -0.945 1.00 32.04 C ATOM 9014 O ARG B 211 70.209 32.366 -0.822 1.00 33.94 O ATOM 9015 CB ARG B 211 67.961 32.637 -2.216 1.00 28.77 C ATOM 9016 CG ARG B 211 68.819 32.951 -3.449 1.00 34.92 C ATOM 9017 CD ARG B 211 68.250 34.125 -4.193 1.00 33.97 C ATOM 9018 NE ARG B 211 67.240 33.650 -5.125 1.00 48.87 N ATOM 9019 CZ ARG B 211 66.163 34.330 -5.461 1.00 57.86 C ATOM 9020 NH1 ARG B 211 65.967 35.539 -4.973 1.00 67.30 N ATOM 9021 NH2 ARG B 211 65.294 33.803 -6.293 1.00 33.82 N ATOM 9022 HA ARG B 211 68.225 30.500 -2.374 1.00 0.00 H ATOM 9023 HB2 ARG B 211 66.912 32.673 -2.509 1.00 0.00 H ATOM 9024 HB3 ARG B 211 68.152 33.399 -1.461 1.00 0.00 H ATOM 9025 HG2 ARG B 211 69.835 33.184 -3.131 1.00 0.00 H ATOM 9026 HG3 ARG B 211 68.836 32.082 -4.107 1.00 0.00 H ATOM 9027 HD2 ARG B 211 69.045 34.631 -4.741 1.00 0.00 H ATOM 9028 HD3 ARG B 211 67.798 34.821 -3.487 1.00 0.00 H ATOM 9029 HE ARG B 211 67.377 32.713 -5.554 1.00 0.00 H ATOM 9030 HH12 ARG B 211 65.117 36.075 -5.239 1.00 0.00 H ATOM 9031 HH11 ARG B 211 66.663 35.956 -4.322 1.00 0.00 H ATOM 9032 HH22 ARG B 211 64.442 34.336 -6.562 1.00 0.00 H ATOM 9033 HH21 ARG B 211 65.458 32.853 -6.683 1.00 0.00 H ATOM 9034 H ARG B 211 66.656 31.752 -0.180 1.00 0.00 H ATOM 9035 N ASN B 212 70.052 30.162 -0.455 1.00 28.36 N ATOM 9036 CA ASN B 212 71.326 30.133 0.261 1.00 27.62 C ATOM 9037 C ASN B 212 72.546 30.552 -0.567 1.00 34.06 C ATOM 9038 O ASN B 212 73.533 31.038 -0.028 1.00 32.50 O ATOM 9039 CB ASN B 212 71.531 28.738 0.840 1.00 29.85 C ATOM 9040 CG ASN B 212 70.407 28.352 1.768 1.00 45.18 C ATOM 9041 OD1 ASN B 212 70.083 29.109 2.680 1.00 33.84 O ATOM 9042 ND2 ASN B 212 69.706 27.273 1.450 1.00 37.37 N ATOM 9043 HA ASN B 212 71.255 30.885 1.047 1.00 0.00 H ATOM 9044 HB2 ASN B 212 71.578 28.019 0.022 1.00 0.00 H ATOM 9045 HB3 ASN B 212 72.470 28.719 1.394 1.00 0.00 H ATOM 9046 HD22 ASN B 212 70.019 26.661 0.670 1.00 0.00 H ATOM 9047 HD21 ASN B 212 68.843 27.038 1.981 1.00 0.00 H ATOM 9048 H ASN B 212 69.505 29.286 -0.579 1.00 0.00 H ATOM 9049 N ASP B 213 72.476 30.344 -1.876 1.00 33.46 N ATOM 9050 CA ASP B 213 73.609 30.640 -2.760 1.00 34.45 C ATOM 9051 C ASP B 213 73.813 32.122 -3.033 1.00 38.33 C ATOM 9052 O ASP B 213 74.846 32.517 -3.560 1.00 36.35 O ATOM 9053 CB ASP B 213 73.522 29.842 -4.072 1.00 36.19 C ATOM 9054 CG ASP B 213 72.359 30.264 -4.947 1.00 53.14 C ATOM 9055 OD1 ASP B 213 72.059 29.538 -5.919 1.00 59.40 O ATOM 9056 OD2 ASP B 213 71.754 31.323 -4.700 1.00 55.65 O ATOM 9057 HA ASP B 213 74.494 30.316 -2.212 1.00 0.00 H ATOM 9058 HB2 ASP B 213 74.447 29.988 -4.630 1.00 0.00 H ATOM 9059 HB3 ASP B 213 73.409 28.785 -3.829 1.00 0.00 H ATOM 9060 H ASP B 213 71.599 29.963 -2.284 1.00 0.00 H ATOM 9061 N ASN B 214 72.828 32.940 -2.661 1.00 33.43 N ATOM 9062 CA ASN B 214 72.958 34.381 -2.803 1.00 32.18 C ATOM 9063 C ASN B 214 72.153 35.101 -1.700 1.00 32.05 C ATOM 9064 O ASN B 214 71.128 35.709 -1.972 1.00 31.29 O ATOM 9065 CB ASN B 214 72.432 34.785 -4.172 1.00 33.87 C ATOM 9066 CG ASN B 214 72.957 36.123 -4.618 1.00 46.50 C ATOM 9067 OD1 ASN B 214 72.927 36.439 -5.804 1.00 39.41 O ATOM 9068 ND2 ASN B 214 73.401 36.938 -3.663 1.00 30.36 N ATOM 9069 HA ASN B 214 74.006 34.665 -2.707 1.00 0.00 H ATOM 9070 HB2 ASN B 214 72.733 34.031 -4.899 1.00 0.00 H ATOM 9071 HB3 ASN B 214 71.344 34.833 -4.129 1.00 0.00 H ATOM 9072 HD22 ASN B 214 73.406 36.623 -2.672 1.00 0.00 H ATOM 9073 HD21 ASN B 214 73.743 37.889 -3.908 1.00 0.00 H ATOM 9074 H ASN B 214 71.954 32.541 -2.263 1.00 0.00 H ATOM 9075 N PRO B 215 72.595 34.989 -0.441 1.00 30.15 N ATOM 9076 CA PRO B 215 71.837 35.583 0.676 1.00 29.89 C ATOM 9077 C PRO B 215 71.445 37.025 0.490 1.00 31.86 C ATOM 9078 O PRO B 215 70.379 37.421 0.954 1.00 31.10 O ATOM 9079 CB PRO B 215 72.783 35.437 1.869 1.00 31.08 C ATOM 9080 CG PRO B 215 73.613 34.241 1.528 1.00 36.10 C ATOM 9081 CD PRO B 215 73.839 34.351 0.032 1.00 32.06 C ATOM 9082 HA PRO B 215 70.878 35.078 0.787 1.00 0.00 H ATOM 9083 HD3 PRO B 215 74.707 34.971 -0.190 1.00 0.00 H ATOM 9084 HD2 PRO B 215 73.972 33.367 -0.419 1.00 0.00 H ATOM 9085 HG3 PRO B 215 73.082 33.321 1.771 1.00 0.00 H ATOM 9086 HG2 PRO B 215 74.562 34.264 2.064 1.00 0.00 H ATOM 9087 HB2 PRO B 215 73.407 36.324 1.980 1.00 0.00 H ATOM 9088 HB3 PRO B 215 72.223 35.271 2.790 1.00 0.00 H ATOM 9089 N GLN B 216 72.321 37.845 -0.105 1.00 27.36 N ATOM 9090 CA GLN B 216 71.994 39.273 -0.285 1.00 25.45 C ATOM 9091 C GLN B 216 70.940 39.582 -1.352 1.00 27.96 C ATOM 9092 O GLN B 216 70.355 40.664 -1.357 1.00 28.59 O ATOM 9093 CB GLN B 216 73.246 40.108 -0.483 1.00 27.59 C ATOM 9094 CG GLN B 216 74.337 39.818 0.535 1.00 40.19 C ATOM 9095 CD GLN B 216 75.453 40.834 0.445 1.00 74.09 C ATOM 9096 OE1 GLN B 216 76.311 40.916 1.321 1.00 72.10 O ATOM 9097 NE2 GLN B 216 75.444 41.625 -0.625 1.00 72.66 N ATOM 9098 HA GLN B 216 71.518 39.560 0.653 1.00 0.00 H ATOM 9099 HB2 GLN B 216 73.641 39.907 -1.479 1.00 0.00 H ATOM 9100 HB3 GLN B 216 72.974 41.161 -0.407 1.00 0.00 H ATOM 9101 HG2 GLN B 216 73.907 39.849 1.536 1.00 0.00 H ATOM 9102 HG3 GLN B 216 74.744 38.825 0.347 1.00 0.00 H ATOM 9103 HE22 GLN B 216 74.698 41.521 -1.342 1.00 0.00 H ATOM 9104 HE21 GLN B 216 76.183 42.347 -0.744 1.00 0.00 H ATOM 9105 H GLN B 216 73.233 37.475 -0.441 1.00 0.00 H ATOM 9106 N ALA B 217 70.662 38.624 -2.234 1.00 25.46 N ATOM 9107 CA ALA B 217 69.638 38.816 -3.269 1.00 26.39 C ATOM 9108 C ALA B 217 68.337 38.151 -2.836 1.00 29.79 C ATOM 9109 O ALA B 217 67.321 38.227 -3.514 1.00 28.69 O ATOM 9110 CB ALA B 217 70.094 38.160 -4.567 1.00 28.55 C ATOM 9111 HA ALA B 217 69.485 39.885 -3.416 1.00 0.00 H ATOM 9112 HB1 ALA B 217 71.029 38.615 -4.893 1.00 0.00 H ATOM 9113 HB2 ALA B 217 70.246 37.094 -4.400 1.00 0.00 H ATOM 9114 HB3 ALA B 217 69.332 38.304 -5.333 1.00 0.00 H ATOM 9115 H ALA B 217 71.180 37.723 -2.189 1.00 0.00 H ATOM 9116 N ALA B 218 68.386 37.441 -1.722 1.00 28.43 N ATOM 9117 CA ALA B 218 67.216 36.702 -1.242 1.00 28.45 C ATOM 9118 C ALA B 218 65.944 37.546 -1.040 1.00 30.09 C ATOM 9119 O ALA B 218 64.857 37.210 -1.536 1.00 29.18 O ATOM 9120 CB ALA B 218 67.591 35.973 0.054 1.00 28.90 C ATOM 9121 HA ALA B 218 66.951 35.999 -2.032 1.00 0.00 H ATOM 9122 HB1 ALA B 218 68.410 35.282 -0.143 1.00 0.00 H ATOM 9123 HB2 ALA B 218 67.901 36.702 0.803 1.00 0.00 H ATOM 9124 HB3 ALA B 218 66.727 35.419 0.421 1.00 0.00 H ATOM 9125 H ALA B 218 69.271 37.407 -1.177 1.00 0.00 H ATOM 9126 N SER B 219 66.072 38.608 -0.246 1.00 26.90 N ATOM 9127 CA SER B 219 64.938 39.472 0.086 1.00 25.25 C ATOM 9128 C SER B 219 64.736 40.417 -1.081 1.00 31.26 C ATOM 9129 O SER B 219 65.552 41.313 -1.325 1.00 28.97 O ATOM 9130 CB SER B 219 65.252 40.280 1.354 1.00 26.68 C ATOM 9131 OG SER B 219 64.113 40.999 1.777 1.00 28.78 O ATOM 9132 HA SER B 219 64.042 38.879 0.268 1.00 0.00 H ATOM 9133 HB2 SER B 219 66.060 40.980 1.143 1.00 0.00 H ATOM 9134 HB3 SER B 219 65.561 39.599 2.147 1.00 0.00 H ATOM 9135 HG SER B 219 64.333 41.513 2.594 1.00 0.00 H ATOM 9136 H SER B 219 67.007 38.830 0.151 1.00 0.00 H ATOM 9137 N ARG B 220 63.643 40.214 -1.805 1.00 27.27 N ATOM 9138 CA ARG B 220 63.414 40.918 -3.033 1.00 26.05 C ATOM 9139 C ARG B 220 61.944 41.179 -3.219 1.00 29.93 C ATOM 9140 O ARG B 220 61.289 40.551 -4.048 1.00 29.16 O ATOM 9141 CB ARG B 220 64.025 40.087 -4.192 1.00 24.61 C ATOM 9142 CG ARG B 220 63.446 38.667 -4.396 1.00 26.23 C ATOM 9143 CD ARG B 220 63.750 38.179 -5.853 1.00 48.03 C ATOM 9144 NE ARG B 220 65.174 38.307 -5.960 1.00 45.80 N ATOM 9145 CZ ARG B 220 65.887 38.990 -6.836 1.00 38.69 C ATOM 9146 NH1 ARG B 220 65.447 39.369 -8.027 1.00 36.68 N ATOM 9147 NH2 ARG B 220 67.153 39.133 -6.537 1.00 31.38 N ATOM 9148 HA ARG B 220 63.899 41.894 -3.017 1.00 0.00 H ATOM 9149 HB2 ARG B 220 63.873 40.644 -5.117 1.00 0.00 H ATOM 9150 HB3 ARG B 220 65.093 39.986 -4.002 1.00 0.00 H ATOM 9151 HG2 ARG B 220 63.903 37.983 -3.681 1.00 0.00 H ATOM 9152 HG3 ARG B 220 62.368 38.689 -4.238 1.00 0.00 H ATOM 9153 HD2 ARG B 220 63.246 38.807 -6.588 1.00 0.00 H ATOM 9154 HD3 ARG B 220 63.441 37.143 -5.989 1.00 0.00 H ATOM 9155 HE ARG B 220 65.723 37.788 -5.246 1.00 0.00 H ATOM 9156 HH12 ARG B 220 66.069 39.906 -8.664 1.00 0.00 H ATOM 9157 HH11 ARG B 220 64.480 39.129 -8.324 1.00 0.00 H ATOM 9158 HH22 ARG B 220 67.782 39.659 -7.177 1.00 0.00 H ATOM 9159 HH21 ARG B 220 67.530 38.721 -5.660 1.00 0.00 H ATOM 9160 H ARG B 220 62.935 39.528 -1.474 1.00 0.00 H ATOM 9161 N PRO B 221 61.393 42.115 -2.414 1.00 25.56 N ATOM 9162 CA PRO B 221 59.965 42.453 -2.399 1.00 23.95 C ATOM 9163 C PRO B 221 59.459 42.883 -3.769 1.00 30.92 C ATOM 9164 O PRO B 221 60.072 43.700 -4.444 1.00 31.76 O ATOM 9165 CB PRO B 221 59.891 43.626 -1.391 1.00 23.83 C ATOM 9166 CG PRO B 221 61.090 43.411 -0.500 1.00 27.18 C ATOM 9167 CD PRO B 221 62.153 42.929 -1.438 1.00 25.60 C ATOM 9168 HA PRO B 221 59.341 41.601 -2.127 1.00 0.00 H ATOM 9169 HD3 PRO B 221 62.651 43.765 -1.929 1.00 0.00 H ATOM 9170 HD2 PRO B 221 62.893 42.323 -0.914 1.00 0.00 H ATOM 9171 HG3 PRO B 221 60.877 42.663 0.263 1.00 0.00 H ATOM 9172 HG2 PRO B 221 61.389 44.343 -0.020 1.00 0.00 H ATOM 9173 HB2 PRO B 221 59.956 44.585 -1.905 1.00 0.00 H ATOM 9174 HB3 PRO B 221 58.967 43.586 -0.815 1.00 0.00 H ATOM 9175 N TRP B 222 58.316 42.331 -4.153 1.00 27.97 N ATOM 9176 CA TRP B 222 57.669 42.623 -5.444 1.00 28.22 C ATOM 9177 C TRP B 222 58.376 42.064 -6.682 1.00 32.22 C ATOM 9178 O TRP B 222 57.867 42.216 -7.790 1.00 32.90 O ATOM 9179 CB TRP B 222 57.301 44.106 -5.594 1.00 27.08 C ATOM 9180 CG TRP B 222 56.429 44.612 -4.456 1.00 28.22 C ATOM 9181 CD1 TRP B 222 55.139 44.243 -4.181 1.00 30.43 C ATOM 9182 CD2 TRP B 222 56.818 45.525 -3.406 1.00 28.09 C ATOM 9183 NE1 TRP B 222 54.684 44.912 -3.055 1.00 29.97 N ATOM 9184 CE2 TRP B 222 55.706 45.668 -2.540 1.00 30.35 C ATOM 9185 CE3 TRP B 222 57.994 46.246 -3.120 1.00 29.15 C ATOM 9186 CZ2 TRP B 222 55.728 46.511 -1.428 1.00 29.66 C ATOM 9187 CZ3 TRP B 222 58.011 47.093 -1.989 1.00 29.38 C ATOM 9188 CH2 TRP B 222 56.902 47.182 -1.146 1.00 29.49 C ATOM 9189 HA TRP B 222 56.739 42.056 -5.402 1.00 0.00 H ATOM 9190 HB2 TRP B 222 58.219 44.693 -5.618 1.00 0.00 H ATOM 9191 HB3 TRP B 222 56.762 44.239 -6.532 1.00 0.00 H ATOM 9192 HE1 TRP B 222 53.722 44.850 -2.664 1.00 0.00 H ATOM 9193 HD1 TRP B 222 54.556 43.528 -4.762 1.00 0.00 H ATOM 9194 HZ2 TRP B 222 54.845 46.636 -0.801 1.00 0.00 H ATOM 9195 HH2 TRP B 222 56.964 47.794 -0.246 1.00 0.00 H ATOM 9196 HZ3 TRP B 222 58.901 47.684 -1.772 1.00 0.00 H ATOM 9197 HE3 TRP B 222 58.873 46.152 -3.758 1.00 0.00 H ATOM 9198 H TRP B 222 57.853 41.658 -3.510 1.00 0.00 H ATOM 9199 N ASP B 223 59.503 41.380 -6.489 1.00 28.93 N ATOM 9200 CA ASP B 223 60.237 40.769 -7.604 1.00 29.83 C ATOM 9201 C ASP B 223 59.653 39.396 -7.915 1.00 37.52 C ATOM 9202 O ASP B 223 59.300 38.628 -7.002 1.00 35.89 O ATOM 9203 CB ASP B 223 61.719 40.602 -7.280 1.00 30.37 C ATOM 9204 CG ASP B 223 62.513 40.026 -8.464 1.00 32.54 C ATOM 9205 OD1 ASP B 223 63.011 40.831 -9.257 1.00 32.60 O ATOM 9206 OD2 ASP B 223 62.757 38.793 -8.522 1.00 31.22 O ATOM 9207 HA ASP B 223 60.139 41.433 -8.463 1.00 0.00 H ATOM 9208 HB2 ASP B 223 62.133 41.576 -7.020 1.00 0.00 H ATOM 9209 HB3 ASP B 223 61.819 39.928 -6.429 1.00 0.00 H ATOM 9210 H ASP B 223 59.873 41.276 -5.522 1.00 0.00 H ATOM 9211 N LYS B 224 59.563 39.066 -9.203 1.00 34.17 N ATOM 9212 CA LYS B 224 58.962 37.787 -9.593 1.00 33.91 C ATOM 9213 C LYS B 224 59.638 36.548 -9.032 1.00 34.41 C ATOM 9214 O LYS B 224 59.024 35.476 -8.940 1.00 34.74 O ATOM 9215 CB LYS B 224 58.840 37.680 -11.119 1.00 36.32 C ATOM 9216 CG LYS B 224 57.867 38.686 -11.739 1.00 40.06 C ATOM 9217 CD LYS B 224 58.283 38.927 -13.186 1.00 55.70 C ATOM 9218 CE LYS B 224 57.115 39.154 -14.121 1.00 64.60 C ATOM 9219 NZ LYS B 224 57.615 39.320 -15.528 1.00 68.93 N ATOM 9220 HA LYS B 224 57.973 37.804 -9.135 1.00 0.00 H ATOM 9221 HB2 LYS B 224 59.826 37.844 -11.554 1.00 0.00 H ATOM 9222 HB3 LYS B 224 58.498 36.675 -11.366 1.00 0.00 H ATOM 9223 HG2 LYS B 224 56.854 38.286 -11.709 1.00 0.00 H ATOM 9224 HG3 LYS B 224 57.903 39.624 -11.184 1.00 0.00 H ATOM 9225 HD2 LYS B 224 58.927 39.806 -13.218 1.00 0.00 H ATOM 9226 HD3 LYS B 224 58.840 38.057 -13.534 1.00 0.00 H ATOM 9227 HE2 LYS B 224 56.578 40.053 -13.819 1.00 0.00 H ATOM 9228 HE3 LYS B 224 56.442 38.298 -14.074 1.00 0.00 H ATOM 9229 HZ1 LYS B 224 58.256 40.138 -15.573 1.00 0.00 H ATOM 9230 HZ2 LYS B 224 58.126 38.461 -15.817 1.00 0.00 H ATOM 9231 HZ3 LYS B 224 56.808 39.476 -16.165 1.00 0.00 H ATOM 9232 H LYS B 224 59.919 39.716 -9.932 1.00 0.00 H ATOM 9233 N GLU B 225 60.930 36.647 -8.746 1.00 29.07 N ATOM 9234 CA GLU B 225 61.634 35.491 -8.237 1.00 27.91 C ATOM 9235 C GLU B 225 61.646 35.358 -6.703 1.00 32.79 C ATOM 9236 O GLU B 225 62.350 34.498 -6.160 1.00 30.90 O ATOM 9237 CB GLU B 225 63.045 35.463 -8.781 1.00 28.52 C ATOM 9238 CG GLU B 225 63.062 35.245 -10.301 1.00 40.57 C ATOM 9239 CD GLU B 225 64.471 35.203 -10.839 1.00 57.05 C ATOM 9240 OE1 GLU B 225 65.085 34.120 -10.790 1.00 60.13 O ATOM 9241 OE2 GLU B 225 64.993 36.272 -11.222 1.00 53.34 O ATOM 9242 HA GLU B 225 61.070 34.628 -8.591 1.00 0.00 H ATOM 9243 HB2 GLU B 225 63.530 36.412 -8.554 1.00 0.00 H ATOM 9244 HB3 GLU B 225 63.593 34.652 -8.301 1.00 0.00 H ATOM 9245 HG2 GLU B 225 62.567 34.301 -10.529 1.00 0.00 H ATOM 9246 HG3 GLU B 225 62.523 36.061 -10.782 1.00 0.00 H ATOM 9247 H GLU B 225 61.431 37.547 -8.887 1.00 0.00 H ATOM 9248 N ARG B 226 60.878 36.203 -6.012 1.00 30.79 N ATOM 9249 CA ARG B 226 60.829 36.143 -4.541 1.00 30.72 C ATOM 9250 C ARG B 226 60.303 34.802 -4.031 1.00 35.51 C ATOM 9251 O ARG B 226 59.434 34.183 -4.660 1.00 33.92 O ATOM 9252 CB ARG B 226 60.016 37.306 -3.972 1.00 28.82 C ATOM 9253 CG ARG B 226 58.493 37.166 -4.090 1.00 29.25 C ATOM 9254 CD ARG B 226 57.905 38.518 -3.794 1.00 21.89 C ATOM 9255 NE ARG B 226 56.465 38.666 -3.973 1.00 28.85 N ATOM 9256 CZ ARG B 226 55.876 39.028 -5.107 1.00 37.93 C ATOM 9257 NH1 ARG B 226 56.600 39.215 -6.203 1.00 32.32 N ATOM 9258 NH2 ARG B 226 54.563 39.211 -5.142 1.00 26.74 N ATOM 9259 HA ARG B 226 61.855 36.236 -4.185 1.00 0.00 H ATOM 9260 HB2 ARG B 226 60.264 37.404 -2.915 1.00 0.00 H ATOM 9261 HB3 ARG B 226 60.312 38.213 -4.499 1.00 0.00 H ATOM 9262 HG2 ARG B 226 58.222 36.852 -5.098 1.00 0.00 H ATOM 9263 HG3 ARG B 226 58.127 36.432 -3.372 1.00 0.00 H ATOM 9264 HD2 ARG B 226 58.394 39.240 -4.448 1.00 0.00 H ATOM 9265 HD3 ARG B 226 58.134 38.757 -2.755 1.00 0.00 H ATOM 9266 HE ARG B 226 55.855 38.474 -3.153 1.00 0.00 H ATOM 9267 HH12 ARG B 226 56.137 39.498 -7.090 1.00 0.00 H ATOM 9268 HH11 ARG B 226 57.631 39.078 -6.175 1.00 0.00 H ATOM 9269 HH22 ARG B 226 54.101 39.494 -6.030 1.00 0.00 H ATOM 9270 HH21 ARG B 226 53.995 39.071 -4.282 1.00 0.00 H ATOM 9271 H ARG B 226 60.308 36.911 -6.517 1.00 0.00 H ATOM 9272 N ASP B 227 60.871 34.330 -2.922 1.00 30.82 N ATOM 9273 CA ASP B 227 60.496 33.040 -2.373 1.00 28.59 C ATOM 9274 C ASP B 227 60.338 33.010 -0.841 1.00 29.63 C ATOM 9275 O ASP B 227 60.584 31.979 -0.227 1.00 26.87 O ATOM 9276 CB ASP B 227 61.494 31.961 -2.815 1.00 29.36 C ATOM 9277 CG ASP B 227 62.859 32.105 -2.154 1.00 30.49 C ATOM 9278 OD1 ASP B 227 63.381 33.234 -2.036 1.00 30.60 O ATOM 9279 OD2 ASP B 227 63.468 31.070 -1.839 1.00 30.11 O ATOM 9280 HA ASP B 227 59.504 32.835 -2.777 1.00 0.00 H ATOM 9281 HB2 ASP B 227 61.085 30.984 -2.559 1.00 0.00 H ATOM 9282 HB3 ASP B 227 61.622 32.028 -3.895 1.00 0.00 H ATOM 9283 H ASP B 227 61.597 34.897 -2.440 1.00 0.00 H ATOM 9284 N GLY B 228 59.907 34.109 -0.231 1.00 28.28 N ATOM 9285 CA GLY B 228 59.702 34.143 1.219 1.00 27.43 C ATOM 9286 C GLY B 228 60.549 35.208 1.895 1.00 30.23 C ATOM 9287 O GLY B 228 61.424 35.805 1.274 1.00 25.50 O ATOM 9288 HA3 GLY B 228 59.965 33.170 1.634 1.00 0.00 H ATOM 9289 HA2 GLY B 228 58.651 34.350 1.420 1.00 0.00 H ATOM 9290 H GLY B 228 59.711 34.961 -0.794 1.00 0.00 H ATOM 9291 N PHE B 229 60.299 35.451 3.180 1.00 26.95 N ATOM 9292 CA PHE B 229 61.033 36.511 3.879 1.00 24.99 C ATOM 9293 C PHE B 229 62.358 36.067 4.413 1.00 26.56 C ATOM 9294 O PHE B 229 62.714 34.878 4.349 1.00 25.84 O ATOM 9295 CB PHE B 229 60.162 37.233 4.931 1.00 25.65 C ATOM 9296 CG PHE B 229 59.941 36.444 6.210 1.00 27.34 C ATOM 9297 CD1 PHE B 229 60.793 36.605 7.301 1.00 27.87 C ATOM 9298 CD2 PHE B 229 58.781 35.690 6.386 1.00 29.42 C ATOM 9299 CE1 PHE B 229 60.580 35.930 8.506 1.00 28.18 C ATOM 9300 CE2 PHE B 229 58.550 35.023 7.585 1.00 30.81 C ATOM 9301 CZ PHE B 229 59.448 35.147 8.651 1.00 28.08 C ATOM 9302 HA PHE B 229 61.274 37.256 3.121 1.00 0.00 H ATOM 9303 HB2 PHE B 229 60.649 38.173 5.190 1.00 0.00 H ATOM 9304 HB3 PHE B 229 59.189 37.440 4.485 1.00 0.00 H ATOM 9305 HD2 PHE B 229 58.051 35.623 5.579 1.00 0.00 H ATOM 9306 HE2 PHE B 229 57.663 34.399 7.695 1.00 0.00 H ATOM 9307 HZ PHE B 229 59.257 34.629 9.591 1.00 0.00 H ATOM 9308 HE1 PHE B 229 61.297 36.019 9.322 1.00 0.00 H ATOM 9309 HD1 PHE B 229 61.648 37.275 7.212 1.00 0.00 H ATOM 9310 H PHE B 229 59.585 34.890 3.687 1.00 0.00 H ATOM 9311 N VAL B 230 63.161 37.060 4.767 1.00 23.03 N ATOM 9312 CA VAL B 230 64.477 36.846 5.329 1.00 22.68 C ATOM 9313 C VAL B 230 64.415 37.345 6.782 1.00 25.00 C ATOM 9314 O VAL B 230 63.958 38.455 7.044 1.00 22.54 O ATOM 9315 CB VAL B 230 65.541 37.626 4.543 1.00 26.60 C ATOM 9316 CG1 VAL B 230 66.909 37.446 5.230 1.00 26.16 C ATOM 9317 CG2 VAL B 230 65.560 37.128 3.102 1.00 27.06 C ATOM 9318 HA VAL B 230 64.753 35.793 5.281 1.00 0.00 H ATOM 9319 HB VAL B 230 65.309 38.691 4.529 1.00 0.00 H ATOM 9320 HG11 VAL B 230 66.855 37.826 6.250 1.00 0.00 H ATOM 9321 HG12 VAL B 230 67.169 36.388 5.248 1.00 0.00 H ATOM 9322 HG13 VAL B 230 67.668 37.998 4.676 1.00 0.00 H ATOM 9323 HG21 VAL B 230 65.800 36.065 3.090 1.00 0.00 H ATOM 9324 HG22 VAL B 230 64.580 37.286 2.651 1.00 0.00 H ATOM 9325 HG23 VAL B 230 66.314 37.678 2.539 1.00 0.00 H ATOM 9326 H VAL B 230 62.830 38.037 4.635 1.00 0.00 H ATOM 9327 N LEU B 231 64.827 36.509 7.718 1.00 24.50 N ATOM 9328 CA LEU B 231 64.734 36.868 9.142 1.00 27.16 C ATOM 9329 C LEU B 231 65.853 37.866 9.459 1.00 28.15 C ATOM 9330 O LEU B 231 66.966 37.693 8.985 1.00 28.14 O ATOM 9331 CB LEU B 231 64.973 35.604 9.965 1.00 28.26 C ATOM 9332 CG LEU B 231 64.270 35.131 11.246 1.00 37.43 C ATOM 9333 CD1 LEU B 231 62.983 35.857 11.598 1.00 39.08 C ATOM 9334 CD2 LEU B 231 64.022 33.627 11.096 1.00 41.37 C ATOM 9335 HA LEU B 231 63.759 37.299 9.370 1.00 0.00 H ATOM 9336 HB2 LEU B 231 64.822 34.789 9.257 1.00 0.00 H ATOM 9337 HB3 LEU B 231 66.027 35.655 10.239 1.00 0.00 H ATOM 9338 HG LEU B 231 64.929 35.365 12.082 1.00 0.00 H ATOM 9339 HD21 LEU B 231 63.393 33.449 10.224 1.00 0.00 H ATOM 9340 HD22 LEU B 231 64.975 33.114 10.969 1.00 0.00 H ATOM 9341 HD23 LEU B 231 63.522 33.252 11.989 1.00 0.00 H ATOM 9342 HD11 LEU B 231 63.192 36.918 11.737 1.00 0.00 H ATOM 9343 HD12 LEU B 231 62.263 35.731 10.789 1.00 0.00 H ATOM 9344 HD13 LEU B 231 62.573 35.442 12.519 1.00 0.00 H ATOM 9345 H LEU B 231 65.222 35.586 7.445 1.00 0.00 H ATOM 9346 N GLY B 232 65.539 38.911 10.215 1.00 24.12 N ATOM 9347 CA GLY B 232 66.479 39.928 10.656 1.00 24.74 C ATOM 9348 C GLY B 232 66.344 40.171 12.162 1.00 26.77 C ATOM 9349 O GLY B 232 65.247 40.051 12.713 1.00 26.69 O ATOM 9350 HA3 GLY B 232 66.277 40.857 10.123 1.00 0.00 H ATOM 9351 HA2 GLY B 232 67.494 39.597 10.436 1.00 0.00 H ATOM 9352 H GLY B 232 64.548 39.009 10.514 1.00 0.00 H ATOM 9353 N ASP B 233 67.456 40.462 12.836 1.00 24.23 N ATOM 9354 CA ASP B 233 67.462 40.711 14.291 1.00 22.61 C ATOM 9355 C ASP B 233 67.735 42.194 14.544 1.00 25.91 C ATOM 9356 O ASP B 233 68.372 42.872 13.714 1.00 21.49 O ATOM 9357 CB ASP B 233 68.613 39.985 14.999 1.00 24.20 C ATOM 9358 CG ASP B 233 68.630 38.481 14.771 1.00 28.60 C ATOM 9359 OD1 ASP B 233 67.567 37.849 14.701 1.00 25.00 O ATOM 9360 OD2 ASP B 233 69.735 37.905 14.842 1.00 25.87 O ATOM 9361 HA ASP B 233 66.497 40.369 14.665 1.00 0.00 H ATOM 9362 HB2 ASP B 233 69.554 40.398 14.635 1.00 0.00 H ATOM 9363 HB3 ASP B 233 68.527 40.169 16.070 1.00 0.00 H ATOM 9364 H ASP B 233 68.355 40.516 12.316 1.00 0.00 H ATOM 9365 N GLY B 234 67.344 42.689 15.721 1.00 21.95 N ATOM 9366 CA GLY B 234 67.646 44.072 16.077 1.00 22.74 C ATOM 9367 C GLY B 234 66.681 44.712 17.030 1.00 24.93 C ATOM 9368 O GLY B 234 65.893 44.046 17.682 1.00 23.04 O ATOM 9369 HA3 GLY B 234 67.656 44.662 15.160 1.00 0.00 H ATOM 9370 HA2 GLY B 234 68.636 44.095 16.533 1.00 0.00 H ATOM 9371 H GLY B 234 66.821 42.086 16.388 1.00 0.00 H ATOM 9372 N ALA B 235 66.702 46.032 17.087 1.00 21.20 N ATOM 9373 CA ALA B 235 65.784 46.724 17.973 1.00 19.30 C ATOM 9374 C ALA B 235 65.696 48.150 17.525 1.00 25.40 C ATOM 9375 O ALA B 235 66.664 48.682 17.013 1.00 24.34 O ATOM 9376 CB ALA B 235 66.273 46.654 19.410 1.00 19.09 C ATOM 9377 HA ALA B 235 64.802 46.253 17.933 1.00 0.00 H ATOM 9378 HB1 ALA B 235 66.343 45.611 19.718 1.00 0.00 H ATOM 9379 HB2 ALA B 235 67.255 47.122 19.482 1.00 0.00 H ATOM 9380 HB3 ALA B 235 65.571 47.179 20.057 1.00 0.00 H ATOM 9381 H ALA B 235 67.371 46.571 16.501 1.00 0.00 H ATOM 9382 N GLY B 236 64.525 48.754 17.683 1.00 22.94 N ATOM 9383 CA GLY B 236 64.335 50.143 17.315 1.00 22.66 C ATOM 9384 C GLY B 236 63.577 50.748 18.472 1.00 26.02 C ATOM 9385 O GLY B 236 62.629 50.136 18.975 1.00 23.92 O ATOM 9386 HA3 GLY B 236 63.757 50.221 16.394 1.00 0.00 H ATOM 9387 HA2 GLY B 236 65.296 50.640 17.183 1.00 0.00 H ATOM 9388 H GLY B 236 63.726 48.219 18.080 1.00 0.00 H ATOM 9389 N MET B 237 63.994 51.926 18.908 1.00 22.26 N ATOM 9390 CA MET B 237 63.315 52.649 20.006 1.00 20.67 C ATOM 9391 C MET B 237 63.211 54.135 19.715 1.00 26.68 C ATOM 9392 O MET B 237 64.130 54.743 19.154 1.00 25.84 O ATOM 9393 CB MET B 237 64.046 52.483 21.313 1.00 22.76 C ATOM 9394 CG MET B 237 64.306 51.065 21.681 1.00 24.58 C ATOM 9395 SD MET B 237 62.829 50.356 22.439 1.00 26.56 S ATOM 9396 CE MET B 237 63.257 48.685 22.279 1.00 22.41 C ATOM 9397 HA MET B 237 62.318 52.216 20.082 1.00 0.00 H ATOM 9398 HB2 MET B 237 65.003 53.000 21.240 1.00 0.00 H ATOM 9399 HB3 MET B 237 63.448 52.939 22.102 1.00 0.00 H ATOM 9400 HG2 MET B 237 65.135 51.019 22.388 1.00 0.00 H ATOM 9401 HG3 MET B 237 64.562 50.499 20.786 1.00 0.00 H ATOM 9402 HE1 MET B 237 63.392 48.445 21.224 1.00 0.00 H ATOM 9403 HE2 MET B 237 64.186 48.496 22.818 1.00 0.00 H ATOM 9404 HE3 MET B 237 62.462 48.066 22.695 1.00 0.00 H ATOM 9405 H MET B 237 64.828 52.359 18.463 1.00 0.00 H ATOM 9406 N LEU B 238 62.089 54.719 20.119 1.00 23.65 N ATOM 9407 CA LEU B 238 61.840 56.142 19.933 1.00 24.54 C ATOM 9408 C LEU B 238 61.405 56.682 21.281 1.00 29.43 C ATOM 9409 O LEU B 238 60.667 56.026 22.020 1.00 28.38 O ATOM 9410 CB LEU B 238 60.661 56.370 18.954 1.00 24.11 C ATOM 9411 CG LEU B 238 60.737 55.998 17.464 1.00 27.69 C ATOM 9412 CD1 LEU B 238 60.922 54.514 17.270 1.00 28.91 C ATOM 9413 CD2 LEU B 238 59.455 56.434 16.768 1.00 27.46 C ATOM 9414 HA LEU B 238 62.735 56.625 19.540 1.00 0.00 H ATOM 9415 HB2 LEU B 238 59.817 55.813 19.362 1.00 0.00 H ATOM 9416 HB3 LEU B 238 60.441 57.437 18.988 1.00 0.00 H ATOM 9417 HG LEU B 238 61.599 56.509 17.034 1.00 0.00 H ATOM 9418 HD21 LEU B 238 58.604 55.930 17.227 1.00 0.00 H ATOM 9419 HD22 LEU B 238 59.337 57.513 16.869 1.00 0.00 H ATOM 9420 HD23 LEU B 238 59.509 56.170 15.712 1.00 0.00 H ATOM 9421 HD11 LEU B 238 61.848 54.199 17.751 1.00 0.00 H ATOM 9422 HD12 LEU B 238 60.080 53.983 17.715 1.00 0.00 H ATOM 9423 HD13 LEU B 238 60.971 54.292 16.204 1.00 0.00 H ATOM 9424 H LEU B 238 61.362 54.140 20.585 1.00 0.00 H ATOM 9425 N VAL B 239 61.826 57.901 21.593 1.00 26.62 N ATOM 9426 CA VAL B 239 61.308 58.575 22.760 1.00 24.90 C ATOM 9427 C VAL B 239 60.182 59.440 22.192 1.00 27.75 C ATOM 9428 O VAL B 239 60.434 60.264 21.313 1.00 25.72 O ATOM 9429 CB VAL B 239 62.375 59.444 23.458 1.00 27.88 C ATOM 9430 CG1 VAL B 239 61.681 60.370 24.479 1.00 27.37 C ATOM 9431 CG2 VAL B 239 63.406 58.554 24.135 1.00 27.02 C ATOM 9432 HA VAL B 239 60.976 57.876 23.528 1.00 0.00 H ATOM 9433 HB VAL B 239 62.895 60.059 22.724 1.00 0.00 H ATOM 9434 HG11 VAL B 239 60.967 61.010 23.961 1.00 0.00 H ATOM 9435 HG12 VAL B 239 61.158 59.765 25.219 1.00 0.00 H ATOM 9436 HG13 VAL B 239 62.430 60.987 24.976 1.00 0.00 H ATOM 9437 HG21 VAL B 239 62.912 57.926 24.876 1.00 0.00 H ATOM 9438 HG22 VAL B 239 63.888 57.924 23.387 1.00 0.00 H ATOM 9439 HG23 VAL B 239 64.155 59.176 24.625 1.00 0.00 H ATOM 9440 H VAL B 239 62.533 58.373 20.994 1.00 0.00 H ATOM 9441 N LEU B 240 58.939 59.231 22.659 1.00 23.46 N ATOM 9442 CA LEU B 240 57.799 60.035 22.225 1.00 23.59 C ATOM 9443 C LEU B 240 57.529 60.977 23.380 1.00 26.61 C ATOM 9444 O LEU B 240 57.794 60.634 24.513 1.00 27.36 O ATOM 9445 CB LEU B 240 56.554 59.160 21.988 1.00 24.69 C ATOM 9446 CG LEU B 240 56.718 58.013 20.964 1.00 29.93 C ATOM 9447 CD1 LEU B 240 55.378 57.293 20.824 1.00 29.87 C ATOM 9448 CD2 LEU B 240 57.119 58.565 19.635 1.00 28.84 C ATOM 9449 HA LEU B 240 58.013 60.549 21.288 1.00 0.00 H ATOM 9450 HB2 LEU B 240 56.270 58.717 22.943 1.00 0.00 H ATOM 9451 HB3 LEU B 240 55.752 59.809 21.637 1.00 0.00 H ATOM 9452 HG LEU B 240 57.489 57.323 21.308 1.00 0.00 H ATOM 9453 HD21 LEU B 240 56.351 59.253 19.282 1.00 0.00 H ATOM 9454 HD22 LEU B 240 58.066 59.095 19.734 1.00 0.00 H ATOM 9455 HD23 LEU B 240 57.231 57.748 18.922 1.00 0.00 H ATOM 9456 HD11 LEU B 240 55.081 56.889 21.792 1.00 0.00 H ATOM 9457 HD12 LEU B 240 54.623 57.998 20.476 1.00 0.00 H ATOM 9458 HD13 LEU B 240 55.477 56.480 20.104 1.00 0.00 H ATOM 9459 H LEU B 240 58.784 58.472 23.352 1.00 0.00 H ATOM 9460 N GLU B 241 57.007 62.158 23.097 1.00 25.88 N ATOM 9461 CA GLU B 241 56.885 63.183 24.132 1.00 26.52 C ATOM 9462 C GLU B 241 55.802 64.221 23.792 1.00 30.77 C ATOM 9463 O GLU B 241 55.706 64.661 22.670 1.00 29.81 O ATOM 9464 CB GLU B 241 58.239 63.892 24.240 1.00 27.02 C ATOM 9465 CG GLU B 241 58.374 64.855 25.422 1.00 30.89 C ATOM 9466 CD GLU B 241 59.797 65.349 25.604 1.00 41.11 C ATOM 9467 OE1 GLU B 241 60.014 66.200 26.487 1.00 34.67 O ATOM 9468 OE2 GLU B 241 60.709 64.852 24.903 1.00 30.86 O ATOM 9469 HA GLU B 241 56.598 62.707 25.069 1.00 0.00 H ATOM 9470 HB2 GLU B 241 59.013 63.130 24.334 1.00 0.00 H ATOM 9471 HB3 GLU B 241 58.398 64.458 23.322 1.00 0.00 H ATOM 9472 HG2 GLU B 241 57.724 65.713 25.251 1.00 0.00 H ATOM 9473 HG3 GLU B 241 58.063 64.340 26.331 1.00 0.00 H ATOM 9474 H GLU B 241 56.681 62.360 22.130 1.00 0.00 H ATOM 9475 N GLU B 242 55.000 64.609 24.777 1.00 28.83 N ATOM 9476 CA GLU B 242 53.976 65.607 24.545 1.00 28.67 C ATOM 9477 C GLU B 242 54.663 66.885 24.031 1.00 34.62 C ATOM 9478 O GLU B 242 55.751 67.246 24.478 1.00 33.39 O ATOM 9479 CB GLU B 242 53.175 65.879 25.822 1.00 29.13 C ATOM 9480 CG GLU B 242 52.007 66.802 25.543 1.00 29.74 C ATOM 9481 CD GLU B 242 52.413 68.264 25.697 1.00 40.75 C ATOM 9482 OE1 GLU B 242 53.342 68.539 26.489 1.00 34.42 O ATOM 9483 OE2 GLU B 242 51.800 69.132 25.050 1.00 34.72 O ATOM 9484 HA GLU B 242 53.265 65.247 23.801 1.00 0.00 H ATOM 9485 HB2 GLU B 242 52.798 64.935 26.215 1.00 0.00 H ATOM 9486 HB3 GLU B 242 53.828 66.343 26.561 1.00 0.00 H ATOM 9487 HG2 GLU B 242 51.656 66.635 24.525 1.00 0.00 H ATOM 9488 HG3 GLU B 242 51.202 66.580 26.244 1.00 0.00 H ATOM 9489 H GLU B 242 55.108 64.192 25.724 1.00 0.00 H ATOM 9490 N TYR B 243 54.043 67.534 23.058 1.00 32.26 N ATOM 9491 CA TYR B 243 54.664 68.670 22.393 1.00 34.52 C ATOM 9492 C TYR B 243 55.128 69.822 23.292 1.00 37.75 C ATOM 9493 O TYR B 243 56.281 70.233 23.221 1.00 36.89 O ATOM 9494 CB TYR B 243 53.798 69.159 21.236 1.00 36.71 C ATOM 9495 CG TYR B 243 54.442 70.214 20.350 1.00 42.67 C ATOM 9496 CD1 TYR B 243 55.749 70.088 19.902 1.00 45.21 C ATOM 9497 CD2 TYR B 243 53.708 71.295 19.902 1.00 45.77 C ATOM 9498 CE1 TYR B 243 56.312 71.030 19.034 1.00 48.20 C ATOM 9499 CE2 TYR B 243 54.260 72.251 19.056 1.00 48.27 C ATOM 9500 CZ TYR B 243 55.559 72.120 18.627 1.00 58.80 C ATOM 9501 OH TYR B 243 56.091 73.092 17.800 1.00 64.16 O ATOM 9502 HA TYR B 243 55.603 68.274 22.006 1.00 0.00 H ATOM 9503 HB3 TYR B 243 52.883 69.580 21.653 1.00 0.00 H ATOM 9504 HB2 TYR B 243 53.550 68.300 20.613 1.00 0.00 H ATOM 9505 HD2 TYR B 243 52.671 71.401 20.219 1.00 0.00 H ATOM 9506 HE2 TYR B 243 53.663 73.104 18.733 1.00 0.00 H ATOM 9507 HE1 TYR B 243 57.336 70.907 18.680 1.00 0.00 H ATOM 9508 HD1 TYR B 243 56.348 69.240 20.232 1.00 0.00 H ATOM 9509 HH TYR B 243 55.557 73.144 16.968 1.00 0.00 H ATOM 9510 H TYR B 243 53.094 67.226 22.763 1.00 0.00 H ATOM 9511 N GLU B 244 54.254 70.324 24.157 1.00 32.78 N ATOM 9512 CA GLU B 244 54.659 71.454 25.001 1.00 31.41 C ATOM 9513 C GLU B 244 55.762 71.124 25.974 1.00 38.36 C ATOM 9514 O GLU B 244 56.579 71.987 26.323 1.00 38.87 O ATOM 9515 CB GLU B 244 53.469 72.076 25.702 1.00 32.17 C ATOM 9516 CG GLU B 244 52.374 72.434 24.742 1.00 38.97 C ATOM 9517 CD GLU B 244 52.698 73.669 23.929 1.00 56.36 C ATOM 9518 OE1 GLU B 244 53.740 74.312 24.181 1.00 43.41 O ATOM 9519 OE2 GLU B 244 51.873 74.018 23.067 1.00 53.25 O ATOM 9520 HA GLU B 244 55.081 72.193 24.320 1.00 0.00 H ATOM 9521 HB2 GLU B 244 53.079 71.366 26.431 1.00 0.00 H ATOM 9522 HB3 GLU B 244 53.796 72.980 26.216 1.00 0.00 H ATOM 9523 HG2 GLU B 244 52.218 71.597 24.061 1.00 0.00 H ATOM 9524 HG3 GLU B 244 51.459 72.616 25.306 1.00 0.00 H ATOM 9525 H GLU B 244 53.298 69.923 24.235 1.00 0.00 H ATOM 9526 N HIS B 245 55.778 69.866 26.422 1.00 33.27 N ATOM 9527 CA HIS B 245 56.793 69.378 27.325 1.00 32.75 C ATOM 9528 C HIS B 245 58.149 69.344 26.595 1.00 36.04 C ATOM 9529 O HIS B 245 59.189 69.642 27.190 1.00 34.60 O ATOM 9530 CB HIS B 245 56.406 67.953 27.796 1.00 33.08 C ATOM 9531 CG HIS B 245 57.301 67.394 28.855 1.00 34.51 C ATOM 9532 ND1 HIS B 245 58.483 66.746 28.561 1.00 35.47 N ATOM 9533 CD2 HIS B 245 57.162 67.333 30.200 1.00 36.18 C ATOM 9534 CE1 HIS B 245 59.057 66.349 29.685 1.00 34.89 C ATOM 9535 NE2 HIS B 245 58.270 66.681 30.695 1.00 35.51 N ATOM 9536 HA HIS B 245 56.872 70.035 28.191 1.00 0.00 H ATOM 9537 HB2 HIS B 245 55.390 67.987 28.189 1.00 0.00 H ATOM 9538 HB3 HIS B 245 56.439 67.287 26.934 1.00 0.00 H ATOM 9539 HD2 HIS B 245 56.329 67.726 30.783 1.00 0.00 H ATOM 9540 HE1 HIS B 245 60.015 65.836 29.765 1.00 0.00 H ATOM 9541 H HIS B 245 55.031 69.214 26.109 1.00 0.00 H ATOM 9542 N ALA B 246 58.143 68.927 25.322 1.00 34.05 N ATOM 9543 CA ALA B 246 59.389 68.861 24.540 1.00 33.50 C ATOM 9544 C ALA B 246 60.018 70.267 24.418 1.00 38.68 C ATOM 9545 O ALA B 246 61.148 70.486 24.865 1.00 36.47 O ATOM 9546 CB ALA B 246 59.136 68.257 23.144 1.00 33.60 C ATOM 9547 HA ALA B 246 60.087 68.209 25.065 1.00 0.00 H ATOM 9548 HB1 ALA B 246 58.738 67.248 23.253 1.00 0.00 H ATOM 9549 HB2 ALA B 246 58.418 68.876 22.606 1.00 0.00 H ATOM 9550 HB3 ALA B 246 60.074 68.221 22.590 1.00 0.00 H ATOM 9551 H ALA B 246 57.245 68.646 24.879 1.00 0.00 H ATOM 9552 N LYS B 247 59.265 71.210 23.849 1.00 37.18 N ATOM 9553 CA LYS B 247 59.732 72.606 23.702 1.00 38.04 C ATOM 9554 C LYS B 247 60.266 73.226 25.010 1.00 43.44 C ATOM 9555 O LYS B 247 61.380 73.733 25.071 1.00 43.91 O ATOM 9556 CB LYS B 247 58.584 73.481 23.208 1.00 40.58 C ATOM 9557 CG LYS B 247 58.059 73.141 21.815 1.00 52.67 C ATOM 9558 CD LYS B 247 56.630 73.632 21.669 1.00 64.25 C ATOM 9559 CE LYS B 247 56.521 74.741 20.638 1.00 86.73 C ATOM 9560 NZ LYS B 247 55.220 75.469 20.733 1.00 97.19 N ATOM 9561 HA LYS B 247 60.557 72.570 22.990 1.00 0.00 H ATOM 9562 HB2 LYS B 247 57.758 73.384 23.913 1.00 0.00 H ATOM 9563 HB3 LYS B 247 58.929 74.515 23.195 1.00 0.00 H ATOM 9564 HG2 LYS B 247 58.686 73.623 21.064 1.00 0.00 H ATOM 9565 HG3 LYS B 247 58.087 72.061 21.671 1.00 0.00 H ATOM 9566 HD2 LYS B 247 55.999 72.798 21.360 1.00 0.00 H ATOM 9567 HD3 LYS B 247 56.285 74.009 22.632 1.00 0.00 H ATOM 9568 HE2 LYS B 247 56.609 74.306 19.642 1.00 0.00 H ATOM 9569 HE3 LYS B 247 57.334 75.450 20.796 1.00 0.00 H ATOM 9570 HZ1 LYS B 247 54.438 74.801 20.576 1.00 0.00 H ATOM 9571 HZ2 LYS B 247 55.130 75.894 21.678 1.00 0.00 H ATOM 9572 HZ3 LYS B 247 55.189 76.217 20.011 1.00 0.00 H ATOM 9573 H LYS B 247 58.320 70.956 23.498 1.00 0.00 H ATOM 9574 N LYS B 248 59.438 73.219 26.043 1.00 40.63 N ATOM 9575 CA LYS B 248 59.794 73.798 27.330 1.00 40.27 C ATOM 9576 C LYS B 248 61.162 73.353 27.821 1.00 45.32 C ATOM 9577 O LYS B 248 61.846 74.100 28.527 1.00 44.17 O ATOM 9578 CB LYS B 248 58.712 73.486 28.369 1.00 42.59 C ATOM 9579 CG LYS B 248 59.003 73.982 29.770 1.00 64.00 C ATOM 9580 CD LYS B 248 57.768 73.877 30.663 1.00 81.96 C ATOM 9581 CE LYS B 248 56.501 73.615 29.838 1.00102.86 C ATOM 9582 NZ LYS B 248 55.468 74.692 29.962 1.00113.49 N ATOM 9583 HA LYS B 248 59.855 74.877 27.189 1.00 0.00 H ATOM 9584 HB2 LYS B 248 57.781 73.944 28.035 1.00 0.00 H ATOM 9585 HB3 LYS B 248 58.588 72.404 28.413 1.00 0.00 H ATOM 9586 HG2 LYS B 248 59.805 73.382 30.200 1.00 0.00 H ATOM 9587 HG3 LYS B 248 59.318 75.024 29.720 1.00 0.00 H ATOM 9588 HD2 LYS B 248 57.908 73.058 31.368 1.00 0.00 H ATOM 9589 HD3 LYS B 248 57.647 74.811 31.213 1.00 0.00 H ATOM 9590 HE2 LYS B 248 56.061 72.675 30.172 1.00 0.00 H ATOM 9591 HE3 LYS B 248 56.785 73.529 28.789 1.00 0.00 H ATOM 9592 HZ1 LYS B 248 55.178 74.779 30.957 1.00 0.00 H ATOM 9593 HZ2 LYS B 248 55.869 75.595 29.636 1.00 0.00 H ATOM 9594 HZ3 LYS B 248 54.642 74.448 29.379 1.00 0.00 H ATOM 9595 H LYS B 248 58.500 72.784 25.931 1.00 0.00 H ATOM 9596 N ARG B 249 61.587 72.148 27.454 1.00 40.38 N ATOM 9597 CA ARG B 249 62.914 71.692 27.884 1.00 39.96 C ATOM 9598 C ARG B 249 63.961 71.860 26.789 1.00 43.78 C ATOM 9599 O ARG B 249 65.107 71.405 26.933 1.00 44.35 O ATOM 9600 CB ARG B 249 62.903 70.226 28.336 1.00 43.10 C ATOM 9601 CG ARG B 249 62.515 69.241 27.235 1.00 34.15 C ATOM 9602 CD ARG B 249 62.506 67.793 27.766 1.00 46.68 C ATOM 9603 NE ARG B 249 63.797 67.204 27.482 1.00 61.81 N ATOM 9604 CZ ARG B 249 64.046 66.345 26.507 1.00 68.37 C ATOM 9605 NH1 ARG B 249 63.070 65.841 25.779 1.00 56.74 N ATOM 9606 NH2 ARG B 249 65.286 65.948 26.310 1.00 60.87 N ATOM 9607 HA ARG B 249 63.179 72.324 28.731 1.00 0.00 H ATOM 9608 HB2 ARG B 249 63.901 69.969 28.691 1.00 0.00 H ATOM 9609 HB3 ARG B 249 62.190 70.124 29.154 1.00 0.00 H ATOM 9610 HG2 ARG B 249 61.520 69.492 26.866 1.00 0.00 H ATOM 9611 HG3 ARG B 249 63.234 69.317 26.419 1.00 0.00 H ATOM 9612 HD2 ARG B 249 61.721 67.222 27.270 1.00 0.00 H ATOM 9613 HD3 ARG B 249 62.328 67.794 28.841 1.00 0.00 H ATOM 9614 HE ARG B 249 64.593 67.478 28.093 1.00 0.00 H ATOM 9615 HH12 ARG B 249 63.285 65.167 25.017 1.00 0.00 H ATOM 9616 HH11 ARG B 249 62.085 66.117 25.967 1.00 0.00 H ATOM 9617 HH22 ARG B 249 65.501 65.273 25.548 1.00 0.00 H ATOM 9618 HH21 ARG B 249 66.050 66.309 26.916 1.00 0.00 H ATOM 9619 H ARG B 249 60.985 71.535 26.868 1.00 0.00 H ATOM 9620 N GLY B 250 63.567 72.488 25.693 1.00 39.42 N ATOM 9621 CA GLY B 250 64.473 72.700 24.575 1.00 40.74 C ATOM 9622 C GLY B 250 64.920 71.400 23.909 1.00 43.43 C ATOM 9623 O GLY B 250 66.095 71.234 23.572 1.00 43.32 O ATOM 9624 HA3 GLY B 250 65.356 73.225 24.939 1.00 0.00 H ATOM 9625 HA2 GLY B 250 63.967 73.315 23.831 1.00 0.00 H ATOM 9626 H GLY B 250 62.589 72.837 25.630 1.00 0.00 H ATOM 9627 N ALA B 251 63.980 70.474 23.737 1.00 36.60 N ATOM 9628 CA ALA B 251 64.281 69.192 23.101 1.00 36.51 C ATOM 9629 C ALA B 251 64.486 69.321 21.586 1.00 38.22 C ATOM 9630 O ALA B 251 63.854 70.127 20.926 1.00 36.85 O ATOM 9631 CB ALA B 251 63.151 68.182 23.383 1.00 36.99 C ATOM 9632 HA ALA B 251 65.217 68.837 23.531 1.00 0.00 H ATOM 9633 HB1 ALA B 251 63.057 68.035 24.459 1.00 0.00 H ATOM 9634 HB2 ALA B 251 62.213 68.568 22.985 1.00 0.00 H ATOM 9635 HB3 ALA B 251 63.387 67.232 22.904 1.00 0.00 H ATOM 9636 H ALA B 251 63.011 70.666 24.062 1.00 0.00 H ATOM 9637 N LYS B 252 65.308 68.451 21.023 1.00 35.68 N ATOM 9638 CA LYS B 252 65.425 68.415 19.575 1.00 35.86 C ATOM 9639 C LYS B 252 64.257 67.550 19.125 1.00 37.32 C ATOM 9640 O LYS B 252 63.924 66.553 19.773 1.00 36.02 O ATOM 9641 CB LYS B 252 66.762 67.829 19.135 1.00 38.81 C ATOM 9642 CG LYS B 252 66.908 66.358 19.293 1.00 49.13 C ATOM 9643 CD LYS B 252 68.111 65.889 18.487 1.00 47.29 C ATOM 9644 CE LYS B 252 68.421 64.453 18.813 1.00 38.33 C ATOM 9645 NZ LYS B 252 69.814 64.132 18.448 1.00 34.14 N ATOM 9646 HA LYS B 252 65.394 69.411 19.133 1.00 0.00 H ATOM 9647 HB2 LYS B 252 66.901 68.068 18.081 1.00 0.00 H ATOM 9648 HB3 LYS B 252 67.546 68.308 19.721 1.00 0.00 H ATOM 9649 HG2 LYS B 252 67.056 66.116 20.345 1.00 0.00 H ATOM 9650 HG3 LYS B 252 66.009 65.860 18.931 1.00 0.00 H ATOM 9651 HD2 LYS B 252 67.890 65.978 17.423 1.00 0.00 H ATOM 9652 HD3 LYS B 252 68.973 66.509 18.731 1.00 0.00 H ATOM 9653 HE2 LYS B 252 67.745 63.804 18.256 1.00 0.00 H ATOM 9654 HE3 LYS B 252 68.282 64.289 19.882 1.00 0.00 H ATOM 9655 HZ1 LYS B 252 69.948 64.285 17.428 1.00 0.00 H ATOM 9656 HZ2 LYS B 252 70.461 64.748 18.980 1.00 0.00 H ATOM 9657 HZ3 LYS B 252 70.011 63.137 18.680 1.00 0.00 H ATOM 9658 H LYS B 252 65.865 67.799 21.611 1.00 0.00 H ATOM 9659 N ILE B 253 63.547 68.002 18.107 1.00 32.21 N ATOM 9660 CA ILE B 253 62.343 67.311 17.685 1.00 32.95 C ATOM 9661 C ILE B 253 62.517 66.765 16.285 1.00 37.31 C ATOM 9662 O ILE B 253 62.692 67.527 15.337 1.00 37.22 O ATOM 9663 CB ILE B 253 61.143 68.243 17.772 1.00 35.76 C ATOM 9664 CG1 ILE B 253 60.960 68.718 19.217 1.00 35.60 C ATOM 9665 CG2 ILE B 253 59.873 67.555 17.263 1.00 36.46 C ATOM 9666 CD1 ILE B 253 59.842 69.739 19.347 1.00 38.81 C ATOM 9667 HA ILE B 253 62.162 66.469 18.353 1.00 0.00 H ATOM 9668 HB ILE B 253 61.327 69.108 17.135 1.00 0.00 H ATOM 9669 HG12 ILE B 253 60.725 67.857 19.843 1.00 0.00 H ATOM 9670 HG13 ILE B 253 61.891 69.170 19.559 1.00 0.00 H ATOM 9671 HD11 ILE B 253 60.072 70.608 18.730 1.00 0.00 H ATOM 9672 HD12 ILE B 253 58.904 69.294 19.015 1.00 0.00 H ATOM 9673 HD13 ILE B 253 59.751 70.045 20.389 1.00 0.00 H ATOM 9674 HG21 ILE B 253 60.013 67.261 16.223 1.00 0.00 H ATOM 9675 HG22 ILE B 253 59.673 66.671 17.868 1.00 0.00 H ATOM 9676 HG23 ILE B 253 59.033 68.245 17.337 1.00 0.00 H ATOM 9677 H ILE B 253 63.853 68.859 17.604 1.00 0.00 H ATOM 9678 N TYR B 254 62.492 65.446 16.148 1.00 30.15 N ATOM 9679 CA TYR B 254 62.669 64.856 14.824 1.00 28.75 C ATOM 9680 C TYR B 254 61.465 64.990 13.900 1.00 33.01 C ATOM 9681 O TYR B 254 61.621 65.209 12.712 1.00 34.54 O ATOM 9682 CB TYR B 254 63.090 63.384 14.927 1.00 27.37 C ATOM 9683 CG TYR B 254 64.460 63.133 15.467 1.00 26.72 C ATOM 9684 CD1 TYR B 254 65.559 63.059 14.613 1.00 28.56 C ATOM 9685 CD2 TYR B 254 64.640 62.780 16.793 1.00 27.49 C ATOM 9686 CE1 TYR B 254 66.813 62.726 15.097 1.00 27.39 C ATOM 9687 CE2 TYR B 254 65.875 62.442 17.272 1.00 29.50 C ATOM 9688 CZ TYR B 254 66.963 62.423 16.413 1.00 31.70 C ATOM 9689 OH TYR B 254 68.194 62.062 16.898 1.00 31.75 O ATOM 9690 HA TYR B 254 63.466 65.441 14.364 1.00 0.00 H ATOM 9691 HB3 TYR B 254 63.040 62.952 13.928 1.00 0.00 H ATOM 9692 HB2 TYR B 254 62.377 62.877 15.577 1.00 0.00 H ATOM 9693 HD2 TYR B 254 63.783 62.771 17.467 1.00 0.00 H ATOM 9694 HE2 TYR B 254 66.004 62.189 18.324 1.00 0.00 H ATOM 9695 HE1 TYR B 254 67.673 62.707 14.428 1.00 0.00 H ATOM 9696 HD1 TYR B 254 65.430 63.266 13.551 1.00 0.00 H ATOM 9697 HH TYR B 254 68.148 61.141 17.258 1.00 0.00 H ATOM 9698 H TYR B 254 62.347 64.836 16.978 1.00 0.00 H ATOM 9699 N ALA B 255 60.271 64.760 14.432 1.00 29.36 N ATOM 9700 CA ALA B 255 59.048 64.745 13.639 1.00 27.90 C ATOM 9701 C ALA B 255 57.890 64.668 14.618 1.00 30.07 C ATOM 9702 O ALA B 255 58.096 64.496 15.809 1.00 29.72 O ATOM 9703 CB ALA B 255 59.033 63.479 12.722 1.00 28.91 C ATOM 9704 HA ALA B 255 58.978 65.633 13.010 1.00 0.00 H ATOM 9705 HB1 ALA B 255 59.896 63.503 12.057 1.00 0.00 H ATOM 9706 HB2 ALA B 255 59.075 62.583 13.341 1.00 0.00 H ATOM 9707 HB3 ALA B 255 58.117 63.471 12.131 1.00 0.00 H ATOM 9708 H ALA B 255 60.205 64.584 15.455 1.00 0.00 H ATOM 9709 N GLU B 256 56.672 64.801 14.115 1.00 26.82 N ATOM 9710 CA GLU B 256 55.499 64.674 14.964 1.00 26.99 C ATOM 9711 C GLU B 256 54.774 63.406 14.545 1.00 30.11 C ATOM 9712 O GLU B 256 54.735 63.099 13.358 1.00 29.13 O ATOM 9713 CB GLU B 256 54.551 65.838 14.733 1.00 27.97 C ATOM 9714 CG GLU B 256 53.301 65.785 15.597 1.00 30.82 C ATOM 9715 CD GLU B 256 52.391 66.955 15.293 1.00 46.82 C ATOM 9716 OE1 GLU B 256 52.799 67.808 14.480 1.00 39.51 O ATOM 9717 OE2 GLU B 256 51.291 67.042 15.870 1.00 32.25 O ATOM 9718 HA GLU B 256 55.803 64.654 16.010 1.00 0.00 H ATOM 9719 HB2 GLU B 256 55.082 66.764 14.951 1.00 0.00 H ATOM 9720 HB3 GLU B 256 54.247 65.833 13.686 1.00 0.00 H ATOM 9721 HG2 GLU B 256 52.768 64.855 15.399 1.00 0.00 H ATOM 9722 HG3 GLU B 256 53.590 65.819 16.647 1.00 0.00 H ATOM 9723 H GLU B 256 56.553 64.999 13.101 1.00 0.00 H ATOM 9724 N LEU B 257 54.184 62.685 15.504 1.00 27.65 N ATOM 9725 CA LEU B 257 53.406 61.461 15.182 1.00 26.16 C ATOM 9726 C LEU B 257 51.952 61.925 15.110 1.00 28.40 C ATOM 9727 O LEU B 257 51.408 62.353 16.132 1.00 28.74 O ATOM 9728 CB LEU B 257 53.565 60.421 16.305 1.00 26.62 C ATOM 9729 CG LEU B 257 53.249 58.977 15.888 1.00 32.96 C ATOM 9730 CD1 LEU B 257 53.394 58.002 17.049 1.00 33.72 C ATOM 9731 CD2 LEU B 257 51.892 58.889 15.320 1.00 39.30 C ATOM 9732 HA LEU B 257 53.741 60.995 14.255 1.00 0.00 H ATOM 9733 HB2 LEU B 257 54.596 60.456 16.657 1.00 0.00 H ATOM 9734 HB3 LEU B 257 52.894 60.695 17.120 1.00 0.00 H ATOM 9735 HG LEU B 257 53.977 58.695 15.127 1.00 0.00 H ATOM 9736 HD21 LEU B 257 51.165 59.210 16.067 1.00 0.00 H ATOM 9737 HD22 LEU B 257 51.824 59.534 14.444 1.00 0.00 H ATOM 9738 HD23 LEU B 257 51.687 57.858 15.031 1.00 0.00 H ATOM 9739 HD11 LEU B 257 54.418 58.033 17.422 1.00 0.00 H ATOM 9740 HD12 LEU B 257 52.707 58.284 17.847 1.00 0.00 H ATOM 9741 HD13 LEU B 257 53.161 56.994 16.706 1.00 0.00 H ATOM 9742 H LEU B 257 54.271 62.987 16.495 1.00 0.00 H ATOM 9743 N VAL B 258 51.331 61.878 13.927 1.00 23.88 N ATOM 9744 CA VAL B 258 49.982 62.441 13.760 1.00 24.84 C ATOM 9745 C VAL B 258 48.814 61.470 13.595 1.00 30.08 C ATOM 9746 O VAL B 258 47.655 61.833 13.836 1.00 29.77 O ATOM 9747 CB VAL B 258 49.960 63.471 12.587 1.00 28.91 C ATOM 9748 CG1 VAL B 258 50.869 64.680 12.908 1.00 28.29 C ATOM 9749 CG2 VAL B 258 50.423 62.815 11.293 1.00 28.87 C ATOM 9750 HA VAL B 258 49.802 62.907 14.729 1.00 0.00 H ATOM 9751 HB VAL B 258 48.935 63.820 12.463 1.00 0.00 H ATOM 9752 HG11 VAL B 258 50.514 65.169 13.815 1.00 0.00 H ATOM 9753 HG12 VAL B 258 51.892 64.334 13.056 1.00 0.00 H ATOM 9754 HG13 VAL B 258 50.839 65.386 12.078 1.00 0.00 H ATOM 9755 HG21 VAL B 258 51.440 62.443 11.419 1.00 0.00 H ATOM 9756 HG22 VAL B 258 49.759 61.986 11.050 1.00 0.00 H ATOM 9757 HG23 VAL B 258 50.401 63.549 10.487 1.00 0.00 H ATOM 9758 H VAL B 258 51.808 61.438 13.114 1.00 0.00 H ATOM 9759 N GLY B 259 49.098 60.273 13.097 1.00 26.66 N ATOM 9760 CA GLY B 259 48.051 59.307 12.829 1.00 26.57 C ATOM 9761 C GLY B 259 48.462 57.883 13.156 1.00 29.15 C ATOM 9762 O GLY B 259 49.633 57.495 12.987 1.00 27.81 O ATOM 9763 HA3 GLY B 259 47.791 59.360 11.772 1.00 0.00 H ATOM 9764 HA2 GLY B 259 47.179 59.564 13.430 1.00 0.00 H ATOM 9765 H GLY B 259 50.088 60.024 12.896 1.00 0.00 H ATOM 9766 N PHE B 260 47.492 57.117 13.646 1.00 25.49 N ATOM 9767 CA PHE B 260 47.691 55.700 14.019 1.00 23.85 C ATOM 9768 C PHE B 260 46.395 54.952 13.698 1.00 28.93 C ATOM 9769 O PHE B 260 45.325 55.325 14.173 1.00 27.82 O ATOM 9770 CB PHE B 260 48.069 55.611 15.516 1.00 24.26 C ATOM 9771 CG PHE B 260 48.087 54.197 16.095 1.00 23.73 C ATOM 9772 CD1 PHE B 260 48.607 53.131 15.382 1.00 24.90 C ATOM 9773 CD2 PHE B 260 47.650 53.978 17.405 1.00 23.82 C ATOM 9774 CE1 PHE B 260 48.673 51.855 15.961 1.00 23.71 C ATOM 9775 CE2 PHE B 260 47.707 52.717 17.989 1.00 23.68 C ATOM 9776 CZ PHE B 260 48.217 51.666 17.283 1.00 21.59 C ATOM 9777 HA PHE B 260 48.507 55.244 13.459 1.00 0.00 H ATOM 9778 HB2 PHE B 260 49.063 56.040 15.640 1.00 0.00 H ATOM 9779 HB3 PHE B 260 47.347 56.200 16.083 1.00 0.00 H ATOM 9780 HD2 PHE B 260 47.256 54.815 17.982 1.00 0.00 H ATOM 9781 HE2 PHE B 260 47.346 52.569 19.007 1.00 0.00 H ATOM 9782 HZ PHE B 260 48.272 50.679 17.741 1.00 0.00 H ATOM 9783 HE1 PHE B 260 49.074 51.015 15.394 1.00 0.00 H ATOM 9784 HD1 PHE B 260 48.967 53.284 14.365 1.00 0.00 H ATOM 9785 H PHE B 260 46.548 57.534 13.773 1.00 0.00 H ATOM 9786 N GLY B 261 46.502 53.940 12.834 1.00 26.86 N ATOM 9787 CA GLY B 261 45.382 53.132 12.398 1.00 26.05 C ATOM 9788 C GLY B 261 45.606 51.651 12.636 1.00 29.12 C ATOM 9789 O GLY B 261 46.720 51.129 12.508 1.00 26.58 O ATOM 9790 HA3 GLY B 261 45.227 53.295 11.331 1.00 0.00 H ATOM 9791 HA2 GLY B 261 44.492 53.443 12.945 1.00 0.00 H ATOM 9792 H GLY B 261 47.444 53.719 12.452 1.00 0.00 H ATOM 9793 N MET B 262 44.524 50.965 12.982 1.00 26.09 N ATOM 9794 CA MET B 262 44.555 49.530 13.239 1.00 23.59 C ATOM 9795 C MET B 262 43.447 48.820 12.469 1.00 26.58 C ATOM 9796 O MET B 262 42.432 49.413 12.191 1.00 26.39 O ATOM 9797 CB MET B 262 44.313 49.286 14.749 1.00 24.66 C ATOM 9798 CG MET B 262 45.458 49.767 15.623 1.00 25.29 C ATOM 9799 SD MET B 262 44.983 49.732 17.361 1.00 27.90 S ATOM 9800 CE MET B 262 44.233 51.314 17.565 1.00 24.12 C ATOM 9801 HA MET B 262 45.524 49.143 12.924 1.00 0.00 H ATOM 9802 HB2 MET B 262 43.406 49.813 15.045 1.00 0.00 H ATOM 9803 HB3 MET B 262 44.179 48.216 14.910 1.00 0.00 H ATOM 9804 HG2 MET B 262 45.719 50.787 15.343 1.00 0.00 H ATOM 9805 HG3 MET B 262 46.321 49.118 15.473 1.00 0.00 H ATOM 9806 HE1 MET B 262 44.961 52.092 17.336 1.00 0.00 H ATOM 9807 HE2 MET B 262 43.382 51.401 16.890 1.00 0.00 H ATOM 9808 HE3 MET B 262 43.894 51.424 18.595 1.00 0.00 H ATOM 9809 H MET B 262 43.619 51.470 13.073 1.00 0.00 H ATOM 9810 N SER B 263 43.623 47.528 12.194 1.00 23.94 N ATOM 9811 CA SER B 263 42.560 46.732 11.588 1.00 24.11 C ATOM 9812 C SER B 263 42.899 45.266 11.756 1.00 30.48 C ATOM 9813 O SER B 263 44.015 44.923 12.178 1.00 29.84 O ATOM 9814 CB SER B 263 42.447 47.035 10.092 1.00 25.74 C ATOM 9815 OG SER B 263 43.505 46.410 9.383 1.00 30.63 O ATOM 9816 HA SER B 263 41.615 46.974 12.074 1.00 0.00 H ATOM 9817 HB2 SER B 263 42.498 48.113 9.938 1.00 0.00 H ATOM 9818 HB3 SER B 263 41.493 46.661 9.720 1.00 0.00 H ATOM 9819 HG SER B 263 43.420 46.614 8.418 1.00 0.00 H ATOM 9820 H SER B 263 44.534 47.079 12.415 1.00 0.00 H ATOM 9821 N SER B 264 41.952 44.405 11.387 1.00 25.60 N ATOM 9822 CA SER B 264 42.178 42.968 11.393 1.00 25.97 C ATOM 9823 C SER B 264 41.692 42.425 10.027 1.00 26.15 C ATOM 9824 O SER B 264 40.720 42.933 9.488 1.00 23.81 O ATOM 9825 CB SER B 264 41.398 42.319 12.536 1.00 29.31 C ATOM 9826 OG SER B 264 41.815 42.803 13.804 1.00 28.87 O ATOM 9827 HA SER B 264 43.233 42.739 11.542 1.00 0.00 H ATOM 9828 HB2 SER B 264 41.554 41.241 12.502 1.00 0.00 H ATOM 9829 HB3 SER B 264 40.338 42.536 12.407 1.00 0.00 H ATOM 9830 HG SER B 264 42.776 42.604 13.932 1.00 0.00 H ATOM 9831 H SER B 264 41.026 44.770 11.086 1.00 0.00 H ATOM 9832 N ASP B 265 42.401 41.458 9.444 1.00 22.36 N ATOM 9833 CA ASP B 265 42.017 40.933 8.137 1.00 23.49 C ATOM 9834 C ASP B 265 40.799 40.008 8.272 1.00 31.41 C ATOM 9835 O ASP B 265 40.032 39.877 7.318 1.00 30.68 O ATOM 9836 CB ASP B 265 43.133 40.064 7.515 1.00 25.68 C ATOM 9837 CG ASP B 265 44.264 40.855 6.944 1.00 26.95 C ATOM 9838 OD1 ASP B 265 44.146 42.099 6.782 1.00 26.67 O ATOM 9839 OD2 ASP B 265 45.316 40.200 6.753 1.00 24.61 O ATOM 9840 HA ASP B 265 41.810 41.801 7.511 1.00 0.00 H ATOM 9841 HB2 ASP B 265 43.529 39.407 8.289 1.00 0.00 H ATOM 9842 HB3 ASP B 265 42.697 39.462 6.718 1.00 0.00 H ATOM 9843 H ASP B 265 43.238 41.073 9.926 1.00 0.00 H ATOM 9844 N ALA B 266 40.694 39.297 9.408 1.00 29.24 N ATOM 9845 CA ALA B 266 39.618 38.310 9.646 1.00 27.13 C ATOM 9846 C ALA B 266 39.575 37.328 8.480 1.00 31.71 C ATOM 9847 O ALA B 266 38.510 37.000 7.974 1.00 32.30 O ATOM 9848 CB ALA B 266 38.254 39.011 9.771 1.00 27.26 C ATOM 9849 HA ALA B 266 39.825 37.782 10.577 1.00 0.00 H ATOM 9850 HB1 ALA B 266 38.282 39.711 10.606 1.00 0.00 H ATOM 9851 HB2 ALA B 266 38.039 39.552 8.849 1.00 0.00 H ATOM 9852 HB3 ALA B 266 37.478 38.265 9.946 1.00 0.00 H ATOM 9853 H ALA B 266 41.402 39.448 10.154 1.00 0.00 H ATOM 9854 N TYR B 267 40.738 36.873 8.040 1.00 28.09 N ATOM 9855 CA TYR B 267 40.822 36.019 6.864 1.00 28.10 C ATOM 9856 C TYR B 267 41.532 34.703 7.112 1.00 33.48 C ATOM 9857 O TYR B 267 40.919 33.656 7.054 1.00 35.84 O ATOM 9858 CB TYR B 267 41.441 36.808 5.678 1.00 28.16 C ATOM 9859 CG TYR B 267 41.689 35.990 4.433 1.00 33.27 C ATOM 9860 CD1 TYR B 267 40.627 35.569 3.620 1.00 37.16 C ATOM 9861 CD2 TYR B 267 42.976 35.661 4.044 1.00 33.83 C ATOM 9862 CE1 TYR B 267 40.856 34.789 2.476 1.00 38.88 C ATOM 9863 CE2 TYR B 267 43.212 34.858 2.935 1.00 36.17 C ATOM 9864 CZ TYR B 267 42.150 34.447 2.134 1.00 47.16 C ATOM 9865 OH TYR B 267 42.400 33.695 0.995 1.00 47.95 O ATOM 9866 HA TYR B 267 39.803 35.734 6.602 1.00 0.00 H ATOM 9867 HB3 TYR B 267 42.394 37.223 6.007 1.00 0.00 H ATOM 9868 HB2 TYR B 267 40.762 37.621 5.420 1.00 0.00 H ATOM 9869 HD2 TYR B 267 43.821 36.039 4.619 1.00 0.00 H ATOM 9870 HE2 TYR B 267 44.229 34.550 2.692 1.00 0.00 H ATOM 9871 HE1 TYR B 267 40.019 34.456 1.862 1.00 0.00 H ATOM 9872 HD1 TYR B 267 39.607 35.852 3.881 1.00 0.00 H ATOM 9873 HH TYR B 267 42.982 34.210 0.382 1.00 0.00 H ATOM 9874 H TYR B 267 41.610 37.131 8.545 1.00 0.00 H ATOM 9875 N HIS B 268 42.832 34.737 7.373 1.00 27.90 N ATOM 9876 CA HIS B 268 43.571 33.505 7.580 1.00 27.97 C ATOM 9877 C HIS B 268 44.697 33.840 8.547 1.00 30.34 C ATOM 9878 O HIS B 268 45.191 34.967 8.556 1.00 28.11 O ATOM 9879 CB HIS B 268 44.134 33.022 6.241 1.00 30.66 C ATOM 9880 CG HIS B 268 45.028 31.822 6.342 1.00 35.11 C ATOM 9881 ND1 HIS B 268 44.648 30.571 5.895 1.00 38.62 N ATOM 9882 CD2 HIS B 268 46.306 31.695 6.769 1.00 36.72 C ATOM 9883 CE1 HIS B 268 45.651 29.722 6.062 1.00 37.32 C ATOM 9884 NE2 HIS B 268 46.668 30.380 6.592 1.00 37.20 N ATOM 9885 HA HIS B 268 42.941 32.712 7.982 1.00 0.00 H ATOM 9886 HB2 HIS B 268 43.297 32.770 5.590 1.00 0.00 H ATOM 9887 HB3 HIS B 268 44.706 33.837 5.797 1.00 0.00 H ATOM 9888 HD2 HIS B 268 46.932 32.488 7.178 1.00 0.00 H ATOM 9889 HE1 HIS B 268 45.640 28.662 5.806 1.00 0.00 H ATOM 9890 H HIS B 268 43.324 35.651 7.430 1.00 0.00 H ATOM 9891 N MET B 269 45.085 32.869 9.350 1.00 28.56 N ATOM 9892 CA MET B 269 46.093 33.067 10.395 1.00 33.02 C ATOM 9893 C MET B 269 47.472 33.496 9.894 1.00 35.66 C ATOM 9894 O MET B 269 48.167 34.279 10.572 1.00 33.22 O ATOM 9895 CB MET B 269 46.128 31.872 11.404 1.00 37.42 C ATOM 9896 CG MET B 269 46.984 30.625 11.016 1.00 46.04 C ATOM 9897 SD MET B 269 46.792 28.985 12.033 1.00 53.36 S ATOM 9898 CE MET B 269 44.994 28.537 11.466 1.00 49.71 C ATOM 9899 HA MET B 269 45.759 33.941 10.954 1.00 0.00 H ATOM 9900 HB2 MET B 269 46.516 32.253 12.349 1.00 0.00 H ATOM 9901 HB3 MET B 269 45.102 31.533 11.544 1.00 0.00 H ATOM 9902 HG2 MET B 269 48.030 30.923 11.088 1.00 0.00 H ATOM 9903 HG3 MET B 269 46.746 30.386 9.980 1.00 0.00 H ATOM 9904 HE1 MET B 269 44.314 29.339 11.752 1.00 0.00 H ATOM 9905 HE2 MET B 269 44.976 28.413 10.383 1.00 0.00 H ATOM 9906 HE3 MET B 269 44.684 27.608 11.945 1.00 0.00 H ATOM 9907 H MET B 269 44.660 31.927 9.237 1.00 0.00 H ATOM 9908 N THR B 270 47.878 32.976 8.730 1.00 28.67 N ATOM 9909 CA THR B 270 49.231 33.235 8.219 1.00 28.84 C ATOM 9910 C THR B 270 49.312 33.781 6.776 1.00 31.54 C ATOM 9911 O THR B 270 50.360 33.712 6.142 1.00 29.84 O ATOM 9912 CB THR B 270 50.108 32.001 8.355 1.00 35.30 C ATOM 9913 OG1 THR B 270 49.494 30.922 7.648 1.00 29.84 O ATOM 9914 CG2 THR B 270 50.265 31.603 9.824 1.00 33.59 C ATOM 9915 HA THR B 270 49.602 34.042 8.851 1.00 0.00 H ATOM 9916 HB THR B 270 51.093 32.223 7.945 1.00 0.00 H ATOM 9917 HG1 THR B 270 48.600 30.743 8.033 1.00 0.00 H ATOM 9918 HG23 THR B 270 50.733 32.420 10.373 1.00 0.00 H ATOM 9919 HG21 THR B 270 49.283 31.393 10.249 1.00 0.00 H ATOM 9920 HG22 THR B 270 50.890 30.713 9.893 1.00 0.00 H ATOM 9921 H THR B 270 47.227 32.380 8.179 1.00 0.00 H ATOM 9922 N SER B 271 48.213 34.332 6.281 1.00 27.82 N ATOM 9923 CA SER B 271 48.197 34.884 4.938 1.00 27.74 C ATOM 9924 C SER B 271 47.147 35.985 4.876 1.00 30.84 C ATOM 9925 O SER B 271 46.098 35.894 5.507 1.00 29.61 O ATOM 9926 CB SER B 271 47.833 33.777 3.922 1.00 35.13 C ATOM 9927 OG SER B 271 47.960 34.299 2.606 1.00 55.15 O ATOM 9928 HA SER B 271 49.181 35.285 4.694 1.00 0.00 H ATOM 9929 HB2 SER B 271 46.807 33.450 4.089 1.00 0.00 H ATOM 9930 HB3 SER B 271 48.507 32.930 4.046 1.00 0.00 H ATOM 9931 HG SER B 271 47.728 33.595 1.949 1.00 0.00 H ATOM 9932 H SER B 271 47.351 34.370 6.862 1.00 0.00 H ATOM 9933 N PRO B 272 47.420 37.045 4.108 1.00 27.79 N ATOM 9934 CA PRO B 272 46.441 38.128 3.969 1.00 26.78 C ATOM 9935 C PRO B 272 45.479 37.779 2.831 1.00 30.07 C ATOM 9936 O PRO B 272 45.772 36.921 2.008 1.00 29.89 O ATOM 9937 CB PRO B 272 47.313 39.316 3.531 1.00 28.45 C ATOM 9938 CG PRO B 272 48.433 38.690 2.784 1.00 32.11 C ATOM 9939 CD PRO B 272 48.709 37.374 3.466 1.00 28.77 C ATOM 9940 HA PRO B 272 45.856 38.315 4.870 1.00 0.00 H ATOM 9941 HD3 PRO B 272 48.991 36.610 2.741 1.00 0.00 H ATOM 9942 HD2 PRO B 272 49.500 37.477 4.209 1.00 0.00 H ATOM 9943 HG3 PRO B 272 49.316 39.328 2.821 1.00 0.00 H ATOM 9944 HG2 PRO B 272 48.149 38.525 1.745 1.00 0.00 H ATOM 9945 HB2 PRO B 272 46.750 39.993 2.889 1.00 0.00 H ATOM 9946 HB3 PRO B 272 47.684 39.864 4.397 1.00 0.00 H ATOM 9947 N PRO B 273 44.318 38.438 2.780 1.00 25.67 N ATOM 9948 CA PRO B 273 43.412 38.177 1.644 1.00 26.74 C ATOM 9949 C PRO B 273 43.983 38.852 0.387 1.00 34.31 C ATOM 9950 O PRO B 273 44.637 39.911 0.485 1.00 32.29 O ATOM 9951 CB PRO B 273 42.118 38.903 2.061 1.00 26.79 C ATOM 9952 CG PRO B 273 42.616 40.049 2.902 1.00 30.29 C ATOM 9953 CD PRO B 273 43.755 39.431 3.716 1.00 25.09 C ATOM 9954 HA PRO B 273 43.270 37.118 1.428 1.00 0.00 H ATOM 9955 HD3 PRO B 273 44.497 40.182 3.987 1.00 0.00 H ATOM 9956 HD2 PRO B 273 43.378 38.951 4.619 1.00 0.00 H ATOM 9957 HG3 PRO B 273 41.828 40.423 3.556 1.00 0.00 H ATOM 9958 HG2 PRO B 273 42.982 40.862 2.275 1.00 0.00 H ATOM 9959 HB2 PRO B 273 41.576 39.266 1.188 1.00 0.00 H ATOM 9960 HB3 PRO B 273 41.471 38.245 2.641 1.00 0.00 H ATOM 9961 N GLU B 274 43.706 38.285 -0.795 1.00 33.51 N ATOM 9962 CA GLU B 274 44.241 38.846 -2.054 1.00 33.66 C ATOM 9963 C GLU B 274 43.922 40.319 -2.216 1.00 37.79 C ATOM 9964 O GLU B 274 44.710 41.099 -2.751 1.00 36.46 O ATOM 9965 CB GLU B 274 43.745 38.048 -3.258 1.00 35.55 C ATOM 9966 CG GLU B 274 44.369 36.661 -3.329 1.00 44.69 C ATOM 9967 CD GLU B 274 43.910 35.886 -4.559 1.00 76.33 C ATOM 9968 OE1 GLU B 274 44.747 35.626 -5.453 1.00 83.43 O ATOM 9969 OE2 GLU B 274 42.710 35.544 -4.629 1.00 66.49 O ATOM 9970 HA GLU B 274 45.326 38.762 -2.001 1.00 0.00 H ATOM 9971 HB2 GLU B 274 42.662 37.942 -3.187 1.00 0.00 H ATOM 9972 HB3 GLU B 274 43.997 38.593 -4.168 1.00 0.00 H ATOM 9973 HG2 GLU B 274 45.453 36.765 -3.364 1.00 0.00 H ATOM 9974 HG3 GLU B 274 44.087 36.103 -2.436 1.00 0.00 H ATOM 9975 H GLU B 274 43.105 37.437 -0.827 1.00 0.00 H ATOM 9976 N ASN B 275 42.738 40.651 -1.727 1.00 36.20 N ATOM 9977 CA ASN B 275 42.126 41.985 -1.666 1.00 37.03 C ATOM 9978 C ASN B 275 43.007 43.063 -1.013 1.00 38.00 C ATOM 9979 O ASN B 275 42.821 44.273 -1.252 1.00 35.99 O ATOM 9980 CB ASN B 275 40.961 41.792 -0.655 1.00 44.09 C ATOM 9981 CG ASN B 275 39.825 42.708 -0.891 1.00 78.77 C ATOM 9982 OD1 ASN B 275 38.716 42.446 -0.439 1.00 63.61 O ATOM 9983 ND2 ASN B 275 40.090 43.829 -1.550 1.00 83.92 N ATOM 9984 HA ASN B 275 41.891 42.310 -2.679 1.00 0.00 H ATOM 9985 HB2 ASN B 275 40.601 40.766 -0.733 1.00 0.00 H ATOM 9986 HB3 ASN B 275 41.343 41.966 0.351 1.00 0.00 H ATOM 9987 HD22 ASN B 275 41.048 44.004 -1.914 1.00 0.00 H ATOM 9988 HD21 ASN B 275 39.339 44.532 -1.703 1.00 0.00 H ATOM 9989 H ASN B 275 42.171 39.871 -1.338 1.00 0.00 H ATOM 9990 N GLY B 276 43.767 42.642 -0.001 1.00 31.96 N ATOM 9991 CA GLY B 276 44.521 43.562 0.862 1.00 30.39 C ATOM 9992 C GLY B 276 43.593 44.469 1.667 1.00 33.38 C ATOM 9993 O GLY B 276 43.992 45.533 2.150 1.00 32.18 O ATOM 9994 HA3 GLY B 276 45.168 44.181 0.240 1.00 0.00 H ATOM 9995 HA2 GLY B 276 45.132 42.979 1.552 1.00 0.00 H ATOM 9996 H GLY B 276 43.829 41.621 0.185 1.00 0.00 H ATOM 9997 N ALA B 277 42.335 44.059 1.830 1.00 29.91 N ATOM 9998 CA ALA B 277 41.340 44.906 2.510 1.00 29.38 C ATOM 9999 C ALA B 277 41.745 45.314 3.929 1.00 32.33 C ATOM 10000 O ALA B 277 41.365 46.383 4.405 1.00 31.39 O ATOM 10001 CB ALA B 277 39.962 44.197 2.523 1.00 30.56 C ATOM 10002 HA ALA B 277 41.279 45.832 1.938 1.00 0.00 H ATOM 10003 HB1 ALA B 277 39.639 44.015 1.498 1.00 0.00 H ATOM 10004 HB2 ALA B 277 40.048 43.248 3.052 1.00 0.00 H ATOM 10005 HB3 ALA B 277 39.233 44.831 3.028 1.00 0.00 H ATOM 10006 H ALA B 277 42.051 43.125 1.471 1.00 0.00 H ATOM 10007 N GLY B 278 42.456 44.435 4.641 1.00 30.48 N ATOM 10008 CA GLY B 278 42.847 44.742 6.009 1.00 29.49 C ATOM 10009 C GLY B 278 43.887 45.844 6.018 1.00 30.74 C ATOM 10010 O GLY B 278 43.758 46.839 6.750 1.00 29.82 O ATOM 10011 HA3 GLY B 278 43.264 43.849 6.474 1.00 0.00 H ATOM 10012 HA2 GLY B 278 41.971 45.068 6.570 1.00 0.00 H ATOM 10013 H GLY B 278 42.731 43.527 4.216 1.00 0.00 H ATOM 10014 N ALA B 279 44.903 45.666 5.175 1.00 25.70 N ATOM 10015 CA ALA B 279 45.961 46.649 5.007 1.00 27.02 C ATOM 10016 C ALA B 279 45.347 47.987 4.629 1.00 30.70 C ATOM 10017 O ALA B 279 45.718 49.030 5.168 1.00 28.74 O ATOM 10018 CB ALA B 279 46.958 46.176 3.898 1.00 28.59 C ATOM 10019 HA ALA B 279 46.510 46.758 5.942 1.00 0.00 H ATOM 10020 HB1 ALA B 279 47.397 45.222 4.189 1.00 0.00 H ATOM 10021 HB2 ALA B 279 46.423 46.059 2.956 1.00 0.00 H ATOM 10022 HB3 ALA B 279 47.747 46.919 3.780 1.00 0.00 H ATOM 10023 H ALA B 279 44.941 44.790 4.615 1.00 0.00 H ATOM 10024 N ALA B 280 44.410 47.962 3.684 1.00 28.13 N ATOM 10025 CA ALA B 280 43.767 49.202 3.254 1.00 28.81 C ATOM 10026 C ALA B 280 43.073 49.899 4.428 1.00 32.62 C ATOM 10027 O ALA B 280 43.271 51.096 4.658 1.00 32.76 O ATOM 10028 CB ALA B 280 42.767 48.928 2.087 1.00 28.88 C ATOM 10029 HA ALA B 280 44.540 49.875 2.884 1.00 0.00 H ATOM 10030 HB1 ALA B 280 43.305 48.498 1.242 1.00 0.00 H ATOM 10031 HB2 ALA B 280 42.000 48.231 2.424 1.00 0.00 H ATOM 10032 HB3 ALA B 280 42.300 49.865 1.783 1.00 0.00 H ATOM 10033 H ALA B 280 44.135 47.058 3.250 1.00 0.00 H ATOM 10034 N LEU B 281 42.238 49.162 5.168 1.00 28.23 N ATOM 10035 CA LEU B 281 41.523 49.758 6.301 1.00 26.56 C ATOM 10036 C LEU B 281 42.467 50.374 7.330 1.00 30.34 C ATOM 10037 O LEU B 281 42.173 51.428 7.882 1.00 33.14 O ATOM 10038 CB LEU B 281 40.654 48.694 6.971 1.00 26.85 C ATOM 10039 CG LEU B 281 39.813 49.068 8.178 1.00 31.21 C ATOM 10040 CD1 LEU B 281 38.820 50.159 7.843 1.00 33.11 C ATOM 10041 CD2 LEU B 281 39.082 47.799 8.659 1.00 31.97 C ATOM 10042 HA LEU B 281 40.903 50.564 5.909 1.00 0.00 H ATOM 10043 HB2 LEU B 281 39.969 48.319 6.211 1.00 0.00 H ATOM 10044 HB3 LEU B 281 41.321 47.891 7.285 1.00 0.00 H ATOM 10045 HG LEU B 281 40.458 49.458 8.966 1.00 0.00 H ATOM 10046 HD21 LEU B 281 38.446 47.422 7.858 1.00 0.00 H ATOM 10047 HD22 LEU B 281 39.815 47.040 8.930 1.00 0.00 H ATOM 10048 HD23 LEU B 281 38.469 48.041 9.527 1.00 0.00 H ATOM 10049 HD11 LEU B 281 39.357 51.046 7.507 1.00 0.00 H ATOM 10050 HD12 LEU B 281 38.155 49.813 7.052 1.00 0.00 H ATOM 10051 HD13 LEU B 281 38.235 50.401 8.730 1.00 0.00 H ATOM 10052 H LEU B 281 42.095 48.158 4.938 1.00 0.00 H ATOM 10053 N ALA B 282 43.606 49.735 7.600 1.00 25.69 N ATOM 10054 CA ALA B 282 44.545 50.296 8.580 1.00 25.66 C ATOM 10055 C ALA B 282 45.103 51.633 8.103 1.00 29.10 C ATOM 10056 O ALA B 282 45.237 52.569 8.882 1.00 28.78 O ATOM 10057 CB ALA B 282 45.668 49.319 8.894 1.00 26.18 C ATOM 10058 HA ALA B 282 43.991 50.472 9.502 1.00 0.00 H ATOM 10059 HB1 ALA B 282 45.246 48.402 9.304 1.00 0.00 H ATOM 10060 HB2 ALA B 282 46.216 49.091 7.980 1.00 0.00 H ATOM 10061 HB3 ALA B 282 46.344 49.767 9.622 1.00 0.00 H ATOM 10062 H ALA B 282 43.829 48.841 7.117 1.00 0.00 H ATOM 10063 N MET B 283 45.457 51.704 6.825 1.00 25.83 N ATOM 10064 CA MET B 283 45.986 52.952 6.257 1.00 26.05 C ATOM 10065 C MET B 283 44.897 54.004 6.259 1.00 31.02 C ATOM 10066 O MET B 283 45.127 55.152 6.637 1.00 30.75 O ATOM 10067 CB MET B 283 46.478 52.713 4.825 1.00 28.09 C ATOM 10068 CG MET B 283 47.744 51.875 4.761 1.00 30.30 C ATOM 10069 SD MET B 283 48.443 51.823 3.086 1.00 34.92 S ATOM 10070 CE MET B 283 47.350 50.669 2.244 1.00 31.08 C ATOM 10071 HA MET B 283 46.825 53.295 6.862 1.00 0.00 H ATOM 10072 HB2 MET B 283 45.693 52.199 4.270 1.00 0.00 H ATOM 10073 HB3 MET B 283 46.677 53.679 4.361 1.00 0.00 H ATOM 10074 HG2 MET B 283 47.509 50.858 5.076 1.00 0.00 H ATOM 10075 HG3 MET B 283 48.484 52.302 5.438 1.00 0.00 H ATOM 10076 HE1 MET B 283 47.386 49.703 2.748 1.00 0.00 H ATOM 10077 HE2 MET B 283 46.331 51.054 2.266 1.00 0.00 H ATOM 10078 HE3 MET B 283 47.674 50.553 1.210 1.00 0.00 H ATOM 10079 H MET B 283 45.359 50.865 6.218 1.00 0.00 H ATOM 10080 N ALA B 284 43.697 53.601 5.846 1.00 28.87 N ATOM 10081 CA ALA B 284 42.554 54.509 5.842 1.00 27.86 C ATOM 10082 C ALA B 284 42.324 55.059 7.249 1.00 34.75 C ATOM 10083 O ALA B 284 42.007 56.233 7.419 1.00 33.96 O ATOM 10084 CB ALA B 284 41.302 53.767 5.369 1.00 28.25 C ATOM 10085 HA ALA B 284 42.759 55.336 5.162 1.00 0.00 H ATOM 10086 HB1 ALA B 284 41.465 53.388 4.360 1.00 0.00 H ATOM 10087 HB2 ALA B 284 41.099 52.934 6.042 1.00 0.00 H ATOM 10088 HB3 ALA B 284 40.454 54.452 5.369 1.00 0.00 H ATOM 10089 H ALA B 284 43.572 52.621 5.520 1.00 0.00 H ATOM 10090 N ASN B 285 42.433 54.193 8.261 1.00 30.46 N ATOM 10091 CA ASN B 285 42.215 54.630 9.637 1.00 29.33 C ATOM 10092 C ASN B 285 43.303 55.605 10.108 1.00 30.77 C ATOM 10093 O ASN B 285 43.026 56.575 10.819 1.00 30.40 O ATOM 10094 CB ASN B 285 42.096 53.415 10.576 1.00 27.14 C ATOM 10095 CG ASN B 285 40.769 52.682 10.403 1.00 42.40 C ATOM 10096 OD1 ASN B 285 39.806 53.254 9.899 1.00 32.53 O ATOM 10097 ND2 ASN B 285 40.709 51.423 10.835 1.00 27.22 N ATOM 10098 HA ASN B 285 41.273 55.177 9.668 1.00 0.00 H ATOM 10099 HB2 ASN B 285 42.910 52.723 10.361 1.00 0.00 H ATOM 10100 HB3 ASN B 285 42.176 53.759 11.607 1.00 0.00 H ATOM 10101 HD22 ASN B 285 41.549 50.977 11.256 1.00 0.00 H ATOM 10102 HD21 ASN B 285 39.822 50.886 10.752 1.00 0.00 H ATOM 10103 H ASN B 285 42.675 53.200 8.067 1.00 0.00 H ATOM 10104 N ALA B 286 44.546 55.353 9.722 1.00 26.05 N ATOM 10105 CA ALA B 286 45.620 56.252 10.120 1.00 24.96 C ATOM 10106 C ALA B 286 45.403 57.620 9.465 1.00 31.21 C ATOM 10107 O ALA B 286 45.625 58.644 10.103 1.00 29.12 O ATOM 10108 CB ALA B 286 46.976 55.682 9.715 1.00 26.13 C ATOM 10109 HA ALA B 286 45.609 56.362 11.204 1.00 0.00 H ATOM 10110 HB1 ALA B 286 47.123 54.718 10.202 1.00 0.00 H ATOM 10111 HB2 ALA B 286 47.006 55.553 8.633 1.00 0.00 H ATOM 10112 HB3 ALA B 286 47.764 56.370 10.022 1.00 0.00 H ATOM 10113 H ALA B 286 44.753 54.518 9.138 1.00 0.00 H ATOM 10114 N LEU B 287 45.014 57.630 8.180 1.00 29.84 N ATOM 10115 CA LEU B 287 44.775 58.906 7.476 1.00 29.89 C ATOM 10116 C LEU B 287 43.673 59.704 8.145 1.00 32.55 C ATOM 10117 O LEU B 287 43.822 60.915 8.378 1.00 31.82 O ATOM 10118 CB LEU B 287 44.446 58.706 5.977 1.00 28.81 C ATOM 10119 CG LEU B 287 45.582 58.148 5.129 1.00 32.26 C ATOM 10120 CD1 LEU B 287 45.052 57.440 3.881 1.00 31.96 C ATOM 10121 CD2 LEU B 287 46.663 59.194 4.798 1.00 33.48 C ATOM 10122 HA LEU B 287 45.708 59.466 7.537 1.00 0.00 H ATOM 10123 HB2 LEU B 287 43.603 58.018 5.906 1.00 0.00 H ATOM 10124 HB3 LEU B 287 44.160 59.673 5.563 1.00 0.00 H ATOM 10125 HG LEU B 287 46.085 57.398 5.740 1.00 0.00 H ATOM 10126 HD21 LEU B 287 46.212 60.018 4.244 1.00 0.00 H ATOM 10127 HD22 LEU B 287 47.097 59.571 5.724 1.00 0.00 H ATOM 10128 HD23 LEU B 287 47.442 58.731 4.192 1.00 0.00 H ATOM 10129 HD11 LEU B 287 44.405 56.615 4.180 1.00 0.00 H ATOM 10130 HD12 LEU B 287 44.484 58.148 3.277 1.00 0.00 H ATOM 10131 HD13 LEU B 287 45.890 57.055 3.300 1.00 0.00 H ATOM 10132 H LEU B 287 44.880 56.730 7.676 1.00 0.00 H ATOM 10133 N ARG B 288 42.574 59.031 8.489 1.00 30.01 N ATOM 10134 CA ARG B 288 41.468 59.725 9.147 1.00 29.63 C ATOM 10135 C ARG B 288 41.891 60.219 10.513 1.00 32.80 C ATOM 10136 O ARG B 288 41.528 61.312 10.920 1.00 33.29 O ATOM 10137 CB ARG B 288 40.201 58.840 9.202 1.00 36.61 C ATOM 10138 CG ARG B 288 39.086 59.349 10.116 1.00 48.36 C ATOM 10139 CD ARG B 288 37.934 58.348 10.168 1.00 58.30 C ATOM 10140 NE ARG B 288 37.746 57.689 8.879 1.00 72.77 N ATOM 10141 CZ ARG B 288 37.873 56.382 8.676 1.00 91.10 C ATOM 10142 NH1 ARG B 288 38.196 55.576 9.684 1.00 81.94 N ATOM 10143 NH2 ARG B 288 37.678 55.885 7.459 1.00 74.67 N ATOM 10144 HA ARG B 288 41.205 60.600 8.553 1.00 0.00 H ATOM 10145 HB2 ARG B 288 39.800 58.763 8.192 1.00 0.00 H ATOM 10146 HB3 ARG B 288 40.496 57.850 9.550 1.00 0.00 H ATOM 10147 HG2 ARG B 288 39.483 59.491 11.121 1.00 0.00 H ATOM 10148 HG3 ARG B 288 38.717 60.301 9.735 1.00 0.00 H ATOM 10149 HD2 ARG B 288 37.018 58.874 10.435 1.00 0.00 H ATOM 10150 HD3 ARG B 288 38.152 57.594 10.924 1.00 0.00 H ATOM 10151 HE ARG B 288 37.495 58.284 8.063 1.00 0.00 H ATOM 10152 HH12 ARG B 288 38.294 54.554 9.521 1.00 0.00 H ATOM 10153 HH11 ARG B 288 38.350 55.968 10.635 1.00 0.00 H ATOM 10154 HH22 ARG B 288 37.776 54.863 7.293 1.00 0.00 H ATOM 10155 HH21 ARG B 288 37.428 56.518 6.673 1.00 0.00 H ATOM 10156 H ARG B 288 42.504 58.013 8.289 1.00 0.00 H ATOM 10157 N ASP B 289 42.716 59.440 11.206 1.00 29.38 N ATOM 10158 CA ASP B 289 43.203 59.831 12.520 1.00 29.01 C ATOM 10159 C ASP B 289 44.056 61.100 12.407 1.00 31.76 C ATOM 10160 O ASP B 289 44.018 61.961 13.295 1.00 31.58 O ATOM 10161 CB ASP B 289 44.034 58.677 13.145 1.00 30.42 C ATOM 10162 CG ASP B 289 44.359 58.913 14.605 1.00 33.03 C ATOM 10163 OD1 ASP B 289 43.480 59.398 15.344 1.00 34.99 O ATOM 10164 OD2 ASP B 289 45.483 58.575 15.031 1.00 33.21 O ATOM 10165 HA ASP B 289 42.351 60.038 13.167 1.00 0.00 H ATOM 10166 HB2 ASP B 289 43.465 57.751 13.060 1.00 0.00 H ATOM 10167 HB3 ASP B 289 44.968 58.580 12.591 1.00 0.00 H ATOM 10168 H ASP B 289 43.020 58.532 10.800 1.00 0.00 H ATOM 10169 N ALA B 290 44.867 61.167 11.347 1.00 28.65 N ATOM 10170 CA ALA B 290 45.734 62.322 11.078 1.00 28.78 C ATOM 10171 C ALA B 290 44.959 63.530 10.483 1.00 37.29 C ATOM 10172 O ALA B 290 45.469 64.657 10.475 1.00 38.73 O ATOM 10173 CB ALA B 290 46.846 61.925 10.129 1.00 29.02 C ATOM 10174 HA ALA B 290 46.146 62.636 12.037 1.00 0.00 H ATOM 10175 HB1 ALA B 290 47.438 61.128 10.579 1.00 0.00 H ATOM 10176 HB2 ALA B 290 46.414 61.574 9.192 1.00 0.00 H ATOM 10177 HB3 ALA B 290 47.483 62.788 9.936 1.00 0.00 H ATOM 10178 H ALA B 290 44.885 60.366 10.683 1.00 0.00 H ATOM 10179 N GLY B 291 43.774 63.288 9.937 1.00 33.13 N ATOM 10180 CA GLY B 291 42.951 64.341 9.347 1.00 33.83 C ATOM 10181 C GLY B 291 43.438 64.781 7.977 1.00 39.59 C ATOM 10182 O GLY B 291 43.236 65.921 7.576 1.00 41.49 O ATOM 10183 HA3 GLY B 291 42.962 65.204 10.013 1.00 0.00 H ATOM 10184 HA2 GLY B 291 41.930 63.971 9.250 1.00 0.00 H ATOM 10185 H GLY B 291 43.417 62.311 9.929 1.00 0.00 H ATOM 10186 N ILE B 292 44.079 63.874 7.245 1.00 35.09 N ATOM 10187 CA ILE B 292 44.639 64.207 5.944 1.00 34.18 C ATOM 10188 C ILE B 292 44.187 63.215 4.891 1.00 38.60 C ATOM 10189 O ILE B 292 43.645 62.161 5.214 1.00 37.51 O ATOM 10190 CB ILE B 292 46.178 64.210 6.031 1.00 36.56 C ATOM 10191 CG1 ILE B 292 46.687 62.832 6.469 1.00 36.76 C ATOM 10192 CG2 ILE B 292 46.652 65.257 7.006 1.00 35.05 C ATOM 10193 CD1 ILE B 292 48.050 62.526 5.930 1.00 42.92 C ATOM 10194 HA ILE B 292 44.285 65.197 5.657 1.00 0.00 H ATOM 10195 HB ILE B 292 46.575 64.443 5.043 1.00 0.00 H ATOM 10196 HG12 ILE B 292 46.727 62.804 7.558 1.00 0.00 H ATOM 10197 HG13 ILE B 292 45.991 62.073 6.112 1.00 0.00 H ATOM 10198 HD11 ILE B 292 48.021 62.543 4.841 1.00 0.00 H ATOM 10199 HD12 ILE B 292 48.757 63.275 6.287 1.00 0.00 H ATOM 10200 HD13 ILE B 292 48.361 61.539 6.271 1.00 0.00 H ATOM 10201 HG21 ILE B 292 46.314 66.239 6.675 1.00 0.00 H ATOM 10202 HG22 ILE B 292 46.242 65.044 7.993 1.00 0.00 H ATOM 10203 HG23 ILE B 292 47.741 65.242 7.052 1.00 0.00 H ATOM 10204 H ILE B 292 44.182 62.906 7.611 1.00 0.00 H ATOM 10205 N GLU B 293 44.477 63.523 3.631 1.00 36.09 N ATOM 10206 CA GLU B 293 44.128 62.632 2.529 1.00 36.52 C ATOM 10207 C GLU B 293 45.344 61.856 2.057 1.00 38.07 C ATOM 10208 O GLU B 293 46.469 62.335 2.175 1.00 35.88 O ATOM 10209 CB GLU B 293 43.563 63.443 1.358 1.00 38.73 C ATOM 10210 CG GLU B 293 42.253 64.154 1.718 1.00 58.69 C ATOM 10211 CD GLU B 293 41.417 64.455 0.498 1.00103.87 C ATOM 10212 OE1 GLU B 293 40.245 64.015 0.460 1.00114.97 O ATOM 10213 OE2 GLU B 293 41.952 65.091 -0.440 1.00104.17 O ATOM 10214 HA GLU B 293 43.376 61.929 2.887 1.00 0.00 H ATOM 10215 HB2 GLU B 293 44.298 64.192 1.063 1.00 0.00 H ATOM 10216 HB3 GLU B 293 43.377 62.769 0.522 1.00 0.00 H ATOM 10217 HG2 GLU B 293 41.679 63.515 2.389 1.00 0.00 H ATOM 10218 HG3 GLU B 293 42.488 65.091 2.223 1.00 0.00 H ATOM 10219 H GLU B 293 44.964 64.419 3.426 1.00 0.00 H ATOM 10220 N ALA B 294 45.093 60.700 1.445 1.00 34.71 N ATOM 10221 CA ALA B 294 46.147 59.847 0.932 1.00 35.02 C ATOM 10222 C ALA B 294 47.129 60.590 0.015 1.00 40.14 C ATOM 10223 O ALA B 294 48.312 60.263 -0.014 1.00 38.36 O ATOM 10224 CB ALA B 294 45.544 58.611 0.230 1.00 35.68 C ATOM 10225 HA ALA B 294 46.733 59.514 1.788 1.00 0.00 H ATOM 10226 HB1 ALA B 294 44.944 58.046 0.944 1.00 0.00 H ATOM 10227 HB2 ALA B 294 44.914 58.936 -0.598 1.00 0.00 H ATOM 10228 HB3 ALA B 294 46.349 57.981 -0.149 1.00 0.00 H ATOM 10229 H ALA B 294 44.104 60.398 1.331 1.00 0.00 H ATOM 10230 N SER B 295 46.640 61.607 -0.706 1.00 38.26 N ATOM 10231 CA SER B 295 47.484 62.387 -1.627 1.00 38.84 C ATOM 10232 C SER B 295 48.588 63.173 -0.913 1.00 40.53 C ATOM 10233 O SER B 295 49.594 63.567 -1.522 1.00 40.53 O ATOM 10234 CB SER B 295 46.628 63.346 -2.475 1.00 44.25 C ATOM 10235 OG SER B 295 46.171 64.458 -1.711 1.00 50.29 O ATOM 10236 HA SER B 295 47.973 61.660 -2.275 1.00 0.00 H ATOM 10237 HB2 SER B 295 45.765 62.803 -2.860 1.00 0.00 H ATOM 10238 HB3 SER B 295 47.227 63.712 -3.309 1.00 0.00 H ATOM 10239 HG SER B 295 45.626 65.051 -2.287 1.00 0.00 H ATOM 10240 H SER B 295 45.634 61.853 -0.613 1.00 0.00 H ATOM 10241 N GLN B 296 48.412 63.399 0.382 1.00 34.41 N ATOM 10242 CA GLN B 296 49.422 64.137 1.118 1.00 32.63 C ATOM 10243 C GLN B 296 50.583 63.275 1.604 1.00 37.39 C ATOM 10244 O GLN B 296 51.564 63.796 2.133 1.00 37.15 O ATOM 10245 CB GLN B 296 48.789 64.906 2.264 1.00 32.76 C ATOM 10246 CG GLN B 296 47.696 65.811 1.800 1.00 39.85 C ATOM 10247 CD GLN B 296 46.970 66.451 2.942 1.00 50.35 C ATOM 10248 OE1 GLN B 296 45.799 66.164 3.186 1.00 47.38 O ATOM 10249 NE2 GLN B 296 47.657 67.325 3.651 1.00 37.89 N ATOM 10250 HA GLN B 296 49.860 64.843 0.413 1.00 0.00 H ATOM 10251 HB2 GLN B 296 48.376 64.194 2.979 1.00 0.00 H ATOM 10252 HB3 GLN B 296 49.558 65.505 2.752 1.00 0.00 H ATOM 10253 HG2 GLN B 296 48.128 66.593 1.176 1.00 0.00 H ATOM 10254 HG3 GLN B 296 46.985 65.231 1.212 1.00 0.00 H ATOM 10255 HE22 GLN B 296 48.646 67.533 3.404 1.00 0.00 H ATOM 10256 HE21 GLN B 296 47.210 67.806 4.458 1.00 0.00 H ATOM 10257 H GLN B 296 47.559 63.051 0.865 1.00 0.00 H ATOM 10258 N ILE B 297 50.474 61.955 1.439 1.00 31.98 N ATOM 10259 CA ILE B 297 51.562 61.076 1.857 1.00 29.71 C ATOM 10260 C ILE B 297 52.636 61.087 0.772 1.00 33.24 C ATOM 10261 O ILE B 297 52.341 60.791 -0.384 1.00 32.05 O ATOM 10262 CB ILE B 297 51.075 59.618 2.071 1.00 30.63 C ATOM 10263 CG1 ILE B 297 50.075 59.520 3.230 1.00 29.87 C ATOM 10264 CG2 ILE B 297 52.263 58.692 2.225 1.00 28.92 C ATOM 10265 CD1 ILE B 297 50.604 60.016 4.573 1.00 26.18 C ATOM 10266 HA ILE B 297 51.955 61.441 2.806 1.00 0.00 H ATOM 10267 HB ILE B 297 50.526 59.294 1.187 1.00 0.00 H ATOM 10268 HG12 ILE B 297 49.196 60.111 2.972 1.00 0.00 H ATOM 10269 HG13 ILE B 297 49.788 58.475 3.343 1.00 0.00 H ATOM 10270 HD11 ILE B 297 51.476 59.428 4.858 1.00 0.00 H ATOM 10271 HD12 ILE B 297 50.885 61.066 4.486 1.00 0.00 H ATOM 10272 HD13 ILE B 297 49.828 59.908 5.330 1.00 0.00 H ATOM 10273 HG21 ILE B 297 52.876 58.737 1.325 1.00 0.00 H ATOM 10274 HG22 ILE B 297 52.855 59.003 3.086 1.00 0.00 H ATOM 10275 HG23 ILE B 297 51.910 57.672 2.375 1.00 0.00 H ATOM 10276 H ILE B 297 49.615 61.553 1.013 1.00 0.00 H ATOM 10277 N GLY B 298 53.896 61.313 1.147 1.00 28.80 N ATOM 10278 CA GLY B 298 54.943 61.271 0.146 1.00 28.55 C ATOM 10279 C GLY B 298 55.630 59.923 -0.035 1.00 33.51 C ATOM 10280 O GLY B 298 56.132 59.616 -1.109 1.00 31.29 O ATOM 10281 HA3 GLY B 298 55.704 62.000 0.426 1.00 0.00 H ATOM 10282 HA2 GLY B 298 54.504 61.555 -0.810 1.00 0.00 H ATOM 10283 H GLY B 298 54.123 61.516 2.141 1.00 0.00 H ATOM 10284 N TYR B 299 55.688 59.126 1.033 1.00 29.42 N ATOM 10285 CA TYR B 299 56.443 57.878 1.011 1.00 27.32 C ATOM 10286 C TYR B 299 55.805 56.907 2.019 1.00 30.46 C ATOM 10287 O TYR B 299 55.402 57.304 3.114 1.00 26.08 O ATOM 10288 CB TYR B 299 57.877 58.183 1.465 1.00 27.00 C ATOM 10289 CG TYR B 299 58.682 56.978 1.873 1.00 26.22 C ATOM 10290 CD1 TYR B 299 58.828 55.892 0.999 1.00 27.47 C ATOM 10291 CD2 TYR B 299 59.279 56.895 3.144 1.00 25.25 C ATOM 10292 CE1 TYR B 299 59.560 54.770 1.365 1.00 25.56 C ATOM 10293 CE2 TYR B 299 60.044 55.772 3.502 1.00 23.51 C ATOM 10294 CZ TYR B 299 60.151 54.710 2.622 1.00 26.77 C ATOM 10295 OH TYR B 299 60.939 53.612 2.926 1.00 25.87 O ATOM 10296 HA TYR B 299 56.441 57.441 0.012 1.00 0.00 H ATOM 10297 HB3 TYR B 299 57.826 58.861 2.317 1.00 0.00 H ATOM 10298 HB2 TYR B 299 58.396 58.674 0.642 1.00 0.00 H ATOM 10299 HD2 TYR B 299 59.147 57.709 3.857 1.00 0.00 H ATOM 10300 HE2 TYR B 299 60.550 55.738 4.467 1.00 0.00 H ATOM 10301 HE1 TYR B 299 59.671 53.939 0.669 1.00 0.00 H ATOM 10302 HD1 TYR B 299 58.359 55.929 0.016 1.00 0.00 H ATOM 10303 HH TYR B 299 60.893 52.958 2.184 1.00 0.00 H ATOM 10304 H TYR B 299 55.184 59.400 1.900 1.00 0.00 H ATOM 10305 N VAL B 300 55.688 55.648 1.604 1.00 28.15 N ATOM 10306 CA VAL B 300 55.109 54.594 2.418 1.00 26.76 C ATOM 10307 C VAL B 300 56.231 53.614 2.622 1.00 29.10 C ATOM 10308 O VAL B 300 56.751 53.058 1.642 1.00 28.32 O ATOM 10309 CB VAL B 300 53.939 53.867 1.663 1.00 29.80 C ATOM 10310 CG1 VAL B 300 53.434 52.630 2.458 1.00 28.35 C ATOM 10311 CG2 VAL B 300 52.781 54.803 1.376 1.00 28.95 C ATOM 10312 HA VAL B 300 54.699 54.992 3.346 1.00 0.00 H ATOM 10313 HB VAL B 300 54.347 53.529 0.710 1.00 0.00 H ATOM 10314 HG11 VAL B 300 54.254 51.924 2.588 1.00 0.00 H ATOM 10315 HG12 VAL B 300 53.070 52.951 3.434 1.00 0.00 H ATOM 10316 HG13 VAL B 300 52.625 52.151 1.907 1.00 0.00 H ATOM 10317 HG21 VAL B 300 52.390 55.194 2.315 1.00 0.00 H ATOM 10318 HG22 VAL B 300 53.128 55.628 0.754 1.00 0.00 H ATOM 10319 HG23 VAL B 300 51.995 54.257 0.853 1.00 0.00 H ATOM 10320 H VAL B 300 56.028 55.407 0.651 1.00 0.00 H ATOM 10321 N ASN B 301 56.618 53.390 3.877 1.00 23.65 N ATOM 10322 CA ASN B 301 57.611 52.351 4.148 1.00 22.25 C ATOM 10323 C ASN B 301 56.726 51.126 4.361 1.00 26.32 C ATOM 10324 O ASN B 301 55.957 51.038 5.322 1.00 27.10 O ATOM 10325 CB ASN B 301 58.490 52.678 5.366 1.00 22.32 C ATOM 10326 CG ASN B 301 59.478 51.608 5.646 1.00 33.97 C ATOM 10327 OD1 ASN B 301 60.676 51.730 5.352 1.00 31.58 O ATOM 10328 ND2 ASN B 301 58.977 50.495 6.129 1.00 22.04 N ATOM 10329 HA ASN B 301 58.344 52.222 3.352 1.00 0.00 H ATOM 10330 HB2 ASN B 301 59.024 53.608 5.174 1.00 0.00 H ATOM 10331 HB3 ASN B 301 57.849 52.802 6.239 1.00 0.00 H ATOM 10332 HD22 ASN B 301 57.965 50.438 6.362 1.00 0.00 H ATOM 10333 HD21 ASN B 301 59.592 49.670 6.279 1.00 0.00 H ATOM 10334 H ASN B 301 56.217 53.949 4.657 1.00 0.00 H ATOM 10335 N ALA B 302 56.745 50.243 3.377 1.00 25.02 N ATOM 10336 CA ALA B 302 55.876 49.078 3.352 1.00 25.20 C ATOM 10337 C ALA B 302 56.212 47.959 4.330 1.00 27.98 C ATOM 10338 O ALA B 302 57.334 47.809 4.799 1.00 28.15 O ATOM 10339 CB ALA B 302 55.825 48.520 1.908 1.00 26.55 C ATOM 10340 HA ALA B 302 54.905 49.440 3.690 1.00 0.00 H ATOM 10341 HB1 ALA B 302 55.435 49.286 1.238 1.00 0.00 H ATOM 10342 HB2 ALA B 302 56.830 48.238 1.593 1.00 0.00 H ATOM 10343 HB3 ALA B 302 55.175 47.646 1.881 1.00 0.00 H ATOM 10344 H ALA B 302 57.408 50.388 2.589 1.00 0.00 H ATOM 10345 N HIS B 303 55.233 47.108 4.565 1.00 24.08 N ATOM 10346 CA HIS B 303 55.492 45.920 5.329 1.00 23.62 C ATOM 10347 C HIS B 303 56.387 45.069 4.414 1.00 27.60 C ATOM 10348 O HIS B 303 57.416 44.584 4.833 1.00 26.75 O ATOM 10349 CB HIS B 303 54.157 45.223 5.607 1.00 24.86 C ATOM 10350 CG HIS B 303 54.298 43.985 6.419 1.00 30.27 C ATOM 10351 ND1 HIS B 303 54.983 43.960 7.613 1.00 33.96 N ATOM 10352 CD2 HIS B 303 53.895 42.719 6.186 1.00 32.60 C ATOM 10353 CE1 HIS B 303 55.019 42.721 8.066 1.00 33.08 C ATOM 10354 NE2 HIS B 303 54.363 41.954 7.222 1.00 33.18 N ATOM 10355 HA HIS B 303 55.970 46.105 6.291 1.00 0.00 H ATOM 10356 HB2 HIS B 303 53.509 45.917 6.143 1.00 0.00 H ATOM 10357 HB3 HIS B 303 53.698 44.961 4.654 1.00 0.00 H ATOM 10358 HD2 HIS B 303 53.309 42.371 5.336 1.00 0.00 H ATOM 10359 HE1 HIS B 303 55.508 42.390 8.982 1.00 0.00 H ATOM 10360 H HIS B 303 54.278 47.296 4.199 1.00 0.00 H ATOM 10361 N GLY B 304 56.016 44.943 3.136 1.00 25.97 N ATOM 10362 CA GLY B 304 56.801 44.245 2.102 1.00 25.25 C ATOM 10363 C GLY B 304 57.881 43.278 2.533 1.00 27.90 C ATOM 10364 O GLY B 304 59.081 43.580 2.475 1.00 25.86 O ATOM 10365 HA3 GLY B 304 57.281 45.011 1.493 1.00 0.00 H ATOM 10366 HA2 GLY B 304 56.096 43.685 1.488 1.00 0.00 H ATOM 10367 H GLY B 304 55.110 45.367 2.851 1.00 0.00 H ATOM 10368 N THR B 305 57.453 42.083 2.939 1.00 23.62 N ATOM 10369 CA THR B 305 58.347 41.087 3.474 1.00 22.25 C ATOM 10370 C THR B 305 59.060 40.208 2.469 1.00 27.07 C ATOM 10371 O THR B 305 59.988 39.486 2.844 1.00 25.50 O ATOM 10372 CB THR B 305 57.601 40.211 4.485 1.00 32.26 C ATOM 10373 OG1 THR B 305 56.557 39.502 3.792 1.00 31.58 O ATOM 10374 CG2 THR B 305 56.955 41.094 5.590 1.00 24.09 C ATOM 10375 HA THR B 305 59.143 41.665 3.943 1.00 0.00 H ATOM 10376 HB THR B 305 58.302 39.516 4.947 1.00 0.00 H ATOM 10377 HG1 THR B 305 55.933 40.153 3.383 1.00 0.00 H ATOM 10378 HG23 THR B 305 57.736 41.637 6.123 1.00 0.00 H ATOM 10379 HG21 THR B 305 56.267 41.803 5.130 1.00 0.00 H ATOM 10380 HG22 THR B 305 56.411 40.459 6.289 1.00 0.00 H ATOM 10381 H THR B 305 56.439 41.862 2.867 1.00 0.00 H ATOM 10382 N SER B 306 58.627 40.242 1.211 1.00 24.43 N ATOM 10383 CA SER B 306 59.228 39.395 0.164 1.00 22.53 C ATOM 10384 C SER B 306 58.596 38.020 0.046 1.00 27.25 C ATOM 10385 O SER B 306 59.241 37.062 -0.375 1.00 26.34 O ATOM 10386 CB SER B 306 60.764 39.329 0.203 1.00 26.37 C ATOM 10387 OG SER B 306 61.307 38.969 -1.082 1.00 26.61 O ATOM 10388 HA SER B 306 58.983 39.921 -0.759 1.00 0.00 H ATOM 10389 HB2 SER B 306 61.069 38.584 0.938 1.00 0.00 H ATOM 10390 HB3 SER B 306 61.154 40.305 0.493 1.00 0.00 H ATOM 10391 HG SER B 306 60.960 38.081 -1.348 1.00 0.00 H ATOM 10392 H SER B 306 57.846 40.881 0.960 1.00 0.00 H ATOM 10393 N THR B 307 57.306 37.939 0.363 1.00 25.61 N ATOM 10394 CA THR B 307 56.572 36.692 0.182 1.00 25.81 C ATOM 10395 C THR B 307 55.717 36.853 -1.082 1.00 28.84 C ATOM 10396 O THR B 307 55.270 37.955 -1.418 1.00 27.32 O ATOM 10397 CB THR B 307 55.678 36.344 1.388 1.00 22.11 C ATOM 10398 OG1 THR B 307 54.667 37.347 1.527 1.00 24.13 O ATOM 10399 CG2 THR B 307 56.529 36.212 2.691 1.00 20.01 C ATOM 10400 HA THR B 307 57.282 35.870 0.089 1.00 0.00 H ATOM 10401 HB THR B 307 55.199 35.380 1.218 1.00 0.00 H ATOM 10402 HG1 THR B 307 54.119 37.378 0.703 1.00 0.00 H ATOM 10403 HG23 THR B 307 57.288 35.442 2.552 1.00 0.00 H ATOM 10404 HG21 THR B 307 57.012 37.165 2.906 1.00 0.00 H ATOM 10405 HG22 THR B 307 55.879 35.937 3.522 1.00 0.00 H ATOM 10406 H THR B 307 56.816 38.774 0.744 1.00 0.00 H ATOM 10407 N PRO B 308 55.435 35.742 -1.763 1.00 26.34 N ATOM 10408 CA PRO B 308 54.621 35.901 -2.977 1.00 26.48 C ATOM 10409 C PRO B 308 53.266 36.566 -2.738 1.00 31.36 C ATOM 10410 O PRO B 308 52.934 37.568 -3.396 1.00 31.11 O ATOM 10411 CB PRO B 308 54.477 34.472 -3.499 1.00 28.13 C ATOM 10412 CG PRO B 308 55.728 33.758 -3.004 1.00 32.71 C ATOM 10413 CD PRO B 308 56.022 34.391 -1.638 1.00 28.89 C ATOM 10414 HA PRO B 308 55.096 36.577 -3.689 1.00 0.00 H ATOM 10415 HD3 PRO B 308 55.545 33.829 -0.835 1.00 0.00 H ATOM 10416 HD2 PRO B 308 57.095 34.445 -1.454 1.00 0.00 H ATOM 10417 HG3 PRO B 308 56.560 33.919 -3.690 1.00 0.00 H ATOM 10418 HG2 PRO B 308 55.545 32.688 -2.901 1.00 0.00 H ATOM 10419 HB2 PRO B 308 53.580 34.003 -3.096 1.00 0.00 H ATOM 10420 HB3 PRO B 308 54.432 34.462 -4.588 1.00 0.00 H ATOM 10421 N ALA B 309 52.486 36.040 -1.791 1.00 27.37 N ATOM 10422 CA ALA B 309 51.141 36.587 -1.525 1.00 26.54 C ATOM 10423 C ALA B 309 51.092 37.848 -0.693 1.00 28.33 C ATOM 10424 O ALA B 309 50.153 38.632 -0.811 1.00 28.68 O ATOM 10425 CB ALA B 309 50.242 35.527 -0.870 1.00 27.53 C ATOM 10426 HA ALA B 309 50.777 36.868 -2.513 1.00 0.00 H ATOM 10427 HB1 ALA B 309 50.148 34.670 -1.537 1.00 0.00 H ATOM 10428 HB2 ALA B 309 50.686 35.209 0.073 1.00 0.00 H ATOM 10429 HB3 ALA B 309 49.256 35.953 -0.684 1.00 0.00 H ATOM 10430 H ALA B 309 52.831 35.233 -1.233 1.00 0.00 H ATOM 10431 N GLY B 310 52.017 37.986 0.246 1.00 26.51 N ATOM 10432 CA GLY B 310 52.028 39.170 1.096 1.00 25.97 C ATOM 10433 C GLY B 310 52.319 40.441 0.326 1.00 28.65 C ATOM 10434 O GLY B 310 51.609 41.439 0.478 1.00 28.18 O ATOM 10435 HA3 GLY B 310 52.794 39.043 1.861 1.00 0.00 H ATOM 10436 HA2 GLY B 310 51.052 39.266 1.572 1.00 0.00 H ATOM 10437 H GLY B 310 52.737 37.247 0.377 1.00 0.00 H ATOM 10438 N ASP B 311 53.350 40.416 -0.522 1.00 25.79 N ATOM 10439 CA ASP B 311 53.686 41.627 -1.284 1.00 25.43 C ATOM 10440 C ASP B 311 52.555 42.057 -2.205 1.00 30.37 C ATOM 10441 O ASP B 311 52.270 43.241 -2.329 1.00 29.38 O ATOM 10442 CB ASP B 311 54.969 41.465 -2.099 1.00 27.75 C ATOM 10443 CG ASP B 311 56.172 41.187 -1.247 1.00 33.06 C ATOM 10444 OD1 ASP B 311 56.049 41.203 0.002 1.00 35.59 O ATOM 10445 OD2 ASP B 311 57.248 40.941 -1.833 1.00 28.80 O ATOM 10446 HA ASP B 311 53.846 42.405 -0.538 1.00 0.00 H ATOM 10447 HB2 ASP B 311 54.837 40.637 -2.795 1.00 0.00 H ATOM 10448 HB3 ASP B 311 55.144 42.384 -2.659 1.00 0.00 H ATOM 10449 H ASP B 311 53.910 39.548 -0.642 1.00 0.00 H ATOM 10450 N LYS B 312 51.878 41.090 -2.814 1.00 28.03 N ATOM 10451 CA LYS B 312 50.785 41.416 -3.741 1.00 28.16 C ATOM 10452 C LYS B 312 49.626 42.050 -3.009 1.00 30.97 C ATOM 10453 O LYS B 312 49.023 42.989 -3.501 1.00 29.52 O ATOM 10454 CB LYS B 312 50.273 40.151 -4.462 1.00 30.73 C ATOM 10455 CG LYS B 312 51.158 39.650 -5.600 1.00 44.15 C ATOM 10456 CD LYS B 312 50.575 38.362 -6.188 1.00 48.51 C ATOM 10457 CE LYS B 312 51.627 37.569 -6.945 1.00 57.53 C ATOM 10458 NZ LYS B 312 51.901 38.203 -8.261 1.00 60.06 N ATOM 10459 HA LYS B 312 51.186 42.117 -4.473 1.00 0.00 H ATOM 10460 HB2 LYS B 312 50.187 39.353 -3.724 1.00 0.00 H ATOM 10461 HB3 LYS B 312 49.288 40.372 -4.873 1.00 0.00 H ATOM 10462 HG2 LYS B 312 51.211 40.411 -6.379 1.00 0.00 H ATOM 10463 HG3 LYS B 312 52.160 39.452 -5.218 1.00 0.00 H ATOM 10464 HD2 LYS B 312 50.183 37.748 -5.377 1.00 0.00 H ATOM 10465 HD3 LYS B 312 49.765 38.619 -6.871 1.00 0.00 H ATOM 10466 HE2 LYS B 312 51.267 36.552 -7.103 1.00 0.00 H ATOM 10467 HE3 LYS B 312 52.547 37.541 -6.360 1.00 0.00 H ATOM 10468 HZ1 LYS B 312 51.025 38.228 -8.821 1.00 0.00 H ATOM 10469 HZ2 LYS B 312 52.247 39.172 -8.112 1.00 0.00 H ATOM 10470 HZ3 LYS B 312 52.622 37.650 -8.767 1.00 0.00 H ATOM 10471 H LYS B 312 52.123 40.095 -2.634 1.00 0.00 H ATOM 10472 N ALA B 313 49.289 41.520 -1.835 1.00 29.52 N ATOM 10473 CA ALA B 313 48.155 42.078 -1.077 1.00 28.95 C ATOM 10474 C ALA B 313 48.363 43.541 -0.716 1.00 30.40 C ATOM 10475 O ALA B 313 47.453 44.356 -0.813 1.00 30.49 O ATOM 10476 CB ALA B 313 47.855 41.222 0.190 1.00 29.91 C ATOM 10477 HA ALA B 313 47.284 42.037 -1.731 1.00 0.00 H ATOM 10478 HB1 ALA B 313 47.608 40.204 -0.111 1.00 0.00 H ATOM 10479 HB2 ALA B 313 48.734 41.208 0.834 1.00 0.00 H ATOM 10480 HB3 ALA B 313 47.014 41.657 0.730 1.00 0.00 H ATOM 10481 H ALA B 313 49.825 40.714 -1.454 1.00 0.00 H ATOM 10482 N GLU B 314 49.571 43.895 -0.296 1.00 27.49 N ATOM 10483 CA GLU B 314 49.830 45.302 0.092 1.00 25.28 C ATOM 10484 C GLU B 314 49.833 46.249 -1.119 1.00 29.30 C ATOM 10485 O GLU B 314 49.420 47.397 -1.015 1.00 29.51 O ATOM 10486 CB GLU B 314 51.188 45.424 0.815 1.00 25.42 C ATOM 10487 CG GLU B 314 51.359 46.770 1.483 1.00 26.75 C ATOM 10488 CD GLU B 314 52.594 46.831 2.333 1.00 35.91 C ATOM 10489 OE1 GLU B 314 53.437 45.917 2.253 1.00 27.36 O ATOM 10490 OE2 GLU B 314 52.718 47.785 3.102 1.00 31.58 O ATOM 10491 HA GLU B 314 49.019 45.594 0.759 1.00 0.00 H ATOM 10492 HB2 GLU B 314 51.254 44.644 1.574 1.00 0.00 H ATOM 10493 HB3 GLU B 314 51.988 45.289 0.087 1.00 0.00 H ATOM 10494 HG2 GLU B 314 51.425 47.538 0.713 1.00 0.00 H ATOM 10495 HG3 GLU B 314 50.490 46.962 2.112 1.00 0.00 H ATOM 10496 H GLU B 314 50.332 43.189 -0.239 1.00 0.00 H ATOM 10497 N ALA B 315 50.360 45.788 -2.246 1.00 28.32 N ATOM 10498 CA ALA B 315 50.361 46.603 -3.475 1.00 27.63 C ATOM 10499 C ALA B 315 48.902 46.866 -3.839 1.00 31.77 C ATOM 10500 O ALA B 315 48.533 47.977 -4.175 1.00 32.32 O ATOM 10501 CB ALA B 315 51.070 45.852 -4.609 1.00 29.22 C ATOM 10502 HA ALA B 315 50.894 47.541 -3.319 1.00 0.00 H ATOM 10503 HB1 ALA B 315 52.100 45.644 -4.317 1.00 0.00 H ATOM 10504 HB2 ALA B 315 50.550 44.914 -4.803 1.00 0.00 H ATOM 10505 HB3 ALA B 315 51.063 46.466 -5.510 1.00 0.00 H ATOM 10506 H ALA B 315 50.779 44.836 -2.263 1.00 0.00 H ATOM 10507 N GLN B 316 48.036 45.862 -3.697 1.00 30.43 N ATOM 10508 CA GLN B 316 46.596 46.085 -3.951 1.00 29.77 C ATOM 10509 C GLN B 316 46.008 47.114 -2.973 1.00 33.26 C ATOM 10510 O GLN B 316 45.285 48.036 -3.359 1.00 33.67 O ATOM 10511 CB GLN B 316 45.826 44.765 -3.844 1.00 31.19 C ATOM 10512 CG GLN B 316 44.429 44.855 -4.386 1.00 51.65 C ATOM 10513 CD GLN B 316 44.392 45.544 -5.747 1.00 61.06 C ATOM 10514 OE1 GLN B 316 44.986 45.056 -6.716 1.00 50.73 O ATOM 10515 NE2 GLN B 316 43.749 46.711 -5.806 1.00 45.08 N ATOM 10516 HA GLN B 316 46.494 46.480 -4.962 1.00 0.00 H ATOM 10517 HB2 GLN B 316 46.367 44.001 -4.402 1.00 0.00 H ATOM 10518 HB3 GLN B 316 45.774 44.477 -2.794 1.00 0.00 H ATOM 10519 HG2 GLN B 316 44.025 43.848 -4.489 1.00 0.00 H ATOM 10520 HG3 GLN B 316 43.815 45.422 -3.686 1.00 0.00 H ATOM 10521 HE22 GLN B 316 43.264 47.080 -4.964 1.00 0.00 H ATOM 10522 HE21 GLN B 316 43.733 47.252 -6.694 1.00 0.00 H ATOM 10523 H GLN B 316 48.373 44.922 -3.408 1.00 0.00 H ATOM 10524 N ALA B 317 46.337 46.980 -1.693 1.00 30.13 N ATOM 10525 CA ALA B 317 45.858 47.922 -0.683 1.00 29.10 C ATOM 10526 C ALA B 317 46.357 49.351 -0.936 1.00 31.13 C ATOM 10527 O ALA B 317 45.650 50.326 -0.670 1.00 30.89 O ATOM 10528 CB ALA B 317 46.280 47.450 0.709 1.00 30.63 C ATOM 10529 HA ALA B 317 44.770 47.948 -0.747 1.00 0.00 H ATOM 10530 HB1 ALA B 317 45.853 46.466 0.902 1.00 0.00 H ATOM 10531 HB2 ALA B 317 47.367 47.392 0.757 1.00 0.00 H ATOM 10532 HB3 ALA B 317 45.919 48.157 1.456 1.00 0.00 H ATOM 10533 H ALA B 317 46.947 46.189 -1.404 1.00 0.00 H ATOM 10534 N VAL B 318 47.605 49.491 -1.365 1.00 27.69 N ATOM 10535 CA VAL B 318 48.142 50.836 -1.663 1.00 27.87 C ATOM 10536 C VAL B 318 47.355 51.415 -2.871 1.00 34.88 C ATOM 10537 O VAL B 318 46.864 52.544 -2.847 1.00 33.55 O ATOM 10538 CB VAL B 318 49.670 50.786 -1.973 1.00 32.24 C ATOM 10539 CG1 VAL B 318 50.114 52.135 -2.577 1.00 31.84 C ATOM 10540 CG2 VAL B 318 50.478 50.503 -0.701 1.00 31.61 C ATOM 10541 HA VAL B 318 48.018 51.477 -0.790 1.00 0.00 H ATOM 10542 HB VAL B 318 49.854 49.981 -2.684 1.00 0.00 H ATOM 10543 HG11 VAL B 318 49.561 52.319 -3.498 1.00 0.00 H ATOM 10544 HG12 VAL B 318 49.912 52.935 -1.864 1.00 0.00 H ATOM 10545 HG13 VAL B 318 51.182 52.101 -2.794 1.00 0.00 H ATOM 10546 HG21 VAL B 318 50.294 51.292 0.028 1.00 0.00 H ATOM 10547 HG22 VAL B 318 50.173 49.543 -0.284 1.00 0.00 H ATOM 10548 HG23 VAL B 318 51.540 50.473 -0.946 1.00 0.00 H ATOM 10549 H VAL B 318 48.207 48.652 -1.492 1.00 0.00 H ATOM 10550 N LYS B 319 47.151 50.594 -3.894 1.00 35.07 N ATOM 10551 CA LYS B 319 46.362 51.043 -5.055 1.00 34.88 C ATOM 10552 C LYS B 319 45.000 51.531 -4.624 1.00 41.07 C ATOM 10553 O LYS B 319 44.518 52.568 -5.083 1.00 40.23 O ATOM 10554 CB LYS B 319 46.162 49.896 -6.047 1.00 36.77 C ATOM 10555 CG LYS B 319 47.194 49.867 -7.153 1.00 56.35 C ATOM 10556 CD LYS B 319 47.438 48.431 -7.632 1.00 64.56 C ATOM 10557 CE LYS B 319 48.854 48.245 -8.170 1.00 51.47 C ATOM 10558 NZ LYS B 319 49.241 46.836 -8.066 1.00 56.72 N ATOM 10559 HA LYS B 319 46.915 51.855 -5.527 1.00 0.00 H ATOM 10560 HB2 LYS B 319 46.215 48.954 -5.501 1.00 0.00 H ATOM 10561 HB3 LYS B 319 45.175 49.998 -6.498 1.00 0.00 H ATOM 10562 HG2 LYS B 319 46.838 50.468 -7.990 1.00 0.00 H ATOM 10563 HG3 LYS B 319 48.130 50.284 -6.780 1.00 0.00 H ATOM 10564 HD2 LYS B 319 47.286 47.749 -6.795 1.00 0.00 H ATOM 10565 HD3 LYS B 319 46.726 48.197 -8.424 1.00 0.00 H ATOM 10566 HE2 LYS B 319 49.546 48.855 -7.589 1.00 0.00 H ATOM 10567 HE3 LYS B 319 48.888 48.554 -9.215 1.00 0.00 H ATOM 10568 HZ1 LYS B 319 49.209 46.542 -7.069 1.00 0.00 H ATOM 10569 HZ2 LYS B 319 48.581 46.255 -8.622 1.00 0.00 H ATOM 10570 HZ3 LYS B 319 50.206 46.715 -8.434 1.00 0.00 H ATOM 10571 H LYS B 319 47.548 49.633 -3.876 1.00 0.00 H ATOM 10572 N THR B 320 44.363 50.746 -3.756 1.00 38.83 N ATOM 10573 CA THR B 320 43.026 51.048 -3.260 1.00 36.57 C ATOM 10574 C THR B 320 42.949 52.381 -2.526 1.00 37.98 C ATOM 10575 O THR B 320 42.031 53.151 -2.720 1.00 35.56 O ATOM 10576 CB THR B 320 42.540 49.919 -2.337 1.00 40.10 C ATOM 10577 OG1 THR B 320 42.419 48.704 -3.086 1.00 41.28 O ATOM 10578 CG2 THR B 320 41.209 50.273 -1.691 1.00 34.64 C ATOM 10579 HA THR B 320 42.378 51.127 -4.133 1.00 0.00 H ATOM 10580 HB THR B 320 43.273 49.783 -1.541 1.00 0.00 H ATOM 10581 HG1 THR B 320 43.301 48.463 -3.466 1.00 0.00 H ATOM 10582 HG23 THR B 320 41.316 51.198 -1.125 1.00 0.00 H ATOM 10583 HG21 THR B 320 40.454 50.405 -2.466 1.00 0.00 H ATOM 10584 HG22 THR B 320 40.907 49.469 -1.021 1.00 0.00 H ATOM 10585 H THR B 320 44.838 49.884 -3.419 1.00 0.00 H ATOM 10586 N ILE B 321 43.899 52.632 -1.639 1.00 35.14 N ATOM 10587 CA ILE B 321 43.882 53.843 -0.817 1.00 33.25 C ATOM 10588 C ILE B 321 44.345 55.068 -1.594 1.00 37.21 C ATOM 10589 O ILE B 321 43.869 56.179 -1.373 1.00 36.67 O ATOM 10590 CB ILE B 321 44.780 53.638 0.453 1.00 35.51 C ATOM 10591 CG1 ILE B 321 44.233 52.489 1.301 1.00 34.69 C ATOM 10592 CG2 ILE B 321 44.938 54.950 1.252 1.00 35.60 C ATOM 10593 CD1 ILE B 321 42.817 52.697 1.792 1.00 35.39 C ATOM 10594 HA ILE B 321 42.851 54.021 -0.512 1.00 0.00 H ATOM 10595 HB ILE B 321 45.785 53.360 0.134 1.00 0.00 H ATOM 10596 HG12 ILE B 321 44.256 51.580 0.700 1.00 0.00 H ATOM 10597 HG13 ILE B 321 44.881 52.366 2.169 1.00 0.00 H ATOM 10598 HD11 ILE B 321 42.775 53.596 2.407 1.00 0.00 H ATOM 10599 HD12 ILE B 321 42.150 52.809 0.937 1.00 0.00 H ATOM 10600 HD13 ILE B 321 42.509 51.835 2.384 1.00 0.00 H ATOM 10601 HG21 ILE B 321 45.402 55.706 0.619 1.00 0.00 H ATOM 10602 HG22 ILE B 321 43.957 55.298 1.575 1.00 0.00 H ATOM 10603 HG23 ILE B 321 45.566 54.769 2.124 1.00 0.00 H ATOM 10604 H ILE B 321 44.677 51.952 -1.523 1.00 0.00 H ATOM 10605 N PHE B 322 45.352 54.877 -2.430 1.00 35.84 N ATOM 10606 CA PHE B 322 45.938 56.000 -3.144 1.00 36.67 C ATOM 10607 C PHE B 322 45.252 56.370 -4.453 1.00 46.66 C ATOM 10608 O PHE B 322 45.380 57.503 -4.911 1.00 45.36 O ATOM 10609 CB PHE B 322 47.449 55.833 -3.278 1.00 37.47 C ATOM 10610 CG PHE B 322 48.161 55.967 -1.971 1.00 38.79 C ATOM 10611 CD1 PHE B 322 48.046 54.965 -1.008 1.00 41.03 C ATOM 10612 CD2 PHE B 322 48.798 57.154 -1.636 1.00 40.35 C ATOM 10613 CE1 PHE B 322 48.608 55.122 0.241 1.00 42.03 C ATOM 10614 CE2 PHE B 322 49.376 57.314 -0.404 1.00 43.96 C ATOM 10615 CZ PHE B 322 49.278 56.296 0.549 1.00 42.07 C ATOM 10616 HA PHE B 322 45.751 56.874 -2.520 1.00 0.00 H ATOM 10617 HB2 PHE B 322 47.656 54.845 -3.689 1.00 0.00 H ATOM 10618 HB3 PHE B 322 47.825 56.595 -3.960 1.00 0.00 H ATOM 10619 HD2 PHE B 322 48.839 57.967 -2.361 1.00 0.00 H ATOM 10620 HE2 PHE B 322 49.911 58.234 -0.167 1.00 0.00 H ATOM 10621 HZ PHE B 322 49.728 56.425 1.533 1.00 0.00 H ATOM 10622 HE1 PHE B 322 48.526 54.327 0.982 1.00 0.00 H ATOM 10623 HD1 PHE B 322 47.506 54.048 -1.245 1.00 0.00 H ATOM 10624 H PHE B 322 45.727 53.918 -2.578 1.00 0.00 H ATOM 10625 N GLY B 323 44.468 55.438 -4.998 1.00 49.09 N ATOM 10626 CA GLY B 323 43.706 55.621 -6.228 1.00 51.15 C ATOM 10627 C GLY B 323 44.503 56.339 -7.305 1.00 59.91 C ATOM 10628 O GLY B 323 45.491 55.799 -7.823 1.00 57.89 O ATOM 10629 HA3 GLY B 323 42.815 56.207 -6.003 1.00 0.00 H ATOM 10630 HA2 GLY B 323 43.411 54.642 -6.605 1.00 0.00 H ATOM 10631 H GLY B 323 44.396 54.520 -4.514 1.00 0.00 H ATOM 10632 N GLU B 324 44.084 57.572 -7.602 1.00 61.21 N ATOM 10633 CA GLU B 324 44.732 58.443 -8.591 1.00 62.77 C ATOM 10634 C GLU B 324 46.218 58.673 -8.302 1.00 65.16 C ATOM 10635 O GLU B 324 47.066 58.534 -9.187 1.00 64.58 O ATOM 10636 CB GLU B 324 44.027 59.809 -8.598 1.00 65.37 C ATOM 10637 CG GLU B 324 43.547 60.265 -9.963 1.00 85.23 C ATOM 10638 CD GLU B 324 42.288 59.539 -10.408 1.00127.85 C ATOM 10639 OE1 GLU B 324 41.182 59.934 -9.969 1.00131.45 O ATOM 10640 OE2 GLU B 324 42.408 58.567 -11.191 1.00129.69 O ATOM 10641 HA GLU B 324 44.653 57.942 -9.556 1.00 0.00 H ATOM 10642 HB2 GLU B 324 43.163 59.749 -7.936 1.00 0.00 H ATOM 10643 HB3 GLU B 324 44.725 60.554 -8.216 1.00 0.00 H ATOM 10644 HG2 GLU B 324 43.339 61.334 -9.922 1.00 0.00 H ATOM 10645 HG3 GLU B 324 44.335 60.078 -10.692 1.00 0.00 H ATOM 10646 H GLU B 324 43.248 57.937 -7.103 1.00 0.00 H ATOM 10647 N ALA B 325 46.514 59.069 -7.066 1.00 60.24 N ATOM 10648 CA ALA B 325 47.882 59.344 -6.635 1.00 59.69 C ATOM 10649 C ALA B 325 48.777 58.104 -6.476 1.00 61.88 C ATOM 10650 O ALA B 325 49.971 58.234 -6.213 1.00 61.58 O ATOM 10651 CB ALA B 325 47.867 60.148 -5.319 1.00 60.44 C ATOM 10652 HA ALA B 325 48.327 59.923 -7.444 1.00 0.00 H ATOM 10653 HB1 ALA B 325 47.343 61.091 -5.477 1.00 0.00 H ATOM 10654 HB2 ALA B 325 47.356 59.571 -4.548 1.00 0.00 H ATOM 10655 HB3 ALA B 325 48.892 60.348 -5.005 1.00 0.00 H ATOM 10656 H ALA B 325 45.741 59.187 -6.381 1.00 0.00 H ATOM 10657 N ALA B 326 48.194 56.913 -6.577 1.00 57.50 N ATOM 10658 CA ALA B 326 48.932 55.663 -6.384 1.00 56.89 C ATOM 10659 C ALA B 326 50.326 55.635 -7.013 1.00 61.40 C ATOM 10660 O ALA B 326 51.291 55.219 -6.369 1.00 61.24 O ATOM 10661 CB ALA B 326 48.099 54.461 -6.841 1.00 57.33 C ATOM 10662 HA ALA B 326 49.106 55.598 -5.310 1.00 0.00 H ATOM 10663 HB1 ALA B 326 47.177 54.418 -6.261 1.00 0.00 H ATOM 10664 HB2 ALA B 326 47.859 54.568 -7.899 1.00 0.00 H ATOM 10665 HB3 ALA B 326 48.670 53.545 -6.687 1.00 0.00 H ATOM 10666 H ALA B 326 47.179 56.868 -6.801 1.00 0.00 H ATOM 10667 N SER B 327 50.431 56.082 -8.263 1.00 58.00 N ATOM 10668 CA SER B 327 51.717 56.100 -8.969 1.00 57.35 C ATOM 10669 C SER B 327 52.645 57.233 -8.504 1.00 58.76 C ATOM 10670 O SER B 327 53.868 57.147 -8.680 1.00 59.84 O ATOM 10671 CB SER B 327 51.496 56.187 -10.491 1.00 61.43 C ATOM 10672 OG SER B 327 50.572 57.212 -10.820 1.00 66.93 O ATOM 10673 HA SER B 327 52.216 55.162 -8.724 1.00 0.00 H ATOM 10674 HB2 SER B 327 51.110 55.233 -10.849 1.00 0.00 H ATOM 10675 HB3 SER B 327 52.449 56.398 -10.977 1.00 0.00 H ATOM 10676 HG SER B 327 50.451 57.243 -11.802 1.00 0.00 H ATOM 10677 H SER B 327 49.580 56.427 -8.751 1.00 0.00 H ATOM 10678 N ARG B 328 52.058 58.281 -7.915 1.00 51.39 N ATOM 10679 CA ARG B 328 52.792 59.459 -7.422 1.00 49.60 C ATOM 10680 C ARG B 328 53.426 59.304 -6.019 1.00 51.03 C ATOM 10681 O ARG B 328 54.361 60.026 -5.664 1.00 51.26 O ATOM 10682 CB ARG B 328 51.865 60.673 -7.439 1.00 49.08 C ATOM 10683 CG ARG B 328 52.447 61.930 -6.839 1.00 65.60 C ATOM 10684 CD ARG B 328 51.640 63.164 -7.265 1.00 87.29 C ATOM 10685 NE ARG B 328 51.712 64.248 -6.281 1.00108.46 N ATOM 10686 CZ ARG B 328 50.740 64.555 -5.422 1.00128.40 C ATOM 10687 NH1 ARG B 328 49.609 63.861 -5.420 1.00120.02 N ATOM 10688 NH2 ARG B 328 50.899 65.555 -4.561 1.00113.16 N ATOM 10689 HA ARG B 328 53.635 59.586 -8.102 1.00 0.00 H ATOM 10690 HB2 ARG B 328 51.602 60.883 -8.476 1.00 0.00 H ATOM 10691 HB3 ARG B 328 50.964 60.418 -6.882 1.00 0.00 H ATOM 10692 HG2 ARG B 328 52.429 61.849 -5.752 1.00 0.00 H ATOM 10693 HG3 ARG B 328 53.477 62.043 -7.176 1.00 0.00 H ATOM 10694 HD2 ARG B 328 50.597 62.874 -7.390 1.00 0.00 H ATOM 10695 HD3 ARG B 328 52.031 63.527 -8.215 1.00 0.00 H ATOM 10696 HE ARG B 328 52.582 64.817 -6.251 1.00 0.00 H ATOM 10697 HH12 ARG B 328 48.852 64.102 -4.749 1.00 0.00 H ATOM 10698 HH11 ARG B 328 49.480 63.076 -6.090 1.00 0.00 H ATOM 10699 HH22 ARG B 328 50.138 65.791 -3.892 1.00 0.00 H ATOM 10700 HH21 ARG B 328 51.784 66.101 -4.556 1.00 0.00 H ATOM 10701 H ARG B 328 51.025 58.263 -7.799 1.00 0.00 H ATOM 10702 N VAL B 329 52.890 58.406 -5.196 1.00 43.43 N ATOM 10703 CA VAL B 329 53.468 58.189 -3.869 1.00 39.93 C ATOM 10704 C VAL B 329 54.613 57.207 -4.045 1.00 38.68 C ATOM 10705 O VAL B 329 54.521 56.290 -4.862 1.00 37.38 O ATOM 10706 CB VAL B 329 52.415 57.629 -2.883 1.00 42.60 C ATOM 10707 CG1 VAL B 329 51.946 56.270 -3.339 1.00 41.02 C ATOM 10708 CG2 VAL B 329 52.988 57.554 -1.463 1.00 42.46 C ATOM 10709 HA VAL B 329 53.820 59.131 -3.447 1.00 0.00 H ATOM 10710 HB VAL B 329 51.560 58.305 -2.868 1.00 0.00 H ATOM 10711 HG11 VAL B 329 51.499 56.355 -4.329 1.00 0.00 H ATOM 10712 HG12 VAL B 329 52.796 55.589 -3.380 1.00 0.00 H ATOM 10713 HG13 VAL B 329 51.206 55.888 -2.636 1.00 0.00 H ATOM 10714 HG21 VAL B 329 53.859 56.899 -1.458 1.00 0.00 H ATOM 10715 HG22 VAL B 329 53.281 58.552 -1.137 1.00 0.00 H ATOM 10716 HG23 VAL B 329 52.230 57.158 -0.787 1.00 0.00 H ATOM 10717 H VAL B 329 52.059 57.857 -5.496 1.00 0.00 H ATOM 10718 N LEU B 330 55.697 57.390 -3.300 1.00 32.95 N ATOM 10719 CA LEU B 330 56.790 56.434 -3.354 1.00 30.71 C ATOM 10720 C LEU B 330 56.516 55.372 -2.277 1.00 33.27 C ATOM 10721 O LEU B 330 56.081 55.702 -1.163 1.00 29.99 O ATOM 10722 CB LEU B 330 58.118 57.111 -3.046 1.00 31.45 C ATOM 10723 CG LEU B 330 58.570 58.244 -3.970 1.00 36.95 C ATOM 10724 CD1 LEU B 330 59.949 58.727 -3.513 1.00 37.01 C ATOM 10725 CD2 LEU B 330 58.592 57.773 -5.418 1.00 40.13 C ATOM 10726 HA LEU B 330 56.851 55.997 -4.351 1.00 0.00 H ATOM 10727 HB2 LEU B 330 58.049 57.520 -2.038 1.00 0.00 H ATOM 10728 HB3 LEU B 330 58.890 56.342 -3.072 1.00 0.00 H ATOM 10729 HG LEU B 330 57.868 59.076 -3.915 1.00 0.00 H ATOM 10730 HD21 LEU B 330 59.284 56.937 -5.516 1.00 0.00 H ATOM 10731 HD22 LEU B 330 57.591 57.454 -5.710 1.00 0.00 H ATOM 10732 HD23 LEU B 330 58.916 58.592 -6.060 1.00 0.00 H ATOM 10733 HD11 LEU B 330 59.884 59.088 -2.487 1.00 0.00 H ATOM 10734 HD12 LEU B 330 60.658 57.900 -3.565 1.00 0.00 H ATOM 10735 HD13 LEU B 330 60.283 59.535 -4.163 1.00 0.00 H ATOM 10736 H LEU B 330 55.764 58.220 -2.676 1.00 0.00 H ATOM 10737 N VAL B 331 56.807 54.113 -2.610 1.00 29.86 N ATOM 10738 CA VAL B 331 56.643 52.975 -1.702 1.00 27.96 C ATOM 10739 C VAL B 331 57.957 52.223 -1.694 1.00 31.02 C ATOM 10740 O VAL B 331 58.466 51.896 -2.755 1.00 32.75 O ATOM 10741 CB VAL B 331 55.557 51.985 -2.251 1.00 32.14 C ATOM 10742 CG1 VAL B 331 55.385 50.798 -1.292 1.00 31.45 C ATOM 10743 CG2 VAL B 331 54.230 52.682 -2.500 1.00 31.76 C ATOM 10744 HA VAL B 331 56.349 53.334 -0.716 1.00 0.00 H ATOM 10745 HB VAL B 331 55.905 51.609 -3.213 1.00 0.00 H ATOM 10746 HG11 VAL B 331 56.333 50.270 -1.196 1.00 0.00 H ATOM 10747 HG12 VAL B 331 55.072 51.165 -0.315 1.00 0.00 H ATOM 10748 HG13 VAL B 331 54.628 50.120 -1.687 1.00 0.00 H ATOM 10749 HG21 VAL B 331 53.864 53.108 -1.566 1.00 0.00 H ATOM 10750 HG22 VAL B 331 54.370 53.477 -3.233 1.00 0.00 H ATOM 10751 HG23 VAL B 331 53.507 51.960 -2.879 1.00 0.00 H ATOM 10752 H VAL B 331 57.170 53.929 -3.567 1.00 0.00 H ATOM 10753 N SER B 332 58.516 51.893 -0.532 1.00 25.69 N ATOM 10754 CA SER B 332 59.709 51.061 -0.560 1.00 24.52 C ATOM 10755 C SER B 332 59.738 50.098 0.594 1.00 29.09 C ATOM 10756 O SER B 332 59.197 50.403 1.643 1.00 29.03 O ATOM 10757 CB SER B 332 61.004 51.876 -0.689 1.00 25.99 C ATOM 10758 OG SER B 332 61.563 52.248 0.564 1.00 30.91 O ATOM 10759 HA SER B 332 59.654 50.463 -1.470 1.00 0.00 H ATOM 10760 HB2 SER B 332 60.787 52.783 -1.254 1.00 0.00 H ATOM 10761 HB3 SER B 332 61.737 51.278 -1.231 1.00 0.00 H ATOM 10762 HG SER B 332 62.392 52.768 0.413 1.00 0.00 H ATOM 10763 H SER B 332 58.112 52.220 0.369 1.00 0.00 H ATOM 10764 N SER B 333 60.355 48.929 0.399 1.00 24.85 N ATOM 10765 CA SER B 333 60.513 48.014 1.509 1.00 24.82 C ATOM 10766 C SER B 333 61.986 47.956 1.870 1.00 28.00 C ATOM 10767 O SER B 333 62.797 47.455 1.091 1.00 27.43 O ATOM 10768 CB SER B 333 59.990 46.602 1.220 1.00 26.30 C ATOM 10769 OG SER B 333 60.413 45.738 2.278 1.00 28.75 O ATOM 10770 HA SER B 333 59.913 48.391 2.337 1.00 0.00 H ATOM 10771 HB2 SER B 333 60.393 46.247 0.271 1.00 0.00 H ATOM 10772 HB3 SER B 333 58.901 46.616 1.169 1.00 0.00 H ATOM 10773 HG SER B 333 60.083 44.821 2.106 1.00 0.00 H ATOM 10774 H SER B 333 60.719 48.679 -0.543 1.00 0.00 H ATOM 10775 N THR B 334 62.331 48.442 3.064 1.00 23.73 N ATOM 10776 CA THR B 334 63.724 48.380 3.534 1.00 22.93 C ATOM 10777 C THR B 334 64.099 46.986 3.994 1.00 25.76 C ATOM 10778 O THR B 334 65.262 46.719 4.265 1.00 25.33 O ATOM 10779 CB THR B 334 64.006 49.423 4.645 1.00 25.49 C ATOM 10780 OG1 THR B 334 62.901 49.436 5.539 1.00 25.05 O ATOM 10781 CG2 THR B 334 64.111 50.805 4.026 1.00 21.86 C ATOM 10782 HA THR B 334 64.354 48.630 2.680 1.00 0.00 H ATOM 10783 HB THR B 334 64.932 49.167 5.160 1.00 0.00 H ATOM 10784 HG1 THR B 334 62.790 48.537 5.938 1.00 0.00 H ATOM 10785 HG23 THR B 334 64.952 50.828 3.333 1.00 0.00 H ATOM 10786 HG21 THR B 334 63.190 51.032 3.489 1.00 0.00 H ATOM 10787 HG22 THR B 334 64.266 51.543 4.813 1.00 0.00 H ATOM 10788 H THR B 334 61.604 48.871 3.672 1.00 0.00 H ATOM 10789 N LYS B 335 63.112 46.085 4.081 1.00 22.00 N ATOM 10790 CA LYS B 335 63.419 44.695 4.416 1.00 20.34 C ATOM 10791 C LYS B 335 64.222 44.065 3.260 1.00 24.78 C ATOM 10792 O LYS B 335 64.880 43.050 3.442 1.00 23.77 O ATOM 10793 CB LYS B 335 62.143 43.869 4.672 1.00 22.98 C ATOM 10794 CG LYS B 335 61.258 44.377 5.804 1.00 24.34 C ATOM 10795 CD LYS B 335 60.124 43.370 6.095 1.00 23.78 C ATOM 10796 CE LYS B 335 59.346 43.720 7.388 1.00 22.30 C ATOM 10797 NZ LYS B 335 58.613 45.029 7.264 1.00 23.36 N ATOM 10798 HA LYS B 335 64.004 44.688 5.336 1.00 0.00 H ATOM 10799 HB2 LYS B 335 61.552 43.868 3.756 1.00 0.00 H ATOM 10800 HB3 LYS B 335 62.443 42.849 4.910 1.00 0.00 H ATOM 10801 HG2 LYS B 335 61.862 44.507 6.702 1.00 0.00 H ATOM 10802 HG3 LYS B 335 60.823 45.335 5.518 1.00 0.00 H ATOM 10803 HD2 LYS B 335 59.429 43.372 5.256 1.00 0.00 H ATOM 10804 HD3 LYS B 335 60.557 42.376 6.204 1.00 0.00 H ATOM 10805 HE2 LYS B 335 60.051 43.787 8.217 1.00 0.00 H ATOM 10806 HE3 LYS B 335 58.624 42.929 7.590 1.00 0.00 H ATOM 10807 HZ1 LYS B 335 59.296 45.791 7.077 1.00 0.00 H ATOM 10808 HZ2 LYS B 335 57.933 44.971 6.479 1.00 0.00 H ATOM 10809 HZ3 LYS B 335 58.106 45.226 8.150 1.00 0.00 H ATOM 10810 H LYS B 335 62.128 46.374 3.910 1.00 0.00 H ATOM 10811 N SER B 336 64.240 44.697 2.089 1.00 24.01 N ATOM 10812 CA SER B 336 65.103 44.206 0.971 1.00 23.44 C ATOM 10813 C SER B 336 66.571 44.224 1.400 1.00 27.97 C ATOM 10814 O SER B 336 67.377 43.468 0.879 1.00 29.56 O ATOM 10815 CB SER B 336 64.934 45.103 -0.271 1.00 26.19 C ATOM 10816 OG SER B 336 65.213 46.453 0.052 1.00 28.86 O ATOM 10817 HA SER B 336 64.802 43.188 0.725 1.00 0.00 H ATOM 10818 HB2 SER B 336 63.909 45.025 -0.634 1.00 0.00 H ATOM 10819 HB3 SER B 336 65.620 44.771 -1.050 1.00 0.00 H ATOM 10820 HG SER B 336 64.589 46.758 0.757 1.00 0.00 H ATOM 10821 H SER B 336 63.648 45.541 1.950 1.00 0.00 H ATOM 10822 N MET B 337 66.910 45.053 2.396 1.00 22.80 N ATOM 10823 CA MET B 337 68.308 45.136 2.875 1.00 23.07 C ATOM 10824 C MET B 337 68.494 44.587 4.293 1.00 27.22 C ATOM 10825 O MET B 337 69.503 44.007 4.671 1.00 27.21 O ATOM 10826 CB MET B 337 68.705 46.630 2.913 1.00 25.23 C ATOM 10827 CG MET B 337 68.794 47.304 1.533 1.00 27.09 C ATOM 10828 SD MET B 337 69.001 49.126 1.592 1.00 28.78 S ATOM 10829 CE MET B 337 67.328 49.699 1.593 1.00 23.61 C ATOM 10830 HA MET B 337 68.920 44.540 2.198 1.00 0.00 H ATOM 10831 HB2 MET B 337 67.962 47.164 3.506 1.00 0.00 H ATOM 10832 HB3 MET B 337 69.679 46.711 3.395 1.00 0.00 H ATOM 10833 HG2 MET B 337 67.878 47.082 0.985 1.00 0.00 H ATOM 10834 HG3 MET B 337 69.646 46.881 1.001 1.00 0.00 H ATOM 10835 HE1 MET B 337 66.828 49.358 0.686 1.00 0.00 H ATOM 10836 HE2 MET B 337 66.810 49.302 2.466 1.00 0.00 H ATOM 10837 HE3 MET B 337 67.318 50.788 1.627 1.00 0.00 H ATOM 10838 H MET B 337 66.180 45.647 2.839 1.00 0.00 H ATOM 10839 N THR B 338 67.511 44.888 5.113 1.00 25.25 N ATOM 10840 CA THR B 338 67.549 44.631 6.545 1.00 25.60 C ATOM 10841 C THR B 338 66.999 43.224 6.926 1.00 29.76 C ATOM 10842 O THR B 338 67.377 42.618 7.937 1.00 28.32 O ATOM 10843 CB THR B 338 66.675 45.773 7.052 1.00 30.21 C ATOM 10844 OG1 THR B 338 67.390 46.791 7.767 1.00 36.29 O ATOM 10845 CG2 THR B 338 65.428 45.396 7.545 1.00 19.96 C ATOM 10846 HA THR B 338 68.551 44.607 6.973 1.00 0.00 H ATOM 10847 HB THR B 338 66.370 46.309 6.153 1.00 0.00 H ATOM 10848 HG1 THR B 338 66.757 47.493 8.061 1.00 0.00 H ATOM 10849 HG23 THR B 338 65.005 44.621 6.906 1.00 0.00 H ATOM 10850 HG21 THR B 338 65.541 45.012 8.559 1.00 0.00 H ATOM 10851 HG22 THR B 338 64.766 46.262 7.554 1.00 0.00 H ATOM 10852 H THR B 338 66.659 45.334 4.716 1.00 0.00 H ATOM 10853 N GLY B 339 66.156 42.670 6.071 1.00 26.75 N ATOM 10854 CA GLY B 339 65.492 41.431 6.421 1.00 26.33 C ATOM 10855 C GLY B 339 64.311 41.841 7.299 1.00 28.44 C ATOM 10856 O GLY B 339 64.032 43.044 7.483 1.00 27.67 O ATOM 10857 HA3 GLY B 339 66.168 40.777 6.971 1.00 0.00 H ATOM 10858 HA2 GLY B 339 65.142 40.918 5.525 1.00 0.00 H ATOM 10859 H GLY B 339 65.971 43.121 5.152 1.00 0.00 H ATOM 10860 N HIS B 340 63.594 40.858 7.820 1.00 23.76 N ATOM 10861 CA HIS B 340 62.351 41.100 8.601 1.00 23.06 C ATOM 10862 C HIS B 340 62.656 41.013 10.087 1.00 25.46 C ATOM 10863 O HIS B 340 62.941 39.922 10.597 1.00 24.69 O ATOM 10864 CB HIS B 340 61.356 39.979 8.239 1.00 23.14 C ATOM 10865 CG HIS B 340 59.943 40.218 8.690 1.00 25.28 C ATOM 10866 ND1 HIS B 340 59.583 41.246 9.538 1.00 26.08 N ATOM 10867 CD2 HIS B 340 58.794 39.584 8.359 1.00 24.38 C ATOM 10868 CE1 HIS B 340 58.274 41.219 9.726 1.00 24.08 C ATOM 10869 NE2 HIS B 340 57.774 40.221 9.019 1.00 24.64 N ATOM 10870 HA HIS B 340 61.944 42.085 8.374 1.00 0.00 H ATOM 10871 HB2 HIS B 340 61.351 39.867 7.155 1.00 0.00 H ATOM 10872 HB3 HIS B 340 61.706 39.054 8.697 1.00 0.00 H ATOM 10873 HD2 HIS B 340 58.697 38.727 7.692 1.00 0.00 H ATOM 10874 HE1 HIS B 340 57.705 41.903 10.356 1.00 0.00 H ATOM 10875 H HIS B 340 63.912 39.878 7.678 1.00 0.00 H ATOM 10876 N LEU B 341 62.675 42.170 10.754 1.00 21.97 N ATOM 10877 CA LEU B 341 62.954 42.269 12.195 1.00 21.00 C ATOM 10878 C LEU B 341 61.755 41.873 13.081 1.00 21.69 C ATOM 10879 O LEU B 341 61.792 42.019 14.299 1.00 20.12 O ATOM 10880 CB LEU B 341 63.468 43.699 12.562 1.00 19.61 C ATOM 10881 CG LEU B 341 65.015 43.789 12.507 1.00 24.17 C ATOM 10882 CD1 LEU B 341 65.465 43.773 11.052 1.00 24.29 C ATOM 10883 CD2 LEU B 341 65.553 45.064 13.184 1.00 24.27 C ATOM 10884 HA LEU B 341 63.739 41.542 12.405 1.00 0.00 H ATOM 10885 HB2 LEU B 341 63.048 44.417 11.857 1.00 0.00 H ATOM 10886 HB3 LEU B 341 63.136 43.945 13.571 1.00 0.00 H ATOM 10887 HG LEU B 341 65.414 42.932 13.050 1.00 0.00 H ATOM 10888 HD21 LEU B 341 65.146 45.941 12.680 1.00 0.00 H ATOM 10889 HD22 LEU B 341 65.252 45.073 14.231 1.00 0.00 H ATOM 10890 HD23 LEU B 341 66.641 45.078 13.118 1.00 0.00 H ATOM 10891 HD11 LEU B 341 65.134 42.847 10.581 1.00 0.00 H ATOM 10892 HD12 LEU B 341 65.029 44.624 10.529 1.00 0.00 H ATOM 10893 HD13 LEU B 341 66.552 43.836 11.009 1.00 0.00 H ATOM 10894 H LEU B 341 62.483 43.046 10.228 1.00 0.00 H ATOM 10895 N LEU B 342 60.710 41.335 12.470 1.00 20.75 N ATOM 10896 CA LEU B 342 59.522 40.869 13.207 1.00 20.01 C ATOM 10897 C LEU B 342 58.950 41.902 14.194 1.00 23.72 C ATOM 10898 O LEU B 342 58.524 42.988 13.785 1.00 24.24 O ATOM 10899 CB LEU B 342 59.775 39.511 13.876 1.00 19.72 C ATOM 10900 CG LEU B 342 60.261 38.385 12.937 1.00 26.21 C ATOM 10901 CD1 LEU B 342 60.693 37.161 13.727 1.00 26.92 C ATOM 10902 CD2 LEU B 342 59.181 37.974 11.865 1.00 25.29 C ATOM 10903 HA LEU B 342 58.743 40.736 12.457 1.00 0.00 H ATOM 10904 HB2 LEU B 342 60.530 39.653 14.649 1.00 0.00 H ATOM 10905 HB3 LEU B 342 58.843 39.185 14.337 1.00 0.00 H ATOM 10906 HG LEU B 342 61.119 38.789 12.400 1.00 0.00 H ATOM 10907 HD21 LEU B 342 58.283 37.621 12.372 1.00 0.00 H ATOM 10908 HD22 LEU B 342 58.935 38.839 11.249 1.00 0.00 H ATOM 10909 HD23 LEU B 342 59.580 37.179 11.235 1.00 0.00 H ATOM 10910 HD11 LEU B 342 61.508 37.432 14.398 1.00 0.00 H ATOM 10911 HD12 LEU B 342 59.850 36.790 14.310 1.00 0.00 H ATOM 10912 HD13 LEU B 342 61.030 36.386 13.038 1.00 0.00 H ATOM 10913 H LEU B 342 60.729 41.238 11.435 1.00 0.00 H ATOM 10914 N GLY B 343 58.987 41.603 15.491 1.00 19.33 N ATOM 10915 CA GLY B 343 58.406 42.542 16.461 1.00 19.59 C ATOM 10916 C GLY B 343 59.168 43.875 16.540 1.00 25.29 C ATOM 10917 O GLY B 343 58.698 44.822 17.177 1.00 24.04 O ATOM 10918 HA3 GLY B 343 58.419 42.076 17.446 1.00 0.00 H ATOM 10919 HA2 GLY B 343 57.376 42.748 16.171 1.00 0.00 H ATOM 10920 H GLY B 343 59.422 40.715 15.814 1.00 0.00 H ATOM 10921 N ALA B 344 60.369 43.932 15.953 1.00 20.75 N ATOM 10922 CA ALA B 344 61.150 45.187 15.928 1.00 18.91 C ATOM 10923 C ALA B 344 61.026 45.872 14.559 1.00 22.50 C ATOM 10924 O ALA B 344 61.477 46.982 14.378 1.00 22.75 O ATOM 10925 CB ALA B 344 62.659 44.872 16.244 1.00 19.35 C ATOM 10926 HA ALA B 344 60.757 45.865 16.685 1.00 0.00 H ATOM 10927 HB1 ALA B 344 62.735 44.416 17.231 1.00 0.00 H ATOM 10928 HB2 ALA B 344 63.050 44.185 15.494 1.00 0.00 H ATOM 10929 HB3 ALA B 344 63.234 45.798 16.225 1.00 0.00 H ATOM 10930 H ALA B 344 60.760 43.078 15.506 1.00 0.00 H ATOM 10931 N ALA B 345 60.452 45.192 13.564 1.00 20.85 N ATOM 10932 CA ALA B 345 60.365 45.758 12.212 1.00 19.12 C ATOM 10933 C ALA B 345 59.639 47.085 12.175 1.00 24.52 C ATOM 10934 O ALA B 345 60.071 48.007 11.507 1.00 26.00 O ATOM 10935 CB ALA B 345 59.665 44.771 11.241 1.00 18.69 C ATOM 10936 HA ALA B 345 61.393 45.929 11.893 1.00 0.00 H ATOM 10937 HB1 ALA B 345 60.234 43.842 11.196 1.00 0.00 H ATOM 10938 HB2 ALA B 345 58.657 44.564 11.600 1.00 0.00 H ATOM 10939 HB3 ALA B 345 59.614 45.216 10.247 1.00 0.00 H ATOM 10940 H ALA B 345 60.060 44.247 13.749 1.00 0.00 H ATOM 10941 N GLY B 346 58.496 47.178 12.841 1.00 22.12 N ATOM 10942 CA GLY B 346 57.701 48.394 12.817 1.00 21.38 C ATOM 10943 C GLY B 346 58.377 49.544 13.539 1.00 25.21 C ATOM 10944 O GLY B 346 58.129 50.720 13.239 1.00 26.48 O ATOM 10945 HA3 GLY B 346 56.743 48.195 13.296 1.00 0.00 H ATOM 10946 HA2 GLY B 346 57.534 48.682 11.779 1.00 0.00 H ATOM 10947 H GLY B 346 58.161 46.362 13.393 1.00 0.00 H ATOM 10948 N ALA B 347 59.215 49.200 14.511 1.00 21.28 N ATOM 10949 CA ALA B 347 60.002 50.181 15.274 1.00 20.15 C ATOM 10950 C ALA B 347 61.176 50.742 14.416 1.00 25.18 C ATOM 10951 O ALA B 347 61.348 51.962 14.318 1.00 25.88 O ATOM 10952 CB ALA B 347 60.539 49.526 16.592 1.00 20.35 C ATOM 10953 HA ALA B 347 59.355 51.018 15.537 1.00 0.00 H ATOM 10954 HB1 ALA B 347 59.698 49.190 17.198 1.00 0.00 H ATOM 10955 HB2 ALA B 347 61.171 48.674 16.341 1.00 0.00 H ATOM 10956 HB3 ALA B 347 61.120 50.260 17.150 1.00 0.00 H ATOM 10957 H ALA B 347 59.319 48.192 14.743 1.00 0.00 H ATOM 10958 N VAL B 348 62.026 49.884 13.844 1.00 21.40 N ATOM 10959 CA VAL B 348 63.117 50.425 13.014 1.00 20.21 C ATOM 10960 C VAL B 348 62.540 51.135 11.788 1.00 26.28 C ATOM 10961 O VAL B 348 63.070 52.148 11.337 1.00 28.72 O ATOM 10962 CB VAL B 348 64.198 49.399 12.623 1.00 22.49 C ATOM 10963 CG1 VAL B 348 64.849 48.828 13.863 1.00 22.45 C ATOM 10964 CG2 VAL B 348 63.629 48.274 11.738 1.00 23.23 C ATOM 10965 HA VAL B 348 63.644 51.146 13.638 1.00 0.00 H ATOM 10966 HB VAL B 348 64.953 49.920 12.035 1.00 0.00 H ATOM 10967 HG11 VAL B 348 65.311 49.634 14.433 1.00 0.00 H ATOM 10968 HG12 VAL B 348 64.093 48.335 14.475 1.00 0.00 H ATOM 10969 HG13 VAL B 348 65.611 48.105 13.572 1.00 0.00 H ATOM 10970 HG21 VAL B 348 62.841 47.751 12.280 1.00 0.00 H ATOM 10971 HG22 VAL B 348 63.220 48.704 10.824 1.00 0.00 H ATOM 10972 HG23 VAL B 348 64.425 47.574 11.486 1.00 0.00 H ATOM 10973 H VAL B 348 61.920 48.859 13.981 1.00 0.00 H ATOM 10974 N GLU B 349 61.470 50.589 11.231 1.00 22.38 N ATOM 10975 CA GLU B 349 60.848 51.165 10.033 1.00 19.93 C ATOM 10976 C GLU B 349 60.168 52.508 10.262 1.00 26.13 C ATOM 10977 O GLU B 349 60.108 53.337 9.353 1.00 26.76 O ATOM 10978 CB GLU B 349 59.956 50.144 9.348 1.00 21.19 C ATOM 10979 CG GLU B 349 60.809 48.956 8.821 1.00 17.95 C ATOM 10980 CD GLU B 349 59.997 47.714 8.497 1.00 29.33 C ATOM 10981 OE1 GLU B 349 58.773 47.830 8.331 1.00 25.70 O ATOM 10982 OE2 GLU B 349 60.620 46.683 8.193 1.00 28.25 O ATOM 10983 HA GLU B 349 61.659 51.408 9.347 1.00 0.00 H ATOM 10984 HB2 GLU B 349 59.221 49.772 10.061 1.00 0.00 H ATOM 10985 HB3 GLU B 349 59.442 50.618 8.512 1.00 0.00 H ATOM 10986 HG2 GLU B 349 61.323 49.277 7.915 1.00 0.00 H ATOM 10987 HG3 GLU B 349 61.545 48.697 9.582 1.00 0.00 H ATOM 10988 H GLU B 349 61.060 49.731 11.653 1.00 0.00 H ATOM 10989 N SER B 350 59.698 52.742 11.489 1.00 20.82 N ATOM 10990 CA SER B 350 59.142 54.039 11.867 1.00 21.46 C ATOM 10991 C SER B 350 60.328 55.020 11.903 1.00 26.96 C ATOM 10992 O SER B 350 60.200 56.179 11.506 1.00 26.10 O ATOM 10993 CB SER B 350 58.517 53.960 13.271 1.00 22.48 C ATOM 10994 OG SER B 350 57.200 53.414 13.183 1.00 27.69 O ATOM 10995 HA SER B 350 58.369 54.352 11.165 1.00 0.00 H ATOM 10996 HB2 SER B 350 58.467 54.960 13.702 1.00 0.00 H ATOM 10997 HB3 SER B 350 59.132 53.322 13.906 1.00 0.00 H ATOM 10998 HG SER B 350 57.246 52.505 12.793 1.00 0.00 H ATOM 10999 H SER B 350 59.728 51.980 12.196 1.00 0.00 H ATOM 11000 N ILE B 351 61.482 54.555 12.390 1.00 24.05 N ATOM 11001 CA ILE B 351 62.659 55.416 12.397 1.00 23.79 C ATOM 11002 C ILE B 351 62.994 55.818 10.953 1.00 27.89 C ATOM 11003 O ILE B 351 63.267 56.986 10.688 1.00 26.75 O ATOM 11004 CB ILE B 351 63.866 54.781 13.155 1.00 26.74 C ATOM 11005 CG1 ILE B 351 63.489 54.544 14.633 1.00 26.81 C ATOM 11006 CG2 ILE B 351 65.083 55.736 13.122 1.00 26.28 C ATOM 11007 CD1 ILE B 351 64.604 53.907 15.486 1.00 26.00 C ATOM 11008 HA ILE B 351 62.432 56.320 12.962 1.00 0.00 H ATOM 11009 HB ILE B 351 64.116 53.839 12.668 1.00 0.00 H ATOM 11010 HG12 ILE B 351 63.229 55.505 15.076 1.00 0.00 H ATOM 11011 HG13 ILE B 351 62.621 53.886 14.661 1.00 0.00 H ATOM 11012 HD11 ILE B 351 64.870 52.936 15.068 1.00 0.00 H ATOM 11013 HD12 ILE B 351 65.479 54.557 15.483 1.00 0.00 H ATOM 11014 HD13 ILE B 351 64.249 53.778 16.508 1.00 0.00 H ATOM 11015 HG21 ILE B 351 65.370 55.921 12.087 1.00 0.00 H ATOM 11016 HG22 ILE B 351 64.817 56.678 13.601 1.00 0.00 H ATOM 11017 HG23 ILE B 351 65.917 55.279 13.655 1.00 0.00 H ATOM 11018 H ILE B 351 61.541 53.585 12.762 1.00 0.00 H ATOM 11019 N TYR B 352 62.950 54.860 10.021 1.00 25.40 N ATOM 11020 CA TYR B 352 63.286 55.147 8.609 1.00 24.97 C ATOM 11021 C TYR B 352 62.317 56.166 8.062 1.00 27.23 C ATOM 11022 O TYR B 352 62.684 57.064 7.306 1.00 26.64 O ATOM 11023 CB TYR B 352 63.288 53.884 7.711 1.00 22.57 C ATOM 11024 CG TYR B 352 64.177 52.776 8.230 1.00 22.50 C ATOM 11025 CD1 TYR B 352 65.189 53.040 9.163 1.00 23.40 C ATOM 11026 CD2 TYR B 352 63.897 51.438 7.924 1.00 22.46 C ATOM 11027 CE1 TYR B 352 65.968 51.988 9.696 1.00 25.48 C ATOM 11028 CE2 TYR B 352 64.621 50.391 8.517 1.00 21.61 C ATOM 11029 CZ TYR B 352 65.658 50.657 9.366 1.00 27.69 C ATOM 11030 OH TYR B 352 66.373 49.577 9.897 1.00 21.03 O ATOM 11031 HA TYR B 352 64.303 55.538 8.595 1.00 0.00 H ATOM 11032 HB3 TYR B 352 63.634 54.168 6.717 1.00 0.00 H ATOM 11033 HB2 TYR B 352 62.268 53.506 7.645 1.00 0.00 H ATOM 11034 HD2 TYR B 352 63.104 51.206 7.214 1.00 0.00 H ATOM 11035 HE2 TYR B 352 64.353 49.357 8.298 1.00 0.00 H ATOM 11036 HE1 TYR B 352 66.805 52.207 10.359 1.00 0.00 H ATOM 11037 HD1 TYR B 352 65.377 54.066 9.480 1.00 0.00 H ATOM 11038 HH TYR B 352 67.089 49.917 10.490 1.00 0.00 H ATOM 11039 H TYR B 352 62.674 53.895 10.294 1.00 0.00 H ATOM 11040 N SER B 353 61.066 56.006 8.434 1.00 23.49 N ATOM 11041 CA SER B 353 60.003 56.903 7.990 1.00 23.25 C ATOM 11042 C SER B 353 60.193 58.323 8.538 1.00 29.01 C ATOM 11043 O SER B 353 59.777 59.315 7.921 1.00 28.09 O ATOM 11044 CB SER B 353 58.638 56.336 8.438 1.00 24.49 C ATOM 11045 OG SER B 353 58.379 55.066 7.814 1.00 29.47 O ATOM 11046 HA SER B 353 60.039 56.967 6.902 1.00 0.00 H ATOM 11047 HB2 SER B 353 57.851 57.037 8.160 1.00 0.00 H ATOM 11048 HB3 SER B 353 58.643 56.208 9.520 1.00 0.00 H ATOM 11049 HG SER B 353 59.089 54.424 8.067 1.00 0.00 H ATOM 11050 H SER B 353 60.826 55.215 9.065 1.00 0.00 H ATOM 11051 N ILE B 354 60.799 58.417 9.711 1.00 26.51 N ATOM 11052 CA ILE B 354 61.023 59.721 10.334 1.00 25.66 C ATOM 11053 C ILE B 354 62.230 60.380 9.668 1.00 30.19 C ATOM 11054 O ILE B 354 62.184 61.550 9.292 1.00 30.56 O ATOM 11055 CB ILE B 354 61.241 59.592 11.854 1.00 26.83 C ATOM 11056 CG1 ILE B 354 59.919 59.335 12.572 1.00 26.78 C ATOM 11057 CG2 ILE B 354 61.824 60.915 12.437 1.00 24.34 C ATOM 11058 CD1 ILE B 354 60.063 58.526 13.887 1.00 27.66 C ATOM 11059 HA ILE B 354 60.137 60.340 10.192 1.00 0.00 H ATOM 11060 HB ILE B 354 61.930 58.761 12.008 1.00 0.00 H ATOM 11061 HG12 ILE B 354 59.465 60.297 12.809 1.00 0.00 H ATOM 11062 HG13 ILE B 354 59.265 58.782 11.899 1.00 0.00 H ATOM 11063 HD11 ILE B 354 60.505 57.554 13.668 1.00 0.00 H ATOM 11064 HD12 ILE B 354 60.705 59.071 14.579 1.00 0.00 H ATOM 11065 HD13 ILE B 354 59.079 58.386 14.336 1.00 0.00 H ATOM 11066 HG21 ILE B 354 62.779 61.131 11.959 1.00 0.00 H ATOM 11067 HG22 ILE B 354 61.128 61.732 12.247 1.00 0.00 H ATOM 11068 HG23 ILE B 354 61.971 60.804 13.511 1.00 0.00 H ATOM 11069 H ILE B 354 61.119 57.554 10.195 1.00 0.00 H ATOM 11070 N LEU B 355 63.304 59.620 9.503 1.00 27.85 N ATOM 11071 CA LEU B 355 64.531 60.147 8.872 1.00 26.15 C ATOM 11072 C LEU B 355 64.300 60.548 7.414 1.00 31.84 C ATOM 11073 O LEU B 355 64.930 61.480 6.909 1.00 31.74 O ATOM 11074 CB LEU B 355 65.678 59.137 9.001 1.00 24.61 C ATOM 11075 CG LEU B 355 66.109 58.826 10.440 1.00 26.10 C ATOM 11076 CD1 LEU B 355 67.224 57.802 10.480 1.00 26.08 C ATOM 11077 CD2 LEU B 355 66.498 60.070 11.242 1.00 25.06 C ATOM 11078 HA LEU B 355 64.813 61.055 9.405 1.00 0.00 H ATOM 11079 HB2 LEU B 355 65.362 58.205 8.533 1.00 0.00 H ATOM 11080 HB3 LEU B 355 66.541 59.535 8.468 1.00 0.00 H ATOM 11081 HG LEU B 355 65.227 58.404 10.922 1.00 0.00 H ATOM 11082 HD21 LEU B 355 67.333 60.571 10.751 1.00 0.00 H ATOM 11083 HD22 LEU B 355 65.646 60.748 11.295 1.00 0.00 H ATOM 11084 HD23 LEU B 355 66.791 59.774 12.249 1.00 0.00 H ATOM 11085 HD11 LEU B 355 66.883 56.877 10.015 1.00 0.00 H ATOM 11086 HD12 LEU B 355 68.088 58.186 9.937 1.00 0.00 H ATOM 11087 HD13 LEU B 355 67.501 57.609 11.516 1.00 0.00 H ATOM 11088 H LEU B 355 63.282 58.631 9.825 1.00 0.00 H ATOM 11089 N ALA B 356 63.400 59.861 6.723 1.00 27.45 N ATOM 11090 CA ALA B 356 63.102 60.236 5.335 1.00 27.42 C ATOM 11091 C ALA B 356 62.582 61.685 5.299 1.00 32.78 C ATOM 11092 O ALA B 356 62.833 62.436 4.343 1.00 31.33 O ATOM 11093 CB ALA B 356 62.075 59.292 4.714 1.00 27.88 C ATOM 11094 HA ALA B 356 64.019 60.160 4.750 1.00 0.00 H ATOM 11095 HB1 ALA B 356 62.466 58.275 4.723 1.00 0.00 H ATOM 11096 HB2 ALA B 356 61.151 59.332 5.291 1.00 0.00 H ATOM 11097 HB3 ALA B 356 61.877 59.598 3.687 1.00 0.00 H ATOM 11098 H ALA B 356 62.906 59.058 7.163 1.00 0.00 H ATOM 11099 N LEU B 357 61.826 62.057 6.327 1.00 28.64 N ATOM 11100 CA LEU B 357 61.268 63.406 6.442 1.00 28.19 C ATOM 11101 C LEU B 357 62.413 64.379 6.681 1.00 34.13 C ATOM 11102 O LEU B 357 62.488 65.432 6.037 1.00 32.73 O ATOM 11103 CB LEU B 357 60.272 63.506 7.626 1.00 27.32 C ATOM 11104 CG LEU B 357 58.851 62.957 7.371 1.00 30.81 C ATOM 11105 CD1 LEU B 357 57.988 62.959 8.659 1.00 29.15 C ATOM 11106 CD2 LEU B 357 58.124 63.689 6.228 1.00 27.73 C ATOM 11107 HA LEU B 357 60.732 63.643 5.523 1.00 0.00 H ATOM 11108 HB2 LEU B 357 60.696 62.954 8.465 1.00 0.00 H ATOM 11109 HB3 LEU B 357 60.179 64.558 7.894 1.00 0.00 H ATOM 11110 HG LEU B 357 58.986 61.922 7.056 1.00 0.00 H ATOM 11111 HD21 LEU B 357 58.033 64.747 6.475 1.00 0.00 H ATOM 11112 HD22 LEU B 357 58.695 63.578 5.306 1.00 0.00 H ATOM 11113 HD23 LEU B 357 57.131 63.259 6.096 1.00 0.00 H ATOM 11114 HD11 LEU B 357 58.464 62.335 9.415 1.00 0.00 H ATOM 11115 HD12 LEU B 357 57.898 63.979 9.033 1.00 0.00 H ATOM 11116 HD13 LEU B 357 56.998 62.565 8.432 1.00 0.00 H ATOM 11117 H LEU B 357 61.623 61.365 7.077 1.00 0.00 H ATOM 11118 N ARG B 358 63.258 64.063 7.658 1.00 30.56 N ATOM 11119 CA ARG B 358 64.374 64.941 7.983 1.00 30.81 C ATOM 11120 C ARG B 358 65.266 65.191 6.772 1.00 35.26 C ATOM 11121 O ARG B 358 65.638 66.330 6.479 1.00 34.16 O ATOM 11122 CB ARG B 358 65.216 64.355 9.126 1.00 29.52 C ATOM 11123 CG ARG B 358 66.440 65.244 9.507 1.00 32.89 C ATOM 11124 CD ARG B 358 67.444 64.543 10.416 1.00 28.37 C ATOM 11125 NE ARG B 358 68.224 63.519 9.711 1.00 32.01 N ATOM 11126 CZ ARG B 358 69.087 62.687 10.294 1.00 38.30 C ATOM 11127 NH1 ARG B 358 69.290 62.736 11.600 1.00 27.41 N ATOM 11128 NH2 ARG B 358 69.779 61.822 9.565 1.00 25.86 N ATOM 11129 HA ARG B 358 63.948 65.893 8.300 1.00 0.00 H ATOM 11130 HB2 ARG B 358 64.580 64.246 10.004 1.00 0.00 H ATOM 11131 HB3 ARG B 358 65.582 63.375 8.820 1.00 0.00 H ATOM 11132 HG2 ARG B 358 66.951 65.538 8.590 1.00 0.00 H ATOM 11133 HG3 ARG B 358 66.074 66.134 10.019 1.00 0.00 H ATOM 11134 HD2 ARG B 358 66.903 64.068 11.234 1.00 0.00 H ATOM 11135 HD3 ARG B 358 68.130 65.288 10.820 1.00 0.00 H ATOM 11136 HE ARG B 358 68.094 63.437 8.682 1.00 0.00 H ATOM 11137 HH12 ARG B 358 69.965 62.083 12.046 1.00 0.00 H ATOM 11138 HH11 ARG B 358 68.774 63.428 12.181 1.00 0.00 H ATOM 11139 HH22 ARG B 358 70.451 61.175 10.025 1.00 0.00 H ATOM 11140 HH21 ARG B 358 69.650 61.791 8.534 1.00 0.00 H ATOM 11141 H ARG B 358 63.121 63.182 8.194 1.00 0.00 H ATOM 11142 N ASP B 359 65.636 64.113 6.087 1.00 31.12 N ATOM 11143 CA ASP B 359 66.601 64.184 4.998 1.00 29.11 C ATOM 11144 C ASP B 359 66.039 64.355 3.593 1.00 31.46 C ATOM 11145 O ASP B 359 66.808 64.488 2.630 1.00 30.04 O ATOM 11146 CB ASP B 359 67.526 62.967 5.049 1.00 28.35 C ATOM 11147 CG ASP B 359 68.439 62.980 6.266 1.00 34.01 C ATOM 11148 OD1 ASP B 359 68.531 64.011 6.964 1.00 33.18 O ATOM 11149 OD2 ASP B 359 69.120 61.974 6.506 1.00 33.63 O ATOM 11150 HA ASP B 359 67.142 65.113 5.178 1.00 0.00 H ATOM 11151 HB2 ASP B 359 66.916 62.065 5.079 1.00 0.00 H ATOM 11152 HB3 ASP B 359 68.142 62.958 4.150 1.00 0.00 H ATOM 11153 H ASP B 359 65.224 63.191 6.336 1.00 0.00 H ATOM 11154 N GLN B 360 64.718 64.290 3.468 1.00 28.17 N ATOM 11155 CA GLN B 360 64.056 64.374 2.177 1.00 28.22 C ATOM 11156 C GLN B 360 64.692 63.394 1.202 1.00 32.86 C ATOM 11157 O GLN B 360 64.949 63.719 0.042 1.00 29.94 O ATOM 11158 CB GLN B 360 64.075 65.803 1.632 1.00 29.84 C ATOM 11159 CG GLN B 360 63.262 66.801 2.482 1.00 22.06 C ATOM 11160 CD GLN B 360 61.761 66.569 2.432 1.00 36.82 C ATOM 11161 OE1 GLN B 360 61.129 66.726 1.384 1.00 29.99 O ATOM 11162 NE2 GLN B 360 61.171 66.243 3.585 1.00 28.77 N ATOM 11163 HA GLN B 360 63.009 64.099 2.305 1.00 0.00 H ATOM 11164 HB2 GLN B 360 65.110 66.144 1.596 1.00 0.00 H ATOM 11165 HB3 GLN B 360 63.662 65.793 0.623 1.00 0.00 H ATOM 11166 HG2 GLN B 360 63.589 66.716 3.518 1.00 0.00 H ATOM 11167 HG3 GLN B 360 63.467 67.808 2.119 1.00 0.00 H ATOM 11168 HE22 GLN B 360 61.743 66.120 4.445 1.00 0.00 H ATOM 11169 HE21 GLN B 360 60.140 66.112 3.623 1.00 0.00 H ATOM 11170 H GLN B 360 64.138 64.175 4.323 1.00 0.00 H ATOM 11171 N ALA B 361 64.913 62.169 1.695 1.00 28.58 N ATOM 11172 CA ALA B 361 65.557 61.102 0.943 1.00 28.43 C ATOM 11173 C ALA B 361 64.847 59.791 1.293 1.00 32.05 C ATOM 11174 O ALA B 361 64.550 59.533 2.460 1.00 28.77 O ATOM 11175 CB ALA B 361 67.005 61.018 1.340 1.00 29.34 C ATOM 11176 HA ALA B 361 65.497 61.292 -0.129 1.00 0.00 H ATOM 11177 HB1 ALA B 361 67.496 61.966 1.122 1.00 0.00 H ATOM 11178 HB2 ALA B 361 67.076 60.807 2.407 1.00 0.00 H ATOM 11179 HB3 ALA B 361 67.489 60.219 0.778 1.00 0.00 H ATOM 11180 H ALA B 361 64.608 61.969 2.669 1.00 0.00 H ATOM 11181 N VAL B 362 64.593 58.974 0.277 1.00 29.55 N ATOM 11182 CA VAL B 362 63.831 57.731 0.442 1.00 30.23 C ATOM 11183 C VAL B 362 64.672 56.533 0.018 1.00 35.19 C ATOM 11184 O VAL B 362 65.196 56.509 -1.100 1.00 36.75 O ATOM 11185 CB VAL B 362 62.546 57.867 -0.373 1.00 33.39 C ATOM 11186 CG1 VAL B 362 61.932 56.557 -0.674 1.00 34.00 C ATOM 11187 CG2 VAL B 362 61.582 58.832 0.311 1.00 32.56 C ATOM 11188 HA VAL B 362 63.571 57.561 1.487 1.00 0.00 H ATOM 11189 HB VAL B 362 62.803 58.294 -1.342 1.00 0.00 H ATOM 11190 HG11 VAL B 362 62.634 55.951 -1.247 1.00 0.00 H ATOM 11191 HG12 VAL B 362 61.689 56.048 0.259 1.00 0.00 H ATOM 11192 HG13 VAL B 362 61.022 56.708 -1.255 1.00 0.00 H ATOM 11193 HG21 VAL B 362 61.335 58.455 1.303 1.00 0.00 H ATOM 11194 HG22 VAL B 362 62.052 59.811 0.400 1.00 0.00 H ATOM 11195 HG23 VAL B 362 60.672 58.917 -0.283 1.00 0.00 H ATOM 11196 H VAL B 362 64.947 59.224 -0.669 1.00 0.00 H ATOM 11197 N PRO B 363 64.897 55.571 0.941 1.00 28.94 N ATOM 11198 CA PRO B 363 65.707 54.376 0.706 1.00 26.57 C ATOM 11199 C PRO B 363 65.022 53.457 -0.302 1.00 27.15 C ATOM 11200 O PRO B 363 63.801 53.466 -0.455 1.00 26.78 O ATOM 11201 CB PRO B 363 65.786 53.733 2.105 1.00 29.06 C ATOM 11202 CG PRO B 363 64.479 54.093 2.739 1.00 33.39 C ATOM 11203 CD PRO B 363 64.041 55.428 2.142 1.00 30.48 C ATOM 11204 HA PRO B 363 66.690 54.585 0.285 1.00 0.00 H ATOM 11205 HD3 PRO B 363 62.986 55.405 1.868 1.00 0.00 H ATOM 11206 HD2 PRO B 363 64.215 56.244 2.843 1.00 0.00 H ATOM 11207 HG3 PRO B 363 64.600 54.188 3.818 1.00 0.00 H ATOM 11208 HG2 PRO B 363 63.735 53.325 2.524 1.00 0.00 H ATOM 11209 HB2 PRO B 363 65.896 52.651 2.030 1.00 0.00 H ATOM 11210 HB3 PRO B 363 66.620 54.143 2.674 1.00 0.00 H ATOM 11211 N PRO B 364 65.814 52.695 -1.052 1.00 24.77 N ATOM 11212 CA PRO B 364 65.284 51.862 -2.143 1.00 26.48 C ATOM 11213 C PRO B 364 64.787 50.493 -1.730 1.00 31.88 C ATOM 11214 O PRO B 364 65.206 49.965 -0.704 1.00 30.58 O ATOM 11215 CB PRO B 364 66.532 51.625 -2.999 1.00 27.31 C ATOM 11216 CG PRO B 364 67.636 51.513 -1.966 1.00 30.35 C ATOM 11217 CD PRO B 364 67.288 52.626 -0.972 1.00 25.98 C ATOM 11218 HA PRO B 364 64.430 52.359 -2.603 1.00 0.00 H ATOM 11219 HD3 PRO B 364 67.614 52.368 0.035 1.00 0.00 H ATOM 11220 HD2 PRO B 364 67.741 53.572 -1.268 1.00 0.00 H ATOM 11221 HG3 PRO B 364 68.614 51.681 -2.417 1.00 0.00 H ATOM 11222 HG2 PRO B 364 67.623 50.536 -1.482 1.00 0.00 H ATOM 11223 HB2 PRO B 364 66.442 50.706 -3.578 1.00 0.00 H ATOM 11224 HB3 PRO B 364 66.710 52.462 -3.674 1.00 0.00 H ATOM 11225 N THR B 365 63.995 49.872 -2.604 1.00 29.03 N ATOM 11226 CA THR B 365 63.695 48.454 -2.474 1.00 27.92 C ATOM 11227 C THR B 365 64.788 47.856 -3.372 1.00 32.88 C ATOM 11228 O THR B 365 64.687 47.978 -4.606 1.00 31.63 O ATOM 11229 CB THR B 365 62.327 48.062 -3.074 1.00 28.13 C ATOM 11230 OG1 THR B 365 61.278 48.786 -2.434 1.00 26.01 O ATOM 11231 CG2 THR B 365 62.077 46.564 -2.867 1.00 24.13 C ATOM 11232 HA THR B 365 63.664 48.130 -1.434 1.00 0.00 H ATOM 11233 HB THR B 365 62.341 48.298 -4.138 1.00 0.00 H ATOM 11234 HG1 THR B 365 61.422 49.757 -2.564 1.00 0.00 H ATOM 11235 HG23 THR B 365 62.871 45.994 -3.350 1.00 0.00 H ATOM 11236 HG21 THR B 365 62.067 46.343 -1.800 1.00 0.00 H ATOM 11237 HG22 THR B 365 61.116 46.294 -3.304 1.00 0.00 H ATOM 11238 H THR B 365 63.584 50.411 -3.393 1.00 0.00 H ATOM 11239 N ILE B 366 65.850 47.278 -2.795 1.00 28.31 N ATOM 11240 CA ILE B 366 66.895 46.673 -3.642 1.00 27.74 C ATOM 11241 C ILE B 366 66.418 45.312 -4.158 1.00 33.00 C ATOM 11242 O ILE B 366 65.423 44.778 -3.654 1.00 29.37 O ATOM 11243 CB ILE B 366 68.267 46.563 -2.920 1.00 29.83 C ATOM 11244 CG1 ILE B 366 68.249 45.467 -1.847 1.00 27.64 C ATOM 11245 CG2 ILE B 366 68.656 47.927 -2.318 1.00 31.25 C ATOM 11246 CD1 ILE B 366 69.656 45.178 -1.178 1.00 29.94 C ATOM 11247 HA ILE B 366 67.061 47.337 -4.490 1.00 0.00 H ATOM 11248 HB ILE B 366 69.021 46.279 -3.655 1.00 0.00 H ATOM 11249 HG12 ILE B 366 67.555 45.769 -1.063 1.00 0.00 H ATOM 11250 HG13 ILE B 366 67.895 44.545 -2.308 1.00 0.00 H ATOM 11251 HD11 ILE B 366 70.363 44.860 -1.944 1.00 0.00 H ATOM 11252 HD12 ILE B 366 70.022 46.086 -0.698 1.00 0.00 H ATOM 11253 HD13 ILE B 366 69.548 44.390 -0.433 1.00 0.00 H ATOM 11254 HG21 ILE B 366 68.728 48.667 -3.115 1.00 0.00 H ATOM 11255 HG22 ILE B 366 67.896 48.236 -1.600 1.00 0.00 H ATOM 11256 HG23 ILE B 366 69.619 47.839 -1.814 1.00 0.00 H ATOM 11257 H ILE B 366 65.937 47.256 -1.759 1.00 0.00 H ATOM 11258 N ASN B 367 67.116 44.769 -5.167 1.00 29.36 N ATOM 11259 CA ASN B 367 66.791 43.454 -5.734 1.00 28.26 C ATOM 11260 C ASN B 367 65.518 43.376 -6.552 1.00 28.70 C ATOM 11261 O ASN B 367 65.110 42.286 -6.960 1.00 30.69 O ATOM 11262 CB ASN B 367 66.736 42.381 -4.643 1.00 29.06 C ATOM 11263 CG ASN B 367 68.051 42.176 -3.979 1.00 39.13 C ATOM 11264 OD1 ASN B 367 69.101 42.294 -4.612 1.00 31.46 O ATOM 11265 ND2 ASN B 367 68.020 41.906 -2.679 1.00 28.54 N ATOM 11266 HA ASN B 367 67.609 43.275 -6.432 1.00 0.00 H ATOM 11267 HB2 ASN B 367 66.008 42.684 -3.891 1.00 0.00 H ATOM 11268 HB3 ASN B 367 66.421 41.440 -5.094 1.00 0.00 H ATOM 11269 HD22 ASN B 367 67.108 41.816 -2.188 1.00 0.00 H ATOM 11270 HD21 ASN B 367 68.908 41.785 -2.152 1.00 0.00 H ATOM 11271 H ASN B 367 67.918 45.300 -5.563 1.00 0.00 H ATOM 11272 N LEU B 368 64.877 44.508 -6.777 1.00 25.30 N ATOM 11273 CA LEU B 368 63.651 44.544 -7.555 1.00 25.96 C ATOM 11274 C LEU B 368 63.986 44.510 -9.058 1.00 36.28 C ATOM 11275 O LEU B 368 63.692 45.444 -9.805 1.00 35.60 O ATOM 11276 CB LEU B 368 62.901 45.823 -7.230 1.00 25.75 C ATOM 11277 CG LEU B 368 61.450 45.813 -7.711 1.00 30.09 C ATOM 11278 CD1 LEU B 368 60.913 44.410 -7.904 1.00 29.19 C ATOM 11279 CD2 LEU B 368 60.518 46.651 -6.860 1.00 31.07 C ATOM 11280 HA LEU B 368 63.034 43.679 -7.309 1.00 0.00 H ATOM 11281 HB2 LEU B 368 62.906 45.962 -6.149 1.00 0.00 H ATOM 11282 HB3 LEU B 368 63.417 46.657 -7.705 1.00 0.00 H ATOM 11283 HG LEU B 368 61.477 46.292 -8.690 1.00 0.00 H ATOM 11284 HD21 LEU B 368 60.523 46.273 -5.838 1.00 0.00 H ATOM 11285 HD22 LEU B 368 60.855 47.688 -6.867 1.00 0.00 H ATOM 11286 HD23 LEU B 368 59.508 46.593 -7.265 1.00 0.00 H ATOM 11287 HD11 LEU B 368 61.517 43.890 -8.647 1.00 0.00 H ATOM 11288 HD12 LEU B 368 60.957 43.872 -6.957 1.00 0.00 H ATOM 11289 HD13 LEU B 368 59.879 44.462 -8.246 1.00 0.00 H ATOM 11290 H LEU B 368 65.259 45.394 -6.388 1.00 0.00 H ATOM 11291 N ASP B 369 64.600 43.419 -9.486 1.00 36.14 N ATOM 11292 CA ASP B 369 65.037 43.263 -10.867 1.00 36.69 C ATOM 11293 C ASP B 369 63.914 43.120 -11.881 1.00 43.45 C ATOM 11294 O ASP B 369 63.949 43.759 -12.930 1.00 44.06 O ATOM 11295 CB ASP B 369 65.994 42.087 -10.957 1.00 36.65 C ATOM 11296 CG ASP B 369 67.174 42.258 -10.054 1.00 43.43 C ATOM 11297 OD1 ASP B 369 67.729 43.382 -10.027 1.00 42.29 O ATOM 11298 OD2 ASP B 369 67.539 41.297 -9.346 1.00 46.86 O ATOM 11299 HA ASP B 369 65.537 44.193 -11.138 1.00 0.00 H ATOM 11300 HB2 ASP B 369 65.463 41.178 -10.675 1.00 0.00 H ATOM 11301 HB3 ASP B 369 66.346 41.997 -11.985 1.00 0.00 H ATOM 11302 H ASP B 369 64.777 42.646 -8.813 1.00 0.00 H ATOM 11303 N ASN B 370 62.931 42.275 -11.566 1.00 39.09 N ATOM 11304 CA ASN B 370 61.809 41.989 -12.458 1.00 38.15 C ATOM 11305 C ASN B 370 60.481 42.002 -11.675 1.00 42.48 C ATOM 11306 O ASN B 370 59.959 40.953 -11.283 1.00 43.41 O ATOM 11307 CB ASN B 370 62.018 40.606 -13.124 1.00 35.33 C ATOM 11308 CG ASN B 370 63.254 40.561 -14.015 1.00 51.02 C ATOM 11309 OD1 ASN B 370 63.285 41.198 -15.065 1.00 43.66 O ATOM 11310 ND2 ASN B 370 64.284 39.815 -13.593 1.00 34.73 N ATOM 11311 HA ASN B 370 61.763 42.759 -13.228 1.00 0.00 H ATOM 11312 HB2 ASN B 370 62.125 39.855 -12.342 1.00 0.00 H ATOM 11313 HB3 ASN B 370 61.142 40.375 -13.731 1.00 0.00 H ATOM 11314 HD22 ASN B 370 64.214 39.292 -12.697 1.00 0.00 H ATOM 11315 HD21 ASN B 370 65.153 39.759 -14.162 1.00 0.00 H ATOM 11316 H ASN B 370 62.965 41.797 -10.643 1.00 0.00 H ATOM 11317 N PRO B 371 59.902 43.191 -11.475 1.00 38.22 N ATOM 11318 CA PRO B 371 58.667 43.416 -10.713 1.00 37.88 C ATOM 11319 C PRO B 371 57.503 42.606 -11.236 1.00 43.99 C ATOM 11320 O PRO B 371 57.443 42.325 -12.434 1.00 44.07 O ATOM 11321 CB PRO B 371 58.367 44.898 -10.947 1.00 39.61 C ATOM 11322 CG PRO B 371 59.612 45.474 -11.553 1.00 43.98 C ATOM 11323 CD PRO B 371 60.317 44.377 -12.244 1.00 39.52 C ATOM 11324 HA PRO B 371 58.795 43.129 -9.669 1.00 0.00 H ATOM 11325 HD3 PRO B 371 60.002 44.301 -13.285 1.00 0.00 H ATOM 11326 HD2 PRO B 371 61.397 44.515 -12.202 1.00 0.00 H ATOM 11327 HG3 PRO B 371 60.248 45.892 -10.772 1.00 0.00 H ATOM 11328 HG2 PRO B 371 59.352 46.257 -12.266 1.00 0.00 H ATOM 11329 HB2 PRO B 371 57.524 45.012 -11.629 1.00 0.00 H ATOM 11330 HB3 PRO B 371 58.139 45.393 -10.003 1.00 0.00 H ATOM 11331 N ASP B 372 56.577 42.252 -10.342 1.00 38.67 N ATOM 11332 CA ASP B 372 55.354 41.563 -10.727 1.00 38.74 C ATOM 11333 C ASP B 372 54.740 42.376 -11.878 1.00 45.31 C ATOM 11334 O ASP B 372 54.871 43.599 -11.924 1.00 40.94 O ATOM 11335 CB ASP B 372 54.348 41.593 -9.571 1.00 39.46 C ATOM 11336 CG ASP B 372 54.607 40.522 -8.521 1.00 39.22 C ATOM 11337 OD1 ASP B 372 55.605 39.765 -8.639 1.00 33.79 O ATOM 11338 OD2 ASP B 372 53.760 40.413 -7.603 1.00 38.30 O ATOM 11339 HA ASP B 372 55.572 40.530 -11.000 1.00 0.00 H ATOM 11340 HB2 ASP B 372 54.402 42.570 -9.090 1.00 0.00 H ATOM 11341 HB3 ASP B 372 53.348 41.444 -9.978 1.00 0.00 H ATOM 11342 H ASP B 372 56.734 42.476 -9.339 1.00 0.00 H ATOM 11343 N GLU B 373 54.037 41.705 -12.780 1.00 48.36 N ATOM 11344 CA GLU B 373 53.456 42.386 -13.935 1.00 51.37 C ATOM 11345 C GLU B 373 52.591 43.623 -13.676 1.00 63.35 C ATOM 11346 O GLU B 373 53.122 44.731 -13.481 1.00 66.60 O ATOM 11347 CB GLU B 373 52.802 41.396 -14.902 1.00 52.65 C ATOM 11348 CG GLU B 373 53.811 40.668 -15.774 1.00 60.04 C ATOM 11349 CD GLU B 373 54.805 41.619 -16.402 1.00 80.21 C ATOM 11350 OE1 GLU B 373 55.996 41.254 -16.513 1.00 63.48 O ATOM 11351 OE2 GLU B 373 54.395 42.748 -16.764 1.00 81.93 O ATOM 11352 HA GLU B 373 54.327 42.833 -14.415 1.00 0.00 H ATOM 11353 HB2 GLU B 373 52.246 40.659 -14.323 1.00 0.00 H ATOM 11354 HB3 GLU B 373 52.114 41.942 -15.547 1.00 0.00 H ATOM 11355 HG2 GLU B 373 54.352 39.947 -15.161 1.00 0.00 H ATOM 11356 HG3 GLU B 373 53.278 40.142 -16.566 1.00 0.00 H ATOM 11357 H GLU B 373 53.897 40.681 -12.664 1.00 0.00 H ATOM 11358 N GLY B 374 51.275 43.439 -13.678 1.00 61.62 N ATOM 11359 CA GLY B 374 50.288 44.503 -13.530 1.00 62.78 C ATOM 11360 C GLY B 374 50.487 45.608 -12.502 1.00 70.96 C ATOM 11361 O GLY B 374 49.559 46.379 -12.254 1.00 70.53 O ATOM 11362 HA3 GLY B 374 49.342 44.019 -13.289 1.00 0.00 H ATOM 11363 HA2 GLY B 374 50.208 44.991 -14.501 1.00 0.00 H ATOM 11364 H GLY B 374 50.924 42.467 -13.793 1.00 0.00 H ATOM 11365 N CYS B 375 51.685 45.691 -11.923 1.00 71.28 N ATOM 11366 CA CYS B 375 52.039 46.700 -10.908 1.00 72.50 C ATOM 11367 C CYS B 375 52.289 48.069 -11.552 1.00 68.52 C ATOM 11368 O CYS B 375 53.153 48.201 -12.405 1.00 68.82 O ATOM 11369 CB CYS B 375 53.335 46.285 -10.165 1.00 75.41 C ATOM 11370 SG CYS B 375 53.183 45.367 -8.573 1.00 80.92 S ATOM 11371 HA CYS B 375 51.201 46.765 -10.213 1.00 0.00 H ATOM 11372 HB2 CYS B 375 53.894 47.198 -9.958 1.00 0.00 H ATOM 11373 HB3 CYS B 375 53.909 45.656 -10.846 1.00 0.00 H ATOM 11374 HG CYS B 375 52.487 46.138 -7.664 1.00 0.00 H ATOM 11375 H CYS B 375 52.413 45.003 -12.204 1.00 0.00 H ATOM 11376 N ASP B 376 51.580 49.084 -11.082 1.00 59.04 N ATOM 11377 CA ASP B 376 51.703 50.445 -11.582 1.00 57.11 C ATOM 11378 C ASP B 376 52.499 51.337 -10.612 1.00 54.36 C ATOM 11379 O ASP B 376 52.919 52.444 -10.965 1.00 53.36 O ATOM 11380 CB ASP B 376 50.281 51.001 -11.776 1.00 60.30 C ATOM 11381 CG ASP B 376 50.231 52.515 -11.852 1.00 80.11 C ATOM 11382 OD1 ASP B 376 50.883 53.084 -12.754 1.00 84.16 O ATOM 11383 OD2 ASP B 376 49.450 53.126 -11.084 1.00 87.14 O ATOM 11384 HA ASP B 376 52.250 50.439 -12.525 1.00 0.00 H ATOM 11385 HB2 ASP B 376 49.874 50.595 -12.702 1.00 0.00 H ATOM 11386 HB3 ASP B 376 49.665 50.676 -10.937 1.00 0.00 H ATOM 11387 H ASP B 376 50.901 48.899 -10.317 1.00 0.00 H ATOM 11388 N LEU B 377 52.704 50.848 -9.387 1.00 45.04 N ATOM 11389 CA LEU B 377 53.386 51.608 -8.319 1.00 40.77 C ATOM 11390 C LEU B 377 54.884 51.876 -8.458 1.00 39.17 C ATOM 11391 O LEU B 377 55.640 51.071 -9.015 1.00 39.46 O ATOM 11392 CB LEU B 377 53.118 50.951 -6.946 1.00 39.64 C ATOM 11393 CG LEU B 377 51.668 50.540 -6.636 1.00 41.87 C ATOM 11394 CD1 LEU B 377 51.579 49.767 -5.314 1.00 39.60 C ATOM 11395 CD2 LEU B 377 50.788 51.783 -6.600 1.00 44.80 C ATOM 11396 HA LEU B 377 52.939 52.597 -8.416 1.00 0.00 H ATOM 11397 HB2 LEU B 377 53.734 50.054 -6.885 1.00 0.00 H ATOM 11398 HB3 LEU B 377 53.431 51.657 -6.177 1.00 0.00 H ATOM 11399 HG LEU B 377 51.315 49.874 -7.423 1.00 0.00 H ATOM 11400 HD21 LEU B 377 51.149 52.460 -5.826 1.00 0.00 H ATOM 11401 HD22 LEU B 377 50.827 52.282 -7.568 1.00 0.00 H ATOM 11402 HD23 LEU B 377 49.760 51.493 -6.380 1.00 0.00 H ATOM 11403 HD11 LEU B 377 52.189 48.866 -5.380 1.00 0.00 H ATOM 11404 HD12 LEU B 377 51.943 50.396 -4.502 1.00 0.00 H ATOM 11405 HD13 LEU B 377 50.541 49.492 -5.125 1.00 0.00 H ATOM 11406 H LEU B 377 52.368 49.887 -9.174 1.00 0.00 H ATOM 11407 N ASP B 378 55.326 52.955 -7.825 1.00 32.26 N ATOM 11408 CA ASP B 378 56.740 53.311 -7.790 1.00 31.83 C ATOM 11409 C ASP B 378 57.348 52.769 -6.492 1.00 33.40 C ATOM 11410 O ASP B 378 57.240 53.396 -5.446 1.00 32.28 O ATOM 11411 CB ASP B 378 56.899 54.849 -7.821 1.00 33.45 C ATOM 11412 CG ASP B 378 58.348 55.289 -7.991 1.00 38.37 C ATOM 11413 OD1 ASP B 378 59.251 54.439 -7.846 1.00 36.35 O ATOM 11414 OD2 ASP B 378 58.587 56.503 -8.223 1.00 41.71 O ATOM 11415 HA ASP B 378 57.246 52.883 -8.655 1.00 0.00 H ATOM 11416 HB2 ASP B 378 56.315 55.243 -8.653 1.00 0.00 H ATOM 11417 HB3 ASP B 378 56.518 55.258 -6.885 1.00 0.00 H ATOM 11418 H ASP B 378 54.641 53.567 -7.337 1.00 0.00 H ATOM 11419 N PHE B 379 57.969 51.601 -6.583 1.00 30.90 N ATOM 11420 CA PHE B 379 58.594 50.910 -5.449 1.00 30.06 C ATOM 11421 C PHE B 379 60.022 51.339 -5.178 1.00 33.59 C ATOM 11422 O PHE B 379 60.748 50.660 -4.448 1.00 30.62 O ATOM 11423 CB PHE B 379 58.581 49.410 -5.687 1.00 30.94 C ATOM 11424 CG PHE B 379 57.202 48.812 -5.713 1.00 32.77 C ATOM 11425 CD1 PHE B 379 56.429 48.769 -4.566 1.00 35.73 C ATOM 11426 CD2 PHE B 379 56.694 48.262 -6.885 1.00 35.06 C ATOM 11427 CE1 PHE B 379 55.148 48.269 -4.591 1.00 37.47 C ATOM 11428 CE2 PHE B 379 55.436 47.672 -6.910 1.00 38.20 C ATOM 11429 CZ PHE B 379 54.653 47.669 -5.765 1.00 36.74 C ATOM 11430 HA PHE B 379 58.002 51.182 -4.575 1.00 0.00 H ATOM 11431 HB2 PHE B 379 59.061 49.209 -6.645 1.00 0.00 H ATOM 11432 HB3 PHE B 379 59.149 48.930 -4.890 1.00 0.00 H ATOM 11433 HD2 PHE B 379 57.291 48.294 -7.797 1.00 0.00 H ATOM 11434 HE2 PHE B 379 55.066 47.213 -7.827 1.00 0.00 H ATOM 11435 HZ PHE B 379 53.666 47.207 -5.774 1.00 0.00 H ATOM 11436 HE1 PHE B 379 54.518 48.337 -3.704 1.00 0.00 H ATOM 11437 HD1 PHE B 379 56.842 49.138 -3.627 1.00 0.00 H ATOM 11438 H PHE B 379 58.016 51.146 -7.517 1.00 0.00 H ATOM 11439 N VAL B 380 60.424 52.487 -5.733 1.00 31.62 N ATOM 11440 CA VAL B 380 61.797 53.007 -5.536 1.00 29.58 C ATOM 11441 C VAL B 380 62.849 51.936 -5.751 1.00 33.09 C ATOM 11442 O VAL B 380 63.731 51.755 -4.924 1.00 34.58 O ATOM 11443 CB VAL B 380 61.945 53.674 -4.142 1.00 31.86 C ATOM 11444 CG1 VAL B 380 63.230 54.502 -4.074 1.00 31.67 C ATOM 11445 CG2 VAL B 380 60.719 54.558 -3.854 1.00 30.17 C ATOM 11446 HA VAL B 380 61.965 53.771 -6.295 1.00 0.00 H ATOM 11447 HB VAL B 380 62.005 52.893 -3.384 1.00 0.00 H ATOM 11448 HG11 VAL B 380 64.088 53.853 -4.248 1.00 0.00 H ATOM 11449 HG12 VAL B 380 63.200 55.280 -4.837 1.00 0.00 H ATOM 11450 HG13 VAL B 380 63.314 54.960 -3.089 1.00 0.00 H ATOM 11451 HG21 VAL B 380 60.643 55.332 -4.618 1.00 0.00 H ATOM 11452 HG22 VAL B 380 59.819 53.944 -3.866 1.00 0.00 H ATOM 11453 HG23 VAL B 380 60.830 55.023 -2.874 1.00 0.00 H ATOM 11454 H VAL B 380 59.756 53.029 -6.318 1.00 0.00 H ATOM 11455 N PRO B 381 62.782 51.217 -6.884 1.00 31.74 N ATOM 11456 CA PRO B 381 63.750 50.132 -7.103 1.00 31.74 C ATOM 11457 C PRO B 381 65.219 50.548 -7.181 1.00 35.85 C ATOM 11458 O PRO B 381 65.562 51.582 -7.741 1.00 36.95 O ATOM 11459 CB PRO B 381 63.313 49.547 -8.444 1.00 33.51 C ATOM 11460 CG PRO B 381 62.672 50.736 -9.156 1.00 38.03 C ATOM 11461 CD PRO B 381 61.937 51.455 -8.072 1.00 32.94 C ATOM 11462 HA PRO B 381 63.732 49.449 -6.253 1.00 0.00 H ATOM 11463 HD3 PRO B 381 61.859 52.520 -8.291 1.00 0.00 H ATOM 11464 HD2 PRO B 381 60.939 51.040 -7.933 1.00 0.00 H ATOM 11465 HG3 PRO B 381 61.985 50.399 -9.932 1.00 0.00 H ATOM 11466 HG2 PRO B 381 63.433 51.378 -9.600 1.00 0.00 H ATOM 11467 HB2 PRO B 381 64.170 49.172 -9.004 1.00 0.00 H ATOM 11468 HB3 PRO B 381 62.592 48.742 -8.302 1.00 0.00 H ATOM 11469 N HIS B 382 66.078 49.719 -6.601 1.00 30.50 N ATOM 11470 CA HIS B 382 67.509 49.869 -6.734 1.00 30.38 C ATOM 11471 C HIS B 382 68.271 50.977 -6.027 1.00 33.10 C ATOM 11472 O HIS B 382 69.253 50.709 -5.364 1.00 32.72 O ATOM 11473 CB HIS B 382 67.856 49.859 -8.229 1.00 30.20 C ATOM 11474 CG HIS B 382 67.304 48.682 -8.952 1.00 33.60 C ATOM 11475 ND1 HIS B 382 67.566 47.389 -8.559 1.00 35.51 N ATOM 11476 CD2 HIS B 382 66.499 48.596 -10.037 1.00 34.53 C ATOM 11477 CE1 HIS B 382 66.961 46.554 -9.391 1.00 34.96 C ATOM 11478 NE2 HIS B 382 66.310 47.263 -10.295 1.00 34.55 N ATOM 11479 HA HIS B 382 67.871 49.016 -6.160 1.00 0.00 H ATOM 11480 HB2 HIS B 382 67.455 50.765 -8.684 1.00 0.00 H ATOM 11481 HB3 HIS B 382 68.941 49.852 -8.333 1.00 0.00 H ATOM 11482 HD2 HIS B 382 66.080 49.430 -10.600 1.00 0.00 H ATOM 11483 HE1 HIS B 382 66.995 45.466 -9.338 1.00 0.00 H ATOM 11484 H HIS B 382 65.708 48.933 -6.030 1.00 0.00 H ATOM 11485 N GLU B 383 67.864 52.218 -6.257 1.00 33.79 N ATOM 11486 CA GLU B 383 68.573 53.408 -5.754 1.00 32.69 C ATOM 11487 C GLU B 383 67.675 54.310 -4.921 1.00 32.49 C ATOM 11488 O GLU B 383 66.513 54.483 -5.254 1.00 31.66 O ATOM 11489 CB GLU B 383 69.011 54.271 -6.977 1.00 34.25 C ATOM 11490 CG GLU B 383 70.020 53.637 -7.848 1.00 40.39 C ATOM 11491 CD GLU B 383 71.358 53.568 -7.173 1.00 55.48 C ATOM 11492 OE1 GLU B 383 71.745 54.564 -6.509 1.00 51.23 O ATOM 11493 OE2 GLU B 383 72.001 52.504 -7.278 1.00 56.47 O ATOM 11494 HA GLU B 383 69.405 53.052 -5.146 1.00 0.00 H ATOM 11495 HB2 GLU B 383 68.127 54.482 -7.579 1.00 0.00 H ATOM 11496 HB3 GLU B 383 69.425 55.207 -6.602 1.00 0.00 H ATOM 11497 HG2 GLU B 383 69.693 52.626 -8.093 1.00 0.00 H ATOM 11498 HG3 GLU B 383 70.114 54.219 -8.765 1.00 0.00 H ATOM 11499 H GLU B 383 67.001 52.358 -6.821 1.00 0.00 H ATOM 11500 N ALA B 384 68.249 54.950 -3.899 1.00 29.30 N ATOM 11501 CA ALA B 384 67.525 55.920 -3.077 1.00 28.45 C ATOM 11502 C ALA B 384 67.019 57.026 -3.976 1.00 35.10 C ATOM 11503 O ALA B 384 67.578 57.252 -5.054 1.00 33.70 O ATOM 11504 CB ALA B 384 68.464 56.523 -2.020 1.00 28.85 C ATOM 11505 HA ALA B 384 66.695 55.424 -2.573 1.00 0.00 H ATOM 11506 HB1 ALA B 384 68.848 55.728 -1.381 1.00 0.00 H ATOM 11507 HB2 ALA B 384 69.295 57.024 -2.517 1.00 0.00 H ATOM 11508 HB3 ALA B 384 67.913 57.243 -1.415 1.00 0.00 H ATOM 11509 H ALA B 384 69.246 54.752 -3.680 1.00 0.00 H ATOM 11510 N ARG B 385 65.997 57.740 -3.508 1.00 32.40 N ATOM 11511 CA ARG B 385 65.365 58.800 -4.273 1.00 32.40 C ATOM 11512 C ARG B 385 65.352 60.127 -3.489 1.00 38.62 C ATOM 11513 O ARG B 385 65.090 60.157 -2.292 1.00 36.25 O ATOM 11514 CB ARG B 385 63.938 58.365 -4.622 1.00 32.68 C ATOM 11515 CG ARG B 385 63.159 59.245 -5.622 1.00 35.33 C ATOM 11516 CD ARG B 385 63.422 58.850 -7.074 1.00 40.95 C ATOM 11517 NE ARG B 385 63.229 57.435 -7.381 1.00 43.33 N ATOM 11518 CZ ARG B 385 62.052 56.889 -7.658 1.00 53.09 C ATOM 11519 NH1 ARG B 385 60.955 57.633 -7.604 1.00 42.24 N ATOM 11520 NH2 ARG B 385 61.968 55.595 -7.974 1.00 45.79 N ATOM 11521 HA ARG B 385 65.935 58.973 -5.186 1.00 0.00 H ATOM 11522 HB2 ARG B 385 63.994 57.361 -5.042 1.00 0.00 H ATOM 11523 HB3 ARG B 385 63.367 58.338 -3.694 1.00 0.00 H ATOM 11524 HG2 ARG B 385 62.093 59.145 -5.420 1.00 0.00 H ATOM 11525 HG3 ARG B 385 63.459 60.284 -5.482 1.00 0.00 H ATOM 11526 HD2 ARG B 385 64.454 59.109 -7.312 1.00 0.00 H ATOM 11527 HD3 ARG B 385 62.749 59.427 -7.708 1.00 0.00 H ATOM 11528 HE ARG B 385 64.066 56.817 -7.383 1.00 0.00 H ATOM 11529 HH12 ARG B 385 60.029 57.211 -7.820 1.00 0.00 H ATOM 11530 HH11 ARG B 385 61.021 58.638 -7.346 1.00 0.00 H ATOM 11531 HH22 ARG B 385 61.043 55.172 -8.190 1.00 0.00 H ATOM 11532 HH21 ARG B 385 62.827 55.010 -8.004 1.00 0.00 H ATOM 11533 H ARG B 385 65.637 57.530 -2.555 1.00 0.00 H ATOM 11534 N GLN B 386 65.668 61.224 -4.173 1.00 35.47 N ATOM 11535 CA GLN B 386 65.628 62.558 -3.566 1.00 33.89 C ATOM 11536 C GLN B 386 64.176 63.012 -3.643 1.00 37.47 C ATOM 11537 O GLN B 386 63.551 62.847 -4.682 1.00 39.45 O ATOM 11538 CB GLN B 386 66.447 63.508 -4.459 1.00 35.40 C ATOM 11539 CG GLN B 386 66.285 64.975 -4.152 1.00 36.16 C ATOM 11540 CD GLN B 386 66.960 65.347 -2.864 1.00 35.30 C ATOM 11541 OE1 GLN B 386 68.196 65.272 -2.743 1.00 35.61 O ATOM 11542 NE2 GLN B 386 66.163 65.732 -1.872 1.00 35.40 N ATOM 11543 HA GLN B 386 66.013 62.553 -2.546 1.00 0.00 H ATOM 11544 HB2 GLN B 386 67.501 63.254 -4.345 1.00 0.00 H ATOM 11545 HB3 GLN B 386 66.144 63.344 -5.493 1.00 0.00 H ATOM 11546 HG2 GLN B 386 66.723 65.557 -4.963 1.00 0.00 H ATOM 11547 HG3 GLN B 386 65.222 65.205 -4.074 1.00 0.00 H ATOM 11548 HE22 GLN B 386 65.135 65.780 -2.020 1.00 0.00 H ATOM 11549 HE21 GLN B 386 66.568 65.986 -0.948 1.00 0.00 H ATOM 11550 H GLN B 386 65.952 61.132 -5.169 1.00 0.00 H ATOM 11551 N VAL B 387 63.633 63.601 -2.581 1.00 31.62 N ATOM 11552 CA VAL B 387 62.295 64.156 -2.672 1.00 30.48 C ATOM 11553 C VAL B 387 62.363 65.629 -2.310 1.00 34.79 C ATOM 11554 O VAL B 387 63.352 66.085 -1.743 1.00 33.25 O ATOM 11555 CB VAL B 387 61.232 63.393 -1.843 1.00 33.32 C ATOM 11556 CG1 VAL B 387 61.081 61.957 -2.367 1.00 32.29 C ATOM 11557 CG2 VAL B 387 61.549 63.470 -0.342 1.00 32.50 C ATOM 11558 HA VAL B 387 61.950 64.039 -3.699 1.00 0.00 H ATOM 11559 HB VAL B 387 60.261 63.872 -1.966 1.00 0.00 H ATOM 11560 HG11 VAL B 387 60.769 61.983 -3.411 1.00 0.00 H ATOM 11561 HG12 VAL B 387 62.037 61.439 -2.285 1.00 0.00 H ATOM 11562 HG13 VAL B 387 60.331 61.433 -1.775 1.00 0.00 H ATOM 11563 HG21 VAL B 387 62.526 63.025 -0.155 1.00 0.00 H ATOM 11564 HG22 VAL B 387 61.558 64.513 -0.027 1.00 0.00 H ATOM 11565 HG23 VAL B 387 60.788 62.926 0.217 1.00 0.00 H ATOM 11566 H VAL B 387 64.165 63.664 -1.689 1.00 0.00 H ATOM 11567 N SER B 388 61.300 66.365 -2.608 1.00 34.27 N ATOM 11568 CA SER B 388 61.319 67.797 -2.366 1.00 36.79 C ATOM 11569 C SER B 388 60.566 68.380 -1.143 1.00 44.39 C ATOM 11570 O SER B 388 61.181 68.850 -0.164 1.00 50.66 O ATOM 11571 CB SER B 388 61.035 68.558 -3.683 1.00 42.39 C ATOM 11572 OG SER B 388 60.979 69.960 -3.467 1.00 57.94 O ATOM 11573 HA SER B 388 62.339 67.973 -2.024 1.00 0.00 H ATOM 11574 HB2 SER B 388 60.080 68.223 -4.089 1.00 0.00 H ATOM 11575 HB3 SER B 388 61.829 68.340 -4.398 1.00 0.00 H ATOM 11576 HG SER B 388 60.256 70.165 -2.822 1.00 0.00 H ATOM 11577 H SER B 388 60.454 65.917 -3.014 1.00 0.00 H ATOM 11578 N GLY B 389 59.258 68.475 -1.226 1.00 34.29 N ATOM 11579 CA GLY B 389 58.498 69.045 -0.135 1.00 34.40 C ATOM 11580 C GLY B 389 57.614 67.963 0.464 1.00 37.65 C ATOM 11581 O GLY B 389 56.379 68.055 0.435 1.00 37.14 O ATOM 11582 HA3 GLY B 389 57.878 69.861 -0.507 1.00 0.00 H ATOM 11583 HA2 GLY B 389 59.179 69.426 0.627 1.00 0.00 H ATOM 11584 H GLY B 389 58.767 68.139 -2.079 1.00 0.00 H ATOM 11585 N MET B 390 58.260 66.886 0.917 1.00 31.80 N ATOM 11586 CA MET B 390 57.541 65.784 1.538 1.00 30.39 C ATOM 11587 C MET B 390 57.229 66.180 2.981 1.00 34.79 C ATOM 11588 O MET B 390 58.136 66.499 3.733 1.00 36.26 O ATOM 11589 CB MET B 390 58.401 64.517 1.520 1.00 31.09 C ATOM 11590 CG MET B 390 57.697 63.307 2.156 1.00 31.71 C ATOM 11591 SD MET B 390 58.489 61.775 1.711 1.00 31.11 S ATOM 11592 CE MET B 390 60.042 61.891 2.531 1.00 25.79 C ATOM 11593 HA MET B 390 56.620 65.580 0.992 1.00 0.00 H ATOM 11594 HB2 MET B 390 58.642 64.275 0.485 1.00 0.00 H ATOM 11595 HB3 MET B 390 59.321 64.713 2.070 1.00 0.00 H ATOM 11596 HG2 MET B 390 56.662 63.281 1.816 1.00 0.00 H ATOM 11597 HG3 MET B 390 57.720 63.415 3.240 1.00 0.00 H ATOM 11598 HE1 MET B 390 60.580 62.766 2.166 1.00 0.00 H ATOM 11599 HE2 MET B 390 59.878 61.985 3.605 1.00 0.00 H ATOM 11600 HE3 MET B 390 60.626 60.993 2.329 1.00 0.00 H ATOM 11601 H MET B 390 59.295 66.834 0.824 1.00 0.00 H ATOM 11602 N GLU B 391 55.947 66.201 3.350 1.00 32.24 N ATOM 11603 CA GLU B 391 55.552 66.555 4.712 1.00 32.29 C ATOM 11604 C GLU B 391 55.045 65.384 5.576 1.00 35.39 C ATOM 11605 O GLU B 391 54.957 65.504 6.803 1.00 35.55 O ATOM 11606 CB GLU B 391 54.474 67.641 4.700 1.00 34.23 C ATOM 11607 CG GLU B 391 54.988 68.999 5.209 1.00 56.99 C ATOM 11608 CD GLU B 391 54.086 69.628 6.274 1.00 97.51 C ATOM 11609 OE1 GLU B 391 52.844 69.611 6.103 1.00 92.57 O ATOM 11610 OE2 GLU B 391 54.628 70.174 7.265 1.00 98.87 O ATOM 11611 HA GLU B 391 56.475 66.909 5.171 1.00 0.00 H ATOM 11612 HB2 GLU B 391 54.116 67.765 3.678 1.00 0.00 H ATOM 11613 HB3 GLU B 391 53.649 67.320 5.336 1.00 0.00 H ATOM 11614 HG2 GLU B 391 55.980 68.855 5.637 1.00 0.00 H ATOM 11615 HG3 GLU B 391 55.054 69.683 4.363 1.00 0.00 H ATOM 11616 H GLU B 391 55.213 65.960 2.654 1.00 0.00 H ATOM 11617 N TYR B 392 54.656 64.290 4.928 1.00 30.76 N ATOM 11618 CA TYR B 392 54.079 63.137 5.627 1.00 30.76 C ATOM 11619 C TYR B 392 54.644 61.812 5.116 1.00 32.57 C ATOM 11620 O TYR B 392 54.765 61.612 3.897 1.00 30.97 O ATOM 11621 CB TYR B 392 52.552 63.090 5.417 1.00 31.89 C ATOM 11622 CG TYR B 392 51.775 64.292 5.945 1.00 32.85 C ATOM 11623 CD1 TYR B 392 51.316 64.333 7.258 1.00 33.07 C ATOM 11624 CD2 TYR B 392 51.490 65.380 5.111 1.00 34.03 C ATOM 11625 CE1 TYR B 392 50.583 65.413 7.724 1.00 30.43 C ATOM 11626 CE2 TYR B 392 50.763 66.477 5.578 1.00 34.18 C ATOM 11627 CZ TYR B 392 50.303 66.477 6.869 1.00 39.84 C ATOM 11628 OH TYR B 392 49.606 67.570 7.325 1.00 41.70 O ATOM 11629 HA TYR B 392 54.332 63.261 6.680 1.00 0.00 H ATOM 11630 HB3 TYR B 392 52.172 62.199 5.917 1.00 0.00 H ATOM 11631 HB2 TYR B 392 52.363 63.013 4.346 1.00 0.00 H ATOM 11632 HD2 TYR B 392 51.842 65.371 4.079 1.00 0.00 H ATOM 11633 HE2 TYR B 392 50.563 67.325 4.922 1.00 0.00 H ATOM 11634 HE1 TYR B 392 50.227 65.430 8.754 1.00 0.00 H ATOM 11635 HD1 TYR B 392 51.536 63.503 7.930 1.00 0.00 H ATOM 11636 HH TYR B 392 49.342 67.422 8.268 1.00 0.00 H ATOM 11637 H TYR B 392 54.764 64.251 3.894 1.00 0.00 H ATOM 11638 N THR B 393 54.947 60.891 6.042 1.00 28.28 N ATOM 11639 CA THR B 393 55.361 59.553 5.641 1.00 28.58 C ATOM 11640 C THR B 393 54.419 58.575 6.349 1.00 31.04 C ATOM 11641 O THR B 393 53.824 58.913 7.378 1.00 26.65 O ATOM 11642 CB THR B 393 56.812 59.245 5.982 1.00 36.18 C ATOM 11643 OG1 THR B 393 57.028 59.487 7.374 1.00 33.59 O ATOM 11644 CG2 THR B 393 57.780 60.098 5.135 1.00 34.02 C ATOM 11645 HA THR B 393 55.300 59.466 4.556 1.00 0.00 H ATOM 11646 HB THR B 393 57.010 58.198 5.754 1.00 0.00 H ATOM 11647 HG1 THR B 393 57.971 59.288 7.600 1.00 0.00 H ATOM 11648 HG23 THR B 393 57.604 59.903 4.077 1.00 0.00 H ATOM 11649 HG21 THR B 393 57.610 61.154 5.344 1.00 0.00 H ATOM 11650 HG22 THR B 393 58.808 59.837 5.387 1.00 0.00 H ATOM 11651 H THR B 393 54.886 61.133 7.052 1.00 0.00 H ATOM 11652 N LEU B 394 54.269 57.376 5.793 1.00 28.46 N ATOM 11653 CA LEU B 394 53.391 56.392 6.410 1.00 27.36 C ATOM 11654 C LEU B 394 54.153 55.095 6.541 1.00 29.61 C ATOM 11655 O LEU B 394 54.780 54.663 5.581 1.00 30.91 O ATOM 11656 CB LEU B 394 52.140 56.187 5.551 1.00 27.86 C ATOM 11657 CG LEU B 394 51.023 55.278 6.109 1.00 31.55 C ATOM 11658 CD1 LEU B 394 49.669 55.781 5.590 1.00 32.26 C ATOM 11659 CD2 LEU B 394 51.247 53.857 5.709 1.00 32.04 C ATOM 11660 HA LEU B 394 53.073 56.739 7.393 1.00 0.00 H ATOM 11661 HB2 LEU B 394 51.702 57.169 5.375 1.00 0.00 H ATOM 11662 HB3 LEU B 394 52.464 55.759 4.602 1.00 0.00 H ATOM 11663 HG LEU B 394 51.033 55.318 7.198 1.00 0.00 H ATOM 11664 HD21 LEU B 394 51.251 53.783 4.622 1.00 0.00 H ATOM 11665 HD22 LEU B 394 52.206 53.517 6.101 1.00 0.00 H ATOM 11666 HD23 LEU B 394 50.447 53.237 6.114 1.00 0.00 H ATOM 11667 HD11 LEU B 394 49.512 56.807 5.923 1.00 0.00 H ATOM 11668 HD12 LEU B 394 49.664 55.747 4.501 1.00 0.00 H ATOM 11669 HD13 LEU B 394 48.873 55.145 5.979 1.00 0.00 H ATOM 11670 H LEU B 394 54.779 57.141 4.917 1.00 0.00 H ATOM 11671 N CYS B 395 54.058 54.450 7.710 1.00 25.20 N ATOM 11672 CA CYS B 395 54.748 53.192 7.950 1.00 24.00 C ATOM 11673 C CYS B 395 53.721 52.084 8.197 1.00 26.63 C ATOM 11674 O CYS B 395 52.929 52.202 9.111 1.00 23.57 O ATOM 11675 CB CYS B 395 55.636 53.317 9.182 1.00 24.94 C ATOM 11676 SG CYS B 395 56.599 51.813 9.572 1.00 29.48 S ATOM 11677 HA CYS B 395 55.357 52.951 7.079 1.00 0.00 H ATOM 11678 HB2 CYS B 395 55.002 53.548 10.038 1.00 0.00 H ATOM 11679 HB3 CYS B 395 56.335 54.137 9.017 1.00 0.00 H ATOM 11680 HG CYS B 395 57.363 52.037 10.699 1.00 0.00 H ATOM 11681 H CYS B 395 53.475 54.859 8.468 1.00 0.00 H ATOM 11682 N ASN B 396 53.761 51.016 7.392 1.00 24.06 N ATOM 11683 CA ASN B 396 52.889 49.842 7.577 1.00 23.65 C ATOM 11684 C ASN B 396 53.608 48.673 8.238 1.00 25.08 C ATOM 11685 O ASN B 396 54.772 48.387 7.939 1.00 25.80 O ATOM 11686 CB ASN B 396 52.427 49.278 6.235 1.00 25.53 C ATOM 11687 CG ASN B 396 51.315 50.043 5.631 1.00 30.62 C ATOM 11688 OD1 ASN B 396 50.622 50.798 6.300 1.00 28.58 O ATOM 11689 ND2 ASN B 396 51.165 49.901 4.331 1.00 30.45 N ATOM 11690 HA ASN B 396 52.068 50.209 8.192 1.00 0.00 H ATOM 11691 HB2 ASN B 396 53.271 49.290 5.545 1.00 0.00 H ATOM 11692 HB3 ASN B 396 52.098 48.250 6.386 1.00 0.00 H ATOM 11693 HD22 ASN B 396 51.779 49.246 3.805 1.00 0.00 H ATOM 11694 HD21 ASN B 396 50.433 50.443 3.830 1.00 0.00 H ATOM 11695 H ASN B 396 54.437 51.014 6.601 1.00 0.00 H ATOM 11696 N SER B 397 52.860 47.919 9.040 1.00 22.05 N ATOM 11697 CA SER B 397 53.379 46.709 9.668 1.00 21.50 C ATOM 11698 C SER B 397 52.179 45.758 9.865 1.00 25.88 C ATOM 11699 O SER B 397 51.148 46.173 10.394 1.00 25.35 O ATOM 11700 CB SER B 397 54.062 47.083 11.004 1.00 27.61 C ATOM 11701 OG SER B 397 55.284 46.408 11.122 1.00 40.89 O ATOM 11702 HA SER B 397 54.133 46.213 9.057 1.00 0.00 H ATOM 11703 HB2 SER B 397 53.412 46.802 11.833 1.00 0.00 H ATOM 11704 HB3 SER B 397 54.239 48.158 11.031 1.00 0.00 H ATOM 11705 HG SER B 397 55.124 45.431 11.099 1.00 0.00 H ATOM 11706 H SER B 397 51.876 48.201 9.224 1.00 0.00 H ATOM 11707 N PHE B 398 52.267 44.543 9.316 1.00 24.47 N ATOM 11708 CA PHE B 398 51.162 43.565 9.419 1.00 24.17 C ATOM 11709 C PHE B 398 51.676 42.337 10.124 1.00 27.40 C ATOM 11710 O PHE B 398 52.874 42.111 10.161 1.00 27.22 O ATOM 11711 CB PHE B 398 50.586 43.207 8.025 1.00 24.94 C ATOM 11712 CG PHE B 398 50.406 44.411 7.118 1.00 25.74 C ATOM 11713 CD1 PHE B 398 49.856 45.584 7.605 1.00 26.63 C ATOM 11714 CD2 PHE B 398 50.726 44.338 5.767 1.00 27.63 C ATOM 11715 CE1 PHE B 398 49.682 46.710 6.762 1.00 28.60 C ATOM 11716 CE2 PHE B 398 50.577 45.464 4.924 1.00 30.30 C ATOM 11717 CZ PHE B 398 50.053 46.650 5.421 1.00 27.03 C ATOM 11718 HA PHE B 398 50.344 44.004 9.990 1.00 0.00 H ATOM 11719 HB2 PHE B 398 51.266 42.507 7.539 1.00 0.00 H ATOM 11720 HB3 PHE B 398 49.615 42.731 8.164 1.00 0.00 H ATOM 11721 HD2 PHE B 398 51.097 43.401 5.352 1.00 0.00 H ATOM 11722 HE2 PHE B 398 50.875 45.400 3.878 1.00 0.00 H ATOM 11723 HZ PHE B 398 49.934 47.518 4.773 1.00 0.00 H ATOM 11724 HE1 PHE B 398 49.255 47.628 7.166 1.00 0.00 H ATOM 11725 HD1 PHE B 398 49.553 45.643 8.650 1.00 0.00 H ATOM 11726 H PHE B 398 53.133 44.279 8.804 1.00 0.00 H ATOM 11727 N GLY B 399 50.791 41.550 10.732 1.00 24.92 N ATOM 11728 CA GLY B 399 51.296 40.413 11.475 1.00 23.84 C ATOM 11729 C GLY B 399 50.443 39.161 11.399 1.00 26.03 C ATOM 11730 O GLY B 399 49.269 39.219 11.034 1.00 23.66 O ATOM 11731 HA3 GLY B 399 51.377 40.703 12.523 1.00 0.00 H ATOM 11732 HA2 GLY B 399 52.286 40.171 11.089 1.00 0.00 H ATOM 11733 H GLY B 399 49.771 41.745 10.676 1.00 0.00 H ATOM 11734 N PHE B 400 51.051 38.027 11.730 1.00 22.51 N ATOM 11735 CA PHE B 400 50.322 36.748 11.744 1.00 22.20 C ATOM 11736 C PHE B 400 49.119 37.017 12.603 1.00 27.11 C ATOM 11737 O PHE B 400 49.202 37.814 13.534 1.00 24.34 O ATOM 11738 CB PHE B 400 51.145 35.653 12.410 1.00 22.89 C ATOM 11739 CG PHE B 400 52.138 34.991 11.500 1.00 24.47 C ATOM 11740 CD1 PHE B 400 52.279 35.410 10.191 1.00 27.53 C ATOM 11741 CD2 PHE B 400 52.918 33.928 11.959 1.00 25.12 C ATOM 11742 CE1 PHE B 400 53.147 34.757 9.330 1.00 29.12 C ATOM 11743 CE2 PHE B 400 53.779 33.270 11.107 1.00 29.05 C ATOM 11744 CZ PHE B 400 53.922 33.710 9.780 1.00 27.97 C ATOM 11745 HA PHE B 400 50.085 36.415 10.733 1.00 0.00 H ATOM 11746 HB2 PHE B 400 51.688 36.094 13.246 1.00 0.00 H ATOM 11747 HB3 PHE B 400 50.462 34.890 12.783 1.00 0.00 H ATOM 11748 HD2 PHE B 400 52.845 33.615 13.001 1.00 0.00 H ATOM 11749 HE2 PHE B 400 54.348 32.410 11.462 1.00 0.00 H ATOM 11750 HZ PHE B 400 54.638 33.228 9.114 1.00 0.00 H ATOM 11751 HE1 PHE B 400 53.217 35.074 8.289 1.00 0.00 H ATOM 11752 HD1 PHE B 400 51.702 36.262 9.832 1.00 0.00 H ATOM 11753 H PHE B 400 52.059 38.043 11.984 1.00 0.00 H ATOM 11754 N GLY B 401 47.992 36.384 12.284 1.00 24.53 N ATOM 11755 CA GLY B 401 46.745 36.648 12.984 1.00 24.20 C ATOM 11756 C GLY B 401 45.928 37.705 12.257 1.00 28.22 C ATOM 11757 O GLY B 401 44.849 38.092 12.692 1.00 29.04 O ATOM 11758 HA3 GLY B 401 46.968 36.999 13.991 1.00 0.00 H ATOM 11759 HA2 GLY B 401 46.166 35.726 13.042 1.00 0.00 H ATOM 11760 H GLY B 401 48.004 35.684 11.515 1.00 0.00 H ATOM 11761 N GLY B 402 46.456 38.231 11.158 1.00 24.02 N ATOM 11762 CA GLY B 402 45.709 39.229 10.425 1.00 22.61 C ATOM 11763 C GLY B 402 45.638 40.580 11.091 1.00 26.62 C ATOM 11764 O GLY B 402 44.803 41.398 10.743 1.00 28.52 O ATOM 11765 HA3 GLY B 402 44.691 38.862 10.292 1.00 0.00 H ATOM 11766 HA2 GLY B 402 46.178 39.356 9.449 1.00 0.00 H ATOM 11767 H GLY B 402 47.395 37.929 10.829 1.00 0.00 H ATOM 11768 N THR B 403 46.571 40.865 11.996 1.00 23.17 N ATOM 11769 CA THR B 403 46.546 42.132 12.712 1.00 21.69 C ATOM 11770 C THR B 403 47.412 43.173 12.016 1.00 26.00 C ATOM 11771 O THR B 403 48.617 42.946 11.785 1.00 25.89 O ATOM 11772 CB THR B 403 46.937 41.929 14.207 1.00 26.38 C ATOM 11773 OG1 THR B 403 46.876 43.183 14.887 1.00 28.98 O ATOM 11774 CG2 THR B 403 48.323 41.355 14.337 1.00 23.47 C ATOM 11775 HA THR B 403 45.527 42.518 12.700 1.00 0.00 H ATOM 11776 HB THR B 403 46.234 41.225 14.652 1.00 0.00 H ATOM 11777 HG1 THR B 403 45.955 43.543 14.831 1.00 0.00 H ATOM 11778 HG23 THR B 403 48.369 40.398 13.818 1.00 0.00 H ATOM 11779 HG21 THR B 403 49.043 42.044 13.896 1.00 0.00 H ATOM 11780 HG22 THR B 403 48.557 41.209 15.392 1.00 0.00 H ATOM 11781 H THR B 403 47.325 40.176 12.193 1.00 0.00 H ATOM 11782 N ASN B 404 46.810 44.333 11.751 1.00 23.51 N ATOM 11783 CA ASN B 404 47.441 45.385 10.963 1.00 23.90 C ATOM 11784 C ASN B 404 47.600 46.723 11.676 1.00 25.98 C ATOM 11785 O ASN B 404 46.786 47.087 12.496 1.00 24.11 O ATOM 11786 CB ASN B 404 46.633 45.611 9.686 1.00 22.46 C ATOM 11787 CG ASN B 404 46.344 44.332 8.944 1.00 31.61 C ATOM 11788 OD1 ASN B 404 47.247 43.584 8.590 1.00 30.35 O ATOM 11789 ND2 ASN B 404 45.101 44.165 8.553 1.00 26.69 N ATOM 11790 HA ASN B 404 48.450 45.027 10.760 1.00 0.00 H ATOM 11791 HB2 ASN B 404 45.686 46.082 9.951 1.00 0.00 H ATOM 11792 HB3 ASN B 404 47.196 46.275 9.030 1.00 0.00 H ATOM 11793 HD22 ASN B 404 44.362 44.822 8.875 1.00 0.00 H ATOM 11794 HD21 ASN B 404 44.856 43.376 7.921 1.00 0.00 H ATOM 11795 H ASN B 404 45.852 44.494 12.121 1.00 0.00 H ATOM 11796 N GLY B 405 48.613 47.494 11.308 1.00 24.41 N ATOM 11797 CA GLY B 405 48.769 48.800 11.935 1.00 22.37 C ATOM 11798 C GLY B 405 49.501 49.754 10.983 1.00 26.38 C ATOM 11799 O GLY B 405 50.370 49.338 10.215 1.00 25.84 O ATOM 11800 HA3 GLY B 405 49.346 48.693 12.854 1.00 0.00 H ATOM 11801 HA2 GLY B 405 47.786 49.208 12.170 1.00 0.00 H ATOM 11802 H GLY B 405 49.286 47.172 10.583 1.00 0.00 H ATOM 11803 N SER B 406 49.143 51.038 11.038 1.00 23.09 N ATOM 11804 CA SER B 406 49.799 52.057 10.200 1.00 21.93 C ATOM 11805 C SER B 406 50.024 53.300 11.078 1.00 27.20 C ATOM 11806 O SER B 406 49.154 53.685 11.850 1.00 26.86 O ATOM 11807 CB SER B 406 48.921 52.427 8.990 1.00 23.46 C ATOM 11808 OG SER B 406 48.747 51.320 8.103 1.00 25.89 O ATOM 11809 HA SER B 406 50.743 51.670 9.816 1.00 0.00 H ATOM 11810 HB2 SER B 406 49.395 53.244 8.446 1.00 0.00 H ATOM 11811 HB3 SER B 406 47.943 52.750 9.348 1.00 0.00 H ATOM 11812 HG SER B 406 49.631 51.025 7.768 1.00 0.00 H ATOM 11813 H SER B 406 48.383 51.326 11.687 1.00 0.00 H ATOM 11814 N LEU B 407 51.191 53.918 10.926 1.00 23.71 N ATOM 11815 CA LEU B 407 51.556 55.129 11.638 1.00 22.82 C ATOM 11816 C LEU B 407 51.835 56.211 10.594 1.00 27.78 C ATOM 11817 O LEU B 407 52.457 55.944 9.554 1.00 25.76 O ATOM 11818 CB LEU B 407 52.877 54.903 12.402 1.00 22.12 C ATOM 11819 CG LEU B 407 52.796 54.027 13.649 1.00 24.61 C ATOM 11820 CD1 LEU B 407 54.176 53.840 14.229 1.00 22.88 C ATOM 11821 CD2 LEU B 407 51.856 54.683 14.668 1.00 23.81 C ATOM 11822 HA LEU B 407 50.757 55.406 12.326 1.00 0.00 H ATOM 11823 HB2 LEU B 407 53.583 54.438 11.714 1.00 0.00 H ATOM 11824 HB3 LEU B 407 53.257 55.879 12.705 1.00 0.00 H ATOM 11825 HG LEU B 407 52.399 53.045 13.390 1.00 0.00 H ATOM 11826 HD21 LEU B 407 52.242 55.666 14.936 1.00 0.00 H ATOM 11827 HD22 LEU B 407 50.864 54.788 14.230 1.00 0.00 H ATOM 11828 HD23 LEU B 407 51.797 54.059 15.560 1.00 0.00 H ATOM 11829 HD11 LEU B 407 54.817 53.360 13.490 1.00 0.00 H ATOM 11830 HD12 LEU B 407 54.591 54.812 14.496 1.00 0.00 H ATOM 11831 HD13 LEU B 407 54.113 53.214 15.119 1.00 0.00 H ATOM 11832 H LEU B 407 51.880 53.512 10.261 1.00 0.00 H ATOM 11833 N ILE B 408 51.473 57.452 10.915 1.00 28.07 N ATOM 11834 CA ILE B 408 51.751 58.571 10.006 1.00 27.08 C ATOM 11835 C ILE B 408 52.558 59.616 10.763 1.00 29.47 C ATOM 11836 O ILE B 408 52.131 60.089 11.810 1.00 26.23 O ATOM 11837 CB ILE B 408 50.456 59.208 9.426 1.00 29.48 C ATOM 11838 CG1 ILE B 408 49.727 58.219 8.530 1.00 29.64 C ATOM 11839 CG2 ILE B 408 50.804 60.452 8.611 1.00 29.92 C ATOM 11840 CD1 ILE B 408 48.374 58.712 8.098 1.00 30.09 C ATOM 11841 HA ILE B 408 52.314 58.189 9.155 1.00 0.00 H ATOM 11842 HB ILE B 408 49.810 59.481 10.260 1.00 0.00 H ATOM 11843 HG12 ILE B 408 50.333 58.041 7.642 1.00 0.00 H ATOM 11844 HG13 ILE B 408 49.600 57.284 9.075 1.00 0.00 H ATOM 11845 HD11 ILE B 408 47.754 58.885 8.978 1.00 0.00 H ATOM 11846 HD12 ILE B 408 48.488 59.643 7.543 1.00 0.00 H ATOM 11847 HD13 ILE B 408 47.902 57.964 7.461 1.00 0.00 H ATOM 11848 HG21 ILE B 408 51.304 61.177 9.253 1.00 0.00 H ATOM 11849 HG22 ILE B 408 51.466 60.174 7.791 1.00 0.00 H ATOM 11850 HG23 ILE B 408 49.890 60.890 8.210 1.00 0.00 H ATOM 11851 H ILE B 408 50.989 57.630 11.818 1.00 0.00 H ATOM 11852 N PHE B 409 53.715 59.962 10.205 1.00 25.66 N ATOM 11853 CA PHE B 409 54.602 60.965 10.762 1.00 26.04 C ATOM 11854 C PHE B 409 54.512 62.233 9.904 1.00 29.80 C ATOM 11855 O PHE B 409 54.302 62.160 8.694 1.00 28.72 O ATOM 11856 CB PHE B 409 56.033 60.420 10.768 1.00 27.25 C ATOM 11857 CG PHE B 409 56.215 59.253 11.711 1.00 27.82 C ATOM 11858 CD1 PHE B 409 56.282 59.459 13.079 1.00 29.61 C ATOM 11859 CD2 PHE B 409 56.177 57.946 11.232 1.00 29.72 C ATOM 11860 CE1 PHE B 409 56.417 58.369 13.959 1.00 30.70 C ATOM 11861 CE2 PHE B 409 56.296 56.851 12.109 1.00 30.74 C ATOM 11862 CZ PHE B 409 56.410 57.069 13.465 1.00 28.66 C ATOM 11863 HA PHE B 409 54.314 61.205 11.785 1.00 0.00 H ATOM 11864 HB2 PHE B 409 56.286 60.095 9.759 1.00 0.00 H ATOM 11865 HB3 PHE B 409 56.709 61.220 11.070 1.00 0.00 H ATOM 11866 HD2 PHE B 409 56.053 57.768 10.164 1.00 0.00 H ATOM 11867 HE2 PHE B 409 56.298 55.834 11.717 1.00 0.00 H ATOM 11868 HZ PHE B 409 56.494 56.224 14.149 1.00 0.00 H ATOM 11869 HE1 PHE B 409 56.527 58.544 15.029 1.00 0.00 H ATOM 11870 HD1 PHE B 409 56.230 60.472 13.477 1.00 0.00 H ATOM 11871 H PHE B 409 53.998 59.489 9.323 1.00 0.00 H ATOM 11872 N LYS B 410 54.682 63.384 10.540 1.00 28.84 N ATOM 11873 CA LYS B 410 54.592 64.666 9.840 1.00 30.56 C ATOM 11874 C LYS B 410 55.871 65.459 10.094 1.00 35.10 C ATOM 11875 O LYS B 410 56.358 65.497 11.216 1.00 33.17 O ATOM 11876 CB LYS B 410 53.426 65.478 10.402 1.00 32.53 C ATOM 11877 CG LYS B 410 53.217 66.831 9.725 1.00 30.81 C ATOM 11878 CD LYS B 410 52.133 67.620 10.456 1.00 39.51 C ATOM 11879 CE LYS B 410 51.617 68.808 9.626 1.00 43.99 C ATOM 11880 NZ LYS B 410 50.703 69.632 10.461 1.00 48.18 N ATOM 11881 HA LYS B 410 54.449 64.482 8.775 1.00 0.00 H ATOM 11882 HB2 LYS B 410 52.514 64.893 10.284 1.00 0.00 H ATOM 11883 HB3 LYS B 410 53.610 65.651 11.462 1.00 0.00 H ATOM 11884 HG2 LYS B 410 54.150 67.394 9.747 1.00 0.00 H ATOM 11885 HG3 LYS B 410 52.913 66.674 8.690 1.00 0.00 H ATOM 11886 HD2 LYS B 410 51.298 66.953 10.671 1.00 0.00 H ATOM 11887 HD3 LYS B 410 52.545 67.998 11.392 1.00 0.00 H ATOM 11888 HE2 LYS B 410 51.078 68.437 8.754 1.00 0.00 H ATOM 11889 HE3 LYS B 410 52.460 69.417 9.299 1.00 0.00 H ATOM 11890 HZ1 LYS B 410 49.900 69.049 10.772 1.00 0.00 H ATOM 11891 HZ2 LYS B 410 51.219 69.985 11.292 1.00 0.00 H ATOM 11892 HZ3 LYS B 410 50.354 70.436 9.901 1.00 0.00 H ATOM 11893 H LYS B 410 54.884 63.375 11.560 1.00 0.00 H ATOM 11894 N LYS B 411 56.396 66.105 9.059 1.00 32.67 N ATOM 11895 CA LYS B 411 57.615 66.877 9.226 1.00 33.07 C ATOM 11896 C LYS B 411 57.317 68.056 10.142 1.00 39.44 C ATOM 11897 O LYS B 411 56.316 68.734 9.971 1.00 38.78 O ATOM 11898 CB LYS B 411 58.130 67.378 7.876 1.00 36.91 C ATOM 11899 CG LYS B 411 59.422 68.198 7.984 1.00 46.68 C ATOM 11900 CD LYS B 411 59.977 68.589 6.612 1.00 59.18 C ATOM 11901 CE LYS B 411 61.469 68.905 6.686 1.00 63.97 C ATOM 11902 NZ LYS B 411 61.679 70.265 7.254 1.00 74.87 N ATOM 11903 HA LYS B 411 58.388 66.246 9.664 1.00 0.00 H ATOM 11904 HB2 LYS B 411 58.320 66.516 7.237 1.00 0.00 H ATOM 11905 HB3 LYS B 411 57.361 68.003 7.422 1.00 0.00 H ATOM 11906 HG2 LYS B 411 59.215 69.106 8.551 1.00 0.00 H ATOM 11907 HG3 LYS B 411 60.171 67.606 8.510 1.00 0.00 H ATOM 11908 HD2 LYS B 411 59.823 67.763 5.918 1.00 0.00 H ATOM 11909 HD3 LYS B 411 59.445 69.469 6.251 1.00 0.00 H ATOM 11910 HE2 LYS B 411 61.896 68.863 5.684 1.00 0.00 H ATOM 11911 HE3 LYS B 411 61.962 68.169 7.321 1.00 0.00 H ATOM 11912 HZ1 LYS B 411 61.211 70.969 6.648 1.00 0.00 H ATOM 11913 HZ2 LYS B 411 61.274 70.306 8.211 1.00 0.00 H ATOM 11914 HZ3 LYS B 411 62.698 70.467 7.299 1.00 0.00 H ATOM 11915 H LYS B 411 55.934 66.058 8.128 1.00 0.00 H ATOM 11916 N ILE B 412 58.187 68.277 11.123 1.00 39.49 N ATOM 11917 CA ILE B 412 58.056 69.376 12.082 1.00 48.59 C ATOM 11918 C ILE B 412 56.766 69.495 12.899 1.00 75.96 C ATOM 11919 O ILE B 412 56.881 69.727 14.130 1.00 78.05 O ATOM 11920 CB ILE B 412 58.545 70.710 11.508 1.00 52.42 C ATOM 11921 CG1 ILE B 412 60.068 70.676 11.399 1.00 53.36 C ATOM 11922 CG2 ILE B 412 58.129 71.868 12.418 1.00 53.92 C ATOM 11923 CD1 ILE B 412 60.608 69.961 10.168 1.00 61.70 C ATOM 11924 HA ILE B 412 58.743 69.063 12.868 1.00 0.00 H ATOM 11925 OXT ILE B 412 55.654 69.342 12.331 1.00 93.96 O ATOM 11926 HB ILE B 412 58.100 70.859 10.524 1.00 0.00 H ATOM 11927 HG12 ILE B 412 60.429 71.704 11.379 1.00 0.00 H ATOM 11928 HG13 ILE B 412 60.460 70.172 12.282 1.00 0.00 H ATOM 11929 HD11 ILE B 412 60.271 68.924 10.174 1.00 0.00 H ATOM 11930 HD12 ILE B 412 60.241 70.458 9.270 1.00 0.00 H ATOM 11931 HD13 ILE B 412 61.698 69.990 10.181 1.00 0.00 H ATOM 11932 HG21 ILE B 412 57.042 71.893 12.498 1.00 0.00 H ATOM 11933 HG22 ILE B 412 58.565 71.726 13.407 1.00 0.00 H ATOM 11934 HG23 ILE B 412 58.485 72.807 11.994 1.00 0.00 H ATOM 11935 H ILE B 412 59.002 67.637 11.214 1.00 0.00 H TER 11936 ILE B 412 HETATM11937 O HOH 1 31.431 30.819 15.716 1.00 64.47 O HETATM11938 O HOH 2 24.158 35.703 45.134 1.00 67.44 O HETATM11939 O HOH 3 32.882 24.247 25.958 1.00 55.18 O HETATM11940 O HOH 4 32.981 16.065 22.202 1.00 59.27 O HETATM11941 O HOH 5 35.364 53.406 57.830 1.00 58.93 O HETATM11942 O HOH 6 30.074 29.699 52.874 1.00 63.01 O HETATM11943 O HOH 7 33.169 22.849 14.641 1.00 64.07 O HETATM11944 O HOH 8 39.836 57.168 52.657 1.00 63.16 O HETATM11945 O HOH 9 26.144 51.846 14.988 1.00 72.13 O HETATM11946 O HOH 10 59.492 13.953 19.466 1.00 61.72 O HETATM11947 O HOH 11 56.081 28.111 57.884 1.00 62.37 O HETATM11948 O HOH 12 36.113 17.995 38.164 1.00 54.69 O HETATM11949 O HOH 13 34.424 12.629 32.721 1.00 59.45 O HETATM11950 O HOH 14 61.260 37.167 55.354 1.00 69.80 O HETATM11951 O HOH 15 40.200 18.076 40.781 1.00 65.27 O HETATM11952 O HOH 16 33.204 24.936 49.560 1.00 54.85 O HETATM11953 O HOH 17 50.516 13.714 47.637 1.00 55.79 O HETATM11954 O HOH 18 39.958 15.483 35.951 1.00 67.53 O HETATM11955 O HOH 19 49.926 58.075 47.582 1.00 69.56 O HETATM11956 O HOH 20 58.252 47.654 55.305 1.00 68.74 O HETATM11957 O HOH 21 22.145 36.311 25.213 1.00 70.69 O HETATM11958 O HOH 22 37.114 53.079 59.469 1.00 64.29 O HETATM11959 O HOH 23 33.057 20.662 30.551 1.00 65.06 O HETATM11960 O HOH 24 29.561 61.001 29.275 1.00 65.17 O HETATM11961 O HOH 25 49.846 18.407 21.464 1.00 55.71 O HETATM11962 O HOH 26 18.486 43.433 28.637 1.00 58.71 O HETATM11963 O HOH 27 19.082 43.117 30.802 1.00 64.98 O HETATM11964 O HOH 28 24.816 30.111 40.284 1.00 67.14 O HETATM11965 O HOH 29 26.700 58.231 39.564 1.00 70.71 O HETATM11966 O HOH 30 56.831 15.701 11.536 1.00 61.91 O HETATM11967 O HOH 31 51.526 11.668 33.339 1.00 64.11 O HETATM11968 O HOH 32 56.947 51.160 54.334 1.00 74.09 O HETATM11969 O HOH 33 59.168 54.589 51.898 1.00 60.68 O HETATM11970 O HOH 34 23.143 33.219 38.103 1.00 55.95 O HETATM11971 O HOH 35 17.955 53.504 25.298 1.00 67.26 O HETATM11972 O HOH 36 38.364 64.183 42.760 1.00 74.40 O HETATM11973 O HOH 37 23.581 57.034 40.270 1.00 61.65 O HETATM11974 O HOH 38 40.192 49.099 67.142 1.00 66.50 O HETATM11975 O HOH 39 43.332 23.511 7.313 1.00 50.27 O HETATM11976 O HOH 40 40.390 16.153 17.421 1.00 52.49 O HETATM11977 O HOH 41 40.292 58.978 14.383 1.00 64.21 O HETATM11978 O HOH 42 52.622 45.209 55.029 1.00 54.02 O HETATM11979 O HOH 43 41.233 60.523 43.676 1.00 61.52 O HETATM11980 O HOH 44 48.205 48.900 60.181 1.00 63.97 O HETATM11981 O HOH 45 43.988 21.161 25.143 1.00 54.98 O HETATM11982 O HOH 46 32.072 61.064 40.919 1.00 63.60 O HETATM11983 O HOH 47 55.274 44.132 56.722 1.00 63.15 O HETATM11984 O HOH 48 23.096 30.395 36.529 1.00 60.24 O HETATM11985 O HOH 49 31.751 35.888 9.746 1.00 68.72 O HETATM11986 O HOH 50 43.247 30.030 63.043 1.00 60.76 O HETATM11987 O HOH 51 34.699 59.481 18.212 1.00 60.32 O HETATM11988 O HOH 52 56.859 16.679 13.945 1.00 59.49 O HETATM11989 O HOH 53 36.712 26.548 11.537 1.00 70.42 O HETATM11990 O HOH 54 15.911 46.624 21.746 1.00 76.58 O HETATM11991 O HOH 55 59.669 12.387 23.688 1.00 71.01 O HETATM11992 O HOH 56 38.929 62.536 35.540 1.00 69.79 O HETATM11993 O HOH 57 36.116 13.141 45.605 1.00 65.08 O HETATM11994 O HOH 58 51.576 13.721 50.632 1.00 73.20 O HETATM11995 O HOH 59 46.589 28.597 64.263 1.00 70.01 O HETATM11996 O HOH 60 46.504 13.117 31.853 1.00 59.82 O HETATM11997 O HOH 61 36.340 62.682 35.565 1.00 65.44 O HETATM11998 O HOH 62 37.748 21.011 6.323 1.00 64.77 O HETATM11999 O HOH 63 20.533 45.082 41.915 1.00 68.38 O HETATM12000 O HOH 64 23.970 54.803 33.689 1.00 66.49 O HETATM12001 O HOH 65 70.703 9.670 21.562 1.00 61.07 O HETATM12002 O HOH 66 33.312 61.341 38.413 1.00 55.11 O HETATM12003 O HOH 67 50.433 30.129 67.986 1.00 64.49 O HETATM12004 O HOH 68 50.489 31.817 64.172 1.00 81.56 O HETATM12005 O HOH 69 21.416 47.955 13.477 1.00 61.67 O HETATM12006 O HOH 70 60.188 23.255 52.548 1.00 58.35 O HETATM12007 O HOH 71 22.079 46.690 34.201 1.00 72.08 O HETATM12008 O HOH 72 49.668 56.821 54.453 1.00 74.19 O HETATM12009 O HOH 73 42.207 16.546 20.007 1.00 60.80 O HETATM12010 O HOH 74 29.790 64.436 24.277 1.00 70.60 O HETATM12011 O HOH 75 37.966 59.273 54.032 1.00 70.39 O HETATM12012 O HOH 76 41.400 62.124 16.074 1.00 72.29 O HETATM12013 O HOH 77 50.264 28.395 63.927 1.00 84.33 O HETATM12014 O HOH 78 39.072 29.679 8.829 1.00 81.74 O HETATM12015 O HOH 79 43.447 12.774 33.713 1.00 69.85 O HETATM12016 O HOH 80 59.598 47.847 58.035 1.00 86.99 O HETATM12017 O HOH 81 20.625 41.381 38.804 1.00 71.29 O HETATM12018 O HOH 82 38.729 60.755 13.339 1.00 78.14 O HETATM12019 O HOH 83 30.442 23.399 32.928 1.00 63.70 O HETATM12020 O HOH 84 15.962 37.164 9.444 1.00 67.16 O HETATM12021 O HOH 85 61.938 10.658 42.846 1.00 66.00 O HETATM12022 O HOH 86 43.567 25.631 4.813 1.00126.68 O HETATM12023 O HOH 87 44.262 16.335 31.245 1.00 74.78 O HETATM12024 O HOH 88 45.737 6.997 43.871 1.00 64.11 O HETATM12025 O HOH 89 38.676 43.563 60.241 1.00 65.73 O HETATM12026 O HOH 90 31.291 61.396 21.218 1.00 57.73 O HETATM12027 O HOH 91 43.056 41.091 41.192 1.00 7.39 O HETATM12028 O HOH 92 45.794 36.801 21.899 1.00 20.89 O HETATM12029 O HOH 93 46.667 39.187 34.201 1.00 22.13 O HETATM12030 O HOH 94 45.411 52.988 23.755 1.00 33.50 O HETATM12031 O HOH 95 50.283 30.053 28.836 1.00 22.29 O HETATM12032 O HOH 96 52.536 26.220 43.874 1.00 25.31 O HETATM12033 O HOH 97 43.198 26.678 47.457 1.00 23.02 O HETATM12034 O HOH 98 48.572 31.802 44.671 1.00 24.89 O HETATM12035 O HOH 99 45.385 45.998 14.874 1.00 26.31 O HETATM12036 O HOH 100 54.581 48.455 44.325 1.00 28.64 O HETATM12037 O HOH 101 42.582 37.934 43.536 1.00 23.06 O HETATM12038 O HOH 102 54.488 38.775 29.361 1.00 20.20 O HETATM12039 O HOH 103 62.243 31.444 36.193 1.00 25.84 O HETATM12040 O HOH 104 46.538 38.915 16.487 1.00 25.39 O HETATM12041 O HOH 105 37.600 23.622 35.510 1.00 26.38 O HETATM12042 O HOH 106 47.886 55.639 34.430 1.00 27.50 O HETATM12043 O HOH 107 44.343 23.076 32.703 1.00 28.29 O HETATM12044 O HOH 108 59.381 48.781 36.725 1.00 27.48 O HETATM12045 O HOH 109 44.186 34.319 39.132 1.00 24.93 O HETATM12046 O HOH 110 53.048 23.367 16.931 1.00 23.59 O HETATM12047 O HOH 111 30.091 31.119 30.757 1.00 28.62 O HETATM12048 O HOH 112 60.387 47.037 39.072 1.00 26.97 O HETATM12049 O HOH 113 45.958 26.349 47.188 1.00 30.45 O HETATM12050 O HOH 114 49.270 22.761 24.514 1.00 24.34 O HETATM12051 O HOH 115 40.932 56.662 25.148 1.00 25.23 O HETATM12052 O HOH 116 53.774 38.559 36.834 1.00 24.27 O HETATM12053 O HOH 117 63.239 43.789 35.135 1.00 20.00 O HETATM12054 O HOH 118 51.733 30.309 49.691 1.00 27.24 O HETATM12055 O HOH 119 56.043 36.560 26.942 1.00 21.43 O HETATM12056 O HOH 120 51.603 25.568 41.321 1.00 26.16 O HETATM12057 O HOH 121 50.684 25.511 27.304 1.00 27.25 O HETATM12058 O HOH 122 50.096 21.077 29.053 1.00 26.35 O HETATM12059 O HOH 123 53.924 34.986 38.428 1.00 27.33 O HETATM12060 O HOH 124 47.386 45.119 56.797 1.00 32.08 O HETATM12061 O HOH 125 52.976 38.899 44.130 1.00 30.06 O HETATM12062 O HOH 126 43.036 21.629 39.614 1.00 29.99 O HETATM12063 O HOH 127 40.887 19.775 30.984 1.00 31.00 O HETATM12064 O HOH 128 59.754 14.383 37.342 1.00 31.17 O HETATM12065 O HOH 129 32.806 54.554 31.068 1.00 31.70 O HETATM12066 O HOH 130 42.573 55.248 13.967 1.00 30.37 O HETATM12067 O HOH 131 21.251 38.698 52.603 1.00 27.73 O HETATM12068 O HOH 132 39.664 29.109 55.053 1.00 33.44 O HETATM12069 O HOH 133 58.534 42.857 39.595 1.00 32.92 O HETATM12070 O HOH 134 43.525 54.160 22.588 1.00 24.10 O HETATM12071 O HOH 135 41.533 35.017 41.224 1.00 27.09 O HETATM12072 O HOH 136 40.344 46.659 54.635 1.00 39.86 O HETATM12073 O HOH 137 58.681 24.727 43.141 1.00 27.04 O HETATM12074 O HOH 138 28.859 33.317 29.431 1.00 27.50 O HETATM12075 O HOH 139 36.262 35.670 8.940 1.00 35.37 O HETATM12076 O HOH 140 30.030 25.809 40.763 1.00 28.80 O HETATM12077 O HOH 141 50.348 41.590 45.648 1.00 29.21 O HETATM12078 O HOH 142 57.062 33.390 25.580 1.00 46.78 O HETATM12079 O HOH 143 51.228 39.436 46.111 1.00 27.56 O HETATM12080 O HOH 144 52.543 43.395 45.570 1.00 26.20 O HETATM12081 O HOH 145 58.771 23.408 40.684 1.00 33.93 O HETATM12082 O HOH 146 57.869 47.378 33.151 1.00 32.00 O HETATM12083 O HOH 147 57.935 51.994 43.069 1.00 31.27 O HETATM12084 O HOH 148 66.512 27.046 41.431 1.00 33.70 O HETATM12085 O HOH 149 27.696 29.609 46.201 1.00 26.60 O HETATM12086 O HOH 150 31.922 31.455 51.606 1.00 33.90 O HETATM12087 O HOH 151 57.255 43.387 50.818 1.00 32.30 O HETATM12088 O HOH 152 54.229 45.735 42.059 1.00 28.69 O HETATM12089 O HOH 153 51.614 15.573 40.820 1.00 31.30 O HETATM12090 O HOH 154 63.005 23.988 38.723 1.00 31.95 O HETATM12091 O HOH 155 54.397 19.335 25.339 1.00 34.87 O HETATM12092 O HOH 156 27.816 31.106 32.997 1.00 27.02 O HETATM12093 O HOH 157 48.788 28.753 33.994 1.00 34.49 O HETATM12094 O HOH 158 44.536 26.575 55.601 1.00 31.45 O HETATM12095 O HOH 159 43.752 59.496 43.070 1.00 34.63 O HETATM12096 O HOH 160 45.583 39.217 29.020 1.00 44.26 O HETATM12097 O HOH 161 24.624 42.179 25.934 1.00 30.93 O HETATM12098 O HOH 162 27.931 32.426 27.096 1.00 32.38 O HETATM12099 O HOH 163 59.101 45.570 41.039 1.00 42.40 O HETATM12100 O HOH 164 58.899 41.903 52.614 1.00 35.57 O HETATM12101 O HOH 165 23.543 38.847 35.016 1.00 33.81 O HETATM12102 O HOH 166 28.164 58.268 22.138 1.00 41.40 O HETATM12103 O HOH 167 44.959 59.075 36.287 1.00 35.76 O HETATM12104 O HOH 168 43.606 17.535 11.457 1.00 40.94 O HETATM12105 O HOH 169 62.239 47.704 49.267 1.00 43.99 O HETATM12106 O HOH 170 54.663 19.858 28.013 1.00 41.01 O HETATM12107 O HOH 171 46.250 41.032 18.270 1.00 27.61 O HETATM12108 O HOH 172 39.878 20.635 41.485 1.00 41.20 O HETATM12109 O HOH 173 38.088 50.559 11.963 1.00 32.98 O HETATM12110 O HOH 174 51.930 27.807 9.541 1.00 36.44 O HETATM12111 O HOH 175 22.025 50.273 51.306 1.00 41.09 O HETATM12112 O HOH 176 45.154 33.305 53.181 1.00 39.84 O HETATM12113 O HOH 177 55.528 33.324 55.157 1.00 33.75 O HETATM12114 O HOH 178 32.155 26.655 26.526 1.00 33.02 O HETATM12115 O HOH 179 61.910 14.226 16.566 1.00 39.24 O HETATM12116 O HOH 180 43.544 53.726 19.882 1.00 28.82 O HETATM12117 O HOH 181 24.894 34.727 42.670 1.00 35.44 O HETATM12118 O HOH 182 35.178 57.195 33.701 1.00 43.78 O HETATM12119 O HOH 183 59.581 43.747 48.904 1.00 46.57 O HETATM12120 O HOH 184 37.219 25.791 14.246 1.00 33.61 O HETATM12121 O HOH 185 24.021 49.172 18.405 1.00 42.72 O HETATM12122 O HOH 186 59.005 20.002 47.328 1.00 32.95 O HETATM12123 O HOH 187 59.280 19.093 28.008 1.00 33.06 O HETATM12124 O HOH 188 53.645 38.593 60.919 1.00 39.58 O HETATM12125 O HOH 189 28.866 56.938 25.808 1.00 34.54 O HETATM12126 O HOH 190 66.361 17.918 10.211 1.00 38.10 O HETATM12127 O HOH 191 47.265 28.750 15.693 1.00 35.42 O HETATM12128 O HOH 192 55.550 35.989 54.997 1.00 35.38 O HETATM12129 O HOH 193 52.174 17.193 29.608 1.00 54.17 O HETATM12130 O HOH 194 57.747 15.889 20.498 1.00 40.68 O HETATM12131 O HOH 195 47.052 39.450 39.378 1.00 46.48 O HETATM12132 O HOH 196 23.609 24.320 44.705 1.00 35.60 O HETATM12133 O HOH 197 36.967 29.110 54.064 1.00 36.36 O HETATM12134 O HOH 198 54.550 36.812 57.338 1.00 37.64 O HETATM12135 O HOH 199 26.340 46.603 37.920 1.00 38.48 O HETATM12136 O HOH 200 30.030 25.132 43.406 1.00 37.17 O HETATM12137 O HOH 201 20.636 48.314 27.453 1.00 42.23 O HETATM12138 O HOH 202 58.824 17.574 26.021 1.00 51.75 O HETATM12139 O HOH 203 60.175 50.572 49.881 1.00 39.29 O HETATM12140 O HOH 204 44.193 19.462 49.437 1.00 43.03 O HETATM12141 O HOH 205 32.800 44.775 6.648 1.00 39.68 O HETATM12142 O HOH 206 50.823 41.601 55.292 1.00 36.68 O HETATM12143 O HOH 207 66.033 35.547 47.772 1.00 38.91 O HETATM12144 O HOH 208 21.125 45.667 31.538 1.00 40.64 O HETATM12145 O HOH 209 61.696 41.001 47.933 1.00 37.05 O HETATM12146 O HOH 210 29.236 49.456 15.318 1.00 36.67 O HETATM12147 O HOH 211 56.747 16.769 48.362 1.00 37.96 O HETATM12148 O HOH 212 33.434 57.235 37.699 1.00 38.97 O HETATM12149 O HOH 213 24.526 49.680 45.166 1.00 39.37 O HETATM12150 O HOH 214 26.747 31.830 39.846 1.00 41.15 O HETATM12151 O HOH 215 23.619 38.102 46.123 1.00 50.84 O HETATM12152 O HOH 216 37.851 55.712 31.352 1.00 46.60 O HETATM12153 O HOH 217 38.803 54.562 29.383 1.00 43.31 O HETATM12154 O HOH 218 37.323 19.154 23.172 1.00 45.07 O HETATM12155 O HOH 219 27.208 35.592 33.150 1.00 33.82 O HETATM12156 O HOH 220 59.193 52.435 45.811 1.00 35.64 O HETATM12157 O HOH 221 60.020 17.011 32.990 1.00 31.83 O HETATM12158 O HOH 222 52.868 55.700 45.189 1.00 37.23 O HETATM12159 O HOH 223 64.246 34.144 41.647 1.00 39.38 O HETATM12160 O HOH 224 51.061 20.978 54.806 1.00 46.27 O HETATM12161 O HOH 225 58.179 28.498 47.911 1.00 38.59 O HETATM12162 O HOH 226 47.295 21.186 20.157 1.00 39.73 O HETATM12163 O HOH 227 46.693 19.880 31.719 1.00 46.16 O HETATM12164 O HOH 228 58.215 14.948 33.542 1.00 35.94 O HETATM12165 O HOH 229 24.937 43.460 36.691 1.00 39.65 O HETATM12166 O HOH 230 42.972 21.041 29.400 1.00 37.79 O HETATM12167 O HOH 231 56.402 17.807 24.835 1.00 40.31 O HETATM12168 O HOH 232 28.858 32.595 18.892 1.00 44.55 O HETATM12169 O HOH 233 52.822 52.568 49.545 1.00 44.17 O HETATM12170 O HOH 234 39.348 51.897 13.839 1.00 32.65 O HETATM12171 O HOH 235 34.853 23.137 28.711 1.00 43.88 O HETATM12172 O HOH 236 31.956 24.523 39.422 1.00 32.53 O HETATM12173 O HOH 237 40.297 17.143 33.446 1.00 46.15 O HETATM12174 O HOH 238 35.650 59.678 24.802 1.00 40.85 O HETATM12175 O HOH 239 28.295 35.153 54.060 1.00 35.65 O HETATM12176 O HOH 240 48.896 20.464 18.191 1.00 48.65 O HETATM12177 O HOH 241 23.972 44.094 13.988 1.00 47.94 O HETATM12178 O HOH 242 58.164 26.388 49.617 1.00 40.43 O HETATM12179 O HOH 243 29.708 54.986 18.232 1.00 47.04 O HETATM12180 O HOH 244 56.189 45.232 52.174 1.00 38.11 O HETATM12181 O HOH 245 44.941 17.347 45.649 1.00 48.93 O HETATM12182 O HOH 246 29.575 20.243 18.187 1.00 61.91 O HETATM12183 O HOH 247 46.959 17.147 35.420 1.00 42.52 O HETATM12184 O HOH 248 42.722 18.702 34.062 1.00 50.19 O HETATM12185 O HOH 249 27.044 27.243 34.465 1.00 42.38 O HETATM12186 O HOH 250 41.097 59.098 47.122 1.00 45.31 O HETATM12187 O HOH 251 31.191 51.640 46.737 1.00 39.59 O HETATM12188 O HOH 252 23.088 37.367 32.781 1.00 42.81 O HETATM12189 O HOH 253 54.614 19.250 51.549 1.00 56.62 O HETATM12190 O HOH 254 22.046 42.331 12.851 1.00 60.72 O HETATM12191 O HOH 255 23.902 35.075 33.886 1.00 40.94 O HETATM12192 O HOH 256 59.187 20.663 9.117 1.00 41.14 O HETATM12193 O HOH 257 41.229 40.525 57.886 1.00 44.17 O HETATM12194 O HOH 258 22.902 40.720 47.816 1.00 41.87 O HETATM12195 O HOH 259 22.212 43.458 40.578 1.00 39.77 O HETATM12196 O HOH 260 21.546 40.722 25.376 1.00 54.98 O HETATM12197 O HOH 261 40.181 24.148 8.883 1.00 48.12 O HETATM12198 O HOH 262 61.067 22.074 40.435 1.00 43.93 O HETATM12199 O HOH 263 21.505 43.081 20.709 1.00 51.36 O HETATM12200 O HOH 264 31.374 58.289 38.901 1.00 46.83 O HETATM12201 O HOH 265 40.386 28.830 13.587 1.00 34.45 O HETATM12202 O HOH 266 35.169 28.329 56.325 1.00 43.07 O HETATM12203 O HOH 267 26.454 36.857 19.714 1.00 45.42 O HETATM12204 O HOH 268 33.077 47.271 56.439 1.00 53.61 O HETATM12205 O HOH 269 41.914 35.966 59.489 1.00 52.53 O HETATM12206 O HOH 270 39.222 60.550 19.833 1.00 47.27 O HETATM12207 O HOH 271 26.279 59.527 28.955 1.00 52.92 O HETATM12208 O HOH 272 25.380 45.664 6.962 1.00 49.78 O HETATM12209 O HOH 273 54.955 24.230 52.110 1.00 44.82 O HETATM12210 O HOH 274 39.784 63.116 39.110 1.00 58.65 O HETATM12211 O HOH 275 58.842 43.210 55.102 1.00 43.52 O HETATM12212 O HOH 276 22.805 44.194 48.900 1.00 42.58 O HETATM12213 O HOH 277 36.682 22.446 42.245 1.00 60.50 O HETATM12214 O HOH 278 44.513 16.016 43.864 1.00 38.02 O HETATM12215 O HOH 279 30.148 36.223 12.956 1.00 42.88 O HETATM12216 O HOH 280 52.520 19.772 29.712 1.00 34.95 O HETATM12217 O HOH 281 21.338 36.775 28.987 1.00 46.72 O HETATM12218 O HOH 282 36.336 27.276 52.267 1.00 41.02 O HETATM12219 O HOH 283 55.128 36.240 36.416 1.00 23.73 O HETATM12220 O HOH 284 43.507 56.517 24.193 1.00 48.08 O HETATM12221 O HOH 285 49.777 22.757 27.181 1.00 28.24 O HETATM12222 O HOH 286 25.870 30.966 44.895 1.00 33.69 O HETATM12223 O HOH 287 27.233 33.446 31.586 1.00 33.84 O HETATM12224 O HOH 288 56.691 15.842 22.882 1.00 35.60 O HETATM12225 O HOH 289 26.756 27.105 46.749 1.00 36.66 O HETATM12226 O HOH 290 45.079 17.206 13.084 1.00 42.11 O HETATM12227 O HOH 291 53.337 45.890 44.554 1.00 37.67 O HETATM12228 O HOH 292 59.651 17.436 30.002 1.00 37.10 O HETATM12229 O HOH 293 24.223 26.259 46.699 1.00 34.59 O HETATM12230 O HOH 294 35.577 22.628 37.225 1.00 37.89 O HETATM12231 O HOH 295 59.853 23.091 49.919 1.00 46.49 O HETATM12232 O HOH 296 38.641 27.868 15.410 1.00 37.14 O HETATM12233 O HOH 297 30.752 50.913 49.213 1.00 44.42 O HETATM12234 O HOH 298 28.638 29.096 29.309 1.00 35.10 O HETATM12235 O HOH 299 26.146 32.333 42.523 1.00 41.89 O HETATM12236 O HOH 300 38.237 23.469 10.145 1.00 49.82 O HETATM12237 O HOH 301 42.466 38.550 58.498 1.00 41.11 O HETATM12238 O HOH 302 23.578 41.670 35.037 1.00 44.58 O HETATM12239 O HOH 303 51.800 13.684 42.827 1.00 44.67 O HETATM12240 O HOH 304 44.495 20.609 32.275 1.00 50.32 O HETATM12241 O HOH 305 56.449 13.376 43.758 1.00 42.54 O HETATM12242 O HOH 306 39.660 59.077 24.941 1.00 40.14 O HETATM12243 O HOH 307 44.887 20.159 10.584 1.00 43.10 O HETATM12244 O HOH 308 27.762 25.310 39.170 1.00 45.40 O HETATM12245 O HOH 309 33.829 57.050 31.484 1.00 41.33 O HETATM12246 O HOH 310 55.684 28.579 55.210 1.00 36.92 O HETATM12247 O HOH 311 26.233 47.181 15.605 1.00 35.34 O HETATM12248 O HOH 312 33.701 29.720 52.417 1.00 43.06 O HETATM12249 O HOH 313 31.363 23.272 37.505 1.00 47.83 O HETATM12250 O HOH 314 39.187 54.438 13.561 1.00 44.49 O HETATM12251 O HOH 315 32.909 40.470 8.834 1.00 49.23 O HETATM12252 O HOH 316 32.000 24.014 35.167 1.00 43.90 O HETATM12253 O HOH 317 43.400 58.369 47.935 1.00 50.79 O HETATM12254 O HOH 318 64.442 13.152 11.243 1.00 49.99 O HETATM12255 O HOH 319 42.815 20.038 27.195 1.00 43.55 O HETATM12256 O HOH 320 44.924 17.435 33.467 1.00 53.73 O HETATM12257 O HOH 321 35.795 45.922 57.118 1.00 52.33 O HETATM12258 O HOH 322 26.625 58.154 26.427 1.00 46.94 O HETATM12259 O HOH 323 64.678 17.668 41.365 1.00 47.50 O HETATM12260 O HOH 324 23.631 42.971 17.586 1.00 53.29 O HETATM12261 O HOH 325 37.734 23.967 48.965 1.00 46.98 O HETATM12262 O HOH 326 27.493 54.981 19.371 1.00 49.20 O HETATM12263 O HOH 327 32.533 28.433 23.917 1.00 48.88 O HETATM12264 O HOH 328 48.115 36.059 63.247 1.00 59.44 O HETATM12265 O HOH 329 55.282 38.703 58.904 1.00 56.01 O HETATM12266 O HOH 330 32.540 41.928 6.664 1.00 50.52 O HETATM12267 O HOH 331 29.324 27.257 28.023 1.00 44.00 O HETATM12268 O HOH 332 58.882 39.027 52.955 1.00 43.81 O HETATM12269 O HOH 333 28.427 25.341 45.426 1.00 41.08 O HETATM12270 O HOH 334 59.209 14.298 16.706 1.00 48.93 O HETATM12271 O HOH 335 69.345 20.010 14.846 1.00 50.30 O HETATM12272 O HOH 336 55.417 14.755 18.606 1.00 60.40 O HETATM12273 O HOH 337 66.500 37.490 46.154 1.00 43.77 O HETATM12274 O HOH 338 39.548 18.491 23.614 1.00 51.40 O HETATM12275 O HOH 339 32.733 27.632 54.031 1.00 64.65 O HETATM12276 O HOH 340 21.110 41.208 22.973 1.00 56.85 O HETATM12277 O HOH 341 48.505 21.034 56.029 1.00 47.10 O HETATM12278 O HOH 342 30.580 58.861 20.383 1.00 48.64 O HETATM12279 O HOH 343 55.261 34.796 58.881 1.00 55.09 O HETATM12280 O HOH 344 53.591 25.823 57.190 1.00 43.26 O HETATM12281 O HOH 345 54.792 12.823 41.920 1.00 48.74 O HETATM12282 O HOH 346 30.806 50.948 53.739 1.00 51.20 O HETATM12283 O HOH 347 32.659 47.833 51.312 1.00 48.39 O HETATM12284 O HOH 348 37.649 19.630 10.958 1.00 39.08 O HETATM12285 O HOH 349 30.542 27.231 51.508 1.00 44.26 O HETATM12286 O HOH 350 66.540 47.887 48.186 1.00 52.58 O HETATM12287 O HOH 351 38.870 29.653 11.894 1.00 51.99 O HETATM12288 O HOH 352 63.659 41.718 46.625 1.00 50.45 O HETATM12289 O HOH 353 62.321 17.054 27.856 1.00 41.79 O HETATM12290 O HOH 354 45.935 27.251 8.598 1.00 48.55 O HETATM12291 O HOH 355 69.288 16.765 11.533 1.00 52.82 O HETATM12292 O HOH 356 30.919 57.710 33.722 1.00 50.60 O HETATM12293 O HOH 357 24.991 46.003 11.948 1.00 51.15 O HETATM12294 O HOH 358 43.668 24.176 56.573 1.00 52.74 O HETATM12295 O HOH 359 58.283 36.955 55.112 1.00 53.25 O HETATM12296 O HOH 360 53.223 55.332 48.193 1.00 45.53 O HETATM12297 O HOH 361 55.080 16.848 29.112 1.00 41.26 O HETATM12298 O HOH 362 24.738 33.659 28.199 1.00 56.33 O HETATM12299 O HOH 363 26.018 41.415 6.707 1.00 54.94 O HETATM12300 O HOH 364 48.428 20.863 22.837 1.00 52.65 O HETATM12301 O HOH 365 42.865 18.893 46.035 1.00 56.79 O HETATM12302 O HOH 366 44.947 19.873 20.565 1.00 44.08 O HETATM12303 O HOH 367 41.778 24.816 52.605 1.00 42.47 O HETATM12304 O HOH 368 38.974 58.518 50.211 1.00 45.99 O HETATM12305 O HOH 369 61.081 31.659 48.221 1.00 45.34 O HETATM12306 O HOH 370 41.779 32.500 61.305 1.00 52.83 O HETATM12307 O HOH 371 59.011 55.597 46.276 1.00 64.20 O HETATM12308 O HOH 372 53.793 42.741 43.197 1.00 45.64 O HETATM12309 O HOH 373 61.544 53.801 42.193 1.00 58.01 O HETATM12310 O HOH 374 20.369 37.265 32.717 1.00 48.47 O HETATM12311 O HOH 375 58.407 30.854 47.267 1.00 42.31 O HETATM12312 O HOH 376 27.078 37.587 14.555 1.00 54.76 O HETATM12313 O HOH 377 44.561 13.701 42.836 1.00 50.98 O HETATM12314 O HOH 378 23.446 44.885 38.114 1.00 56.48 O HETATM12315 O HOH 379 18.401 49.082 25.925 1.00 52.48 O HETATM12316 O HOH 380 39.581 46.185 59.137 1.00 61.04 O HETATM12317 O HOH 381 51.234 30.785 61.579 1.00 47.07 O HETATM12318 O HOH 382 51.622 21.296 16.553 1.00 57.98 O HETATM12319 O HOH 383 40.116 24.261 50.806 1.00 44.93 O HETATM12320 O HOH 384 43.313 42.432 59.763 1.00 55.05 O HETATM12321 O HOH 385 40.952 17.465 30.725 1.00 62.12 O HETATM12322 O HOH 386 39.021 57.757 16.222 1.00 46.58 O HETATM12323 O HOH 387 35.802 52.942 11.658 1.00 52.71 O HETATM12324 O HOH 388 68.785 18.356 16.648 1.00 50.19 O HETATM12325 O HOH 389 28.141 36.701 16.536 1.00 54.80 O HETATM12326 O HOH 390 59.028 14.719 26.265 1.00 46.56 O HETATM12327 O HOH 391 54.481 19.044 16.971 1.00 45.75 O HETATM12328 O HOH 392 22.129 37.161 40.838 1.00 52.10 O HETATM12329 O HOH 393 33.523 36.439 8.072 1.00 58.08 O HETATM12330 O HOH 394 51.168 18.755 10.417 1.00 63.50 O HETATM12331 O HOH 395 44.336 18.161 18.260 1.00 41.54 O HETATM12332 O HOH 396 25.634 29.289 33.044 1.00 51.50 O HETATM12333 O HOH 397 56.137 30.731 58.867 1.00 59.74 O HETATM12334 O HOH 398 61.605 51.632 45.785 1.00 54.31 O HETATM12335 O HOH 399 31.692 25.001 29.607 1.00 56.48 O HETATM12336 O HOH 400 43.026 26.969 7.020 1.00 57.02 O HETATM12337 O HOH 401 44.975 58.560 45.541 1.00 59.69 O HETATM12338 O HOH 402 65.923 43.478 38.976 1.00 46.23 O HETATM12339 O HOH 403 29.341 40.259 3.048 1.00 59.08 O HETATM12340 O HOH 404 65.185 15.430 1.699 1.00 51.72 O HETATM12341 O HOH 405 21.617 38.001 36.594 1.00 56.30 O HETATM12342 O HOH 406 60.841 37.794 51.713 1.00 36.26 O HETATM12343 O HOH 407 49.976 16.913 27.760 1.00 66.50 O HETATM12344 O HOH 408 53.316 41.768 60.086 1.00 64.19 O HETATM12345 O HOH 409 62.775 11.796 15.679 1.00 59.04 O HETATM12346 O HOH 410 35.631 18.783 13.414 1.00 47.12 O HETATM12347 O HOH 411 56.118 13.158 32.157 1.00 45.12 O HETATM12348 O HOH 412 29.222 53.844 15.181 1.00 56.68 O HETATM12349 O HOH 413 36.633 54.410 29.952 1.00 45.55 O HETATM12350 O HOH 414 37.712 59.119 27.283 1.00 52.41 O HETATM12351 O HOH 415 38.628 40.733 58.822 1.00 51.76 O HETATM12352 O HOH 416 29.859 56.304 46.072 1.00 51.13 O HETATM12353 O HOH 417 26.559 23.706 41.667 1.00 63.15 O HETATM12354 O HOH 418 61.234 34.991 51.650 1.00 44.82 O HETATM12355 O HOH 419 49.884 59.125 43.472 1.00 41.19 O HETATM12356 O HOH 420 65.745 39.606 47.488 1.00 42.10 O HETATM12357 O HOH 421 52.623 14.726 45.965 1.00 46.86 O HETATM12358 O HOH 422 28.247 23.568 37.430 1.00 50.08 O HETATM12359 O HOH 423 40.374 18.381 26.710 1.00 49.42 O HETATM12360 O HOH 424 24.509 32.735 31.448 1.00 55.85 O HETATM12361 O HOH 425 33.628 57.009 16.954 1.00 52.57 O HETATM12362 O HOH 426 45.779 61.585 19.083 1.00 57.96 O HETATM12363 O HOH 427 57.155 15.668 30.047 1.00 60.42 O HETATM12364 O HOH 428 48.346 24.153 57.681 1.00 59.16 O HETATM12365 O HOH 429 20.794 38.730 38.900 1.00 48.69 O HETATM12366 O HOH 430 26.188 27.346 37.872 1.00 48.52 O HETATM12367 O HOH 431 58.453 41.631 57.448 1.00 53.20 O HETATM12368 O HOH 432 25.479 48.856 12.848 1.00 54.76 O HETATM12369 O HOH 433 53.861 30.636 61.595 1.00 52.72 O HETATM12370 O HOH 434 28.153 37.542 11.180 1.00 61.58 O HETATM12371 O HOH 435 33.248 22.267 41.464 1.00 73.01 O HETATM12372 O HOH 436 24.455 51.124 17.078 1.00 61.08 O HETATM12373 O HOH 437 43.125 26.339 60.936 1.00 62.88 O HETATM12374 O HOH 438 63.544 32.906 49.622 1.00 59.96 O HETATM12375 O HOH 439 18.164 51.409 27.914 1.00 66.00 O HETATM12376 O HOH 440 26.272 28.815 30.381 1.00 53.04 O HETATM12377 O HOH 441 51.910 17.970 24.627 1.00 58.81 O HETATM12378 O HOH 442 58.291 28.556 53.869 1.00 53.43 O HETATM12379 O HOH 443 60.449 33.301 49.755 1.00 47.35 O HETATM12380 O HOH 444 42.965 22.273 52.620 1.00 56.24 O HETATM12381 O HOH 445 50.512 57.066 44.900 1.00 50.69 O HETATM12382 O HOH 446 36.198 17.372 26.898 1.00 57.24 O HETATM12383 O HOH 447 48.740 15.547 48.134 1.00 47.32 O HETATM12384 O HOH 448 34.607 28.954 13.562 1.00 49.64 O HETATM12385 O HOH 449 52.735 60.888 42.672 1.00 53.88 O HETATM12386 O HOH 450 32.846 37.441 56.006 1.00 47.40 O HETATM12387 O HOH 451 63.606 30.707 48.862 1.00 42.65 O HETATM12388 O HOH 452 28.195 50.502 13.078 1.00 52.62 O HETATM12389 O HOH 453 38.458 53.510 31.313 1.00 56.79 O HETATM12390 O HOH 454 20.700 42.405 35.306 1.00 66.66 O HETATM12391 O HOH 455 45.819 15.739 14.995 1.00 53.98 O HETATM12392 O HOH 456 46.793 17.343 17.710 1.00 52.25 O HETATM12393 O HOH 457 28.579 32.873 54.152 1.00 56.03 O HETATM12394 O HOH 458 39.637 43.664 6.746 1.00 29.18 O HETATM12395 O HOH 459 28.657 56.783 35.357 1.00 52.30 O HETATM12396 O HOH 460 27.771 56.949 44.416 1.00 61.36 O HETATM12397 O HOH 461 51.637 44.472 58.781 1.00 53.68 O HETATM12398 O HOH 462 36.395 30.017 11.344 1.00 52.83 O HETATM12399 O HOH 463 48.218 19.222 28.185 1.00 63.96 O HETATM12400 O HOH 464 58.789 11.585 43.989 1.00 64.53 O HETATM12401 O HOH 465 22.531 37.901 49.191 1.00 52.77 O HETATM12402 O HOH 466 35.150 31.913 9.966 1.00 52.86 O HETATM12403 O HOH 467 59.921 34.797 54.163 1.00 53.24 O HETATM12404 O HOH 468 62.798 12.118 40.173 1.00 54.03 O HETATM12405 O HOH 469 29.619 39.358 8.949 1.00 71.19 O HETATM12406 O HOH 470 51.527 27.545 51.701 1.00 24.53 O HETATM12407 O HOH 471 35.270 37.366 56.231 1.00 59.88 O HETATM12408 O HOH 472 58.601 31.990 49.529 1.00 45.37 O HETATM12409 O HOH 473 46.153 15.999 47.346 1.00 51.34 O HETATM12410 O HOH 474 24.165 46.670 17.065 1.00 48.76 O HETATM12411 O HOH 475 41.126 24.559 6.285 1.00 62.57 O HETATM12412 O HOH 476 52.687 12.525 38.433 1.00 61.76 O HETATM12413 O HOH 477 44.124 16.834 38.944 1.00 59.46 O HETATM12414 O HOH 478 29.608 28.727 24.247 1.00 54.56 O HETATM12415 O HOH 479 35.776 22.265 39.485 1.00 56.48 O HETATM12416 O HOH 480 56.827 18.849 16.626 1.00 50.48 O HETATM12417 O HOH 481 26.948 34.602 18.101 1.00 69.27 O HETATM12418 O HOH 482 64.791 21.517 6.659 1.00 62.94 O HETATM12419 O HOH 483 35.652 38.121 59.632 1.00 58.93 O HETATM12420 O HOH 484 40.061 62.150 41.868 1.00 64.03 O HETATM12421 O HOH 485 62.792 52.128 43.284 1.00 60.22 O HETATM12422 O HOH 486 48.919 29.770 59.583 1.00 39.45 O HETATM12423 O HOH 487 21.910 35.089 36.396 1.00 60.87 O HETATM12424 O HOH 488 50.769 23.591 58.785 1.00 67.50 O HETATM12425 O HOH 489 45.565 19.673 29.728 1.00 70.38 O HETATM12426 O HOH 490 57.535 11.105 31.901 1.00 63.91 O HETATM12427 O HOH 491 54.811 32.499 23.265 1.00 56.74 O HETATM12428 O HOH 492 36.609 21.143 9.605 1.00 57.45 O HETATM12429 O HOH 493 34.222 20.706 34.862 1.00 59.09 O HETATM12430 O HOH 494 23.153 59.252 29.628 1.00 60.68 O HETATM12431 O HOH 495 41.927 42.780 62.063 1.00 64.84 O HETATM12432 O HOH 496 31.821 48.725 6.334 1.00 64.02 O HETATM12433 O HOH 497 20.857 42.049 18.524 1.00 74.67 O HETATM12434 O HOH 498 26.657 48.824 51.231 1.00 45.38 O HETATM12435 O HOH 499 41.730 17.047 44.075 1.00 67.31 O HETATM12436 O HOH 500 53.766 14.910 50.340 1.00 59.22 O HETATM12437 O HOH 501 36.907 32.695 7.370 1.00 70.82 O HETATM12438 O HOH 502 56.431 24.519 53.865 1.00 79.21 O HETATM12439 O HOH 503 46.926 19.617 26.020 1.00 76.84 O HETATM12440 O HOH 504 71.817 54.136 32.717 1.00 64.47 O HETATM12441 O HOH 505 71.223 62.876 3.299 1.00 67.44 O HETATM12442 O HOH 506 76.782 49.593 22.475 1.00 55.18 O HETATM12443 O HOH 507 83.819 45.416 26.231 1.00 59.27 O HETATM12444 O HOH 508 50.289 62.023 -9.397 1.00 58.93 O HETATM12445 O HOH 509 73.465 54.751 -4.441 1.00 63.01 O HETATM12446 O HOH 510 77.850 48.645 33.792 1.00 64.07 O HETATM12447 O HOH 511 44.795 60.031 -4.224 1.00 63.16 O HETATM12448 O HOH 512 56.250 69.228 33.445 1.00 72.13 O HETATM12449 O HOH 513 72.392 21.401 28.967 1.00 61.72 O HETATM12450 O HOH 514 61.837 31.434 -9.451 1.00 62.37 O HETATM12451 O HOH 515 80.581 43.669 10.269 1.00 54.69 O HETATM12452 O HOH 516 86.073 42.449 15.712 1.00 59.45 O HETATM12453 O HOH 517 51.404 31.477 -6.921 1.00 69.80 O HETATM12454 O HOH 518 78.468 40.170 7.652 1.00 65.27 O HETATM12455 O HOH 519 76.025 49.659 -1.127 1.00 54.85 O HETATM12456 O HOH 520 77.087 29.055 0.796 1.00 55.79 O HETATM12457 O HOH 521 80.834 39.083 12.482 1.00 67.53 O HETATM12458 O HOH 522 38.965 51.746 0.851 1.00 69.56 O HETATM12459 O HOH 523 43.826 39.325 -6.872 1.00 68.74 O HETATM12460 O HOH 524 71.703 64.924 23.220 1.00 70.69 O HETATM12461 O HOH 525 49.697 60.344 -11.036 1.00 64.29 O HETATM12462 O HOH 526 79.800 47.649 17.882 1.00 65.06 O HETATM12463 O HOH 527 46.613 70.846 19.158 1.00 65.17 O HETATM12464 O HOH 528 73.358 31.982 26.969 1.00 55.71 O HETATM12465 O HOH 529 67.365 71.653 19.796 1.00 58.71 O HETATM12466 O HOH 530 67.341 70.979 17.631 1.00 64.98 O HETATM12467 O HOH 531 75.737 59.510 8.149 1.00 67.14 O HETATM12468 O HOH 532 50.443 71.939 8.869 1.00 70.71 O HETATM12469 O HOH 533 72.209 24.579 36.897 1.00 61.91 O HETATM12470 O HOH 534 78.354 27.157 15.094 1.00 64.11 O HETATM12471 O HOH 535 41.443 42.209 -5.901 1.00 74.09 O HETATM12472 O HOH 536 37.362 42.000 -3.465 1.00 60.68 O HETATM12473 O HOH 537 73.882 62.513 10.330 1.00 55.95 O HETATM12474 O HOH 538 58.909 77.149 23.135 1.00 67.26 O HETATM12475 O HOH 539 39.456 64.813 5.673 1.00 74.40 O HETATM12476 O HOH 540 53.039 74.041 8.163 1.00 61.65 O HETATM12477 O HOH 541 51.605 55.688 -18.709 1.00 66.50 O HETATM12478 O HOH 542 72.195 40.175 41.120 1.00 50.27 O HETATM12479 O HOH 543 80.038 39.044 31.012 1.00 52.49 O HETATM12480 O HOH 544 43.000 60.541 34.050 1.00 64.21 O HETATM12481 O HOH 545 48.759 42.979 -6.596 1.00 54.02 O HETATM12482 O HOH 546 41.191 60.499 4.757 1.00 61.52 O HETATM12483 O HOH 547 47.771 48.649 -11.748 1.00 63.97 O HETATM12484 O HOH 548 73.902 38.432 23.290 1.00 54.98 O HETATM12485 O HOH 549 45.303 68.703 7.514 1.00 63.60 O HETATM12486 O HOH 550 48.366 40.143 -8.289 1.00 63.15 O HETATM12487 O HOH 551 76.351 61.142 11.904 1.00 60.24 O HETATM12488 O HOH 552 67.267 56.393 38.687 1.00 68.72 O HETATM12489 O HOH 553 66.592 43.508 -14.610 1.00 60.76 O HETATM12490 O HOH 554 45.360 65.636 30.221 1.00 60.32 O HETATM12491 O HOH 555 71.348 25.044 34.488 1.00 59.49 O HETATM12492 O HOH 556 72.875 47.427 36.896 1.00 70.42 O HETATM12493 O HOH 557 65.889 75.479 26.687 1.00 76.58 O HETATM12494 O HOH 558 73.660 20.465 24.745 1.00 71.01 O HETATM12495 O HOH 559 40.600 63.501 12.893 1.00 69.79 O HETATM12496 O HOH 560 84.784 41.239 2.828 1.00 65.08 O HETATM12497 O HOH 561 76.551 28.140 -2.199 1.00 73.20 O HETATM12498 O HOH 562 66.162 39.897 -15.830 1.00 70.01 O HETATM12499 O HOH 563 79.610 32.231 16.580 1.00 59.82 O HETATM12500 O HOH 564 41.768 65.816 12.868 1.00 65.44 O HETATM12501 O HOH 565 77.152 43.761 42.110 1.00 64.77 O HETATM12502 O HOH 566 64.913 70.705 6.518 1.00 68.38 O HETATM12503 O HOH 567 54.776 72.589 14.744 1.00 66.49 O HETATM12504 O HOH 568 70.496 9.550 26.871 1.00 61.07 O HETATM12505 O HOH 569 44.443 67.768 10.020 1.00 55.11 O HETATM12506 O HOH 570 62.913 37.334 -19.553 1.00 64.49 O HETATM12507 O HOH 571 61.423 38.130 -15.739 1.00 81.56 O HETATM12508 O HOH 572 61.984 71.377 34.956 1.00 61.67 O HETATM12509 O HOH 573 63.989 25.449 -4.115 1.00 58.35 O HETATM12510 O HOH 574 62.748 70.170 14.232 1.00 72.08 O HETATM12511 O HOH 575 40.180 51.343 -6.020 1.00 74.19 O HETATM12512 O HOH 576 78.789 37.667 28.426 1.00 60.80 O HETATM12513 O HOH 577 43.524 72.365 24.156 1.00 70.60 O HETATM12514 O HOH 578 43.907 62.703 -5.599 1.00 70.39 O HETATM12515 O HOH 579 39.721 61.155 32.359 1.00 72.29 O HETATM12516 O HOH 580 64.499 36.614 -15.494 1.00 84.33 O HETATM12517 O HOH 581 68.983 46.948 39.604 1.00 81.74 O HETATM12518 O HOH 582 81.436 34.707 14.720 1.00 69.85 O HETATM12519 O HOH 583 42.986 38.256 -9.602 1.00 86.99 O HETATM12520 O HOH 584 68.073 68.775 9.629 1.00 71.29 O HETATM12521 O HOH 585 42.242 62.783 35.094 1.00 78.14 O HETATM12522 O HOH 586 78.737 51.282 15.505 1.00 63.70 O HETATM12523 O HOH 587 74.056 70.705 38.989 1.00 67.16 O HETATM12524 O HOH 588 74.023 17.635 5.587 1.00 66.00 O HETATM12525 O HOH 589 70.241 41.032 43.620 1.00126.68 O HETATM12526 O HOH 590 77.945 35.782 17.188 1.00 74.78 O HETATM12527 O HOH 591 85.294 29.835 4.562 1.00 64.11 O HETATM12528 O HOH 592 57.157 54.233 -11.808 1.00 65.73 O HETATM12529 O HOH 593 45.406 69.545 27.215 1.00 57.73 O HETATM12530 O HOH 594 57.108 49.204 7.241 1.00 7.39 O HETATM12531 O HOH 595 59.454 44.688 26.534 1.00 20.89 O HETATM12532 O HOH 596 56.952 45.125 14.232 1.00 22.13 O HETATM12533 O HOH 597 45.627 53.113 24.678 1.00 33.50 O HETATM12534 O HOH 598 63.054 37.426 19.597 1.00 22.29 O HETATM12535 O HOH 599 65.247 33.559 4.559 1.00 25.31 O HETATM12536 O HOH 600 69.519 41.874 0.976 1.00 23.02 O HETATM12537 O HOH 601 62.395 39.782 3.762 1.00 24.89 O HETATM12538 O HOH 602 51.694 49.641 33.559 1.00 26.31 O HETATM12539 O HOH 603 44.968 42.905 4.108 1.00 28.64 O HETATM12540 O HOH 604 60.079 48.036 4.897 1.00 23.06 O HETATM12541 O HOH 605 53.398 38.146 19.072 1.00 20.20 O HETATM12542 O HOH 606 55.869 27.764 12.240 1.00 25.84 O HETATM12543 O HOH 607 57.252 45.100 31.946 1.00 25.39 O HETATM12544 O HOH 608 74.965 45.194 12.923 1.00 26.38 O HETATM12545 O HOH 609 42.094 52.295 14.003 1.00 27.50 O HETATM12546 O HOH 610 72.066 39.082 15.730 1.00 28.29 O HETATM12547 O HOH 611 42.286 38.911 11.708 1.00 27.48 O HETATM12548 O HOH 612 62.408 44.839 9.301 1.00 24.93 O HETATM12549 O HOH 613 67.462 31.689 31.502 1.00 23.59 O HETATM12550 O HOH 614 72.227 55.446 17.676 1.00 28.62 O HETATM12551 O HOH 615 43.293 37.168 9.361 1.00 26.97 O HETATM12552 O HOH 616 68.424 39.320 1.245 1.00 30.45 O HETATM12553 O HOH 617 69.875 34.657 23.919 1.00 24.34 O HETATM12554 O HOH 618 44.685 58.829 23.285 1.00 25.23 O HETATM12555 O HOH 619 53.942 38.656 11.599 1.00 24.27 O HETATM12556 O HOH 620 44.680 33.074 13.298 1.00 20.00 O HETATM12557 O HOH 621 62.107 36.298 -1.258 1.00 27.24 O HETATM12558 O HOH 622 54.539 35.691 21.491 1.00 21.43 O HETATM12559 O HOH 623 66.278 34.041 7.112 1.00 26.16 O HETATM12560 O HOH 624 66.787 34.808 21.129 1.00 27.25 O HETATM12561 O HOH 625 70.921 33.100 19.380 1.00 26.35 O HETATM12562 O HOH 626 56.961 36.739 10.005 1.00 27.33 O HETATM12563 O HOH 627 51.455 47.468 -8.364 1.00 32.08 O HETATM12564 O HOH 628 54.047 39.517 4.303 1.00 30.06 O HETATM12565 O HOH 629 73.973 39.490 8.819 1.00 29.99 O HETATM12566 O HOH 630 76.653 40.424 17.449 1.00 31.00 O HETATM12567 O HOH 631 71.889 21.389 11.091 1.00 31.17 O HETATM12568 O HOH 632 50.574 64.812 17.365 1.00 31.70 O HETATM12569 O HOH 633 45.089 56.701 34.466 1.00 30.37 O HETATM12570 O HOH 634 70.083 66.891 -4.170 1.00 27.73 O HETATM12571 O HOH 635 69.181 46.151 -6.620 1.00 33.44 O HETATM12572 O HOH 636 47.840 36.683 8.838 1.00 32.92 O HETATM12573 O HOH 637 45.556 55.332 25.845 1.00 24.10 O HETATM12574 O HOH 638 63.130 47.486 7.209 1.00 27.09 O HETATM12575 O HOH 639 53.642 54.337 -6.202 1.00 39.86 O HETATM12576 O HOH 640 63.467 27.490 5.292 1.00 27.04 O HETATM12577 O HOH 641 70.939 57.612 19.002 1.00 27.50 O HETATM12578 O HOH 642 65.200 52.377 39.493 1.00 35.37 O HETATM12579 O HOH 643 76.856 52.844 7.670 1.00 28.80 O HETATM12580 O HOH 644 53.030 43.139 2.785 1.00 29.21 O HETATM12581 O HOH 645 56.774 33.224 22.853 1.00 46.78 O HETATM12582 O HOH 646 54.455 41.299 2.322 1.00 27.56 O HETATM12583 O HOH 647 50.369 42.140 2.863 1.00 26.20 O HETATM12584 O HOH 648 64.565 26.753 7.749 1.00 33.93 O HETATM12585 O HOH 649 44.257 39.519 15.282 1.00 32.00 O HETATM12586 O HOH 650 40.226 41.770 5.364 1.00 31.27 O HETATM12587 O HOH 651 57.544 21.868 7.002 1.00 33.70 O HETATM12588 O HOH 652 74.732 56.765 2.232 1.00 26.60 O HETATM12589 O HOH 653 71.020 54.028 -3.173 1.00 33.90 O HETATM12590 O HOH 654 48.020 38.055 -2.385 1.00 32.30 O HETATM12591 O HOH 655 47.500 41.850 6.374 1.00 28.69 O HETATM12592 O HOH 656 74.928 29.034 7.613 1.00 31.30 O HETATM12593 O HOH 657 61.945 23.376 9.710 1.00 31.95 O HETATM12594 O HOH 658 70.279 28.504 23.094 1.00 34.87 O HETATM12595 O HOH 659 73.375 57.410 15.436 1.00 27.02 O HETATM12596 O HOH 660 64.927 38.071 14.439 1.00 34.49 O HETATM12597 O HOH 661 68.939 40.664 -7.168 1.00 31.45 O HETATM12598 O HOH 662 40.821 57.804 5.363 1.00 34.63 O HETATM12599 O HOH 663 57.468 46.079 19.413 1.00 44.26 O HETATM12600 O HOH 664 65.382 65.711 22.499 1.00 30.93 O HETATM12601 O HOH 665 72.175 57.970 21.337 1.00 32.38 O HETATM12602 O HOH 666 45.207 37.548 7.394 1.00 42.40 O HETATM12603 O HOH 667 48.483 35.890 -4.181 1.00 35.57 O HETATM12604 O HOH 668 68.808 64.981 13.417 1.00 33.81 O HETATM12605 O HOH 669 49.678 70.689 26.295 1.00 41.40 O HETATM12606 O HOH 670 40.582 56.548 12.146 1.00 35.76 O HETATM12607 O HOH 671 77.233 36.950 36.976 1.00 40.94 O HETATM12608 O HOH 672 41.790 35.898 -0.834 1.00 43.99 O HETATM12609 O HOH 673 69.693 28.536 20.420 1.00 41.01 O HETATM12610 O HOH 674 55.562 46.408 30.163 1.00 27.61 O HETATM12611 O HOH 675 76.413 41.728 6.948 1.00 41.20 O HETATM12612 O HOH 676 51.393 58.240 36.470 1.00 32.98 O HETATM12613 O HOH 677 64.175 34.877 38.892 1.00 36.44 O HETATM12614 O HOH 678 59.672 72.008 -2.873 1.00 41.09 O HETATM12615 O HOH 679 62.802 43.494 -4.748 1.00 39.84 O HETATM12616 O HOH 680 57.599 34.519 -6.724 1.00 33.75 O HETATM12617 O HOH 681 75.061 51.427 21.907 1.00 33.02 O HETATM12618 O HOH 682 70.947 19.444 31.867 1.00 39.24 O HETATM12619 O HOH 683 45.922 55.099 28.551 1.00 28.82 O HETATM12620 O HOH 684 71.701 61.751 5.763 1.00 35.44 O HETATM12621 O HOH 685 47.101 64.079 14.732 1.00 43.78 O HETATM12622 O HOH 686 46.545 36.221 -0.471 1.00 46.57 O HETATM12623 O HOH 687 73.277 46.609 34.187 1.00 33.61 O HETATM12624 O HOH 688 59.627 69.729 30.028 1.00 42.72 O HETATM12625 O HOH 689 67.397 24.847 1.105 1.00 32.95 O HETATM12626 O HOH 690 68.047 24.155 20.425 1.00 33.06 O HETATM12627 O HOH 691 53.977 38.785 -12.486 1.00 39.58 O HETATM12628 O HOH 692 50.479 69.416 22.625 1.00 34.54 O HETATM12629 O HOH 693 65.524 17.435 38.222 1.00 38.10 O HETATM12630 O HOH 694 65.691 39.388 32.740 1.00 35.42 O HETATM12631 O HOH 695 55.280 35.833 -6.564 1.00 35.38 O HETATM12632 O HOH 696 73.245 29.359 18.825 1.00 54.17 O HETATM12633 O HOH 697 71.588 23.880 27.935 1.00 40.68 O HETATM12634 O HOH 698 56.531 44.923 9.055 1.00 46.48 O HETATM12635 O HOH 699 81.356 57.660 3.728 1.00 35.60 O HETATM12636 O HOH 700 70.528 48.487 -5.631 1.00 36.36 O HETATM12637 O HOH 701 55.067 37.110 -8.905 1.00 37.64 O HETATM12638 O HOH 702 60.693 66.436 10.513 1.00 38.48 O HETATM12639 O HOH 703 77.442 52.505 5.027 1.00 37.17 O HETATM12640 O HOH 704 62.063 72.232 20.980 1.00 42.23 O HETATM12641 O HOH 705 69.591 23.790 22.412 1.00 51.75 O HETATM12642 O HOH 706 40.338 39.119 -1.448 1.00 39.29 O HETATM12643 O HOH 707 75.271 37.405 -1.004 1.00 43.03 O HETATM12644 O HOH 708 59.046 59.928 41.785 1.00 39.68 O HETATM12645 O HOH 709 52.783 42.733 -6.859 1.00 36.68 O HETATM12646 O HOH 710 50.421 26.533 0.661 1.00 38.91 O HETATM12647 O HOH 711 64.111 70.485 16.895 1.00 40.64 O HETATM12648 O HOH 712 47.866 33.016 0.500 1.00 37.05 O HETATM12649 O HOH 713 56.774 65.355 33.115 1.00 36.67 O HETATM12650 O HOH 714 71.326 25.186 0.071 1.00 37.96 O HETATM12651 O HOH 715 47.938 65.609 10.734 1.00 38.97 O HETATM12652 O HOH 716 58.935 69.546 3.267 1.00 39.37 O HETATM12653 O HOH 717 73.283 58.697 8.587 1.00 41.15 O HETATM12654 O HOH 718 69.415 64.542 2.310 1.00 50.84 O HETATM12655 O HOH 719 47.048 61.022 17.081 1.00 46.60 O HETATM12656 O HOH 720 47.568 59.623 19.050 1.00 43.31 O HETATM12657 O HOH 721 78.973 43.200 25.261 1.00 45.07 O HETATM12658 O HOH 722 69.794 60.179 15.283 1.00 33.82 O HETATM12659 O HOH 723 39.215 40.901 2.622 1.00 35.64 O HETATM12660 O HOH 724 69.480 22.473 15.443 1.00 31.83 O HETATM12661 O HOH 725 39.550 48.011 3.244 1.00 37.23 O HETATM12662 O HOH 726 52.529 27.379 6.786 1.00 39.38 O HETATM12663 O HOH 727 70.524 32.215 -6.373 1.00 46.27 O HETATM12664 O HOH 728 60.453 29.811 0.522 1.00 38.59 O HETATM12665 O HOH 729 72.227 35.580 28.276 1.00 39.73 O HETATM12666 O HOH 730 73.659 35.449 16.714 1.00 46.16 O HETATM12667 O HOH 731 72.169 23.004 14.891 1.00 35.94 O HETATM12668 O HOH 732 64.116 66.080 11.742 1.00 39.65 O HETATM12669 O HOH 733 74.514 39.252 19.033 1.00 37.79 O HETATM12670 O HOH 734 70.600 26.004 23.598 1.00 40.31 O HETATM12671 O HOH 735 71.565 57.252 29.541 1.00 44.55 O HETATM12672 O HOH 736 42.286 46.485 -1.112 1.00 44.17 O HETATM12673 O HOH 737 49.604 57.818 34.594 1.00 32.65 O HETATM12674 O HOH 738 76.758 47.331 19.722 1.00 43.88 O HETATM12675 O HOH 739 77.007 50.533 9.011 1.00 32.53 O HETATM12676 O HOH 740 79.227 39.619 14.987 1.00 46.15 O HETATM12677 O HOH 741 44.714 64.911 23.631 1.00 40.85 O HETATM12678 O HOH 742 69.631 59.018 -5.627 1.00 35.65 O HETATM12679 O HOH 743 72.052 33.833 30.242 1.00 48.65 O HETATM12680 O HOH 744 64.049 67.233 34.445 1.00 47.94 O HETATM12681 O HOH 745 62.287 28.769 -1.184 1.00 40.43 O HETATM12682 O HOH 746 51.749 67.711 30.201 1.00 47.04 O HETATM12683 O HOH 747 46.955 39.901 -3.741 1.00 38.11 O HETATM12684 O HOH 748 76.729 35.700 2.784 1.00 48.93 O HETATM12685 O HOH 749 81.903 50.455 30.246 1.00 61.91 O HETATM12686 O HOH 750 75.893 33.852 13.013 1.00 42.52 O HETATM12687 O HOH 751 76.665 38.299 14.371 1.00 50.19 O HETATM12688 O HOH 752 77.107 56.147 13.968 1.00 42.38 O HETATM12689 O HOH 753 42.493 59.904 1.311 1.00 45.31 O HETATM12690 O HOH 754 53.905 64.754 1.696 1.00 39.59 O HETATM12691 O HOH 755 70.317 64.635 15.652 1.00 42.81 O HETATM12692 O HOH 756 70.244 28.274 -3.116 1.00 56.62 O HETATM12693 O HOH 757 66.539 68.019 35.582 1.00 60.72 O HETATM12694 O HOH 758 71.895 62.784 14.547 1.00 40.94 O HETATM12695 O HOH 759 66.734 25.020 39.316 1.00 41.14 O HETATM12696 O HOH 760 58.512 50.503 -9.453 1.00 44.17 O HETATM12697 O HOH 761 67.506 66.472 0.617 1.00 41.87 O HETATM12698 O HOH 762 65.480 68.439 7.855 1.00 39.77 O HETATM12699 O HOH 763 68.183 67.648 23.057 1.00 54.98 O HETATM12700 O HOH 764 73.219 43.222 39.550 1.00 48.12 O HETATM12701 O HOH 765 64.572 24.098 7.998 1.00 43.93 O HETATM12702 O HOH 766 66.160 68.863 27.724 1.00 51.36 O HETATM12703 O HOH 767 48.055 67.920 9.532 1.00 46.83 O HETATM12704 O HOH 768 69.061 45.386 34.846 1.00 34.45 O HETATM12705 O HOH 769 72.104 49.653 -7.892 1.00 43.07 O HETATM12706 O HOH 770 69.076 61.465 28.719 1.00 45.42 O HETATM12707 O HOH 771 56.746 60.936 -8.006 1.00 53.61 O HETATM12708 O HOH 772 62.117 47.630 -11.056 1.00 52.53 O HETATM12709 O HOH 773 42.173 62.254 28.600 1.00 47.27 O HETATM12710 O HOH 774 49.531 72.951 19.478 1.00 52.92 O HETATM12711 O HOH 775 61.986 66.798 41.471 1.00 49.78 O HETATM12712 O HOH 776 65.761 30.469 -3.677 1.00 44.82 O HETATM12713 O HOH 777 39.670 63.050 9.323 1.00 58.65 O HETATM12714 O HOH 778 47.380 36.592 -6.669 1.00 43.52 O HETATM12715 O HOH 779 64.546 68.293 -0.467 1.00 42.58 O HETATM12716 O HOH 780 76.442 45.402 6.188 1.00 60.50 O HETATM12717 O HOH 781 78.095 35.405 4.569 1.00 38.02 O HETATM12718 O HOH 782 67.778 57.949 35.477 1.00 42.88 O HETATM12719 O HOH 783 70.839 30.348 18.721 1.00 34.95 O HETATM12720 O HOH 784 71.705 65.854 19.446 1.00 46.72 O HETATM12721 O HOH 785 72.432 48.116 -3.834 1.00 41.02 O HETATM12722 O HOH 786 55.273 36.324 12.017 1.00 23.73 O HETATM12723 O HOH 787 43.523 56.526 24.240 1.00 48.08 O HETATM12724 O HOH 788 69.625 34.217 21.252 1.00 28.24 O HETATM12725 O HOH 789 74.470 59.025 3.538 1.00 33.69 O HETATM12726 O HOH 790 71.640 59.085 16.847 1.00 33.84 O HETATM12727 O HOH 791 72.157 24.771 25.551 1.00 35.60 O HETATM12728 O HOH 792 77.370 56.327 1.684 1.00 36.66 O HETATM12729 O HOH 793 76.782 35.510 35.349 1.00 42.11 O HETATM12730 O HOH 794 47.812 42.700 3.879 1.00 37.67 O HETATM12731 O HOH 795 69.296 23.005 18.431 1.00 37.10 O HETATM12732 O HOH 796 79.370 58.098 1.734 1.00 34.59 O HETATM12733 O HOH 797 76.837 46.450 11.208 1.00 37.89 O HETATM12734 O HOH 798 64.298 25.657 -1.486 1.00 46.49 O HETATM12735 O HOH 799 70.767 46.416 33.023 1.00 37.14 O HETATM12736 O HOH 800 54.754 64.771 -0.780 1.00 44.42 O HETATM12737 O HOH 801 74.705 55.693 19.124 1.00 35.10 O HETATM12738 O HOH 802 73.148 59.469 5.910 1.00 41.89 O HETATM12739 O HOH 803 74.779 44.566 38.288 1.00 49.82 O HETATM12740 O HOH 804 59.604 48.444 -10.065 1.00 41.11 O HETATM12741 O HOH 805 66.346 66.362 13.396 1.00 44.58 O HETATM12742 O HOH 806 76.471 27.928 5.606 1.00 44.67 O HETATM12743 O HOH 807 74.127 37.717 16.158 1.00 50.32 O HETATM12744 O HOH 808 74.413 23.748 4.675 1.00 42.54 O HETATM12745 O HOH 809 43.230 61.138 23.492 1.00 40.14 O HETATM12746 O HOH 810 74.320 37.152 37.849 1.00 43.10 O HETATM12747 O HOH 811 78.422 54.559 9.263 1.00 45.40 O HETATM12748 O HOH 812 47.901 65.174 16.949 1.00 41.33 O HETATM12749 O HOH 813 61.630 32.012 -6.777 1.00 36.92 O HETATM12750 O HOH 814 60.246 66.818 32.828 1.00 35.34 O HETATM12751 O HOH 815 71.633 51.620 -3.984 1.00 43.06 O HETATM12752 O HOH 816 78.386 50.421 10.928 1.00 47.83 O HETATM12753 O HOH 817 47.484 59.228 34.872 1.00 44.49 O HETATM12754 O HOH 818 62.719 57.681 39.599 1.00 49.23 O HETATM12755 O HOH 819 77.425 50.240 13.266 1.00 43.90 O HETATM12756 O HOH 820 41.973 57.545 0.498 1.00 50.79 O HETATM12757 O HOH 821 70.611 16.714 37.190 1.00 49.99 O HETATM12758 O HOH 822 75.461 38.886 21.238 1.00 43.55 O HETATM12759 O HOH 823 76.661 35.758 14.966 1.00 53.73 O HETATM12760 O HOH 824 56.555 57.908 -8.685 1.00 52.33 O HETATM12761 O HOH 825 50.547 71.965 22.006 1.00 46.94 O HETATM12762 O HOH 826 66.582 18.767 7.068 1.00 47.50 O HETATM12763 O HOH 827 65.192 66.967 30.847 1.00 53.29 O HETATM12764 O HOH 828 74.599 45.251 -0.532 1.00 46.98 O HETATM12765 O HOH 829 52.861 69.627 29.062 1.00 49.20 O HETATM12766 O HOH 830 73.332 51.988 24.516 1.00 48.88 O HETATM12767 O HOH 831 58.937 42.307 -14.814 1.00 59.44 O HETATM12768 O HOH 832 53.063 37.422 -10.471 1.00 56.01 O HETATM12769 O HOH 833 61.641 58.730 41.769 1.00 50.52 O HETATM12770 O HOH 834 75.955 54.179 20.410 1.00 44.00 O HETATM12771 O HOH 835 50.983 34.466 -4.522 1.00 43.81 O HETATM12772 O HOH 836 78.063 53.998 3.007 1.00 41.08 O HETATM12773 O HOH 837 72.235 21.819 31.727 1.00 48.93 O HETATM12774 O HOH 838 62.220 15.897 33.587 1.00 50.30 O HETATM12775 O HOH 839 73.735 25.331 29.827 1.00 60.40 O HETATM12776 O HOH 840 48.505 27.100 2.279 1.00 43.77 O HETATM12777 O HOH 841 78.434 40.942 24.819 1.00 51.40 O HETATM12778 O HOH 842 73.925 51.414 -5.598 1.00 64.65 O HETATM12779 O HOH 843 67.980 68.268 25.460 1.00 56.85 O HETATM12780 O HOH 844 71.754 34.456 -7.596 1.00 47.10 O HETATM12781 O HOH 845 47.957 68.894 28.050 1.00 48.64 O HETATM12782 O HOH 846 56.457 35.487 -10.448 1.00 55.09 O HETATM12783 O HOH 847 65.063 32.446 -8.757 1.00 43.26 O HETATM12784 O HOH 848 75.721 24.906 6.513 1.00 48.74 O HETATM12785 O HOH 849 54.697 64.741 -5.306 1.00 51.20 O HETATM12786 O HOH 850 56.468 61.579 -2.879 1.00 48.39 O HETATM12787 O HOH 851 78.397 43.156 37.475 1.00 39.08 O HETATM12788 O HOH 852 75.368 53.111 -3.075 1.00 44.26 O HETATM12789 O HOH 853 39.481 32.264 0.247 1.00 52.58 O HETATM12790 O HOH 854 69.107 47.110 36.539 1.00 51.99 O HETATM12791 O HOH 855 46.264 31.675 1.808 1.00 50.45 O HETATM12792 O HOH 856 68.292 20.502 20.577 1.00 41.79 O HETATM12793 O HOH 857 67.654 39.791 39.835 1.00 48.55 O HETATM12794 O HOH 858 65.059 14.323 36.900 1.00 52.82 O HETATM12795 O HOH 859 48.784 68.025 14.711 1.00 50.60 O HETATM12796 O HOH 860 61.887 67.305 36.485 1.00 51.15 O HETATM12797 O HOH 861 71.451 40.217 -8.140 1.00 52.74 O HETATM12798 O HOH 862 53.077 33.949 -6.679 1.00 53.25 O HETATM12799 O HOH 863 39.692 47.520 0.240 1.00 45.53 O HETATM12800 O HOH 864 72.091 26.669 19.321 1.00 41.26 O HETATM12801 O HOH 865 72.704 61.352 20.234 1.00 56.33 O HETATM12802 O HOH 866 65.347 64.121 41.726 1.00 54.94 O HETATM12803 O HOH 867 71.940 34.438 25.596 1.00 52.65 O HETATM12804 O HOH 868 76.428 38.270 2.398 1.00 56.79 O HETATM12805 O HOH 869 74.538 36.957 27.868 1.00 44.08 O HETATM12806 O HOH 870 71.842 42.173 -4.172 1.00 42.47 O HETATM12807 O HOH 871 44.057 61.453 -1.778 1.00 45.99 O HETATM12808 O HOH 872 56.264 28.878 0.212 1.00 45.34 O HETATM12809 O HOH 873 65.187 46.014 -12.872 1.00 52.83 O HETATM12810 O HOH 874 36.568 42.640 2.157 1.00 64.20 O HETATM12811 O HOH 875 50.311 40.730 5.236 1.00 45.64 O HETATM12812 O HOH 876 36.857 39.548 6.240 1.00 58.01 O HETATM12813 O HOH 877 71.765 66.939 15.716 1.00 48.47 O HETATM12814 O HOH 878 58.298 30.791 1.166 1.00 42.31 O HETATM12815 O HOH 879 68.132 61.289 33.878 1.00 54.76 O HETATM12816 O HOH 880 80.076 34.206 5.597 1.00 50.98 O HETATM12817 O HOH 881 63.627 68.084 10.319 1.00 56.48 O HETATM12818 O HOH 882 62.515 74.551 22.508 1.00 52.48 O HETATM12819 O HOH 883 54.434 54.761 -10.704 1.00 61.04 O HETATM12820 O HOH 884 61.944 36.969 -13.146 1.00 47.07 O HETATM12821 O HOH 885 69.968 31.888 31.880 1.00 57.98 O HETATM12822 O HOH 886 73.153 43.335 -2.373 1.00 44.93 O HETATM12823 O HOH 887 55.818 49.652 -11.330 1.00 55.05 O HETATM12824 O HOH 888 78.621 39.213 17.708 1.00 62.12 O HETATM12825 O HOH 889 44.693 61.031 32.211 1.00 46.58 O HETATM12826 O HOH 890 50.472 61.412 36.775 1.00 52.71 O HETATM12827 O HOH 891 63.933 15.555 31.785 1.00 50.19 O HETATM12828 O HOH 892 68.368 59.926 31.897 1.00 54.80 O HETATM12829 O HOH 893 71.961 22.186 22.168 1.00 46.56 O HETATM12830 O HOH 894 70.489 28.286 31.462 1.00 45.75 O HETATM12831 O HOH 895 70.975 65.362 7.595 1.00 52.10 O HETATM12832 O HOH 896 65.903 55.134 40.361 1.00 58.08 O HETATM12833 O HOH 897 72.396 31.011 38.016 1.00 63.50 O HETATM12834 O HOH 898 76.326 36.630 30.173 1.00 41.54 O HETATM12835 O HOH 899 76.040 58.391 15.389 1.00 51.50 O HETATM12836 O HOH 900 59.540 32.696 -10.434 1.00 59.74 O HETATM12837 O HOH 901 38.705 38.411 2.648 1.00 54.31 O HETATM12838 O HOH 902 76.725 51.001 18.826 1.00 56.48 O HETATM12839 O HOH 903 69.353 42.169 41.413 1.00 57.02 O HETATM12840 O HOH 904 41.020 56.277 2.892 1.00 59.69 O HETATM12841 O HOH 905 43.607 30.594 9.457 1.00 46.23 O HETATM12842 O HOH 906 64.686 60.666 45.385 1.00 59.08 O HETATM12843 O HOH 907 68.267 17.209 46.734 1.00 51.72 O HETATM12844 O HOH 908 70.504 66.226 11.839 1.00 56.30 O HETATM12845 O HOH 909 51.071 32.153 -3.280 1.00 36.26 O HETATM12846 O HOH 910 74.587 31.122 20.673 1.00 66.50 O HETATM12847 O HOH 911 51.392 40.657 -11.653 1.00 64.19 O HETATM12848 O HOH 912 72.619 17.479 32.754 1.00 59.04 O HETATM12849 O HOH 913 80.140 44.480 35.019 1.00 47.12 O HETATM12850 O HOH 914 74.768 23.925 16.276 1.00 45.12 O HETATM12851 O HOH 915 52.981 67.561 33.252 1.00 56.68 O HETATM12852 O HOH 916 48.785 61.426 18.481 1.00 45.55 O HETATM12853 O HOH 917 44.167 62.846 21.150 1.00 52.41 O HETATM12854 O HOH 918 59.632 52.860 -10.389 1.00 51.76 O HETATM12855 O HOH 919 50.532 68.239 2.361 1.00 51.13 O HETATM12856 O HOH 920 80.412 54.798 6.766 1.00 63.15 O HETATM12857 O HOH 921 53.302 30.411 -3.217 1.00 44.82 O HETATM12858 O HOH 922 38.076 52.308 4.961 1.00 41.19 O HETATM12859 O HOH 923 47.050 28.812 0.945 1.00 42.10 O HETATM12860 O HOH 924 75.157 27.736 2.468 1.00 46.86 O HETATM12861 O HOH 925 79.688 53.267 11.003 1.00 50.08 O HETATM12862 O HOH 926 78.117 40.172 21.723 1.00 49.42 O HETATM12863 O HOH 927 73.618 61.088 16.985 1.00 55.85 O HETATM12864 O HOH 928 48.037 65.328 31.479 1.00 52.57 O HETATM12865 O HOH 929 37.998 57.093 29.350 1.00 57.96 O HETATM12866 O HOH 930 72.076 24.282 18.386 1.00 60.42 O HETATM12867 O HOH 931 69.132 36.154 -9.248 1.00 59.16 O HETATM12868 O HOH 932 70.284 67.303 9.533 1.00 48.69 O HETATM12869 O HOH 933 77.446 56.940 10.561 1.00 48.52 O HETATM12870 O HOH 934 48.942 36.140 -9.015 1.00 53.20 O HETATM12871 O HOH 935 59.172 68.309 35.585 1.00 54.76 O HETATM12872 O HOH 936 60.760 34.619 -13.162 1.00 52.72 O HETATM12873 O HOH 937 67.633 60.336 37.253 1.00 61.58 O HETATM12874 O HOH 938 78.314 48.286 6.969 1.00 73.01 O HETATM12875 O HOH 939 57.720 70.329 31.355 1.00 61.08 O HETATM12876 O HOH 940 69.849 41.768 -12.503 1.00 62.88 O HETATM12877 O HOH 941 53.953 27.368 -1.189 1.00 59.96 O HETATM12878 O HOH 942 60.618 75.920 20.519 1.00 66.00 O HETATM12879 O HOH 943 76.132 57.601 18.052 1.00 53.04 O HETATM12880 O HOH 944 72.704 29.976 23.806 1.00 58.81 O HETATM12881 O HOH 945 60.346 29.743 -5.436 1.00 53.43 O HETATM12882 O HOH 946 55.158 30.246 -1.322 1.00 47.35 O HETATM12883 O HOH 947 73.451 39.874 -4.187 1.00 56.24 O HETATM12884 O HOH 948 39.545 50.734 3.533 1.00 50.69 O HETATM12885 O HOH 949 81.078 43.284 21.535 1.00 57.24 O HETATM12886 O HOH 950 76.388 31.509 0.299 1.00 47.32 O HETATM12887 O HOH 951 71.844 50.453 34.871 1.00 49.64 O HETATM12888 O HOH 952 35.124 50.720 5.761 1.00 53.88 O HETATM12889 O HOH 953 65.374 56.221 -7.573 1.00 47.40 O HETATM12890 O HOH 954 55.826 26.215 -0.429 1.00 42.65 O HETATM12891 O HOH 955 56.389 66.779 35.355 1.00 52.62 O HETATM12892 O HOH 956 48.652 59.395 17.120 1.00 56.79 O HETATM12893 O HOH 957 67.148 69.222 13.127 1.00 66.66 O HETATM12894 O HOH 958 77.682 34.135 33.438 1.00 53.98 O HETATM12895 O HOH 959 75.806 34.094 30.723 1.00 52.25 O HETATM12896 O HOH 960 71.464 57.633 -5.719 1.00 56.03 O HETATM12897 O HOH 961 56.589 53.452 41.687 1.00 29.18 O HETATM12898 O HOH 962 50.718 69.520 13.076 1.00 52.30 O HETATM12899 O HOH 963 51.017 70.370 4.017 1.00 61.36 O HETATM12900 O HOH 964 49.890 43.463 -10.348 1.00 53.68 O HETATM12901 O HOH 965 70.029 49.436 37.089 1.00 52.83 O HETATM12902 O HOH 966 73.466 33.799 20.248 1.00 63.96 O HETATM12903 O HOH 967 74.795 20.826 4.444 1.00 64.53 O HETATM12904 O HOH 968 70.133 65.384 -0.758 1.00 52.77 O HETATM12905 O HOH 969 69.010 51.462 38.467 1.00 52.86 O HETATM12906 O HOH 970 54.126 31.451 -5.730 1.00 53.24 O HETATM12907 O HOH 971 72.329 17.620 8.260 1.00 54.03 O HETATM12908 O HOH 972 65.328 59.974 39.484 1.00 71.19 O HETATM12909 O HOH 973 64.604 35.095 -3.268 1.00 24.53 O HETATM12910 O HOH 974 64.227 54.084 -7.798 1.00 59.88 O HETATM12911 O HOH 975 57.217 31.191 -1.096 1.00 45.37 O HETATM12912 O HOH 976 77.290 33.976 1.087 1.00 51.34 O HETATM12913 O HOH 977 61.722 68.354 31.368 1.00 48.76 O HETATM12914 O HOH 978 72.390 42.609 42.148 1.00 62.57 O HETATM12915 O HOH 979 77.031 26.580 10.000 1.00 61.76 O HETATM12916 O HOH 980 77.581 36.151 9.489 1.00 59.46 O HETATM12917 O HOH 981 74.540 54.668 24.186 1.00 54.56 O HETATM12918 O HOH 982 77.052 46.096 8.948 1.00 56.48 O HETATM12919 O HOH 983 69.485 26.157 31.807 1.00 50.48 O HETATM12920 O HOH 984 70.782 59.909 30.332 1.00 69.27 O HETATM12921 O HOH 985 63.192 20.594 41.774 1.00 62.94 O HETATM12922 O HOH 986 63.382 54.131 -11.199 1.00 58.93 O HETATM12923 O HOH 987 40.368 62.327 6.565 1.00 64.03 O HETATM12924 O HOH 988 37.682 37.631 5.149 1.00 60.22 O HETATM12925 O HOH 989 63.981 38.466 -11.150 1.00 39.45 O HETATM12926 O HOH 990 72.879 64.516 12.037 1.00 60.87 O HETATM12927 O HOH 991 68.407 33.774 -10.352 1.00 67.50 O HETATM12928 O HOH 992 74.402 36.322 18.705 1.00 70.38 O HETATM12929 O HOH 993 75.837 21.672 16.532 1.00 63.91 O HETATM12930 O HOH 994 58.672 34.728 25.168 1.00 56.74 O HETATM12931 O HOH 995 77.607 44.813 38.828 1.00 57.45 O HETATM12932 O HOH 996 79.179 46.662 13.571 1.00 59.09 O HETATM12933 O HOH 997 51.332 75.521 18.805 1.00 60.68 O HETATM12934 O HOH 998 56.210 51.026 -13.630 1.00 64.84 O HETATM12935 O HOH 999 56.114 62.751 42.099 1.00 64.02 O HETATM12936 O HOH 1000 67.378 68.908 29.909 1.00 74.67 O HETATM12937 O HOH 1001 58.611 67.272 -2.798 1.00 45.38 O HETATM12938 O HOH 1002 78.594 38.330 4.358 1.00 67.31 O HETATM12939 O HOH 1003 74.427 26.838 -1.907 1.00 59.22 O HETATM12940 O HOH 1004 67.454 50.331 41.063 1.00 70.82 O HETATM12941 O HOH 1005 64.772 29.335 -5.432 1.00 79.21 O HETATM12942 O HOH 1006 73.770 35.115 22.413 1.00 76.84 O HETATM12943 C1 N A 32 62.273 36.148 44.614 1.00 -0.01 C HETATM12944 C10 N A 32 60.872 36.344 44.226 1.00 -0.04 C HETATM12945 C9 N A 32 60.578 36.146 45.724 1.00 -0.05 C HETATM12946 C4 N A 32 59.237 36.533 46.281 1.00 0.04 C HETATM12947 C3 N A 32 58.099 36.843 45.316 1.00 -0.03 C HETATM12948 C2 N A 32 58.159 38.333 45.037 1.00 0.04 C HETATM12949 C11 N A 32 56.958 38.700 44.256 1.00 0.18 C HETATM12950 O20 N A 32 55.859 38.547 44.799 1.00 -0.40 O HETATM12951 N28 N A 32 57.136 39.177 43.056 1.00 -0.25 N HETATM12952 C24 N A 32 56.097 39.307 42.073 1.00 0.19 C HETATM12953 C23 N A 32 55.184 38.344 41.673 1.00 0.16 C HETATM12954 O31 N A 32 55.225 37.178 42.182 1.00 -0.39 O HETATM12955 C22 N A 32 54.223 38.620 40.679 1.00 0.06 C HETATM12956 C21 N A 32 53.273 37.680 40.175 1.00 0.05 C HETATM12957 O32 N A 32 53.386 36.449 40.437 1.00 -0.57 O HETATM12958 O33 N A 32 52.366 38.059 39.355 1.00 -0.57 O HETATM12959 C27 N A 32 54.168 39.899 40.118 1.00 -0.02 C HETATM12960 C26 N A 32 55.085 40.887 40.512 1.00 0.07 C HETATM12961 C25 N A 32 56.057 40.569 41.484 1.00 0.16 C HETATM12962 O30 N A 32 56.912 41.441 41.799 1.00 -0.38 O HETATM12963 H24 N A 32 55.625 41.205 39.608 1.00 0.07 H HETATM12964 H25 N A 32 54.500 41.731 40.905 1.00 0.07 H HETATM12965 H26 N A 32 53.410 40.131 39.371 1.00 0.10 H HETATM12966 H23 N A 32 55.392 39.615 42.859 1.00 0.10 H HETATM12967 H2 N A 32 58.057 39.472 42.803 1.00 0.19 H HETATM12968 H3 N A 32 58.172 38.890 45.985 1.00 0.05 H HETATM12969 H4 N A 32 59.066 38.569 44.461 1.00 0.05 H HETATM12970 H5 N A 32 58.229 36.277 44.382 1.00 0.03 H HETATM12971 H6 N A 32 57.133 36.581 45.772 1.00 0.03 H HETATM12972 C5 N A 32 59.026 36.660 47.771 1.00 0.21 C HETATM12973 O19 N A 32 57.930 36.857 48.235 1.00 -0.28 O HETATM12974 C6 N A 32 60.224 36.544 48.660 1.00 0.05 C HETATM12975 C7 N A 32 61.480 36.430 48.173 1.00 -0.06 C HETATM12976 C8 N A 32 61.746 36.566 46.701 1.00 -0.03 C HETATM12977 C14 N A 32 63.015 37.445 46.245 1.00 -0.04 C HETATM12978 C15 N A 32 63.147 37.253 44.785 1.00 -0.08 C HETATM12979 C17 N A 32 63.415 38.213 43.906 1.00 -0.13 C HETATM12980 H14 N A 32 63.493 37.975 42.846 1.00 0.01 H HETATM12981 H15 N A 32 63.556 39.238 44.245 1.00 0.01 H HETATM12982 H12 N A 32 63.924 37.098 46.759 1.00 0.03 H HETATM12983 H13 N A 32 62.846 38.507 46.476 1.00 0.03 H HETATM12984 C28 N A 32 62.461 35.104 46.582 1.00 -0.07 C HETATM12985 C29 N A 32 62.825 34.835 45.056 1.00 -0.05 C HETATM12986 H21 N A 32 63.905 34.731 44.876 1.00 0.03 H HETATM12987 H22 N A 32 62.297 33.971 44.626 1.00 0.03 H HETATM12988 H19 N A 32 61.772 34.325 46.941 1.00 0.02 H HETATM12989 H20 N A 32 63.378 35.090 47.189 1.00 0.02 H HETATM12990 H8 N A 32 62.307 36.238 48.855 1.00 0.07 H HETATM12991 H7 N A 32 60.079 36.552 49.739 1.00 0.15 H HETATM12992 C18 N A 32 58.822 35.058 46.396 1.00 -0.05 C HETATM12993 H16 N A 32 57.803 34.995 46.806 1.00 0.02 H HETATM12994 H17 N A 32 59.520 34.532 47.064 1.00 0.02 H HETATM12995 H18 N A 32 58.846 34.592 45.400 1.00 0.02 H HETATM12996 H9 N A 32 60.561 35.049 45.805 1.00 0.02 H HETATM12997 H10 N A 32 60.457 35.573 43.560 1.00 0.03 H HETATM12998 H11 N A 32 60.630 37.341 43.828 1.00 0.03 H HETATM12999 H1 N A 32 62.575 35.987 43.569 1.00 0.05 H CONECT 1 2 22 23 24 CONECT 22 1 CONECT 23 1 CONECT 24 1 CONECT 5969 5970 5990 5991 5992 CONECT 5990 5969 CONECT 5991 5969 CONECT 5992 5969 CONECT1294312944129781298512999 CONECT1294412943129451299712998 CONECT1294512944129461297612996 CONECT1294612945129471297212992 CONECT1294712946129481297012971 CONECT1294812947129491296812969 CONECT12949129481295012951 CONECT1295012949 CONECT12951129491295212967 CONECT1295212951129531296112966 CONECT12953129521295412955 CONECT1295412953 CONECT12955129531295612959 CONECT12956129551295712958 CONECT1295712956 CONECT1295812956 CONECT12959129551296012965 CONECT1296012959129611296312964 CONECT12961129521296012962 CONECT1296212961 CONECT1296312960 CONECT1296412960 CONECT1296512959 CONECT1296612952 CONECT1296712951 CONECT1296812948 CONECT1296912948 CONECT1297012947 CONECT1297112947 CONECT12972129461297312974 CONECT1297312972 CONECT12974129721297512991 CONECT12975129741297612990 CONECT1297612945129751297712984 CONECT1297712976129781298212983 CONECT12978129431297712979 CONECT12979129781298012981 CONECT1298012979 CONECT1298112979 CONECT1298212977 CONECT1298312977 CONECT1298412976129851298812989 CONECT1298512943129841298612987 CONECT1298612985 CONECT1298712985 CONECT1298812984 CONECT1298912984 CONECT1299012975 CONECT1299112974 CONECT1299212946129931299412995 CONECT1299312992 CONECT1299412992 CONECT1299512992 CONECT1299612945 CONECT1299712944 CONECT1299812944 CONECT1299912943 MASTER 0 0 0 0 0 0 0 012997 2 65 64 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 3ho2
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
3hnz
RCSB PDB
PDBbind
427aa, >3HNZ_1|Chain... *
3ho9
RCSB PDB
PDBbind
427aa, >3HO9_1|Chain... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
3ho2
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
E. coli FabF(C163A)
Ligand Name
N32
EC.Number
E.C.2.3.1.179
Resolution
2(Å)
Affinity (Kd/Ki/IC50)
IC50=113nM
Release Year
2010
Protein/NA Sequence
Check fasta file
Primary Reference
(2009) Bioorg.Med.Chem.Lett. Vol. 19: pp. 4756-4759
Ligand Properties
Formula
C
2
4
H
2
7
NO
6
Molecular Weight
425.474
Exact Mass
425.184
No. of atoms
58
No. of bonds
61
Polar Surface Area
117.61
LOGP Value
3.26 (
Computed with XLOGP3
)
2.70 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 6
No. of Rotatable Bonds: 5
No. of Nitrogen and Oxygen Atoms: 7
No. of Rings: 4
Canonical SMILES
O=C(N[C@H]1C(=O)CC=C(C1=O)C(=O)O)CC[C@]1(C)C(=O)C=C[C@]23[C@@H]1C[C@H](CC2)C(=C)C3
InChI String
InChI=1S/C24H27NO6/c1-13-12-24-9-5-14(13)11-17(24)23(2,18(27)6-10-24)8-7-19(28)25-20-16(26)4-3-15(21(20)29)22(30)31/h3,6,10,14,17,20H,1,4-5,7-9,11-12H2,2H3,(H,25,28)(H,30,31)/t14-,17+,20-,23-,24+/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P0AAI5
Entrez Gene ID
NCBI Entrez Gene ID:
61755202
946665
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com