Browse entries in the PDBbind-CN Database
HEADER 4GTQ_COMPLEX COMPND 4GTQ_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 315 PHE LEU SER LEU ASP SER PRO THR TYR VAL LEU TYR ARG SEQRES 2 A 315 ASP ARG ALA GLU TRP ALA ASP ILE ASP PRO VAL PRO GLN SEQRES 3 A 315 ASN ASP GLY PRO SER PRO VAL VAL GLN ILE ILE TYR SER SEQRES 4 A 315 GLU LYS PHE ARG ASP VAL TYR ASP TYR PHE ARG ALA VAL SEQRES 5 A 315 LEU GLN ARG ASP GLU ARG SER GLU ARG ALA PHE LYS LEU SEQRES 6 A 315 THR ARG ASP ALA ILE GLU LEU ASN ALA ALA ASN TYR THR SEQRES 7 A 315 VAL TRP HIS PHE ARG ARG VAL LEU LEU ARG SER LEU GLN SEQRES 8 A 315 LYS ASP LEU GLN GLU GLU MET ASN TYR ILE ILE ALA ILE SEQRES 9 A 315 ILE GLU GLU GLN PRO LYS ASN TYR GLN VAL TRP HIS HIS SEQRES 10 A 315 ARG ARG VAL LEU VAL GLU TRP LEU LYS ASP PRO SER GLN SEQRES 11 A 315 GLU LEU GLU PHE ILE ALA ASP ILE LEU ASN GLN ASP ALA SEQRES 12 A 315 LYS ASN TYR HIS ALA TRP GLN HIS ARG GLN TRP VAL ILE SEQRES 13 A 315 GLN GLU PHE ARG LEU TRP ASP ASN GLU LEU GLN TYR VAL SEQRES 14 A 315 ASP GLN LEU LEU LYS GLU ASP VAL ARG ASN ASN SER VAL SEQRES 15 A 315 TRP ASN GLN ARG HIS PHE VAL ILE SER ASN THR THR GLY SEQRES 16 A 315 TYR SER ASP ARG ALA VAL LEU GLU ARG GLU VAL GLN TYR SEQRES 17 A 315 THR LEU GLU MET ILE LYS LEU VAL PRO HIS ASN GLU SER SEQRES 18 A 315 ALA TRP ASN TYR LEU LYS GLY ILE LEU GLN ASP ARG GLY SEQRES 19 A 315 LEU SER ARG TYR PRO ASN LEU LEU ASN GLN LEU LEU ASP SEQRES 20 A 315 LEU GLN PRO SER HIS SER SER PRO TYR LEU ILE ALA PHE SEQRES 21 A 315 LEU VAL ASP ILE TYR GLU ASP MET LEU GLU ASN GLN CYS SEQRES 22 A 315 ASP ASN LYS GLU ASP ILE LEU ASN LYS ALA LEU GLU LEU SEQRES 23 A 315 CYS GLU ILE LEU ALA LYS GLU LYS ASP THR ILE ARG LYS SEQRES 24 A 315 GLU TYR TRP ARG TYR ILE GLY ARG SER LEU GLN SER LYS SEQRES 25 A 315 HIS SER ARG SEQRES 1 B 405 TRP SER GLU PRO LEU TYR SER LEU ARG PRO GLU HIS ALA SEQRES 2 B 405 ARG GLU ARG LEU GLN ASP ASP SER VAL GLU THR VAL THR SEQRES 3 B 405 SER ILE GLU GLN ALA LYS VAL GLU GLU LYS ILE GLN GLU SEQRES 4 B 405 VAL PHE SER SER TYR LYS PHE ASN HIS LEU VAL PRO ARG SEQRES 5 B 405 LEU VAL LEU GLN ARG GLU LYS HIS PHE HIS TYR LEU LYS SEQRES 6 B 405 ARG GLY LEU ARG GLN LEU THR ASP ALA TYR GLU CYS LEU SEQRES 7 B 405 ASP ALA SER ARG PRO TRP LEU CYS TYR TRP ILE LEU HIS SEQRES 8 B 405 SER LEU GLU LEU LEU ASP GLU PRO ILE PRO GLN ILE VAL SEQRES 9 B 405 ALA THR ASP VAL CYS GLN PHE LEU GLU LEU CYS GLN SER SEQRES 10 B 405 PRO ASP GLY GLY PHE GLY GLY GLY PRO GLY GLN TYR PRO SEQRES 11 B 405 HIS LEU ALA PRO THR TYR ALA ALA VAL ASN ALA LEU CYS SEQRES 12 B 405 ILE ILE GLY THR GLU GLU ALA TYR ASN VAL ILE ASN ARG SEQRES 13 B 405 GLU LYS LEU LEU GLN TYR LEU TYR SER LEU LYS GLN PRO SEQRES 14 B 405 ASP GLY SER PHE LEU MET HIS VAL GLY GLY GLU VAL ASP SEQRES 15 B 405 VAL ARG SER ALA TYR CYS ALA ALA SER VAL ALA SER LEU SEQRES 16 B 405 THR ASN ILE ILE THR PRO ASP LEU PHE GLU GLY THR ALA SEQRES 17 B 405 GLU TRP ILE ALA ARG CYS GLN ASN TRP GLU GLY GLY ILE SEQRES 18 B 405 GLY GLY VAL PRO GLY MET GLU ALA HIS GLY GLY TYR THR SEQRES 19 B 405 PHE CYS GLY LEU ALA ALA LEU VAL ILE LEU LYS LYS GLU SEQRES 20 B 405 ARG SER LEU ASN LEU LYS SER LEU LEU GLN TRP VAL THR SEQRES 21 B 405 SER ARG GLN MET ARG PHE GLU GLY GLY PHE GLN GLY ARG SEQRES 22 B 405 CYS ASN LYS LEU VAL ASP GLY CYS TYR SER PHE TRP GLN SEQRES 23 B 405 ALA GLY LEU LEU PRO LEU LEU HIS ARG ALA LEU HIS ALA SEQRES 24 B 405 GLN GLY ASP PRO ALA LEU SER MET SER HIS TRP MET PHE SEQRES 25 B 405 HIS GLN GLN ALA LEU GLN GLU TYR ILE LEU MET CYS CYS SEQRES 26 B 405 GLN CYS PRO ALA GLY GLY LEU LEU ASP LYS PRO GLY LYS SEQRES 27 B 405 SER ARG ASP PHE TYR HIS THR CYS TYR CYS LEU SER GLY SEQRES 28 B 405 LEU SER ILE ALA GLN HIS PHE GLY SER GLY ALA MET LEU SEQRES 29 B 405 HIS ASP VAL VAL MET GLY VAL PRO GLU ASN VAL LEU GLN SEQRES 30 B 405 PRO THR HIS PRO VAL TYR ASN ILE GLY PRO ASP LYS VAL SEQRES 31 B 405 ILE GLN ALA THR THR HIS PHE LEU GLN LYS PRO VAL PRO SEQRES 32 B 405 GLY PHE HET ZN A 1 1 HET UNN A 966 85 ATOM 1 N PHE A 55 -33.384 56.194 24.643 1.00 55.96 N ATOM 2 CA PHE A 55 -34.585 55.407 25.113 1.00 56.42 C ATOM 3 C PHE A 55 -35.547 55.054 23.953 1.00 55.30 C ATOM 4 O PHE A 55 -35.748 53.848 23.732 1.00 56.28 O ATOM 5 CB PHE A 55 -35.291 56.043 26.340 1.00 57.58 C ATOM 6 CG PHE A 55 -35.077 55.262 27.653 1.00 59.66 C ATOM 7 CD1 PHE A 55 -35.967 55.429 28.730 1.00 61.15 C ATOM 8 CD2 PHE A 55 -34.018 54.330 27.811 1.00 60.78 C ATOM 9 CE1 PHE A 55 -35.802 54.711 29.971 1.00 62.07 C ATOM 10 CE2 PHE A 55 -33.837 53.612 29.035 1.00 61.99 C ATOM 11 CZ PHE A 55 -34.738 53.804 30.119 1.00 62.42 C ATOM 12 HA PHE A 55 -34.203 54.454 25.479 1.00 0.00 H ATOM 13 HB2 PHE A 55 -34.905 57.054 26.474 1.00 0.00 H ATOM 14 HB3 PHE A 55 -36.361 56.088 26.137 1.00 0.00 H ATOM 15 HD2 PHE A 55 -33.329 54.158 26.984 1.00 0.00 H ATOM 16 HE2 PHE A 55 -33.005 52.915 29.137 1.00 0.00 H ATOM 17 HZ PHE A 55 -34.605 53.255 31.052 1.00 0.00 H ATOM 18 HE1 PHE A 55 -36.501 54.872 30.792 1.00 0.00 H ATOM 19 HD1 PHE A 55 -36.804 56.119 28.624 1.00 0.00 H ATOM 20 HN3 PHE A 55 -33.703 57.083 24.206 1.00 0.00 H ATOM 21 HN2 PHE A 55 -32.855 55.633 23.945 1.00 0.00 H ATOM 22 HN1 PHE A 55 -32.770 56.406 25.455 1.00 0.00 H ATOM 23 N LEU A 56 -35.991 56.026 23.173 1.00 52.09 N ATOM 24 CA LEU A 56 -36.687 55.725 21.937 1.00 50.70 C ATOM 25 C LEU A 56 -35.885 56.188 20.742 1.00 48.23 C ATOM 26 O LEU A 56 -35.756 57.355 20.502 1.00 47.53 O ATOM 27 CB LEU A 56 -38.058 56.361 21.936 1.00 20.00 C ATOM 28 CG LEU A 56 -38.999 55.959 20.827 1.00 20.00 C ATOM 29 CD1 LEU A 56 -39.201 54.469 20.836 1.00 20.00 C ATOM 30 CD2 LEU A 56 -40.313 56.706 20.922 1.00 20.00 C ATOM 31 HA LEU A 56 -36.807 54.644 21.866 1.00 0.00 H ATOM 32 HB2 LEU A 56 -38.538 56.110 22.882 1.00 0.00 H ATOM 33 HB3 LEU A 56 -37.920 57.441 21.875 1.00 0.00 H ATOM 34 HG LEU A 56 -38.550 56.234 19.873 1.00 0.00 H ATOM 35 HD21 LEU A 56 -40.788 56.484 21.878 1.00 0.00 H ATOM 36 HD22 LEU A 56 -40.127 57.777 20.848 1.00 0.00 H ATOM 37 HD23 LEU A 56 -40.967 56.393 20.108 1.00 0.00 H ATOM 38 HD11 LEU A 56 -38.242 53.973 20.690 1.00 0.00 H ATOM 39 HD12 LEU A 56 -39.625 54.167 21.793 1.00 0.00 H ATOM 40 HD13 LEU A 56 -39.882 54.191 20.031 1.00 0.00 H ATOM 41 H LEU A 56 -35.839 57.017 23.449 1.00 0.00 H ATOM 42 N SER A 57 -35.325 55.260 20.002 1.00 46.54 N ATOM 43 CA SER A 57 -34.471 55.584 18.894 1.00 45.00 C ATOM 44 C SER A 57 -35.169 56.214 17.692 1.00 43.70 C ATOM 45 O SER A 57 -36.305 55.883 17.378 1.00 43.30 O ATOM 46 CB SER A 57 -33.790 54.313 18.438 1.00 45.06 C ATOM 47 OG SER A 57 -33.705 54.311 17.029 1.00 47.92 O ATOM 48 HA SER A 57 -33.776 56.339 19.261 1.00 0.00 H ATOM 49 HB2 SER A 57 -34.368 53.450 18.770 1.00 0.00 H ATOM 50 HB3 SER A 57 -32.788 54.263 18.864 1.00 0.00 H ATOM 51 HG SER A 57 -34.616 54.356 16.645 1.00 0.00 H ATOM 52 H SER A 57 -35.505 54.260 20.225 1.00 0.00 H ATOM 53 N LEU A 58 -34.445 57.087 16.992 1.00 42.83 N ATOM 54 CA LEU A 58 -34.991 57.802 15.840 1.00 42.85 C ATOM 55 C LEU A 58 -35.347 56.863 14.701 1.00 43.78 C ATOM 56 O LEU A 58 -36.130 57.254 13.820 1.00 43.85 O ATOM 57 CB LEU A 58 -34.022 58.855 15.286 1.00 42.11 C ATOM 58 CG LEU A 58 -34.147 60.335 15.623 1.00 41.47 C ATOM 59 CD1 LEU A 58 -32.960 60.973 14.929 1.00 42.93 C ATOM 60 CD2 LEU A 58 -35.433 61.048 15.214 1.00 36.71 C ATOM 61 HA LEU A 58 -35.889 58.293 16.216 1.00 0.00 H ATOM 62 HB2 LEU A 58 -33.027 58.553 15.611 1.00 0.00 H ATOM 63 HB3 LEU A 58 -34.085 58.784 14.200 1.00 0.00 H ATOM 64 HG LEU A 58 -34.173 60.431 16.708 1.00 0.00 H ATOM 65 HD21 LEU A 58 -35.552 60.988 14.132 1.00 0.00 H ATOM 66 HD22 LEU A 58 -36.283 60.570 15.701 1.00 0.00 H ATOM 67 HD23 LEU A 58 -35.380 62.093 15.518 1.00 0.00 H ATOM 68 HD11 LEU A 58 -32.038 60.540 15.317 1.00 0.00 H ATOM 69 HD12 LEU A 58 -33.026 60.789 13.857 1.00 0.00 H ATOM 70 HD13 LEU A 58 -32.966 62.047 15.116 1.00 0.00 H ATOM 71 H LEU A 58 -33.460 57.265 17.274 1.00 0.00 H ATOM 72 N ASP A 59 -34.755 55.666 14.692 1.00 44.93 N ATOM 73 CA ASP A 59 -35.046 54.653 13.653 1.00 46.68 C ATOM 74 C ASP A 59 -35.888 53.445 14.125 1.00 47.45 C ATOM 75 O ASP A 59 -36.144 52.509 13.356 1.00 48.70 O ATOM 76 CB ASP A 59 -33.734 54.158 13.033 1.00 47.37 C ATOM 77 CG ASP A 59 -32.985 55.258 12.277 1.00 49.96 C ATOM 78 OD1 ASP A 59 -31.722 55.228 12.310 1.00 54.01 O ATOM 79 OD2 ASP A 59 -33.663 56.166 11.685 1.00 51.77 O ATOM 80 HA ASP A 59 -35.666 55.165 12.917 1.00 0.00 H ATOM 81 HB2 ASP A 59 -33.092 53.783 13.830 1.00 0.00 H ATOM 82 HB3 ASP A 59 -33.960 53.349 12.338 1.00 0.00 H ATOM 83 H ASP A 59 -34.068 55.438 15.439 1.00 0.00 H ATOM 84 N SER A 60 -36.303 53.468 15.384 1.00 47.26 N ATOM 85 CA SER A 60 -37.275 52.545 15.902 1.00 47.35 C ATOM 86 C SER A 60 -38.603 52.585 15.122 1.00 47.52 C ATOM 87 O SER A 60 -39.143 53.651 14.846 1.00 46.78 O ATOM 88 CB SER A 60 -37.554 52.907 17.352 1.00 47.28 C ATOM 89 OG SER A 60 -38.497 52.022 17.887 1.00 47.83 O ATOM 90 HA SER A 60 -36.866 51.539 15.805 1.00 0.00 H ATOM 91 HB2 SER A 60 -37.942 53.924 17.403 1.00 0.00 H ATOM 92 HB3 SER A 60 -36.630 52.842 17.926 1.00 0.00 H ATOM 93 HG SER A 60 -38.675 52.262 18.831 1.00 0.00 H ATOM 94 H SER A 60 -35.908 54.185 16.025 1.00 0.00 H ATOM 95 N PRO A 61 -39.161 51.409 14.799 1.00 48.24 N ATOM 96 CA PRO A 61 -40.475 51.456 14.166 1.00 47.75 C ATOM 97 C PRO A 61 -41.556 52.055 15.055 1.00 46.81 C ATOM 98 O PRO A 61 -42.568 52.522 14.538 1.00 46.67 O ATOM 99 CB PRO A 61 -40.760 49.995 13.829 1.00 48.24 C ATOM 100 CG PRO A 61 -39.872 49.200 14.754 1.00 49.04 C ATOM 101 CD PRO A 61 -38.659 50.026 14.960 1.00 48.88 C ATOM 102 HA PRO A 61 -40.479 52.109 13.293 1.00 0.00 H ATOM 103 HD3 PRO A 61 -38.246 49.873 15.957 1.00 0.00 H ATOM 104 HD2 PRO A 61 -37.898 49.797 14.214 1.00 0.00 H ATOM 105 HG3 PRO A 61 -39.608 48.245 14.299 1.00 0.00 H ATOM 106 HG2 PRO A 61 -40.376 49.022 15.704 1.00 0.00 H ATOM 107 HB2 PRO A 61 -41.809 49.758 14.007 1.00 0.00 H ATOM 108 HB3 PRO A 61 -40.513 49.787 12.788 1.00 0.00 H ATOM 109 N THR A 62 -41.236 52.194 16.305 1.00 45.99 N ATOM 110 CA THR A 62 -42.134 52.648 17.311 1.00 44.63 C ATOM 111 C THR A 62 -41.911 54.109 17.655 1.00 42.39 C ATOM 112 O THR A 62 -42.556 54.608 18.526 1.00 42.05 O ATOM 113 CB THR A 62 -41.919 51.739 18.521 1.00 20.00 C ATOM 114 OG1 THR A 62 -42.741 50.600 18.361 1.00 20.00 O ATOM 115 CG2 THR A 62 -42.265 52.407 19.772 1.00 20.00 C ATOM 116 HA THR A 62 -43.165 52.593 16.962 1.00 0.00 H ATOM 117 HB THR A 62 -40.865 51.468 18.574 1.00 0.00 H ATOM 118 HG1 THR A 62 -42.619 49.995 19.135 1.00 0.00 H ATOM 119 HG23 THR A 62 -41.633 53.286 19.900 1.00 0.00 H ATOM 120 HG21 THR A 62 -43.311 52.711 19.743 1.00 0.00 H ATOM 121 HG22 THR A 62 -42.108 51.721 20.604 1.00 0.00 H ATOM 122 H THR A 62 -40.263 51.959 16.589 1.00 0.00 H ATOM 123 N TYR A 63 -41.000 54.774 16.957 1.00 40.04 N ATOM 124 CA TYR A 63 -40.752 56.195 17.112 1.00 37.94 C ATOM 125 C TYR A 63 -42.059 56.970 16.916 1.00 37.41 C ATOM 126 O TYR A 63 -42.843 56.652 16.032 1.00 35.96 O ATOM 127 CB TYR A 63 -39.707 56.711 16.113 1.00 37.52 C ATOM 128 CG TYR A 63 -39.296 58.169 16.370 1.00 35.28 C ATOM 129 CD1 TYR A 63 -38.368 58.473 17.346 1.00 33.92 C ATOM 130 CD2 TYR A 63 -39.880 59.220 15.670 1.00 33.21 C ATOM 131 CE1 TYR A 63 -38.018 59.764 17.622 1.00 33.16 C ATOM 132 CE2 TYR A 63 -39.535 60.530 15.931 1.00 33.67 C ATOM 133 CZ TYR A 63 -38.590 60.805 16.923 1.00 34.32 C ATOM 134 OH TYR A 63 -38.193 62.107 17.227 1.00 31.44 O ATOM 135 HA TYR A 63 -40.362 56.351 18.118 1.00 0.00 H ATOM 136 HB3 TYR A 63 -40.123 56.639 15.108 1.00 0.00 H ATOM 137 HB2 TYR A 63 -38.819 56.082 16.183 1.00 0.00 H ATOM 138 HD2 TYR A 63 -40.623 59.005 14.902 1.00 0.00 H ATOM 139 HE2 TYR A 63 -39.995 61.343 15.369 1.00 0.00 H ATOM 140 HE1 TYR A 63 -37.283 59.972 18.399 1.00 0.00 H ATOM 141 HD1 TYR A 63 -37.904 57.664 17.910 1.00 0.00 H ATOM 142 HH TYR A 63 -37.797 62.526 16.422 1.00 0.00 H ATOM 143 H TYR A 63 -40.433 54.249 16.261 1.00 0.00 H ATOM 144 N VAL A 64 -42.227 58.005 17.740 1.00 36.41 N ATOM 145 CA VAL A 64 -43.421 58.829 17.841 1.00 36.01 C ATOM 146 C VAL A 64 -42.941 60.305 17.906 1.00 35.08 C ATOM 147 O VAL A 64 -42.030 60.616 18.643 1.00 34.62 O ATOM 148 CB VAL A 64 -44.220 58.433 19.174 1.00 36.11 C ATOM 149 CG1 VAL A 64 -45.352 59.376 19.479 1.00 35.48 C ATOM 150 CG2 VAL A 64 -44.737 57.013 19.100 1.00 36.76 C ATOM 151 HA VAL A 64 -44.089 58.685 16.992 1.00 0.00 H ATOM 152 HB VAL A 64 -43.502 58.511 19.990 1.00 0.00 H ATOM 153 HG11 VAL A 64 -44.958 60.383 19.614 1.00 0.00 H ATOM 154 HG12 VAL A 64 -46.061 59.370 18.651 1.00 0.00 H ATOM 155 HG13 VAL A 64 -45.854 59.056 20.392 1.00 0.00 H ATOM 156 HG21 VAL A 64 -45.411 56.917 18.248 1.00 0.00 H ATOM 157 HG22 VAL A 64 -43.898 56.328 18.980 1.00 0.00 H ATOM 158 HG23 VAL A 64 -45.274 56.775 20.018 1.00 0.00 H ATOM 159 H VAL A 64 -41.432 58.244 18.367 1.00 0.00 H ATOM 160 N LEU A 65 -43.540 61.213 17.149 1.00 34.53 N ATOM 161 CA LEU A 65 -43.156 62.612 17.210 1.00 34.22 C ATOM 162 C LEU A 65 -43.369 63.170 18.633 1.00 34.77 C ATOM 163 O LEU A 65 -44.236 62.697 19.406 1.00 34.81 O ATOM 164 CB LEU A 65 -43.922 63.447 16.194 1.00 34.52 C ATOM 165 CG LEU A 65 -44.055 62.959 14.726 1.00 35.45 C ATOM 166 CD1 LEU A 65 -45.075 63.811 13.918 1.00 33.87 C ATOM 167 CD2 LEU A 65 -42.723 62.976 14.053 1.00 33.41 C ATOM 168 HA LEU A 65 -42.097 62.674 16.961 1.00 0.00 H ATOM 169 HB2 LEU A 65 -44.935 63.561 16.580 1.00 0.00 H ATOM 170 HB3 LEU A 65 -43.436 64.422 16.158 1.00 0.00 H ATOM 171 HG LEU A 65 -44.432 61.937 14.755 1.00 0.00 H ATOM 172 HD21 LEU A 65 -42.328 63.992 14.057 1.00 0.00 H ATOM 173 HD22 LEU A 65 -42.039 62.317 14.588 1.00 0.00 H ATOM 174 HD23 LEU A 65 -42.832 62.631 13.025 1.00 0.00 H ATOM 175 HD11 LEU A 65 -46.056 63.745 14.389 1.00 0.00 H ATOM 176 HD12 LEU A 65 -44.747 64.850 13.903 1.00 0.00 H ATOM 177 HD13 LEU A 65 -45.135 63.433 12.897 1.00 0.00 H ATOM 178 H LEU A 65 -44.298 60.919 16.500 1.00 0.00 H ATOM 179 N TYR A 66 -42.548 64.152 18.985 1.00 33.88 N ATOM 180 CA TYR A 66 -42.579 64.735 20.306 1.00 33.88 C ATOM 181 C TYR A 66 -43.939 65.377 20.536 1.00 34.30 C ATOM 182 O TYR A 66 -44.465 65.402 21.664 1.00 33.30 O ATOM 183 CB TYR A 66 -41.441 65.791 20.463 1.00 33.67 C ATOM 184 CG TYR A 66 -40.106 65.151 20.794 1.00 31.97 C ATOM 185 CD1 TYR A 66 -39.344 64.570 19.815 1.00 29.02 C ATOM 186 CD2 TYR A 66 -39.645 65.096 22.092 1.00 31.22 C ATOM 187 CE1 TYR A 66 -38.170 63.947 20.117 1.00 30.19 C ATOM 188 CE2 TYR A 66 -38.440 64.481 22.392 1.00 30.79 C ATOM 189 CZ TYR A 66 -37.721 63.913 21.388 1.00 28.67 C ATOM 190 OH TYR A 66 -36.551 63.308 21.640 1.00 29.48 O ATOM 191 HA TYR A 66 -42.418 63.955 21.050 1.00 0.00 H ATOM 192 HB3 TYR A 66 -41.709 66.479 21.265 1.00 0.00 H ATOM 193 HB2 TYR A 66 -41.343 66.344 19.529 1.00 0.00 H ATOM 194 HD2 TYR A 66 -40.236 65.542 22.892 1.00 0.00 H ATOM 195 HE2 TYR A 66 -38.074 64.453 23.418 1.00 0.00 H ATOM 196 HE1 TYR A 66 -37.590 63.473 19.325 1.00 0.00 H ATOM 197 HD1 TYR A 66 -39.682 64.606 18.779 1.00 0.00 H ATOM 198 HH TYR A 66 -36.174 62.956 20.795 1.00 0.00 H ATOM 199 H TYR A 66 -41.863 64.512 18.290 1.00 0.00 H ATOM 200 N ARG A 67 -44.512 65.901 19.457 1.00 35.18 N ATOM 201 CA ARG A 67 -45.838 66.517 19.559 1.00 36.01 C ATOM 202 C ARG A 67 -46.954 65.501 19.928 1.00 36.18 C ATOM 203 O ARG A 67 -48.010 65.925 20.373 1.00 35.87 O ATOM 204 CB ARG A 67 -46.191 67.317 18.309 1.00 35.88 C ATOM 205 CG ARG A 67 -46.461 66.476 17.079 1.00 39.34 C ATOM 206 CD ARG A 67 -47.537 67.135 16.179 1.00 41.94 C ATOM 207 NE ARG A 67 -47.631 66.475 14.876 1.00 43.52 N ATOM 208 CZ ARG A 67 -46.886 66.787 13.818 1.00 45.09 C ATOM 209 NH1 ARG A 67 -45.979 67.744 13.900 1.00 45.46 N ATOM 210 NH2 ARG A 67 -47.024 66.132 12.675 1.00 45.56 N ATOM 211 HA ARG A 67 -45.781 67.219 20.391 1.00 0.00 H ATOM 212 HB2 ARG A 67 -47.084 67.905 18.522 1.00 0.00 H ATOM 213 HB3 ARG A 67 -45.360 67.987 18.088 1.00 0.00 H ATOM 214 HG2 ARG A 67 -45.537 66.369 16.510 1.00 0.00 H ATOM 215 HG3 ARG A 67 -46.811 65.492 17.390 1.00 0.00 H ATOM 216 HD2 ARG A 67 -47.277 68.183 16.027 1.00 0.00 H ATOM 217 HD3 ARG A 67 -48.504 67.070 16.679 1.00 0.00 H ATOM 218 HE ARG A 67 -48.327 65.710 14.770 1.00 0.00 H ATOM 219 HH12 ARG A 67 -45.400 67.984 13.070 1.00 0.00 H ATOM 220 HH11 ARG A 67 -45.844 68.258 14.794 1.00 0.00 H ATOM 221 HH22 ARG A 67 -46.436 66.386 11.856 1.00 0.00 H ATOM 222 HH21 ARG A 67 -47.721 65.364 12.597 1.00 0.00 H ATOM 223 H ARG A 67 -44.020 65.874 18.541 1.00 0.00 H ATOM 224 N ASP A 68 -46.686 64.192 19.794 1.00 36.60 N ATOM 225 CA ASP A 68 -47.622 63.109 20.191 1.00 37.16 C ATOM 226 C ASP A 68 -47.193 62.357 21.481 1.00 37.97 C ATOM 227 O ASP A 68 -47.744 61.289 21.786 1.00 38.56 O ATOM 228 CB ASP A 68 -47.724 62.052 19.063 1.00 37.98 C ATOM 229 CG ASP A 68 -48.248 62.619 17.742 1.00 39.17 C ATOM 230 OD1 ASP A 68 -48.998 63.617 17.778 1.00 40.96 O ATOM 231 OD2 ASP A 68 -47.901 62.063 16.666 1.00 40.57 O ATOM 232 HA ASP A 68 -48.575 63.605 20.378 1.00 0.00 H ATOM 233 HB2 ASP A 68 -46.732 61.634 18.890 1.00 0.00 H ATOM 234 HB3 ASP A 68 -48.398 61.261 19.391 1.00 0.00 H ATOM 235 H ASP A 68 -45.768 63.920 19.388 1.00 0.00 H ATOM 236 N ARG A 69 -46.204 62.880 22.220 1.00 37.84 N ATOM 237 CA ARG A 69 -45.778 62.273 23.492 1.00 37.42 C ATOM 238 C ARG A 69 -46.345 63.055 24.665 1.00 37.38 C ATOM 239 O ARG A 69 -46.190 64.273 24.762 1.00 35.96 O ATOM 240 CB ARG A 69 -44.256 62.264 23.640 1.00 37.48 C ATOM 241 CG ARG A 69 -43.516 61.629 22.500 1.00 37.35 C ATOM 242 CD ARG A 69 -42.026 61.742 22.686 1.00 36.41 C ATOM 243 NE ARG A 69 -41.362 61.227 21.504 1.00 37.23 N ATOM 244 CZ ARG A 69 -40.084 60.844 21.427 1.00 35.35 C ATOM 245 NH1 ARG A 69 -39.276 60.928 22.476 1.00 33.73 N ATOM 246 NH2 ARG A 69 -39.618 60.357 20.277 1.00 32.89 N ATOM 247 HA ARG A 69 -46.148 61.248 23.487 1.00 0.00 H ATOM 248 HB2 ARG A 69 -43.918 63.296 23.731 1.00 0.00 H ATOM 249 HB3 ARG A 69 -44.007 61.720 24.551 1.00 0.00 H ATOM 250 HG2 ARG A 69 -43.788 60.575 22.442 1.00 0.00 H ATOM 251 HG3 ARG A 69 -43.797 62.127 21.572 1.00 0.00 H ATOM 252 HD2 ARG A 69 -41.721 61.163 23.558 1.00 0.00 H ATOM 253 HD3 ARG A 69 -41.754 62.787 22.832 1.00 0.00 H ATOM 254 HE ARG A 69 -41.932 61.149 20.638 1.00 0.00 H ATOM 255 HH12 ARG A 69 -38.285 60.624 22.394 1.00 0.00 H ATOM 256 HH11 ARG A 69 -39.634 61.297 23.380 1.00 0.00 H ATOM 257 HH22 ARG A 69 -38.625 60.055 20.204 1.00 0.00 H ATOM 258 HH21 ARG A 69 -40.247 60.279 19.453 1.00 0.00 H ATOM 259 H ARG A 69 -45.724 63.739 21.885 1.00 0.00 H ATOM 260 N ALA A 70 -46.952 62.302 25.573 1.00 38.31 N ATOM 261 CA ALA A 70 -47.720 62.825 26.676 1.00 38.49 C ATOM 262 C ALA A 70 -46.798 63.613 27.602 1.00 39.22 C ATOM 263 O ALA A 70 -47.132 64.739 28.035 1.00 39.40 O ATOM 264 CB ALA A 70 -48.322 61.676 27.420 1.00 39.04 C ATOM 265 HA ALA A 70 -48.508 63.484 26.312 1.00 0.00 H ATOM 266 HB1 ALA A 70 -48.969 61.110 26.750 1.00 0.00 H ATOM 267 HB2 ALA A 70 -47.527 61.029 27.792 1.00 0.00 H ATOM 268 HB3 ALA A 70 -48.907 62.054 28.258 1.00 0.00 H ATOM 269 H ALA A 70 -46.869 61.269 25.484 1.00 0.00 H ATOM 270 N GLU A 71 -45.625 63.035 27.885 1.00 38.48 N ATOM 271 CA GLU A 71 -44.651 63.665 28.786 1.00 38.12 C ATOM 272 C GLU A 71 -44.010 64.944 28.239 1.00 37.04 C ATOM 273 O GLU A 71 -43.092 65.456 28.874 1.00 36.44 O ATOM 274 CB GLU A 71 -43.528 62.668 29.130 1.00 39.02 C ATOM 275 CG GLU A 71 -42.534 62.395 27.968 1.00 39.83 C ATOM 276 CD GLU A 71 -42.995 61.283 26.989 1.00 45.52 C ATOM 277 OE1 GLU A 71 -44.227 60.920 26.896 1.00 48.02 O ATOM 278 OE2 GLU A 71 -42.077 60.765 26.302 1.00 46.93 O ATOM 279 HA GLU A 71 -45.223 63.950 29.669 1.00 0.00 H ATOM 280 HB2 GLU A 71 -42.965 63.066 29.974 1.00 0.00 H ATOM 281 HB3 GLU A 71 -43.987 61.722 29.415 1.00 0.00 H ATOM 282 HG2 GLU A 71 -42.406 63.318 27.403 1.00 0.00 H ATOM 283 HG3 GLU A 71 -41.577 62.098 28.398 1.00 0.00 H ATOM 284 H GLU A 71 -45.397 62.116 27.456 1.00 0.00 H ATOM 285 N TRP A 72 -44.473 65.421 27.076 1.00 35.95 N ATOM 286 CA TRP A 72 -44.109 66.703 26.521 1.00 35.53 C ATOM 287 C TRP A 72 -45.294 67.628 26.342 1.00 36.83 C ATOM 288 O TRP A 72 -45.168 68.727 25.761 1.00 35.43 O ATOM 289 CB TRP A 72 -43.447 66.499 25.162 1.00 35.12 C ATOM 290 CG TRP A 72 -42.046 66.042 25.273 1.00 33.54 C ATOM 291 CD1 TRP A 72 -41.612 64.770 25.221 1.00 33.49 C ATOM 292 CD2 TRP A 72 -40.894 66.857 25.472 1.00 33.00 C ATOM 293 NE1 TRP A 72 -40.256 64.720 25.382 1.00 32.77 N ATOM 294 CE2 TRP A 72 -39.783 65.998 25.521 1.00 34.14 C ATOM 295 CE3 TRP A 72 -40.685 68.233 25.603 1.00 33.58 C ATOM 296 CZ2 TRP A 72 -38.464 66.471 25.696 1.00 32.54 C ATOM 297 CZ3 TRP A 72 -39.371 68.700 25.785 1.00 33.10 C ATOM 298 CH2 TRP A 72 -38.293 67.820 25.836 1.00 32.05 C ATOM 299 HA TRP A 72 -43.426 67.170 27.231 1.00 0.00 H ATOM 300 HB2 TRP A 72 -44.014 65.753 24.606 1.00 0.00 H ATOM 301 HB3 TRP A 72 -43.464 67.445 24.620 1.00 0.00 H ATOM 302 HE1 TRP A 72 -39.679 63.855 25.397 1.00 0.00 H ATOM 303 HD1 TRP A 72 -42.252 63.901 25.071 1.00 0.00 H ATOM 304 HZ2 TRP A 72 -37.615 65.787 25.719 1.00 0.00 H ATOM 305 HH2 TRP A 72 -37.289 68.216 25.991 1.00 0.00 H ATOM 306 HZ3 TRP A 72 -39.193 69.770 25.888 1.00 0.00 H ATOM 307 HE3 TRP A 72 -41.523 68.929 25.565 1.00 0.00 H ATOM 308 H TRP A 72 -45.138 64.829 26.538 1.00 0.00 H ATOM 309 N ALA A 73 -46.443 67.208 26.875 1.00 39.13 N ATOM 310 CA ALA A 73 -47.720 67.968 26.745 1.00 40.33 C ATOM 311 C ALA A 73 -47.721 69.352 27.394 1.00 41.20 C ATOM 312 O ALA A 73 -48.447 70.254 26.954 1.00 42.58 O ATOM 313 CB ALA A 73 -48.865 67.159 27.283 1.00 40.57 C ATOM 314 HA ALA A 73 -47.834 68.144 25.675 1.00 0.00 H ATOM 315 HB1 ALA A 73 -48.946 66.228 26.722 1.00 0.00 H ATOM 316 HB2 ALA A 73 -48.688 66.936 28.335 1.00 0.00 H ATOM 317 HB3 ALA A 73 -49.789 67.727 27.181 1.00 0.00 H ATOM 318 H ALA A 73 -46.448 66.312 27.404 1.00 0.00 H ATOM 319 N ASP A 74 -46.913 69.536 28.428 1.00 41.68 N ATOM 320 CA ASP A 74 -46.856 70.822 29.114 1.00 42.27 C ATOM 321 C ASP A 74 -46.083 71.907 28.376 1.00 42.27 C ATOM 322 O ASP A 74 -46.102 73.051 28.782 1.00 42.33 O ATOM 323 CB ASP A 74 -46.193 70.631 30.459 1.00 42.75 C ATOM 324 CG ASP A 74 -44.801 70.144 30.317 1.00 42.99 C ATOM 325 OD1 ASP A 74 -43.903 70.986 30.307 1.00 45.75 O ATOM 326 OD2 ASP A 74 -44.621 68.935 30.148 1.00 45.41 O ATOM 327 HA ASP A 74 -47.890 71.159 29.188 1.00 0.00 H ATOM 328 HB2 ASP A 74 -46.182 71.585 30.987 1.00 0.00 H ATOM 329 HB3 ASP A 74 -46.765 69.904 31.036 1.00 0.00 H ATOM 330 H ASP A 74 -46.311 68.753 28.755 1.00 0.00 H ATOM 331 N ILE A 75 -45.354 71.550 27.325 1.00 42.64 N ATOM 332 CA ILE A 75 -44.510 72.511 26.638 1.00 42.10 C ATOM 333 C ILE A 75 -45.020 72.753 25.227 1.00 41.73 C ATOM 334 O ILE A 75 -45.401 71.847 24.519 1.00 40.19 O ATOM 335 CB ILE A 75 -43.069 72.028 26.612 1.00 42.56 C ATOM 336 CG1 ILE A 75 -42.134 73.164 26.268 1.00 43.08 C ATOM 337 CG2 ILE A 75 -42.878 70.948 25.577 1.00 42.93 C ATOM 338 CD1 ILE A 75 -40.976 73.151 27.201 1.00 44.42 C ATOM 339 HA ILE A 75 -44.546 73.455 27.182 1.00 0.00 H ATOM 340 HB ILE A 75 -42.845 71.637 27.604 1.00 0.00 H ATOM 341 HG12 ILE A 75 -41.778 73.045 25.245 1.00 0.00 H ATOM 342 HG13 ILE A 75 -42.664 74.112 26.359 1.00 0.00 H ATOM 343 HD11 ILE A 75 -41.334 73.270 28.224 1.00 0.00 H ATOM 344 HD12 ILE A 75 -40.447 72.203 27.108 1.00 0.00 H ATOM 345 HD13 ILE A 75 -40.302 73.971 26.953 1.00 0.00 H ATOM 346 HG21 ILE A 75 -43.526 70.103 25.811 1.00 0.00 H ATOM 347 HG22 ILE A 75 -43.133 71.341 24.593 1.00 0.00 H ATOM 348 HG23 ILE A 75 -41.838 70.622 25.581 1.00 0.00 H ATOM 349 H ILE A 75 -45.388 70.566 26.989 1.00 0.00 H ATOM 350 N ASP A 76 -45.071 74.018 24.857 1.00 42.74 N ATOM 351 CA ASP A 76 -45.500 74.417 23.538 1.00 43.72 C ATOM 352 C ASP A 76 -44.234 74.516 22.693 1.00 42.90 C ATOM 353 O ASP A 76 -43.278 75.177 23.070 1.00 42.95 O ATOM 354 CB ASP A 76 -46.223 75.784 23.566 1.00 44.79 C ATOM 355 CG ASP A 76 -47.643 75.722 24.183 1.00 48.92 C ATOM 356 OD1 ASP A 76 -48.417 74.749 23.882 1.00 52.80 O ATOM 357 OD2 ASP A 76 -47.981 76.675 24.968 1.00 53.25 O ATOM 358 HA ASP A 76 -46.209 73.695 23.132 1.00 0.00 H ATOM 359 HB2 ASP A 76 -45.622 76.480 24.152 1.00 0.00 H ATOM 360 HB3 ASP A 76 -46.307 76.151 22.543 1.00 0.00 H ATOM 361 H ASP A 76 -44.793 74.753 25.539 1.00 0.00 H ATOM 362 N PRO A 77 -44.213 73.834 21.561 1.00 42.72 N ATOM 363 CA PRO A 77 -43.064 73.891 20.686 1.00 42.90 C ATOM 364 C PRO A 77 -42.841 75.284 20.138 1.00 43.39 C ATOM 365 O PRO A 77 -43.760 76.068 20.073 1.00 42.87 O ATOM 366 CB PRO A 77 -43.443 72.964 19.529 1.00 43.21 C ATOM 367 CG PRO A 77 -44.875 72.600 19.711 1.00 43.28 C ATOM 368 CD PRO A 77 -45.300 72.979 21.058 1.00 43.14 C ATOM 369 HA PRO A 77 -42.150 73.610 21.209 1.00 0.00 H ATOM 370 HD3 PRO A 77 -46.240 73.530 21.025 1.00 0.00 H ATOM 371 HD2 PRO A 77 -45.419 72.097 21.687 1.00 0.00 H ATOM 372 HG3 PRO A 77 -44.998 71.525 19.578 1.00 0.00 H ATOM 373 HG2 PRO A 77 -45.482 73.127 18.975 1.00 0.00 H ATOM 374 HB2 PRO A 77 -43.305 73.478 18.577 1.00 0.00 H ATOM 375 HB3 PRO A 77 -42.823 72.067 19.549 1.00 0.00 H ATOM 376 N VAL A 78 -41.630 75.574 19.701 1.00 44.12 N ATOM 377 CA VAL A 78 -41.346 76.894 19.169 1.00 44.99 C ATOM 378 C VAL A 78 -40.949 76.783 17.711 1.00 45.42 C ATOM 379 O VAL A 78 -39.869 76.304 17.414 1.00 45.55 O ATOM 380 CB VAL A 78 -40.261 77.605 19.984 1.00 45.09 C ATOM 381 CG1 VAL A 78 -39.816 78.878 19.246 1.00 45.59 C ATOM 382 CG2 VAL A 78 -40.793 77.908 21.414 1.00 43.08 C ATOM 383 HA VAL A 78 -42.250 77.499 19.243 1.00 0.00 H ATOM 384 HB VAL A 78 -39.387 76.963 20.091 1.00 0.00 H ATOM 385 HG11 VAL A 78 -39.418 78.609 18.268 1.00 0.00 H ATOM 386 HG12 VAL A 78 -40.671 79.542 19.122 1.00 0.00 H ATOM 387 HG13 VAL A 78 -39.044 79.382 19.827 1.00 0.00 H ATOM 388 HG21 VAL A 78 -41.672 78.549 21.345 1.00 0.00 H ATOM 389 HG22 VAL A 78 -41.061 76.973 21.906 1.00 0.00 H ATOM 390 HG23 VAL A 78 -40.017 78.414 21.989 1.00 0.00 H ATOM 391 H VAL A 78 -40.879 74.856 19.738 1.00 0.00 H ATOM 392 N PRO A 79 -41.842 77.200 16.798 1.00 46.63 N ATOM 393 CA PRO A 79 -41.614 77.189 15.340 1.00 46.89 C ATOM 394 C PRO A 79 -40.430 78.017 14.919 1.00 46.52 C ATOM 395 O PRO A 79 -40.140 79.006 15.551 1.00 45.91 O ATOM 396 CB PRO A 79 -42.874 77.834 14.764 1.00 47.11 C ATOM 397 CG PRO A 79 -43.867 77.708 15.798 1.00 48.11 C ATOM 398 CD PRO A 79 -43.186 77.697 17.124 1.00 47.06 C ATOM 399 HA PRO A 79 -41.415 76.174 14.997 1.00 0.00 H ATOM 400 HD3 PRO A 79 -43.141 78.699 17.551 1.00 0.00 H ATOM 401 HD2 PRO A 79 -43.693 77.029 17.820 1.00 0.00 H ATOM 402 HG3 PRO A 79 -44.420 76.779 15.663 1.00 0.00 H ATOM 403 HG2 PRO A 79 -44.557 78.551 15.748 1.00 0.00 H ATOM 404 HB2 PRO A 79 -42.695 78.884 14.531 1.00 0.00 H ATOM 405 HB3 PRO A 79 -43.193 77.312 13.862 1.00 0.00 H ATOM 406 N GLN A 80 -39.776 77.617 13.838 1.00 46.85 N ATOM 407 CA GLN A 80 -38.647 78.375 13.361 1.00 47.50 C ATOM 408 C GLN A 80 -39.122 79.717 12.841 1.00 49.00 C ATOM 409 O GLN A 80 -40.027 79.801 12.015 1.00 48.47 O ATOM 410 CB GLN A 80 -37.855 77.646 12.271 1.00 47.30 C ATOM 411 CG GLN A 80 -36.584 78.393 11.887 1.00 46.92 C ATOM 412 CD GLN A 80 -35.546 77.492 11.307 1.00 47.40 C ATOM 413 OE1 GLN A 80 -34.458 77.370 11.852 1.00 49.72 O ATOM 414 NE2 GLN A 80 -35.876 76.826 10.212 1.00 46.28 N ATOM 415 HA GLN A 80 -37.971 78.511 14.205 1.00 0.00 H ATOM 416 HB2 GLN A 80 -37.584 76.656 12.637 1.00 0.00 H ATOM 417 HB3 GLN A 80 -38.484 77.546 11.387 1.00 0.00 H ATOM 418 HG2 GLN A 80 -36.836 79.157 11.151 1.00 0.00 H ATOM 419 HG3 GLN A 80 -36.175 78.870 12.778 1.00 0.00 H ATOM 420 HE22 GLN A 80 -36.814 76.962 9.783 1.00 0.00 H ATOM 421 HE21 GLN A 80 -35.198 76.166 9.780 1.00 0.00 H ATOM 422 H GLN A 80 -40.077 76.758 13.335 1.00 0.00 H ATOM 423 N ASN A 81 -38.473 80.755 13.355 1.00 51.02 N ATOM 424 CA ASN A 81 -38.720 82.125 12.986 1.00 52.89 C ATOM 425 C ASN A 81 -37.908 82.446 11.708 1.00 53.45 C ATOM 426 O ASN A 81 -36.775 82.903 11.807 1.00 52.95 O ATOM 427 CB ASN A 81 -38.288 83.010 14.170 1.00 53.54 C ATOM 428 CG ASN A 81 -38.518 84.504 13.937 1.00 56.05 C ATOM 429 OD1 ASN A 81 -39.568 84.921 13.425 1.00 58.87 O ATOM 430 ND2 ASN A 81 -37.539 85.320 14.353 1.00 55.90 N ATOM 431 HA ASN A 81 -39.773 82.307 12.771 1.00 0.00 H ATOM 432 HB2 ASN A 81 -38.855 82.708 15.051 1.00 0.00 H ATOM 433 HB3 ASN A 81 -37.225 82.849 14.350 1.00 0.00 H ATOM 434 HD22 ASN A 81 -36.676 84.923 14.777 1.00 0.00 H ATOM 435 HD21 ASN A 81 -37.642 86.350 14.252 1.00 0.00 H ATOM 436 H ASN A 81 -37.740 80.567 14.069 1.00 0.00 H ATOM 437 N ASP A 82 -38.489 82.187 10.526 1.00 54.15 N ATOM 438 CA ASP A 82 -37.825 82.443 9.230 1.00 54.57 C ATOM 439 C ASP A 82 -38.301 83.730 8.561 1.00 56.17 C ATOM 440 O ASP A 82 -37.796 84.110 7.509 1.00 56.33 O ATOM 441 CB ASP A 82 -38.045 81.270 8.250 1.00 54.36 C ATOM 442 CG ASP A 82 -36.868 80.286 8.204 1.00 52.64 C ATOM 443 OD1 ASP A 82 -35.915 80.455 8.987 1.00 50.87 O ATOM 444 OD2 ASP A 82 -36.909 79.337 7.381 1.00 50.73 O ATOM 445 HA ASP A 82 -36.765 82.548 9.460 1.00 0.00 H ATOM 446 HB2 ASP A 82 -38.939 80.726 8.556 1.00 0.00 H ATOM 447 HB3 ASP A 82 -38.194 81.678 7.250 1.00 0.00 H ATOM 448 H ASP A 82 -39.450 81.788 10.522 1.00 0.00 H ATOM 449 N GLY A 83 -39.285 84.389 9.150 1.00 57.75 N ATOM 450 CA GLY A 83 -39.764 85.668 8.632 1.00 59.20 C ATOM 451 C GLY A 83 -40.881 85.537 7.606 1.00 59.77 C ATOM 452 O GLY A 83 -41.172 84.446 7.131 1.00 58.55 O ATOM 453 HA3 GLY A 83 -38.926 86.185 8.164 1.00 0.00 H ATOM 454 HA2 GLY A 83 -40.133 86.261 9.469 1.00 0.00 H ATOM 455 H GLY A 83 -39.728 83.987 10.001 1.00 0.00 H ATOM 456 N PRO A 84 -41.490 86.673 7.235 1.00 60.89 N ATOM 457 CA PRO A 84 -42.544 86.671 6.209 1.00 61.03 C ATOM 458 C PRO A 84 -42.076 86.072 4.871 1.00 59.31 C ATOM 459 O PRO A 84 -42.865 85.447 4.178 1.00 58.91 O ATOM 460 CB PRO A 84 -42.873 88.167 6.023 1.00 62.07 C ATOM 461 CG PRO A 84 -41.674 88.930 6.624 1.00 62.35 C ATOM 462 CD PRO A 84 -41.169 88.032 7.720 1.00 61.61 C ATOM 463 HA PRO A 84 -43.393 86.060 6.516 1.00 0.00 H ATOM 464 HD3 PRO A 84 -40.094 88.152 7.857 1.00 0.00 H ATOM 465 HD2 PRO A 84 -41.680 88.240 8.660 1.00 0.00 H ATOM 466 HG3 PRO A 84 -41.992 89.891 7.028 1.00 0.00 H ATOM 467 HG2 PRO A 84 -40.903 89.091 5.871 1.00 0.00 H ATOM 468 HB2 PRO A 84 -42.984 88.404 4.965 1.00 0.00 H ATOM 469 HB3 PRO A 84 -43.792 88.424 6.550 1.00 0.00 H ATOM 470 N SER A 85 -40.835 86.335 4.480 1.00 57.15 N ATOM 471 CA SER A 85 -40.313 85.922 3.179 1.00 56.17 C ATOM 472 C SER A 85 -38.962 85.227 3.252 1.00 54.66 C ATOM 473 O SER A 85 -37.933 85.846 3.141 1.00 54.66 O ATOM 474 CB SER A 85 -40.200 87.129 2.263 1.00 20.00 C ATOM 475 OG SER A 85 -40.667 86.827 0.974 1.00 20.00 O ATOM 476 HA SER A 85 -41.023 85.195 2.786 1.00 0.00 H ATOM 477 HB2 SER A 85 -39.155 87.434 2.202 1.00 0.00 H ATOM 478 HB3 SER A 85 -40.792 87.946 2.675 1.00 0.00 H ATOM 479 HG SER A 85 -40.583 87.628 0.398 1.00 0.00 H ATOM 480 H SER A 85 -40.209 86.856 5.126 1.00 0.00 H ATOM 481 N PRO A 86 -38.971 83.928 3.434 1.00 53.61 N ATOM 482 CA PRO A 86 -37.723 83.168 3.624 1.00 52.23 C ATOM 483 C PRO A 86 -36.792 83.041 2.419 1.00 49.77 C ATOM 484 O PRO A 86 -37.260 82.954 1.296 1.00 49.61 O ATOM 485 CB PRO A 86 -38.232 81.766 4.015 1.00 52.45 C ATOM 486 CG PRO A 86 -39.628 81.981 4.502 1.00 53.74 C ATOM 487 CD PRO A 86 -40.164 83.094 3.683 1.00 53.83 C ATOM 488 HA PRO A 86 -37.101 83.690 4.351 1.00 0.00 H ATOM 489 HD3 PRO A 86 -40.586 82.725 2.748 1.00 0.00 H ATOM 490 HD2 PRO A 86 -40.925 83.651 4.229 1.00 0.00 H ATOM 491 HG3 PRO A 86 -39.626 82.251 5.558 1.00 0.00 H ATOM 492 HG2 PRO A 86 -40.225 81.080 4.359 1.00 0.00 H ATOM 493 HB2 PRO A 86 -38.226 81.101 3.151 1.00 0.00 H ATOM 494 HB3 PRO A 86 -37.612 81.340 4.804 1.00 0.00 H ATOM 495 N VAL A 87 -35.486 83.031 2.668 1.00 46.68 N ATOM 496 CA VAL A 87 -34.506 82.587 1.664 1.00 43.82 C ATOM 497 C VAL A 87 -33.876 81.293 2.150 1.00 41.32 C ATOM 498 O VAL A 87 -33.957 80.959 3.338 1.00 39.59 O ATOM 499 CB VAL A 87 -33.423 83.620 1.392 1.00 43.86 C ATOM 500 CG1 VAL A 87 -33.995 84.777 0.554 1.00 45.62 C ATOM 501 CG2 VAL A 87 -32.836 84.131 2.669 1.00 40.82 C ATOM 502 HA VAL A 87 -35.033 82.439 0.722 1.00 0.00 H ATOM 503 HB VAL A 87 -32.623 83.141 0.827 1.00 0.00 H ATOM 504 HG11 VAL A 87 -34.366 84.388 -0.394 1.00 0.00 H ATOM 505 HG12 VAL A 87 -34.812 85.249 1.099 1.00 0.00 H ATOM 506 HG13 VAL A 87 -33.211 85.510 0.366 1.00 0.00 H ATOM 507 HG21 VAL A 87 -33.620 84.595 3.268 1.00 0.00 H ATOM 508 HG22 VAL A 87 -32.397 83.301 3.223 1.00 0.00 H ATOM 509 HG23 VAL A 87 -32.065 84.868 2.444 1.00 0.00 H ATOM 510 H VAL A 87 -35.147 83.346 3.599 1.00 0.00 H ATOM 511 N VAL A 88 -33.282 80.548 1.221 1.00 38.98 N ATOM 512 CA VAL A 88 -32.571 79.329 1.561 1.00 37.36 C ATOM 513 C VAL A 88 -33.341 78.535 2.640 1.00 36.85 C ATOM 514 O VAL A 88 -32.772 78.049 3.625 1.00 35.82 O ATOM 515 CB VAL A 88 -31.072 79.614 1.989 1.00 37.00 C ATOM 516 CG1 VAL A 88 -30.274 80.160 0.809 1.00 35.75 C ATOM 517 CG2 VAL A 88 -30.972 80.552 3.207 1.00 34.94 C ATOM 518 HA VAL A 88 -32.519 78.711 0.664 1.00 0.00 H ATOM 519 HB VAL A 88 -30.639 78.662 2.295 1.00 0.00 H ATOM 520 HG11 VAL A 88 -30.279 79.430 -0.000 1.00 0.00 H ATOM 521 HG12 VAL A 88 -30.727 81.089 0.464 1.00 0.00 H ATOM 522 HG13 VAL A 88 -29.247 80.349 1.123 1.00 0.00 H ATOM 523 HG21 VAL A 88 -31.440 81.507 2.968 1.00 0.00 H ATOM 524 HG22 VAL A 88 -31.483 80.098 4.056 1.00 0.00 H ATOM 525 HG23 VAL A 88 -29.923 80.712 3.456 1.00 0.00 H ATOM 526 H VAL A 88 -33.328 80.847 0.226 1.00 0.00 H ATOM 527 N GLN A 89 -34.649 78.413 2.413 1.00 36.77 N ATOM 528 CA GLN A 89 -35.553 77.689 3.280 1.00 36.53 C ATOM 529 C GLN A 89 -35.493 76.203 3.024 1.00 36.05 C ATOM 530 O GLN A 89 -35.713 75.761 1.912 1.00 36.66 O ATOM 531 CB GLN A 89 -36.982 78.124 3.043 1.00 36.77 C ATOM 532 CG GLN A 89 -37.921 77.384 3.979 1.00 38.26 C ATOM 533 CD GLN A 89 -39.267 78.019 4.072 1.00 39.34 C ATOM 534 OE1 GLN A 89 -40.029 77.991 3.112 1.00 38.95 O ATOM 535 NE2 GLN A 89 -39.570 78.616 5.224 1.00 39.89 N ATOM 536 HA GLN A 89 -35.243 77.906 4.302 1.00 0.00 H ATOM 537 HB2 GLN A 89 -37.066 79.196 3.222 1.00 0.00 H ATOM 538 HB3 GLN A 89 -37.258 77.907 2.011 1.00 0.00 H ATOM 539 HG2 GLN A 89 -38.042 76.364 3.616 1.00 0.00 H ATOM 540 HG3 GLN A 89 -37.476 77.364 4.974 1.00 0.00 H ATOM 541 HE22 GLN A 89 -38.887 78.611 6.008 1.00 0.00 H ATOM 542 HE21 GLN A 89 -40.490 79.087 5.339 1.00 0.00 H ATOM 543 H GLN A 89 -35.043 78.865 1.563 1.00 0.00 H ATOM 544 N ILE A 90 -35.243 75.437 4.072 1.00 35.13 N ATOM 545 CA ILE A 90 -35.093 73.996 3.960 1.00 34.88 C ATOM 546 C ILE A 90 -36.476 73.353 4.222 1.00 35.05 C ATOM 547 O ILE A 90 -37.134 73.632 5.230 1.00 35.21 O ATOM 548 CB ILE A 90 -33.986 73.468 4.974 1.00 34.50 C ATOM 549 CG1 ILE A 90 -32.650 74.170 4.714 1.00 34.83 C ATOM 550 CG2 ILE A 90 -33.764 71.954 4.889 1.00 32.00 C ATOM 551 CD1 ILE A 90 -31.582 73.968 5.827 1.00 34.15 C ATOM 552 HA ILE A 90 -34.753 73.720 2.962 1.00 0.00 H ATOM 553 HB ILE A 90 -34.358 73.697 5.973 1.00 0.00 H ATOM 554 HG12 ILE A 90 -32.242 73.788 3.778 1.00 0.00 H ATOM 555 HG13 ILE A 90 -32.841 75.239 4.616 1.00 0.00 H ATOM 556 HD11 ILE A 90 -31.965 74.357 6.771 1.00 0.00 H ATOM 557 HD12 ILE A 90 -31.365 72.905 5.932 1.00 0.00 H ATOM 558 HD13 ILE A 90 -30.671 74.501 5.556 1.00 0.00 H ATOM 559 HG21 ILE A 90 -34.696 71.438 5.119 1.00 0.00 H ATOM 560 HG22 ILE A 90 -33.441 71.691 3.882 1.00 0.00 H ATOM 561 HG23 ILE A 90 -32.997 71.660 5.606 1.00 0.00 H ATOM 562 H ILE A 90 -35.151 75.881 5.008 1.00 0.00 H ATOM 563 N ILE A 91 -36.927 72.509 3.305 1.00 34.73 N ATOM 564 CA ILE A 91 -38.174 71.803 3.510 1.00 34.73 C ATOM 565 C ILE A 91 -37.856 70.603 4.357 1.00 34.52 C ATOM 566 O ILE A 91 -37.666 69.476 3.870 1.00 35.12 O ATOM 567 CB ILE A 91 -38.812 71.378 2.193 1.00 35.49 C ATOM 568 CG1 ILE A 91 -39.068 72.632 1.304 1.00 36.72 C ATOM 569 CG2 ILE A 91 -40.057 70.594 2.477 1.00 34.60 C ATOM 570 CD1 ILE A 91 -39.634 73.916 2.093 1.00 36.04 C ATOM 571 HA ILE A 91 -38.898 72.455 3.999 1.00 0.00 H ATOM 572 HB ILE A 91 -38.142 70.727 1.631 1.00 0.00 H ATOM 573 HG12 ILE A 91 -38.126 72.912 0.833 1.00 0.00 H ATOM 574 HG13 ILE A 91 -39.791 72.361 0.535 1.00 0.00 H ATOM 575 HD11 ILE A 91 -40.585 73.663 2.561 1.00 0.00 H ATOM 576 HD12 ILE A 91 -38.919 74.214 2.859 1.00 0.00 H ATOM 577 HD13 ILE A 91 -39.780 74.737 1.391 1.00 0.00 H ATOM 578 HG21 ILE A 91 -39.803 69.710 3.062 1.00 0.00 H ATOM 579 HG22 ILE A 91 -40.755 71.215 3.038 1.00 0.00 H ATOM 580 HG23 ILE A 91 -40.515 70.289 1.536 1.00 0.00 H ATOM 581 H ILE A 91 -36.382 72.353 2.433 1.00 0.00 H ATOM 582 N TYR A 92 -37.777 70.854 5.645 1.00 33.83 N ATOM 583 CA TYR A 92 -37.406 69.811 6.552 1.00 33.55 C ATOM 584 C TYR A 92 -38.420 68.668 6.511 1.00 34.04 C ATOM 585 O TYR A 92 -39.631 68.884 6.275 1.00 34.14 O ATOM 586 CB TYR A 92 -37.336 70.327 7.982 1.00 32.92 C ATOM 587 CG TYR A 92 -36.544 71.585 8.209 1.00 31.69 C ATOM 588 CD1 TYR A 92 -37.175 72.760 8.477 1.00 29.30 C ATOM 589 CD2 TYR A 92 -35.156 71.571 8.222 1.00 33.27 C ATOM 590 CE1 TYR A 92 -36.487 73.890 8.702 1.00 30.86 C ATOM 591 CE2 TYR A 92 -34.436 72.725 8.444 1.00 32.28 C ATOM 592 CZ TYR A 92 -35.119 73.892 8.676 1.00 32.28 C ATOM 593 OH TYR A 92 -34.454 75.068 8.949 1.00 33.29 O ATOM 594 HA TYR A 92 -36.425 69.453 6.240 1.00 0.00 H ATOM 595 HB3 TYR A 92 -36.893 69.542 8.595 1.00 0.00 H ATOM 596 HB2 TYR A 92 -38.357 70.514 8.316 1.00 0.00 H ATOM 597 HD2 TYR A 92 -34.627 70.633 8.054 1.00 0.00 H ATOM 598 HE2 TYR A 92 -33.346 72.711 8.435 1.00 0.00 H ATOM 599 HE1 TYR A 92 -37.024 74.816 8.908 1.00 0.00 H ATOM 600 HD1 TYR A 92 -38.264 72.784 8.510 1.00 0.00 H ATOM 601 HH TYR A 92 -33.909 74.955 9.768 1.00 0.00 H ATOM 602 H TYR A 92 -37.984 71.808 6.004 1.00 0.00 H ATOM 603 N SER A 93 -37.924 67.459 6.759 1.00 33.89 N ATOM 604 CA SER A 93 -38.802 66.345 7.104 1.00 34.19 C ATOM 605 C SER A 93 -39.582 66.613 8.400 1.00 34.42 C ATOM 606 O SER A 93 -39.169 67.406 9.255 1.00 34.38 O ATOM 607 CB SER A 93 -37.988 65.089 7.279 1.00 33.91 C ATOM 608 OG SER A 93 -37.270 65.111 8.519 1.00 35.85 O ATOM 609 HA SER A 93 -39.516 66.228 6.289 1.00 0.00 H ATOM 610 HB2 SER A 93 -37.277 65.007 6.457 1.00 0.00 H ATOM 611 HB3 SER A 93 -38.655 64.227 7.268 1.00 0.00 H ATOM 612 HG SER A 93 -36.659 65.890 8.532 1.00 0.00 H ATOM 613 H SER A 93 -36.897 67.305 6.706 1.00 0.00 H ATOM 614 N GLU A 94 -40.677 65.909 8.544 1.00 35.34 N ATOM 615 CA GLU A 94 -41.566 66.068 9.662 1.00 36.17 C ATOM 616 C GLU A 94 -40.871 65.730 10.969 1.00 34.31 C ATOM 617 O GLU A 94 -41.019 66.413 11.932 1.00 32.55 O ATOM 618 CB GLU A 94 -42.834 65.234 9.425 1.00 20.00 C ATOM 619 CG GLU A 94 -44.101 65.730 10.087 1.00 20.00 C ATOM 620 CD GLU A 94 -44.820 66.823 9.326 1.00 20.00 C ATOM 621 OE1 GLU A 94 -44.659 66.910 8.106 1.00 20.00 O ATOM 622 OE2 GLU A 94 -45.574 67.603 9.936 1.00 20.00 O ATOM 623 HA GLU A 94 -41.865 67.113 9.747 1.00 0.00 H ATOM 624 HB2 GLU A 94 -43.013 65.200 8.350 1.00 0.00 H ATOM 625 HB3 GLU A 94 -42.641 64.226 9.792 1.00 0.00 H ATOM 626 HG2 GLU A 94 -44.782 64.886 10.195 1.00 0.00 H ATOM 627 HG3 GLU A 94 -43.842 66.115 11.073 1.00 0.00 H ATOM 628 H GLU A 94 -40.914 65.204 7.817 1.00 0.00 H ATOM 629 N LYS A 95 -40.091 64.678 10.953 1.00 33.36 N ATOM 630 CA LYS A 95 -39.323 64.181 12.096 1.00 32.78 C ATOM 631 C LYS A 95 -38.355 65.291 12.581 1.00 32.06 C ATOM 632 O LYS A 95 -38.328 65.656 13.749 1.00 30.94 O ATOM 633 CB LYS A 95 -38.533 62.977 11.614 1.00 32.95 C ATOM 634 CG LYS A 95 -38.341 61.867 12.588 1.00 35.03 C ATOM 635 CD LYS A 95 -38.533 60.513 11.877 1.00 36.79 C ATOM 636 CE LYS A 95 -37.593 59.452 12.422 1.00 37.09 C ATOM 637 NZ LYS A 95 -36.469 59.254 11.467 1.00 38.33 N ATOM 638 HA LYS A 95 -39.976 63.904 12.924 1.00 0.00 H ATOM 639 HB2 LYS A 95 -39.050 62.569 10.746 1.00 0.00 H ATOM 640 HB3 LYS A 95 -37.545 63.328 11.315 1.00 0.00 H ATOM 641 HG2 LYS A 95 -37.335 61.919 13.003 1.00 0.00 H ATOM 642 HG3 LYS A 95 -39.070 61.961 13.393 1.00 0.00 H ATOM 643 HD2 LYS A 95 -39.561 60.181 12.021 1.00 0.00 H ATOM 644 HD3 LYS A 95 -38.340 60.643 10.812 1.00 0.00 H ATOM 645 HE2 LYS A 95 -38.135 58.514 12.547 1.00 0.00 H ATOM 646 HE3 LYS A 95 -37.200 59.774 13.386 1.00 0.00 H ATOM 647 HZ1 LYS A 95 -36.847 58.947 10.548 1.00 0.00 H ATOM 648 HZ2 LYS A 95 -35.954 60.150 11.350 1.00 0.00 H ATOM 649 HZ3 LYS A 95 -35.824 58.528 11.838 1.00 0.00 H ATOM 650 H LYS A 95 -40.011 64.155 10.058 1.00 0.00 H ATOM 651 N PHE A 96 -37.596 65.826 11.624 1.00 30.96 N ATOM 652 CA PHE A 96 -36.614 66.845 11.863 1.00 30.25 C ATOM 653 C PHE A 96 -37.239 68.076 12.498 1.00 29.80 C ATOM 654 O PHE A 96 -36.754 68.553 13.542 1.00 28.19 O ATOM 655 CB PHE A 96 -35.917 67.231 10.535 1.00 29.76 C ATOM 656 CG PHE A 96 -34.694 68.118 10.698 1.00 27.87 C ATOM 657 CD1 PHE A 96 -33.409 67.598 10.494 1.00 29.07 C ATOM 658 CD2 PHE A 96 -34.813 69.463 10.980 1.00 26.53 C ATOM 659 CE1 PHE A 96 -32.256 68.422 10.595 1.00 28.93 C ATOM 660 CE2 PHE A 96 -33.670 70.292 11.083 1.00 26.98 C ATOM 661 CZ PHE A 96 -32.402 69.776 10.895 1.00 27.84 C ATOM 662 HA PHE A 96 -35.875 66.445 12.557 1.00 0.00 H ATOM 663 HB2 PHE A 96 -35.608 66.314 10.034 1.00 0.00 H ATOM 664 HB3 PHE A 96 -36.639 67.758 9.912 1.00 0.00 H ATOM 665 HD2 PHE A 96 -35.803 69.895 11.126 1.00 0.00 H ATOM 666 HE2 PHE A 96 -33.792 71.350 11.313 1.00 0.00 H ATOM 667 HZ PHE A 96 -31.526 70.420 10.980 1.00 0.00 H ATOM 668 HE1 PHE A 96 -31.264 67.999 10.439 1.00 0.00 H ATOM 669 HD1 PHE A 96 -33.292 66.541 10.253 1.00 0.00 H ATOM 670 H PHE A 96 -37.723 65.486 10.649 1.00 0.00 H ATOM 671 N ARG A 97 -38.259 68.602 11.820 1.00 29.44 N ATOM 672 CA ARG A 97 -38.901 69.826 12.238 1.00 30.31 C ATOM 673 C ARG A 97 -39.539 69.685 13.600 1.00 29.43 C ATOM 674 O ARG A 97 -39.454 70.580 14.398 1.00 29.08 O ATOM 675 CB ARG A 97 -39.956 70.281 11.238 1.00 30.66 C ATOM 676 CG ARG A 97 -40.536 71.647 11.617 1.00 32.29 C ATOM 677 CD ARG A 97 -41.816 71.998 10.840 1.00 35.04 C ATOM 678 NE ARG A 97 -41.483 72.663 9.593 1.00 38.90 N ATOM 679 CZ ARG A 97 -41.462 72.074 8.403 1.00 44.45 C ATOM 680 NH1 ARG A 97 -41.821 70.781 8.298 1.00 46.52 N ATOM 681 NH2 ARG A 97 -41.090 72.774 7.302 1.00 42.08 N ATOM 682 HA ARG A 97 -38.115 70.579 12.290 1.00 0.00 H ATOM 683 HB2 ARG A 97 -39.501 70.351 10.250 1.00 0.00 H ATOM 684 HB3 ARG A 97 -40.762 69.548 11.215 1.00 0.00 H ATOM 685 HG2 ARG A 97 -40.767 71.642 12.682 1.00 0.00 H ATOM 686 HG3 ARG A 97 -39.786 72.411 11.413 1.00 0.00 H ATOM 687 HD2 ARG A 97 -42.435 72.659 11.446 1.00 0.00 H ATOM 688 HD3 ARG A 97 -42.368 71.083 10.624 1.00 0.00 H ATOM 689 HE ARG A 97 -41.243 73.674 9.635 1.00 0.00 H ATOM 690 HH12 ARG A 97 -41.808 70.311 7.370 1.00 0.00 H ATOM 691 HH11 ARG A 97 -42.112 70.252 9.145 1.00 0.00 H ATOM 692 HH22 ARG A 97 -41.075 72.310 6.371 1.00 0.00 H ATOM 693 HH21 ARG A 97 -40.820 73.775 7.389 1.00 0.00 H ATOM 694 H ARG A 97 -38.602 68.117 10.966 1.00 0.00 H ATOM 695 N ASP A 98 -40.185 68.551 13.849 1.00 29.93 N ATOM 696 CA ASP A 98 -40.686 68.193 15.170 1.00 29.77 C ATOM 697 C ASP A 98 -39.586 68.247 16.234 1.00 29.22 C ATOM 698 O ASP A 98 -39.769 68.856 17.278 1.00 28.43 O ATOM 699 CB ASP A 98 -41.299 66.782 15.127 1.00 30.00 C ATOM 700 CG ASP A 98 -41.786 66.308 16.490 1.00 29.69 C ATOM 701 OD1 ASP A 98 -42.777 66.865 17.043 1.00 28.45 O ATOM 702 OD2 ASP A 98 -41.158 65.368 17.007 1.00 27.74 O ATOM 703 HA ASP A 98 -41.448 68.923 15.445 1.00 0.00 H ATOM 704 HB2 ASP A 98 -42.144 66.790 14.438 1.00 0.00 H ATOM 705 HB3 ASP A 98 -40.543 66.085 14.765 1.00 0.00 H ATOM 706 H ASP A 98 -40.341 67.887 13.064 1.00 0.00 H ATOM 707 N VAL A 99 -38.450 67.606 15.985 1.00 29.04 N ATOM 708 CA VAL A 99 -37.403 67.598 16.995 1.00 29.03 C ATOM 709 C VAL A 99 -36.934 69.023 17.277 1.00 29.83 C ATOM 710 O VAL A 99 -36.874 69.456 18.444 1.00 30.56 O ATOM 711 CB VAL A 99 -36.265 66.673 16.626 1.00 28.96 C ATOM 712 CG1 VAL A 99 -34.976 67.026 17.393 1.00 26.45 C ATOM 713 CG2 VAL A 99 -36.692 65.207 16.873 1.00 26.61 C ATOM 714 HA VAL A 99 -37.820 67.197 17.919 1.00 0.00 H ATOM 715 HB VAL A 99 -36.039 66.799 15.567 1.00 0.00 H ATOM 716 HG11 VAL A 99 -34.681 68.048 17.154 1.00 0.00 H ATOM 717 HG12 VAL A 99 -35.157 66.940 18.464 1.00 0.00 H ATOM 718 HG13 VAL A 99 -34.181 66.339 17.101 1.00 0.00 H ATOM 719 HG21 VAL A 99 -36.942 65.075 17.926 1.00 0.00 H ATOM 720 HG22 VAL A 99 -37.563 64.975 16.260 1.00 0.00 H ATOM 721 HG23 VAL A 99 -35.871 64.541 16.607 1.00 0.00 H ATOM 722 H VAL A 99 -38.310 67.115 15.079 1.00 0.00 H ATOM 723 N TYR A 100 -36.681 69.783 16.225 1.00 29.30 N ATOM 724 CA TYR A 100 -36.071 71.070 16.420 1.00 29.35 C ATOM 725 C TYR A 100 -37.039 72.115 16.988 1.00 29.97 C ATOM 726 O TYR A 100 -36.613 72.990 17.747 1.00 29.05 O ATOM 727 CB TYR A 100 -35.332 71.533 15.167 1.00 28.26 C ATOM 728 CG TYR A 100 -33.924 71.018 15.164 1.00 27.64 C ATOM 729 CD1 TYR A 100 -33.607 69.777 14.600 1.00 27.29 C ATOM 730 CD2 TYR A 100 -32.909 71.736 15.773 1.00 26.74 C ATOM 731 CE1 TYR A 100 -32.332 69.301 14.617 1.00 26.32 C ATOM 732 CE2 TYR A 100 -31.620 71.283 15.780 1.00 24.39 C ATOM 733 CZ TYR A 100 -31.329 70.065 15.223 1.00 27.20 C ATOM 734 OH TYR A 100 -30.028 69.610 15.243 1.00 27.45 O ATOM 735 HA TYR A 100 -35.315 70.952 17.196 1.00 0.00 H ATOM 736 HB3 TYR A 100 -35.315 72.623 15.143 1.00 0.00 H ATOM 737 HB2 TYR A 100 -35.852 71.159 14.285 1.00 0.00 H ATOM 738 HD2 TYR A 100 -33.143 72.684 16.258 1.00 0.00 H ATOM 739 HE2 TYR A 100 -30.829 71.886 16.225 1.00 0.00 H ATOM 740 HE1 TYR A 100 -32.096 68.338 14.165 1.00 0.00 H ATOM 741 HD1 TYR A 100 -34.395 69.181 14.139 1.00 0.00 H ATOM 742 HH TYR A 100 -29.983 68.723 14.805 1.00 0.00 H ATOM 743 H TYR A 100 -36.920 69.454 15.268 1.00 0.00 H ATOM 744 N ASP A 101 -38.323 71.989 16.651 1.00 30.71 N ATOM 745 CA ASP A 101 -39.366 72.796 17.263 1.00 31.59 C ATOM 746 C ASP A 101 -39.297 72.582 18.770 1.00 32.22 C ATOM 747 O ASP A 101 -39.409 73.528 19.533 1.00 32.24 O ATOM 748 CB ASP A 101 -40.769 72.401 16.760 1.00 31.81 C ATOM 749 CG ASP A 101 -41.167 73.060 15.405 1.00 32.81 C ATOM 750 OD1 ASP A 101 -42.342 72.937 14.986 1.00 36.56 O ATOM 751 OD2 ASP A 101 -40.345 73.685 14.718 1.00 32.56 O ATOM 752 HA ASP A 101 -39.204 73.841 16.997 1.00 0.00 H ATOM 753 HB2 ASP A 101 -40.796 71.318 16.636 1.00 0.00 H ATOM 754 HB3 ASP A 101 -41.499 72.698 17.513 1.00 0.00 H ATOM 755 H ASP A 101 -38.587 71.291 15.927 1.00 0.00 H ATOM 756 N TYR A 102 -39.098 71.337 19.208 1.00 32.64 N ATOM 757 CA TYR A 102 -39.042 71.067 20.646 1.00 32.84 C ATOM 758 C TYR A 102 -37.716 71.490 21.225 1.00 32.54 C ATOM 759 O TYR A 102 -37.688 71.995 22.358 1.00 32.34 O ATOM 760 CB TYR A 102 -39.417 69.605 21.012 1.00 32.98 C ATOM 761 CG TYR A 102 -40.924 69.468 21.136 1.00 32.56 C ATOM 762 CD1 TYR A 102 -41.696 69.239 20.017 1.00 35.12 C ATOM 763 CD2 TYR A 102 -41.571 69.649 22.342 1.00 32.65 C ATOM 764 CE1 TYR A 102 -43.072 69.162 20.086 1.00 35.59 C ATOM 765 CE2 TYR A 102 -42.956 69.578 22.426 1.00 34.12 C ATOM 766 CZ TYR A 102 -43.695 69.332 21.282 1.00 34.63 C ATOM 767 OH TYR A 102 -45.052 69.240 21.299 1.00 33.43 O ATOM 768 HA TYR A 102 -39.814 71.680 21.112 1.00 0.00 H ATOM 769 HB3 TYR A 102 -38.951 69.340 21.961 1.00 0.00 H ATOM 770 HB2 TYR A 102 -39.057 68.934 20.232 1.00 0.00 H ATOM 771 HD2 TYR A 102 -40.987 69.850 23.240 1.00 0.00 H ATOM 772 HE2 TYR A 102 -43.456 69.715 23.385 1.00 0.00 H ATOM 773 HE1 TYR A 102 -43.656 68.966 19.187 1.00 0.00 H ATOM 774 HD1 TYR A 102 -41.206 69.115 19.051 1.00 0.00 H ATOM 775 HH TYR A 102 -45.324 68.501 21.899 1.00 0.00 H ATOM 776 H TYR A 102 -38.983 70.559 18.528 1.00 0.00 H ATOM 777 N PHE A 103 -36.635 71.346 20.453 1.00 32.00 N ATOM 778 CA PHE A 103 -35.359 71.837 20.930 1.00 32.15 C ATOM 779 C PHE A 103 -35.344 73.343 21.189 1.00 32.78 C ATOM 780 O PHE A 103 -34.729 73.802 22.159 1.00 31.93 O ATOM 781 CB PHE A 103 -34.227 71.530 19.976 1.00 32.21 C ATOM 782 CG PHE A 103 -32.924 72.074 20.438 1.00 30.83 C ATOM 783 CD1 PHE A 103 -32.304 71.531 21.529 1.00 29.85 C ATOM 784 CD2 PHE A 103 -32.370 73.197 19.846 1.00 32.42 C ATOM 785 CE1 PHE A 103 -31.111 72.058 21.993 1.00 31.36 C ATOM 786 CE2 PHE A 103 -31.160 73.738 20.330 1.00 31.43 C ATOM 787 CZ PHE A 103 -30.540 73.170 21.381 1.00 29.72 C ATOM 788 HA PHE A 103 -35.213 71.309 21.872 1.00 0.00 H ATOM 789 HB2 PHE A 103 -34.138 70.448 19.877 1.00 0.00 H ATOM 790 HB3 PHE A 103 -34.462 71.965 19.004 1.00 0.00 H ATOM 791 HD2 PHE A 103 -32.872 73.666 19.000 1.00 0.00 H ATOM 792 HE2 PHE A 103 -30.727 74.617 19.852 1.00 0.00 H ATOM 793 HZ PHE A 103 -29.599 73.577 21.750 1.00 0.00 H ATOM 794 HE1 PHE A 103 -30.614 71.597 22.847 1.00 0.00 H ATOM 795 HD1 PHE A 103 -32.752 70.677 22.037 1.00 0.00 H ATOM 796 H PHE A 103 -36.709 70.888 19.522 1.00 0.00 H ATOM 797 N ARG A 104 -35.995 74.105 20.312 1.00 33.27 N ATOM 798 CA ARG A 104 -36.028 75.540 20.476 1.00 33.95 C ATOM 799 C ARG A 104 -36.797 75.875 21.743 1.00 33.90 C ATOM 800 O ARG A 104 -36.397 76.749 22.525 1.00 32.70 O ATOM 801 CB ARG A 104 -36.616 76.244 19.250 1.00 34.24 C ATOM 802 CG ARG A 104 -35.626 76.399 18.112 1.00 34.49 C ATOM 803 CD ARG A 104 -36.250 77.107 16.924 1.00 34.75 C ATOM 804 NE ARG A 104 -37.193 76.247 16.217 1.00 36.28 N ATOM 805 CZ ARG A 104 -36.893 75.462 15.173 1.00 36.06 C ATOM 806 NH1 ARG A 104 -35.677 75.414 14.646 1.00 34.82 N ATOM 807 NH2 ARG A 104 -37.847 74.726 14.626 1.00 36.40 N ATOM 808 HA ARG A 104 -35.007 75.909 20.571 1.00 0.00 H ATOM 809 HB2 ARG A 104 -37.466 75.663 18.892 1.00 0.00 H ATOM 810 HB3 ARG A 104 -36.956 77.235 19.550 1.00 0.00 H ATOM 811 HG2 ARG A 104 -34.772 76.979 18.462 1.00 0.00 H ATOM 812 HG3 ARG A 104 -35.289 75.411 17.799 1.00 0.00 H ATOM 813 HD2 ARG A 104 -35.460 77.406 16.236 1.00 0.00 H ATOM 814 HD3 ARG A 104 -36.777 77.993 17.277 1.00 0.00 H ATOM 815 HE ARG A 104 -38.178 76.243 16.550 1.00 0.00 H ATOM 816 HH12 ARG A 104 -35.486 74.791 13.836 1.00 0.00 H ATOM 817 HH11 ARG A 104 -34.915 75.999 15.043 1.00 0.00 H ATOM 818 HH22 ARG A 104 -37.630 74.112 13.815 1.00 0.00 H ATOM 819 HH21 ARG A 104 -38.814 74.762 15.007 1.00 0.00 H ATOM 820 H ARG A 104 -36.482 73.665 19.505 1.00 0.00 H ATOM 821 N ALA A 105 -37.881 75.148 21.960 1.00 34.12 N ATOM 822 CA ALA A 105 -38.647 75.345 23.172 1.00 34.86 C ATOM 823 C ALA A 105 -37.741 75.146 24.387 1.00 35.41 C ATOM 824 O ALA A 105 -37.603 76.064 25.178 1.00 37.00 O ATOM 825 CB ALA A 105 -39.833 74.449 23.219 1.00 34.68 C ATOM 826 HA ALA A 105 -39.028 76.366 23.185 1.00 0.00 H ATOM 827 HB1 ALA A 105 -40.478 74.657 22.365 1.00 0.00 H ATOM 828 HB2 ALA A 105 -39.504 73.410 23.183 1.00 0.00 H ATOM 829 HB3 ALA A 105 -40.384 74.625 24.143 1.00 0.00 H ATOM 830 H ALA A 105 -38.181 74.438 21.262 1.00 0.00 H ATOM 831 N VAL A 106 -37.090 73.998 24.546 1.00 35.04 N ATOM 832 CA VAL A 106 -36.272 73.817 25.755 1.00 34.85 C ATOM 833 C VAL A 106 -35.102 74.817 25.845 1.00 34.95 C ATOM 834 O VAL A 106 -34.676 75.162 26.941 1.00 35.32 O ATOM 835 CB VAL A 106 -35.718 72.339 25.953 1.00 34.43 C ATOM 836 CG1 VAL A 106 -36.831 71.395 26.173 1.00 32.77 C ATOM 837 CG2 VAL A 106 -34.908 71.906 24.787 1.00 33.12 C ATOM 838 HA VAL A 106 -36.972 74.017 26.567 1.00 0.00 H ATOM 839 HB VAL A 106 -35.074 72.342 26.833 1.00 0.00 H ATOM 840 HG11 VAL A 106 -37.384 71.689 27.065 1.00 0.00 H ATOM 841 HG12 VAL A 106 -37.496 71.412 25.310 1.00 0.00 H ATOM 842 HG13 VAL A 106 -36.432 70.389 26.306 1.00 0.00 H ATOM 843 HG21 VAL A 106 -35.525 71.928 23.889 1.00 0.00 H ATOM 844 HG22 VAL A 106 -34.061 72.581 24.664 1.00 0.00 H ATOM 845 HG23 VAL A 106 -34.545 70.892 24.955 1.00 0.00 H ATOM 846 H VAL A 106 -37.157 73.245 23.832 1.00 0.00 H ATOM 847 N LEU A 107 -34.588 75.275 24.705 1.00 34.51 N ATOM 848 CA LEU A 107 -33.439 76.190 24.700 1.00 34.33 C ATOM 849 C LEU A 107 -33.899 77.546 25.191 1.00 36.02 C ATOM 850 O LEU A 107 -33.248 78.137 26.049 1.00 36.33 O ATOM 851 CB LEU A 107 -32.810 76.321 23.310 1.00 33.74 C ATOM 852 CG LEU A 107 -31.551 77.164 23.166 1.00 32.35 C ATOM 853 CD1 LEU A 107 -30.452 76.549 23.986 1.00 29.54 C ATOM 854 CD2 LEU A 107 -31.169 77.280 21.692 1.00 30.75 C ATOM 855 HA LEU A 107 -32.672 75.783 25.359 1.00 0.00 H ATOM 856 HB2 LEU A 107 -32.566 75.315 22.969 1.00 0.00 H ATOM 857 HB3 LEU A 107 -33.565 76.753 22.653 1.00 0.00 H ATOM 858 HG LEU A 107 -31.727 78.174 23.536 1.00 0.00 H ATOM 859 HD21 LEU A 107 -30.985 76.285 21.286 1.00 0.00 H ATOM 860 HD22 LEU A 107 -31.984 77.752 21.143 1.00 0.00 H ATOM 861 HD23 LEU A 107 -30.267 77.885 21.598 1.00 0.00 H ATOM 862 HD11 LEU A 107 -30.755 76.517 25.032 1.00 0.00 H ATOM 863 HD12 LEU A 107 -30.259 75.536 23.631 1.00 0.00 H ATOM 864 HD13 LEU A 107 -29.547 77.149 23.887 1.00 0.00 H ATOM 865 H LEU A 107 -35.008 74.979 23.801 1.00 0.00 H ATOM 866 N GLN A 108 -35.045 78.005 24.691 1.00 37.62 N ATOM 867 CA GLN A 108 -35.617 79.276 25.131 1.00 40.13 C ATOM 868 C GLN A 108 -35.922 79.337 26.610 1.00 40.68 C ATOM 869 O GLN A 108 -35.558 80.275 27.250 1.00 41.21 O ATOM 870 CB GLN A 108 -36.845 79.648 24.324 1.00 40.20 C ATOM 871 CG GLN A 108 -36.438 80.294 23.002 1.00 42.92 C ATOM 872 CD GLN A 108 -37.617 80.805 22.153 1.00 44.62 C ATOM 873 OE1 GLN A 108 -37.416 81.127 20.966 1.00 49.07 O ATOM 874 NE2 GLN A 108 -38.839 80.895 22.753 1.00 45.64 N ATOM 875 HA GLN A 108 -34.834 80.012 24.948 1.00 0.00 H ATOM 876 HB2 GLN A 108 -37.427 78.749 24.121 1.00 0.00 H ATOM 877 HB3 GLN A 108 -37.451 80.351 24.896 1.00 0.00 H ATOM 878 HG2 GLN A 108 -35.785 81.138 23.222 1.00 0.00 H ATOM 879 HG3 GLN A 108 -35.890 79.556 22.416 1.00 0.00 H ATOM 880 HE22 GLN A 108 -38.952 80.613 23.748 1.00 0.00 H ATOM 881 HE21 GLN A 108 -39.657 81.246 22.216 1.00 0.00 H ATOM 882 H GLN A 108 -35.545 77.446 23.970 1.00 0.00 H ATOM 883 N ARG A 109 -36.546 78.320 27.150 1.00 42.44 N ATOM 884 CA ARG A 109 -36.819 78.256 28.573 1.00 44.40 C ATOM 885 C ARG A 109 -35.571 77.938 29.385 1.00 44.21 C ATOM 886 O ARG A 109 -35.586 78.045 30.607 1.00 44.22 O ATOM 887 CB ARG A 109 -37.882 77.183 28.832 1.00 45.55 C ATOM 888 CG ARG A 109 -39.199 77.581 28.200 1.00 50.70 C ATOM 889 CD ARG A 109 -40.192 76.450 28.102 1.00 57.22 C ATOM 890 NE ARG A 109 -41.194 76.518 29.155 1.00 59.83 N ATOM 891 CZ ARG A 109 -41.136 75.849 30.300 1.00 62.46 C ATOM 892 NH1 ARG A 109 -40.111 75.039 30.588 1.00 63.17 N ATOM 893 NH2 ARG A 109 -42.125 75.991 31.171 1.00 63.81 N ATOM 894 HA ARG A 109 -37.175 79.236 28.889 1.00 0.00 H ATOM 895 HB2 ARG A 109 -37.549 76.237 28.404 1.00 0.00 H ATOM 896 HB3 ARG A 109 -38.020 77.066 29.907 1.00 0.00 H ATOM 897 HG2 ARG A 109 -39.642 78.377 28.799 1.00 0.00 H ATOM 898 HG3 ARG A 109 -39.000 77.952 27.195 1.00 0.00 H ATOM 899 HD2 ARG A 109 -39.658 75.503 28.183 1.00 0.00 H ATOM 900 HD3 ARG A 109 -40.692 76.502 27.135 1.00 0.00 H ATOM 901 HE ARG A 109 -42.016 77.136 28.999 1.00 0.00 H ATOM 902 HH12 ARG A 109 -40.091 74.527 31.493 1.00 0.00 H ATOM 903 HH11 ARG A 109 -39.334 74.921 29.907 1.00 0.00 H ATOM 904 HH22 ARG A 109 -42.100 75.476 32.074 1.00 0.00 H ATOM 905 HH21 ARG A 109 -42.926 76.617 30.951 1.00 0.00 H ATOM 906 H ARG A 109 -36.855 77.536 26.541 1.00 0.00 H ATOM 907 N ASP A 110 -34.495 77.552 28.705 1.00 43.75 N ATOM 908 CA ASP A 110 -33.292 77.048 29.365 1.00 43.28 C ATOM 909 C ASP A 110 -33.645 75.978 30.370 1.00 42.33 C ATOM 910 O ASP A 110 -33.234 76.015 31.531 1.00 41.93 O ATOM 911 CB ASP A 110 -32.503 78.159 30.034 1.00 43.58 C ATOM 912 CG ASP A 110 -31.149 77.686 30.523 1.00 45.38 C ATOM 913 OD1 ASP A 110 -30.642 76.670 30.003 1.00 43.53 O ATOM 914 OD2 ASP A 110 -30.587 78.325 31.446 1.00 48.97 O ATOM 915 HA ASP A 110 -32.658 76.614 28.592 1.00 0.00 H ATOM 916 HB2 ASP A 110 -32.355 78.966 29.316 1.00 0.00 H ATOM 917 HB3 ASP A 110 -33.073 78.531 30.885 1.00 0.00 H ATOM 918 H ASP A 110 -34.510 77.611 27.667 1.00 0.00 H ATOM 919 N GLU A 111 -34.410 75.009 29.889 1.00 41.57 N ATOM 920 CA GLU A 111 -34.788 73.847 30.685 1.00 40.52 C ATOM 921 C GLU A 111 -33.632 72.863 30.805 1.00 39.25 C ATOM 922 O GLU A 111 -33.215 72.248 29.818 1.00 38.43 O ATOM 923 CB GLU A 111 -35.993 73.145 30.074 1.00 40.08 C ATOM 924 CG GLU A 111 -36.546 72.071 30.983 1.00 41.18 C ATOM 925 CD GLU A 111 -37.725 71.358 30.369 1.00 43.19 C ATOM 926 OE1 GLU A 111 -37.583 70.140 30.128 1.00 45.21 O ATOM 927 OE2 GLU A 111 -38.766 72.023 30.100 1.00 42.71 O ATOM 928 HA GLU A 111 -35.048 74.203 31.682 1.00 0.00 H ATOM 929 HB2 GLU A 111 -36.773 73.883 29.887 1.00 0.00 H ATOM 930 HB3 GLU A 111 -35.693 72.688 29.131 1.00 0.00 H ATOM 931 HG2 GLU A 111 -35.761 71.342 31.185 1.00 0.00 H ATOM 932 HG3 GLU A 111 -36.862 72.531 31.919 1.00 0.00 H ATOM 933 H GLU A 111 -34.753 75.080 28.910 1.00 0.00 H ATOM 934 N ARG A 112 -33.153 72.697 32.027 1.00 38.45 N ATOM 935 CA ARG A 112 -32.020 71.852 32.287 1.00 38.08 C ATOM 936 C ARG A 112 -32.490 70.507 32.780 1.00 37.74 C ATOM 937 O ARG A 112 -32.084 70.086 33.840 1.00 39.69 O ATOM 938 CB ARG A 112 -31.128 72.480 33.354 1.00 38.12 C ATOM 939 CG ARG A 112 -30.835 73.957 33.157 1.00 39.53 C ATOM 940 CD ARG A 112 -29.810 74.181 32.092 1.00 40.22 C ATOM 941 NE ARG A 112 -29.178 75.506 32.141 1.00 41.73 N ATOM 942 CZ ARG A 112 -28.268 75.903 33.041 1.00 43.11 C ATOM 943 NH1 ARG A 112 -27.887 75.111 34.031 1.00 44.83 N ATOM 944 NH2 ARG A 112 -27.737 77.120 32.955 1.00 41.64 N ATOM 945 HA ARG A 112 -31.456 71.734 31.362 1.00 0.00 H ATOM 946 HB2 ARG A 112 -31.618 72.358 34.320 1.00 0.00 H ATOM 947 HB3 ARG A 112 -30.179 71.944 33.360 1.00 0.00 H ATOM 948 HG2 ARG A 112 -31.756 74.465 32.873 1.00 0.00 H ATOM 949 HG3 ARG A 112 -30.467 74.372 34.095 1.00 0.00 H ATOM 950 HD2 ARG A 112 -30.293 74.067 31.122 1.00 0.00 H ATOM 951 HD3 ARG A 112 -29.032 73.425 32.200 1.00 0.00 H ATOM 952 HE ARG A 112 -29.461 76.195 31.415 1.00 0.00 H ATOM 953 HH12 ARG A 112 -27.179 75.441 34.718 1.00 0.00 H ATOM 954 HH11 ARG A 112 -28.296 74.159 34.122 1.00 0.00 H ATOM 955 HH22 ARG A 112 -27.031 77.430 33.653 1.00 0.00 H ATOM 956 HH21 ARG A 112 -28.028 77.762 32.190 1.00 0.00 H ATOM 957 H ARG A 112 -33.609 73.191 32.821 1.00 0.00 H ATOM 958 N SER A 113 -33.338 69.821 32.031 1.00 36.90 N ATOM 959 CA SER A 113 -33.926 68.554 32.493 1.00 35.95 C ATOM 960 C SER A 113 -33.397 67.328 31.763 1.00 35.21 C ATOM 961 O SER A 113 -32.801 67.414 30.693 1.00 34.42 O ATOM 962 CB SER A 113 -35.419 68.582 32.254 1.00 36.14 C ATOM 963 OG SER A 113 -35.644 68.568 30.848 1.00 37.10 O ATOM 964 HA SER A 113 -33.660 68.472 33.547 1.00 0.00 H ATOM 965 HB2 SER A 113 -35.846 69.487 32.687 1.00 0.00 H ATOM 966 HB3 SER A 113 -35.883 67.708 32.711 1.00 0.00 H ATOM 967 HG SER A 113 -36.618 68.586 30.671 1.00 0.00 H ATOM 968 H SER A 113 -33.595 70.187 31.092 1.00 0.00 H ATOM 969 N GLU A 114 -33.703 66.176 32.345 1.00 34.96 N ATOM 970 CA GLU A 114 -33.341 64.886 31.801 1.00 35.03 C ATOM 971 C GLU A 114 -33.999 64.642 30.437 1.00 34.43 C ATOM 972 O GLU A 114 -33.389 64.065 29.522 1.00 34.91 O ATOM 973 CB GLU A 114 -33.739 63.789 32.805 1.00 35.59 C ATOM 974 CG GLU A 114 -33.256 62.399 32.458 1.00 37.17 C ATOM 975 CD GLU A 114 -31.754 62.369 32.305 1.00 41.49 C ATOM 976 OE1 GLU A 114 -31.058 62.838 33.278 1.00 44.81 O ATOM 977 OE2 GLU A 114 -31.302 61.907 31.217 1.00 39.25 O ATOM 978 HA GLU A 114 -32.263 64.863 31.641 1.00 0.00 H ATOM 979 HB2 GLU A 114 -33.329 64.057 33.779 1.00 0.00 H ATOM 980 HB3 GLU A 114 -34.827 63.764 32.865 1.00 0.00 H ATOM 981 HG2 GLU A 114 -33.547 61.712 33.252 1.00 0.00 H ATOM 982 HG3 GLU A 114 -33.716 62.085 31.521 1.00 0.00 H ATOM 983 H GLU A 114 -34.231 66.202 33.240 1.00 0.00 H ATOM 984 N ARG A 115 -35.237 65.091 30.305 1.00 33.75 N ATOM 985 CA ARG A 115 -35.910 65.040 29.015 1.00 33.29 C ATOM 986 C ARG A 115 -35.250 65.967 27.954 1.00 32.08 C ATOM 987 O ARG A 115 -35.227 65.652 26.794 1.00 31.31 O ATOM 988 CB ARG A 115 -37.425 65.292 29.152 1.00 31.74 C ATOM 989 CG ARG A 115 -37.819 66.682 29.473 1.00 33.17 C ATOM 990 CD ARG A 115 -39.324 66.918 29.264 1.00 34.63 C ATOM 991 NE ARG A 115 -39.687 68.284 29.648 1.00 36.56 N ATOM 992 CZ ARG A 115 -40.915 68.809 29.637 1.00 36.21 C ATOM 993 NH1 ARG A 115 -41.981 68.102 29.277 1.00 35.47 N ATOM 994 NH2 ARG A 115 -41.071 70.074 29.991 1.00 34.91 N ATOM 995 HA ARG A 115 -35.787 64.024 28.640 1.00 0.00 H ATOM 996 HB2 ARG A 115 -37.897 65.020 28.208 1.00 0.00 H ATOM 997 HB3 ARG A 115 -37.802 64.646 29.945 1.00 0.00 H ATOM 998 HG2 ARG A 115 -37.572 66.886 30.515 1.00 0.00 H ATOM 999 HG3 ARG A 115 -37.263 67.363 28.829 1.00 0.00 H ATOM 1000 HD2 ARG A 115 -39.886 66.212 29.875 1.00 0.00 H ATOM 1001 HD3 ARG A 115 -39.569 66.763 28.213 1.00 0.00 H ATOM 1002 HE ARG A 115 -38.913 68.905 29.959 1.00 0.00 H ATOM 1003 HH12 ARG A 115 -42.923 68.543 29.280 1.00 0.00 H ATOM 1004 HH11 ARG A 115 -41.873 67.108 28.992 1.00 0.00 H ATOM 1005 HH22 ARG A 115 -42.019 70.501 29.989 1.00 0.00 H ATOM 1006 HH21 ARG A 115 -40.246 70.641 30.271 1.00 0.00 H ATOM 1007 H ARG A 115 -35.733 65.484 31.130 1.00 0.00 H ATOM 1008 N ALA A 116 -34.743 67.115 28.349 1.00 31.93 N ATOM 1009 CA ALA A 116 -34.059 67.971 27.392 1.00 31.70 C ATOM 1010 C ALA A 116 -32.811 67.240 26.903 1.00 31.33 C ATOM 1011 O ALA A 116 -32.468 67.283 25.751 1.00 30.14 O ATOM 1012 CB ALA A 116 -33.688 69.335 28.042 1.00 31.59 C ATOM 1013 HA ALA A 116 -34.714 68.184 26.547 1.00 0.00 H ATOM 1014 HB1 ALA A 116 -34.597 69.835 28.377 1.00 0.00 H ATOM 1015 HB2 ALA A 116 -33.031 69.163 28.895 1.00 0.00 H ATOM 1016 HB3 ALA A 116 -33.178 69.959 27.308 1.00 0.00 H ATOM 1017 H ALA A 116 -34.831 67.410 29.342 1.00 0.00 H ATOM 1018 N PHE A 117 -32.137 66.560 27.815 1.00 31.97 N ATOM 1019 CA PHE A 117 -30.913 65.886 27.498 1.00 31.86 C ATOM 1020 C PHE A 117 -31.120 64.842 26.424 1.00 31.27 C ATOM 1021 O PHE A 117 -30.359 64.762 25.478 1.00 30.48 O ATOM 1022 CB PHE A 117 -30.391 65.234 28.750 1.00 32.61 C ATOM 1023 CG PHE A 117 -29.101 64.515 28.554 1.00 32.40 C ATOM 1024 CD1 PHE A 117 -27.960 65.210 28.206 1.00 33.33 C ATOM 1025 CD2 PHE A 117 -29.022 63.156 28.735 1.00 32.24 C ATOM 1026 CE1 PHE A 117 -26.780 64.562 28.041 1.00 33.34 C ATOM 1027 CE2 PHE A 117 -27.848 62.495 28.558 1.00 32.50 C ATOM 1028 CZ PHE A 117 -26.725 63.189 28.212 1.00 34.01 C ATOM 1029 HA PHE A 117 -30.196 66.613 27.117 1.00 0.00 H ATOM 1030 HB2 PHE A 117 -30.244 66.006 29.506 1.00 0.00 H ATOM 1031 HB3 PHE A 117 -31.134 64.519 29.102 1.00 0.00 H ATOM 1032 HD2 PHE A 117 -29.913 62.600 29.025 1.00 0.00 H ATOM 1033 HE2 PHE A 117 -27.803 61.414 28.692 1.00 0.00 H ATOM 1034 HZ PHE A 117 -25.782 62.661 28.070 1.00 0.00 H ATOM 1035 HE1 PHE A 117 -25.881 65.118 27.776 1.00 0.00 H ATOM 1036 HD1 PHE A 117 -28.008 66.289 28.063 1.00 0.00 H ATOM 1037 H PHE A 117 -32.505 66.513 28.787 1.00 0.00 H ATOM 1038 N LYS A 118 -32.155 64.040 26.577 1.00 31.15 N ATOM 1039 CA LYS A 118 -32.447 62.980 25.598 1.00 31.26 C ATOM 1040 C LYS A 118 -32.802 63.524 24.235 1.00 29.98 C ATOM 1041 O LYS A 118 -32.462 62.916 23.215 1.00 28.70 O ATOM 1042 CB LYS A 118 -33.577 62.074 26.091 1.00 31.53 C ATOM 1043 CG LYS A 118 -33.103 61.101 27.125 1.00 34.11 C ATOM 1044 CD LYS A 118 -34.195 60.224 27.653 1.00 37.40 C ATOM 1045 CE LYS A 118 -33.646 59.094 28.554 1.00 41.07 C ATOM 1046 NZ LYS A 118 -33.706 59.368 30.044 1.00 41.08 N ATOM 1047 HA LYS A 118 -31.528 62.402 25.498 1.00 0.00 H ATOM 1048 HB2 LYS A 118 -34.362 62.694 26.524 1.00 0.00 H ATOM 1049 HB3 LYS A 118 -33.979 61.519 25.243 1.00 0.00 H ATOM 1050 HG2 LYS A 118 -32.335 60.469 26.680 1.00 0.00 H ATOM 1051 HG3 LYS A 118 -32.674 61.660 27.957 1.00 0.00 H ATOM 1052 HD2 LYS A 118 -34.886 60.834 28.235 1.00 0.00 H ATOM 1053 HD3 LYS A 118 -34.726 59.777 26.812 1.00 0.00 H ATOM 1054 HE2 LYS A 118 -32.604 58.924 28.284 1.00 0.00 H ATOM 1055 HE3 LYS A 118 -34.224 58.192 28.353 1.00 0.00 H ATOM 1056 HZ1 LYS A 118 -33.148 60.218 30.262 1.00 0.00 H ATOM 1057 HZ2 LYS A 118 -34.695 59.519 30.328 1.00 0.00 H ATOM 1058 HZ3 LYS A 118 -33.316 58.554 30.561 1.00 0.00 H ATOM 1059 H LYS A 118 -32.776 64.158 27.403 1.00 0.00 H ATOM 1060 N LEU A 119 -33.522 64.640 24.253 1.00 29.00 N ATOM 1061 CA LEU A 119 -33.858 65.382 23.078 1.00 28.93 C ATOM 1062 C LEU A 119 -32.620 65.915 22.321 1.00 28.66 C ATOM 1063 O LEU A 119 -32.603 65.859 21.098 1.00 27.33 O ATOM 1064 CB LEU A 119 -34.803 66.528 23.440 1.00 28.73 C ATOM 1065 CG LEU A 119 -35.216 67.528 22.336 1.00 29.13 C ATOM 1066 CD1 LEU A 119 -36.028 66.874 21.224 1.00 27.46 C ATOM 1067 CD2 LEU A 119 -35.977 68.670 22.956 1.00 28.42 C ATOM 1068 HA LEU A 119 -34.358 64.693 22.397 1.00 0.00 H ATOM 1069 HB2 LEU A 119 -35.719 66.079 23.825 1.00 0.00 H ATOM 1070 HB3 LEU A 119 -34.321 67.104 24.230 1.00 0.00 H ATOM 1071 HG LEU A 119 -34.306 67.903 21.868 1.00 0.00 H ATOM 1072 HD21 LEU A 119 -36.868 68.285 23.451 1.00 0.00 H ATOM 1073 HD22 LEU A 119 -35.343 69.174 23.686 1.00 0.00 H ATOM 1074 HD23 LEU A 119 -36.269 69.376 22.178 1.00 0.00 H ATOM 1075 HD11 LEU A 119 -35.435 66.087 20.758 1.00 0.00 H ATOM 1076 HD12 LEU A 119 -36.938 66.445 21.644 1.00 0.00 H ATOM 1077 HD13 LEU A 119 -36.290 67.624 20.478 1.00 0.00 H ATOM 1078 H LEU A 119 -33.859 64.993 25.171 1.00 0.00 H ATOM 1079 N THR A 120 -31.601 66.423 23.024 1.00 28.94 N ATOM 1080 CA THR A 120 -30.413 66.919 22.331 1.00 29.69 C ATOM 1081 C THR A 120 -29.807 65.748 21.582 1.00 30.73 C ATOM 1082 O THR A 120 -29.111 65.895 20.560 1.00 30.75 O ATOM 1083 CB THR A 120 -29.292 67.520 23.227 1.00 29.37 C ATOM 1084 OG1 THR A 120 -28.764 66.518 24.107 1.00 28.44 O ATOM 1085 CG2 THR A 120 -29.784 68.732 24.007 1.00 29.34 C ATOM 1086 HA THR A 120 -30.761 67.739 21.702 1.00 0.00 H ATOM 1087 HB THR A 120 -28.490 67.863 22.574 1.00 0.00 H ATOM 1088 HG1 THR A 120 -29.490 66.173 24.685 1.00 0.00 H ATOM 1089 HG23 THR A 120 -30.178 69.474 23.313 1.00 0.00 H ATOM 1090 HG21 THR A 120 -30.570 68.424 24.697 1.00 0.00 H ATOM 1091 HG22 THR A 120 -28.955 69.162 24.568 1.00 0.00 H ATOM 1092 H THR A 120 -31.654 66.465 24.062 1.00 0.00 H ATOM 1093 N ARG A 121 -30.060 64.561 22.078 1.00 31.12 N ATOM 1094 CA ARG A 121 -29.470 63.467 21.407 1.00 31.65 C ATOM 1095 C ARG A 121 -30.082 63.279 20.051 1.00 30.51 C ATOM 1096 O ARG A 121 -29.370 63.081 19.090 1.00 29.96 O ATOM 1097 CB ARG A 121 -29.610 62.213 22.216 1.00 33.17 C ATOM 1098 CG ARG A 121 -28.653 61.195 21.708 1.00 36.12 C ATOM 1099 CD ARG A 121 -29.401 59.995 21.307 1.00 39.51 C ATOM 1100 NE ARG A 121 -29.037 58.966 22.240 1.00 42.36 N ATOM 1101 CZ ARG A 121 -29.588 57.777 22.275 1.00 41.89 C ATOM 1102 NH1 ARG A 121 -30.593 57.473 21.453 1.00 40.16 N ATOM 1103 NH2 ARG A 121 -29.123 56.918 23.165 1.00 42.49 N ATOM 1104 HA ARG A 121 -28.409 63.683 21.279 1.00 0.00 H ATOM 1105 HB2 ARG A 121 -29.393 62.428 23.262 1.00 0.00 H ATOM 1106 HB3 ARG A 121 -30.628 61.833 22.128 1.00 0.00 H ATOM 1107 HG2 ARG A 121 -28.115 61.595 20.849 1.00 0.00 H ATOM 1108 HG3 ARG A 121 -27.942 60.938 22.493 1.00 0.00 H ATOM 1109 HD2 ARG A 121 -29.128 59.700 20.294 1.00 0.00 H ATOM 1110 HD3 ARG A 121 -30.473 60.185 21.353 1.00 0.00 H ATOM 1111 HE ARG A 121 -28.289 59.177 22.931 1.00 0.00 H ATOM 1112 HH12 ARG A 121 -31.025 56.527 21.487 1.00 0.00 H ATOM 1113 HH11 ARG A 121 -30.945 58.181 20.778 1.00 0.00 H ATOM 1114 HH22 ARG A 121 -29.530 55.963 23.228 1.00 0.00 H ATOM 1115 HH21 ARG A 121 -28.350 57.197 23.802 1.00 0.00 H ATOM 1116 H ARG A 121 -30.661 64.432 22.917 1.00 0.00 H ATOM 1117 N ASP A 122 -31.403 63.356 19.972 1.00 30.24 N ATOM 1118 CA ASP A 122 -32.094 63.220 18.704 1.00 29.47 C ATOM 1119 C ASP A 122 -31.786 64.379 17.802 1.00 29.14 C ATOM 1120 O ASP A 122 -31.802 64.210 16.610 1.00 28.51 O ATOM 1121 CB ASP A 122 -33.611 63.190 18.897 1.00 29.96 C ATOM 1122 CG ASP A 122 -34.123 61.886 19.488 1.00 29.47 C ATOM 1123 OD1 ASP A 122 -33.406 60.877 19.503 1.00 29.05 O ATOM 1124 OD2 ASP A 122 -35.286 61.862 19.922 1.00 31.65 O ATOM 1125 HA ASP A 122 -31.751 62.284 18.263 1.00 0.00 H ATOM 1126 HB2 ASP A 122 -33.890 64.005 19.565 1.00 0.00 H ATOM 1127 HB3 ASP A 122 -34.085 63.339 17.927 1.00 0.00 H ATOM 1128 H ASP A 122 -31.956 63.517 20.838 1.00 0.00 H ATOM 1129 N ALA A 123 -31.551 65.575 18.359 1.00 28.93 N ATOM 1130 CA ALA A 123 -31.302 66.750 17.526 1.00 28.03 C ATOM 1131 C ALA A 123 -29.926 66.626 16.879 1.00 28.32 C ATOM 1132 O ALA A 123 -29.755 66.991 15.717 1.00 27.68 O ATOM 1133 CB ALA A 123 -31.432 68.006 18.317 1.00 26.57 C ATOM 1134 HA ALA A 123 -32.053 66.799 16.737 1.00 0.00 H ATOM 1135 HB1 ALA A 123 -32.441 68.074 18.725 1.00 0.00 H ATOM 1136 HB2 ALA A 123 -30.709 67.997 19.133 1.00 0.00 H ATOM 1137 HB3 ALA A 123 -31.241 68.862 17.670 1.00 0.00 H ATOM 1138 H ALA A 123 -31.546 65.668 19.395 1.00 0.00 H ATOM 1139 N ILE A 124 -28.965 66.087 17.636 1.00 28.40 N ATOM 1140 CA ILE A 124 -27.648 65.792 17.131 1.00 28.67 C ATOM 1141 C ILE A 124 -27.735 64.745 16.044 1.00 29.20 C ATOM 1142 O ILE A 124 -27.124 64.859 14.986 1.00 28.59 O ATOM 1143 CB ILE A 124 -26.680 65.323 18.258 1.00 28.68 C ATOM 1144 CG1 ILE A 124 -26.225 66.504 19.101 1.00 28.37 C ATOM 1145 CG2 ILE A 124 -25.466 64.663 17.716 1.00 26.23 C ATOM 1146 CD1 ILE A 124 -25.712 66.136 20.457 1.00 28.85 C ATOM 1147 HA ILE A 124 -27.239 66.713 16.717 1.00 0.00 H ATOM 1148 HB ILE A 124 -27.240 64.608 18.861 1.00 0.00 H ATOM 1149 HG12 ILE A 124 -25.429 67.020 18.564 1.00 0.00 H ATOM 1150 HG13 ILE A 124 -27.072 67.178 19.228 1.00 0.00 H ATOM 1151 HD11 ILE A 124 -26.499 65.630 21.017 1.00 0.00 H ATOM 1152 HD12 ILE A 124 -24.854 65.471 20.352 1.00 0.00 H ATOM 1153 HD13 ILE A 124 -25.410 67.039 20.987 1.00 0.00 H ATOM 1154 HG21 ILE A 124 -25.758 63.789 17.134 1.00 0.00 H ATOM 1155 HG22 ILE A 124 -24.928 65.363 17.077 1.00 0.00 H ATOM 1156 HG23 ILE A 124 -24.823 64.354 18.540 1.00 0.00 H ATOM 1157 H ILE A 124 -29.177 65.872 18.631 1.00 0.00 H ATOM 1158 N GLU A 125 -28.508 63.715 16.274 1.00 29.91 N ATOM 1159 CA GLU A 125 -28.518 62.650 15.298 1.00 30.63 C ATOM 1160 C GLU A 125 -29.046 63.132 13.943 1.00 30.25 C ATOM 1161 O GLU A 125 -28.578 62.680 12.886 1.00 31.22 O ATOM 1162 CB GLU A 125 -29.313 61.469 15.815 1.00 31.22 C ATOM 1163 CG GLU A 125 -29.140 60.218 14.985 1.00 34.81 C ATOM 1164 CD GLU A 125 -29.741 58.999 15.681 1.00 41.19 C ATOM 1165 OE1 GLU A 125 -30.348 58.160 14.986 1.00 43.44 O ATOM 1166 OE2 GLU A 125 -29.618 58.881 16.931 1.00 45.30 O ATOM 1167 HA GLU A 125 -27.489 62.326 15.140 1.00 0.00 H ATOM 1168 HB2 GLU A 125 -28.991 61.255 16.834 1.00 0.00 H ATOM 1169 HB3 GLU A 125 -30.369 61.738 15.818 1.00 0.00 H ATOM 1170 HG2 GLU A 125 -29.636 60.358 14.024 1.00 0.00 H ATOM 1171 HG3 GLU A 125 -28.076 60.045 14.822 1.00 0.00 H ATOM 1172 H GLU A 125 -29.096 63.665 17.131 1.00 0.00 H ATOM 1173 N LEU A 126 -29.999 64.051 13.974 1.00 29.14 N ATOM 1174 CA LEU A 126 -30.574 64.635 12.766 1.00 28.74 C ATOM 1175 C LEU A 126 -29.668 65.649 12.084 1.00 28.12 C ATOM 1176 O LEU A 126 -29.772 65.842 10.871 1.00 26.72 O ATOM 1177 CB LEU A 126 -31.909 65.321 13.084 1.00 28.94 C ATOM 1178 CG LEU A 126 -33.046 64.353 13.473 1.00 28.83 C ATOM 1179 CD1 LEU A 126 -34.241 65.065 14.177 1.00 23.57 C ATOM 1180 CD2 LEU A 126 -33.476 63.602 12.237 1.00 25.20 C ATOM 1181 HA LEU A 126 -30.714 63.800 12.080 1.00 0.00 H ATOM 1182 HB2 LEU A 126 -31.749 66.011 13.913 1.00 0.00 H ATOM 1183 HB3 LEU A 126 -32.224 65.880 12.203 1.00 0.00 H ATOM 1184 HG LEU A 126 -32.669 63.650 14.216 1.00 0.00 H ATOM 1185 HD21 LEU A 126 -33.829 64.310 11.487 1.00 0.00 H ATOM 1186 HD22 LEU A 126 -32.629 63.043 11.840 1.00 0.00 H ATOM 1187 HD23 LEU A 126 -34.280 62.912 12.494 1.00 0.00 H ATOM 1188 HD11 LEU A 126 -33.889 65.546 15.090 1.00 0.00 H ATOM 1189 HD12 LEU A 126 -34.660 65.816 13.507 1.00 0.00 H ATOM 1190 HD13 LEU A 126 -35.006 64.329 14.424 1.00 0.00 H ATOM 1191 H LEU A 126 -30.353 64.370 14.898 1.00 0.00 H ATOM 1192 N ASN A 127 -28.834 66.341 12.868 1.00 27.86 N ATOM 1193 CA ASN A 127 -27.834 67.277 12.321 1.00 27.51 C ATOM 1194 C ASN A 127 -26.690 67.445 13.275 1.00 27.90 C ATOM 1195 O ASN A 127 -26.725 68.337 14.132 1.00 27.52 O ATOM 1196 CB ASN A 127 -28.413 68.655 12.010 1.00 27.05 C ATOM 1197 CG ASN A 127 -27.353 69.629 11.482 1.00 27.21 C ATOM 1198 OD1 ASN A 127 -26.250 69.217 11.053 1.00 26.84 O ATOM 1199 ND2 ASN A 127 -27.686 70.928 11.494 1.00 21.98 N ATOM 1200 HA ASN A 127 -27.492 66.835 11.386 1.00 0.00 H ATOM 1201 HB2 ASN A 127 -29.194 68.545 11.257 1.00 0.00 H ATOM 1202 HB3 ASN A 127 -28.845 69.068 12.922 1.00 0.00 H ATOM 1203 HD22 ASN A 127 -28.614 71.224 11.860 1.00 0.00 H ATOM 1204 HD21 ASN A 127 -27.017 71.640 11.137 1.00 0.00 H ATOM 1205 H ASN A 127 -28.893 66.215 13.899 1.00 0.00 H ATOM 1206 N ALA A 128 -25.659 66.619 13.099 1.00 27.94 N ATOM 1207 CA ALA A 128 -24.579 66.540 14.076 1.00 27.85 C ATOM 1208 C ALA A 128 -23.676 67.749 13.980 1.00 27.45 C ATOM 1209 O ALA A 128 -22.822 67.928 14.844 1.00 27.83 O ATOM 1210 CB ALA A 128 -23.769 65.215 13.922 1.00 27.19 C ATOM 1211 HA ALA A 128 -25.028 66.534 15.069 1.00 0.00 H ATOM 1212 HB1 ALA A 128 -24.434 64.365 14.071 1.00 0.00 H ATOM 1213 HB2 ALA A 128 -23.337 65.169 12.922 1.00 0.00 H ATOM 1214 HB3 ALA A 128 -22.972 65.189 14.665 1.00 0.00 H ATOM 1215 H ALA A 128 -25.624 66.020 12.250 1.00 0.00 H ATOM 1216 N ALA A 129 -23.861 68.564 12.934 1.00 26.89 N ATOM 1217 CA ALA A 129 -23.100 69.826 12.751 1.00 26.80 C ATOM 1218 C ALA A 129 -23.698 71.029 13.534 1.00 26.48 C ATOM 1219 O ALA A 129 -23.093 72.085 13.582 1.00 25.16 O ATOM 1220 CB ALA A 129 -22.904 70.182 11.212 1.00 25.12 C ATOM 1221 HA ALA A 129 -22.117 69.639 13.183 1.00 0.00 H ATOM 1222 HB1 ALA A 129 -22.356 69.378 10.721 1.00 0.00 H ATOM 1223 HB2 ALA A 129 -23.880 70.299 10.740 1.00 0.00 H ATOM 1224 HB3 ALA A 129 -22.343 71.112 11.124 1.00 0.00 H ATOM 1225 H ALA A 129 -24.569 68.302 12.218 1.00 0.00 H ATOM 1226 N ASN A 130 -24.849 70.857 14.178 1.00 26.53 N ATOM 1227 CA ASN A 130 -25.458 71.946 14.899 1.00 26.67 C ATOM 1228 C ASN A 130 -24.758 72.240 16.213 1.00 26.78 C ATOM 1229 O ASN A 130 -24.993 71.626 17.221 1.00 27.53 O ATOM 1230 CB ASN A 130 -26.960 71.694 15.091 1.00 26.47 C ATOM 1231 CG ASN A 130 -27.666 72.891 15.684 1.00 25.62 C ATOM 1232 OD1 ASN A 130 -27.162 73.501 16.620 1.00 26.05 O ATOM 1233 ND2 ASN A 130 -28.818 73.248 15.141 1.00 22.88 N ATOM 1234 HA ASN A 130 -25.341 72.844 14.292 1.00 0.00 H ATOM 1235 HB2 ASN A 130 -27.405 71.467 14.122 1.00 0.00 H ATOM 1236 HB3 ASN A 130 -27.091 70.842 15.758 1.00 0.00 H ATOM 1237 HD22 ASN A 130 -29.210 72.702 14.348 1.00 0.00 H ATOM 1238 HD21 ASN A 130 -29.332 74.075 15.507 1.00 0.00 H ATOM 1239 H ASN A 130 -25.314 69.927 14.161 1.00 0.00 H ATOM 1240 N TYR A 131 -23.886 73.214 16.204 1.00 27.48 N ATOM 1241 CA TYR A 131 -23.038 73.506 17.389 1.00 27.59 C ATOM 1242 C TYR A 131 -23.824 74.124 18.596 1.00 27.39 C ATOM 1243 O TYR A 131 -23.403 73.976 19.730 1.00 26.29 O ATOM 1244 CB TYR A 131 -21.842 74.378 16.955 1.00 27.96 C ATOM 1245 CG TYR A 131 -22.311 75.659 16.317 1.00 27.80 C ATOM 1246 CD1 TYR A 131 -22.572 76.770 17.107 1.00 27.77 C ATOM 1247 CD2 TYR A 131 -22.573 75.738 14.946 1.00 28.55 C ATOM 1248 CE1 TYR A 131 -23.039 77.924 16.585 1.00 29.41 C ATOM 1249 CE2 TYR A 131 -23.077 76.920 14.386 1.00 30.29 C ATOM 1250 CZ TYR A 131 -23.303 78.007 15.227 1.00 30.49 C ATOM 1251 OH TYR A 131 -23.792 79.192 14.764 1.00 29.94 O ATOM 1252 HA TYR A 131 -22.668 72.555 17.773 1.00 0.00 H ATOM 1253 HB3 TYR A 131 -21.237 73.823 16.238 1.00 0.00 H ATOM 1254 HB2 TYR A 131 -21.238 74.616 17.830 1.00 0.00 H ATOM 1255 HD2 TYR A 131 -22.384 74.875 14.308 1.00 0.00 H ATOM 1256 HE2 TYR A 131 -23.287 76.987 13.318 1.00 0.00 H ATOM 1257 HE1 TYR A 131 -23.208 78.787 17.229 1.00 0.00 H ATOM 1258 HD1 TYR A 131 -22.395 76.709 18.181 1.00 0.00 H ATOM 1259 HH TYR A 131 -23.879 79.829 15.517 1.00 0.00 H ATOM 1260 H TYR A 131 -23.784 73.797 15.349 1.00 0.00 H ATOM 1261 N THR A 132 -24.966 74.790 18.346 1.00 27.08 N ATOM 1262 CA THR A 132 -25.860 75.240 19.412 1.00 27.17 C ATOM 1263 C THR A 132 -26.393 74.040 20.191 1.00 26.98 C ATOM 1264 O THR A 132 -26.473 74.111 21.397 1.00 26.86 O ATOM 1265 CB THR A 132 -27.076 76.105 18.896 1.00 27.60 C ATOM 1266 OG1 THR A 132 -26.605 77.242 18.174 1.00 27.62 O ATOM 1267 CG2 THR A 132 -27.994 76.590 20.031 1.00 25.96 C ATOM 1268 HA THR A 132 -25.261 75.884 20.056 1.00 0.00 H ATOM 1269 HB THR A 132 -27.660 75.451 18.248 1.00 0.00 H ATOM 1270 HG1 THR A 132 -26.070 76.940 17.397 1.00 0.00 H ATOM 1271 HG23 THR A 132 -28.362 75.731 20.592 1.00 0.00 H ATOM 1272 HG21 THR A 132 -27.432 77.246 20.696 1.00 0.00 H ATOM 1273 HG22 THR A 132 -28.837 77.136 19.607 1.00 0.00 H ATOM 1274 H THR A 132 -25.222 74.992 17.359 1.00 0.00 H ATOM 1275 N VAL A 133 -26.744 72.937 19.536 1.00 26.98 N ATOM 1276 CA VAL A 133 -27.238 71.773 20.293 1.00 27.19 C ATOM 1277 C VAL A 133 -26.140 71.171 21.185 1.00 27.77 C ATOM 1278 O VAL A 133 -26.379 70.882 22.358 1.00 26.49 O ATOM 1279 CB VAL A 133 -27.895 70.669 19.386 1.00 27.85 C ATOM 1280 CG1 VAL A 133 -28.335 69.476 20.217 1.00 22.86 C ATOM 1281 CG2 VAL A 133 -29.110 71.248 18.586 1.00 25.62 C ATOM 1282 HA VAL A 133 -28.032 72.155 20.935 1.00 0.00 H ATOM 1283 HB VAL A 133 -27.141 70.336 18.673 1.00 0.00 H ATOM 1284 HG11 VAL A 133 -27.469 69.047 20.721 1.00 0.00 H ATOM 1285 HG12 VAL A 133 -29.065 69.801 20.959 1.00 0.00 H ATOM 1286 HG13 VAL A 133 -28.786 68.727 19.565 1.00 0.00 H ATOM 1287 HG21 VAL A 133 -29.860 71.618 19.285 1.00 0.00 H ATOM 1288 HG22 VAL A 133 -28.769 72.065 17.950 1.00 0.00 H ATOM 1289 HG23 VAL A 133 -29.544 70.462 17.968 1.00 0.00 H ATOM 1290 H VAL A 133 -26.671 72.896 18.499 1.00 0.00 H ATOM 1291 N TRP A 134 -24.937 71.006 20.633 1.00 28.02 N ATOM 1292 CA TRP A 134 -23.827 70.500 21.401 1.00 28.63 C ATOM 1293 C TRP A 134 -23.538 71.362 22.668 1.00 29.54 C ATOM 1294 O TRP A 134 -23.302 70.851 23.769 1.00 28.67 O ATOM 1295 CB TRP A 134 -22.582 70.398 20.521 1.00 28.73 C ATOM 1296 CG TRP A 134 -22.578 69.271 19.558 1.00 28.05 C ATOM 1297 CD1 TRP A 134 -22.782 69.352 18.230 1.00 27.90 C ATOM 1298 CD2 TRP A 134 -22.364 67.892 19.844 1.00 29.17 C ATOM 1299 NE1 TRP A 134 -22.689 68.129 17.651 1.00 28.10 N ATOM 1300 CE2 TRP A 134 -22.460 67.201 18.625 1.00 28.71 C ATOM 1301 CE3 TRP A 134 -22.120 67.164 21.024 1.00 29.40 C ATOM 1302 CZ2 TRP A 134 -22.295 65.833 18.535 1.00 28.12 C ATOM 1303 CZ3 TRP A 134 -21.981 65.830 20.952 1.00 28.42 C ATOM 1304 CH2 TRP A 134 -22.058 65.159 19.705 1.00 29.95 C ATOM 1305 HA TRP A 134 -24.100 69.505 21.753 1.00 0.00 H ATOM 1306 HB2 TRP A 134 -22.492 71.325 19.955 1.00 0.00 H ATOM 1307 HB3 TRP A 134 -21.716 70.287 21.174 1.00 0.00 H ATOM 1308 HE1 TRP A 134 -22.778 67.931 16.634 1.00 0.00 H ATOM 1309 HD1 TRP A 134 -22.994 70.276 17.692 1.00 0.00 H ATOM 1310 HZ2 TRP A 134 -22.351 65.313 17.578 1.00 0.00 H ATOM 1311 HH2 TRP A 134 -21.925 64.078 19.676 1.00 0.00 H ATOM 1312 HZ3 TRP A 134 -21.807 65.257 21.862 1.00 0.00 H ATOM 1313 HE3 TRP A 134 -22.045 67.676 21.983 1.00 0.00 H ATOM 1314 H TRP A 134 -24.797 71.247 19.631 1.00 0.00 H ATOM 1315 N HIS A 135 -23.550 72.674 22.507 1.00 30.05 N ATOM 1316 CA HIS A 135 -23.251 73.547 23.610 1.00 30.42 C ATOM 1317 C HIS A 135 -24.275 73.338 24.708 1.00 30.03 C ATOM 1318 O HIS A 135 -23.947 73.256 25.882 1.00 30.10 O ATOM 1319 CB HIS A 135 -23.223 75.005 23.145 1.00 30.96 C ATOM 1320 CG HIS A 135 -22.888 75.964 24.235 1.00 32.66 C ATOM 1321 ND1 HIS A 135 -23.851 76.546 25.040 1.00 34.29 N ATOM 1322 CD2 HIS A 135 -21.697 76.411 24.689 1.00 34.48 C ATOM 1323 CE1 HIS A 135 -23.267 77.310 25.943 1.00 34.76 C ATOM 1324 NE2 HIS A 135 -21.959 77.246 25.747 1.00 38.06 N ATOM 1325 HA HIS A 135 -22.263 73.310 24.006 1.00 0.00 H ATOM 1326 HB2 HIS A 135 -22.477 75.103 22.356 1.00 0.00 H ATOM 1327 HB3 HIS A 135 -24.205 75.261 22.748 1.00 0.00 H ATOM 1328 HD2 HIS A 135 -20.715 76.157 24.291 1.00 0.00 H ATOM 1329 HE1 HIS A 135 -23.772 77.891 26.714 1.00 0.00 H ATOM 1330 H HIS A 135 -23.777 73.078 21.576 1.00 0.00 H ATOM 1331 N PHE A 136 -25.529 73.259 24.318 1.00 29.79 N ATOM 1332 CA PHE A 136 -26.576 73.021 25.266 1.00 29.80 C ATOM 1333 C PHE A 136 -26.401 71.676 25.938 1.00 29.31 C ATOM 1334 O PHE A 136 -26.646 71.547 27.128 1.00 29.01 O ATOM 1335 CB PHE A 136 -27.946 73.088 24.601 1.00 29.51 C ATOM 1336 CG PHE A 136 -29.057 73.186 25.578 1.00 29.38 C ATOM 1337 CD1 PHE A 136 -29.123 74.249 26.458 1.00 31.72 C ATOM 1338 CD2 PHE A 136 -30.036 72.231 25.645 1.00 29.29 C ATOM 1339 CE1 PHE A 136 -30.175 74.363 27.379 1.00 31.34 C ATOM 1340 CE2 PHE A 136 -31.074 72.339 26.557 1.00 29.65 C ATOM 1341 CZ PHE A 136 -31.129 73.413 27.429 1.00 30.99 C ATOM 1342 HA PHE A 136 -26.516 73.804 26.021 1.00 0.00 H ATOM 1343 HB2 PHE A 136 -27.975 73.963 23.951 1.00 0.00 H ATOM 1344 HB3 PHE A 136 -28.087 72.188 24.003 1.00 0.00 H ATOM 1345 HD2 PHE A 136 -29.998 71.374 24.972 1.00 0.00 H ATOM 1346 HE2 PHE A 136 -31.851 71.575 26.588 1.00 0.00 H ATOM 1347 HZ PHE A 136 -31.940 73.490 28.153 1.00 0.00 H ATOM 1348 HE1 PHE A 136 -30.220 75.219 28.053 1.00 0.00 H ATOM 1349 HD1 PHE A 136 -28.345 75.012 26.436 1.00 0.00 H ATOM 1350 H PHE A 136 -25.763 73.371 23.311 1.00 0.00 H ATOM 1351 N ARG A 137 -25.987 70.678 25.175 1.00 29.06 N ATOM 1352 CA ARG A 137 -25.764 69.352 25.739 1.00 29.71 C ATOM 1353 C ARG A 137 -24.659 69.396 26.784 1.00 29.70 C ATOM 1354 O ARG A 137 -24.802 68.848 27.880 1.00 29.87 O ATOM 1355 CB ARG A 137 -25.421 68.337 24.660 1.00 29.55 C ATOM 1356 CG ARG A 137 -25.450 66.898 25.121 1.00 30.13 C ATOM 1357 CD ARG A 137 -25.086 65.990 23.973 1.00 30.95 C ATOM 1358 NE ARG A 137 -24.877 64.602 24.378 1.00 32.11 N ATOM 1359 CZ ARG A 137 -25.854 63.722 24.592 1.00 33.75 C ATOM 1360 NH1 ARG A 137 -27.120 64.068 24.444 1.00 35.21 N ATOM 1361 NH2 ARG A 137 -25.575 62.483 24.939 1.00 33.88 N ATOM 1362 HA ARG A 137 -26.693 69.037 26.215 1.00 0.00 H ATOM 1363 HB2 ARG A 137 -26.138 68.449 23.847 1.00 0.00 H ATOM 1364 HB3 ARG A 137 -24.419 68.557 24.292 1.00 0.00 H ATOM 1365 HG2 ARG A 137 -24.734 66.762 25.932 1.00 0.00 H ATOM 1366 HG3 ARG A 137 -26.451 66.651 25.476 1.00 0.00 H ATOM 1367 HD2 ARG A 137 -24.168 66.360 23.517 1.00 0.00 H ATOM 1368 HD3 ARG A 137 -25.892 66.019 23.240 1.00 0.00 H ATOM 1369 HE ARG A 137 -23.897 64.278 24.508 1.00 0.00 H ATOM 1370 HH12 ARG A 137 -27.873 63.371 24.614 1.00 0.00 H ATOM 1371 HH11 ARG A 137 -27.364 65.037 24.157 1.00 0.00 H ATOM 1372 HH22 ARG A 137 -26.345 61.803 25.104 1.00 0.00 H ATOM 1373 HH21 ARG A 137 -24.585 62.184 25.048 1.00 0.00 H ATOM 1374 H ARG A 137 -25.819 70.841 24.162 1.00 0.00 H ATOM 1375 N ARG A 138 -23.567 70.069 26.460 1.00 29.51 N ATOM 1376 CA ARG A 138 -22.508 70.273 27.443 1.00 29.76 C ATOM 1377 C ARG A 138 -23.010 71.051 28.671 1.00 29.57 C ATOM 1378 O ARG A 138 -22.671 70.681 29.787 1.00 29.60 O ATOM 1379 CB ARG A 138 -21.271 70.895 26.799 1.00 29.89 C ATOM 1380 CG ARG A 138 -20.522 69.901 25.971 1.00 29.95 C ATOM 1381 CD ARG A 138 -19.164 70.369 25.530 1.00 31.50 C ATOM 1382 NE ARG A 138 -19.187 71.399 24.496 1.00 33.62 N ATOM 1383 CZ ARG A 138 -19.350 71.160 23.197 1.00 32.54 C ATOM 1384 NH1 ARG A 138 -19.559 69.933 22.759 1.00 33.51 N ATOM 1385 NH2 ARG A 138 -19.314 72.148 22.329 1.00 32.51 N ATOM 1386 HA ARG A 138 -22.202 69.296 27.818 1.00 0.00 H ATOM 1387 HB2 ARG A 138 -21.582 71.723 26.162 1.00 0.00 H ATOM 1388 HB3 ARG A 138 -20.613 71.269 27.584 1.00 0.00 H ATOM 1389 HG2 ARG A 138 -20.397 68.991 26.558 1.00 0.00 H ATOM 1390 HG3 ARG A 138 -21.114 69.680 25.082 1.00 0.00 H ATOM 1391 HD2 ARG A 138 -18.616 69.510 25.143 1.00 0.00 H ATOM 1392 HD3 ARG A 138 -18.642 70.770 26.399 1.00 0.00 H ATOM 1393 HE ARG A 138 -19.068 72.388 24.795 1.00 0.00 H ATOM 1394 HH12 ARG A 138 -19.685 69.758 21.742 1.00 0.00 H ATOM 1395 HH11 ARG A 138 -19.598 69.140 23.431 1.00 0.00 H ATOM 1396 HH22 ARG A 138 -19.442 71.954 21.315 1.00 0.00 H ATOM 1397 HH21 ARG A 138 -19.157 73.123 22.657 1.00 0.00 H ATOM 1398 H ARG A 138 -23.463 70.455 25.500 1.00 0.00 H ATOM 1399 N VAL A 139 -23.868 72.053 28.494 1.00 29.31 N ATOM 1400 CA VAL A 139 -24.507 72.663 29.658 1.00 29.77 C ATOM 1401 C VAL A 139 -25.279 71.630 30.507 1.00 30.98 C ATOM 1402 O VAL A 139 -25.189 71.641 31.735 1.00 30.48 O ATOM 1403 CB VAL A 139 -25.450 73.829 29.295 1.00 30.00 C ATOM 1404 CG1 VAL A 139 -26.279 74.278 30.521 1.00 28.31 C ATOM 1405 CG2 VAL A 139 -24.663 75.001 28.711 1.00 27.15 C ATOM 1406 HA VAL A 139 -23.684 73.067 30.247 1.00 0.00 H ATOM 1407 HB VAL A 139 -26.145 73.474 28.534 1.00 0.00 H ATOM 1408 HG11 VAL A 139 -26.880 73.441 30.878 1.00 0.00 H ATOM 1409 HG12 VAL A 139 -25.606 74.607 31.312 1.00 0.00 H ATOM 1410 HG13 VAL A 139 -26.934 75.101 30.234 1.00 0.00 H ATOM 1411 HG21 VAL A 139 -23.937 75.351 29.445 1.00 0.00 H ATOM 1412 HG22 VAL A 139 -24.143 74.675 27.810 1.00 0.00 H ATOM 1413 HG23 VAL A 139 -25.350 75.810 28.463 1.00 0.00 H ATOM 1414 H VAL A 139 -24.082 72.398 27.537 1.00 0.00 H ATOM 1415 N LEU A 140 -26.023 70.733 29.861 1.00 31.86 N ATOM 1416 CA LEU A 140 -26.828 69.749 30.599 1.00 32.70 C ATOM 1417 C LEU A 140 -25.945 68.647 31.220 1.00 33.14 C ATOM 1418 O LEU A 140 -26.242 68.173 32.323 1.00 33.18 O ATOM 1419 CB LEU A 140 -27.901 69.117 29.710 1.00 32.98 C ATOM 1420 CG LEU A 140 -29.052 70.028 29.273 1.00 33.50 C ATOM 1421 CD1 LEU A 140 -29.920 69.366 28.193 1.00 31.28 C ATOM 1422 CD2 LEU A 140 -29.877 70.386 30.475 1.00 32.94 C ATOM 1423 HA LEU A 140 -27.324 70.291 31.404 1.00 0.00 H ATOM 1424 HB2 LEU A 140 -27.410 68.749 28.809 1.00 0.00 H ATOM 1425 HB3 LEU A 140 -28.332 68.278 30.256 1.00 0.00 H ATOM 1426 HG LEU A 140 -28.634 70.933 28.833 1.00 0.00 H ATOM 1427 HD21 LEU A 140 -30.278 69.477 30.923 1.00 0.00 H ATOM 1428 HD22 LEU A 140 -29.252 70.906 31.201 1.00 0.00 H ATOM 1429 HD23 LEU A 140 -30.698 71.035 30.170 1.00 0.00 H ATOM 1430 HD11 LEU A 140 -29.306 69.145 27.320 1.00 0.00 H ATOM 1431 HD12 LEU A 140 -30.343 68.441 28.585 1.00 0.00 H ATOM 1432 HD13 LEU A 140 -30.725 70.044 27.910 1.00 0.00 H ATOM 1433 H LEU A 140 -26.034 70.729 28.821 1.00 0.00 H ATOM 1434 N LEU A 141 -24.866 68.249 30.537 1.00 32.78 N ATOM 1435 CA LEU A 141 -23.932 67.300 31.132 1.00 32.92 C ATOM 1436 C LEU A 141 -23.448 67.831 32.486 1.00 34.06 C ATOM 1437 O LEU A 141 -23.461 67.105 33.457 1.00 34.51 O ATOM 1438 CB LEU A 141 -22.754 67.051 30.215 1.00 32.49 C ATOM 1439 CG LEU A 141 -22.967 66.145 28.995 1.00 31.19 C ATOM 1440 CD1 LEU A 141 -21.637 66.100 28.166 1.00 26.95 C ATOM 1441 CD2 LEU A 141 -23.467 64.752 29.427 1.00 25.23 C ATOM 1442 HA LEU A 141 -24.449 66.352 31.281 1.00 0.00 H ATOM 1443 HB2 LEU A 141 -22.421 68.021 29.844 1.00 0.00 H ATOM 1444 HB3 LEU A 141 -21.964 66.603 30.817 1.00 0.00 H ATOM 1445 HG LEU A 141 -23.748 66.548 28.351 1.00 0.00 H ATOM 1446 HD21 LEU A 141 -22.730 64.290 30.084 1.00 0.00 H ATOM 1447 HD22 LEU A 141 -24.413 64.856 29.958 1.00 0.00 H ATOM 1448 HD23 LEU A 141 -23.610 64.129 28.544 1.00 0.00 H ATOM 1449 HD11 LEU A 141 -21.379 67.108 27.840 1.00 0.00 H ATOM 1450 HD12 LEU A 141 -20.836 65.702 28.789 1.00 0.00 H ATOM 1451 HD13 LEU A 141 -21.775 65.459 27.295 1.00 0.00 H ATOM 1452 H LEU A 141 -24.693 68.617 29.580 1.00 0.00 H ATOM 1453 N ARG A 142 -23.141 69.093 32.584 1.00 35.00 N ATOM 1454 CA ARG A 142 -22.750 69.630 33.847 1.00 36.75 C ATOM 1455 C ARG A 142 -23.868 69.825 34.841 1.00 36.75 C ATOM 1456 O ARG A 142 -23.716 69.460 35.972 1.00 37.84 O ATOM 1457 CB ARG A 142 -21.988 70.927 33.664 1.00 20.00 C ATOM 1458 CG ARG A 142 -20.595 70.718 33.148 1.00 20.00 C ATOM 1459 CD ARG A 142 -20.005 71.995 32.578 1.00 20.00 C ATOM 1460 NE ARG A 142 -18.988 72.562 33.455 1.00 20.00 N ATOM 1461 CZ ARG A 142 -18.250 71.847 34.291 1.00 20.00 C ATOM 1462 NH1 ARG A 142 -18.406 70.559 34.367 1.00 20.00 N ATOM 1463 NH2 ARG A 142 -17.370 72.419 35.057 1.00 20.00 N ATOM 1464 HA ARG A 142 -22.107 68.865 34.283 1.00 0.00 H ATOM 1465 HB2 ARG A 142 -22.531 71.553 32.956 1.00 0.00 H ATOM 1466 HB3 ARG A 142 -21.930 71.435 34.626 1.00 0.00 H ATOM 1467 HG2 ARG A 142 -19.964 70.373 33.967 1.00 0.00 H ATOM 1468 HG3 ARG A 142 -20.619 69.960 32.365 1.00 0.00 H ATOM 1469 HD2 ARG A 142 -20.804 72.725 32.446 1.00 0.00 H ATOM 1470 HD3 ARG A 142 -19.553 71.774 31.611 1.00 0.00 H ATOM 1471 HE ARG A 142 -18.832 73.590 33.422 1.00 0.00 H ATOM 1472 HH12 ARG A 142 -17.824 70.003 35.025 1.00 0.00 H ATOM 1473 HH11 ARG A 142 -19.113 70.085 33.770 1.00 0.00 H ATOM 1474 HH22 ARG A 142 -16.797 71.846 35.709 1.00 0.00 H ATOM 1475 HH21 ARG A 142 -17.239 73.450 35.018 1.00 0.00 H ATOM 1476 H ARG A 142 -23.181 69.707 31.745 1.00 0.00 H ATOM 1477 N SER A 143 -24.976 70.426 34.446 1.00 36.57 N ATOM 1478 CA SER A 143 -26.040 70.728 35.459 1.00 36.96 C ATOM 1479 C SER A 143 -26.680 69.487 36.002 1.00 37.11 C ATOM 1480 O SER A 143 -26.982 69.431 37.174 1.00 37.96 O ATOM 1481 CB SER A 143 -27.157 71.611 34.930 1.00 36.26 C ATOM 1482 OG SER A 143 -26.692 72.318 33.813 1.00 38.72 O ATOM 1483 HA SER A 143 -25.502 71.260 36.244 1.00 0.00 H ATOM 1484 HB2 SER A 143 -27.466 72.313 35.704 1.00 0.00 H ATOM 1485 HB3 SER A 143 -28.007 70.992 34.643 1.00 0.00 H ATOM 1486 HG SER A 143 -26.412 71.678 33.112 1.00 0.00 H ATOM 1487 H SER A 143 -25.109 70.686 33.448 1.00 0.00 H ATOM 1488 N LEU A 144 -26.915 68.509 35.143 1.00 36.88 N ATOM 1489 CA LEU A 144 -27.472 67.249 35.595 1.00 37.64 C ATOM 1490 C LEU A 144 -26.426 66.347 36.256 1.00 38.59 C ATOM 1491 O LEU A 144 -26.773 65.308 36.760 1.00 38.35 O ATOM 1492 CB LEU A 144 -28.147 66.499 34.424 1.00 36.72 C ATOM 1493 CG LEU A 144 -29.293 67.263 33.732 1.00 35.38 C ATOM 1494 CD1 LEU A 144 -29.620 66.644 32.371 1.00 28.59 C ATOM 1495 CD2 LEU A 144 -30.538 67.366 34.657 1.00 33.44 C ATOM 1496 HA LEU A 144 -28.219 67.492 36.350 1.00 0.00 H ATOM 1497 HB2 LEU A 144 -27.384 66.284 33.676 1.00 0.00 H ATOM 1498 HB3 LEU A 144 -28.550 65.563 34.810 1.00 0.00 H ATOM 1499 HG LEU A 144 -28.961 68.284 33.543 1.00 0.00 H ATOM 1500 HD21 LEU A 144 -30.888 66.364 34.906 1.00 0.00 H ATOM 1501 HD22 LEU A 144 -30.268 67.896 35.570 1.00 0.00 H ATOM 1502 HD23 LEU A 144 -31.329 67.910 34.141 1.00 0.00 H ATOM 1503 HD11 LEU A 144 -28.737 66.684 31.733 1.00 0.00 H ATOM 1504 HD12 LEU A 144 -29.924 65.606 32.509 1.00 0.00 H ATOM 1505 HD13 LEU A 144 -30.432 67.202 31.905 1.00 0.00 H ATOM 1506 H LEU A 144 -26.698 68.645 34.135 1.00 0.00 H ATOM 1507 N GLN A 145 -25.149 66.703 36.228 1.00 39.71 N ATOM 1508 CA GLN A 145 -24.127 65.781 36.740 1.00 41.18 C ATOM 1509 C GLN A 145 -24.179 64.415 36.051 1.00 40.53 C ATOM 1510 O GLN A 145 -24.154 63.384 36.707 1.00 40.29 O ATOM 1511 CB GLN A 145 -24.310 65.568 38.252 1.00 42.18 C ATOM 1512 CG GLN A 145 -24.500 66.866 39.036 1.00 45.57 C ATOM 1513 CD GLN A 145 -23.286 67.213 39.882 1.00 50.68 C ATOM 1514 OE1 GLN A 145 -22.185 67.490 39.339 1.00 49.44 O ATOM 1515 NE2 GLN A 145 -23.464 67.176 41.234 1.00 51.26 N ATOM 1516 HA GLN A 145 -23.161 66.240 36.530 1.00 0.00 H ATOM 1517 HB2 GLN A 145 -25.187 64.940 38.408 1.00 0.00 H ATOM 1518 HB3 GLN A 145 -23.427 65.059 38.638 1.00 0.00 H ATOM 1519 HG2 GLN A 145 -24.680 67.678 38.332 1.00 0.00 H ATOM 1520 HG3 GLN A 145 -25.364 66.757 39.691 1.00 0.00 H ATOM 1521 HE22 GLN A 145 -24.397 66.941 41.629 1.00 0.00 H ATOM 1522 HE21 GLN A 145 -22.667 67.383 41.869 1.00 0.00 H ATOM 1523 H GLN A 145 -24.873 67.630 35.846 1.00 0.00 H ATOM 1524 N LYS A 146 -24.239 64.394 34.733 1.00 39.83 N ATOM 1525 CA LYS A 146 -24.308 63.129 34.057 1.00 39.92 C ATOM 1526 C LYS A 146 -22.974 62.431 34.172 1.00 40.74 C ATOM 1527 O LYS A 146 -21.926 63.062 34.275 1.00 40.69 O ATOM 1528 CB LYS A 146 -24.701 63.283 32.591 1.00 39.25 C ATOM 1529 CG LYS A 146 -26.038 63.977 32.349 1.00 39.47 C ATOM 1530 CD LYS A 146 -27.218 63.235 32.991 1.00 40.15 C ATOM 1531 CE LYS A 146 -27.372 61.841 32.413 1.00 39.97 C ATOM 1532 NZ LYS A 146 -28.635 61.223 32.834 1.00 41.27 N ATOM 1533 HA LYS A 146 -25.084 62.530 34.534 1.00 0.00 H ATOM 1534 HB2 LYS A 146 -23.924 63.862 32.092 1.00 0.00 H ATOM 1535 HB3 LYS A 146 -24.752 62.288 32.148 1.00 0.00 H ATOM 1536 HG2 LYS A 146 -25.990 64.982 32.767 1.00 0.00 H ATOM 1537 HG3 LYS A 146 -26.209 64.040 31.274 1.00 0.00 H ATOM 1538 HD2 LYS A 146 -27.048 63.158 34.065 1.00 0.00 H ATOM 1539 HD3 LYS A 146 -28.133 63.798 32.809 1.00 0.00 H ATOM 1540 HE2 LYS A 146 -26.543 61.222 32.754 1.00 0.00 H ATOM 1541 HE3 LYS A 146 -27.353 61.904 31.325 1.00 0.00 H ATOM 1542 HZ1 LYS A 146 -28.657 61.155 33.872 1.00 0.00 H ATOM 1543 HZ2 LYS A 146 -29.431 61.806 32.506 1.00 0.00 H ATOM 1544 HZ3 LYS A 146 -28.708 60.271 32.421 1.00 0.00 H ATOM 1545 H LYS A 146 -24.236 65.282 34.191 1.00 0.00 H ATOM 1546 N ASP A 147 -23.034 61.107 34.161 1.00 41.79 N ATOM 1547 CA ASP A 147 -21.854 60.279 34.201 1.00 42.64 C ATOM 1548 C ASP A 147 -21.109 60.471 32.873 1.00 41.53 C ATOM 1549 O ASP A 147 -21.610 60.144 31.790 1.00 39.84 O ATOM 1550 CB ASP A 147 -22.242 58.811 34.432 1.00 43.23 C ATOM 1551 CG ASP A 147 -21.025 57.882 34.547 1.00 46.71 C ATOM 1552 OD1 ASP A 147 -20.242 57.750 33.560 1.00 48.11 O ATOM 1553 OD2 ASP A 147 -20.862 57.265 35.632 1.00 53.11 O ATOM 1554 HA ASP A 147 -21.203 60.564 35.027 1.00 0.00 H ATOM 1555 HB2 ASP A 147 -22.819 58.745 35.354 1.00 0.00 H ATOM 1556 HB3 ASP A 147 -22.856 58.478 33.596 1.00 0.00 H ATOM 1557 H ASP A 147 -23.967 60.648 34.122 1.00 0.00 H ATOM 1558 N LEU A 148 -19.901 61.002 32.991 1.00 41.01 N ATOM 1559 CA LEU A 148 -19.112 61.344 31.822 1.00 40.53 C ATOM 1560 C LEU A 148 -18.550 60.119 31.155 1.00 41.03 C ATOM 1561 O LEU A 148 -18.146 60.189 30.007 1.00 40.93 O ATOM 1562 CB LEU A 148 -18.023 62.372 32.182 1.00 39.74 C ATOM 1563 CG LEU A 148 -18.638 63.706 32.665 1.00 39.32 C ATOM 1564 CD1 LEU A 148 -17.570 64.758 32.961 1.00 38.99 C ATOM 1565 CD2 LEU A 148 -19.632 64.243 31.667 1.00 36.88 C ATOM 1566 HA LEU A 148 -19.771 61.814 31.091 1.00 0.00 H ATOM 1567 HB2 LEU A 148 -17.398 61.962 32.975 1.00 0.00 H ATOM 1568 HB3 LEU A 148 -17.411 62.563 31.301 1.00 0.00 H ATOM 1569 HG LEU A 148 -19.160 63.489 33.597 1.00 0.00 H ATOM 1570 HD21 LEU A 148 -19.131 64.416 30.714 1.00 0.00 H ATOM 1571 HD22 LEU A 148 -20.435 63.519 31.531 1.00 0.00 H ATOM 1572 HD23 LEU A 148 -20.046 65.181 32.037 1.00 0.00 H ATOM 1573 HD11 LEU A 148 -16.904 64.389 33.741 1.00 0.00 H ATOM 1574 HD12 LEU A 148 -16.996 64.956 32.056 1.00 0.00 H ATOM 1575 HD13 LEU A 148 -18.050 65.677 33.297 1.00 0.00 H ATOM 1576 H LEU A 148 -19.511 61.177 33.939 1.00 0.00 H ATOM 1577 N GLN A 149 -18.590 58.994 31.798 1.00 42.77 N ATOM 1578 CA GLN A 149 -18.067 57.813 31.193 1.00 44.74 C ATOM 1579 C GLN A 149 -19.111 57.181 30.286 1.00 43.72 C ATOM 1580 O GLN A 149 -18.786 56.607 29.303 1.00 43.34 O ATOM 1581 CB GLN A 149 -17.589 56.892 32.294 1.00 20.00 C ATOM 1582 CG GLN A 149 -16.534 55.888 31.930 1.00 20.00 C ATOM 1583 CD GLN A 149 -15.314 56.458 31.258 1.00 20.00 C ATOM 1584 OE1 GLN A 149 -14.573 57.241 31.825 1.00 20.00 O ATOM 1585 NE2 GLN A 149 -15.073 56.010 30.054 1.00 20.00 N ATOM 1586 HA GLN A 149 -17.215 58.040 30.552 1.00 0.00 H ATOM 1587 HB2 GLN A 149 -17.189 57.515 33.094 1.00 0.00 H ATOM 1588 HB3 GLN A 149 -18.455 56.341 32.662 1.00 0.00 H ATOM 1589 HG2 GLN A 149 -16.214 55.388 32.844 1.00 0.00 H ATOM 1590 HG3 GLN A 149 -16.981 55.158 31.256 1.00 0.00 H ATOM 1591 HE22 GLN A 149 -15.732 55.342 29.606 1.00 0.00 H ATOM 1592 HE21 GLN A 149 -14.222 56.322 29.544 1.00 0.00 H ATOM 1593 H GLN A 149 -19.002 58.953 32.752 1.00 0.00 H ATOM 1594 N GLU A 150 -20.379 57.330 30.609 1.00 43.27 N ATOM 1595 CA GLU A 150 -21.425 56.918 29.723 1.00 43.08 C ATOM 1596 C GLU A 150 -21.444 57.826 28.501 1.00 40.27 C ATOM 1597 O GLU A 150 -21.704 57.394 27.383 1.00 39.80 O ATOM 1598 CB GLU A 150 -22.754 56.969 30.444 1.00 44.14 C ATOM 1599 CG GLU A 150 -23.855 56.291 29.645 1.00 49.81 C ATOM 1600 CD GLU A 150 -24.775 55.461 30.531 1.00 58.01 C ATOM 1601 OE1 GLU A 150 -25.668 56.107 31.145 1.00 61.57 O ATOM 1602 OE2 GLU A 150 -24.606 54.193 30.612 1.00 61.83 O ATOM 1603 HA GLU A 150 -21.246 55.894 29.396 1.00 0.00 H ATOM 1604 HB2 GLU A 150 -22.654 56.465 31.405 1.00 0.00 H ATOM 1605 HB3 GLU A 150 -23.027 58.011 30.608 1.00 0.00 H ATOM 1606 HG2 GLU A 150 -24.447 57.056 29.141 1.00 0.00 H ATOM 1607 HG3 GLU A 150 -23.399 55.638 28.901 1.00 0.00 H ATOM 1608 H GLU A 150 -20.625 57.755 31.526 1.00 0.00 H ATOM 1609 N GLU A 151 -21.165 59.092 28.747 1.00 38.05 N ATOM 1610 CA GLU A 151 -21.122 60.082 27.712 1.00 36.76 C ATOM 1611 C GLU A 151 -19.909 59.859 26.792 1.00 36.72 C ATOM 1612 O GLU A 151 -20.010 60.153 25.605 1.00 36.85 O ATOM 1613 CB GLU A 151 -21.126 61.487 28.329 1.00 36.27 C ATOM 1614 CG GLU A 151 -21.045 62.636 27.329 1.00 35.48 C ATOM 1615 CD GLU A 151 -22.301 62.788 26.461 1.00 35.08 C ATOM 1616 OE1 GLU A 151 -23.294 62.042 26.653 1.00 30.68 O ATOM 1617 OE2 GLU A 151 -22.281 63.691 25.590 1.00 33.06 O ATOM 1618 HA GLU A 151 -22.013 59.988 27.091 1.00 0.00 H ATOM 1619 HB2 GLU A 151 -22.047 61.602 28.901 1.00 0.00 H ATOM 1620 HB3 GLU A 151 -20.271 61.563 29.000 1.00 0.00 H ATOM 1621 HG2 GLU A 151 -20.894 63.563 27.881 1.00 0.00 H ATOM 1622 HG3 GLU A 151 -20.192 62.462 26.673 1.00 0.00 H ATOM 1623 H GLU A 151 -20.969 59.381 29.727 1.00 0.00 H ATOM 1624 N MET A 152 -18.777 59.359 27.319 1.00 36.74 N ATOM 1625 CA MET A 152 -17.671 58.904 26.452 1.00 36.55 C ATOM 1626 C MET A 152 -18.093 57.758 25.574 1.00 35.92 C ATOM 1627 O MET A 152 -17.720 57.736 24.410 1.00 35.95 O ATOM 1628 CB MET A 152 -16.463 58.414 27.243 1.00 37.38 C ATOM 1629 CG MET A 152 -15.507 59.501 27.734 1.00 40.06 C ATOM 1630 SD MET A 152 -14.537 60.405 26.505 1.00 41.45 S ATOM 1631 CE MET A 152 -13.887 59.057 25.526 1.00 38.06 C ATOM 1632 HA MET A 152 -17.403 59.780 25.862 1.00 0.00 H ATOM 1633 HB2 MET A 152 -16.830 57.872 28.114 1.00 0.00 H ATOM 1634 HB3 MET A 152 -15.898 57.734 26.605 1.00 0.00 H ATOM 1635 HG2 MET A 152 -14.802 59.027 28.417 1.00 0.00 H ATOM 1636 HG3 MET A 152 -16.103 60.234 28.279 1.00 0.00 H ATOM 1637 HE1 MET A 152 -13.287 58.405 26.161 1.00 0.00 H ATOM 1638 HE2 MET A 152 -14.713 58.489 25.098 1.00 0.00 H ATOM 1639 HE3 MET A 152 -13.266 59.458 24.725 1.00 0.00 H ATOM 1640 H MET A 152 -18.679 59.292 28.352 1.00 0.00 H ATOM 1641 N ASN A 153 -18.805 56.781 26.136 1.00 35.75 N ATOM 1642 CA ASN A 153 -19.310 55.662 25.339 1.00 36.27 C ATOM 1643 C ASN A 153 -20.143 56.153 24.182 1.00 36.01 C ATOM 1644 O ASN A 153 -19.971 55.683 23.051 1.00 35.54 O ATOM 1645 CB ASN A 153 -20.168 54.710 26.158 1.00 36.50 C ATOM 1646 CG ASN A 153 -19.369 53.981 27.241 1.00 37.99 C ATOM 1647 OD1 ASN A 153 -18.124 54.023 27.300 1.00 37.17 O ATOM 1648 ND2 ASN A 153 -20.090 53.313 28.101 1.00 35.07 N ATOM 1649 HA ASN A 153 -18.429 55.132 24.978 1.00 0.00 H ATOM 1650 HB2 ASN A 153 -20.964 55.281 26.636 1.00 0.00 H ATOM 1651 HB3 ASN A 153 -20.605 53.969 25.488 1.00 0.00 H ATOM 1652 HD22 ASN A 153 -21.126 53.304 28.015 1.00 0.00 H ATOM 1653 HD21 ASN A 153 -19.628 52.790 28.872 1.00 0.00 H ATOM 1654 H ASN A 153 -19.005 56.814 27.156 1.00 0.00 H ATOM 1655 N TYR A 154 -21.021 57.116 24.471 1.00 35.06 N ATOM 1656 CA TYR A 154 -21.892 57.703 23.454 1.00 34.67 C ATOM 1657 C TYR A 154 -21.135 58.347 22.277 1.00 34.35 C ATOM 1658 O TYR A 154 -21.432 58.067 21.120 1.00 34.76 O ATOM 1659 CB TYR A 154 -22.836 58.713 24.119 1.00 34.32 C ATOM 1660 CG TYR A 154 -23.438 59.686 23.183 1.00 34.32 C ATOM 1661 CD1 TYR A 154 -24.516 59.339 22.393 1.00 35.17 C ATOM 1662 CD2 TYR A 154 -22.934 60.976 23.071 1.00 35.30 C ATOM 1663 CE1 TYR A 154 -25.098 60.262 21.512 1.00 33.41 C ATOM 1664 CE2 TYR A 154 -23.510 61.895 22.201 1.00 33.45 C ATOM 1665 CZ TYR A 154 -24.576 61.521 21.415 1.00 32.82 C ATOM 1666 OH TYR A 154 -25.134 62.426 20.530 1.00 34.45 O ATOM 1667 HA TYR A 154 -22.463 56.886 23.012 1.00 0.00 H ATOM 1668 HB3 TYR A 154 -22.272 59.265 24.871 1.00 0.00 H ATOM 1669 HB2 TYR A 154 -23.641 58.161 24.604 1.00 0.00 H ATOM 1670 HD2 TYR A 154 -22.075 61.272 23.674 1.00 0.00 H ATOM 1671 HE2 TYR A 154 -23.118 62.910 22.142 1.00 0.00 H ATOM 1672 HE1 TYR A 154 -25.960 59.977 20.909 1.00 0.00 H ATOM 1673 HD1 TYR A 154 -24.922 58.329 22.455 1.00 0.00 H ATOM 1674 HH TYR A 154 -25.884 61.995 20.049 1.00 0.00 H ATOM 1675 H TYR A 154 -21.088 57.460 25.450 1.00 0.00 H ATOM 1676 N ILE A 155 -20.145 59.183 22.576 1.00 34.08 N ATOM 1677 CA ILE A 155 -19.390 59.906 21.558 1.00 33.60 C ATOM 1678 C ILE A 155 -18.538 58.963 20.692 1.00 33.62 C ATOM 1679 O ILE A 155 -18.339 59.182 19.504 1.00 33.34 O ATOM 1680 CB ILE A 155 -18.560 61.063 22.208 1.00 33.62 C ATOM 1681 CG1 ILE A 155 -18.362 62.212 21.198 1.00 33.66 C ATOM 1682 CG2 ILE A 155 -17.220 60.559 22.779 1.00 31.76 C ATOM 1683 CD1 ILE A 155 -19.621 62.979 20.830 1.00 31.87 C ATOM 1684 HA ILE A 155 -20.099 60.368 20.871 1.00 0.00 H ATOM 1685 HB ILE A 155 -19.126 61.452 23.055 1.00 0.00 H ATOM 1686 HG12 ILE A 155 -17.651 62.918 21.626 1.00 0.00 H ATOM 1687 HG13 ILE A 155 -17.946 61.789 20.284 1.00 0.00 H ATOM 1688 HD11 ILE A 155 -20.344 62.296 20.384 1.00 0.00 H ATOM 1689 HD12 ILE A 155 -20.048 63.426 21.728 1.00 0.00 H ATOM 1690 HD13 ILE A 155 -19.371 63.763 20.115 1.00 0.00 H ATOM 1691 HG21 ILE A 155 -17.412 59.805 23.543 1.00 0.00 H ATOM 1692 HG22 ILE A 155 -16.626 60.121 21.977 1.00 0.00 H ATOM 1693 HG23 ILE A 155 -16.677 61.395 23.220 1.00 0.00 H ATOM 1694 H ILE A 155 -19.899 59.327 23.576 1.00 0.00 H ATOM 1695 N ILE A 156 -18.087 57.891 21.270 1.00 34.39 N ATOM 1696 CA ILE A 156 -17.426 56.836 20.563 1.00 34.23 C ATOM 1697 C ILE A 156 -18.281 56.194 19.495 1.00 34.49 C ATOM 1698 O ILE A 156 -17.824 55.961 18.419 1.00 34.55 O ATOM 1699 CB ILE A 156 -17.051 55.801 21.581 1.00 20.00 C ATOM 1700 CG1 ILE A 156 -16.449 56.497 22.738 1.00 20.00 C ATOM 1701 CG2 ILE A 156 -16.079 54.802 21.045 1.00 20.00 C ATOM 1702 CD1 ILE A 156 -15.350 55.683 23.334 1.00 20.00 C ATOM 1703 HA ILE A 156 -16.563 57.256 20.046 1.00 0.00 H ATOM 1704 HB ILE A 156 -17.950 55.254 21.865 1.00 0.00 H ATOM 1705 HG12 ILE A 156 -16.046 57.455 22.409 1.00 0.00 H ATOM 1706 HG13 ILE A 156 -17.217 56.667 23.492 1.00 0.00 H ATOM 1707 HD11 ILE A 156 -15.749 54.725 23.668 1.00 0.00 H ATOM 1708 HD12 ILE A 156 -14.577 55.514 22.584 1.00 0.00 H ATOM 1709 HD13 ILE A 156 -14.924 56.217 24.183 1.00 0.00 H ATOM 1710 HG21 ILE A 156 -16.521 54.290 20.190 1.00 0.00 H ATOM 1711 HG22 ILE A 156 -15.169 55.314 20.733 1.00 0.00 H ATOM 1712 HG23 ILE A 156 -15.841 54.076 21.822 1.00 0.00 H ATOM 1713 H ILE A 156 -18.212 57.794 22.298 1.00 0.00 H ATOM 1714 N ALA A 157 -19.525 55.908 19.820 1.00 35.09 N ATOM 1715 CA ALA A 157 -20.509 55.404 18.857 1.00 35.00 C ATOM 1716 C ALA A 157 -20.780 56.419 17.739 1.00 34.24 C ATOM 1717 O ALA A 157 -20.861 56.062 16.580 1.00 33.71 O ATOM 1718 CB ALA A 157 -21.782 55.062 19.563 1.00 34.83 C ATOM 1719 HA ALA A 157 -20.097 54.507 18.395 1.00 0.00 H ATOM 1720 HB1 ALA A 157 -21.586 54.295 20.312 1.00 0.00 H ATOM 1721 HB2 ALA A 157 -22.177 55.954 20.049 1.00 0.00 H ATOM 1722 HB3 ALA A 157 -22.508 54.688 18.840 1.00 0.00 H ATOM 1723 H ALA A 157 -19.823 56.046 20.807 1.00 0.00 H ATOM 1724 N ILE A 158 -20.898 57.691 18.082 1.00 33.93 N ATOM 1725 CA ILE A 158 -21.257 58.697 17.068 1.00 34.15 C ATOM 1726 C ILE A 158 -20.122 59.071 16.128 1.00 33.27 C ATOM 1727 O ILE A 158 -20.367 59.345 14.948 1.00 32.60 O ATOM 1728 CB ILE A 158 -21.851 59.934 17.708 1.00 34.16 C ATOM 1729 CG1 ILE A 158 -23.266 59.590 18.128 1.00 38.14 C ATOM 1730 CG2 ILE A 158 -21.966 61.087 16.715 1.00 35.20 C ATOM 1731 CD1 ILE A 158 -24.029 60.797 18.696 1.00 42.92 C ATOM 1732 HA ILE A 158 -22.012 58.217 16.445 1.00 0.00 H ATOM 1733 HB ILE A 158 -21.209 60.234 18.536 1.00 0.00 H ATOM 1734 HG12 ILE A 158 -23.806 59.214 17.259 1.00 0.00 H ATOM 1735 HG13 ILE A 158 -23.224 58.814 18.892 1.00 0.00 H ATOM 1736 HD11 ILE A 158 -23.504 61.177 19.572 1.00 0.00 H ATOM 1737 HD12 ILE A 158 -24.087 61.578 17.938 1.00 0.00 H ATOM 1738 HD13 ILE A 158 -25.035 60.489 18.979 1.00 0.00 H ATOM 1739 HG21 ILE A 158 -20.975 61.339 16.337 1.00 0.00 H ATOM 1740 HG22 ILE A 158 -22.608 60.788 15.886 1.00 0.00 H ATOM 1741 HG23 ILE A 158 -22.397 61.954 17.215 1.00 0.00 H ATOM 1742 H ILE A 158 -20.737 57.981 19.068 1.00 0.00 H ATOM 1743 N ILE A 159 -18.902 59.092 16.666 1.00 33.06 N ATOM 1744 CA ILE A 159 -17.694 59.292 15.872 1.00 32.79 C ATOM 1745 C ILE A 159 -17.533 58.099 14.965 1.00 33.09 C ATOM 1746 O ILE A 159 -17.314 58.282 13.788 1.00 32.03 O ATOM 1747 CB ILE A 159 -16.432 59.472 16.730 1.00 32.45 C ATOM 1748 CG1 ILE A 159 -16.473 60.787 17.495 1.00 32.54 C ATOM 1749 CG2 ILE A 159 -15.221 59.490 15.877 1.00 31.27 C ATOM 1750 CD1 ILE A 159 -15.473 60.879 18.662 1.00 32.22 C ATOM 1751 HA ILE A 159 -17.808 60.215 15.303 1.00 0.00 H ATOM 1752 HB ILE A 159 -16.398 58.634 17.427 1.00 0.00 H ATOM 1753 HG12 ILE A 159 -16.256 61.595 16.796 1.00 0.00 H ATOM 1754 HG13 ILE A 159 -17.478 60.916 17.897 1.00 0.00 H ATOM 1755 HD11 ILE A 159 -15.682 60.087 19.381 1.00 0.00 H ATOM 1756 HD12 ILE A 159 -14.459 60.766 18.279 1.00 0.00 H ATOM 1757 HD13 ILE A 159 -15.573 61.849 19.149 1.00 0.00 H ATOM 1758 HG21 ILE A 159 -15.148 58.549 15.332 1.00 0.00 H ATOM 1759 HG22 ILE A 159 -15.289 60.316 15.169 1.00 0.00 H ATOM 1760 HG23 ILE A 159 -14.339 59.618 16.504 1.00 0.00 H ATOM 1761 H ILE A 159 -18.808 58.960 17.693 1.00 0.00 H ATOM 1762 N GLU A 160 -17.696 56.881 15.475 1.00 34.56 N ATOM 1763 CA GLU A 160 -17.627 55.728 14.554 1.00 36.34 C ATOM 1764 C GLU A 160 -18.511 56.023 13.336 1.00 36.23 C ATOM 1765 O GLU A 160 -18.042 55.917 12.205 1.00 36.82 O ATOM 1766 CB GLU A 160 -18.025 54.399 15.186 1.00 37.14 C ATOM 1767 CG GLU A 160 -17.003 53.815 16.213 1.00 39.27 C ATOM 1768 CD GLU A 160 -15.680 53.303 15.589 1.00 42.53 C ATOM 1769 OE1 GLU A 160 -15.592 53.144 14.330 1.00 44.12 O ATOM 1770 OE2 GLU A 160 -14.730 53.048 16.389 1.00 41.71 O ATOM 1771 HA GLU A 160 -16.583 55.609 14.266 1.00 0.00 H ATOM 1772 HB2 GLU A 160 -18.975 54.542 15.700 1.00 0.00 H ATOM 1773 HB3 GLU A 160 -18.152 53.670 14.386 1.00 0.00 H ATOM 1774 HG2 GLU A 160 -16.759 54.597 16.932 1.00 0.00 H ATOM 1775 HG3 GLU A 160 -17.479 52.982 16.731 1.00 0.00 H ATOM 1776 H GLU A 160 -17.867 56.745 16.492 1.00 0.00 H ATOM 1777 N GLU A 161 -19.726 56.503 13.576 1.00 35.74 N ATOM 1778 CA GLU A 161 -20.672 56.755 12.501 1.00 36.59 C ATOM 1779 C GLU A 161 -20.425 57.973 11.638 1.00 35.41 C ATOM 1780 O GLU A 161 -20.772 57.948 10.461 1.00 35.04 O ATOM 1781 CB GLU A 161 -22.078 56.901 13.056 1.00 37.64 C ATOM 1782 CG GLU A 161 -22.751 55.595 13.413 1.00 43.99 C ATOM 1783 CD GLU A 161 -23.859 55.825 14.469 1.00 51.74 C ATOM 1784 OE1 GLU A 161 -24.807 56.616 14.157 1.00 54.98 O ATOM 1785 OE2 GLU A 161 -23.773 55.244 15.601 1.00 55.61 O ATOM 1786 HA GLU A 161 -20.538 55.883 11.861 1.00 0.00 H ATOM 1787 HB2 GLU A 161 -22.027 57.515 13.955 1.00 0.00 H ATOM 1788 HB3 GLU A 161 -22.689 57.405 12.307 1.00 0.00 H ATOM 1789 HG2 GLU A 161 -23.195 55.163 12.516 1.00 0.00 H ATOM 1790 HG3 GLU A 161 -22.008 54.907 13.817 1.00 0.00 H ATOM 1791 H GLU A 161 -20.008 56.703 14.557 1.00 0.00 H ATOM 1792 N GLN A 162 -19.894 59.054 12.217 1.00 34.36 N ATOM 1793 CA GLN A 162 -19.727 60.323 11.487 1.00 33.39 C ATOM 1794 C GLN A 162 -18.346 60.816 11.800 1.00 32.92 C ATOM 1795 O GLN A 162 -18.156 61.797 12.524 1.00 31.97 O ATOM 1796 CB GLN A 162 -20.758 61.372 11.924 1.00 33.69 C ATOM 1797 CG GLN A 162 -22.214 60.892 11.814 1.00 33.46 C ATOM 1798 CD GLN A 162 -23.188 62.035 11.672 1.00 33.52 C ATOM 1799 OE1 GLN A 162 -23.005 62.909 10.828 1.00 34.36 O ATOM 1800 NE2 GLN A 162 -24.235 62.033 12.484 1.00 33.14 N ATOM 1801 HA GLN A 162 -19.874 60.160 10.419 1.00 0.00 H ATOM 1802 HB2 GLN A 162 -20.560 61.637 12.963 1.00 0.00 H ATOM 1803 HB3 GLN A 162 -20.638 62.255 11.296 1.00 0.00 H ATOM 1804 HG2 GLN A 162 -22.304 60.245 10.942 1.00 0.00 H ATOM 1805 HG3 GLN A 162 -22.465 60.327 12.712 1.00 0.00 H ATOM 1806 HE22 GLN A 162 -24.349 61.272 13.184 1.00 0.00 H ATOM 1807 HE21 GLN A 162 -24.943 62.792 12.422 1.00 0.00 H ATOM 1808 H GLN A 162 -19.590 58.998 13.210 1.00 0.00 H ATOM 1809 N PRO A 163 -17.351 60.108 11.279 1.00 32.27 N ATOM 1810 CA PRO A 163 -16.006 60.476 11.676 1.00 31.83 C ATOM 1811 C PRO A 163 -15.525 61.803 11.082 1.00 31.82 C ATOM 1812 O PRO A 163 -14.520 62.325 11.539 1.00 31.25 O ATOM 1813 CB PRO A 163 -15.156 59.316 11.171 1.00 32.19 C ATOM 1814 CG PRO A 163 -15.985 58.632 10.100 1.00 32.00 C ATOM 1815 CD PRO A 163 -17.404 58.967 10.351 1.00 31.89 C ATOM 1816 HA PRO A 163 -15.945 60.637 12.752 1.00 0.00 H ATOM 1817 HD3 PRO A 163 -17.905 59.246 9.424 1.00 0.00 H ATOM 1818 HD2 PRO A 163 -17.925 58.124 10.805 1.00 0.00 H ATOM 1819 HG3 PRO A 163 -15.843 57.553 10.152 1.00 0.00 H ATOM 1820 HG2 PRO A 163 -15.687 58.989 9.114 1.00 0.00 H ATOM 1821 HB2 PRO A 163 -14.221 59.685 10.750 1.00 0.00 H ATOM 1822 HB3 PRO A 163 -14.938 58.623 11.983 1.00 0.00 H ATOM 1823 N LYS A 164 -16.241 62.360 10.102 1.00 31.61 N ATOM 1824 CA LYS A 164 -15.734 63.522 9.383 1.00 31.83 C ATOM 1825 C LYS A 164 -16.335 64.834 9.844 1.00 31.40 C ATOM 1826 O LYS A 164 -16.324 65.810 9.088 1.00 32.97 O ATOM 1827 CB LYS A 164 -15.929 63.335 7.861 1.00 32.21 C ATOM 1828 CG LYS A 164 -14.873 62.361 7.263 1.00 33.20 C ATOM 1829 CD LYS A 164 -14.699 62.435 5.727 1.00 32.45 C ATOM 1830 CE LYS A 164 -13.364 61.714 5.359 1.00 33.48 C ATOM 1831 NZ LYS A 164 -13.356 61.092 3.995 1.00 36.14 N ATOM 1832 HA LYS A 164 -14.670 63.586 9.611 1.00 0.00 H ATOM 1833 HB2 LYS A 164 -16.925 62.932 7.679 1.00 0.00 H ATOM 1834 HB3 LYS A 164 -15.835 64.304 7.370 1.00 0.00 H ATOM 1835 HG2 LYS A 164 -13.910 62.585 7.722 1.00 0.00 H ATOM 1836 HG3 LYS A 164 -15.169 61.344 7.520 1.00 0.00 H ATOM 1837 HD2 LYS A 164 -15.536 61.939 5.235 1.00 0.00 H ATOM 1838 HD3 LYS A 164 -14.657 63.477 5.409 1.00 0.00 H ATOM 1839 HE2 LYS A 164 -13.186 60.929 6.094 1.00 0.00 H ATOM 1840 HE3 LYS A 164 -12.556 62.445 5.406 1.00 0.00 H ATOM 1841 HZ1 LYS A 164 -14.113 60.382 3.935 1.00 0.00 H ATOM 1842 HZ2 LYS A 164 -13.513 61.829 3.278 1.00 0.00 H ATOM 1843 HZ3 LYS A 164 -12.437 60.635 3.829 1.00 0.00 H ATOM 1844 H LYS A 164 -17.168 61.961 9.850 1.00 0.00 H ATOM 1845 N ASN A 165 -16.838 64.881 11.074 1.00 30.02 N ATOM 1846 CA ASN A 165 -17.526 66.067 11.571 1.00 28.84 C ATOM 1847 C ASN A 165 -16.687 66.682 12.713 1.00 28.18 C ATOM 1848 O ASN A 165 -16.185 65.976 13.566 1.00 27.93 O ATOM 1849 CB ASN A 165 -18.996 65.666 11.889 1.00 28.37 C ATOM 1850 CG ASN A 165 -19.635 66.475 12.990 1.00 28.03 C ATOM 1851 OD1 ASN A 165 -19.138 66.530 14.091 1.00 30.30 O ATOM 1852 ND2 ASN A 165 -20.773 67.064 12.705 1.00 28.69 N ATOM 1853 HA ASN A 165 -17.611 66.876 10.846 1.00 0.00 H ATOM 1854 HB2 ASN A 165 -19.589 65.793 10.983 1.00 0.00 H ATOM 1855 HB3 ASN A 165 -19.008 64.617 12.185 1.00 0.00 H ATOM 1856 HD22 ASN A 165 -21.169 66.994 11.746 1.00 0.00 H ATOM 1857 HD21 ASN A 165 -21.279 67.601 13.438 1.00 0.00 H ATOM 1858 H ASN A 165 -16.739 64.053 11.696 1.00 0.00 H ATOM 1859 N TYR A 166 -16.469 67.992 12.701 1.00 27.95 N ATOM 1860 CA TYR A 166 -15.589 68.585 13.726 1.00 27.57 C ATOM 1861 C TYR A 166 -16.227 68.484 15.099 1.00 27.78 C ATOM 1862 O TYR A 166 -15.543 68.158 16.097 1.00 27.71 O ATOM 1863 CB TYR A 166 -15.225 70.026 13.375 1.00 27.55 C ATOM 1864 CG TYR A 166 -14.883 70.974 14.530 1.00 28.59 C ATOM 1865 CD1 TYR A 166 -15.755 71.997 14.851 1.00 29.73 C ATOM 1866 CD2 TYR A 166 -13.666 70.903 15.247 1.00 29.10 C ATOM 1867 CE1 TYR A 166 -15.479 72.919 15.850 1.00 30.05 C ATOM 1868 CE2 TYR A 166 -13.378 71.844 16.276 1.00 28.93 C ATOM 1869 CZ TYR A 166 -14.311 72.857 16.557 1.00 29.42 C ATOM 1870 OH TYR A 166 -14.178 73.835 17.538 1.00 28.95 O ATOM 1871 HA TYR A 166 -14.659 68.017 13.750 1.00 0.00 H ATOM 1872 HB3 TYR A 166 -16.072 70.456 12.840 1.00 0.00 H ATOM 1873 HB2 TYR A 166 -14.359 69.992 12.714 1.00 0.00 H ATOM 1874 HD2 TYR A 166 -12.943 70.122 15.010 1.00 0.00 H ATOM 1875 HE2 TYR A 166 -12.446 71.780 16.838 1.00 0.00 H ATOM 1876 HE1 TYR A 166 -16.203 73.703 16.074 1.00 0.00 H ATOM 1877 HD1 TYR A 166 -16.692 72.082 14.300 1.00 0.00 H ATOM 1878 HH TYR A 166 -14.974 74.423 17.526 1.00 0.00 H ATOM 1879 H TYR A 166 -16.913 68.593 11.978 1.00 0.00 H ATOM 1880 N GLN A 167 -17.518 68.725 15.138 1.00 27.86 N ATOM 1881 CA GLN A 167 -18.212 68.902 16.376 1.00 28.77 C ATOM 1882 C GLN A 167 -18.076 67.716 17.313 1.00 28.72 C ATOM 1883 O GLN A 167 -17.960 67.916 18.520 1.00 27.93 O ATOM 1884 CB GLN A 167 -19.667 69.166 16.068 1.00 29.59 C ATOM 1885 CG GLN A 167 -20.307 70.268 16.834 1.00 31.58 C ATOM 1886 CD GLN A 167 -19.534 71.543 16.893 1.00 33.38 C ATOM 1887 OE1 GLN A 167 -19.061 72.058 15.863 1.00 34.26 O ATOM 1888 NE2 GLN A 167 -19.416 72.097 18.119 1.00 33.50 N ATOM 1889 HA GLN A 167 -17.763 69.747 16.899 1.00 0.00 H ATOM 1890 HB2 GLN A 167 -19.745 69.407 15.008 1.00 0.00 H ATOM 1891 HB3 GLN A 167 -20.223 68.251 16.273 1.00 0.00 H ATOM 1892 HG2 GLN A 167 -21.272 70.481 16.374 1.00 0.00 H ATOM 1893 HG3 GLN A 167 -20.462 69.921 17.856 1.00 0.00 H ATOM 1894 HE22 GLN A 167 -19.831 71.623 18.946 1.00 0.00 H ATOM 1895 HE21 GLN A 167 -18.910 72.998 18.236 1.00 0.00 H ATOM 1896 H GLN A 167 -18.049 68.789 14.246 1.00 0.00 H ATOM 1897 N VAL A 168 -18.076 66.493 16.766 1.00 28.58 N ATOM 1898 CA VAL A 168 -18.044 65.306 17.615 1.00 28.67 C ATOM 1899 C VAL A 168 -16.670 65.143 18.223 1.00 29.02 C ATOM 1900 O VAL A 168 -16.559 64.758 19.376 1.00 30.22 O ATOM 1901 CB VAL A 168 -18.480 63.992 16.922 1.00 28.80 C ATOM 1902 CG1 VAL A 168 -19.962 64.049 16.503 1.00 28.38 C ATOM 1903 CG2 VAL A 168 -17.579 63.652 15.776 1.00 26.28 C ATOM 1904 HA VAL A 168 -18.791 65.483 18.389 1.00 0.00 H ATOM 1905 HB VAL A 168 -18.384 63.183 17.646 1.00 0.00 H ATOM 1906 HG11 VAL A 168 -20.582 64.200 17.386 1.00 0.00 H ATOM 1907 HG12 VAL A 168 -20.110 64.875 15.808 1.00 0.00 H ATOM 1908 HG13 VAL A 168 -20.238 63.112 16.019 1.00 0.00 H ATOM 1909 HG21 VAL A 168 -17.608 64.457 15.041 1.00 0.00 H ATOM 1910 HG22 VAL A 168 -16.559 63.529 16.141 1.00 0.00 H ATOM 1911 HG23 VAL A 168 -17.916 62.724 15.314 1.00 0.00 H ATOM 1912 H VAL A 168 -18.099 66.389 15.731 1.00 0.00 H ATOM 1913 N TRP A 169 -15.631 65.465 17.468 1.00 28.80 N ATOM 1914 CA TRP A 169 -14.271 65.374 17.966 1.00 28.29 C ATOM 1915 C TRP A 169 -14.035 66.452 19.001 1.00 28.05 C ATOM 1916 O TRP A 169 -13.393 66.201 20.012 1.00 28.96 O ATOM 1917 CB TRP A 169 -13.243 65.480 16.827 1.00 28.49 C ATOM 1918 CG TRP A 169 -13.167 64.263 15.938 1.00 27.55 C ATOM 1919 CD1 TRP A 169 -13.785 64.111 14.758 1.00 28.22 C ATOM 1920 CD2 TRP A 169 -12.425 63.043 16.163 1.00 28.37 C ATOM 1921 NE1 TRP A 169 -13.494 62.892 14.212 1.00 28.34 N ATOM 1922 CE2 TRP A 169 -12.661 62.206 15.053 1.00 28.26 C ATOM 1923 CE3 TRP A 169 -11.599 62.573 17.198 1.00 28.16 C ATOM 1924 CZ2 TRP A 169 -12.104 60.911 14.941 1.00 28.72 C ATOM 1925 CZ3 TRP A 169 -11.045 61.295 17.088 1.00 28.69 C ATOM 1926 CH2 TRP A 169 -11.303 60.475 15.970 1.00 28.59 C ATOM 1927 HA TRP A 169 -14.140 64.396 18.429 1.00 0.00 H ATOM 1928 HB2 TRP A 169 -13.507 66.338 16.209 1.00 0.00 H ATOM 1929 HB3 TRP A 169 -12.260 65.641 17.269 1.00 0.00 H ATOM 1930 HE1 TRP A 169 -13.850 62.541 13.300 1.00 0.00 H ATOM 1931 HD1 TRP A 169 -14.431 64.858 14.297 1.00 0.00 H ATOM 1932 HZ2 TRP A 169 -12.302 60.283 14.073 1.00 0.00 H ATOM 1933 HH2 TRP A 169 -10.861 59.480 15.921 1.00 0.00 H ATOM 1934 HZ3 TRP A 169 -10.399 60.924 17.884 1.00 0.00 H ATOM 1935 HE3 TRP A 169 -11.394 63.194 18.070 1.00 0.00 H ATOM 1936 H TRP A 169 -15.794 65.791 16.494 1.00 0.00 H ATOM 1937 N HIS A 170 -14.535 67.653 18.769 1.00 27.61 N ATOM 1938 CA HIS A 170 -14.399 68.707 19.782 1.00 27.34 C ATOM 1939 C HIS A 170 -15.058 68.248 21.083 1.00 28.55 C ATOM 1940 O HIS A 170 -14.475 68.424 22.165 1.00 29.89 O ATOM 1941 CB HIS A 170 -15.011 70.032 19.306 1.00 26.48 C ATOM 1942 CG HIS A 170 -15.068 71.094 20.359 1.00 26.13 C ATOM 1943 ND1 HIS A 170 -13.951 71.563 21.016 1.00 29.88 N ATOM 1944 CD2 HIS A 170 -16.113 71.789 20.867 1.00 27.26 C ATOM 1945 CE1 HIS A 170 -14.306 72.497 21.884 1.00 29.33 C ATOM 1946 NE2 HIS A 170 -15.615 72.647 21.818 1.00 25.18 N ATOM 1947 HA HIS A 170 -13.337 68.885 19.954 1.00 0.00 H ATOM 1948 HB2 HIS A 170 -14.413 70.406 18.475 1.00 0.00 H ATOM 1949 HB3 HIS A 170 -16.027 69.836 18.962 1.00 0.00 H ATOM 1950 HD2 HIS A 170 -17.158 71.687 20.575 1.00 0.00 H ATOM 1951 HE1 HIS A 170 -13.632 73.048 22.541 1.00 0.00 H ATOM 1952 H HIS A 170 -15.023 67.851 17.872 1.00 0.00 H ATOM 1953 N HIS A 171 -16.261 67.668 20.979 1.00 28.16 N ATOM 1954 CA HIS A 171 -16.962 67.143 22.144 1.00 28.72 C ATOM 1955 C HIS A 171 -16.103 66.158 22.926 1.00 29.23 C ATOM 1956 O HIS A 171 -15.996 66.279 24.150 1.00 29.93 O ATOM 1957 CB HIS A 171 -18.248 66.443 21.747 1.00 28.32 C ATOM 1958 CG HIS A 171 -19.160 66.153 22.891 1.00 28.84 C ATOM 1959 ND1 HIS A 171 -19.818 67.144 23.588 1.00 27.41 N ATOM 1960 CD2 HIS A 171 -19.561 64.976 23.435 1.00 28.78 C ATOM 1961 CE1 HIS A 171 -20.596 66.588 24.503 1.00 28.05 C ATOM 1962 NE2 HIS A 171 -20.458 65.273 24.431 1.00 28.11 N ATOM 1963 HA HIS A 171 -17.189 68.003 22.774 1.00 0.00 H ATOM 1964 HB2 HIS A 171 -18.779 67.078 21.038 1.00 0.00 H ATOM 1965 HB3 HIS A 171 -17.990 65.499 21.266 1.00 0.00 H ATOM 1966 HD2 HIS A 171 -19.232 63.981 23.137 1.00 0.00 H ATOM 1967 HE1 HIS A 171 -21.242 67.123 25.199 1.00 0.00 H ATOM 1968 H HIS A 171 -16.706 67.590 20.042 1.00 0.00 H ATOM 1969 N ARG A 172 -15.488 65.210 22.221 1.00 28.99 N ATOM 1970 CA ARG A 172 -14.646 64.223 22.861 1.00 30.00 C ATOM 1971 C ARG A 172 -13.455 64.862 23.611 1.00 30.93 C ATOM 1972 O ARG A 172 -13.075 64.463 24.717 1.00 30.91 O ATOM 1973 CB ARG A 172 -14.153 63.233 21.828 1.00 29.78 C ATOM 1974 CG ARG A 172 -13.419 62.092 22.447 1.00 30.77 C ATOM 1975 CD ARG A 172 -13.200 60.994 21.433 1.00 33.88 C ATOM 1976 NE ARG A 172 -12.536 59.872 22.080 1.00 34.84 N ATOM 1977 CZ ARG A 172 -13.033 58.654 22.246 1.00 35.09 C ATOM 1978 NH1 ARG A 172 -14.214 58.317 21.786 1.00 36.66 N ATOM 1979 NH2 ARG A 172 -12.309 57.743 22.852 1.00 37.37 N ATOM 1980 HA ARG A 172 -15.247 63.707 23.609 1.00 0.00 H ATOM 1981 HB2 ARG A 172 -15.010 62.843 21.278 1.00 0.00 H ATOM 1982 HB3 ARG A 172 -13.484 63.748 21.138 1.00 0.00 H ATOM 1983 HG2 ARG A 172 -12.453 62.442 22.812 1.00 0.00 H ATOM 1984 HG3 ARG A 172 -14.001 61.700 23.281 1.00 0.00 H ATOM 1985 HD2 ARG A 172 -12.577 61.367 20.620 1.00 0.00 H ATOM 1986 HD3 ARG A 172 -14.161 60.669 21.034 1.00 0.00 H ATOM 1987 HE ARG A 172 -11.578 60.042 22.448 1.00 0.00 H ATOM 1988 HH12 ARG A 172 -14.574 57.352 21.934 1.00 0.00 H ATOM 1989 HH11 ARG A 172 -14.791 59.014 21.273 1.00 0.00 H ATOM 1990 HH22 ARG A 172 -12.688 56.784 22.988 1.00 0.00 H ATOM 1991 HH21 ARG A 172 -11.357 57.980 23.196 1.00 0.00 H ATOM 1992 H ARG A 172 -15.616 65.179 21.189 1.00 0.00 H ATOM 1993 N ARG A 173 -12.897 65.891 23.004 1.00 31.61 N ATOM 1994 CA ARG A 173 -11.775 66.608 23.584 1.00 32.40 C ATOM 1995 C ARG A 173 -12.244 67.235 24.907 1.00 32.05 C ATOM 1996 O ARG A 173 -11.599 67.063 25.954 1.00 31.97 O ATOM 1997 CB ARG A 173 -11.290 67.635 22.547 1.00 32.66 C ATOM 1998 CG ARG A 173 -9.953 68.335 22.751 1.00 34.48 C ATOM 1999 CD ARG A 173 -9.132 68.249 21.395 1.00 38.95 C ATOM 2000 NE ARG A 173 -9.956 68.598 20.212 1.00 42.29 N ATOM 2001 CZ ARG A 173 -10.117 67.878 19.080 1.00 41.70 C ATOM 2002 NH1 ARG A 173 -10.928 68.353 18.128 1.00 39.13 N ATOM 2003 NH2 ARG A 173 -9.487 66.711 18.883 1.00 41.67 N ATOM 2004 HA ARG A 173 -10.929 65.962 23.820 1.00 0.00 H ATOM 2005 HB2 ARG A 173 -11.234 67.117 21.590 1.00 0.00 H ATOM 2006 HB3 ARG A 173 -12.051 68.414 22.493 1.00 0.00 H ATOM 2007 HG2 ARG A 173 -10.120 69.379 23.015 1.00 0.00 H ATOM 2008 HG3 ARG A 173 -9.398 67.844 23.550 1.00 0.00 H ATOM 2009 HD2 ARG A 173 -8.760 67.232 21.275 1.00 0.00 H ATOM 2010 HD3 ARG A 173 -8.290 68.939 21.451 1.00 0.00 H ATOM 2011 HE ARG A 173 -10.469 69.501 20.259 1.00 0.00 H ATOM 2012 HH12 ARG A 173 -11.067 67.816 17.248 1.00 0.00 H ATOM 2013 HH11 ARG A 173 -11.419 69.259 18.268 1.00 0.00 H ATOM 2014 HH22 ARG A 173 -9.634 66.183 17.999 1.00 0.00 H ATOM 2015 HH21 ARG A 173 -8.851 66.334 19.614 1.00 0.00 H ATOM 2016 H ARG A 173 -13.271 66.198 22.083 1.00 0.00 H ATOM 2017 N VAL A 174 -13.405 67.888 24.885 1.00 31.26 N ATOM 2018 CA VAL A 174 -13.919 68.477 26.120 1.00 30.65 C ATOM 2019 C VAL A 174 -14.102 67.412 27.185 1.00 32.01 C ATOM 2020 O VAL A 174 -13.781 67.660 28.368 1.00 32.04 O ATOM 2021 CB VAL A 174 -15.198 69.293 25.906 1.00 30.28 C ATOM 2022 CG1 VAL A 174 -15.921 69.573 27.229 1.00 27.40 C ATOM 2023 CG2 VAL A 174 -14.852 70.585 25.196 1.00 27.36 C ATOM 2024 HA VAL A 174 -13.170 69.187 26.471 1.00 0.00 H ATOM 2025 HB VAL A 174 -15.882 68.711 25.289 1.00 0.00 H ATOM 2026 HG11 VAL A 174 -16.191 68.628 27.701 1.00 0.00 H ATOM 2027 HG12 VAL A 174 -15.261 70.135 27.890 1.00 0.00 H ATOM 2028 HG13 VAL A 174 -16.822 70.154 27.033 1.00 0.00 H ATOM 2029 HG21 VAL A 174 -14.151 71.156 25.805 1.00 0.00 H ATOM 2030 HG22 VAL A 174 -14.397 70.358 24.232 1.00 0.00 H ATOM 2031 HG23 VAL A 174 -15.760 71.168 25.042 1.00 0.00 H ATOM 2032 H VAL A 174 -13.940 67.978 23.998 1.00 0.00 H ATOM 2033 N LEU A 175 -14.549 66.213 26.784 1.00 32.57 N ATOM 2034 CA LEU A 175 -14.732 65.124 27.766 1.00 33.65 C ATOM 2035 C LEU A 175 -13.388 64.668 28.389 1.00 34.90 C ATOM 2036 O LEU A 175 -13.264 64.605 29.619 1.00 35.22 O ATOM 2037 CB LEU A 175 -15.480 63.918 27.173 1.00 33.47 C ATOM 2038 CG LEU A 175 -16.901 64.137 26.634 1.00 33.49 C ATOM 2039 CD1 LEU A 175 -17.437 62.831 26.092 1.00 34.06 C ATOM 2040 CD2 LEU A 175 -17.825 64.704 27.648 1.00 30.75 C ATOM 2041 HA LEU A 175 -15.350 65.542 28.560 1.00 0.00 H ATOM 2042 HB2 LEU A 175 -14.877 63.537 26.349 1.00 0.00 H ATOM 2043 HB3 LEU A 175 -15.544 63.161 27.955 1.00 0.00 H ATOM 2044 HG LEU A 175 -16.840 64.876 25.835 1.00 0.00 H ATOM 2045 HD21 LEU A 175 -17.893 64.023 28.496 1.00 0.00 H ATOM 2046 HD22 LEU A 175 -17.445 65.669 27.984 1.00 0.00 H ATOM 2047 HD23 LEU A 175 -18.812 64.835 27.205 1.00 0.00 H ATOM 2048 HD11 LEU A 175 -16.791 62.481 25.287 1.00 0.00 H ATOM 2049 HD12 LEU A 175 -17.459 62.090 26.891 1.00 0.00 H ATOM 2050 HD13 LEU A 175 -18.446 62.985 25.709 1.00 0.00 H ATOM 2051 H LEU A 175 -14.767 66.049 25.780 1.00 0.00 H ATOM 2052 N VAL A 176 -12.390 64.376 27.544 1.00 35.88 N ATOM 2053 CA VAL A 176 -11.049 63.996 28.021 1.00 36.90 C ATOM 2054 C VAL A 176 -10.448 65.103 28.915 1.00 38.40 C ATOM 2055 O VAL A 176 -9.954 64.807 30.000 1.00 38.76 O ATOM 2056 CB VAL A 176 -10.142 63.634 26.826 1.00 37.12 C ATOM 2057 CG1 VAL A 176 -8.664 63.386 27.249 1.00 36.04 C ATOM 2058 CG2 VAL A 176 -10.726 62.415 26.132 1.00 36.46 C ATOM 2059 HA VAL A 176 -11.129 63.106 28.645 1.00 0.00 H ATOM 2060 HB VAL A 176 -10.115 64.481 26.140 1.00 0.00 H ATOM 2061 HG11 VAL A 176 -8.264 64.288 27.712 1.00 0.00 H ATOM 2062 HG12 VAL A 176 -8.625 62.562 27.961 1.00 0.00 H ATOM 2063 HG13 VAL A 176 -8.073 63.135 26.368 1.00 0.00 H ATOM 2064 HG21 VAL A 176 -10.767 61.583 26.835 1.00 0.00 H ATOM 2065 HG22 VAL A 176 -11.732 62.645 25.781 1.00 0.00 H ATOM 2066 HG23 VAL A 176 -10.097 62.145 25.284 1.00 0.00 H ATOM 2067 H VAL A 176 -12.567 64.419 26.520 1.00 0.00 H ATOM 2068 N GLU A 177 -10.562 66.375 28.504 1.00 39.54 N ATOM 2069 CA GLU A 177 -10.200 67.489 29.396 1.00 41.02 C ATOM 2070 C GLU A 177 -10.954 67.429 30.729 1.00 40.94 C ATOM 2071 O GLU A 177 -10.333 67.643 31.763 1.00 42.70 O ATOM 2072 CB GLU A 177 -10.405 68.885 28.776 1.00 41.02 C ATOM 2073 CG GLU A 177 -9.679 69.163 27.435 1.00 44.16 C ATOM 2074 CD GLU A 177 -9.905 70.606 26.886 1.00 44.27 C ATOM 2075 OE1 GLU A 177 -9.433 71.547 27.562 1.00 51.29 O ATOM 2076 OE2 GLU A 177 -10.511 70.797 25.789 1.00 47.67 O ATOM 2077 HA GLU A 177 -9.132 67.354 29.566 1.00 0.00 H ATOM 2078 HB2 GLU A 177 -11.474 69.019 28.608 1.00 0.00 H ATOM 2079 HB3 GLU A 177 -10.058 69.623 29.499 1.00 0.00 H ATOM 2080 HG2 GLU A 177 -8.610 69.015 27.585 1.00 0.00 H ATOM 2081 HG3 GLU A 177 -10.042 68.452 26.693 1.00 0.00 H ATOM 2082 H GLU A 177 -10.910 66.576 27.545 1.00 0.00 H ATOM 2083 N TRP A 178 -12.263 67.156 30.750 1.00 40.49 N ATOM 2084 CA TRP A 178 -13.004 67.196 32.061 1.00 40.42 C ATOM 2085 C TRP A 178 -12.584 66.062 33.001 1.00 41.75 C ATOM 2086 O TRP A 178 -12.367 66.279 34.201 1.00 41.26 O ATOM 2087 CB TRP A 178 -14.524 67.151 31.885 1.00 38.88 C ATOM 2088 CG TRP A 178 -15.117 68.404 31.389 1.00 37.45 C ATOM 2089 CD1 TRP A 178 -14.515 69.618 31.319 1.00 36.98 C ATOM 2090 CD2 TRP A 178 -16.442 68.585 30.897 1.00 34.66 C ATOM 2091 NE1 TRP A 178 -15.381 70.545 30.809 1.00 37.11 N ATOM 2092 CE2 TRP A 178 -16.579 69.939 30.551 1.00 36.26 C ATOM 2093 CE3 TRP A 178 -17.528 67.744 30.728 1.00 35.57 C ATOM 2094 CZ2 TRP A 178 -17.764 70.470 30.018 1.00 36.41 C ATOM 2095 CZ3 TRP A 178 -18.717 68.272 30.197 1.00 35.79 C ATOM 2096 CH2 TRP A 178 -18.822 69.618 29.851 1.00 35.47 C ATOM 2097 HA TRP A 178 -12.732 68.152 32.507 1.00 0.00 H ATOM 2098 HB2 TRP A 178 -14.762 66.357 31.177 1.00 0.00 H ATOM 2099 HB3 TRP A 178 -14.973 66.921 32.851 1.00 0.00 H ATOM 2100 HE1 TRP A 178 -15.164 71.549 30.644 1.00 0.00 H ATOM 2101 HD1 TRP A 178 -13.489 69.824 31.625 1.00 0.00 H ATOM 2102 HZ2 TRP A 178 -17.839 71.523 29.747 1.00 0.00 H ATOM 2103 HH2 TRP A 178 -19.759 69.997 29.442 1.00 0.00 H ATOM 2104 HZ3 TRP A 178 -19.575 67.615 30.053 1.00 0.00 H ATOM 2105 HE3 TRP A 178 -17.462 66.691 31.002 1.00 0.00 H ATOM 2106 H TRP A 178 -12.764 66.919 29.870 1.00 0.00 H ATOM 2107 N LEU A 179 -12.468 64.871 32.406 1.00 43.09 N ATOM 2108 CA LEU A 179 -12.078 63.632 33.069 1.00 44.59 C ATOM 2109 C LEU A 179 -10.541 63.482 33.331 1.00 45.84 C ATOM 2110 O LEU A 179 -10.110 62.585 34.064 1.00 45.16 O ATOM 2111 CB LEU A 179 -12.513 62.464 32.165 1.00 44.69 C ATOM 2112 CG LEU A 179 -13.971 62.050 32.109 1.00 43.35 C ATOM 2113 CD1 LEU A 179 -14.208 61.041 30.992 1.00 41.42 C ATOM 2114 CD2 LEU A 179 -14.315 61.461 33.431 1.00 43.75 C ATOM 2115 HA LEU A 179 -12.560 63.637 34.047 1.00 0.00 H ATOM 2116 HB2 LEU A 179 -12.221 62.727 31.148 1.00 0.00 H ATOM 2117 HB3 LEU A 179 -11.949 61.589 32.488 1.00 0.00 H ATOM 2118 HG LEU A 179 -14.602 62.913 31.897 1.00 0.00 H ATOM 2119 HD21 LEU A 179 -13.678 60.596 33.619 1.00 0.00 H ATOM 2120 HD22 LEU A 179 -14.158 62.206 34.211 1.00 0.00 H ATOM 2121 HD23 LEU A 179 -15.360 61.151 33.428 1.00 0.00 H ATOM 2122 HD11 LEU A 179 -13.933 61.488 30.036 1.00 0.00 H ATOM 2123 HD12 LEU A 179 -13.598 60.155 31.169 1.00 0.00 H ATOM 2124 HD13 LEU A 179 -15.261 60.761 30.974 1.00 0.00 H ATOM 2125 H LEU A 179 -12.672 64.824 31.387 1.00 0.00 H ATOM 2126 N LYS A 180 -9.764 64.275 32.617 1.00 46.94 N ATOM 2127 CA LYS A 180 -8.334 64.127 32.517 1.00 47.86 C ATOM 2128 C LYS A 180 -7.919 62.711 32.293 1.00 46.74 C ATOM 2129 O LYS A 180 -7.080 62.227 32.974 1.00 47.06 O ATOM 2130 CB LYS A 180 -7.654 64.676 33.755 1.00 20.00 C ATOM 2131 CG LYS A 180 -8.392 65.824 34.391 1.00 20.00 C ATOM 2132 CD LYS A 180 -7.475 66.715 35.189 1.00 20.00 C ATOM 2133 CE LYS A 180 -8.162 67.996 35.617 1.00 20.00 C ATOM 2134 NZ LYS A 180 -7.647 69.219 34.943 1.00 20.00 N ATOM 2135 HA LYS A 180 -8.019 64.700 31.645 1.00 0.00 H ATOM 2136 HB2 LYS A 180 -7.570 63.873 34.487 1.00 0.00 H ATOM 2137 HB3 LYS A 180 -6.657 65.019 33.477 1.00 0.00 H ATOM 2138 HG2 LYS A 180 -8.864 66.416 33.607 1.00 0.00 H ATOM 2139 HG3 LYS A 180 -9.159 65.425 35.054 1.00 0.00 H ATOM 2140 HD2 LYS A 180 -7.147 66.177 36.078 1.00 0.00 H ATOM 2141 HD3 LYS A 180 -6.608 66.967 34.578 1.00 0.00 H ATOM 2142 HE2 LYS A 180 -8.026 68.115 36.692 1.00 0.00 H ATOM 2143 HE3 LYS A 180 -9.225 67.905 35.395 1.00 0.00 H ATOM 2144 HZ1 LYS A 180 -6.635 69.330 35.154 1.00 0.00 H ATOM 2145 HZ2 LYS A 180 -7.780 69.129 33.915 1.00 0.00 H ATOM 2146 HZ3 LYS A 180 -8.168 70.050 35.290 1.00 0.00 H ATOM 2147 H LYS A 180 -10.211 65.055 32.094 1.00 0.00 H ATOM 2148 N ASP A 181 -8.508 62.041 31.330 1.00 45.45 N ATOM 2149 CA ASP A 181 -8.228 60.624 31.158 1.00 45.62 C ATOM 2150 C ASP A 181 -8.068 60.226 29.696 1.00 45.20 C ATOM 2151 O ASP A 181 -9.027 60.019 28.987 1.00 43.75 O ATOM 2152 CB ASP A 181 -9.296 59.791 31.828 1.00 45.83 C ATOM 2153 CG ASP A 181 -9.102 58.316 31.626 1.00 46.97 C ATOM 2154 OD1 ASP A 181 -7.977 57.884 31.311 1.00 50.27 O ATOM 2155 OD2 ASP A 181 -10.084 57.576 31.807 1.00 48.29 O ATOM 2156 HA ASP A 181 -7.269 60.429 31.638 1.00 0.00 H ATOM 2157 HB2 ASP A 181 -9.280 60.000 32.898 1.00 0.00 H ATOM 2158 HB3 ASP A 181 -10.266 60.074 31.418 1.00 0.00 H ATOM 2159 H ASP A 181 -9.173 62.522 30.692 1.00 0.00 H ATOM 2160 N PRO A 182 -6.821 60.077 29.256 1.00 45.57 N ATOM 2161 CA PRO A 182 -6.543 59.743 27.893 1.00 45.56 C ATOM 2162 C PRO A 182 -6.424 58.270 27.665 1.00 46.33 C ATOM 2163 O PRO A 182 -6.007 57.868 26.590 1.00 46.55 O ATOM 2164 CB PRO A 182 -5.185 60.355 27.688 1.00 45.78 C ATOM 2165 CG PRO A 182 -4.504 60.141 29.012 1.00 46.77 C ATOM 2166 CD PRO A 182 -5.588 60.210 30.046 1.00 46.09 C ATOM 2167 HA PRO A 182 -7.334 60.089 27.227 1.00 0.00 H ATOM 2168 HD3 PRO A 182 -5.495 59.396 30.764 1.00 0.00 H ATOM 2169 HD2 PRO A 182 -5.564 61.163 30.574 1.00 0.00 H ATOM 2170 HG3 PRO A 182 -3.762 60.920 29.187 1.00 0.00 H ATOM 2171 HG2 PRO A 182 -4.018 59.166 29.036 1.00 0.00 H ATOM 2172 HB2 PRO A 182 -4.646 59.851 26.886 1.00 0.00 H ATOM 2173 HB3 PRO A 182 -5.266 61.417 27.458 1.00 0.00 H ATOM 2174 N SER A 183 -6.786 57.453 28.641 1.00 46.80 N ATOM 2175 CA SER A 183 -6.408 56.057 28.576 1.00 47.23 C ATOM 2176 C SER A 183 -7.005 55.351 27.388 1.00 46.37 C ATOM 2177 O SER A 183 -6.459 54.378 26.914 1.00 46.90 O ATOM 2178 CB SER A 183 -6.760 55.312 29.880 1.00 48.40 C ATOM 2179 OG SER A 183 -8.154 55.373 30.223 1.00 49.21 O ATOM 2180 HA SER A 183 -5.325 56.042 28.452 1.00 0.00 H ATOM 2181 HB2 SER A 183 -6.185 55.753 30.694 1.00 0.00 H ATOM 2182 HB3 SER A 183 -6.479 54.265 29.765 1.00 0.00 H ATOM 2183 HG SER A 183 -8.422 56.319 30.342 1.00 0.00 H ATOM 2184 H SER A 183 -7.337 57.810 29.447 1.00 0.00 H ATOM 2185 N GLN A 184 -8.122 55.826 26.872 1.00 45.45 N ATOM 2186 CA GLN A 184 -8.746 55.114 25.771 1.00 44.86 C ATOM 2187 C GLN A 184 -8.404 55.699 24.386 1.00 42.44 C ATOM 2188 O GLN A 184 -8.724 55.093 23.352 1.00 41.34 O ATOM 2189 CB GLN A 184 -10.247 55.091 25.981 1.00 44.90 C ATOM 2190 CG GLN A 184 -10.709 54.693 27.377 1.00 46.39 C ATOM 2191 CD GLN A 184 -12.108 55.256 27.723 1.00 48.58 C ATOM 2192 OE1 GLN A 184 -13.168 54.735 27.273 1.00 46.81 O ATOM 2193 NE2 GLN A 184 -12.109 56.352 28.515 1.00 50.93 N ATOM 2194 HA GLN A 184 -8.344 54.101 25.773 1.00 0.00 H ATOM 2195 HB2 GLN A 184 -10.631 56.090 25.772 1.00 0.00 H ATOM 2196 HB3 GLN A 184 -10.675 54.383 25.271 1.00 0.00 H ATOM 2197 HG2 GLN A 184 -10.746 53.605 27.436 1.00 0.00 H ATOM 2198 HG3 GLN A 184 -9.990 55.071 28.104 1.00 0.00 H ATOM 2199 HE22 GLN A 184 -11.210 56.744 28.861 1.00 0.00 H ATOM 2200 HE21 GLN A 184 -13.009 56.803 28.778 1.00 0.00 H ATOM 2201 H GLN A 184 -8.549 56.697 27.248 1.00 0.00 H ATOM 2202 N GLU A 185 -7.722 56.844 24.365 1.00 40.66 N ATOM 2203 CA GLU A 185 -7.678 57.651 23.157 1.00 39.81 C ATOM 2204 C GLU A 185 -6.866 57.026 22.070 1.00 39.54 C ATOM 2205 O GLU A 185 -7.347 56.899 20.973 1.00 39.08 O ATOM 2206 CB GLU A 185 -7.168 59.043 23.452 1.00 39.67 C ATOM 2207 CG GLU A 185 -8.046 59.801 24.448 1.00 40.71 C ATOM 2208 CD GLU A 185 -9.508 59.884 23.993 1.00 42.26 C ATOM 2209 OE1 GLU A 185 -9.761 60.500 22.930 1.00 41.77 O ATOM 2210 OE2 GLU A 185 -10.396 59.329 24.693 1.00 41.85 O ATOM 2211 HA GLU A 185 -8.705 57.715 22.797 1.00 0.00 H ATOM 2212 HB2 GLU A 185 -6.162 58.965 23.864 1.00 0.00 H ATOM 2213 HB3 GLU A 185 -7.134 59.606 22.519 1.00 0.00 H ATOM 2214 HG2 GLU A 185 -8.007 59.289 25.410 1.00 0.00 H ATOM 2215 HG3 GLU A 185 -7.656 60.813 24.560 1.00 0.00 H ATOM 2216 H GLU A 185 -7.219 57.162 25.218 1.00 0.00 H ATOM 2217 N LEU A 186 -5.643 56.603 22.368 1.00 40.28 N ATOM 2218 CA LEU A 186 -4.758 56.083 21.317 1.00 40.34 C ATOM 2219 C LEU A 186 -5.375 54.878 20.606 1.00 40.93 C ATOM 2220 O LEU A 186 -5.295 54.745 19.380 1.00 40.70 O ATOM 2221 CB LEU A 186 -3.334 55.821 21.843 1.00 40.09 C ATOM 2222 CG LEU A 186 -2.544 57.081 22.281 1.00 39.48 C ATOM 2223 CD1 LEU A 186 -1.093 56.757 22.701 1.00 37.17 C ATOM 2224 CD2 LEU A 186 -2.548 58.175 21.206 1.00 35.10 C ATOM 2225 HA LEU A 186 -4.653 56.858 20.558 1.00 0.00 H ATOM 2226 HB2 LEU A 186 -3.410 55.156 22.703 1.00 0.00 H ATOM 2227 HB3 LEU A 186 -2.769 55.327 21.052 1.00 0.00 H ATOM 2228 HG LEU A 186 -3.070 57.462 23.157 1.00 0.00 H ATOM 2229 HD21 LEU A 186 -2.090 57.789 20.295 1.00 0.00 H ATOM 2230 HD22 LEU A 186 -3.575 58.475 20.999 1.00 0.00 H ATOM 2231 HD23 LEU A 186 -1.981 59.035 21.563 1.00 0.00 H ATOM 2232 HD11 LEU A 186 -1.106 56.061 23.540 1.00 0.00 H ATOM 2233 HD12 LEU A 186 -0.565 56.306 21.861 1.00 0.00 H ATOM 2234 HD13 LEU A 186 -0.588 57.676 22.998 1.00 0.00 H ATOM 2235 H LEU A 186 -5.309 56.640 23.352 1.00 0.00 H ATOM 2236 N GLU A 187 -6.071 54.058 21.367 1.00 41.89 N ATOM 2237 CA GLU A 187 -6.673 52.841 20.839 1.00 43.42 C ATOM 2238 C GLU A 187 -7.998 53.140 20.108 1.00 41.05 C ATOM 2239 O GLU A 187 -8.301 52.550 19.078 1.00 41.06 O ATOM 2240 CB GLU A 187 -6.865 51.888 22.010 1.00 44.06 C ATOM 2241 CG GLU A 187 -7.085 50.433 21.664 1.00 48.01 C ATOM 2242 CD GLU A 187 -7.895 49.669 22.776 1.00 49.61 C ATOM 2243 OE1 GLU A 187 -7.844 50.012 24.015 1.00 50.12 O ATOM 2244 OE2 GLU A 187 -8.594 48.713 22.365 1.00 56.16 O ATOM 2245 HA GLU A 187 -6.024 52.384 20.092 1.00 0.00 H ATOM 2246 HB2 GLU A 187 -5.975 51.949 22.637 1.00 0.00 H ATOM 2247 HB3 GLU A 187 -7.731 52.229 22.577 1.00 0.00 H ATOM 2248 HG2 GLU A 187 -7.637 50.375 20.726 1.00 0.00 H ATOM 2249 HG3 GLU A 187 -6.115 49.951 21.543 1.00 0.00 H ATOM 2250 H GLU A 187 -6.194 54.286 22.374 1.00 0.00 H ATOM 2251 N PHE A 188 -8.776 54.078 20.633 1.00 39.23 N ATOM 2252 CA PHE A 188 -9.949 54.553 19.910 1.00 37.91 C ATOM 2253 C PHE A 188 -9.520 55.158 18.577 1.00 37.09 C ATOM 2254 O PHE A 188 -9.963 54.702 17.533 1.00 37.12 O ATOM 2255 CB PHE A 188 -10.800 55.567 20.709 1.00 37.38 C ATOM 2256 CG PHE A 188 -11.847 56.246 19.868 1.00 36.26 C ATOM 2257 CD1 PHE A 188 -12.892 55.521 19.329 1.00 36.09 C ATOM 2258 CD2 PHE A 188 -11.751 57.590 19.563 1.00 36.38 C ATOM 2259 CE1 PHE A 188 -13.836 56.134 18.501 1.00 37.35 C ATOM 2260 CE2 PHE A 188 -12.691 58.210 18.741 1.00 35.53 C ATOM 2261 CZ PHE A 188 -13.728 57.473 18.203 1.00 36.38 C ATOM 2262 HA PHE A 188 -10.588 53.686 19.744 1.00 0.00 H ATOM 2263 HB2 PHE A 188 -11.296 55.039 21.523 1.00 0.00 H ATOM 2264 HB3 PHE A 188 -10.138 56.328 21.121 1.00 0.00 H ATOM 2265 HD2 PHE A 188 -10.927 58.175 19.972 1.00 0.00 H ATOM 2266 HE2 PHE A 188 -12.608 59.275 18.523 1.00 0.00 H ATOM 2267 HZ PHE A 188 -14.456 57.949 17.546 1.00 0.00 H ATOM 2268 HE1 PHE A 188 -14.660 55.550 18.090 1.00 0.00 H ATOM 2269 HD1 PHE A 188 -12.981 54.458 19.552 1.00 0.00 H ATOM 2270 H PHE A 188 -8.547 54.477 21.566 1.00 0.00 H ATOM 2271 N ILE A 189 -8.646 56.163 18.613 1.00 36.63 N ATOM 2272 CA ILE A 189 -8.210 56.829 17.371 1.00 36.30 C ATOM 2273 C ILE A 189 -7.691 55.807 16.348 1.00 37.38 C ATOM 2274 O ILE A 189 -8.025 55.899 15.170 1.00 38.35 O ATOM 2275 CB ILE A 189 -7.114 57.859 17.592 1.00 35.90 C ATOM 2276 CG1 ILE A 189 -7.560 58.960 18.574 1.00 36.15 C ATOM 2277 CG2 ILE A 189 -6.750 58.476 16.270 1.00 33.67 C ATOM 2278 CD1 ILE A 189 -6.431 59.830 19.051 1.00 34.22 C ATOM 2279 HA ILE A 189 -9.097 57.340 16.997 1.00 0.00 H ATOM 2280 HB ILE A 189 -6.250 57.356 18.028 1.00 0.00 H ATOM 2281 HG12 ILE A 189 -8.295 59.591 18.075 1.00 0.00 H ATOM 2282 HG13 ILE A 189 -8.020 58.485 19.440 1.00 0.00 H ATOM 2283 HD11 ILE A 189 -5.691 59.215 19.563 1.00 0.00 H ATOM 2284 HD12 ILE A 189 -5.967 60.322 18.196 1.00 0.00 H ATOM 2285 HD13 ILE A 189 -6.819 60.582 19.738 1.00 0.00 H ATOM 2286 HG21 ILE A 189 -6.395 57.699 15.593 1.00 0.00 H ATOM 2287 HG22 ILE A 189 -7.628 58.959 15.842 1.00 0.00 H ATOM 2288 HG23 ILE A 189 -5.964 59.216 16.420 1.00 0.00 H ATOM 2289 H ILE A 189 -8.267 56.482 19.527 1.00 0.00 H ATOM 2290 N ALA A 190 -6.907 54.828 16.807 1.00 37.68 N ATOM 2291 CA ALA A 190 -6.357 53.793 15.943 1.00 37.85 C ATOM 2292 C ALA A 190 -7.427 52.960 15.233 1.00 38.56 C ATOM 2293 O ALA A 190 -7.205 52.462 14.137 1.00 38.92 O ATOM 2294 CB ALA A 190 -5.438 52.871 16.756 1.00 37.66 C ATOM 2295 HA ALA A 190 -5.792 54.306 15.164 1.00 0.00 H ATOM 2296 HB1 ALA A 190 -4.623 53.456 17.182 1.00 0.00 H ATOM 2297 HB2 ALA A 190 -6.010 52.405 17.558 1.00 0.00 H ATOM 2298 HB3 ALA A 190 -5.030 52.099 16.103 1.00 0.00 H ATOM 2299 H ALA A 190 -6.680 54.804 17.822 1.00 0.00 H ATOM 2300 N ASP A 191 -8.574 52.753 15.863 1.00 39.23 N ATOM 2301 CA ASP A 191 -9.653 52.060 15.166 1.00 39.63 C ATOM 2302 C ASP A 191 -10.314 52.912 14.067 1.00 38.41 C ATOM 2303 O ASP A 191 -10.689 52.378 13.012 1.00 38.28 O ATOM 2304 CB ASP A 191 -10.761 51.633 16.115 1.00 40.54 C ATOM 2305 CG ASP A 191 -11.835 50.873 15.376 1.00 43.87 C ATOM 2306 OD1 ASP A 191 -11.486 49.796 14.849 1.00 50.03 O ATOM 2307 OD2 ASP A 191 -12.970 51.373 15.217 1.00 45.68 O ATOM 2308 HA ASP A 191 -9.167 51.194 14.716 1.00 0.00 H ATOM 2309 HB2 ASP A 191 -10.341 50.994 16.892 1.00 0.00 H ATOM 2310 HB3 ASP A 191 -11.201 52.519 16.574 1.00 0.00 H ATOM 2311 H ASP A 191 -8.704 53.080 16.842 1.00 0.00 H ATOM 2312 N ILE A 192 -10.493 54.215 14.324 1.00 36.97 N ATOM 2313 CA ILE A 192 -11.052 55.118 13.301 1.00 36.18 C ATOM 2314 C ILE A 192 -10.105 55.145 12.107 1.00 35.90 C ATOM 2315 O ILE A 192 -10.561 55.030 10.968 1.00 35.50 O ATOM 2316 CB ILE A 192 -11.262 56.562 13.783 1.00 35.34 C ATOM 2317 CG1 ILE A 192 -12.265 56.623 14.943 1.00 36.58 C ATOM 2318 CG2 ILE A 192 -11.727 57.421 12.643 1.00 33.38 C ATOM 2319 CD1 ILE A 192 -13.603 55.974 14.704 1.00 33.75 C ATOM 2320 HA ILE A 192 -12.036 54.725 13.046 1.00 0.00 H ATOM 2321 HB ILE A 192 -10.308 56.940 14.149 1.00 0.00 H ATOM 2322 HG12 ILE A 192 -11.808 56.135 15.804 1.00 0.00 H ATOM 2323 HG13 ILE A 192 -12.442 57.673 15.174 1.00 0.00 H ATOM 2324 HD11 ILE A 192 -14.093 56.456 13.858 1.00 0.00 H ATOM 2325 HD12 ILE A 192 -13.458 54.916 14.487 1.00 0.00 H ATOM 2326 HD13 ILE A 192 -14.222 56.083 15.594 1.00 0.00 H ATOM 2327 HG21 ILE A 192 -10.976 57.412 11.853 1.00 0.00 H ATOM 2328 HG22 ILE A 192 -12.668 57.031 12.256 1.00 0.00 H ATOM 2329 HG23 ILE A 192 -11.873 58.442 12.995 1.00 0.00 H ATOM 2330 H ILE A 192 -10.234 54.594 15.257 1.00 0.00 H ATOM 2331 N LEU A 193 -8.799 55.252 12.396 1.00 35.65 N ATOM 2332 CA LEU A 193 -7.740 55.291 11.372 1.00 35.99 C ATOM 2333 C LEU A 193 -7.560 53.970 10.668 1.00 37.35 C ATOM 2334 O LEU A 193 -7.013 53.917 9.558 1.00 38.02 O ATOM 2335 CB LEU A 193 -6.385 55.693 11.965 1.00 35.32 C ATOM 2336 CG LEU A 193 -6.263 57.174 12.339 1.00 34.05 C ATOM 2337 CD1 LEU A 193 -4.918 57.421 13.052 1.00 31.77 C ATOM 2338 CD2 LEU A 193 -6.446 58.052 11.089 1.00 28.88 C ATOM 2339 HA LEU A 193 -8.073 56.040 10.653 1.00 0.00 H ATOM 2340 HB2 LEU A 193 -6.219 55.101 12.865 1.00 0.00 H ATOM 2341 HB3 LEU A 193 -5.612 55.463 11.232 1.00 0.00 H ATOM 2342 HG LEU A 193 -7.054 57.451 13.037 1.00 0.00 H ATOM 2343 HD21 LEU A 193 -5.678 57.803 10.356 1.00 0.00 H ATOM 2344 HD22 LEU A 193 -7.432 57.871 10.660 1.00 0.00 H ATOM 2345 HD23 LEU A 193 -6.357 59.102 11.368 1.00 0.00 H ATOM 2346 HD11 LEU A 193 -4.871 56.814 13.956 1.00 0.00 H ATOM 2347 HD12 LEU A 193 -4.100 57.147 12.386 1.00 0.00 H ATOM 2348 HD13 LEU A 193 -4.836 58.475 13.316 1.00 0.00 H ATOM 2349 H LEU A 193 -8.519 55.311 13.396 1.00 0.00 H ATOM 2350 N ASN A 194 -7.974 52.896 11.324 1.00 38.59 N ATOM 2351 CA ASN A 194 -8.112 51.628 10.648 1.00 39.59 C ATOM 2352 C ASN A 194 -9.170 51.711 9.561 1.00 39.19 C ATOM 2353 O ASN A 194 -9.062 51.006 8.582 1.00 39.96 O ATOM 2354 CB ASN A 194 -8.471 50.508 11.633 1.00 41.07 C ATOM 2355 CG ASN A 194 -8.101 49.145 11.104 1.00 42.62 C ATOM 2356 OD1 ASN A 194 -6.934 48.816 10.996 1.00 44.90 O ATOM 2357 ND2 ASN A 194 -9.092 48.364 10.737 1.00 45.88 N ATOM 2358 HA ASN A 194 -7.150 51.394 10.193 1.00 0.00 H ATOM 2359 HB2 ASN A 194 -7.938 50.678 12.568 1.00 0.00 H ATOM 2360 HB3 ASN A 194 -9.545 50.534 11.818 1.00 0.00 H ATOM 2361 HD22 ASN A 194 -10.075 48.685 10.847 1.00 0.00 H ATOM 2362 HD21 ASN A 194 -8.893 47.425 10.337 1.00 0.00 H ATOM 2363 H ASN A 194 -8.202 52.967 12.336 1.00 0.00 H ATOM 2364 N GLN A 195 -10.188 52.556 9.712 1.00 38.48 N ATOM 2365 CA GLN A 195 -11.228 52.674 8.666 1.00 38.25 C ATOM 2366 C GLN A 195 -10.967 53.738 7.637 1.00 37.10 C ATOM 2367 O GLN A 195 -11.355 53.557 6.498 1.00 37.30 O ATOM 2368 CB GLN A 195 -12.619 52.899 9.262 1.00 38.55 C ATOM 2369 CG GLN A 195 -13.149 51.711 10.128 1.00 39.55 C ATOM 2370 CD GLN A 195 -14.282 52.148 11.048 1.00 39.98 C ATOM 2371 OE1 GLN A 195 -15.369 52.500 10.577 1.00 43.10 O ATOM 2372 NE2 GLN A 195 -14.024 52.169 12.358 1.00 42.79 N ATOM 2373 HA GLN A 195 -11.187 51.712 8.155 1.00 0.00 H ATOM 2374 HB2 GLN A 195 -12.581 53.789 9.890 1.00 0.00 H ATOM 2375 HB3 GLN A 195 -13.319 53.063 8.443 1.00 0.00 H ATOM 2376 HG2 GLN A 195 -13.514 50.926 9.466 1.00 0.00 H ATOM 2377 HG3 GLN A 195 -12.331 51.322 10.734 1.00 0.00 H ATOM 2378 HE22 GLN A 195 -13.094 51.863 12.710 1.00 0.00 H ATOM 2379 HE21 GLN A 195 -14.753 52.491 13.026 1.00 0.00 H ATOM 2380 H GLN A 195 -10.253 53.138 10.572 1.00 0.00 H ATOM 2381 N ASP A 196 -10.382 54.871 8.041 1.00 36.53 N ATOM 2382 CA ASP A 196 -9.889 55.911 7.094 1.00 35.49 C ATOM 2383 C ASP A 196 -8.580 56.414 7.614 1.00 34.15 C ATOM 2384 O ASP A 196 -8.536 57.227 8.525 1.00 33.92 O ATOM 2385 CB ASP A 196 -10.864 57.089 6.955 1.00 35.35 C ATOM 2386 CG ASP A 196 -10.338 58.239 6.022 1.00 36.82 C ATOM 2387 OD1 ASP A 196 -11.035 59.284 6.021 1.00 39.64 O ATOM 2388 OD2 ASP A 196 -9.275 58.135 5.309 1.00 37.51 O ATOM 2389 HA ASP A 196 -9.789 55.462 6.106 1.00 0.00 H ATOM 2390 HB2 ASP A 196 -11.801 56.714 6.544 1.00 0.00 H ATOM 2391 HB3 ASP A 196 -11.045 57.505 7.946 1.00 0.00 H ATOM 2392 H ASP A 196 -10.266 55.034 9.062 1.00 0.00 H ATOM 2393 N ALA A 197 -7.511 55.940 7.005 1.00 33.57 N ATOM 2394 CA ALA A 197 -6.162 56.203 7.501 1.00 33.38 C ATOM 2395 C ALA A 197 -5.715 57.681 7.348 1.00 32.29 C ATOM 2396 O ALA A 197 -4.649 58.063 7.846 1.00 32.38 O ATOM 2397 CB ALA A 197 -5.153 55.222 6.811 1.00 32.89 C ATOM 2398 HA ALA A 197 -6.173 56.024 8.576 1.00 0.00 H ATOM 2399 HB1 ALA A 197 -5.432 54.194 7.042 1.00 0.00 H ATOM 2400 HB2 ALA A 197 -5.181 55.374 5.732 1.00 0.00 H ATOM 2401 HB3 ALA A 197 -4.147 55.418 7.181 1.00 0.00 H ATOM 2402 H ALA A 197 -7.631 55.363 6.148 1.00 0.00 H ATOM 2403 N LYS A 198 -6.531 58.496 6.683 1.00 31.14 N ATOM 2404 CA LYS A 198 -6.198 59.870 6.405 1.00 30.55 C ATOM 2405 C LYS A 198 -7.136 60.883 7.044 1.00 29.53 C ATOM 2406 O LYS A 198 -7.007 62.081 6.791 1.00 28.03 O ATOM 2407 CB LYS A 198 -6.140 60.056 4.884 1.00 30.66 C ATOM 2408 CG LYS A 198 -5.011 59.186 4.228 1.00 32.07 C ATOM 2409 CD LYS A 198 -4.952 59.283 2.688 1.00 30.67 C ATOM 2410 CE LYS A 198 -3.942 58.292 2.096 1.00 27.86 C ATOM 2411 NZ LYS A 198 -3.393 58.792 0.810 1.00 23.16 N ATOM 2412 HA LYS A 198 -5.227 60.069 6.859 1.00 0.00 H ATOM 2413 HB2 LYS A 198 -7.100 59.767 4.457 1.00 0.00 H ATOM 2414 HB3 LYS A 198 -5.948 61.106 4.665 1.00 0.00 H ATOM 2415 HG2 LYS A 198 -4.051 59.512 4.628 1.00 0.00 H ATOM 2416 HG3 LYS A 198 -5.181 58.144 4.499 1.00 0.00 H ATOM 2417 HD2 LYS A 198 -5.940 59.066 2.282 1.00 0.00 H ATOM 2418 HD3 LYS A 198 -4.660 60.295 2.408 1.00 0.00 H ATOM 2419 HE2 LYS A 198 -4.439 57.337 1.924 1.00 0.00 H ATOM 2420 HE3 LYS A 198 -3.124 58.153 2.802 1.00 0.00 H ATOM 2421 HZ1 LYS A 198 -4.169 58.922 0.130 1.00 0.00 H ATOM 2422 HZ2 LYS A 198 -2.914 59.701 0.969 1.00 0.00 H ATOM 2423 HZ3 LYS A 198 -2.713 58.101 0.433 1.00 0.00 H ATOM 2424 H LYS A 198 -7.445 58.126 6.351 1.00 0.00 H ATOM 2425 N ASN A 199 -8.057 60.412 7.886 1.00 29.20 N ATOM 2426 CA ASN A 199 -9.041 61.297 8.555 1.00 29.00 C ATOM 2427 C ASN A 199 -8.373 62.450 9.334 1.00 29.05 C ATOM 2428 O ASN A 199 -7.698 62.242 10.390 1.00 29.59 O ATOM 2429 CB ASN A 199 -9.962 60.495 9.476 1.00 28.81 C ATOM 2430 CG ASN A 199 -11.082 61.347 10.090 1.00 29.27 C ATOM 2431 OD1 ASN A 199 -10.815 62.355 10.806 1.00 26.15 O ATOM 2432 ND2 ASN A 199 -12.357 60.925 9.849 1.00 26.23 N ATOM 2433 HA ASN A 199 -9.638 61.749 7.763 1.00 0.00 H ATOM 2434 HB2 ASN A 199 -10.415 59.688 8.899 1.00 0.00 H ATOM 2435 HB3 ASN A 199 -9.364 60.072 10.283 1.00 0.00 H ATOM 2436 HD22 ASN A 199 -12.524 60.089 9.253 1.00 0.00 H ATOM 2437 HD21 ASN A 199 -13.162 61.439 10.262 1.00 0.00 H ATOM 2438 H ASN A 199 -8.086 59.391 8.080 1.00 0.00 H ATOM 2439 N TYR A 200 -8.560 63.665 8.811 1.00 28.13 N ATOM 2440 CA TYR A 200 -7.843 64.822 9.320 1.00 27.57 C ATOM 2441 C TYR A 200 -8.128 65.028 10.807 1.00 27.45 C ATOM 2442 O TYR A 200 -7.202 65.225 11.586 1.00 27.80 O ATOM 2443 CB TYR A 200 -8.197 66.077 8.505 1.00 27.63 C ATOM 2444 CG TYR A 200 -7.175 67.192 8.574 1.00 27.06 C ATOM 2445 CD1 TYR A 200 -6.083 67.226 7.704 1.00 27.31 C ATOM 2446 CD2 TYR A 200 -7.308 68.224 9.475 1.00 27.23 C ATOM 2447 CE1 TYR A 200 -5.139 68.251 7.769 1.00 27.14 C ATOM 2448 CE2 TYR A 200 -6.368 69.258 9.535 1.00 28.64 C ATOM 2449 CZ TYR A 200 -5.276 69.252 8.688 1.00 28.71 C ATOM 2450 OH TYR A 200 -4.330 70.286 8.741 1.00 30.25 O ATOM 2451 HA TYR A 200 -6.774 64.640 9.211 1.00 0.00 H ATOM 2452 HB3 TYR A 200 -9.146 66.464 8.875 1.00 0.00 H ATOM 2453 HB2 TYR A 200 -8.308 65.783 7.461 1.00 0.00 H ATOM 2454 HD2 TYR A 200 -8.161 68.236 10.154 1.00 0.00 H ATOM 2455 HE2 TYR A 200 -6.497 70.070 10.251 1.00 0.00 H ATOM 2456 HE1 TYR A 200 -4.290 68.253 7.085 1.00 0.00 H ATOM 2457 HD1 TYR A 200 -5.966 66.437 6.961 1.00 0.00 H ATOM 2458 HH TYR A 200 -3.623 70.119 8.069 1.00 0.00 H ATOM 2459 H TYR A 200 -9.231 63.785 8.025 1.00 0.00 H ATOM 2460 N HIS A 201 -9.400 64.978 11.195 1.00 27.51 N ATOM 2461 CA HIS A 201 -9.787 65.202 12.588 1.00 28.20 C ATOM 2462 C HIS A 201 -9.173 64.135 13.498 1.00 28.52 C ATOM 2463 O HIS A 201 -8.790 64.445 14.627 1.00 28.38 O ATOM 2464 CB HIS A 201 -11.309 65.198 12.803 1.00 28.60 C ATOM 2465 CG HIS A 201 -12.072 66.111 11.894 1.00 31.74 C ATOM 2466 ND1 HIS A 201 -12.063 67.485 12.018 1.00 34.25 N ATOM 2467 CD2 HIS A 201 -12.894 65.837 10.851 1.00 36.48 C ATOM 2468 CE1 HIS A 201 -12.838 68.015 11.084 1.00 34.58 C ATOM 2469 NE2 HIS A 201 -13.345 67.038 10.354 1.00 35.72 N ATOM 2470 HA HIS A 201 -9.410 66.193 12.841 1.00 0.00 H ATOM 2471 HB2 HIS A 201 -11.672 64.182 12.647 1.00 0.00 H ATOM 2472 HB3 HIS A 201 -11.508 65.499 13.832 1.00 0.00 H ATOM 2473 HD2 HIS A 201 -13.151 64.847 10.475 1.00 0.00 H ATOM 2474 HE1 HIS A 201 -13.026 69.079 10.942 1.00 0.00 H ATOM 2475 H HIS A 201 -10.137 64.775 10.490 1.00 0.00 H ATOM 2476 N ALA A 202 -9.089 62.890 13.014 1.00 28.31 N ATOM 2477 CA ALA A 202 -8.531 61.816 13.812 1.00 28.66 C ATOM 2478 C ALA A 202 -7.031 62.099 14.131 1.00 29.64 C ATOM 2479 O ALA A 202 -6.574 61.951 15.281 1.00 29.94 O ATOM 2480 CB ALA A 202 -8.698 60.491 13.109 1.00 27.65 C ATOM 2481 HA ALA A 202 -9.073 61.764 14.756 1.00 0.00 H ATOM 2482 HB1 ALA A 202 -9.759 60.298 12.948 1.00 0.00 H ATOM 2483 HB2 ALA A 202 -8.183 60.523 12.149 1.00 0.00 H ATOM 2484 HB3 ALA A 202 -8.273 59.698 13.725 1.00 0.00 H ATOM 2485 H ALA A 202 -9.429 62.690 12.052 1.00 0.00 H ATOM 2486 N TRP A 203 -6.270 62.528 13.121 1.00 30.15 N ATOM 2487 CA TRP A 203 -4.833 62.830 13.318 1.00 29.34 C ATOM 2488 C TRP A 203 -4.658 63.997 14.264 1.00 29.30 C ATOM 2489 O TRP A 203 -3.785 63.975 15.129 1.00 29.78 O ATOM 2490 CB TRP A 203 -4.134 63.077 11.990 1.00 28.99 C ATOM 2491 CG TRP A 203 -3.887 61.805 11.247 1.00 28.62 C ATOM 2492 CD1 TRP A 203 -4.489 61.394 10.095 1.00 29.89 C ATOM 2493 CD2 TRP A 203 -2.990 60.769 11.619 1.00 27.66 C ATOM 2494 NE1 TRP A 203 -4.016 60.146 9.727 1.00 29.59 N ATOM 2495 CE2 TRP A 203 -3.105 59.743 10.659 1.00 28.36 C ATOM 2496 CE3 TRP A 203 -2.097 60.606 12.677 1.00 30.12 C ATOM 2497 CZ2 TRP A 203 -2.369 58.585 10.723 1.00 30.50 C ATOM 2498 CZ3 TRP A 203 -1.369 59.446 12.748 1.00 30.52 C ATOM 2499 CH2 TRP A 203 -1.497 58.449 11.767 1.00 30.65 C ATOM 2500 HA TRP A 203 -4.362 61.958 13.772 1.00 0.00 H ATOM 2501 HB2 TRP A 203 -4.759 63.728 11.378 1.00 0.00 H ATOM 2502 HB3 TRP A 203 -3.179 63.566 12.180 1.00 0.00 H ATOM 2503 HE1 TRP A 203 -4.305 59.608 8.885 1.00 0.00 H ATOM 2504 HD1 TRP A 203 -5.235 61.966 9.543 1.00 0.00 H ATOM 2505 HZ2 TRP A 203 -2.476 57.804 9.970 1.00 0.00 H ATOM 2506 HH2 TRP A 203 -0.888 57.548 11.840 1.00 0.00 H ATOM 2507 HZ3 TRP A 203 -0.680 59.295 13.579 1.00 0.00 H ATOM 2508 HE3 TRP A 203 -1.980 61.384 13.432 1.00 0.00 H ATOM 2509 H TRP A 203 -6.694 62.652 12.179 1.00 0.00 H ATOM 2510 N GLN A 204 -5.526 64.987 14.126 1.00 29.25 N ATOM 2511 CA GLN A 204 -5.493 66.182 14.959 1.00 29.09 C ATOM 2512 C GLN A 204 -5.783 65.795 16.383 1.00 29.53 C ATOM 2513 O GLN A 204 -5.132 66.281 17.296 1.00 30.31 O ATOM 2514 CB GLN A 204 -6.528 67.212 14.474 1.00 28.48 C ATOM 2515 CG GLN A 204 -6.432 68.537 15.220 1.00 29.38 C ATOM 2516 CD GLN A 204 -7.130 69.756 14.555 1.00 29.99 C ATOM 2517 OE1 GLN A 204 -7.215 69.890 13.322 1.00 37.24 O ATOM 2518 NE2 GLN A 204 -7.563 70.679 15.383 1.00 31.62 N ATOM 2519 HA GLN A 204 -4.504 66.636 14.892 1.00 0.00 H ATOM 2520 HB2 GLN A 204 -6.366 67.397 13.412 1.00 0.00 H ATOM 2521 HB3 GLN A 204 -7.526 66.800 14.621 1.00 0.00 H ATOM 2522 HG2 GLN A 204 -6.877 68.396 16.205 1.00 0.00 H ATOM 2523 HG3 GLN A 204 -5.375 68.780 15.331 1.00 0.00 H ATOM 2524 HE22 GLN A 204 -7.478 70.538 16.410 1.00 0.00 H ATOM 2525 HE21 GLN A 204 -7.991 71.551 15.012 1.00 0.00 H ATOM 2526 H GLN A 204 -6.261 64.909 13.394 1.00 0.00 H ATOM 2527 N HIS A 205 -6.762 64.916 16.585 1.00 29.45 N ATOM 2528 CA HIS A 205 -7.092 64.518 17.919 1.00 29.56 C ATOM 2529 C HIS A 205 -5.923 63.748 18.552 1.00 29.78 C ATOM 2530 O HIS A 205 -5.580 63.952 19.738 1.00 29.63 O ATOM 2531 CB HIS A 205 -8.336 63.680 17.926 1.00 29.65 C ATOM 2532 CG HIS A 205 -8.821 63.372 19.297 1.00 30.07 C ATOM 2533 ND1 HIS A 205 -9.198 64.353 20.179 1.00 29.88 N ATOM 2534 CD2 HIS A 205 -8.961 62.198 19.957 1.00 33.26 C ATOM 2535 CE1 HIS A 205 -9.578 63.798 21.317 1.00 32.69 C ATOM 2536 NE2 HIS A 205 -9.426 62.491 21.216 1.00 32.07 N ATOM 2537 HA HIS A 205 -7.278 65.414 18.510 1.00 0.00 H ATOM 2538 HB2 HIS A 205 -9.120 64.217 17.392 1.00 0.00 H ATOM 2539 HB3 HIS A 205 -8.126 62.742 17.413 1.00 0.00 H ATOM 2540 HD2 HIS A 205 -8.745 61.205 19.563 1.00 0.00 H ATOM 2541 HE1 HIS A 205 -9.953 64.330 22.191 1.00 0.00 H ATOM 2542 H HIS A 205 -7.284 64.521 15.777 1.00 0.00 H ATOM 2543 N ARG A 206 -5.317 62.893 17.745 1.00 29.90 N ATOM 2544 CA ARG A 206 -4.125 62.144 18.142 1.00 31.25 C ATOM 2545 C ARG A 206 -2.934 63.069 18.500 1.00 31.35 C ATOM 2546 O ARG A 206 -2.336 62.953 19.583 1.00 30.71 O ATOM 2547 CB ARG A 206 -3.713 61.194 17.035 1.00 31.58 C ATOM 2548 CG ARG A 206 -2.785 60.119 17.495 1.00 33.40 C ATOM 2549 CD ARG A 206 -2.639 58.997 16.475 1.00 35.56 C ATOM 2550 NE ARG A 206 -1.962 57.860 17.103 1.00 38.05 N ATOM 2551 CZ ARG A 206 -2.561 56.751 17.541 1.00 41.52 C ATOM 2552 NH1 ARG A 206 -3.872 56.583 17.417 1.00 42.95 N ATOM 2553 NH2 ARG A 206 -1.845 55.785 18.116 1.00 41.40 N ATOM 2554 HA ARG A 206 -4.387 61.583 19.039 1.00 0.00 H ATOM 2555 HB2 ARG A 206 -4.610 60.727 16.628 1.00 0.00 H ATOM 2556 HB3 ARG A 206 -3.217 61.768 16.252 1.00 0.00 H ATOM 2557 HG2 ARG A 206 -1.804 60.558 17.675 1.00 0.00 H ATOM 2558 HG3 ARG A 206 -3.170 59.699 18.424 1.00 0.00 H ATOM 2559 HD2 ARG A 206 -2.051 59.349 15.627 1.00 0.00 H ATOM 2560 HD3 ARG A 206 -3.625 58.688 16.128 1.00 0.00 H ATOM 2561 HE ARG A 206 -0.930 57.922 17.217 1.00 0.00 H ATOM 2562 HH12 ARG A 206 -4.320 55.711 17.765 1.00 0.00 H ATOM 2563 HH11 ARG A 206 -4.451 57.323 16.972 1.00 0.00 H ATOM 2564 HH22 ARG A 206 -2.315 54.922 18.456 1.00 0.00 H ATOM 2565 HH21 ARG A 206 -0.816 55.894 18.224 1.00 0.00 H ATOM 2566 H ARG A 206 -5.703 62.748 16.790 1.00 0.00 H ATOM 2567 N GLN A 207 -2.629 64.033 17.633 1.00 30.56 N ATOM 2568 CA GLN A 207 -1.581 64.975 17.982 1.00 30.16 C ATOM 2569 C GLN A 207 -1.929 65.623 19.315 1.00 30.56 C ATOM 2570 O GLN A 207 -1.115 65.657 20.225 1.00 30.05 O ATOM 2571 CB GLN A 207 -1.305 65.981 16.867 1.00 29.13 C ATOM 2572 CG GLN A 207 -0.594 65.321 15.675 1.00 29.56 C ATOM 2573 CD GLN A 207 -0.085 66.302 14.590 1.00 30.08 C ATOM 2574 OE1 GLN A 207 -0.322 67.538 14.645 1.00 26.66 O ATOM 2575 NE2 GLN A 207 0.623 65.737 13.588 1.00 27.39 N ATOM 2576 HA GLN A 207 -0.638 64.441 18.099 1.00 0.00 H ATOM 2577 HB2 GLN A 207 -2.251 66.401 16.527 1.00 0.00 H ATOM 2578 HB3 GLN A 207 -0.674 66.779 17.258 1.00 0.00 H ATOM 2579 HG2 GLN A 207 0.262 64.766 16.057 1.00 0.00 H ATOM 2580 HG3 GLN A 207 -1.293 64.630 15.205 1.00 0.00 H ATOM 2581 HE22 GLN A 207 0.793 64.711 13.586 1.00 0.00 H ATOM 2582 HE21 GLN A 207 0.998 66.328 12.819 1.00 0.00 H ATOM 2583 H GLN A 207 -3.131 64.109 16.725 1.00 0.00 H ATOM 2584 N TRP A 208 -3.168 66.061 19.471 1.00 31.85 N ATOM 2585 CA TRP A 208 -3.525 66.787 20.689 1.00 33.00 C ATOM 2586 C TRP A 208 -3.315 65.936 21.941 1.00 34.81 C ATOM 2587 O TRP A 208 -2.791 66.410 22.942 1.00 34.83 O ATOM 2588 CB TRP A 208 -4.975 67.229 20.642 1.00 32.80 C ATOM 2589 CG TRP A 208 -5.401 67.925 21.892 1.00 32.42 C ATOM 2590 CD1 TRP A 208 -5.112 69.201 22.251 1.00 32.92 C ATOM 2591 CD2 TRP A 208 -6.209 67.383 22.937 1.00 31.11 C ATOM 2592 NE1 TRP A 208 -5.708 69.512 23.449 1.00 32.82 N ATOM 2593 CE2 TRP A 208 -6.386 68.405 23.899 1.00 34.24 C ATOM 2594 CE3 TRP A 208 -6.822 66.148 23.143 1.00 31.79 C ATOM 2595 CZ2 TRP A 208 -7.143 68.212 25.097 1.00 34.04 C ATOM 2596 CZ3 TRP A 208 -7.564 65.950 24.330 1.00 33.78 C ATOM 2597 CH2 TRP A 208 -7.718 66.991 25.293 1.00 33.01 C ATOM 2598 HA TRP A 208 -2.869 67.656 20.740 1.00 0.00 H ATOM 2599 HB2 TRP A 208 -5.106 67.909 19.801 1.00 0.00 H ATOM 2600 HB3 TRP A 208 -5.604 66.350 20.499 1.00 0.00 H ATOM 2601 HE1 TRP A 208 -5.655 70.431 23.934 1.00 0.00 H ATOM 2602 HD1 TRP A 208 -4.493 69.884 21.670 1.00 0.00 H ATOM 2603 HZ2 TRP A 208 -7.256 69.013 25.828 1.00 0.00 H ATOM 2604 HH2 TRP A 208 -8.302 66.809 26.195 1.00 0.00 H ATOM 2605 HZ3 TRP A 208 -8.028 64.981 24.513 1.00 0.00 H ATOM 2606 HE3 TRP A 208 -6.731 65.352 22.404 1.00 0.00 H ATOM 2607 H TRP A 208 -3.881 65.890 18.734 1.00 0.00 H ATOM 2608 N VAL A 209 -3.755 64.689 21.873 1.00 36.52 N ATOM 2609 CA VAL A 209 -3.659 63.792 23.009 1.00 38.65 C ATOM 2610 C VAL A 209 -2.207 63.461 23.335 1.00 40.45 C ATOM 2611 O VAL A 209 -1.861 63.346 24.511 1.00 41.80 O ATOM 2612 CB VAL A 209 -4.425 62.464 22.729 1.00 39.22 C ATOM 2613 CG1 VAL A 209 -4.069 61.385 23.745 1.00 39.62 C ATOM 2614 CG2 VAL A 209 -5.928 62.717 22.702 1.00 39.05 C ATOM 2615 HA VAL A 209 -4.108 64.304 23.860 1.00 0.00 H ATOM 2616 HB VAL A 209 -4.117 62.097 21.750 1.00 0.00 H ATOM 2617 HG11 VAL A 209 -2.999 61.182 23.698 1.00 0.00 H ATOM 2618 HG12 VAL A 209 -4.331 61.729 24.746 1.00 0.00 H ATOM 2619 HG13 VAL A 209 -4.623 60.475 23.516 1.00 0.00 H ATOM 2620 HG21 VAL A 209 -6.245 63.116 23.666 1.00 0.00 H ATOM 2621 HG22 VAL A 209 -6.160 63.435 21.916 1.00 0.00 H ATOM 2622 HG23 VAL A 209 -6.449 61.780 22.505 1.00 0.00 H ATOM 2623 H VAL A 209 -4.178 64.346 20.987 1.00 0.00 H ATOM 2624 N ILE A 210 -1.367 63.263 22.313 1.00 41.29 N ATOM 2625 CA ILE A 210 0.050 62.936 22.534 1.00 42.17 C ATOM 2626 C ILE A 210 0.801 64.107 23.198 1.00 43.65 C ATOM 2627 O ILE A 210 1.583 63.946 24.132 1.00 43.52 O ATOM 2628 CB ILE A 210 0.748 62.557 21.207 1.00 42.14 C ATOM 2629 CG1 ILE A 210 0.312 61.141 20.777 1.00 39.67 C ATOM 2630 CG2 ILE A 210 2.259 62.672 21.361 1.00 42.29 C ATOM 2631 CD1 ILE A 210 0.809 60.724 19.453 1.00 33.40 C ATOM 2632 HA ILE A 210 0.079 62.078 23.206 1.00 0.00 H ATOM 2633 HB ILE A 210 0.449 63.249 20.419 1.00 0.00 H ATOM 2634 HG12 ILE A 210 0.680 60.431 21.518 1.00 0.00 H ATOM 2635 HG13 ILE A 210 -0.777 61.111 20.757 1.00 0.00 H ATOM 2636 HD11 ILE A 210 0.440 61.414 18.694 1.00 0.00 H ATOM 2637 HD12 ILE A 210 1.899 60.734 19.456 1.00 0.00 H ATOM 2638 HD13 ILE A 210 0.454 59.717 19.234 1.00 0.00 H ATOM 2639 HG21 ILE A 210 2.519 63.697 21.623 1.00 0.00 H ATOM 2640 HG22 ILE A 210 2.595 61.998 22.149 1.00 0.00 H ATOM 2641 HG23 ILE A 210 2.740 62.403 20.421 1.00 0.00 H ATOM 2642 H ILE A 210 -1.724 63.342 21.339 1.00 0.00 H ATOM 2643 N GLN A 211 0.506 65.297 22.722 1.00 45.17 N ATOM 2644 CA GLN A 211 1.125 66.484 23.236 1.00 46.99 C ATOM 2645 C GLN A 211 0.702 66.823 24.650 1.00 47.89 C ATOM 2646 O GLN A 211 1.522 67.085 25.499 1.00 48.87 O ATOM 2647 CB GLN A 211 0.800 67.638 22.302 1.00 47.17 C ATOM 2648 CG GLN A 211 1.657 68.847 22.530 1.00 50.97 C ATOM 2649 CD GLN A 211 2.366 69.366 21.255 1.00 55.71 C ATOM 2650 OE1 GLN A 211 1.734 69.528 20.173 1.00 56.86 O ATOM 2651 NE2 GLN A 211 3.690 69.657 21.389 1.00 54.77 N ATOM 2652 HA GLN A 211 2.199 66.304 23.282 1.00 0.00 H ATOM 2653 HB2 GLN A 211 0.942 67.302 21.275 1.00 0.00 H ATOM 2654 HB3 GLN A 211 -0.242 67.920 22.450 1.00 0.00 H ATOM 2655 HG2 GLN A 211 1.027 69.646 22.921 1.00 0.00 H ATOM 2656 HG3 GLN A 211 2.419 68.593 23.267 1.00 0.00 H ATOM 2657 HE22 GLN A 211 4.166 69.506 22.301 1.00 0.00 H ATOM 2658 HE21 GLN A 211 4.225 70.030 20.579 1.00 0.00 H ATOM 2659 H GLN A 211 -0.192 65.379 21.955 1.00 0.00 H ATOM 2660 N GLU A 212 -0.590 66.806 24.907 1.00 49.34 N ATOM 2661 CA GLU A 212 -1.132 67.322 26.152 1.00 50.18 C ATOM 2662 C GLU A 212 -0.898 66.362 27.310 1.00 50.41 C ATOM 2663 O GLU A 212 -0.883 66.763 28.459 1.00 49.82 O ATOM 2664 CB GLU A 212 -2.627 67.557 25.966 1.00 50.55 C ATOM 2665 CG GLU A 212 -3.148 68.772 26.666 1.00 53.27 C ATOM 2666 CD GLU A 212 -2.542 70.065 26.143 1.00 56.62 C ATOM 2667 OE1 GLU A 212 -2.213 70.949 26.979 1.00 58.50 O ATOM 2668 OE2 GLU A 212 -2.389 70.192 24.898 1.00 59.48 O ATOM 2669 HA GLU A 212 -0.623 68.254 26.397 1.00 0.00 H ATOM 2670 HB2 GLU A 212 -2.826 67.664 24.900 1.00 0.00 H ATOM 2671 HB3 GLU A 212 -3.160 66.687 26.348 1.00 0.00 H ATOM 2672 HG2 GLU A 212 -4.229 68.815 26.530 1.00 0.00 H ATOM 2673 HG3 GLU A 212 -2.920 68.686 27.728 1.00 0.00 H ATOM 2674 H GLU A 212 -1.241 66.412 24.198 1.00 0.00 H ATOM 2675 N PHE A 213 -0.739 65.089 26.997 1.00 51.14 N ATOM 2676 CA PHE A 213 -0.532 64.062 28.008 1.00 52.43 C ATOM 2677 C PHE A 213 0.812 63.369 27.860 1.00 53.64 C ATOM 2678 O PHE A 213 1.003 62.309 28.462 1.00 54.41 O ATOM 2679 CB PHE A 213 -1.653 63.003 27.934 1.00 52.16 C ATOM 2680 CG PHE A 213 -3.013 63.542 28.273 1.00 51.54 C ATOM 2681 CD1 PHE A 213 -3.892 63.937 27.271 1.00 50.67 C ATOM 2682 CD2 PHE A 213 -3.404 63.678 29.596 1.00 50.93 C ATOM 2683 CE1 PHE A 213 -5.133 64.448 27.583 1.00 51.13 C ATOM 2684 CE2 PHE A 213 -4.647 64.190 29.925 1.00 51.17 C ATOM 2685 CZ PHE A 213 -5.518 64.569 28.920 1.00 51.80 C ATOM 2686 HA PHE A 213 -0.551 64.565 28.975 1.00 0.00 H ATOM 2687 HB2 PHE A 213 -1.683 62.603 26.920 1.00 0.00 H ATOM 2688 HB3 PHE A 213 -1.416 62.201 28.633 1.00 0.00 H ATOM 2689 HD2 PHE A 213 -2.721 63.377 30.390 1.00 0.00 H ATOM 2690 HE2 PHE A 213 -4.938 64.294 30.970 1.00 0.00 H ATOM 2691 HZ PHE A 213 -6.503 64.962 29.171 1.00 0.00 H ATOM 2692 HE1 PHE A 213 -5.812 64.757 26.789 1.00 0.00 H ATOM 2693 HD1 PHE A 213 -3.596 63.841 26.226 1.00 0.00 H ATOM 2694 H PHE A 213 -0.762 64.811 25.995 1.00 0.00 H ATOM 2695 N ARG A 214 1.704 63.928 27.069 1.00 54.38 N ATOM 2696 CA ARG A 214 3.013 63.343 26.846 1.00 55.73 C ATOM 2697 C ARG A 214 3.043 61.860 26.593 1.00 55.04 C ATOM 2698 O ARG A 214 3.688 61.152 27.306 1.00 55.73 O ATOM 2699 CB ARG A 214 3.894 63.625 28.025 1.00 20.00 C ATOM 2700 CG ARG A 214 4.085 65.092 28.288 1.00 20.00 C ATOM 2701 CD ARG A 214 5.246 65.320 29.229 1.00 20.00 C ATOM 2702 NE ARG A 214 5.675 66.711 29.329 1.00 20.00 N ATOM 2703 CZ ARG A 214 5.520 67.634 28.389 1.00 20.00 C ATOM 2704 NH1 ARG A 214 4.932 67.334 27.246 1.00 20.00 N ATOM 2705 NH2 ARG A 214 5.952 68.864 28.594 1.00 20.00 N ATOM 2706 HA ARG A 214 3.363 63.812 25.927 1.00 0.00 H ATOM 2707 HB2 ARG A 214 3.446 63.170 28.909 1.00 0.00 H ATOM 2708 HB3 ARG A 214 4.870 63.176 27.843 1.00 0.00 H ATOM 2709 HG2 ARG A 214 4.283 65.602 27.345 1.00 0.00 H ATOM 2710 HG3 ARG A 214 3.177 65.497 28.735 1.00 0.00 H ATOM 2711 HD2 ARG A 214 6.091 64.726 28.879 1.00 0.00 H ATOM 2712 HD3 ARG A 214 4.952 64.981 30.222 1.00 0.00 H ATOM 2713 HE ARG A 214 6.141 67.003 30.211 1.00 0.00 H ATOM 2714 HH12 ARG A 214 4.815 68.064 26.514 1.00 0.00 H ATOM 2715 HH11 ARG A 214 4.586 66.368 27.077 1.00 0.00 H ATOM 2716 HH22 ARG A 214 5.830 69.587 27.857 1.00 0.00 H ATOM 2717 HH21 ARG A 214 6.414 69.110 29.493 1.00 0.00 H ATOM 2718 H ARG A 214 1.462 64.818 26.588 1.00 0.00 H ATOM 2719 N LEU A 215 2.367 61.388 25.567 1.00 53.87 N ATOM 2720 CA LEU A 215 2.326 59.940 25.300 1.00 53.30 C ATOM 2721 C LEU A 215 3.091 59.580 24.034 1.00 52.46 C ATOM 2722 O LEU A 215 2.579 58.953 23.116 1.00 50.74 O ATOM 2723 CB LEU A 215 0.889 59.452 25.256 1.00 53.01 C ATOM 2724 CG LEU A 215 0.139 59.825 26.545 1.00 53.15 C ATOM 2725 CD1 LEU A 215 -1.372 59.797 26.348 1.00 50.03 C ATOM 2726 CD2 LEU A 215 0.565 58.955 27.740 1.00 50.63 C ATOM 2727 HA LEU A 215 2.828 59.427 26.120 1.00 0.00 H ATOM 2728 HB2 LEU A 215 0.384 59.908 24.405 1.00 0.00 H ATOM 2729 HB3 LEU A 215 0.884 58.368 25.142 1.00 0.00 H ATOM 2730 HG LEU A 215 0.420 60.851 26.782 1.00 0.00 H ATOM 2731 HD21 LEU A 215 0.357 57.908 27.518 1.00 0.00 H ATOM 2732 HD22 LEU A 215 1.632 59.084 27.920 1.00 0.00 H ATOM 2733 HD23 LEU A 215 0.007 59.258 28.626 1.00 0.00 H ATOM 2734 HD11 LEU A 215 -1.649 60.510 25.571 1.00 0.00 H ATOM 2735 HD12 LEU A 215 -1.680 58.795 26.050 1.00 0.00 H ATOM 2736 HD13 LEU A 215 -1.864 60.067 27.283 1.00 0.00 H ATOM 2737 H LEU A 215 1.858 62.043 24.940 1.00 0.00 H ATOM 2738 N TRP A 216 4.366 59.949 24.044 1.00 52.53 N ATOM 2739 CA TRP A 216 5.205 59.867 22.862 1.00 52.11 C ATOM 2740 C TRP A 216 5.848 58.482 22.622 1.00 54.27 C ATOM 2741 O TRP A 216 6.215 58.141 21.492 1.00 53.94 O ATOM 2742 CB TRP A 216 6.302 60.911 22.960 1.00 49.95 C ATOM 2743 CG TRP A 216 5.869 62.336 23.150 1.00 47.21 C ATOM 2744 CD1 TRP A 216 5.789 63.010 24.326 1.00 45.59 C ATOM 2745 CD2 TRP A 216 5.511 63.277 22.127 1.00 45.13 C ATOM 2746 NE1 TRP A 216 5.400 64.309 24.112 1.00 44.36 N ATOM 2747 CE2 TRP A 216 5.223 64.506 22.771 1.00 44.46 C ATOM 2748 CE3 TRP A 216 5.398 63.200 20.730 1.00 44.31 C ATOM 2749 CZ2 TRP A 216 4.837 65.654 22.064 1.00 44.44 C ATOM 2750 CZ3 TRP A 216 4.984 64.338 20.023 1.00 44.43 C ATOM 2751 CH2 TRP A 216 4.709 65.546 20.692 1.00 44.90 C ATOM 2752 HA TRP A 216 4.546 60.045 22.012 1.00 0.00 H ATOM 2753 HB2 TRP A 216 6.936 60.644 23.805 1.00 0.00 H ATOM 2754 HB3 TRP A 216 6.885 60.864 22.040 1.00 0.00 H ATOM 2755 HE1 TRP A 216 5.262 65.028 24.851 1.00 0.00 H ATOM 2756 HD1 TRP A 216 6.004 62.579 25.304 1.00 0.00 H ATOM 2757 HZ2 TRP A 216 4.645 66.596 22.577 1.00 0.00 H ATOM 2758 HH2 TRP A 216 4.388 66.414 20.116 1.00 0.00 H ATOM 2759 HZ3 TRP A 216 4.873 64.287 18.940 1.00 0.00 H ATOM 2760 HE3 TRP A 216 5.628 62.273 20.205 1.00 0.00 H ATOM 2761 H TRP A 216 4.778 60.309 24.928 1.00 0.00 H ATOM 2762 N ASP A 217 5.953 57.679 23.672 1.00 56.29 N ATOM 2763 CA ASP A 217 6.889 56.569 23.681 1.00 58.19 C ATOM 2764 C ASP A 217 6.668 55.510 22.613 1.00 58.30 C ATOM 2765 O ASP A 217 7.620 54.854 22.213 1.00 58.77 O ATOM 2766 CB ASP A 217 6.889 55.905 25.061 1.00 59.48 C ATOM 2767 CG ASP A 217 7.416 56.834 26.162 1.00 60.06 C ATOM 2768 OD1 ASP A 217 7.405 56.443 27.343 1.00 61.27 O ATOM 2769 OD2 ASP A 217 7.830 57.963 25.848 1.00 61.20 O ATOM 2770 HA ASP A 217 7.855 57.016 23.446 1.00 0.00 H ATOM 2771 HB2 ASP A 217 5.868 55.613 25.309 1.00 0.00 H ATOM 2772 HB3 ASP A 217 7.520 55.017 25.022 1.00 0.00 H ATOM 2773 H ASP A 217 5.354 57.847 24.505 1.00 0.00 H ATOM 2774 N ASN A 218 5.429 55.325 22.167 1.00 57.82 N ATOM 2775 CA ASN A 218 5.089 54.251 21.207 1.00 57.07 C ATOM 2776 C ASN A 218 4.573 54.748 19.862 1.00 55.55 C ATOM 2777 O ASN A 218 4.152 53.942 19.021 1.00 55.43 O ATOM 2778 CB ASN A 218 4.032 53.316 21.806 1.00 57.24 C ATOM 2779 CG ASN A 218 4.569 52.497 22.960 1.00 58.23 C ATOM 2780 OD1 ASN A 218 4.414 52.874 24.115 1.00 58.06 O ATOM 2781 ND2 ASN A 218 5.218 51.381 22.651 1.00 57.80 N ATOM 2782 HA ASN A 218 6.029 53.731 21.022 1.00 0.00 H ATOM 2783 HB2 ASN A 218 3.196 53.917 22.163 1.00 0.00 H ATOM 2784 HB3 ASN A 218 3.684 52.637 21.027 1.00 0.00 H ATOM 2785 HD22 ASN A 218 5.325 51.100 21.655 1.00 0.00 H ATOM 2786 HD21 ASN A 218 5.619 50.787 23.405 1.00 0.00 H ATOM 2787 H ASN A 218 4.674 55.956 22.504 1.00 0.00 H ATOM 2788 N GLU A 219 4.592 56.056 19.642 1.00 53.61 N ATOM 2789 CA GLU A 219 3.965 56.573 18.448 1.00 52.61 C ATOM 2790 C GLU A 219 4.757 56.201 17.199 1.00 52.08 C ATOM 2791 O GLU A 219 4.200 55.844 16.181 1.00 50.52 O ATOM 2792 CB GLU A 219 3.759 58.090 18.550 1.00 52.25 C ATOM 2793 CG GLU A 219 3.010 58.712 17.350 1.00 51.09 C ATOM 2794 CD GLU A 219 1.545 58.249 17.175 1.00 49.80 C ATOM 2795 OE1 GLU A 219 1.101 57.267 17.806 1.00 48.49 O ATOM 2796 OE2 GLU A 219 0.833 58.884 16.369 1.00 49.49 O ATOM 2797 HA GLU A 219 2.983 56.109 18.359 1.00 0.00 H ATOM 2798 HB2 GLU A 219 3.187 58.297 19.454 1.00 0.00 H ATOM 2799 HB3 GLU A 219 4.738 58.564 18.624 1.00 0.00 H ATOM 2800 HG2 GLU A 219 3.009 59.795 17.478 1.00 0.00 H ATOM 2801 HG3 GLU A 219 3.556 58.455 16.442 1.00 0.00 H ATOM 2802 H GLU A 219 5.051 56.699 20.318 1.00 0.00 H ATOM 2803 N LEU A 220 6.072 56.244 17.311 1.00 52.91 N ATOM 2804 CA LEU A 220 6.928 56.009 16.161 1.00 52.94 C ATOM 2805 C LEU A 220 6.764 54.592 15.657 1.00 52.84 C ATOM 2806 O LEU A 220 6.854 54.356 14.468 1.00 52.78 O ATOM 2807 CB LEU A 220 8.373 56.342 16.515 1.00 53.17 C ATOM 2808 CG LEU A 220 9.433 56.394 15.411 1.00 54.14 C ATOM 2809 CD1 LEU A 220 8.845 56.760 14.039 1.00 55.93 C ATOM 2810 CD2 LEU A 220 10.535 57.382 15.809 1.00 53.31 C ATOM 2811 HA LEU A 220 6.632 56.667 15.344 1.00 0.00 H ATOM 2812 HB2 LEU A 220 8.364 57.322 16.991 1.00 0.00 H ATOM 2813 HB3 LEU A 220 8.703 55.593 17.235 1.00 0.00 H ATOM 2814 HG LEU A 220 9.852 55.393 15.307 1.00 0.00 H ATOM 2815 HD21 LEU A 220 10.101 58.373 15.945 1.00 0.00 H ATOM 2816 HD22 LEU A 220 10.995 57.055 16.741 1.00 0.00 H ATOM 2817 HD23 LEU A 220 11.289 57.419 15.023 1.00 0.00 H ATOM 2818 HD11 LEU A 220 8.102 56.016 13.753 1.00 0.00 H ATOM 2819 HD12 LEU A 220 8.375 57.742 14.097 1.00 0.00 H ATOM 2820 HD13 LEU A 220 9.643 56.781 13.297 1.00 0.00 H ATOM 2821 H LEU A 220 6.501 56.449 18.236 1.00 0.00 H ATOM 2822 N GLN A 221 6.476 53.657 16.539 1.00 53.24 N ATOM 2823 CA GLN A 221 6.221 52.288 16.093 1.00 55.21 C ATOM 2824 C GLN A 221 4.907 52.200 15.325 1.00 53.71 C ATOM 2825 O GLN A 221 4.798 51.468 14.344 1.00 53.30 O ATOM 2826 CB GLN A 221 6.143 51.280 17.251 1.00 55.82 C ATOM 2827 CG GLN A 221 6.942 51.618 18.481 1.00 58.29 C ATOM 2828 CD GLN A 221 6.697 50.631 19.599 1.00 59.51 C ATOM 2829 OE1 GLN A 221 7.125 50.850 20.748 1.00 60.12 O ATOM 2830 NE2 GLN A 221 5.975 49.536 19.278 1.00 62.23 N ATOM 2831 HA GLN A 221 7.068 52.032 15.457 1.00 0.00 H ATOM 2832 HB2 GLN A 221 5.097 51.193 17.547 1.00 0.00 H ATOM 2833 HB3 GLN A 221 6.495 50.318 16.879 1.00 0.00 H ATOM 2834 HG2 GLN A 221 8.002 51.608 18.227 1.00 0.00 H ATOM 2835 HG3 GLN A 221 6.661 52.614 18.822 1.00 0.00 H ATOM 2836 HE22 GLN A 221 5.641 49.401 18.302 1.00 0.00 H ATOM 2837 HE21 GLN A 221 5.753 48.828 20.006 1.00 0.00 H ATOM 2838 H GLN A 221 6.430 53.892 17.551 1.00 0.00 H ATOM 2839 N TYR A 222 3.900 52.914 15.823 1.00 52.53 N ATOM 2840 CA TYR A 222 2.631 53.059 15.130 1.00 51.06 C ATOM 2841 C TYR A 222 2.890 53.670 13.747 1.00 50.73 C ATOM 2842 O TYR A 222 2.495 53.099 12.719 1.00 50.38 O ATOM 2843 CB TYR A 222 1.660 53.931 15.968 1.00 49.75 C ATOM 2844 CG TYR A 222 0.274 54.024 15.398 1.00 47.43 C ATOM 2845 CD1 TYR A 222 -0.534 52.898 15.353 1.00 46.26 C ATOM 2846 CD2 TYR A 222 -0.228 55.241 14.886 1.00 47.11 C ATOM 2847 CE1 TYR A 222 -1.796 52.950 14.808 1.00 47.58 C ATOM 2848 CE2 TYR A 222 -1.506 55.312 14.345 1.00 46.29 C ATOM 2849 CZ TYR A 222 -2.279 54.151 14.298 1.00 46.94 C ATOM 2850 OH TYR A 222 -3.534 54.145 13.777 1.00 44.98 O ATOM 2851 HA TYR A 222 2.160 52.085 14.999 1.00 0.00 H ATOM 2852 HB3 TYR A 222 2.072 54.938 16.033 1.00 0.00 H ATOM 2853 HB2 TYR A 222 1.591 53.503 16.968 1.00 0.00 H ATOM 2854 HD2 TYR A 222 0.395 56.135 14.916 1.00 0.00 H ATOM 2855 HE2 TYR A 222 -1.897 56.256 13.965 1.00 0.00 H ATOM 2856 HE1 TYR A 222 -2.415 52.054 14.776 1.00 0.00 H ATOM 2857 HD1 TYR A 222 -0.163 51.956 15.756 1.00 0.00 H ATOM 2858 HH TYR A 222 -3.910 53.231 13.837 1.00 0.00 H ATOM 2859 H TYR A 222 4.026 53.385 16.742 1.00 0.00 H ATOM 2860 N VAL A 223 3.591 54.801 13.721 1.00 50.27 N ATOM 2861 CA VAL A 223 3.960 55.405 12.456 1.00 50.58 C ATOM 2862 C VAL A 223 4.548 54.344 11.527 1.00 51.98 C ATOM 2863 O VAL A 223 4.165 54.262 10.381 1.00 52.20 O ATOM 2864 CB VAL A 223 4.919 56.588 12.615 1.00 50.31 C ATOM 2865 CG1 VAL A 223 5.377 57.071 11.269 1.00 49.30 C ATOM 2866 CG2 VAL A 223 4.246 57.727 13.360 1.00 48.74 C ATOM 2867 HA VAL A 223 3.051 55.812 12.013 1.00 0.00 H ATOM 2868 HB VAL A 223 5.781 56.250 13.190 1.00 0.00 H ATOM 2869 HG11 VAL A 223 5.891 56.262 10.750 1.00 0.00 H ATOM 2870 HG12 VAL A 223 4.513 57.388 10.685 1.00 0.00 H ATOM 2871 HG13 VAL A 223 6.058 57.912 11.399 1.00 0.00 H ATOM 2872 HG21 VAL A 223 3.369 58.056 12.803 1.00 0.00 H ATOM 2873 HG22 VAL A 223 3.942 57.383 14.349 1.00 0.00 H ATOM 2874 HG23 VAL A 223 4.946 58.557 13.461 1.00 0.00 H ATOM 2875 H VAL A 223 3.876 55.254 14.613 1.00 0.00 H ATOM 2876 N ASP A 224 5.432 53.492 12.020 1.00 53.67 N ATOM 2877 CA ASP A 224 6.039 52.479 11.160 1.00 55.16 C ATOM 2878 C ASP A 224 5.091 51.405 10.691 1.00 55.53 C ATOM 2879 O ASP A 224 5.244 50.871 9.595 1.00 55.32 O ATOM 2880 CB ASP A 224 7.229 51.830 11.858 1.00 56.30 C ATOM 2881 CG ASP A 224 8.438 52.748 11.932 1.00 57.65 C ATOM 2882 OD1 ASP A 224 8.566 53.667 11.097 1.00 59.04 O ATOM 2883 OD2 ASP A 224 9.271 52.541 12.836 1.00 59.22 O ATOM 2884 HA ASP A 224 6.359 53.018 10.268 1.00 0.00 H ATOM 2885 HB2 ASP A 224 6.934 51.559 12.872 1.00 0.00 H ATOM 2886 HB3 ASP A 224 7.507 50.930 11.309 1.00 0.00 H ATOM 2887 H ASP A 224 5.696 53.544 13.025 1.00 0.00 H ATOM 2888 N GLN A 225 4.133 51.051 11.526 1.00 56.23 N ATOM 2889 CA GLN A 225 3.199 50.001 11.164 1.00 56.74 C ATOM 2890 C GLN A 225 2.360 50.478 9.973 1.00 55.04 C ATOM 2891 O GLN A 225 2.120 49.709 9.031 1.00 54.38 O ATOM 2892 CB GLN A 225 2.307 49.631 12.359 1.00 57.43 C ATOM 2893 CG GLN A 225 1.470 48.344 12.139 1.00 59.75 C ATOM 2894 CD GLN A 225 0.044 48.425 12.722 1.00 63.22 C ATOM 2895 OE1 GLN A 225 -0.161 48.382 13.959 1.00 66.52 O ATOM 2896 NE2 GLN A 225 -0.952 48.539 11.826 1.00 62.48 N ATOM 2897 HA GLN A 225 3.747 49.102 10.881 1.00 0.00 H ATOM 2898 HB2 GLN A 225 2.944 49.482 13.231 1.00 0.00 H ATOM 2899 HB3 GLN A 225 1.623 50.458 12.547 1.00 0.00 H ATOM 2900 HG2 GLN A 225 1.394 48.161 11.067 1.00 0.00 H ATOM 2901 HG3 GLN A 225 1.989 47.510 12.612 1.00 0.00 H ATOM 2902 HE22 GLN A 225 -0.736 48.571 10.809 1.00 0.00 H ATOM 2903 HE21 GLN A 225 -1.939 48.595 12.150 1.00 0.00 H ATOM 2904 H GLN A 225 4.047 51.526 12.447 1.00 0.00 H ATOM 2905 N LEU A 226 1.942 51.750 10.016 1.00 52.93 N ATOM 2906 CA LEU A 226 1.073 52.309 8.977 1.00 51.43 C ATOM 2907 C LEU A 226 1.840 52.591 7.713 1.00 50.47 C ATOM 2908 O LEU A 226 1.311 52.396 6.612 1.00 49.46 O ATOM 2909 CB LEU A 226 0.351 53.584 9.434 1.00 50.59 C ATOM 2910 CG LEU A 226 -0.652 53.483 10.596 1.00 50.27 C ATOM 2911 CD1 LEU A 226 -1.527 54.715 10.681 1.00 47.29 C ATOM 2912 CD2 LEU A 226 -1.496 52.261 10.521 1.00 50.43 C ATOM 2913 HA LEU A 226 0.318 51.549 8.777 1.00 0.00 H ATOM 2914 HB2 LEU A 226 1.118 54.299 9.732 1.00 0.00 H ATOM 2915 HB3 LEU A 226 -0.192 53.973 8.573 1.00 0.00 H ATOM 2916 HG LEU A 226 -0.054 53.413 11.504 1.00 0.00 H ATOM 2917 HD21 LEU A 226 -2.063 52.269 9.590 1.00 0.00 H ATOM 2918 HD22 LEU A 226 -0.858 51.378 10.552 1.00 0.00 H ATOM 2919 HD23 LEU A 226 -2.184 52.244 11.366 1.00 0.00 H ATOM 2920 HD11 LEU A 226 -0.901 55.593 10.840 1.00 0.00 H ATOM 2921 HD12 LEU A 226 -2.085 54.828 9.751 1.00 0.00 H ATOM 2922 HD13 LEU A 226 -2.223 54.608 11.513 1.00 0.00 H ATOM 2923 H LEU A 226 2.242 52.356 10.806 1.00 0.00 H ATOM 2924 N LEU A 227 3.079 53.051 7.854 1.00 50.13 N ATOM 2925 CA LEU A 227 3.888 53.320 6.664 1.00 50.00 C ATOM 2926 C LEU A 227 4.110 52.037 5.940 1.00 51.31 C ATOM 2927 O LEU A 227 4.252 52.050 4.738 1.00 51.08 O ATOM 2928 CB LEU A 227 5.215 53.976 6.986 1.00 49.01 C ATOM 2929 CG LEU A 227 5.196 55.487 7.143 1.00 46.05 C ATOM 2930 CD1 LEU A 227 6.615 55.916 7.367 1.00 44.67 C ATOM 2931 CD2 LEU A 227 4.620 56.204 5.958 1.00 42.22 C ATOM 2932 HA LEU A 227 3.342 54.028 6.040 1.00 0.00 H ATOM 2933 HB2 LEU A 227 5.579 53.549 7.920 1.00 0.00 H ATOM 2934 HB3 LEU A 227 5.910 53.734 6.182 1.00 0.00 H ATOM 2935 HG LEU A 227 4.549 55.746 7.981 1.00 0.00 H ATOM 2936 HD21 LEU A 227 5.213 55.974 5.073 1.00 0.00 H ATOM 2937 HD22 LEU A 227 3.591 55.878 5.803 1.00 0.00 H ATOM 2938 HD23 LEU A 227 4.639 57.278 6.141 1.00 0.00 H ATOM 2939 HD11 LEU A 227 7.000 55.437 8.267 1.00 0.00 H ATOM 2940 HD12 LEU A 227 7.221 55.623 6.510 1.00 0.00 H ATOM 2941 HD13 LEU A 227 6.651 56.999 7.486 1.00 0.00 H ATOM 2942 H LEU A 227 3.471 53.219 8.803 1.00 0.00 H ATOM 2943 N LYS A 228 4.110 50.932 6.687 1.00 53.18 N ATOM 2944 CA LYS A 228 4.230 49.588 6.129 1.00 54.86 C ATOM 2945 C LYS A 228 2.970 49.251 5.334 1.00 54.46 C ATOM 2946 O LYS A 228 3.042 48.825 4.166 1.00 54.13 O ATOM 2947 CB LYS A 228 4.427 48.600 7.277 1.00 56.50 C ATOM 2948 CG LYS A 228 4.975 47.225 6.931 1.00 59.87 C ATOM 2949 CD LYS A 228 6.019 46.776 7.999 1.00 63.88 C ATOM 2950 CE LYS A 228 6.918 45.640 7.487 1.00 66.74 C ATOM 2951 NZ LYS A 228 7.392 45.889 6.077 1.00 66.92 N ATOM 2952 HA LYS A 228 5.085 49.530 5.455 1.00 0.00 H ATOM 2953 HB2 LYS A 228 5.116 49.057 7.988 1.00 0.00 H ATOM 2954 HB3 LYS A 228 3.458 48.455 7.754 1.00 0.00 H ATOM 2955 HG2 LYS A 228 4.155 46.507 6.904 1.00 0.00 H ATOM 2956 HG3 LYS A 228 5.454 47.264 5.953 1.00 0.00 H ATOM 2957 HD2 LYS A 228 6.645 47.630 8.260 1.00 0.00 H ATOM 2958 HD3 LYS A 228 5.488 46.432 8.887 1.00 0.00 H ATOM 2959 HE2 LYS A 228 6.355 44.707 7.510 1.00 0.00 H ATOM 2960 HE3 LYS A 228 7.786 45.555 8.141 1.00 0.00 H ATOM 2961 HZ1 LYS A 228 6.570 45.965 5.444 1.00 0.00 H ATOM 2962 HZ2 LYS A 228 7.937 46.775 6.047 1.00 0.00 H ATOM 2963 HZ3 LYS A 228 7.995 45.099 5.771 1.00 0.00 H ATOM 2964 H LYS A 228 4.020 51.033 7.718 1.00 0.00 H ATOM 2965 N GLU A 229 1.819 49.467 5.978 1.00 53.44 N ATOM 2966 CA GLU A 229 0.495 49.315 5.351 1.00 52.95 C ATOM 2967 C GLU A 229 0.273 50.172 4.087 1.00 50.67 C ATOM 2968 O GLU A 229 -0.259 49.676 3.082 1.00 50.12 O ATOM 2969 CB GLU A 229 -0.613 49.626 6.375 1.00 53.15 C ATOM 2970 CG GLU A 229 -0.915 48.457 7.325 1.00 55.30 C ATOM 2971 CD GLU A 229 -1.721 48.843 8.563 1.00 55.07 C ATOM 2972 OE1 GLU A 229 -1.820 47.985 9.462 1.00 58.40 O ATOM 2973 OE2 GLU A 229 -2.244 49.978 8.639 1.00 54.51 O ATOM 2974 HA GLU A 229 0.452 48.276 5.023 1.00 0.00 H ATOM 2975 HB2 GLU A 229 -0.301 50.484 6.971 1.00 0.00 H ATOM 2976 HB3 GLU A 229 -1.525 49.874 5.832 1.00 0.00 H ATOM 2977 HG2 GLU A 229 -1.478 47.705 6.772 1.00 0.00 H ATOM 2978 HG3 GLU A 229 0.033 48.031 7.654 1.00 0.00 H ATOM 2979 H GLU A 229 1.860 49.758 6.976 1.00 0.00 H ATOM 2980 N ASP A 230 0.642 51.456 4.159 1.00 48.03 N ATOM 2981 CA ASP A 230 0.537 52.344 3.005 1.00 45.68 C ATOM 2982 C ASP A 230 1.622 53.404 3.017 1.00 44.26 C ATOM 2983 O ASP A 230 1.495 54.450 3.657 1.00 43.90 O ATOM 2984 CB ASP A 230 -0.844 52.989 2.905 1.00 44.75 C ATOM 2985 CG ASP A 230 -1.055 53.727 1.579 1.00 43.28 C ATOM 2986 OD1 ASP A 230 -0.070 54.127 0.921 1.00 37.18 O ATOM 2987 OD2 ASP A 230 -2.236 53.907 1.195 1.00 45.64 O ATOM 2988 HA ASP A 230 0.678 51.724 2.119 1.00 0.00 H ATOM 2989 HB2 ASP A 230 -1.601 52.210 2.996 1.00 0.00 H ATOM 2990 HB3 ASP A 230 -0.957 53.701 3.723 1.00 0.00 H ATOM 2991 H ASP A 230 1.012 51.830 5.056 1.00 0.00 H ATOM 2992 N VAL A 231 2.667 53.153 2.236 1.00 43.14 N ATOM 2993 CA VAL A 231 3.836 54.026 2.241 1.00 42.04 C ATOM 2994 C VAL A 231 3.566 55.371 1.575 1.00 40.62 C ATOM 2995 O VAL A 231 4.390 56.282 1.690 1.00 39.77 O ATOM 2996 CB VAL A 231 5.138 53.307 1.680 1.00 42.57 C ATOM 2997 CG1 VAL A 231 4.992 52.895 0.213 1.00 41.10 C ATOM 2998 CG2 VAL A 231 6.369 54.186 1.936 1.00 40.94 C ATOM 2999 HA VAL A 231 4.046 54.248 3.287 1.00 0.00 H ATOM 3000 HB VAL A 231 5.277 52.372 2.222 1.00 0.00 H ATOM 3001 HG11 VAL A 231 4.156 52.203 0.113 1.00 0.00 H ATOM 3002 HG12 VAL A 231 4.808 53.781 -0.395 1.00 0.00 H ATOM 3003 HG13 VAL A 231 5.909 52.409 -0.119 1.00 0.00 H ATOM 3004 HG21 VAL A 231 6.241 55.144 1.433 1.00 0.00 H ATOM 3005 HG22 VAL A 231 6.481 54.349 3.008 1.00 0.00 H ATOM 3006 HG23 VAL A 231 7.257 53.687 1.549 1.00 0.00 H ATOM 3007 H VAL A 231 2.652 52.322 1.612 1.00 0.00 H ATOM 3008 N ARG A 232 2.405 55.497 0.916 1.00 39.58 N ATOM 3009 CA ARG A 232 1.996 56.753 0.289 1.00 38.35 C ATOM 3010 C ARG A 232 1.052 57.576 1.183 1.00 37.51 C ATOM 3011 O ARG A 232 0.444 58.582 0.730 1.00 37.89 O ATOM 3012 CB ARG A 232 1.289 56.501 -1.044 1.00 38.64 C ATOM 3013 CG ARG A 232 2.001 55.602 -2.072 1.00 39.73 C ATOM 3014 CD ARG A 232 1.172 55.487 -3.345 1.00 39.70 C ATOM 3015 NE ARG A 232 1.906 54.955 -4.490 1.00 41.39 N ATOM 3016 CZ ARG A 232 2.056 53.655 -4.750 1.00 43.88 C ATOM 3017 NH1 ARG A 232 1.554 52.727 -3.923 1.00 43.38 N ATOM 3018 NH2 ARG A 232 2.715 53.281 -5.840 1.00 43.91 N ATOM 3019 HA ARG A 232 2.915 57.317 0.129 1.00 0.00 H ATOM 3020 HB2 ARG A 232 0.326 56.042 -0.821 1.00 0.00 H ATOM 3021 HB3 ARG A 232 1.127 57.470 -1.515 1.00 0.00 H ATOM 3022 HG2 ARG A 232 2.972 56.033 -2.314 1.00 0.00 H ATOM 3023 HG3 ARG A 232 2.142 54.609 -1.644 1.00 0.00 H ATOM 3024 HD2 ARG A 232 0.805 56.480 -3.605 1.00 0.00 H ATOM 3025 HD3 ARG A 232 0.326 54.829 -3.145 1.00 0.00 H ATOM 3026 HE ARG A 232 2.341 55.635 -5.146 1.00 0.00 H ATOM 3027 HH12 ARG A 232 1.678 51.717 -4.138 1.00 0.00 H ATOM 3028 HH11 ARG A 232 1.040 53.017 -3.067 1.00 0.00 H ATOM 3029 HH22 ARG A 232 2.838 52.270 -6.052 1.00 0.00 H ATOM 3030 HH21 ARG A 232 3.109 53.999 -6.482 1.00 0.00 H ATOM 3031 H ARG A 232 1.774 54.673 0.849 1.00 0.00 H ATOM 3032 N ASN A 233 0.899 57.187 2.446 1.00 36.26 N ATOM 3033 CA ASN A 233 -0.019 57.942 3.302 1.00 34.44 C ATOM 3034 C ASN A 233 0.699 59.131 3.888 1.00 33.68 C ATOM 3035 O ASN A 233 1.442 58.997 4.873 1.00 34.47 O ATOM 3036 CB ASN A 233 -0.567 57.056 4.389 1.00 34.60 C ATOM 3037 CG ASN A 233 -1.641 57.715 5.179 1.00 33.36 C ATOM 3038 OD1 ASN A 233 -1.738 58.937 5.209 1.00 33.15 O ATOM 3039 ND2 ASN A 233 -2.467 56.906 5.834 1.00 30.57 N ATOM 3040 HA ASN A 233 -0.858 58.300 2.705 1.00 0.00 H ATOM 3041 HB2 ASN A 233 -0.973 56.154 3.932 1.00 0.00 H ATOM 3042 HB3 ASN A 233 0.246 56.786 5.063 1.00 0.00 H ATOM 3043 HD22 ASN A 233 -2.341 55.875 5.775 1.00 0.00 H ATOM 3044 HD21 ASN A 233 -3.240 57.303 6.406 1.00 0.00 H ATOM 3045 H ASN A 233 1.419 56.366 2.817 1.00 0.00 H ATOM 3046 N ASN A 234 0.470 60.296 3.282 1.00 32.16 N ATOM 3047 CA ASN A 234 1.103 61.553 3.697 1.00 30.83 C ATOM 3048 C ASN A 234 0.780 61.960 5.127 1.00 30.85 C ATOM 3049 O ASN A 234 1.492 62.758 5.748 1.00 31.35 O ATOM 3050 CB ASN A 234 0.655 62.675 2.767 1.00 30.38 C ATOM 3051 CG ASN A 234 1.561 63.873 2.835 1.00 31.12 C ATOM 3052 OD1 ASN A 234 2.724 63.785 2.428 1.00 34.10 O ATOM 3053 ND2 ASN A 234 1.050 65.005 3.343 1.00 28.74 N ATOM 3054 HA ASN A 234 2.179 61.385 3.643 1.00 0.00 H ATOM 3055 HB2 ASN A 234 0.647 62.300 1.744 1.00 0.00 H ATOM 3056 HB3 ASN A 234 -0.353 62.982 3.048 1.00 0.00 H ATOM 3057 HD22 ASN A 234 0.064 65.028 3.673 1.00 0.00 H ATOM 3058 HD21 ASN A 234 1.640 65.859 3.407 1.00 0.00 H ATOM 3059 H ASN A 234 -0.188 60.315 2.477 1.00 0.00 H ATOM 3060 N SER A 235 -0.340 61.477 5.630 1.00 30.94 N ATOM 3061 CA SER A 235 -0.718 61.755 6.993 1.00 31.78 C ATOM 3062 C SER A 235 0.299 61.092 7.946 1.00 31.96 C ATOM 3063 O SER A 235 0.711 61.672 8.961 1.00 31.89 O ATOM 3064 CB SER A 235 -2.147 61.228 7.252 1.00 32.23 C ATOM 3065 OG SER A 235 -3.110 61.856 6.389 1.00 33.38 O ATOM 3066 HA SER A 235 -0.714 62.830 7.172 1.00 0.00 H ATOM 3067 HB2 SER A 235 -2.416 61.431 8.289 1.00 0.00 H ATOM 3068 HB3 SER A 235 -2.164 60.152 7.077 1.00 0.00 H ATOM 3069 HG SER A 235 -2.875 61.671 5.445 1.00 0.00 H ATOM 3070 H SER A 235 -0.958 60.888 5.036 1.00 0.00 H ATOM 3071 N VAL A 236 0.700 59.882 7.601 1.00 32.19 N ATOM 3072 CA VAL A 236 1.647 59.148 8.418 1.00 32.74 C ATOM 3073 C VAL A 236 3.077 59.761 8.324 1.00 34.17 C ATOM 3074 O VAL A 236 3.793 59.825 9.337 1.00 34.85 O ATOM 3075 CB VAL A 236 1.676 57.685 8.019 1.00 32.83 C ATOM 3076 CG1 VAL A 236 2.627 56.926 8.927 1.00 32.41 C ATOM 3077 CG2 VAL A 236 0.228 57.094 8.040 1.00 30.73 C ATOM 3078 HA VAL A 236 1.316 59.224 9.454 1.00 0.00 H ATOM 3079 HB VAL A 236 2.047 57.584 6.999 1.00 0.00 H ATOM 3080 HG11 VAL A 236 3.628 57.346 8.835 1.00 0.00 H ATOM 3081 HG12 VAL A 236 2.289 57.013 9.959 1.00 0.00 H ATOM 3082 HG13 VAL A 236 2.644 55.876 8.636 1.00 0.00 H ATOM 3083 HG21 VAL A 236 -0.185 57.184 9.045 1.00 0.00 H ATOM 3084 HG22 VAL A 236 -0.398 57.645 7.338 1.00 0.00 H ATOM 3085 HG23 VAL A 236 0.262 56.043 7.752 1.00 0.00 H ATOM 3086 H VAL A 236 0.331 59.449 6.730 1.00 0.00 H ATOM 3087 N TRP A 237 3.483 60.217 7.132 1.00 34.60 N ATOM 3088 CA TRP A 237 4.760 60.916 6.981 1.00 34.93 C ATOM 3089 C TRP A 237 4.747 62.173 7.834 1.00 34.21 C ATOM 3090 O TRP A 237 5.775 62.584 8.412 1.00 35.30 O ATOM 3091 CB TRP A 237 5.064 61.270 5.497 1.00 36.13 C ATOM 3092 CG TRP A 237 5.471 60.079 4.699 1.00 36.79 C ATOM 3093 CD1 TRP A 237 4.671 59.323 3.903 1.00 38.77 C ATOM 3094 CD2 TRP A 237 6.754 59.479 4.661 1.00 38.09 C ATOM 3095 NE1 TRP A 237 5.375 58.282 3.356 1.00 39.14 N ATOM 3096 CE2 TRP A 237 6.666 58.356 3.801 1.00 40.12 C ATOM 3097 CE3 TRP A 237 7.984 59.775 5.272 1.00 40.22 C ATOM 3098 CZ2 TRP A 237 7.760 57.518 3.539 1.00 38.77 C ATOM 3099 CZ3 TRP A 237 9.070 58.954 5.000 1.00 39.41 C ATOM 3100 CH2 TRP A 237 8.947 57.835 4.131 1.00 38.69 C ATOM 3101 HA TRP A 237 5.553 60.248 7.316 1.00 0.00 H ATOM 3102 HB2 TRP A 237 4.169 61.702 5.050 1.00 0.00 H ATOM 3103 HB3 TRP A 237 5.871 62.002 5.470 1.00 0.00 H ATOM 3104 HE1 TRP A 237 4.993 57.560 2.713 1.00 0.00 H ATOM 3105 HD1 TRP A 237 3.614 59.518 3.724 1.00 0.00 H ATOM 3106 HZ2 TRP A 237 7.665 56.649 2.888 1.00 0.00 H ATOM 3107 HH2 TRP A 237 9.822 57.216 3.933 1.00 0.00 H ATOM 3108 HZ3 TRP A 237 10.034 59.171 5.461 1.00 0.00 H ATOM 3109 HE3 TRP A 237 8.083 60.628 5.943 1.00 0.00 H ATOM 3110 H TRP A 237 2.879 60.072 6.298 1.00 0.00 H ATOM 3111 N ASN A 238 3.594 62.807 7.912 1.00 32.95 N ATOM 3112 CA ASN A 238 3.511 64.005 8.727 1.00 32.59 C ATOM 3113 C ASN A 238 3.601 63.616 10.192 1.00 32.87 C ATOM 3114 O ASN A 238 4.221 64.308 10.990 1.00 32.88 O ATOM 3115 CB ASN A 238 2.238 64.788 8.442 1.00 31.66 C ATOM 3116 CG ASN A 238 2.092 65.960 9.338 1.00 32.07 C ATOM 3117 OD1 ASN A 238 2.792 66.952 9.152 1.00 35.58 O ATOM 3118 ND2 ASN A 238 1.208 65.856 10.367 1.00 29.75 N ATOM 3119 HA ASN A 238 4.345 64.661 8.477 1.00 0.00 H ATOM 3120 HB2 ASN A 238 2.263 65.136 7.409 1.00 0.00 H ATOM 3121 HB3 ASN A 238 1.381 64.129 8.582 1.00 0.00 H ATOM 3122 HD22 ASN A 238 0.639 64.993 10.479 1.00 0.00 H ATOM 3123 HD21 ASN A 238 1.101 66.640 11.042 1.00 0.00 H ATOM 3124 H ASN A 238 2.760 62.456 7.400 1.00 0.00 H ATOM 3125 N GLN A 239 2.988 62.500 10.552 1.00 34.01 N ATOM 3126 CA GLN A 239 3.013 62.088 11.956 1.00 35.57 C ATOM 3127 C GLN A 239 4.455 61.774 12.349 1.00 36.58 C ATOM 3128 O GLN A 239 4.944 62.276 13.354 1.00 36.72 O ATOM 3129 CB GLN A 239 2.086 60.886 12.223 1.00 35.98 C ATOM 3130 CG GLN A 239 1.787 60.643 13.732 1.00 36.94 C ATOM 3131 CD GLN A 239 0.983 61.776 14.386 1.00 37.28 C ATOM 3132 OE1 GLN A 239 0.852 62.878 13.824 1.00 38.21 O ATOM 3133 NE2 GLN A 239 0.436 61.503 15.579 1.00 33.68 N ATOM 3134 HA GLN A 239 2.635 62.905 12.570 1.00 0.00 H ATOM 3135 HB2 GLN A 239 1.141 61.060 11.709 1.00 0.00 H ATOM 3136 HB3 GLN A 239 2.558 59.991 11.818 1.00 0.00 H ATOM 3137 HG2 GLN A 239 1.220 59.717 13.827 1.00 0.00 H ATOM 3138 HG3 GLN A 239 2.735 60.543 14.260 1.00 0.00 H ATOM 3139 HE22 GLN A 239 0.572 60.567 16.011 1.00 0.00 H ATOM 3140 HE21 GLN A 239 -0.124 62.227 16.072 1.00 0.00 H ATOM 3141 H GLN A 239 2.493 61.921 9.844 1.00 0.00 H ATOM 3142 N ARG A 240 5.131 60.995 11.510 1.00 38.06 N ATOM 3143 CA ARG A 240 6.566 60.739 11.640 1.00 39.38 C ATOM 3144 C ARG A 240 7.373 61.943 12.080 1.00 39.33 C ATOM 3145 O ARG A 240 8.180 61.883 13.038 1.00 38.62 O ATOM 3146 CB ARG A 240 7.167 60.283 10.317 1.00 40.22 C ATOM 3147 CG ARG A 240 8.276 59.277 10.586 1.00 43.95 C ATOM 3148 CD ARG A 240 9.239 58.990 9.442 1.00 49.50 C ATOM 3149 NE ARG A 240 10.358 58.314 10.064 1.00 51.38 N ATOM 3150 CZ ARG A 240 10.376 57.023 10.400 1.00 54.11 C ATOM 3151 NH1 ARG A 240 9.359 56.212 10.116 1.00 54.01 N ATOM 3152 NH2 ARG A 240 11.446 56.531 11.031 1.00 54.94 N ATOM 3153 HA ARG A 240 6.627 59.968 12.408 1.00 0.00 H ATOM 3154 HB2 ARG A 240 6.393 59.817 9.707 1.00 0.00 H ATOM 3155 HB3 ARG A 240 7.576 61.143 9.787 1.00 0.00 H ATOM 3156 HG2 ARG A 240 8.863 59.650 11.425 1.00 0.00 H ATOM 3157 HG3 ARG A 240 7.805 58.334 10.865 1.00 0.00 H ATOM 3158 HD2 ARG A 240 9.564 59.918 8.971 1.00 0.00 H ATOM 3159 HD3 ARG A 240 8.769 58.350 8.695 1.00 0.00 H ATOM 3160 HE ARG A 240 11.210 58.876 10.263 1.00 0.00 H ATOM 3161 HH12 ARG A 240 9.401 55.210 10.390 1.00 0.00 H ATOM 3162 HH11 ARG A 240 8.523 56.581 9.620 1.00 0.00 H ATOM 3163 HH22 ARG A 240 11.475 55.527 11.300 1.00 0.00 H ATOM 3164 HH21 ARG A 240 12.250 57.152 11.254 1.00 0.00 H ATOM 3165 H ARG A 240 4.616 60.547 10.725 1.00 0.00 H ATOM 3166 N HIS A 241 7.179 63.039 11.384 1.00 38.52 N ATOM 3167 CA HIS A 241 7.909 64.226 11.589 1.00 38.57 C ATOM 3168 C HIS A 241 7.485 64.922 12.804 1.00 37.95 C ATOM 3169 O HIS A 241 8.248 65.645 13.399 1.00 38.31 O ATOM 3170 CB HIS A 241 7.759 65.132 10.377 1.00 20.00 C ATOM 3171 CG HIS A 241 8.515 66.424 10.472 1.00 20.00 C ATOM 3172 ND1 HIS A 241 8.112 67.426 11.214 1.00 20.00 N ATOM 3173 CD2 HIS A 241 9.676 66.839 9.872 1.00 20.00 C ATOM 3174 CE1 HIS A 241 8.969 68.426 11.110 1.00 20.00 C ATOM 3175 NE2 HIS A 241 9.922 68.060 10.290 1.00 20.00 N ATOM 3176 HA HIS A 241 8.958 63.961 11.719 1.00 0.00 H ATOM 3177 HB2 HIS A 241 8.116 64.591 9.501 1.00 0.00 H ATOM 3178 HB3 HIS A 241 6.701 65.364 10.253 1.00 0.00 H ATOM 3179 HD2 HIS A 241 10.284 66.261 9.176 1.00 0.00 H ATOM 3180 HE1 HIS A 241 8.896 69.388 11.618 1.00 0.00 H ATOM 3181 H HIS A 241 6.449 63.030 10.643 1.00 0.00 H ATOM 3182 N PHE A 242 6.251 64.725 13.198 1.00 37.61 N ATOM 3183 CA PHE A 242 5.722 65.305 14.441 1.00 36.70 C ATOM 3184 C PHE A 242 6.352 64.615 15.667 1.00 37.69 C ATOM 3185 O PHE A 242 6.782 65.285 16.578 1.00 36.89 O ATOM 3186 CB PHE A 242 4.186 65.209 14.393 1.00 35.73 C ATOM 3187 CG PHE A 242 3.478 65.575 15.668 1.00 34.21 C ATOM 3188 CD1 PHE A 242 3.249 66.891 15.995 1.00 34.21 C ATOM 3189 CD2 PHE A 242 2.998 64.583 16.518 1.00 32.49 C ATOM 3190 CE1 PHE A 242 2.563 67.224 17.176 1.00 35.24 C ATOM 3191 CE2 PHE A 242 2.335 64.899 17.694 1.00 32.79 C ATOM 3192 CZ PHE A 242 2.107 66.214 18.015 1.00 34.41 C ATOM 3193 HA PHE A 242 5.989 66.358 14.536 1.00 0.00 H ATOM 3194 HB2 PHE A 242 3.831 65.876 13.607 1.00 0.00 H ATOM 3195 HB3 PHE A 242 3.920 64.182 14.143 1.00 0.00 H ATOM 3196 HD2 PHE A 242 3.146 63.536 16.254 1.00 0.00 H ATOM 3197 HE2 PHE A 242 1.996 64.106 18.361 1.00 0.00 H ATOM 3198 HZ PHE A 242 1.568 66.466 18.928 1.00 0.00 H ATOM 3199 HE1 PHE A 242 2.390 68.269 17.432 1.00 0.00 H ATOM 3200 HD1 PHE A 242 3.602 67.682 15.333 1.00 0.00 H ATOM 3201 H PHE A 242 5.624 64.138 12.611 1.00 0.00 H ATOM 3202 N VAL A 243 6.411 63.289 15.665 1.00 39.11 N ATOM 3203 CA VAL A 243 7.047 62.537 16.752 1.00 41.64 C ATOM 3204 C VAL A 243 8.538 62.914 16.938 1.00 43.37 C ATOM 3205 O VAL A 243 8.952 63.415 17.994 1.00 44.11 O ATOM 3206 CB VAL A 243 6.978 61.021 16.488 1.00 41.82 C ATOM 3207 CG1 VAL A 243 7.702 60.233 17.600 1.00 41.59 C ATOM 3208 CG2 VAL A 243 5.531 60.577 16.339 1.00 41.66 C ATOM 3209 HA VAL A 243 6.495 62.797 17.655 1.00 0.00 H ATOM 3210 HB VAL A 243 7.494 60.807 15.552 1.00 0.00 H ATOM 3211 HG11 VAL A 243 8.749 60.535 17.635 1.00 0.00 H ATOM 3212 HG12 VAL A 243 7.229 60.443 18.559 1.00 0.00 H ATOM 3213 HG13 VAL A 243 7.638 59.166 17.388 1.00 0.00 H ATOM 3214 HG21 VAL A 243 4.986 60.805 17.255 1.00 0.00 H ATOM 3215 HG22 VAL A 243 5.074 61.106 15.502 1.00 0.00 H ATOM 3216 HG23 VAL A 243 5.499 59.503 16.153 1.00 0.00 H ATOM 3217 H VAL A 243 5.993 62.767 14.868 1.00 0.00 H ATOM 3218 N ILE A 244 9.313 62.704 15.874 1.00 44.85 N ATOM 3219 CA ILE A 244 10.761 62.928 15.872 1.00 45.55 C ATOM 3220 C ILE A 244 11.015 64.359 16.268 1.00 46.50 C ATOM 3221 O ILE A 244 11.771 64.624 17.227 1.00 47.84 O ATOM 3222 CB ILE A 244 11.408 62.638 14.507 1.00 45.14 C ATOM 3223 CG1 ILE A 244 11.300 61.159 14.169 1.00 44.78 C ATOM 3224 CG2 ILE A 244 12.852 63.027 14.507 1.00 44.36 C ATOM 3225 CD1 ILE A 244 11.771 60.852 12.775 1.00 46.01 C ATOM 3226 HA ILE A 244 11.215 62.236 16.581 1.00 0.00 H ATOM 3227 HB ILE A 244 10.876 63.226 13.760 1.00 0.00 H ATOM 3228 HG12 ILE A 244 11.907 60.593 14.876 1.00 0.00 H ATOM 3229 HG13 ILE A 244 10.258 60.854 14.261 1.00 0.00 H ATOM 3230 HD11 ILE A 244 11.165 61.406 12.058 1.00 0.00 H ATOM 3231 HD12 ILE A 244 12.816 61.145 12.673 1.00 0.00 H ATOM 3232 HD13 ILE A 244 11.672 59.783 12.587 1.00 0.00 H ATOM 3233 HG21 ILE A 244 12.940 64.093 14.718 1.00 0.00 H ATOM 3234 HG22 ILE A 244 13.380 62.459 15.273 1.00 0.00 H ATOM 3235 HG23 ILE A 244 13.285 62.811 13.530 1.00 0.00 H ATOM 3236 H ILE A 244 8.866 62.363 14.999 1.00 0.00 H ATOM 3237 N SER A 245 10.349 65.289 15.602 1.00 46.35 N ATOM 3238 CA SER A 245 10.695 66.665 15.854 1.00 46.99 C ATOM 3239 C SER A 245 10.327 67.090 17.279 1.00 48.34 C ATOM 3240 O SER A 245 10.814 68.116 17.733 1.00 49.24 O ATOM 3241 CB SER A 245 10.101 67.617 14.814 1.00 46.51 C ATOM 3242 OG SER A 245 8.907 68.192 15.271 1.00 44.79 O ATOM 3243 HA SER A 245 11.779 66.734 15.760 1.00 0.00 H ATOM 3244 HB2 SER A 245 9.900 67.061 13.898 1.00 0.00 H ATOM 3245 HB3 SER A 245 10.820 68.409 14.606 1.00 0.00 H ATOM 3246 HG SER A 245 9.084 68.703 16.100 1.00 0.00 H ATOM 3247 H SER A 245 9.604 65.036 14.922 1.00 0.00 H ATOM 3248 N ASN A 246 9.487 66.336 17.996 1.00 49.26 N ATOM 3249 CA ASN A 246 9.118 66.751 19.378 1.00 50.17 C ATOM 3250 C ASN A 246 9.795 65.900 20.455 1.00 51.55 C ATOM 3251 O ASN A 246 9.563 66.112 21.634 1.00 51.17 O ATOM 3252 CB ASN A 246 7.593 66.719 19.585 1.00 49.52 C ATOM 3253 CG ASN A 246 6.895 68.014 19.160 1.00 48.96 C ATOM 3254 OD1 ASN A 246 6.904 69.002 19.893 1.00 48.18 O ATOM 3255 ND2 ASN A 246 6.250 67.995 17.984 1.00 46.49 N ATOM 3256 HA ASN A 246 9.478 67.774 19.485 1.00 0.00 H ATOM 3257 HB2 ASN A 246 7.182 65.896 19.000 1.00 0.00 H ATOM 3258 HB3 ASN A 246 7.391 66.548 20.642 1.00 0.00 H ATOM 3259 HD22 ASN A 246 6.268 67.138 17.395 1.00 0.00 H ATOM 3260 HD21 ASN A 246 5.732 68.837 17.661 1.00 0.00 H ATOM 3261 H ASN A 246 9.093 65.463 17.590 1.00 0.00 H ATOM 3262 N THR A 247 10.600 64.929 20.033 1.00 53.00 N ATOM 3263 CA THR A 247 11.312 64.035 20.928 1.00 54.39 C ATOM 3264 C THR A 247 12.828 64.270 20.735 1.00 56.12 C ATOM 3265 O THR A 247 13.375 65.254 21.266 1.00 56.70 O ATOM 3266 CB THR A 247 10.958 62.572 20.636 1.00 54.54 C ATOM 3267 OG1 THR A 247 11.057 62.330 19.220 1.00 52.65 O ATOM 3268 CG2 THR A 247 9.554 62.244 21.130 1.00 53.25 C ATOM 3269 HA THR A 247 11.025 64.241 21.959 1.00 0.00 H ATOM 3270 HB THR A 247 11.660 61.927 21.165 1.00 0.00 H ATOM 3271 HG1 THR A 247 10.428 62.925 18.740 1.00 0.00 H ATOM 3272 HG23 THR A 247 9.494 62.432 22.202 1.00 0.00 H ATOM 3273 HG21 THR A 247 8.831 62.872 20.609 1.00 0.00 H ATOM 3274 HG22 THR A 247 9.336 61.195 20.931 1.00 0.00 H ATOM 3275 H THR A 247 10.726 64.804 19.008 1.00 0.00 H ATOM 3276 N THR A 248 13.476 63.406 19.936 1.00 56.74 N ATOM 3277 CA THR A 248 14.907 63.501 19.602 1.00 56.59 C ATOM 3278 C THR A 248 15.255 64.754 18.839 1.00 56.89 C ATOM 3279 O THR A 248 16.296 65.312 19.038 1.00 57.64 O ATOM 3280 CB THR A 248 15.392 62.317 18.722 1.00 56.50 C ATOM 3281 OG1 THR A 248 14.637 62.254 17.502 1.00 53.67 O ATOM 3282 CG2 THR A 248 15.265 60.992 19.452 1.00 54.87 C ATOM 3283 HA THR A 248 15.400 63.496 20.574 1.00 0.00 H ATOM 3284 HB THR A 248 16.444 62.493 18.496 1.00 0.00 H ATOM 3285 HG1 THR A 248 14.754 63.098 16.999 1.00 0.00 H ATOM 3286 HG23 THR A 248 15.836 61.033 20.379 1.00 0.00 H ATOM 3287 HG21 THR A 248 14.216 60.802 19.678 1.00 0.00 H ATOM 3288 HG22 THR A 248 15.652 60.192 18.821 1.00 0.00 H ATOM 3289 H THR A 248 12.932 62.620 19.527 1.00 0.00 H ATOM 3290 N GLY A 249 14.395 65.201 17.946 1.00 57.08 N ATOM 3291 CA GLY A 249 14.778 66.274 17.026 1.00 57.24 C ATOM 3292 C GLY A 249 15.595 65.707 15.881 1.00 57.23 C ATOM 3293 O GLY A 249 15.906 64.520 15.861 1.00 57.00 O ATOM 3294 HA3 GLY A 249 15.372 67.015 17.562 1.00 0.00 H ATOM 3295 HA2 GLY A 249 13.880 66.748 16.629 1.00 0.00 H ATOM 3296 H GLY A 249 13.441 64.790 17.894 1.00 0.00 H ATOM 3297 N TYR A 250 15.939 66.556 14.928 1.00 57.93 N ATOM 3298 CA TYR A 250 16.582 66.105 13.682 1.00 59.24 C ATOM 3299 C TYR A 250 18.078 66.472 13.601 1.00 61.44 C ATOM 3300 O TYR A 250 18.678 66.440 12.512 1.00 62.24 O ATOM 3301 CB TYR A 250 15.828 66.670 12.443 1.00 58.17 C ATOM 3302 CG TYR A 250 14.556 65.936 12.081 1.00 56.15 C ATOM 3303 CD1 TYR A 250 13.303 66.471 12.361 1.00 55.60 C ATOM 3304 CD2 TYR A 250 14.611 64.702 11.480 1.00 55.74 C ATOM 3305 CE1 TYR A 250 12.126 65.780 12.023 1.00 55.47 C ATOM 3306 CE2 TYR A 250 13.453 64.007 11.149 1.00 56.62 C ATOM 3307 CZ TYR A 250 12.220 64.545 11.417 1.00 55.28 C ATOM 3308 OH TYR A 250 11.123 63.824 11.060 1.00 53.83 O ATOM 3309 HA TYR A 250 16.523 65.017 13.685 1.00 0.00 H ATOM 3310 HB3 TYR A 250 16.501 66.624 11.587 1.00 0.00 H ATOM 3311 HB2 TYR A 250 15.573 67.710 12.647 1.00 0.00 H ATOM 3312 HD2 TYR A 250 15.582 64.259 11.258 1.00 0.00 H ATOM 3313 HE2 TYR A 250 13.525 63.029 10.674 1.00 0.00 H ATOM 3314 HE1 TYR A 250 11.150 66.216 12.238 1.00 0.00 H ATOM 3315 HD1 TYR A 250 13.232 67.442 12.851 1.00 0.00 H ATOM 3316 HH TYR A 250 11.133 63.672 10.082 1.00 0.00 H ATOM 3317 H TYR A 250 15.750 67.570 15.062 1.00 0.00 H ATOM 3318 N SER A 251 18.679 66.845 14.712 1.00 63.59 N ATOM 3319 CA SER A 251 20.076 67.190 14.717 1.00 65.12 C ATOM 3320 C SER A 251 20.908 66.013 15.139 1.00 65.87 C ATOM 3321 O SER A 251 21.870 65.667 14.518 1.00 66.54 O ATOM 3322 CB SER A 251 20.304 68.393 15.594 1.00 20.00 C ATOM 3323 OG SER A 251 19.729 69.517 14.982 1.00 20.00 O ATOM 3324 HA SER A 251 20.388 67.454 13.707 1.00 0.00 H ATOM 3325 HB2 SER A 251 21.374 68.554 15.724 1.00 0.00 H ATOM 3326 HB3 SER A 251 19.842 68.229 16.567 1.00 0.00 H ATOM 3327 HG SER A 251 19.875 70.313 15.553 1.00 0.00 H ATOM 3328 H SER A 251 18.136 66.891 15.598 1.00 0.00 H ATOM 3329 N ASP A 252 20.517 65.347 16.184 1.00 66.66 N ATOM 3330 CA ASP A 252 21.128 64.081 16.434 1.00 67.90 C ATOM 3331 C ASP A 252 21.408 63.407 15.091 1.00 68.47 C ATOM 3332 O ASP A 252 20.491 62.870 14.426 1.00 67.42 O ATOM 3333 CB ASP A 252 20.258 63.189 17.273 1.00 68.01 C ATOM 3334 CG ASP A 252 21.022 62.024 17.796 1.00 68.98 C ATOM 3335 OD1 ASP A 252 20.957 60.944 17.174 1.00 68.56 O ATOM 3336 OD2 ASP A 252 21.738 62.216 18.806 1.00 71.81 O ATOM 3337 HA ASP A 252 22.051 64.247 16.989 1.00 0.00 H ATOM 3338 HB2 ASP A 252 19.866 63.763 18.113 1.00 0.00 H ATOM 3339 HB3 ASP A 252 19.430 62.826 16.664 1.00 0.00 H ATOM 3340 H ASP A 252 19.783 65.724 16.817 1.00 0.00 H ATOM 3341 N ARG A 253 22.687 63.464 14.719 1.00 69.18 N ATOM 3342 CA ARG A 253 23.147 63.067 13.420 1.00 69.84 C ATOM 3343 C ARG A 253 22.956 61.592 13.183 1.00 70.03 C ATOM 3344 O ARG A 253 22.852 61.180 12.048 1.00 69.92 O ATOM 3345 CB ARG A 253 24.617 63.448 13.246 1.00 70.78 C ATOM 3346 CG ARG A 253 24.867 64.970 13.315 1.00 71.36 C ATOM 3347 CD ARG A 253 26.078 65.422 12.492 1.00 71.90 C ATOM 3348 NE ARG A 253 27.331 65.132 13.190 1.00 72.71 N ATOM 3349 CZ ARG A 253 28.336 65.987 13.411 1.00 72.24 C ATOM 3350 NH1 ARG A 253 28.325 67.254 12.984 1.00 70.62 N ATOM 3351 NH2 ARG A 253 29.389 65.542 14.075 1.00 72.70 N ATOM 3352 HA ARG A 253 22.547 63.596 12.679 1.00 0.00 H ATOM 3353 HB2 ARG A 253 25.195 62.966 14.035 1.00 0.00 H ATOM 3354 HB3 ARG A 253 24.956 63.085 12.276 1.00 0.00 H ATOM 3355 HG2 ARG A 253 23.982 65.484 12.940 1.00 0.00 H ATOM 3356 HG3 ARG A 253 25.033 65.247 14.356 1.00 0.00 H ATOM 3357 HD2 ARG A 253 26.009 66.496 12.317 1.00 0.00 H ATOM 3358 HD3 ARG A 253 26.074 64.898 11.536 1.00 0.00 H ATOM 3359 HE ARG A 253 27.452 64.164 13.550 1.00 0.00 H ATOM 3360 HH12 ARG A 253 29.134 67.877 13.183 1.00 0.00 H ATOM 3361 HH11 ARG A 253 27.508 67.617 12.452 1.00 0.00 H ATOM 3362 HH22 ARG A 253 30.190 66.177 14.266 1.00 0.00 H ATOM 3363 HH21 ARG A 253 29.416 64.557 14.406 1.00 0.00 H ATOM 3364 H ARG A 253 23.386 63.814 15.405 1.00 0.00 H ATOM 3365 N ALA A 254 22.903 60.795 14.244 1.00 70.72 N ATOM 3366 CA ALA A 254 22.561 59.367 14.138 1.00 70.83 C ATOM 3367 C ALA A 254 21.120 59.198 13.677 1.00 70.28 C ATOM 3368 O ALA A 254 20.813 58.339 12.857 1.00 69.51 O ATOM 3369 CB ALA A 254 22.748 58.680 15.473 1.00 71.10 C ATOM 3370 HA ALA A 254 23.226 58.911 13.404 1.00 0.00 H ATOM 3371 HB1 ALA A 254 23.788 58.775 15.786 1.00 0.00 H ATOM 3372 HB2 ALA A 254 22.100 59.147 16.214 1.00 0.00 H ATOM 3373 HB3 ALA A 254 22.491 57.625 15.377 1.00 0.00 H ATOM 3374 H ALA A 254 23.110 61.193 15.182 1.00 0.00 H ATOM 3375 N VAL A 255 20.240 60.024 14.238 1.00 69.53 N ATOM 3376 CA VAL A 255 18.833 60.013 13.884 1.00 68.48 C ATOM 3377 C VAL A 255 18.597 60.606 12.492 1.00 66.90 C ATOM 3378 O VAL A 255 17.978 59.952 11.677 1.00 66.20 O ATOM 3379 CB VAL A 255 17.975 60.734 14.950 1.00 68.86 C ATOM 3380 CG1 VAL A 255 16.611 61.129 14.370 1.00 68.37 C ATOM 3381 CG2 VAL A 255 17.832 59.860 16.199 1.00 67.59 C ATOM 3382 HA VAL A 255 18.517 58.970 13.855 1.00 0.00 H ATOM 3383 HB VAL A 255 18.480 61.653 15.247 1.00 0.00 H ATOM 3384 HG11 VAL A 255 16.758 61.799 13.523 1.00 0.00 H ATOM 3385 HG12 VAL A 255 16.085 60.233 14.040 1.00 0.00 H ATOM 3386 HG13 VAL A 255 16.024 61.635 15.137 1.00 0.00 H ATOM 3387 HG21 VAL A 255 17.350 58.920 15.930 1.00 0.00 H ATOM 3388 HG22 VAL A 255 18.819 59.657 16.614 1.00 0.00 H ATOM 3389 HG23 VAL A 255 17.226 60.382 16.939 1.00 0.00 H ATOM 3390 H VAL A 255 20.572 60.700 14.955 1.00 0.00 H ATOM 3391 N LEU A 256 19.096 61.810 12.209 1.00 65.59 N ATOM 3392 CA LEU A 256 19.027 62.362 10.832 1.00 65.05 C ATOM 3393 C LEU A 256 19.534 61.380 9.754 1.00 65.63 C ATOM 3394 O LEU A 256 18.955 61.258 8.679 1.00 65.38 O ATOM 3395 CB LEU A 256 19.784 63.695 10.722 1.00 65.01 C ATOM 3396 CG LEU A 256 19.968 64.389 9.355 1.00 64.08 C ATOM 3397 CD1 LEU A 256 18.748 64.267 8.512 1.00 63.08 C ATOM 3398 CD2 LEU A 256 20.324 65.867 9.525 1.00 63.28 C ATOM 3399 HA LEU A 256 17.968 62.533 10.640 1.00 0.00 H ATOM 3400 HB2 LEU A 256 19.260 64.404 11.363 1.00 0.00 H ATOM 3401 HB3 LEU A 256 20.784 63.519 11.119 1.00 0.00 H ATOM 3402 HG LEU A 256 20.792 63.882 8.853 1.00 0.00 H ATOM 3403 HD21 LEU A 256 19.524 66.372 10.066 1.00 0.00 H ATOM 3404 HD22 LEU A 256 21.254 65.953 10.086 1.00 0.00 H ATOM 3405 HD23 LEU A 256 20.446 66.325 8.544 1.00 0.00 H ATOM 3406 HD11 LEU A 256 18.532 63.213 8.338 1.00 0.00 H ATOM 3407 HD12 LEU A 256 17.906 64.732 9.025 1.00 0.00 H ATOM 3408 HD13 LEU A 256 18.915 64.767 7.558 1.00 0.00 H ATOM 3409 H LEU A 256 19.540 62.371 12.964 1.00 0.00 H ATOM 3410 N GLU A 257 20.611 60.676 10.060 1.00 66.37 N ATOM 3411 CA GLU A 257 21.165 59.671 9.163 1.00 66.86 C ATOM 3412 C GLU A 257 20.188 58.498 8.977 1.00 65.86 C ATOM 3413 O GLU A 257 19.968 58.050 7.862 1.00 65.36 O ATOM 3414 CB GLU A 257 22.574 59.245 9.678 1.00 67.73 C ATOM 3415 CG GLU A 257 22.984 57.771 9.581 1.00 69.07 C ATOM 3416 CD GLU A 257 23.917 57.477 8.450 1.00 70.07 C ATOM 3417 OE1 GLU A 257 25.074 57.954 8.486 1.00 69.20 O ATOM 3418 OE2 GLU A 257 23.495 56.739 7.537 1.00 71.96 O ATOM 3419 HA GLU A 257 21.301 60.089 8.166 1.00 0.00 H ATOM 3420 HB2 GLU A 257 23.308 59.819 9.113 1.00 0.00 H ATOM 3421 HB3 GLU A 257 22.628 59.524 10.730 1.00 0.00 H ATOM 3422 HG2 GLU A 257 23.473 57.488 10.513 1.00 0.00 H ATOM 3423 HG3 GLU A 257 22.083 57.172 9.449 1.00 0.00 H ATOM 3424 H GLU A 257 21.079 60.846 10.973 1.00 0.00 H ATOM 3425 N ARG A 258 19.595 58.022 10.067 1.00 65.25 N ATOM 3426 CA ARG A 258 18.651 56.890 10.027 1.00 64.78 C ATOM 3427 C ARG A 258 17.396 57.257 9.261 1.00 63.19 C ATOM 3428 O ARG A 258 16.802 56.422 8.588 1.00 62.92 O ATOM 3429 CB ARG A 258 18.255 56.469 11.445 1.00 65.11 C ATOM 3430 CG ARG A 258 17.139 55.420 11.497 1.00 66.38 C ATOM 3431 CD ARG A 258 16.330 55.482 12.791 1.00 68.48 C ATOM 3432 NE ARG A 258 15.866 56.837 13.114 1.00 68.67 N ATOM 3433 CZ ARG A 258 14.986 57.127 14.061 1.00 69.30 C ATOM 3434 NH1 ARG A 258 14.441 56.166 14.783 1.00 71.45 N ATOM 3435 NH2 ARG A 258 14.639 58.389 14.282 1.00 69.65 N ATOM 3436 HA ARG A 258 19.153 56.064 9.524 1.00 0.00 H ATOM 3437 HB2 ARG A 258 19.135 56.058 11.939 1.00 0.00 H ATOM 3438 HB3 ARG A 258 17.918 57.355 11.984 1.00 0.00 H ATOM 3439 HG2 ARG A 258 16.465 55.585 10.656 1.00 0.00 H ATOM 3440 HG3 ARG A 258 17.587 54.430 11.413 1.00 0.00 H ATOM 3441 HD2 ARG A 258 16.955 55.125 13.609 1.00 0.00 H ATOM 3442 HD3 ARG A 258 15.461 54.832 12.689 1.00 0.00 H ATOM 3443 HE ARG A 258 16.256 57.626 12.560 1.00 0.00 H ATOM 3444 HH12 ARG A 258 13.751 56.401 15.525 1.00 0.00 H ATOM 3445 HH11 ARG A 258 14.702 55.174 14.610 1.00 0.00 H ATOM 3446 HH22 ARG A 258 13.948 58.616 15.026 1.00 0.00 H ATOM 3447 HH21 ARG A 258 15.058 59.151 13.712 1.00 0.00 H ATOM 3448 H ARG A 258 19.805 58.465 10.984 1.00 0.00 H ATOM 3449 N GLU A 259 17.003 58.515 9.400 1.00 61.47 N ATOM 3450 CA GLU A 259 15.871 59.052 8.705 1.00 60.68 C ATOM 3451 C GLU A 259 16.106 59.118 7.198 1.00 60.44 C ATOM 3452 O GLU A 259 15.254 58.657 6.404 1.00 59.51 O ATOM 3453 CB GLU A 259 15.527 60.446 9.260 1.00 60.44 C ATOM 3454 CG GLU A 259 14.792 60.408 10.615 1.00 59.86 C ATOM 3455 CD GLU A 259 13.627 59.428 10.614 1.00 59.47 C ATOM 3456 OE1 GLU A 259 12.624 59.728 9.936 1.00 60.26 O ATOM 3457 OE2 GLU A 259 13.714 58.359 11.265 1.00 56.76 O ATOM 3458 HA GLU A 259 15.028 58.381 8.871 1.00 0.00 H ATOM 3459 HB2 GLU A 259 16.454 61.005 9.386 1.00 0.00 H ATOM 3460 HB3 GLU A 259 14.891 60.958 8.537 1.00 0.00 H ATOM 3461 HG2 GLU A 259 15.499 60.111 11.389 1.00 0.00 H ATOM 3462 HG3 GLU A 259 14.411 61.405 10.835 1.00 0.00 H ATOM 3463 H GLU A 259 17.538 59.137 10.039 1.00 0.00 H ATOM 3464 N VAL A 260 17.256 59.682 6.808 1.00 60.47 N ATOM 3465 CA VAL A 260 17.600 59.802 5.385 1.00 59.93 C ATOM 3466 C VAL A 260 17.814 58.411 4.750 1.00 60.95 C ATOM 3467 O VAL A 260 17.346 58.179 3.652 1.00 60.52 O ATOM 3468 CB VAL A 260 18.780 60.761 5.153 1.00 59.59 C ATOM 3469 CG1 VAL A 260 19.109 60.840 3.688 1.00 60.21 C ATOM 3470 CG2 VAL A 260 18.453 62.153 5.660 1.00 56.55 C ATOM 3471 HA VAL A 260 16.752 60.255 4.872 1.00 0.00 H ATOM 3472 HB VAL A 260 19.637 60.372 5.702 1.00 0.00 H ATOM 3473 HG11 VAL A 260 19.379 59.849 3.324 1.00 0.00 H ATOM 3474 HG12 VAL A 260 18.240 61.206 3.141 1.00 0.00 H ATOM 3475 HG13 VAL A 260 19.946 61.523 3.541 1.00 0.00 H ATOM 3476 HG21 VAL A 260 17.580 62.535 5.131 1.00 0.00 H ATOM 3477 HG22 VAL A 260 18.241 62.109 6.728 1.00 0.00 H ATOM 3478 HG23 VAL A 260 19.304 62.812 5.484 1.00 0.00 H ATOM 3479 H VAL A 260 17.918 60.042 7.525 1.00 0.00 H ATOM 3480 N GLN A 261 18.456 57.473 5.444 1.00 62.59 N ATOM 3481 CA GLN A 261 18.620 56.110 4.898 1.00 64.14 C ATOM 3482 C GLN A 261 17.281 55.448 4.653 1.00 63.42 C ATOM 3483 O GLN A 261 17.104 54.745 3.653 1.00 62.86 O ATOM 3484 CB GLN A 261 19.411 55.200 5.842 1.00 65.48 C ATOM 3485 CG GLN A 261 20.890 55.550 5.999 1.00 69.28 C ATOM 3486 CD GLN A 261 21.731 55.185 4.786 1.00 73.46 C ATOM 3487 OE1 GLN A 261 21.307 54.397 3.931 1.00 75.38 O ATOM 3488 NE2 GLN A 261 22.937 55.766 4.704 1.00 75.89 N ATOM 3489 HA GLN A 261 19.164 56.234 3.962 1.00 0.00 H ATOM 3490 HB2 GLN A 261 18.946 55.250 6.827 1.00 0.00 H ATOM 3491 HB3 GLN A 261 19.344 54.181 5.462 1.00 0.00 H ATOM 3492 HG2 GLN A 261 20.975 56.623 6.168 1.00 0.00 H ATOM 3493 HG3 GLN A 261 21.282 55.015 6.864 1.00 0.00 H ATOM 3494 HE22 GLN A 261 23.250 56.422 5.448 1.00 0.00 H ATOM 3495 HE21 GLN A 261 23.559 55.560 3.897 1.00 0.00 H ATOM 3496 H GLN A 261 18.846 57.702 6.380 1.00 0.00 H ATOM 3497 N TYR A 262 16.365 55.648 5.606 1.00 62.92 N ATOM 3498 CA TYR A 262 14.994 55.138 5.523 1.00 62.25 C ATOM 3499 C TYR A 262 14.223 55.756 4.332 1.00 60.33 C ATOM 3500 O TYR A 262 13.668 55.027 3.521 1.00 58.86 O ATOM 3501 CB TYR A 262 14.265 55.375 6.857 1.00 63.33 C ATOM 3502 CG TYR A 262 12.836 54.903 6.869 1.00 63.77 C ATOM 3503 CD1 TYR A 262 12.537 53.544 6.852 1.00 65.96 C ATOM 3504 CD2 TYR A 262 11.785 55.818 6.864 1.00 63.49 C ATOM 3505 CE1 TYR A 262 11.223 53.099 6.853 1.00 67.28 C ATOM 3506 CE2 TYR A 262 10.479 55.400 6.858 1.00 65.22 C ATOM 3507 CZ TYR A 262 10.195 54.035 6.855 1.00 66.84 C ATOM 3508 OH TYR A 262 8.886 53.606 6.853 1.00 66.41 O ATOM 3509 HA TYR A 262 15.037 54.064 5.340 1.00 0.00 H ATOM 3510 HB3 TYR A 262 14.274 56.445 7.067 1.00 0.00 H ATOM 3511 HB2 TYR A 262 14.807 54.847 7.642 1.00 0.00 H ATOM 3512 HD2 TYR A 262 12.005 56.886 6.865 1.00 0.00 H ATOM 3513 HE2 TYR A 262 9.669 56.129 6.856 1.00 0.00 H ATOM 3514 HE1 TYR A 262 11.000 52.032 6.852 1.00 0.00 H ATOM 3515 HD1 TYR A 262 13.349 52.817 6.838 1.00 0.00 H ATOM 3516 HH TYR A 262 8.864 52.616 6.851 1.00 0.00 H ATOM 3517 H TYR A 262 16.639 56.193 6.448 1.00 0.00 H ATOM 3518 N THR A 263 14.224 57.085 4.218 1.00 58.82 N ATOM 3519 CA THR A 263 13.548 57.765 3.110 1.00 58.03 C ATOM 3520 C THR A 263 14.098 57.338 1.734 1.00 58.57 C ATOM 3521 O THR A 263 13.320 57.003 0.847 1.00 58.35 O ATOM 3522 CB THR A 263 13.573 59.298 3.272 1.00 57.23 C ATOM 3523 OG1 THR A 263 13.258 59.621 4.620 1.00 56.10 O ATOM 3524 CG2 THR A 263 12.551 59.992 2.371 1.00 56.17 C ATOM 3525 HA THR A 263 12.506 57.448 3.149 1.00 0.00 H ATOM 3526 HB THR A 263 14.569 59.642 2.993 1.00 0.00 H ATOM 3527 HG1 THR A 263 13.927 59.208 5.222 1.00 0.00 H ATOM 3528 HG23 THR A 263 12.771 59.760 1.329 1.00 0.00 H ATOM 3529 HG21 THR A 263 11.550 59.639 2.620 1.00 0.00 H ATOM 3530 HG22 THR A 263 12.606 61.070 2.524 1.00 0.00 H ATOM 3531 H THR A 263 14.718 57.654 4.935 1.00 0.00 H ATOM 3532 N LEU A 264 15.416 57.298 1.564 1.00 59.28 N ATOM 3533 CA LEU A 264 16.008 56.820 0.297 1.00 59.87 C ATOM 3534 C LEU A 264 15.605 55.399 -0.008 1.00 60.48 C ATOM 3535 O LEU A 264 15.333 55.058 -1.154 1.00 61.00 O ATOM 3536 CB LEU A 264 17.532 56.869 0.325 1.00 59.84 C ATOM 3537 CG LEU A 264 18.158 58.236 0.507 1.00 59.00 C ATOM 3538 CD1 LEU A 264 19.655 58.055 0.645 1.00 59.73 C ATOM 3539 CD2 LEU A 264 17.769 59.142 -0.644 1.00 56.40 C ATOM 3540 HA LEU A 264 15.629 57.491 -0.474 1.00 0.00 H ATOM 3541 HB2 LEU A 264 17.869 56.237 1.147 1.00 0.00 H ATOM 3542 HB3 LEU A 264 17.895 56.461 -0.618 1.00 0.00 H ATOM 3543 HG LEU A 264 17.793 58.723 1.411 1.00 0.00 H ATOM 3544 HD21 LEU A 264 18.120 58.708 -1.581 1.00 0.00 H ATOM 3545 HD22 LEU A 264 16.684 59.245 -0.673 1.00 0.00 H ATOM 3546 HD23 LEU A 264 18.224 60.122 -0.503 1.00 0.00 H ATOM 3547 HD11 LEU A 264 19.865 57.427 1.511 1.00 0.00 H ATOM 3548 HD12 LEU A 264 20.047 57.579 -0.254 1.00 0.00 H ATOM 3549 HD13 LEU A 264 20.127 59.029 0.777 1.00 0.00 H ATOM 3550 H LEU A 264 16.041 57.608 2.335 1.00 0.00 H ATOM 3551 N GLU A 265 15.564 54.570 1.021 1.00 60.99 N ATOM 3552 CA GLU A 265 15.235 53.167 0.846 1.00 62.03 C ATOM 3553 C GLU A 265 13.762 52.978 0.394 1.00 61.65 C ATOM 3554 O GLU A 265 13.461 52.127 -0.458 1.00 62.35 O ATOM 3555 CB GLU A 265 15.577 52.400 2.146 1.00 62.77 C ATOM 3556 CG GLU A 265 15.712 50.889 2.019 1.00 64.61 C ATOM 3557 CD GLU A 265 16.393 50.450 0.704 1.00 67.62 C ATOM 3558 OE1 GLU A 265 15.636 49.942 -0.187 1.00 68.00 O ATOM 3559 OE2 GLU A 265 17.647 50.642 0.562 1.00 64.05 O ATOM 3560 HA GLU A 265 15.838 52.747 0.041 1.00 0.00 H ATOM 3561 HB2 GLU A 265 16.523 52.788 2.522 1.00 0.00 H ATOM 3562 HB3 GLU A 265 14.788 52.604 2.870 1.00 0.00 H ATOM 3563 HG2 GLU A 265 16.305 50.522 2.857 1.00 0.00 H ATOM 3564 HG3 GLU A 265 14.716 50.447 2.059 1.00 0.00 H ATOM 3565 H GLU A 265 15.771 54.930 1.974 1.00 0.00 H ATOM 3566 N MET A 266 12.860 53.790 0.949 1.00 60.60 N ATOM 3567 CA MET A 266 11.465 53.822 0.529 1.00 59.46 C ATOM 3568 C MET A 266 11.346 54.331 -0.896 1.00 58.80 C ATOM 3569 O MET A 266 10.625 53.761 -1.708 1.00 58.59 O ATOM 3570 CB MET A 266 10.657 54.736 1.462 1.00 59.25 C ATOM 3571 CG MET A 266 10.458 54.217 2.879 1.00 58.35 C ATOM 3572 SD MET A 266 9.995 52.474 2.905 1.00 57.63 S ATOM 3573 CE MET A 266 9.135 52.405 4.473 1.00 60.18 C ATOM 3574 HA MET A 266 11.071 52.807 0.577 1.00 0.00 H ATOM 3575 HB2 MET A 266 11.174 55.694 1.525 1.00 0.00 H ATOM 3576 HB3 MET A 266 9.673 54.884 1.017 1.00 0.00 H ATOM 3577 HG2 MET A 266 9.670 54.797 3.359 1.00 0.00 H ATOM 3578 HG3 MET A 266 11.388 54.342 3.433 1.00 0.00 H ATOM 3579 HE1 MET A 266 9.816 52.695 5.273 1.00 0.00 H ATOM 3580 HE2 MET A 266 8.287 53.089 4.451 1.00 0.00 H ATOM 3581 HE3 MET A 266 8.780 51.389 4.647 1.00 0.00 H ATOM 3582 H MET A 266 13.165 54.426 1.713 1.00 0.00 H ATOM 3583 N ILE A 267 12.056 55.411 -1.196 1.00 58.14 N ATOM 3584 CA ILE A 267 12.140 55.911 -2.560 1.00 57.91 C ATOM 3585 C ILE A 267 12.598 54.810 -3.532 1.00 59.91 C ATOM 3586 O ILE A 267 12.090 54.720 -4.648 1.00 59.83 O ATOM 3587 CB ILE A 267 13.079 57.123 -2.673 1.00 57.22 C ATOM 3588 CG1 ILE A 267 12.460 58.334 -1.975 1.00 54.77 C ATOM 3589 CG2 ILE A 267 13.390 57.445 -4.149 1.00 55.86 C ATOM 3590 CD1 ILE A 267 13.396 59.510 -1.865 1.00 53.14 C ATOM 3591 HA ILE A 267 11.135 56.231 -2.834 1.00 0.00 H ATOM 3592 HB ILE A 267 14.020 56.877 -2.180 1.00 0.00 H ATOM 3593 HG12 ILE A 267 11.580 58.645 -2.539 1.00 0.00 H ATOM 3594 HG13 ILE A 267 12.160 58.037 -0.970 1.00 0.00 H ATOM 3595 HD11 ILE A 267 14.277 59.219 -1.293 1.00 0.00 H ATOM 3596 HD12 ILE A 267 13.697 59.827 -2.863 1.00 0.00 H ATOM 3597 HD13 ILE A 267 12.888 60.331 -1.359 1.00 0.00 H ATOM 3598 HG21 ILE A 267 13.871 56.584 -4.614 1.00 0.00 H ATOM 3599 HG22 ILE A 267 12.462 57.671 -4.674 1.00 0.00 H ATOM 3600 HG23 ILE A 267 14.056 58.306 -4.199 1.00 0.00 H ATOM 3601 H ILE A 267 12.564 55.912 -0.439 1.00 0.00 H ATOM 3602 N LYS A 268 13.547 53.970 -3.120 1.00 61.55 N ATOM 3603 CA LYS A 268 13.986 52.875 -3.990 1.00 63.07 C ATOM 3604 C LYS A 268 12.848 51.928 -4.325 1.00 62.92 C ATOM 3605 O LYS A 268 12.692 51.547 -5.483 1.00 63.08 O ATOM 3606 CB LYS A 268 15.151 52.085 -3.372 1.00 64.31 C ATOM 3607 CG LYS A 268 16.519 52.510 -3.895 1.00 66.90 C ATOM 3608 CD LYS A 268 17.637 52.344 -2.878 1.00 69.96 C ATOM 3609 CE LYS A 268 18.859 53.158 -3.296 1.00 72.62 C ATOM 3610 NZ LYS A 268 19.457 53.925 -2.162 1.00 73.61 N ATOM 3611 HA LYS A 268 14.333 53.340 -4.913 1.00 0.00 H ATOM 3612 HB2 LYS A 268 15.133 52.232 -2.292 1.00 0.00 H ATOM 3613 HB3 LYS A 268 15.009 51.028 -3.596 1.00 0.00 H ATOM 3614 HG2 LYS A 268 16.757 51.906 -4.771 1.00 0.00 H ATOM 3615 HG3 LYS A 268 16.467 53.560 -4.183 1.00 0.00 H ATOM 3616 HD2 LYS A 268 17.291 52.689 -1.904 1.00 0.00 H ATOM 3617 HD3 LYS A 268 17.911 51.291 -2.813 1.00 0.00 H ATOM 3618 HE2 LYS A 268 18.561 53.861 -4.074 1.00 0.00 H ATOM 3619 HE3 LYS A 268 19.612 52.478 -3.693 1.00 0.00 H ATOM 3620 HZ1 LYS A 268 18.750 54.585 -1.780 1.00 0.00 H ATOM 3621 HZ2 LYS A 268 19.754 53.264 -1.416 1.00 0.00 H ATOM 3622 HZ3 LYS A 268 20.282 54.458 -2.503 1.00 0.00 H ATOM 3623 H LYS A 268 13.976 54.091 -2.181 1.00 0.00 H ATOM 3624 N LEU A 269 12.058 51.538 -3.323 1.00 62.30 N ATOM 3625 CA LEU A 269 11.007 50.554 -3.559 1.00 61.88 C ATOM 3626 C LEU A 269 9.888 51.160 -4.424 1.00 60.46 C ATOM 3627 O LEU A 269 9.223 50.427 -5.178 1.00 60.36 O ATOM 3628 CB LEU A 269 10.439 49.975 -2.245 1.00 61.98 C ATOM 3629 CG LEU A 269 11.382 49.626 -1.081 1.00 62.92 C ATOM 3630 CD1 LEU A 269 10.718 48.730 -0.050 1.00 61.61 C ATOM 3631 CD2 LEU A 269 12.653 48.970 -1.563 1.00 64.79 C ATOM 3632 HA LEU A 269 11.457 49.722 -4.100 1.00 0.00 H ATOM 3633 HB2 LEU A 269 9.726 50.705 -1.863 1.00 0.00 H ATOM 3634 HB3 LEU A 269 9.912 49.058 -2.508 1.00 0.00 H ATOM 3635 HG LEU A 269 11.630 50.576 -0.608 1.00 0.00 H ATOM 3636 HD21 LEU A 269 12.407 48.049 -2.092 1.00 0.00 H ATOM 3637 HD22 LEU A 269 13.178 49.648 -2.236 1.00 0.00 H ATOM 3638 HD23 LEU A 269 13.289 48.741 -0.708 1.00 0.00 H ATOM 3639 HD11 LEU A 269 9.845 49.237 0.362 1.00 0.00 H ATOM 3640 HD12 LEU A 269 10.408 47.799 -0.525 1.00 0.00 H ATOM 3641 HD13 LEU A 269 11.425 48.513 0.750 1.00 0.00 H ATOM 3642 H LEU A 269 12.192 51.936 -2.372 1.00 0.00 H ATOM 3643 N VAL A 270 9.689 52.484 -4.319 1.00 58.13 N ATOM 3644 CA VAL A 270 8.548 53.171 -4.965 1.00 56.23 C ATOM 3645 C VAL A 270 8.943 54.568 -5.433 1.00 54.51 C ATOM 3646 O VAL A 270 8.526 55.548 -4.835 1.00 53.83 O ATOM 3647 CB VAL A 270 7.341 53.335 -3.986 1.00 55.97 C ATOM 3648 CG1 VAL A 270 6.116 53.835 -4.738 1.00 55.28 C ATOM 3649 CG2 VAL A 270 7.031 52.022 -3.232 1.00 55.19 C ATOM 3650 HA VAL A 270 8.260 52.548 -5.811 1.00 0.00 H ATOM 3651 HB VAL A 270 7.617 54.077 -3.236 1.00 0.00 H ATOM 3652 HG11 VAL A 270 6.340 54.800 -5.193 1.00 0.00 H ATOM 3653 HG12 VAL A 270 5.850 53.118 -5.515 1.00 0.00 H ATOM 3654 HG13 VAL A 270 5.284 53.944 -4.043 1.00 0.00 H ATOM 3655 HG21 VAL A 270 6.785 51.241 -3.951 1.00 0.00 H ATOM 3656 HG22 VAL A 270 7.904 51.722 -2.652 1.00 0.00 H ATOM 3657 HG23 VAL A 270 6.186 52.180 -2.562 1.00 0.00 H ATOM 3658 H VAL A 270 10.362 53.048 -3.762 1.00 0.00 H ATOM 3659 N PRO A 271 9.762 54.665 -6.492 1.00 52.96 N ATOM 3660 CA PRO A 271 10.343 55.936 -6.924 1.00 51.63 C ATOM 3661 C PRO A 271 9.360 57.065 -7.178 1.00 49.82 C ATOM 3662 O PRO A 271 9.719 58.229 -6.990 1.00 47.93 O ATOM 3663 CB PRO A 271 11.046 55.571 -8.226 1.00 52.05 C ATOM 3664 CG PRO A 271 11.330 54.146 -8.094 1.00 52.75 C ATOM 3665 CD PRO A 271 10.237 53.551 -7.322 1.00 53.31 C ATOM 3666 HA PRO A 271 10.979 56.334 -6.133 1.00 0.00 H ATOM 3667 HD3 PRO A 271 9.446 53.189 -7.979 1.00 0.00 H ATOM 3668 HD2 PRO A 271 10.598 52.729 -6.703 1.00 0.00 H ATOM 3669 HG3 PRO A 271 12.276 54.001 -7.573 1.00 0.00 H ATOM 3670 HG2 PRO A 271 11.385 53.684 -9.080 1.00 0.00 H ATOM 3671 HB2 PRO A 271 10.397 55.758 -9.081 1.00 0.00 H ATOM 3672 HB3 PRO A 271 11.969 56.140 -8.340 1.00 0.00 H ATOM 3673 N HIS A 272 8.146 56.719 -7.619 1.00 48.78 N ATOM 3674 CA HIS A 272 7.132 57.737 -7.953 1.00 47.84 C ATOM 3675 C HIS A 272 6.244 58.211 -6.775 1.00 46.01 C ATOM 3676 O HIS A 272 5.417 59.113 -6.954 1.00 46.19 O ATOM 3677 CB HIS A 272 6.315 57.303 -9.179 1.00 48.53 C ATOM 3678 CG HIS A 272 7.154 57.107 -10.411 1.00 50.65 C ATOM 3679 ND1 HIS A 272 7.858 55.945 -10.651 1.00 52.84 N ATOM 3680 CD2 HIS A 272 7.426 57.933 -11.456 1.00 51.89 C ATOM 3681 CE1 HIS A 272 8.504 56.052 -11.804 1.00 53.15 C ATOM 3682 NE2 HIS A 272 8.273 57.255 -12.305 1.00 52.84 N ATOM 3683 HA HIS A 272 7.695 58.635 -8.207 1.00 0.00 H ATOM 3684 HB2 HIS A 272 5.815 56.363 -8.947 1.00 0.00 H ATOM 3685 HB3 HIS A 272 5.568 58.069 -9.387 1.00 0.00 H ATOM 3686 HD2 HIS A 272 7.045 58.944 -11.596 1.00 0.00 H ATOM 3687 HE1 HIS A 272 9.121 55.279 -12.262 1.00 0.00 H ATOM 3688 H HIS A 272 7.912 55.712 -7.729 1.00 0.00 H ATOM 3689 N ASN A 273 6.477 57.669 -5.577 1.00 43.35 N ATOM 3690 CA ASN A 273 5.804 58.151 -4.362 1.00 42.11 C ATOM 3691 C ASN A 273 6.306 59.511 -3.865 1.00 41.27 C ATOM 3692 O ASN A 273 7.373 59.614 -3.295 1.00 41.96 O ATOM 3693 CB ASN A 273 5.892 57.090 -3.238 1.00 42.07 C ATOM 3694 CG ASN A 273 5.457 57.606 -1.876 1.00 40.16 C ATOM 3695 OD1 ASN A 273 4.748 58.605 -1.754 1.00 42.89 O ATOM 3696 ND2 ASN A 273 5.873 56.907 -0.841 1.00 36.54 N ATOM 3697 HA ASN A 273 4.761 58.307 -4.639 1.00 0.00 H ATOM 3698 HB2 ASN A 273 5.254 56.249 -3.508 1.00 0.00 H ATOM 3699 HB3 ASN A 273 6.925 56.751 -3.164 1.00 0.00 H ATOM 3700 HD22 ASN A 273 6.471 56.069 -0.986 1.00 0.00 H ATOM 3701 HD21 ASN A 273 5.604 57.193 0.122 1.00 0.00 H ATOM 3702 H ASN A 273 7.154 56.883 -5.501 1.00 0.00 H ATOM 3703 N GLU A 274 5.468 60.531 -3.994 1.00 40.50 N ATOM 3704 CA GLU A 274 5.866 61.910 -3.712 1.00 39.98 C ATOM 3705 C GLU A 274 6.074 62.212 -2.220 1.00 39.17 C ATOM 3706 O GLU A 274 6.751 63.171 -1.862 1.00 38.96 O ATOM 3707 CB GLU A 274 4.845 62.881 -4.357 1.00 39.52 C ATOM 3708 CG GLU A 274 5.186 64.393 -4.266 1.00 39.35 C ATOM 3709 CD GLU A 274 4.119 65.324 -4.908 1.00 41.17 C ATOM 3710 OE1 GLU A 274 4.033 66.490 -4.409 1.00 45.03 O ATOM 3711 OE2 GLU A 274 3.390 64.925 -5.889 1.00 42.53 O ATOM 3712 HA GLU A 274 6.849 62.058 -4.159 1.00 0.00 H ATOM 3713 HB2 GLU A 274 4.760 62.622 -5.412 1.00 0.00 H ATOM 3714 HB3 GLU A 274 3.883 62.726 -3.867 1.00 0.00 H ATOM 3715 HG2 GLU A 274 5.284 64.659 -3.214 1.00 0.00 H ATOM 3716 HG3 GLU A 274 6.137 64.561 -4.772 1.00 0.00 H ATOM 3717 H GLU A 274 4.494 60.344 -4.307 1.00 0.00 H ATOM 3718 N SER A 275 5.512 61.402 -1.344 1.00 39.16 N ATOM 3719 CA SER A 275 5.618 61.703 0.086 1.00 39.22 C ATOM 3720 C SER A 275 7.026 61.492 0.692 1.00 39.45 C ATOM 3721 O SER A 275 7.471 62.292 1.512 1.00 38.76 O ATOM 3722 CB SER A 275 4.556 60.923 0.861 1.00 39.25 C ATOM 3723 OG SER A 275 3.285 61.553 0.691 1.00 40.08 O ATOM 3724 HA SER A 275 5.438 62.774 0.183 1.00 0.00 H ATOM 3725 HB2 SER A 275 4.816 60.908 1.919 1.00 0.00 H ATOM 3726 HB3 SER A 275 4.509 59.901 0.485 1.00 0.00 H ATOM 3727 HG SER A 275 3.330 62.481 1.033 1.00 0.00 H ATOM 3728 H SER A 275 4.998 60.557 -1.665 1.00 0.00 H ATOM 3729 N ALA A 276 7.713 60.418 0.298 1.00 40.26 N ATOM 3730 CA ALA A 276 9.113 60.210 0.706 1.00 40.42 C ATOM 3731 C ALA A 276 9.921 61.397 0.208 1.00 40.75 C ATOM 3732 O ALA A 276 10.599 62.089 1.001 1.00 41.43 O ATOM 3733 CB ALA A 276 9.662 58.930 0.142 1.00 40.44 C ATOM 3734 HA ALA A 276 9.172 60.132 1.792 1.00 0.00 H ATOM 3735 HB1 ALA A 276 9.067 58.091 0.502 1.00 0.00 H ATOM 3736 HB2 ALA A 276 9.619 58.966 -0.947 1.00 0.00 H ATOM 3737 HB3 ALA A 276 10.697 58.808 0.462 1.00 0.00 H ATOM 3738 H ALA A 276 7.250 59.713 -0.310 1.00 0.00 H ATOM 3739 N TRP A 277 9.793 61.687 -1.086 1.00 40.37 N ATOM 3740 CA TRP A 277 10.548 62.789 -1.671 1.00 40.06 C ATOM 3741 C TRP A 277 10.310 64.063 -0.887 1.00 39.10 C ATOM 3742 O TRP A 277 11.239 64.818 -0.657 1.00 39.40 O ATOM 3743 CB TRP A 277 10.224 63.030 -3.176 1.00 41.07 C ATOM 3744 CG TRP A 277 10.805 62.031 -4.089 1.00 40.84 C ATOM 3745 CD1 TRP A 277 10.154 61.013 -4.675 1.00 42.85 C ATOM 3746 CD2 TRP A 277 12.158 61.944 -4.518 1.00 43.60 C ATOM 3747 NE1 TRP A 277 11.005 60.266 -5.443 1.00 43.57 N ATOM 3748 CE2 TRP A 277 12.253 60.815 -5.364 1.00 44.32 C ATOM 3749 CE3 TRP A 277 13.313 62.697 -4.260 1.00 43.47 C ATOM 3750 CZ2 TRP A 277 13.447 60.416 -5.950 1.00 43.62 C ATOM 3751 CZ3 TRP A 277 14.490 62.302 -4.835 1.00 43.43 C ATOM 3752 CH2 TRP A 277 14.552 61.165 -5.679 1.00 43.55 C ATOM 3753 HA TRP A 277 11.598 62.503 -1.615 1.00 0.00 H ATOM 3754 HB2 TRP A 277 9.141 63.016 -3.299 1.00 0.00 H ATOM 3755 HB3 TRP A 277 10.607 64.011 -3.455 1.00 0.00 H ATOM 3756 HE1 TRP A 277 10.745 59.423 -5.994 1.00 0.00 H ATOM 3757 HD1 TRP A 277 9.090 60.809 -4.555 1.00 0.00 H ATOM 3758 HZ2 TRP A 277 13.498 59.541 -6.599 1.00 0.00 H ATOM 3759 HH2 TRP A 277 15.507 60.883 -6.122 1.00 0.00 H ATOM 3760 HZ3 TRP A 277 15.398 62.873 -4.640 1.00 0.00 H ATOM 3761 HE3 TRP A 277 13.274 63.576 -3.617 1.00 0.00 H ATOM 3762 H TRP A 277 9.152 61.125 -1.682 1.00 0.00 H ATOM 3763 N ASN A 278 9.073 64.327 -0.499 1.00 38.08 N ATOM 3764 CA ASN A 278 8.796 65.551 0.262 1.00 37.89 C ATOM 3765 C ASN A 278 9.393 65.486 1.711 1.00 38.68 C ATOM 3766 O ASN A 278 9.863 66.483 2.282 1.00 37.81 O ATOM 3767 CB ASN A 278 7.284 65.822 0.272 1.00 37.23 C ATOM 3768 CG ASN A 278 6.715 66.241 -1.133 1.00 37.50 C ATOM 3769 OD1 ASN A 278 7.443 66.388 -2.113 1.00 39.45 O ATOM 3770 ND2 ASN A 278 5.410 66.420 -1.208 1.00 34.96 N ATOM 3771 HA ASN A 278 9.292 66.387 -0.231 1.00 0.00 H ATOM 3772 HB2 ASN A 278 6.772 64.916 0.596 1.00 0.00 H ATOM 3773 HB3 ASN A 278 7.081 66.625 0.981 1.00 0.00 H ATOM 3774 HD22 ASN A 278 4.818 66.289 -0.363 1.00 0.00 H ATOM 3775 HD21 ASN A 278 4.974 66.692 -2.112 1.00 0.00 H ATOM 3776 H ASN A 278 8.301 63.671 -0.732 1.00 0.00 H ATOM 3777 N TYR A 279 9.395 64.308 2.301 1.00 39.42 N ATOM 3778 CA TYR A 279 9.929 64.182 3.637 1.00 41.22 C ATOM 3779 C TYR A 279 11.446 64.396 3.619 1.00 42.04 C ATOM 3780 O TYR A 279 11.989 65.141 4.458 1.00 41.06 O ATOM 3781 CB TYR A 279 9.596 62.804 4.201 1.00 42.02 C ATOM 3782 CG TYR A 279 10.091 62.570 5.608 1.00 43.28 C ATOM 3783 CD1 TYR A 279 9.499 63.211 6.680 1.00 41.89 C ATOM 3784 CD2 TYR A 279 11.129 61.655 5.873 1.00 45.20 C ATOM 3785 CE1 TYR A 279 9.913 62.967 7.972 1.00 43.58 C ATOM 3786 CE2 TYR A 279 11.553 61.400 7.195 1.00 44.16 C ATOM 3787 CZ TYR A 279 10.931 62.067 8.231 1.00 44.18 C ATOM 3788 OH TYR A 279 11.316 61.871 9.539 1.00 45.01 O ATOM 3789 HA TYR A 279 9.477 64.942 4.274 1.00 0.00 H ATOM 3790 HB3 TYR A 279 10.045 62.052 3.552 1.00 0.00 H ATOM 3791 HB2 TYR A 279 8.512 62.686 4.196 1.00 0.00 H ATOM 3792 HD2 TYR A 279 11.612 61.136 5.045 1.00 0.00 H ATOM 3793 HE2 TYR A 279 12.356 60.690 7.394 1.00 0.00 H ATOM 3794 HE1 TYR A 279 9.433 63.489 8.799 1.00 0.00 H ATOM 3795 HD1 TYR A 279 8.692 63.921 6.501 1.00 0.00 H ATOM 3796 HH TYR A 279 10.758 62.432 10.134 1.00 0.00 H ATOM 3797 H TYR A 279 9.015 63.475 1.808 1.00 0.00 H ATOM 3798 N LEU A 280 12.095 63.733 2.641 1.00 42.95 N ATOM 3799 CA LEU A 280 13.535 63.862 2.389 1.00 43.55 C ATOM 3800 C LEU A 280 13.969 65.286 2.284 1.00 42.92 C ATOM 3801 O LEU A 280 14.901 65.701 2.968 1.00 43.17 O ATOM 3802 CB LEU A 280 13.944 63.141 1.123 1.00 43.92 C ATOM 3803 CG LEU A 280 15.461 63.084 0.916 1.00 46.15 C ATOM 3804 CD1 LEU A 280 16.098 62.069 1.877 1.00 45.66 C ATOM 3805 CD2 LEU A 280 15.769 62.734 -0.571 1.00 47.30 C ATOM 3806 HA LEU A 280 14.026 63.406 3.249 1.00 0.00 H ATOM 3807 HB2 LEU A 280 13.563 62.121 1.168 1.00 0.00 H ATOM 3808 HB3 LEU A 280 13.498 63.657 0.272 1.00 0.00 H ATOM 3809 HG LEU A 280 15.895 64.059 1.138 1.00 0.00 H ATOM 3810 HD21 LEU A 280 15.332 61.765 -0.813 1.00 0.00 H ATOM 3811 HD22 LEU A 280 15.342 63.499 -1.219 1.00 0.00 H ATOM 3812 HD23 LEU A 280 16.848 62.694 -0.717 1.00 0.00 H ATOM 3813 HD11 LEU A 280 15.891 62.365 2.905 1.00 0.00 H ATOM 3814 HD12 LEU A 280 15.677 61.081 1.691 1.00 0.00 H ATOM 3815 HD13 LEU A 280 17.175 62.043 1.714 1.00 0.00 H ATOM 3816 H LEU A 280 11.545 63.095 2.031 1.00 0.00 H ATOM 3817 N LYS A 281 13.293 66.033 1.427 1.00 43.00 N ATOM 3818 CA LYS A 281 13.568 67.461 1.282 1.00 43.72 C ATOM 3819 C LYS A 281 13.273 68.171 2.576 1.00 43.73 C ATOM 3820 O LYS A 281 13.999 69.062 2.968 1.00 43.76 O ATOM 3821 CB LYS A 281 12.729 68.062 0.164 1.00 43.59 C ATOM 3822 CG LYS A 281 12.731 69.552 0.123 1.00 45.74 C ATOM 3823 CD LYS A 281 12.595 70.073 -1.299 1.00 50.06 C ATOM 3824 CE LYS A 281 11.277 69.641 -1.962 1.00 53.45 C ATOM 3825 NZ LYS A 281 11.150 68.148 -2.351 1.00 55.37 N ATOM 3826 HA LYS A 281 14.621 67.585 1.030 1.00 0.00 H ATOM 3827 HB2 LYS A 281 13.115 67.694 -0.787 1.00 0.00 H ATOM 3828 HB3 LYS A 281 11.700 67.726 0.292 1.00 0.00 H ATOM 3829 HG2 LYS A 281 11.896 69.924 0.718 1.00 0.00 H ATOM 3830 HG3 LYS A 281 13.667 69.917 0.546 1.00 0.00 H ATOM 3831 HD2 LYS A 281 12.635 71.162 -1.278 1.00 0.00 H ATOM 3832 HD3 LYS A 281 13.426 69.692 -1.892 1.00 0.00 H ATOM 3833 HE2 LYS A 281 11.155 70.231 -2.871 1.00 0.00 H ATOM 3834 HE3 LYS A 281 10.468 69.872 -1.269 1.00 0.00 H ATOM 3835 HZ1 LYS A 281 11.901 67.902 -3.028 1.00 0.00 H ATOM 3836 HZ2 LYS A 281 11.244 67.560 -1.499 1.00 0.00 H ATOM 3837 HZ3 LYS A 281 10.221 67.983 -2.787 1.00 0.00 H ATOM 3838 H LYS A 281 12.551 65.595 0.845 1.00 0.00 H ATOM 3839 N GLY A 282 12.197 67.758 3.235 1.00 44.55 N ATOM 3840 CA GLY A 282 11.681 68.466 4.412 1.00 45.03 C ATOM 3841 C GLY A 282 12.672 68.503 5.551 1.00 45.66 C ATOM 3842 O GLY A 282 12.860 69.540 6.187 1.00 44.86 O ATOM 3843 HA3 GLY A 282 10.776 67.963 4.753 1.00 0.00 H ATOM 3844 HA2 GLY A 282 11.440 69.490 4.126 1.00 0.00 H ATOM 3845 H GLY A 282 11.703 66.904 2.906 1.00 0.00 H ATOM 3846 N ILE A 283 13.310 67.363 5.782 1.00 46.62 N ATOM 3847 CA ILE A 283 14.284 67.241 6.844 1.00 48.24 C ATOM 3848 C ILE A 283 15.639 67.932 6.561 1.00 49.82 C ATOM 3849 O ILE A 283 16.128 68.649 7.428 1.00 50.70 O ATOM 3850 CB ILE A 283 14.427 65.775 7.294 1.00 47.95 C ATOM 3851 CG1 ILE A 283 15.051 64.879 6.221 1.00 47.49 C ATOM 3852 CG2 ILE A 283 13.063 65.244 7.661 1.00 47.03 C ATOM 3853 CD1 ILE A 283 15.065 63.393 6.629 1.00 46.89 C ATOM 3854 HA ILE A 283 13.886 67.808 7.686 1.00 0.00 H ATOM 3855 HB ILE A 283 15.100 65.758 8.151 1.00 0.00 H ATOM 3856 HG12 ILE A 283 14.477 64.984 5.300 1.00 0.00 H ATOM 3857 HG13 ILE A 283 16.077 65.204 6.047 1.00 0.00 H ATOM 3858 HD11 ILE A 283 15.644 63.274 7.545 1.00 0.00 H ATOM 3859 HD12 ILE A 283 14.043 63.054 6.798 1.00 0.00 H ATOM 3860 HD13 ILE A 283 15.518 62.803 5.832 1.00 0.00 H ATOM 3861 HG21 ILE A 283 12.648 65.842 8.473 1.00 0.00 H ATOM 3862 HG22 ILE A 283 12.406 65.302 6.793 1.00 0.00 H ATOM 3863 HG23 ILE A 283 13.153 64.206 7.981 1.00 0.00 H ATOM 3864 H ILE A 283 13.105 66.537 5.185 1.00 0.00 H ATOM 3865 N LEU A 284 16.174 67.806 5.341 1.00 51.29 N ATOM 3866 CA LEU A 284 17.510 68.338 4.974 1.00 52.00 C ATOM 3867 C LEU A 284 17.569 69.811 4.597 1.00 54.17 C ATOM 3868 O LEU A 284 18.632 70.427 4.657 1.00 55.26 O ATOM 3869 CB LEU A 284 18.072 67.574 3.783 1.00 51.61 C ATOM 3870 CG LEU A 284 18.032 66.066 3.902 1.00 51.01 C ATOM 3871 CD1 LEU A 284 18.347 65.446 2.577 1.00 49.42 C ATOM 3872 CD2 LEU A 284 18.968 65.574 5.011 1.00 50.71 C ATOM 3873 HA LEU A 284 18.086 68.212 5.890 1.00 0.00 H ATOM 3874 HB2 LEU A 284 17.499 67.857 2.900 1.00 0.00 H ATOM 3875 HB3 LEU A 284 19.112 67.874 3.651 1.00 0.00 H ATOM 3876 HG LEU A 284 17.027 65.756 4.187 1.00 0.00 H ATOM 3877 HD21 LEU A 284 19.990 65.879 4.784 1.00 0.00 H ATOM 3878 HD22 LEU A 284 18.661 66.007 5.963 1.00 0.00 H ATOM 3879 HD23 LEU A 284 18.917 64.487 5.072 1.00 0.00 H ATOM 3880 HD11 LEU A 284 17.611 65.770 1.841 1.00 0.00 H ATOM 3881 HD12 LEU A 284 19.342 65.757 2.259 1.00 0.00 H ATOM 3882 HD13 LEU A 284 18.317 64.360 2.669 1.00 0.00 H ATOM 3883 H LEU A 284 15.624 67.309 4.611 1.00 0.00 H ATOM 3884 N GLN A 285 16.456 70.366 4.156 1.00 56.36 N ATOM 3885 CA GLN A 285 16.419 71.756 3.646 1.00 58.61 C ATOM 3886 C GLN A 285 16.571 72.780 4.778 1.00 59.30 C ATOM 3887 O GLN A 285 17.016 73.901 4.557 1.00 59.43 O ATOM 3888 CB GLN A 285 15.120 72.013 2.848 1.00 58.13 C ATOM 3889 CG GLN A 285 13.870 72.073 3.723 1.00 59.06 C ATOM 3890 CD GLN A 285 12.562 72.053 2.921 1.00 60.07 C ATOM 3891 OE1 GLN A 285 12.557 72.183 1.685 1.00 60.27 O ATOM 3892 NE2 GLN A 285 11.440 71.912 3.634 1.00 61.86 N ATOM 3893 HA GLN A 285 17.269 71.880 2.974 1.00 0.00 H ATOM 3894 HB2 GLN A 285 15.220 72.963 2.322 1.00 0.00 H ATOM 3895 HB3 GLN A 285 14.996 71.209 2.123 1.00 0.00 H ATOM 3896 HG2 GLN A 285 13.877 71.215 4.395 1.00 0.00 H ATOM 3897 HG3 GLN A 285 13.902 72.992 4.309 1.00 0.00 H ATOM 3898 HE22 GLN A 285 11.490 71.806 4.667 1.00 0.00 H ATOM 3899 HE21 GLN A 285 10.517 71.908 3.155 1.00 0.00 H ATOM 3900 H GLN A 285 15.577 69.810 4.167 1.00 0.00 H ATOM 3901 N ASP A 286 16.161 72.374 5.975 1.00 61.01 N ATOM 3902 CA ASP A 286 16.431 73.101 7.218 1.00 62.68 C ATOM 3903 C ASP A 286 17.813 73.711 7.153 1.00 62.49 C ATOM 3904 O ASP A 286 17.958 74.926 6.970 1.00 62.39 O ATOM 3905 CB ASP A 286 16.357 72.122 8.416 1.00 63.62 C ATOM 3906 CG ASP A 286 16.098 72.825 9.745 1.00 66.29 C ATOM 3907 OD1 ASP A 286 14.937 73.263 9.956 1.00 69.76 O ATOM 3908 OD2 ASP A 286 17.027 72.896 10.590 1.00 69.76 O ATOM 3909 HA ASP A 286 15.689 73.889 7.346 1.00 0.00 H ATOM 3910 HB2 ASP A 286 15.550 71.412 8.235 1.00 0.00 H ATOM 3911 HB3 ASP A 286 17.303 71.585 8.485 1.00 0.00 H ATOM 3912 H ASP A 286 15.617 71.489 6.033 1.00 0.00 H ATOM 3913 N ARG A 287 18.806 72.816 7.224 1.00 62.13 N ATOM 3914 CA ARG A 287 20.231 73.164 7.269 1.00 61.96 C ATOM 3915 C ARG A 287 20.863 73.659 5.940 1.00 61.11 C ATOM 3916 O ARG A 287 21.960 74.199 5.961 1.00 60.86 O ATOM 3917 CB ARG A 287 21.032 71.953 7.790 1.00 61.92 C ATOM 3918 HA ARG A 287 20.286 74.022 7.939 1.00 0.00 H ATOM 3919 HB2 ARG A 287 20.686 71.694 8.791 1.00 0.00 H ATOM 3920 HB3 ARG A 287 20.883 71.105 7.121 1.00 0.00 H ATOM 3921 H ARG A 287 18.551 71.808 7.249 1.00 0.00 H ATOM 3922 N GLY A 288 20.183 73.479 4.808 1.00 59.88 N ATOM 3923 CA GLY A 288 20.739 73.823 3.499 1.00 59.52 C ATOM 3924 C GLY A 288 21.273 72.571 2.813 1.00 59.17 C ATOM 3925 O GLY A 288 22.203 71.934 3.326 1.00 59.66 O ATOM 3926 HA3 GLY A 288 21.551 74.538 3.628 1.00 0.00 H ATOM 3927 HA2 GLY A 288 19.959 74.269 2.881 1.00 0.00 H ATOM 3928 H GLY A 288 19.224 73.080 4.857 1.00 0.00 H ATOM 3929 N LEU A 289 20.696 72.220 1.657 1.00 57.92 N ATOM 3930 CA LEU A 289 20.991 70.945 0.951 1.00 57.03 C ATOM 3931 C LEU A 289 22.453 70.754 0.504 1.00 56.65 C ATOM 3932 O LEU A 289 22.901 69.628 0.336 1.00 55.36 O ATOM 3933 CB LEU A 289 20.098 70.797 -0.286 1.00 56.61 C ATOM 3934 CG LEU A 289 18.628 70.453 -0.046 1.00 56.16 C ATOM 3935 CD1 LEU A 289 17.864 70.318 -1.369 1.00 54.58 C ATOM 3936 CD2 LEU A 289 18.510 69.188 0.767 1.00 54.42 C ATOM 3937 HA LEU A 289 20.789 70.179 1.700 1.00 0.00 H ATOM 3938 HB2 LEU A 289 20.130 71.741 -0.830 1.00 0.00 H ATOM 3939 HB3 LEU A 289 20.523 70.008 -0.906 1.00 0.00 H ATOM 3940 HG LEU A 289 18.178 71.272 0.515 1.00 0.00 H ATOM 3941 HD21 LEU A 289 18.984 68.367 0.230 1.00 0.00 H ATOM 3942 HD22 LEU A 289 19.004 69.328 1.728 1.00 0.00 H ATOM 3943 HD23 LEU A 289 17.457 68.958 0.928 1.00 0.00 H ATOM 3944 HD11 LEU A 289 17.916 71.260 -1.915 1.00 0.00 H ATOM 3945 HD12 LEU A 289 18.313 69.525 -1.967 1.00 0.00 H ATOM 3946 HD13 LEU A 289 16.822 70.073 -1.162 1.00 0.00 H ATOM 3947 H LEU A 289 20.007 72.872 1.231 1.00 0.00 H ATOM 3948 N SER A 290 23.178 71.853 0.313 1.00 56.06 N ATOM 3949 CA SER A 290 24.538 71.782 -0.166 1.00 56.22 C ATOM 3950 C SER A 290 25.536 71.541 0.977 1.00 56.60 C ATOM 3951 O SER A 290 26.734 71.474 0.742 1.00 56.34 O ATOM 3952 CB SER A 290 24.891 73.026 -1.008 1.00 55.99 C ATOM 3953 OG SER A 290 25.108 74.182 -0.233 1.00 53.82 O ATOM 3954 HA SER A 290 24.617 70.916 -0.823 1.00 0.00 H ATOM 3955 HB2 SER A 290 24.070 73.221 -1.698 1.00 0.00 H ATOM 3956 HB3 SER A 290 25.798 72.814 -1.575 1.00 0.00 H ATOM 3957 HG SER A 290 24.288 74.392 0.280 1.00 0.00 H ATOM 3958 H SER A 290 22.756 72.782 0.513 1.00 0.00 H ATOM 3959 N ARG A 291 25.016 71.278 2.150 1.00 56.65 N ATOM 3960 CA ARG A 291 25.809 70.983 3.297 1.00 56.85 C ATOM 3961 C ARG A 291 26.045 69.500 3.277 1.00 56.69 C ATOM 3962 O ARG A 291 26.866 68.980 3.987 1.00 56.72 O ATOM 3963 CB ARG A 291 25.075 71.456 4.549 1.00 20.00 C ATOM 3964 CG ARG A 291 25.581 70.897 5.852 1.00 20.00 C ATOM 3965 CD ARG A 291 24.561 71.017 6.960 1.00 20.00 C ATOM 3966 NE ARG A 291 25.104 70.532 8.214 1.00 20.00 N ATOM 3967 CZ ARG A 291 25.964 71.209 8.947 1.00 20.00 C ATOM 3968 NH1 ARG A 291 26.350 72.409 8.564 1.00 20.00 N ATOM 3969 NH2 ARG A 291 26.423 70.693 10.052 1.00 20.00 N ATOM 3970 HA ARG A 291 26.770 71.497 3.295 1.00 0.00 H ATOM 3971 HB2 ARG A 291 25.157 72.542 4.596 1.00 0.00 H ATOM 3972 HB3 ARG A 291 24.026 71.176 4.449 1.00 0.00 H ATOM 3973 HG2 ARG A 291 25.824 69.844 5.711 1.00 0.00 H ATOM 3974 HG3 ARG A 291 26.480 71.441 6.142 1.00 0.00 H ATOM 3975 HD2 ARG A 291 23.680 70.430 6.701 1.00 0.00 H ATOM 3976 HD3 ARG A 291 24.278 72.063 7.074 1.00 0.00 H ATOM 3977 HE ARG A 291 24.798 69.598 8.553 1.00 0.00 H ATOM 3978 HH12 ARG A 291 27.029 72.946 9.141 1.00 0.00 H ATOM 3979 HH11 ARG A 291 25.976 72.820 7.685 1.00 0.00 H ATOM 3980 HH22 ARG A 291 27.102 71.226 10.632 1.00 0.00 H ATOM 3981 HH21 ARG A 291 26.110 69.748 10.354 1.00 0.00 H ATOM 3982 H ARG A 291 23.981 71.285 2.249 1.00 0.00 H ATOM 3983 N TYR A 292 25.325 68.835 2.401 1.00 56.26 N ATOM 3984 CA TYR A 292 25.433 67.389 2.199 1.00 56.46 C ATOM 3985 C TYR A 292 25.904 67.012 0.770 1.00 56.05 C ATOM 3986 O TYR A 292 25.102 66.767 -0.116 1.00 54.42 O ATOM 3987 CB TYR A 292 24.092 66.762 2.539 1.00 56.72 C ATOM 3988 CG TYR A 292 23.614 67.167 3.908 1.00 57.23 C ATOM 3989 CD1 TYR A 292 22.835 68.297 4.090 1.00 58.51 C ATOM 3990 CD2 TYR A 292 23.980 66.447 5.030 1.00 58.63 C ATOM 3991 CE1 TYR A 292 22.410 68.691 5.376 1.00 59.34 C ATOM 3992 CE2 TYR A 292 23.554 66.821 6.318 1.00 59.36 C ATOM 3993 CZ TYR A 292 22.762 67.943 6.485 1.00 58.99 C ATOM 3994 OH TYR A 292 22.337 68.321 7.751 1.00 58.40 O ATOM 3995 HA TYR A 292 26.205 66.997 2.861 1.00 0.00 H ATOM 3996 HB3 TYR A 292 24.192 65.677 2.507 1.00 0.00 H ATOM 3997 HB2 TYR A 292 23.356 67.080 1.800 1.00 0.00 H ATOM 3998 HD2 TYR A 292 24.614 65.568 4.914 1.00 0.00 H ATOM 3999 HE2 TYR A 292 23.848 66.227 7.183 1.00 0.00 H ATOM 4000 HE1 TYR A 292 21.802 69.588 5.496 1.00 0.00 H ATOM 4001 HD1 TYR A 292 22.545 68.893 3.224 1.00 0.00 H ATOM 4002 HH TYR A 292 23.125 68.501 8.322 1.00 0.00 H ATOM 4003 H TYR A 292 24.643 69.364 1.821 1.00 0.00 H ATOM 4004 N PRO A 293 27.234 66.954 0.559 1.00 56.79 N ATOM 4005 CA PRO A 293 27.790 66.861 -0.790 1.00 56.98 C ATOM 4006 C PRO A 293 27.679 65.491 -1.438 1.00 57.14 C ATOM 4007 O PRO A 293 27.672 65.424 -2.669 1.00 57.54 O ATOM 4008 CB PRO A 293 29.245 67.252 -0.593 1.00 57.28 C ATOM 4009 CG PRO A 293 29.547 66.840 0.793 1.00 57.76 C ATOM 4010 CD PRO A 293 28.296 66.983 1.580 1.00 57.10 C ATOM 4011 HA PRO A 293 27.236 67.499 -1.478 1.00 0.00 H ATOM 4012 HD3 PRO A 293 28.182 66.158 2.283 1.00 0.00 H ATOM 4013 HD2 PRO A 293 28.285 67.927 2.125 1.00 0.00 H ATOM 4014 HG3 PRO A 293 30.326 67.478 1.211 1.00 0.00 H ATOM 4015 HG2 PRO A 293 29.882 65.803 0.809 1.00 0.00 H ATOM 4016 HB2 PRO A 293 29.886 66.727 -1.301 1.00 0.00 H ATOM 4017 HB3 PRO A 293 29.376 68.327 -0.714 1.00 0.00 H ATOM 4018 N ASN A 294 27.563 64.425 -0.639 1.00 57.08 N ATOM 4019 CA ASN A 294 27.265 63.073 -1.159 1.00 57.00 C ATOM 4020 C ASN A 294 25.871 62.919 -1.799 1.00 57.37 C ATOM 4021 O ASN A 294 25.622 62.017 -2.620 1.00 56.46 O ATOM 4022 CB ASN A 294 27.431 62.028 -0.054 1.00 56.41 C ATOM 4023 CG ASN A 294 28.869 61.844 0.353 1.00 55.16 C ATOM 4024 OD1 ASN A 294 29.788 62.339 -0.308 1.00 52.07 O ATOM 4025 ND2 ASN A 294 29.080 61.128 1.440 1.00 51.68 N ATOM 4026 HA ASN A 294 27.987 62.913 -1.960 1.00 0.00 H ATOM 4027 HB2 ASN A 294 26.859 62.346 0.817 1.00 0.00 H ATOM 4028 HB3 ASN A 294 27.044 61.074 -0.413 1.00 0.00 H ATOM 4029 HD22 ASN A 294 28.275 60.730 1.965 1.00 0.00 H ATOM 4030 HD21 ASN A 294 30.051 60.961 1.772 1.00 0.00 H ATOM 4031 H ASN A 294 27.687 64.551 0.386 1.00 0.00 H ATOM 4032 N LEU A 295 24.972 63.807 -1.407 1.00 58.42 N ATOM 4033 CA LEU A 295 23.577 63.724 -1.802 1.00 59.39 C ATOM 4034 C LEU A 295 23.468 63.861 -3.318 1.00 59.67 C ATOM 4035 O LEU A 295 22.911 62.986 -3.994 1.00 58.78 O ATOM 4036 CB LEU A 295 22.782 64.827 -1.078 1.00 59.64 C ATOM 4037 CG LEU A 295 21.258 64.715 -0.933 1.00 60.38 C ATOM 4038 CD1 LEU A 295 20.786 63.288 -0.585 1.00 58.51 C ATOM 4039 CD2 LEU A 295 20.804 65.736 0.126 1.00 59.38 C ATOM 4040 HA LEU A 295 23.159 62.757 -1.520 1.00 0.00 H ATOM 4041 HB2 LEU A 295 23.189 64.896 -0.069 1.00 0.00 H ATOM 4042 HB3 LEU A 295 22.979 65.757 -1.612 1.00 0.00 H ATOM 4043 HG LEU A 295 20.797 64.937 -1.896 1.00 0.00 H ATOM 4044 HD21 LEU A 295 21.290 65.513 1.076 1.00 0.00 H ATOM 4045 HD22 LEU A 295 21.079 66.740 -0.198 1.00 0.00 H ATOM 4046 HD23 LEU A 295 19.722 65.675 0.247 1.00 0.00 H ATOM 4047 HD11 LEU A 295 21.094 62.602 -1.374 1.00 0.00 H ATOM 4048 HD12 LEU A 295 21.232 62.980 0.361 1.00 0.00 H ATOM 4049 HD13 LEU A 295 19.700 63.277 -0.497 1.00 0.00 H ATOM 4050 H LEU A 295 25.275 64.591 -0.795 1.00 0.00 H ATOM 4051 N LEU A 296 24.044 64.939 -3.845 1.00 60.41 N ATOM 4052 CA LEU A 296 23.999 65.187 -5.271 1.00 61.44 C ATOM 4053 C LEU A 296 24.298 63.926 -6.088 1.00 63.64 C ATOM 4054 O LEU A 296 23.519 63.549 -6.964 1.00 64.28 O ATOM 4055 CB LEU A 296 24.957 66.314 -5.642 1.00 61.32 C ATOM 4056 CG LEU A 296 25.162 66.530 -7.136 1.00 60.88 C ATOM 4057 CD1 LEU A 296 23.813 66.554 -7.817 1.00 59.49 C ATOM 4058 CD2 LEU A 296 25.953 67.823 -7.429 1.00 60.91 C ATOM 4059 HA LEU A 296 22.982 65.491 -5.519 1.00 0.00 H ATOM 4060 HB2 LEU A 296 24.568 67.240 -5.218 1.00 0.00 H ATOM 4061 HB3 LEU A 296 25.927 66.092 -5.198 1.00 0.00 H ATOM 4062 HG LEU A 296 25.758 65.707 -7.530 1.00 0.00 H ATOM 4063 HD21 LEU A 296 25.407 68.679 -7.032 1.00 0.00 H ATOM 4064 HD22 LEU A 296 26.933 67.763 -6.955 1.00 0.00 H ATOM 4065 HD23 LEU A 296 26.075 67.936 -8.506 1.00 0.00 H ATOM 4066 HD11 LEU A 296 23.305 65.605 -7.648 1.00 0.00 H ATOM 4067 HD12 LEU A 296 23.214 67.366 -7.405 1.00 0.00 H ATOM 4068 HD13 LEU A 296 23.950 66.708 -8.887 1.00 0.00 H ATOM 4069 H LEU A 296 24.534 65.614 -3.223 1.00 0.00 H ATOM 4070 N ASN A 297 25.402 63.254 -5.789 1.00 65.90 N ATOM 4071 CA ASN A 297 25.804 62.091 -6.583 1.00 67.63 C ATOM 4072 C ASN A 297 24.989 60.865 -6.254 1.00 68.09 C ATOM 4073 O ASN A 297 24.705 60.094 -7.137 1.00 68.59 O ATOM 4074 CB ASN A 297 27.292 61.753 -6.431 1.00 68.54 C ATOM 4075 CG ASN A 297 28.127 62.940 -5.962 1.00 70.27 C ATOM 4076 OD1 ASN A 297 28.005 63.379 -4.804 1.00 70.89 O ATOM 4077 ND2 ASN A 297 28.985 63.456 -6.843 1.00 69.77 N ATOM 4078 HA ASN A 297 25.617 62.379 -7.618 1.00 0.00 H ATOM 4079 HB2 ASN A 297 27.393 60.948 -5.704 1.00 0.00 H ATOM 4080 HB3 ASN A 297 27.673 61.419 -7.396 1.00 0.00 H ATOM 4081 HD22 ASN A 297 29.052 63.055 -7.800 1.00 0.00 H ATOM 4082 HD21 ASN A 297 29.588 64.259 -6.573 1.00 0.00 H ATOM 4083 H ASN A 297 25.987 63.556 -4.984 1.00 0.00 H ATOM 4084 N GLN A 298 24.621 60.655 -4.996 1.00 68.87 N ATOM 4085 CA GLN A 298 23.795 59.486 -4.669 1.00 69.50 C ATOM 4086 C GLN A 298 22.440 59.496 -5.414 1.00 69.36 C ATOM 4087 O GLN A 298 21.897 58.442 -5.762 1.00 68.98 O ATOM 4088 CB GLN A 298 23.611 59.349 -3.160 1.00 69.44 C ATOM 4089 CG GLN A 298 24.872 58.863 -2.481 1.00 70.15 C ATOM 4090 CD GLN A 298 24.692 58.581 -1.008 1.00 70.45 C ATOM 4091 OE1 GLN A 298 23.620 58.155 -0.576 1.00 70.75 O ATOM 4092 NE2 GLN A 298 25.748 58.806 -0.224 1.00 69.27 N ATOM 4093 HA GLN A 298 24.332 58.605 -5.020 1.00 0.00 H ATOM 4094 HB2 GLN A 298 23.340 60.321 -2.748 1.00 0.00 H ATOM 4095 HB3 GLN A 298 22.809 58.637 -2.965 1.00 0.00 H ATOM 4096 HG2 GLN A 298 25.197 57.945 -2.971 1.00 0.00 H ATOM 4097 HG3 GLN A 298 25.642 59.626 -2.595 1.00 0.00 H ATOM 4098 HE22 GLN A 298 26.633 59.166 -0.634 1.00 0.00 H ATOM 4099 HE21 GLN A 298 25.686 58.621 0.798 1.00 0.00 H ATOM 4100 H GLN A 298 24.916 61.314 -4.247 1.00 0.00 H ATOM 4101 N LEU A 299 21.917 60.688 -5.688 1.00 69.40 N ATOM 4102 CA LEU A 299 20.702 60.815 -6.496 1.00 69.36 C ATOM 4103 C LEU A 299 21.003 60.530 -7.967 1.00 70.52 C ATOM 4104 O LEU A 299 20.287 59.752 -8.623 1.00 70.04 O ATOM 4105 CB LEU A 299 20.060 62.210 -6.340 1.00 68.61 C ATOM 4106 CG LEU A 299 19.391 62.577 -5.003 1.00 66.32 C ATOM 4107 CD1 LEU A 299 18.681 63.891 -5.164 1.00 65.05 C ATOM 4108 CD2 LEU A 299 18.429 61.536 -4.506 1.00 62.98 C ATOM 4109 HA LEU A 299 19.987 60.077 -6.133 1.00 0.00 H ATOM 4110 HB2 LEU A 299 20.845 62.945 -6.517 1.00 0.00 H ATOM 4111 HB3 LEU A 299 19.298 62.300 -7.114 1.00 0.00 H ATOM 4112 HG LEU A 299 20.180 62.643 -4.254 1.00 0.00 H ATOM 4113 HD21 LEU A 299 17.635 61.396 -5.240 1.00 0.00 H ATOM 4114 HD22 LEU A 299 18.959 60.595 -4.358 1.00 0.00 H ATOM 4115 HD23 LEU A 299 17.997 61.864 -3.560 1.00 0.00 H ATOM 4116 HD11 LEU A 299 19.402 64.660 -5.441 1.00 0.00 H ATOM 4117 HD12 LEU A 299 17.925 63.801 -5.944 1.00 0.00 H ATOM 4118 HD13 LEU A 299 18.203 64.162 -4.223 1.00 0.00 H ATOM 4119 H LEU A 299 22.379 61.545 -5.322 1.00 0.00 H ATOM 4120 N LEU A 300 22.069 61.146 -8.475 1.00 71.91 N ATOM 4121 CA LEU A 300 22.488 60.912 -9.854 1.00 73.11 C ATOM 4122 C LEU A 300 22.679 59.420 -10.154 1.00 74.93 C ATOM 4123 O LEU A 300 22.499 59.008 -11.294 1.00 75.50 O ATOM 4124 CB LEU A 300 23.748 61.698 -10.182 1.00 72.85 C ATOM 4125 CG LEU A 300 23.615 63.222 -10.182 1.00 71.84 C ATOM 4126 CD1 LEU A 300 24.986 63.863 -10.230 1.00 70.14 C ATOM 4127 CD2 LEU A 300 22.762 63.709 -11.330 1.00 69.87 C ATOM 4128 HA LEU A 300 21.684 61.269 -10.498 1.00 0.00 H ATOM 4129 HB2 LEU A 300 24.507 61.431 -9.447 1.00 0.00 H ATOM 4130 HB3 LEU A 300 24.081 61.393 -11.174 1.00 0.00 H ATOM 4131 HG LEU A 300 23.116 63.514 -9.258 1.00 0.00 H ATOM 4132 HD21 LEU A 300 23.216 63.404 -12.273 1.00 0.00 H ATOM 4133 HD22 LEU A 300 21.765 63.277 -11.249 1.00 0.00 H ATOM 4134 HD23 LEU A 300 22.693 64.796 -11.294 1.00 0.00 H ATOM 4135 HD11 LEU A 300 25.561 63.553 -9.358 1.00 0.00 H ATOM 4136 HD12 LEU A 300 25.501 63.548 -11.137 1.00 0.00 H ATOM 4137 HD13 LEU A 300 24.879 64.948 -10.230 1.00 0.00 H ATOM 4138 H LEU A 300 22.612 61.804 -7.880 1.00 0.00 H ATOM 4139 N ASP A 301 23.001 58.613 -9.145 1.00 76.74 N ATOM 4140 CA ASP A 301 23.080 57.153 -9.316 1.00 78.75 C ATOM 4141 C ASP A 301 21.732 56.442 -9.455 1.00 79.28 C ATOM 4142 O ASP A 301 21.648 55.402 -10.096 1.00 79.76 O ATOM 4143 CB ASP A 301 23.859 56.508 -8.166 1.00 79.24 C ATOM 4144 CG ASP A 301 25.325 56.898 -8.161 1.00 80.41 C ATOM 4145 OD1 ASP A 301 25.804 57.402 -9.212 1.00 78.47 O ATOM 4146 OD2 ASP A 301 25.979 56.717 -7.093 1.00 81.69 O ATOM 4147 HA ASP A 301 23.601 57.023 -10.265 1.00 0.00 H ATOM 4148 HB2 ASP A 301 23.411 56.821 -7.223 1.00 0.00 H ATOM 4149 HB3 ASP A 301 23.786 55.424 -8.260 1.00 0.00 H ATOM 4150 H ASP A 301 23.202 59.025 -8.211 1.00 0.00 H ATOM 4151 N LEU A 302 20.686 56.983 -8.846 1.00 79.78 N ATOM 4152 CA LEU A 302 19.354 56.368 -8.933 1.00 79.91 C ATOM 4153 C LEU A 302 18.672 56.617 -10.290 1.00 80.26 C ATOM 4154 O LEU A 302 17.727 55.919 -10.641 1.00 80.07 O ATOM 4155 CB LEU A 302 18.472 56.890 -7.799 1.00 79.51 C ATOM 4156 CG LEU A 302 18.592 56.267 -6.401 1.00 78.63 C ATOM 4157 CD1 LEU A 302 17.459 55.303 -6.126 1.00 78.44 C ATOM 4158 CD2 LEU A 302 19.904 55.574 -6.231 1.00 79.23 C ATOM 4159 HA LEU A 302 19.487 55.290 -8.839 1.00 0.00 H ATOM 4160 HB2 LEU A 302 18.688 57.953 -7.692 1.00 0.00 H ATOM 4161 HB3 LEU A 302 17.437 56.761 -8.116 1.00 0.00 H ATOM 4162 HG LEU A 302 18.532 57.082 -5.680 1.00 0.00 H ATOM 4163 HD21 LEU A 302 19.994 54.782 -6.975 1.00 0.00 H ATOM 4164 HD22 LEU A 302 20.713 56.293 -6.363 1.00 0.00 H ATOM 4165 HD23 LEU A 302 19.959 55.143 -5.231 1.00 0.00 H ATOM 4166 HD11 LEU A 302 16.509 55.834 -6.188 1.00 0.00 H ATOM 4167 HD12 LEU A 302 17.478 54.502 -6.865 1.00 0.00 H ATOM 4168 HD13 LEU A 302 17.577 54.881 -5.128 1.00 0.00 H ATOM 4169 H LEU A 302 20.810 57.858 -8.297 1.00 0.00 H ATOM 4170 N GLN A 303 19.177 57.598 -11.038 1.00 80.91 N ATOM 4171 CA GLN A 303 18.602 58.067 -12.321 1.00 81.43 C ATOM 4172 C GLN A 303 18.324 56.983 -13.394 1.00 82.53 C ATOM 4173 O GLN A 303 17.187 56.850 -13.872 1.00 82.18 O ATOM 4174 CB GLN A 303 19.524 59.143 -12.924 1.00 81.22 C ATOM 4175 CG GLN A 303 18.814 60.198 -13.733 1.00 80.59 C ATOM 4176 CD GLN A 303 18.978 61.593 -13.163 1.00 80.54 C ATOM 4177 OE1 GLN A 303 18.018 62.344 -13.057 1.00 81.67 O ATOM 4178 NE2 GLN A 303 20.204 61.955 -12.817 1.00 81.59 N ATOM 4179 HA GLN A 303 17.618 58.453 -12.055 1.00 0.00 H ATOM 4180 HB2 GLN A 303 20.049 59.637 -12.107 1.00 0.00 H ATOM 4181 HB3 GLN A 303 20.247 58.647 -13.572 1.00 0.00 H ATOM 4182 HG2 GLN A 303 19.215 60.187 -14.746 1.00 0.00 H ATOM 4183 HG3 GLN A 303 17.751 59.957 -13.762 1.00 0.00 H ATOM 4184 HE22 GLN A 303 20.993 61.286 -12.923 1.00 0.00 H ATOM 4185 HE21 GLN A 303 20.378 62.908 -12.439 1.00 0.00 H ATOM 4186 H GLN A 303 20.039 58.069 -10.696 1.00 0.00 H ATOM 4187 N PRO A 304 19.359 56.206 -13.777 1.00 83.60 N ATOM 4188 CA PRO A 304 19.186 55.226 -14.857 1.00 84.06 C ATOM 4189 C PRO A 304 18.027 54.263 -14.639 1.00 83.57 C ATOM 4190 O PRO A 304 17.357 53.905 -15.584 1.00 83.94 O ATOM 4191 CB PRO A 304 20.518 54.440 -14.834 1.00 84.65 C ATOM 4192 CG PRO A 304 21.112 54.710 -13.489 1.00 84.48 C ATOM 4193 CD PRO A 304 20.725 56.143 -13.228 1.00 83.86 C ATOM 4194 HA PRO A 304 18.957 55.725 -15.799 1.00 0.00 H ATOM 4195 HD3 PRO A 304 20.732 56.366 -12.161 1.00 0.00 H ATOM 4196 HD2 PRO A 304 21.391 56.833 -13.747 1.00 0.00 H ATOM 4197 HG3 PRO A 304 22.196 54.594 -13.509 1.00 0.00 H ATOM 4198 HG2 PRO A 304 20.690 54.046 -12.734 1.00 0.00 H ATOM 4199 HB2 PRO A 304 20.335 53.373 -14.964 1.00 0.00 H ATOM 4200 HB3 PRO A 304 21.183 54.792 -15.623 1.00 0.00 H ATOM 4201 N SER A 305 17.825 53.843 -13.398 1.00 82.92 N ATOM 4202 CA SER A 305 16.862 52.797 -13.050 1.00 82.50 C ATOM 4203 C SER A 305 15.701 53.285 -12.159 1.00 80.78 C ATOM 4204 O SER A 305 14.876 52.475 -11.730 1.00 81.05 O ATOM 4205 CB SER A 305 17.611 51.650 -12.343 1.00 83.13 C ATOM 4206 OG SER A 305 18.587 52.155 -11.433 1.00 83.77 O ATOM 4207 HA SER A 305 16.406 52.462 -13.982 1.00 0.00 H ATOM 4208 HB2 SER A 305 18.108 51.034 -13.093 1.00 0.00 H ATOM 4209 HB3 SER A 305 16.893 51.042 -11.793 1.00 0.00 H ATOM 4210 HG SER A 305 18.140 52.711 -10.747 1.00 0.00 H ATOM 4211 H SER A 305 18.379 54.279 -12.633 1.00 0.00 H ATOM 4212 N HIS A 306 15.646 54.588 -11.866 1.00 78.39 N ATOM 4213 CA HIS A 306 14.605 55.144 -10.986 1.00 76.29 C ATOM 4214 C HIS A 306 14.257 56.585 -11.256 1.00 73.68 C ATOM 4215 O HIS A 306 13.866 57.280 -10.316 1.00 72.87 O ATOM 4216 CB HIS A 306 15.021 55.157 -9.502 1.00 76.49 C ATOM 4217 CG HIS A 306 15.519 53.862 -8.982 1.00 77.09 C ATOM 4218 ND1 HIS A 306 16.862 53.593 -8.843 1.00 78.96 N ATOM 4219 CD2 HIS A 306 14.860 52.774 -8.530 1.00 77.55 C ATOM 4220 CE1 HIS A 306 17.011 52.384 -8.335 1.00 79.66 C ATOM 4221 NE2 HIS A 306 15.810 51.868 -8.131 1.00 79.66 N ATOM 4222 HA HIS A 306 13.764 54.483 -11.195 1.00 0.00 H ATOM 4223 HB2 HIS A 306 15.811 55.898 -9.378 1.00 0.00 H ATOM 4224 HB3 HIS A 306 14.154 55.449 -8.910 1.00 0.00 H ATOM 4225 HD2 HIS A 306 13.779 52.641 -8.490 1.00 0.00 H ATOM 4226 HE1 HIS A 306 17.961 51.894 -8.120 1.00 0.00 H ATOM 4227 H HIS A 306 16.359 55.227 -12.271 1.00 0.00 H ATOM 4228 N SER A 307 14.397 57.086 -12.475 1.00 71.43 N ATOM 4229 CA SER A 307 14.071 58.513 -12.644 1.00 69.34 C ATOM 4230 C SER A 307 12.563 58.783 -12.330 1.00 66.57 C ATOM 4231 O SER A 307 11.701 57.891 -12.315 1.00 65.92 O ATOM 4232 CB SER A 307 14.501 59.102 -14.017 1.00 69.73 C ATOM 4233 OG SER A 307 15.027 60.434 -13.882 1.00 70.04 O ATOM 4234 HA SER A 307 14.673 59.051 -11.912 1.00 0.00 H ATOM 4235 HB2 SER A 307 13.634 59.129 -14.677 1.00 0.00 H ATOM 4236 HB3 SER A 307 15.268 58.461 -14.452 1.00 0.00 H ATOM 4237 HG SER A 307 15.290 60.776 -14.773 1.00 0.00 H ATOM 4238 H SER A 307 14.721 56.501 -13.272 1.00 0.00 H ATOM 4239 N SER A 308 12.295 60.033 -12.021 1.00 62.88 N ATOM 4240 CA SER A 308 10.975 60.497 -11.797 1.00 59.99 C ATOM 4241 C SER A 308 11.169 61.977 -11.926 1.00 57.41 C ATOM 4242 O SER A 308 12.287 62.448 -11.769 1.00 56.39 O ATOM 4243 CB SER A 308 10.513 60.128 -10.381 1.00 59.97 C ATOM 4244 OG SER A 308 10.932 61.079 -9.405 1.00 59.10 O ATOM 4245 HA SER A 308 10.223 60.082 -12.468 1.00 0.00 H ATOM 4246 HB2 SER A 308 10.927 59.154 -10.121 1.00 0.00 H ATOM 4247 HB3 SER A 308 9.424 60.073 -10.371 1.00 0.00 H ATOM 4248 HG SER A 308 10.611 60.797 -8.512 1.00 0.00 H ATOM 4249 H SER A 308 13.083 60.707 -11.938 1.00 0.00 H ATOM 4250 N PRO A 309 10.087 62.722 -12.209 1.00 55.11 N ATOM 4251 CA PRO A 309 10.142 64.192 -12.108 1.00 53.74 C ATOM 4252 C PRO A 309 10.573 64.714 -10.711 1.00 52.94 C ATOM 4253 O PRO A 309 11.106 65.838 -10.606 1.00 52.42 O ATOM 4254 CB PRO A 309 8.711 64.619 -12.414 1.00 53.39 C ATOM 4255 CG PRO A 309 8.056 63.447 -13.051 1.00 53.40 C ATOM 4256 CD PRO A 309 8.763 62.231 -12.634 1.00 54.44 C ATOM 4257 HA PRO A 309 10.892 64.601 -12.785 1.00 0.00 H ATOM 4258 HD3 PRO A 309 8.245 61.745 -11.807 1.00 0.00 H ATOM 4259 HD2 PRO A 309 8.856 61.531 -13.465 1.00 0.00 H ATOM 4260 HG3 PRO A 309 8.102 63.545 -14.136 1.00 0.00 H ATOM 4261 HG2 PRO A 309 7.014 63.392 -12.736 1.00 0.00 H ATOM 4262 HB2 PRO A 309 8.192 64.889 -11.494 1.00 0.00 H ATOM 4263 HB3 PRO A 309 8.708 65.470 -13.095 1.00 0.00 H ATOM 4264 N TYR A 310 10.357 63.918 -9.652 1.00 51.97 N ATOM 4265 CA TYR A 310 10.662 64.387 -8.300 1.00 51.24 C ATOM 4266 C TYR A 310 12.158 64.321 -8.058 1.00 51.03 C ATOM 4267 O TYR A 310 12.709 65.171 -7.337 1.00 50.90 O ATOM 4268 CB TYR A 310 9.935 63.590 -7.215 1.00 51.31 C ATOM 4269 CG TYR A 310 8.477 63.390 -7.484 1.00 51.17 C ATOM 4270 CD1 TYR A 310 8.028 62.161 -7.923 1.00 51.20 C ATOM 4271 CD2 TYR A 310 7.552 64.431 -7.333 1.00 51.48 C ATOM 4272 CE1 TYR A 310 6.714 61.932 -8.199 1.00 50.82 C ATOM 4273 CE2 TYR A 310 6.202 64.217 -7.607 1.00 50.62 C ATOM 4274 CZ TYR A 310 5.800 62.939 -8.044 1.00 51.48 C ATOM 4275 OH TYR A 310 4.498 62.611 -8.358 1.00 52.51 O ATOM 4276 HA TYR A 310 10.310 65.417 -8.236 1.00 0.00 H ATOM 4277 HB3 TYR A 310 10.040 64.122 -6.269 1.00 0.00 H ATOM 4278 HB2 TYR A 310 10.407 62.611 -7.134 1.00 0.00 H ATOM 4279 HD2 TYR A 310 7.889 65.413 -7.000 1.00 0.00 H ATOM 4280 HE2 TYR A 310 5.474 65.019 -7.486 1.00 0.00 H ATOM 4281 HE1 TYR A 310 6.391 60.949 -8.542 1.00 0.00 H ATOM 4282 HD1 TYR A 310 8.745 61.351 -8.053 1.00 0.00 H ATOM 4283 HH TYR A 310 4.456 61.663 -8.639 1.00 0.00 H ATOM 4284 H TYR A 310 9.971 62.963 -9.793 1.00 0.00 H ATOM 4285 N LEU A 311 12.797 63.305 -8.634 1.00 50.68 N ATOM 4286 CA LEU A 311 14.237 63.195 -8.575 1.00 50.77 C ATOM 4287 C LEU A 311 14.849 64.385 -9.280 1.00 50.44 C ATOM 4288 O LEU A 311 15.709 65.059 -8.725 1.00 49.88 O ATOM 4289 CB LEU A 311 14.731 61.885 -9.196 1.00 51.14 C ATOM 4290 CG LEU A 311 16.244 61.612 -9.032 1.00 51.28 C ATOM 4291 CD1 LEU A 311 16.519 60.131 -8.968 1.00 50.92 C ATOM 4292 CD2 LEU A 311 17.048 62.229 -10.155 1.00 51.16 C ATOM 4293 HA LEU A 311 14.545 63.186 -7.530 1.00 0.00 H ATOM 4294 HB2 LEU A 311 14.187 61.064 -8.730 1.00 0.00 H ATOM 4295 HB3 LEU A 311 14.506 61.910 -10.262 1.00 0.00 H ATOM 4296 HG LEU A 311 16.552 62.075 -8.094 1.00 0.00 H ATOM 4297 HD21 LEU A 311 16.724 61.808 -11.106 1.00 0.00 H ATOM 4298 HD22 LEU A 311 16.892 63.308 -10.162 1.00 0.00 H ATOM 4299 HD23 LEU A 311 18.106 62.015 -10.003 1.00 0.00 H ATOM 4300 HD11 LEU A 311 15.990 59.701 -8.117 1.00 0.00 H ATOM 4301 HD12 LEU A 311 16.175 59.659 -9.888 1.00 0.00 H ATOM 4302 HD13 LEU A 311 17.590 59.966 -8.853 1.00 0.00 H ATOM 4303 H LEU A 311 12.250 62.577 -9.136 1.00 0.00 H ATOM 4304 N ILE A 312 14.372 64.679 -10.482 1.00 50.56 N ATOM 4305 CA ILE A 312 14.959 65.785 -11.242 1.00 50.98 C ATOM 4306 C ILE A 312 14.813 67.114 -10.504 1.00 50.05 C ATOM 4307 O ILE A 312 15.720 67.946 -10.555 1.00 50.90 O ATOM 4308 CB ILE A 312 14.387 65.952 -12.679 1.00 51.46 C ATOM 4309 CG1 ILE A 312 14.189 64.629 -13.410 1.00 52.69 C ATOM 4310 CG2 ILE A 312 15.355 66.780 -13.504 1.00 51.55 C ATOM 4311 CD1 ILE A 312 15.443 63.753 -13.384 1.00 53.38 C ATOM 4312 HA ILE A 312 16.011 65.514 -11.337 1.00 0.00 H ATOM 4313 HB ILE A 312 13.413 66.430 -12.568 1.00 0.00 H ATOM 4314 HG12 ILE A 312 13.372 64.085 -12.935 1.00 0.00 H ATOM 4315 HG13 ILE A 312 13.929 64.838 -14.448 1.00 0.00 H ATOM 4316 HD11 ILE A 312 16.265 64.283 -13.865 1.00 0.00 H ATOM 4317 HD12 ILE A 312 15.708 63.530 -12.350 1.00 0.00 H ATOM 4318 HD13 ILE A 312 15.247 62.824 -13.919 1.00 0.00 H ATOM 4319 HG21 ILE A 312 15.479 67.759 -13.041 1.00 0.00 H ATOM 4320 HG22 ILE A 312 16.319 66.273 -13.548 1.00 0.00 H ATOM 4321 HG23 ILE A 312 14.960 66.901 -14.513 1.00 0.00 H ATOM 4322 H ILE A 312 13.586 64.128 -10.882 1.00 0.00 H ATOM 4323 N ALA A 313 13.683 67.308 -9.827 1.00 49.10 N ATOM 4324 CA ALA A 313 13.376 68.567 -9.127 1.00 48.61 C ATOM 4325 C ALA A 313 14.173 68.732 -7.843 1.00 48.72 C ATOM 4326 O ALA A 313 14.479 69.855 -7.385 1.00 47.73 O ATOM 4327 CB ALA A 313 11.898 68.627 -8.824 1.00 47.97 C ATOM 4328 HA ALA A 313 13.661 69.386 -9.788 1.00 0.00 H ATOM 4329 HB1 ALA A 313 11.335 68.582 -9.756 1.00 0.00 H ATOM 4330 HB2 ALA A 313 11.623 67.783 -8.192 1.00 0.00 H ATOM 4331 HB3 ALA A 313 11.672 69.559 -8.306 1.00 0.00 H ATOM 4332 H ALA A 313 12.986 66.537 -9.791 1.00 0.00 H ATOM 4333 N PHE A 314 14.482 67.597 -7.228 1.00 49.41 N ATOM 4334 CA PHE A 314 15.313 67.612 -6.049 1.00 49.94 C ATOM 4335 C PHE A 314 16.724 68.039 -6.494 1.00 49.93 C ATOM 4336 O PHE A 314 17.354 68.865 -5.843 1.00 50.21 O ATOM 4337 CB PHE A 314 15.274 66.249 -5.349 1.00 51.14 C ATOM 4338 CG PHE A 314 15.652 66.308 -3.897 1.00 53.24 C ATOM 4339 CD1 PHE A 314 14.694 66.144 -2.905 1.00 54.90 C ATOM 4340 CD2 PHE A 314 16.977 66.552 -3.515 1.00 55.13 C ATOM 4341 CE1 PHE A 314 15.050 66.209 -1.545 1.00 55.49 C ATOM 4342 CE2 PHE A 314 17.332 66.620 -2.165 1.00 56.10 C ATOM 4343 CZ PHE A 314 16.363 66.447 -1.178 1.00 55.05 C ATOM 4344 HA PHE A 314 14.953 68.324 -5.306 1.00 0.00 H ATOM 4345 HB2 PHE A 314 14.262 65.850 -5.426 1.00 0.00 H ATOM 4346 HB3 PHE A 314 15.967 65.579 -5.859 1.00 0.00 H ATOM 4347 HD2 PHE A 314 17.741 66.691 -4.280 1.00 0.00 H ATOM 4348 HE2 PHE A 314 18.368 66.809 -1.883 1.00 0.00 H ATOM 4349 HZ PHE A 314 16.638 66.499 -0.124 1.00 0.00 H ATOM 4350 HE1 PHE A 314 14.288 66.071 -0.777 1.00 0.00 H ATOM 4351 HD1 PHE A 314 13.656 65.963 -3.183 1.00 0.00 H ATOM 4352 H PHE A 314 14.124 66.693 -7.598 1.00 0.00 H ATOM 4353 N LEU A 315 17.200 67.536 -7.635 1.00 49.55 N ATOM 4354 CA LEU A 315 18.463 68.043 -8.178 1.00 49.47 C ATOM 4355 C LEU A 315 18.398 69.551 -8.361 1.00 49.36 C ATOM 4356 O LEU A 315 19.295 70.266 -7.902 1.00 50.79 O ATOM 4357 CB LEU A 315 18.841 67.387 -9.499 1.00 49.30 C ATOM 4358 CG LEU A 315 19.067 65.885 -9.492 1.00 49.16 C ATOM 4359 CD1 LEU A 315 19.311 65.386 -10.900 1.00 47.49 C ATOM 4360 CD2 LEU A 315 20.204 65.505 -8.530 1.00 49.26 C ATOM 4361 HA LEU A 315 19.235 67.790 -7.452 1.00 0.00 H ATOM 4362 HB2 LEU A 315 18.040 67.594 -10.209 1.00 0.00 H ATOM 4363 HB3 LEU A 315 19.762 67.855 -9.846 1.00 0.00 H ATOM 4364 HG LEU A 315 18.168 65.392 -9.123 1.00 0.00 H ATOM 4365 HD21 LEU A 315 21.124 65.997 -8.845 1.00 0.00 H ATOM 4366 HD22 LEU A 315 19.947 65.826 -7.521 1.00 0.00 H ATOM 4367 HD23 LEU A 315 20.345 64.424 -8.545 1.00 0.00 H ATOM 4368 HD11 LEU A 315 18.444 65.614 -11.520 1.00 0.00 H ATOM 4369 HD12 LEU A 315 20.193 65.878 -11.311 1.00 0.00 H ATOM 4370 HD13 LEU A 315 19.471 64.308 -10.879 1.00 0.00 H ATOM 4371 H LEU A 315 16.678 66.789 -8.136 1.00 0.00 H ATOM 4372 N VAL A 316 17.356 70.063 -9.003 1.00 48.43 N ATOM 4373 CA VAL A 316 17.281 71.517 -9.153 1.00 48.18 C ATOM 4374 C VAL A 316 17.394 72.236 -7.794 1.00 48.44 C ATOM 4375 O VAL A 316 18.003 73.296 -7.720 1.00 49.04 O ATOM 4376 CB VAL A 316 16.048 71.995 -9.965 1.00 47.63 C ATOM 4377 CG1 VAL A 316 15.949 73.473 -9.932 1.00 46.15 C ATOM 4378 CG2 VAL A 316 16.137 71.544 -11.424 1.00 47.14 C ATOM 4379 HA VAL A 316 18.148 71.800 -9.749 1.00 0.00 H ATOM 4380 HB VAL A 316 15.164 71.551 -9.506 1.00 0.00 H ATOM 4381 HG11 VAL A 316 15.845 73.806 -8.899 1.00 0.00 H ATOM 4382 HG12 VAL A 316 16.850 73.906 -10.366 1.00 0.00 H ATOM 4383 HG13 VAL A 316 15.079 73.790 -10.506 1.00 0.00 H ATOM 4384 HG21 VAL A 316 17.036 71.961 -11.878 1.00 0.00 H ATOM 4385 HG22 VAL A 316 16.180 70.456 -11.465 1.00 0.00 H ATOM 4386 HG23 VAL A 316 15.258 71.895 -11.966 1.00 0.00 H ATOM 4387 H VAL A 316 16.612 69.447 -9.389 1.00 0.00 H ATOM 4388 N ASP A 317 16.874 71.645 -6.719 1.00 48.94 N ATOM 4389 CA ASP A 317 16.973 72.255 -5.365 1.00 49.61 C ATOM 4390 C ASP A 317 18.408 72.236 -4.768 1.00 49.66 C ATOM 4391 O ASP A 317 18.848 73.226 -4.164 1.00 48.47 O ATOM 4392 CB ASP A 317 16.006 71.563 -4.385 1.00 50.18 C ATOM 4393 CG ASP A 317 14.573 72.050 -4.513 1.00 52.64 C ATOM 4394 OD1 ASP A 317 14.398 73.290 -4.598 1.00 55.42 O ATOM 4395 OD2 ASP A 317 13.634 71.199 -4.503 1.00 55.77 O ATOM 4396 HA ASP A 317 16.698 73.301 -5.498 1.00 0.00 H ATOM 4397 HB2 ASP A 317 16.026 70.490 -4.578 1.00 0.00 H ATOM 4398 HB3 ASP A 317 16.348 71.755 -3.368 1.00 0.00 H ATOM 4399 H ASP A 317 16.386 70.733 -6.829 1.00 0.00 H ATOM 4400 N ILE A 318 19.114 71.116 -4.943 1.00 50.32 N ATOM 4401 CA ILE A 318 20.556 71.020 -4.602 1.00 51.45 C ATOM 4402 C ILE A 318 21.388 72.058 -5.358 1.00 52.81 C ATOM 4403 O ILE A 318 22.162 72.810 -4.747 1.00 52.75 O ATOM 4404 CB ILE A 318 21.168 69.614 -4.890 1.00 51.96 C ATOM 4405 CG1 ILE A 318 20.497 68.516 -4.046 1.00 51.32 C ATOM 4406 CG2 ILE A 318 22.682 69.616 -4.624 1.00 51.00 C ATOM 4407 CD1 ILE A 318 20.742 67.077 -4.580 1.00 50.54 C ATOM 4408 HA ILE A 318 20.597 71.207 -3.529 1.00 0.00 H ATOM 4409 HB ILE A 318 20.986 69.395 -5.942 1.00 0.00 H ATOM 4410 HG12 ILE A 318 20.887 68.577 -3.030 1.00 0.00 H ATOM 4411 HG13 ILE A 318 19.423 68.700 -4.033 1.00 0.00 H ATOM 4412 HD11 ILE A 318 20.347 66.994 -5.593 1.00 0.00 H ATOM 4413 HD12 ILE A 318 21.812 66.871 -4.588 1.00 0.00 H ATOM 4414 HD13 ILE A 318 20.238 66.360 -3.932 1.00 0.00 H ATOM 4415 HG21 ILE A 318 23.162 70.350 -5.272 1.00 0.00 H ATOM 4416 HG22 ILE A 318 22.866 69.874 -3.581 1.00 0.00 H ATOM 4417 HG23 ILE A 318 23.087 68.626 -4.831 1.00 0.00 H ATOM 4418 H ILE A 318 18.636 70.279 -5.333 1.00 0.00 H ATOM 4419 N TYR A 319 21.211 72.132 -6.674 1.00 54.25 N ATOM 4420 CA TYR A 319 21.938 73.139 -7.444 1.00 55.83 C ATOM 4421 C TYR A 319 21.623 74.543 -6.973 1.00 57.31 C ATOM 4422 O TYR A 319 22.518 75.387 -6.919 1.00 57.00 O ATOM 4423 CB TYR A 319 21.647 73.028 -8.936 1.00 56.04 C ATOM 4424 CG TYR A 319 22.095 71.724 -9.587 1.00 55.93 C ATOM 4425 CD1 TYR A 319 21.353 71.157 -10.631 1.00 56.26 C ATOM 4426 CD2 TYR A 319 23.258 71.068 -9.176 1.00 54.76 C ATOM 4427 CE1 TYR A 319 21.756 69.964 -11.243 1.00 56.62 C ATOM 4428 CE2 TYR A 319 23.665 69.891 -9.772 1.00 55.77 C ATOM 4429 CZ TYR A 319 22.918 69.340 -10.805 1.00 56.63 C ATOM 4430 OH TYR A 319 23.339 68.169 -11.387 1.00 56.24 O ATOM 4431 HA TYR A 319 22.997 72.944 -7.278 1.00 0.00 H ATOM 4432 HB3 TYR A 319 22.154 73.850 -9.441 1.00 0.00 H ATOM 4433 HB2 TYR A 319 20.571 73.125 -9.079 1.00 0.00 H ATOM 4434 HD2 TYR A 319 23.855 71.493 -8.370 1.00 0.00 H ATOM 4435 HE2 TYR A 319 24.573 69.394 -9.432 1.00 0.00 H ATOM 4436 HE1 TYR A 319 21.167 69.531 -12.051 1.00 0.00 H ATOM 4437 HD1 TYR A 319 20.445 71.654 -10.973 1.00 0.00 H ATOM 4438 HH TYR A 319 22.704 67.910 -12.101 1.00 0.00 H ATOM 4439 H TYR A 319 20.559 71.477 -7.152 1.00 0.00 H ATOM 4440 N GLU A 320 20.363 74.818 -6.618 1.00 59.06 N ATOM 4441 CA GLU A 320 20.058 76.170 -6.155 1.00 60.43 C ATOM 4442 C GLU A 320 20.822 76.512 -4.893 1.00 60.58 C ATOM 4443 O GLU A 320 21.353 77.619 -4.787 1.00 60.21 O ATOM 4444 CB GLU A 320 18.572 76.452 -5.908 1.00 60.86 C ATOM 4445 CG GLU A 320 18.335 77.995 -5.781 1.00 62.15 C ATOM 4446 CD GLU A 320 17.263 78.413 -4.791 1.00 65.45 C ATOM 4447 OE1 GLU A 320 16.121 77.891 -4.899 1.00 67.80 O ATOM 4448 OE2 GLU A 320 17.557 79.298 -3.935 1.00 67.64 O ATOM 4449 HA GLU A 320 20.372 76.802 -6.986 1.00 0.00 H ATOM 4450 HB2 GLU A 320 17.987 76.064 -6.742 1.00 0.00 H ATOM 4451 HB3 GLU A 320 18.259 75.961 -4.986 1.00 0.00 H ATOM 4452 HG2 GLU A 320 19.274 78.455 -5.473 1.00 0.00 H ATOM 4453 HG3 GLU A 320 18.051 78.373 -6.763 1.00 0.00 H ATOM 4454 H GLU A 320 19.622 74.090 -6.670 1.00 0.00 H ATOM 4455 N ASP A 321 20.854 75.580 -3.938 1.00 60.77 N ATOM 4456 CA ASP A 321 21.560 75.824 -2.682 1.00 61.51 C ATOM 4457 C ASP A 321 23.059 75.967 -2.921 1.00 62.15 C ATOM 4458 O ASP A 321 23.681 76.846 -2.349 1.00 61.70 O ATOM 4459 CB ASP A 321 21.272 74.741 -1.650 1.00 61.33 C ATOM 4460 CG ASP A 321 21.730 75.134 -0.255 1.00 63.88 C ATOM 4461 OD1 ASP A 321 21.855 76.363 0.005 1.00 66.29 O ATOM 4462 OD2 ASP A 321 21.980 74.218 0.585 1.00 65.53 O ATOM 4463 HA ASP A 321 21.187 76.764 -2.276 1.00 0.00 H ATOM 4464 HB2 ASP A 321 20.198 74.556 -1.627 1.00 0.00 H ATOM 4465 HB3 ASP A 321 21.791 73.829 -1.945 1.00 0.00 H ATOM 4466 H ASP A 321 20.372 74.671 -4.089 1.00 0.00 H ATOM 4467 N MET A 322 23.623 75.151 -3.804 1.00 63.30 N ATOM 4468 CA MET A 322 25.042 75.279 -4.136 1.00 64.85 C ATOM 4469 C MET A 322 25.368 76.685 -4.614 1.00 66.89 C ATOM 4470 O MET A 322 26.297 77.304 -4.105 1.00 66.91 O ATOM 4471 CB MET A 322 25.470 74.220 -5.150 1.00 64.49 C ATOM 4472 CG MET A 322 25.488 72.812 -4.556 1.00 64.26 C ATOM 4473 SD MET A 322 25.601 71.463 -5.759 1.00 63.52 S ATOM 4474 CE MET A 322 27.323 71.711 -6.217 1.00 64.84 C ATOM 4475 HA MET A 322 25.617 75.105 -3.227 1.00 0.00 H ATOM 4476 HB2 MET A 322 24.773 74.237 -5.988 1.00 0.00 H ATOM 4477 HB3 MET A 322 26.471 74.462 -5.506 1.00 0.00 H ATOM 4478 HG2 MET A 322 24.570 72.676 -3.983 1.00 0.00 H ATOM 4479 HG3 MET A 322 26.346 72.740 -3.888 1.00 0.00 H ATOM 4480 HE1 MET A 322 27.447 72.712 -6.629 1.00 0.00 H ATOM 4481 HE2 MET A 322 27.952 71.600 -5.334 1.00 0.00 H ATOM 4482 HE3 MET A 322 27.609 70.971 -6.964 1.00 0.00 H ATOM 4483 H MET A 322 23.051 74.414 -4.264 1.00 0.00 H ATOM 4484 N LEU A 323 24.572 77.199 -5.549 1.00 69.46 N ATOM 4485 CA LEU A 323 24.767 78.550 -6.120 1.00 72.07 C ATOM 4486 C LEU A 323 24.552 79.669 -5.109 1.00 73.96 C ATOM 4487 O LEU A 323 25.176 80.729 -5.189 1.00 74.01 O ATOM 4488 CB LEU A 323 23.824 78.769 -7.303 1.00 72.05 C ATOM 4489 CG LEU A 323 24.187 77.971 -8.554 1.00 72.66 C ATOM 4490 CD1 LEU A 323 22.956 77.397 -9.240 1.00 72.26 C ATOM 4491 CD2 LEU A 323 24.990 78.871 -9.503 1.00 73.75 C ATOM 4492 HA LEU A 323 25.807 78.591 -6.442 1.00 0.00 H ATOM 4493 HB2 LEU A 323 22.818 78.483 -6.995 1.00 0.00 H ATOM 4494 HB3 LEU A 323 23.837 79.829 -7.558 1.00 0.00 H ATOM 4495 HG LEU A 323 24.798 77.117 -8.262 1.00 0.00 H ATOM 4496 HD21 LEU A 323 24.386 79.736 -9.779 1.00 0.00 H ATOM 4497 HD22 LEU A 323 25.899 79.206 -9.002 1.00 0.00 H ATOM 4498 HD23 LEU A 323 25.253 78.309 -10.399 1.00 0.00 H ATOM 4499 HD11 LEU A 323 22.434 76.733 -8.551 1.00 0.00 H ATOM 4500 HD12 LEU A 323 22.293 78.211 -9.535 1.00 0.00 H ATOM 4501 HD13 LEU A 323 23.262 76.838 -10.124 1.00 0.00 H ATOM 4502 H LEU A 323 23.777 76.625 -5.894 1.00 0.00 H ATOM 4503 N GLU A 324 23.647 79.419 -4.173 1.00 76.02 N ATOM 4504 CA GLU A 324 23.375 80.336 -3.080 1.00 78.06 C ATOM 4505 C GLU A 324 24.561 80.436 -2.148 1.00 79.38 C ATOM 4506 O GLU A 324 24.820 81.500 -1.588 1.00 80.00 O ATOM 4507 CB GLU A 324 22.144 79.880 -2.283 1.00 78.15 C ATOM 4508 CG GLU A 324 20.857 80.578 -2.664 1.00 79.21 C ATOM 4509 CD GLU A 324 20.936 82.063 -2.383 1.00 81.71 C ATOM 4510 OE1 GLU A 324 20.904 82.844 -3.368 1.00 82.01 O ATOM 4511 OE2 GLU A 324 21.075 82.438 -1.187 1.00 81.84 O ATOM 4512 HA GLU A 324 23.181 81.316 -3.515 1.00 0.00 H ATOM 4513 HB2 GLU A 324 22.012 78.810 -2.443 1.00 0.00 H ATOM 4514 HB3 GLU A 324 22.334 80.068 -1.226 1.00 0.00 H ATOM 4515 HG2 GLU A 324 20.671 80.426 -3.727 1.00 0.00 H ATOM 4516 HG3 GLU A 324 20.036 80.150 -2.088 1.00 0.00 H ATOM 4517 H GLU A 324 23.110 78.530 -4.223 1.00 0.00 H ATOM 4518 N ASN A 325 25.279 79.327 -1.989 1.00 80.49 N ATOM 4519 CA ASN A 325 26.437 79.274 -1.112 1.00 81.58 C ATOM 4520 C ASN A 325 27.763 79.510 -1.819 1.00 83.16 C ATOM 4521 O ASN A 325 28.804 79.039 -1.356 1.00 83.37 O ATOM 4522 CB ASN A 325 26.423 77.960 -0.359 1.00 81.03 C ATOM 4523 CG ASN A 325 25.444 77.996 0.767 1.00 80.25 C ATOM 4524 OD1 ASN A 325 25.714 78.600 1.797 1.00 80.21 O ATOM 4525 ND2 ASN A 325 24.277 77.407 0.570 1.00 78.99 N ATOM 4526 HA ASN A 325 26.356 80.104 -0.411 1.00 0.00 H ATOM 4527 HB2 ASN A 325 26.147 77.159 -1.045 1.00 0.00 H ATOM 4528 HB3 ASN A 325 27.419 77.768 0.041 1.00 0.00 H ATOM 4529 HD22 ASN A 325 24.092 76.905 -0.322 1.00 0.00 H ATOM 4530 HD21 ASN A 325 23.544 77.446 1.307 1.00 0.00 H ATOM 4531 H ASN A 325 25.003 78.470 -2.509 1.00 0.00 H ATOM 4532 N GLN A 326 27.703 80.273 -2.915 1.00 84.60 N ATOM 4533 CA GLN A 326 28.866 80.677 -3.705 1.00 86.03 C ATOM 4534 C GLN A 326 29.878 79.538 -3.886 1.00 87.06 C ATOM 4535 O GLN A 326 31.004 79.615 -3.396 1.00 87.54 O ATOM 4536 CB GLN A 326 29.521 81.940 -3.105 1.00 86.05 C ATOM 4537 HA GLN A 326 28.510 80.924 -4.705 1.00 0.00 H ATOM 4538 HB2 GLN A 326 28.798 82.755 -3.100 1.00 0.00 H ATOM 4539 HB3 GLN A 326 29.843 81.731 -2.085 1.00 0.00 H ATOM 4540 H GLN A 326 26.767 80.601 -3.227 1.00 0.00 H ATOM 4541 N CYS A 327 29.470 78.486 -4.595 1.00 87.85 N ATOM 4542 CA CYS A 327 30.285 77.274 -4.689 1.00 88.85 C ATOM 4543 C CYS A 327 31.250 77.245 -5.880 1.00 90.05 C ATOM 4544 O CYS A 327 31.215 78.111 -6.765 1.00 90.14 O ATOM 4545 CB CYS A 327 29.396 76.040 -4.748 1.00 88.31 C ATOM 4546 SG CYS A 327 28.436 76.010 -6.251 1.00 88.50 S ATOM 4547 HA CYS A 327 30.898 77.276 -3.788 1.00 0.00 H ATOM 4548 HB2 CYS A 327 28.719 76.047 -3.893 1.00 0.00 H ATOM 4549 HB3 CYS A 327 30.021 75.148 -4.707 1.00 0.00 H ATOM 4550 HG CYS A 327 29.286 75.994 -7.338 1.00 0.00 H ATOM 4551 H CYS A 327 28.556 78.527 -5.090 1.00 0.00 H ATOM 4552 N ASP A 328 32.116 76.237 -5.896 1.00 91.06 N ATOM 4553 CA ASP A 328 33.093 76.083 -6.967 1.00 91.79 C ATOM 4554 C ASP A 328 32.215 76.026 -8.213 1.00 91.50 C ATOM 4555 O ASP A 328 31.209 75.318 -8.243 1.00 91.19 O ATOM 4556 CB ASP A 328 34.089 74.973 -6.629 1.00 91.59 C ATOM 4557 HA ASP A 328 33.815 76.882 -7.136 1.00 0.00 H ATOM 4558 HB2 ASP A 328 34.612 75.224 -5.706 1.00 0.00 H ATOM 4559 HB3 ASP A 328 33.553 74.033 -6.500 1.00 0.00 H ATOM 4560 H ASP A 328 32.096 75.540 -5.124 1.00 0.00 H ATOM 4561 N ASN A 329 32.669 76.566 -9.306 1.00 91.25 N ATOM 4562 CA ASN A 329 31.907 76.565 -10.549 1.00 90.59 C ATOM 4563 C ASN A 329 30.530 77.220 -10.557 1.00 89.30 C ATOM 4564 O ASN A 329 29.510 76.539 -10.665 1.00 88.56 O ATOM 4565 CB ASN A 329 31.796 75.083 -10.912 1.00 90.49 C ATOM 4566 CG ASN A 329 33.146 74.398 -10.983 1.00 90.75 C ATOM 4567 OD1 ASN A 329 34.098 74.933 -11.550 1.00 90.24 O ATOM 4568 ND2 ASN A 329 33.235 73.205 -10.404 1.00 88.92 N ATOM 4569 HA ASN A 329 32.437 77.195 -11.263 1.00 0.00 H ATOM 4570 HB2 ASN A 329 31.190 74.583 -10.157 1.00 0.00 H ATOM 4571 HB3 ASN A 329 31.309 74.997 -11.883 1.00 0.00 H ATOM 4572 HD22 ASN A 329 32.404 72.791 -9.936 1.00 0.00 H ATOM 4573 HD21 ASN A 329 34.136 72.686 -10.419 1.00 0.00 H ATOM 4574 H ASN A 329 33.608 77.014 -9.293 1.00 0.00 H ATOM 4575 N LYS A 330 30.508 78.543 -10.443 1.00 88.13 N ATOM 4576 CA LYS A 330 29.256 79.291 -10.437 1.00 86.61 C ATOM 4577 C LYS A 330 28.743 79.416 -11.867 1.00 84.38 C ATOM 4578 O LYS A 330 28.207 80.453 -12.257 1.00 84.73 O ATOM 4579 CB LYS A 330 29.448 80.680 -9.824 1.00 86.98 C ATOM 4580 CG LYS A 330 28.365 81.075 -8.832 1.00 87.22 C ATOM 4581 CD LYS A 330 27.807 82.454 -9.145 1.00 86.85 C ATOM 4582 CE LYS A 330 26.886 82.941 -8.038 1.00 85.89 C ATOM 4583 NZ LYS A 330 26.252 81.810 -7.305 1.00 83.80 N ATOM 4584 HA LYS A 330 28.528 78.755 -9.828 1.00 0.00 H ATOM 4585 HB2 LYS A 330 30.408 80.697 -9.308 1.00 0.00 H ATOM 4586 HB3 LYS A 330 29.457 81.413 -10.631 1.00 0.00 H ATOM 4587 HG2 LYS A 330 27.557 80.345 -8.879 1.00 0.00 H ATOM 4588 HG3 LYS A 330 28.788 81.082 -7.828 1.00 0.00 H ATOM 4589 HD2 LYS A 330 28.634 83.156 -9.254 1.00 0.00 H ATOM 4590 HD3 LYS A 330 27.247 82.407 -10.079 1.00 0.00 H ATOM 4591 HE2 LYS A 330 26.103 83.560 -8.477 1.00 0.00 H ATOM 4592 HE3 LYS A 330 27.466 83.537 -7.333 1.00 0.00 H ATOM 4593 HZ1 LYS A 330 25.691 81.239 -7.969 1.00 0.00 H ATOM 4594 HZ2 LYS A 330 26.992 81.218 -6.877 1.00 0.00 H ATOM 4595 HZ3 LYS A 330 25.632 82.186 -6.559 1.00 0.00 H ATOM 4596 H LYS A 330 31.407 79.059 -10.356 1.00 0.00 H ATOM 4597 N GLU A 331 28.911 78.351 -12.645 1.00 81.10 N ATOM 4598 CA GLU A 331 28.465 78.339 -14.033 1.00 79.07 C ATOM 4599 C GLU A 331 27.944 76.963 -14.432 1.00 79.34 C ATOM 4600 O GLU A 331 26.735 76.748 -14.521 1.00 79.00 O ATOM 4601 CB GLU A 331 29.603 78.761 -14.966 1.00 79.26 C ATOM 4602 CG GLU A 331 29.137 79.363 -16.281 1.00 78.91 C ATOM 4603 CD GLU A 331 29.975 78.908 -17.459 1.00 79.63 C ATOM 4604 OE1 GLU A 331 31.212 78.820 -17.312 1.00 79.99 O ATOM 4605 OE2 GLU A 331 29.396 78.638 -18.533 1.00 80.37 O ATOM 4606 HA GLU A 331 27.648 79.054 -14.126 1.00 0.00 H ATOM 4607 HB2 GLU A 331 30.214 79.500 -14.448 1.00 0.00 H ATOM 4608 HB3 GLU A 331 30.208 77.882 -15.187 1.00 0.00 H ATOM 4609 HG2 GLU A 331 28.102 79.067 -16.453 1.00 0.00 H ATOM 4610 HG3 GLU A 331 29.196 80.449 -16.209 1.00 0.00 H ATOM 4611 H GLU A 331 29.372 77.505 -12.254 1.00 0.00 H ATOM 4612 N ASP A 332 28.863 76.033 -14.672 1.00 80.31 N ATOM 4613 CA ASP A 332 28.497 74.677 -15.061 1.00 81.22 C ATOM 4614 C ASP A 332 27.293 74.182 -14.266 1.00 79.93 C ATOM 4615 O ASP A 332 26.412 73.513 -14.807 1.00 79.23 O ATOM 4616 CB ASP A 332 29.681 73.727 -14.868 1.00 82.11 C ATOM 4617 CG ASP A 332 29.252 72.277 -14.754 1.00 84.08 C ATOM 4618 OD1 ASP A 332 30.064 71.388 -15.086 1.00 86.92 O ATOM 4619 OD2 ASP A 332 28.103 72.027 -14.334 1.00 87.42 O ATOM 4620 HA ASP A 332 28.225 74.694 -16.116 1.00 0.00 H ATOM 4621 HB2 ASP A 332 30.352 73.827 -15.721 1.00 0.00 H ATOM 4622 HB3 ASP A 332 30.209 74.008 -13.957 1.00 0.00 H ATOM 4623 H ASP A 332 29.869 76.279 -14.580 1.00 0.00 H ATOM 4624 N ILE A 333 27.262 74.516 -12.980 1.00 78.46 N ATOM 4625 CA ILE A 333 26.159 74.106 -12.103 1.00 76.54 C ATOM 4626 C ILE A 333 24.813 74.737 -12.505 1.00 75.52 C ATOM 4627 O ILE A 333 23.821 74.023 -12.695 1.00 74.86 O ATOM 4628 CB ILE A 333 26.483 74.436 -10.610 1.00 76.26 C ATOM 4629 CG1 ILE A 333 27.591 73.521 -10.106 1.00 74.97 C ATOM 4630 CG2 ILE A 333 25.247 74.268 -9.695 1.00 75.09 C ATOM 4631 CD1 ILE A 333 27.154 72.087 -9.883 1.00 72.45 C ATOM 4632 HA ILE A 333 26.057 73.027 -12.219 1.00 0.00 H ATOM 4633 HB ILE A 333 26.799 75.479 -10.573 1.00 0.00 H ATOM 4634 HG12 ILE A 333 28.398 73.524 -10.839 1.00 0.00 H ATOM 4635 HG13 ILE A 333 27.960 73.918 -9.160 1.00 0.00 H ATOM 4636 HD11 ILE A 333 26.355 72.063 -9.142 1.00 0.00 H ATOM 4637 HD12 ILE A 333 26.793 71.668 -10.822 1.00 0.00 H ATOM 4638 HD13 ILE A 333 28.001 71.502 -9.525 1.00 0.00 H ATOM 4639 HG21 ILE A 333 24.456 74.940 -10.028 1.00 0.00 H ATOM 4640 HG22 ILE A 333 24.896 73.238 -9.747 1.00 0.00 H ATOM 4641 HG23 ILE A 333 25.522 74.508 -8.668 1.00 0.00 H ATOM 4642 H ILE A 333 28.040 75.083 -12.585 1.00 0.00 H ATOM 4643 N LEU A 334 24.785 76.061 -12.632 1.00 74.27 N ATOM 4644 CA LEU A 334 23.580 76.759 -13.073 1.00 73.74 C ATOM 4645 C LEU A 334 23.050 76.169 -14.388 1.00 73.60 C ATOM 4646 O LEU A 334 21.849 76.037 -14.588 1.00 73.51 O ATOM 4647 CB LEU A 334 23.835 78.282 -13.185 1.00 73.80 C ATOM 4648 CG LEU A 334 22.808 79.174 -13.925 1.00 73.77 C ATOM 4649 CD1 LEU A 334 21.485 79.150 -13.200 1.00 73.38 C ATOM 4650 CD2 LEU A 334 23.282 80.613 -14.083 1.00 72.72 C ATOM 4651 HA LEU A 334 22.806 76.613 -12.320 1.00 0.00 H ATOM 4652 HB2 LEU A 334 23.915 78.666 -12.168 1.00 0.00 H ATOM 4653 HB3 LEU A 334 24.790 78.407 -13.695 1.00 0.00 H ATOM 4654 HG LEU A 334 22.694 78.760 -14.927 1.00 0.00 H ATOM 4655 HD21 LEU A 334 23.453 81.048 -13.098 1.00 0.00 H ATOM 4656 HD22 LEU A 334 24.210 80.628 -14.655 1.00 0.00 H ATOM 4657 HD23 LEU A 334 22.521 81.189 -14.609 1.00 0.00 H ATOM 4658 HD11 LEU A 334 21.111 78.127 -13.163 1.00 0.00 H ATOM 4659 HD12 LEU A 334 21.621 79.525 -12.186 1.00 0.00 H ATOM 4660 HD13 LEU A 334 20.771 79.781 -13.729 1.00 0.00 H ATOM 4661 H LEU A 334 25.640 76.611 -12.412 1.00 0.00 H ATOM 4662 N ASN A 335 23.968 75.819 -15.272 1.00 73.51 N ATOM 4663 CA ASN A 335 23.634 75.259 -16.567 1.00 73.19 C ATOM 4664 C ASN A 335 23.016 73.893 -16.460 1.00 72.36 C ATOM 4665 O ASN A 335 22.163 73.556 -17.261 1.00 72.14 O ATOM 4666 CB ASN A 335 24.883 75.151 -17.456 1.00 73.74 C ATOM 4667 CG ASN A 335 25.099 76.366 -18.299 1.00 73.30 C ATOM 4668 OD1 ASN A 335 24.276 77.282 -18.333 1.00 70.23 O ATOM 4669 ND2 ASN A 335 26.222 76.387 -18.995 1.00 74.21 N ATOM 4670 HA ASN A 335 22.908 75.940 -17.010 1.00 0.00 H ATOM 4671 HB2 ASN A 335 25.755 75.010 -16.817 1.00 0.00 H ATOM 4672 HB3 ASN A 335 24.771 74.287 -18.111 1.00 0.00 H ATOM 4673 HD22 ASN A 335 26.887 75.589 -18.934 1.00 0.00 H ATOM 4674 HD21 ASN A 335 26.441 77.201 -19.604 1.00 0.00 H ATOM 4675 H ASN A 335 24.971 75.951 -15.029 1.00 0.00 H ATOM 4676 N LYS A 336 23.469 73.082 -15.514 1.00 71.73 N ATOM 4677 CA LYS A 336 22.802 71.820 -15.283 1.00 71.83 C ATOM 4678 C LYS A 336 21.352 72.113 -14.835 1.00 71.08 C ATOM 4679 O LYS A 336 20.418 71.514 -15.337 1.00 69.78 O ATOM 4680 CB LYS A 336 23.552 70.988 -14.248 1.00 72.20 C ATOM 4681 CG LYS A 336 24.964 70.601 -14.691 1.00 73.87 C ATOM 4682 CD LYS A 336 25.397 69.206 -14.216 1.00 73.93 C ATOM 4683 CE LYS A 336 26.911 69.123 -14.113 1.00 74.50 C ATOM 4684 NZ LYS A 336 27.385 67.717 -14.107 1.00 74.79 N ATOM 4685 HA LYS A 336 22.785 71.233 -16.201 1.00 0.00 H ATOM 4686 HB2 LYS A 336 23.624 71.565 -13.326 1.00 0.00 H ATOM 4687 HB3 LYS A 336 22.986 70.076 -14.061 1.00 0.00 H ATOM 4688 HG2 LYS A 336 25.001 70.621 -15.780 1.00 0.00 H ATOM 4689 HG3 LYS A 336 25.664 71.334 -14.291 1.00 0.00 H ATOM 4690 HD2 LYS A 336 24.960 69.009 -13.237 1.00 0.00 H ATOM 4691 HD3 LYS A 336 25.044 68.459 -14.928 1.00 0.00 H ATOM 4692 HE2 LYS A 336 27.230 69.607 -13.190 1.00 0.00 H ATOM 4693 HE3 LYS A 336 27.352 69.641 -14.965 1.00 0.00 H ATOM 4694 HZ1 LYS A 336 26.973 67.217 -13.293 1.00 0.00 H ATOM 4695 HZ2 LYS A 336 27.090 67.249 -14.988 1.00 0.00 H ATOM 4696 HZ3 LYS A 336 28.422 67.702 -14.036 1.00 0.00 H ATOM 4697 H LYS A 336 24.296 73.351 -14.944 1.00 0.00 H ATOM 4698 N ALA A 337 21.218 73.078 -13.921 1.00 70.66 N ATOM 4699 CA ALA A 337 19.949 73.553 -13.376 1.00 70.23 C ATOM 4700 C ALA A 337 18.964 73.984 -14.443 1.00 70.22 C ATOM 4701 O ALA A 337 17.869 73.426 -14.540 1.00 69.64 O ATOM 4702 CB ALA A 337 20.197 74.722 -12.414 1.00 69.99 C ATOM 4703 HA ALA A 337 19.504 72.709 -12.849 1.00 0.00 H ATOM 4704 HB1 ALA A 337 20.837 74.389 -11.597 1.00 0.00 H ATOM 4705 HB2 ALA A 337 20.685 75.536 -12.951 1.00 0.00 H ATOM 4706 HB3 ALA A 337 19.245 75.069 -12.013 1.00 0.00 H ATOM 4707 H ALA A 337 22.087 73.527 -13.569 1.00 0.00 H ATOM 4708 N LEU A 338 19.353 74.987 -15.227 1.00 70.65 N ATOM 4709 CA LEU A 338 18.492 75.514 -16.281 1.00 70.55 C ATOM 4710 C LEU A 338 18.121 74.398 -17.226 1.00 70.72 C ATOM 4711 O LEU A 338 16.985 74.285 -17.634 1.00 70.55 O ATOM 4712 CB LEU A 338 19.161 76.644 -17.051 1.00 70.34 C ATOM 4713 CG LEU A 338 19.472 77.913 -16.259 1.00 69.97 C ATOM 4714 CD1 LEU A 338 20.212 78.875 -17.164 1.00 70.33 C ATOM 4715 CD2 LEU A 338 18.238 78.578 -15.662 1.00 67.50 C ATOM 4716 HA LEU A 338 17.597 75.924 -15.813 1.00 0.00 H ATOM 4717 HB2 LEU A 338 20.101 76.263 -17.450 1.00 0.00 H ATOM 4718 HB3 LEU A 338 18.503 76.920 -17.875 1.00 0.00 H ATOM 4719 HG LEU A 338 20.089 77.629 -15.407 1.00 0.00 H ATOM 4720 HD21 LEU A 338 17.552 78.854 -16.463 1.00 0.00 H ATOM 4721 HD22 LEU A 338 17.745 77.883 -14.983 1.00 0.00 H ATOM 4722 HD23 LEU A 338 18.537 79.472 -15.115 1.00 0.00 H ATOM 4723 HD11 LEU A 338 21.138 78.412 -17.505 1.00 0.00 H ATOM 4724 HD12 LEU A 338 19.587 79.116 -18.024 1.00 0.00 H ATOM 4725 HD13 LEU A 338 20.441 79.787 -16.613 1.00 0.00 H ATOM 4726 H LEU A 338 20.294 75.406 -15.085 1.00 0.00 H ATOM 4727 N GLU A 339 19.072 73.549 -17.552 1.00 71.05 N ATOM 4728 CA GLU A 339 18.777 72.481 -18.467 1.00 71.60 C ATOM 4729 C GLU A 339 17.630 71.657 -17.902 1.00 69.72 C ATOM 4730 O GLU A 339 16.666 71.373 -18.596 1.00 70.17 O ATOM 4731 CB GLU A 339 20.012 71.612 -18.701 1.00 72.17 C ATOM 4732 CG GLU A 339 19.856 70.575 -19.806 1.00 74.33 C ATOM 4733 CD GLU A 339 20.760 69.363 -19.581 1.00 77.03 C ATOM 4734 OE1 GLU A 339 20.466 68.562 -18.659 1.00 77.75 O ATOM 4735 OE2 GLU A 339 21.769 69.225 -20.318 1.00 79.35 O ATOM 4736 HA GLU A 339 18.484 72.895 -19.432 1.00 0.00 H ATOM 4737 HB2 GLU A 339 20.844 72.266 -18.963 1.00 0.00 H ATOM 4738 HB3 GLU A 339 20.241 71.089 -17.773 1.00 0.00 H ATOM 4739 HG2 GLU A 339 18.819 70.241 -19.833 1.00 0.00 H ATOM 4740 HG3 GLU A 339 20.113 71.035 -20.760 1.00 0.00 H ATOM 4741 H GLU A 339 20.027 73.650 -17.152 1.00 0.00 H ATOM 4742 N LEU A 340 17.730 71.298 -16.632 1.00 67.73 N ATOM 4743 CA LEU A 340 16.752 70.419 -15.987 1.00 65.75 C ATOM 4744 C LEU A 340 15.353 71.033 -15.856 1.00 64.23 C ATOM 4745 O LEU A 340 14.375 70.358 -16.149 1.00 63.02 O ATOM 4746 CB LEU A 340 17.247 69.966 -14.610 1.00 65.23 C ATOM 4747 CG LEU A 340 18.285 68.848 -14.614 1.00 64.25 C ATOM 4748 CD1 LEU A 340 18.564 68.431 -13.167 1.00 62.29 C ATOM 4749 CD2 LEU A 340 17.873 67.635 -15.473 1.00 62.91 C ATOM 4750 HA LEU A 340 16.656 69.559 -16.650 1.00 0.00 H ATOM 4751 HB2 LEU A 340 17.687 70.830 -14.111 1.00 0.00 H ATOM 4752 HB3 LEU A 340 16.384 69.620 -14.041 1.00 0.00 H ATOM 4753 HG LEU A 340 19.193 69.235 -15.077 1.00 0.00 H ATOM 4754 HD21 LEU A 340 16.942 67.218 -15.088 1.00 0.00 H ATOM 4755 HD22 LEU A 340 17.730 67.954 -16.505 1.00 0.00 H ATOM 4756 HD23 LEU A 340 18.657 66.878 -15.431 1.00 0.00 H ATOM 4757 HD11 LEU A 340 18.944 69.288 -12.610 1.00 0.00 H ATOM 4758 HD12 LEU A 340 17.641 68.078 -12.708 1.00 0.00 H ATOM 4759 HD13 LEU A 340 19.305 67.632 -13.157 1.00 0.00 H ATOM 4760 H LEU A 340 18.532 71.653 -16.072 1.00 0.00 H ATOM 4761 N CYS A 341 15.274 72.289 -15.418 1.00 62.95 N ATOM 4762 CA CYS A 341 14.036 73.057 -15.471 1.00 62.71 C ATOM 4763 C CYS A 341 13.304 72.906 -16.801 1.00 63.26 C ATOM 4764 O CYS A 341 12.077 72.751 -16.856 1.00 62.78 O ATOM 4765 CB CYS A 341 14.323 74.538 -15.267 1.00 62.45 C ATOM 4766 SG CYS A 341 14.753 74.878 -13.610 1.00 61.71 S ATOM 4767 HA CYS A 341 13.403 72.663 -14.676 1.00 0.00 H ATOM 4768 HB2 CYS A 341 13.434 75.112 -15.528 1.00 0.00 H ATOM 4769 HB3 CYS A 341 15.148 74.833 -15.916 1.00 0.00 H ATOM 4770 HG CYS A 341 15.883 74.161 -13.273 1.00 0.00 H ATOM 4771 H CYS A 341 16.126 72.737 -15.024 1.00 0.00 H ATOM 4772 N GLU A 342 14.091 72.977 -17.867 1.00 63.99 N ATOM 4773 CA GLU A 342 13.597 72.907 -19.217 1.00 64.59 C ATOM 4774 C GLU A 342 13.012 71.535 -19.501 1.00 63.00 C ATOM 4775 O GLU A 342 11.893 71.433 -19.975 1.00 62.58 O ATOM 4776 CB GLU A 342 14.733 73.239 -20.202 1.00 66.17 C ATOM 4777 CG GLU A 342 14.267 73.760 -21.550 1.00 70.09 C ATOM 4778 CD GLU A 342 13.398 75.020 -21.423 1.00 75.91 C ATOM 4779 OE1 GLU A 342 12.342 74.977 -20.730 1.00 77.91 O ATOM 4780 OE2 GLU A 342 13.773 76.059 -22.030 1.00 80.51 O ATOM 4781 HA GLU A 342 12.800 73.640 -19.344 1.00 0.00 H ATOM 4782 HB2 GLU A 342 15.369 73.997 -19.745 1.00 0.00 H ATOM 4783 HB3 GLU A 342 15.314 72.332 -20.370 1.00 0.00 H ATOM 4784 HG2 GLU A 342 15.142 73.998 -22.155 1.00 0.00 H ATOM 4785 HG3 GLU A 342 13.685 72.982 -22.044 1.00 0.00 H ATOM 4786 H GLU A 342 15.114 73.089 -17.720 1.00 0.00 H ATOM 4787 N ILE A 343 13.770 70.488 -19.197 1.00 61.44 N ATOM 4788 CA ILE A 343 13.257 69.130 -19.267 1.00 60.73 C ATOM 4789 C ILE A 343 11.880 69.062 -18.523 1.00 59.40 C ATOM 4790 O ILE A 343 10.909 68.497 -19.036 1.00 59.09 O ATOM 4791 CB ILE A 343 14.340 68.099 -18.754 1.00 60.81 C ATOM 4792 CG1 ILE A 343 15.539 68.088 -19.707 1.00 61.42 C ATOM 4793 CG2 ILE A 343 13.786 66.676 -18.631 1.00 60.21 C ATOM 4794 CD1 ILE A 343 16.512 66.910 -19.522 1.00 61.61 C ATOM 4795 HA ILE A 343 13.063 68.839 -20.299 1.00 0.00 H ATOM 4796 HB ILE A 343 14.643 68.425 -17.759 1.00 0.00 H ATOM 4797 HG12 ILE A 343 15.158 68.054 -20.728 1.00 0.00 H ATOM 4798 HG13 ILE A 343 16.097 69.013 -19.559 1.00 0.00 H ATOM 4799 HD11 ILE A 343 16.918 66.932 -18.511 1.00 0.00 H ATOM 4800 HD12 ILE A 343 15.980 65.972 -19.681 1.00 0.00 H ATOM 4801 HD13 ILE A 343 17.325 66.995 -20.244 1.00 0.00 H ATOM 4802 HG21 ILE A 343 12.956 66.670 -17.924 1.00 0.00 H ATOM 4803 HG22 ILE A 343 13.436 66.338 -19.607 1.00 0.00 H ATOM 4804 HG23 ILE A 343 14.573 66.011 -18.275 1.00 0.00 H ATOM 4805 H ILE A 343 14.755 70.644 -18.902 1.00 0.00 H ATOM 4806 N LEU A 344 11.782 69.707 -17.362 1.00 57.78 N ATOM 4807 CA LEU A 344 10.526 69.736 -16.603 1.00 56.71 C ATOM 4808 C LEU A 344 9.394 70.524 -17.320 1.00 56.87 C ATOM 4809 O LEU A 344 8.315 69.969 -17.551 1.00 56.19 O ATOM 4810 CB LEU A 344 10.758 70.264 -15.176 1.00 55.71 C ATOM 4811 CG LEU A 344 11.700 69.351 -14.384 1.00 53.87 C ATOM 4812 CD1 LEU A 344 12.284 69.998 -13.083 1.00 49.31 C ATOM 4813 CD2 LEU A 344 11.022 67.999 -14.116 1.00 51.32 C ATOM 4814 HA LEU A 344 10.180 68.704 -16.539 1.00 0.00 H ATOM 4815 HB2 LEU A 344 11.196 71.260 -15.234 1.00 0.00 H ATOM 4816 HB3 LEU A 344 9.800 70.319 -14.659 1.00 0.00 H ATOM 4817 HG LEU A 344 12.576 69.186 -15.011 1.00 0.00 H ATOM 4818 HD21 LEU A 344 10.110 68.159 -13.541 1.00 0.00 H ATOM 4819 HD22 LEU A 344 10.776 67.523 -15.065 1.00 0.00 H ATOM 4820 HD23 LEU A 344 11.701 67.359 -13.553 1.00 0.00 H ATOM 4821 HD11 LEU A 344 12.851 70.891 -13.346 1.00 0.00 H ATOM 4822 HD12 LEU A 344 11.466 70.269 -12.415 1.00 0.00 H ATOM 4823 HD13 LEU A 344 12.939 69.283 -12.586 1.00 0.00 H ATOM 4824 H LEU A 344 12.615 70.202 -16.984 1.00 0.00 H ATOM 4825 N ALA A 345 9.643 71.791 -17.671 1.00 56.86 N ATOM 4826 CA ALA A 345 8.642 72.618 -18.353 1.00 57.22 C ATOM 4827 C ALA A 345 8.163 72.025 -19.661 1.00 58.13 C ATOM 4828 O ALA A 345 7.009 72.180 -20.024 1.00 58.60 O ATOM 4829 CB ALA A 345 9.175 73.987 -18.617 1.00 57.22 C ATOM 4830 HA ALA A 345 7.790 72.663 -17.675 1.00 0.00 H ATOM 4831 HB1 ALA A 345 9.438 74.462 -17.672 1.00 0.00 H ATOM 4832 HB2 ALA A 345 10.061 73.915 -19.248 1.00 0.00 H ATOM 4833 HB3 ALA A 345 8.414 74.580 -19.123 1.00 0.00 H ATOM 4834 H ALA A 345 10.574 72.201 -17.454 1.00 0.00 H ATOM 4835 N LYS A 346 9.057 71.343 -20.359 1.00 59.19 N ATOM 4836 CA LYS A 346 8.893 71.035 -21.771 1.00 60.27 C ATOM 4837 C LYS A 346 8.388 69.637 -21.969 1.00 59.72 C ATOM 4838 O LYS A 346 7.618 69.378 -22.878 1.00 59.86 O ATOM 4839 CB LYS A 346 10.269 71.139 -22.444 1.00 61.53 C ATOM 4840 CG LYS A 346 10.289 71.399 -23.931 1.00 65.10 C ATOM 4841 CD LYS A 346 9.983 72.877 -24.263 1.00 69.48 C ATOM 4842 CE LYS A 346 10.922 73.879 -23.559 1.00 70.50 C ATOM 4843 NZ LYS A 346 12.300 73.762 -24.067 1.00 71.90 N ATOM 4844 HA LYS A 346 8.174 71.733 -22.199 1.00 0.00 H ATOM 4845 HB2 LYS A 346 10.811 71.952 -21.961 1.00 0.00 H ATOM 4846 HB3 LYS A 346 10.793 70.200 -22.267 1.00 0.00 H ATOM 4847 HG2 LYS A 346 11.276 71.147 -24.320 1.00 0.00 H ATOM 4848 HG3 LYS A 346 9.540 70.768 -24.409 1.00 0.00 H ATOM 4849 HD2 LYS A 346 10.078 73.015 -25.340 1.00 0.00 H ATOM 4850 HD3 LYS A 346 8.959 73.093 -23.959 1.00 0.00 H ATOM 4851 HE2 LYS A 346 10.919 73.678 -22.488 1.00 0.00 H ATOM 4852 HE3 LYS A 346 10.561 74.892 -23.738 1.00 0.00 H ATOM 4853 HZ1 LYS A 346 12.651 72.798 -23.894 1.00 0.00 H ATOM 4854 HZ2 LYS A 346 12.309 73.958 -25.088 1.00 0.00 H ATOM 4855 HZ3 LYS A 346 12.909 74.447 -23.576 1.00 0.00 H ATOM 4856 H LYS A 346 9.916 71.012 -19.876 1.00 0.00 H ATOM 4857 N GLU A 347 8.848 68.734 -21.119 1.00 59.05 N ATOM 4858 CA GLU A 347 8.745 67.317 -21.379 1.00 59.46 C ATOM 4859 C GLU A 347 8.223 66.553 -20.148 1.00 57.23 C ATOM 4860 O GLU A 347 7.214 65.876 -20.254 1.00 57.57 O ATOM 4861 CB GLU A 347 10.132 66.828 -21.834 1.00 59.93 C ATOM 4862 CG GLU A 347 10.243 65.457 -22.535 1.00 62.57 C ATOM 4863 CD GLU A 347 11.745 65.030 -22.760 1.00 64.20 C ATOM 4864 OE1 GLU A 347 12.232 64.062 -22.106 1.00 68.77 O ATOM 4865 OE2 GLU A 347 12.452 65.689 -23.581 1.00 67.86 O ATOM 4866 HA GLU A 347 8.016 67.124 -22.166 1.00 0.00 H ATOM 4867 HB2 GLU A 347 10.525 67.574 -22.525 1.00 0.00 H ATOM 4868 HB3 GLU A 347 10.765 66.787 -20.947 1.00 0.00 H ATOM 4869 HG2 GLU A 347 9.751 64.705 -21.918 1.00 0.00 H ATOM 4870 HG3 GLU A 347 9.744 65.514 -23.502 1.00 0.00 H ATOM 4871 H GLU A 347 9.297 69.054 -20.237 1.00 0.00 H ATOM 4872 N LYS A 348 8.863 66.670 -18.983 1.00 55.08 N ATOM 4873 CA LYS A 348 8.633 65.690 -17.889 1.00 53.76 C ATOM 4874 C LYS A 348 7.653 66.106 -16.793 1.00 50.72 C ATOM 4875 O LYS A 348 7.138 65.245 -16.084 1.00 49.76 O ATOM 4876 CB LYS A 348 9.956 65.292 -17.204 1.00 54.43 C ATOM 4877 CG LYS A 348 11.017 64.738 -18.148 1.00 58.11 C ATOM 4878 CD LYS A 348 10.750 63.271 -18.532 1.00 61.82 C ATOM 4879 CE LYS A 348 11.772 62.334 -17.956 1.00 64.20 C ATOM 4880 NZ LYS A 348 12.973 62.226 -18.836 1.00 66.55 N ATOM 4881 HA LYS A 348 8.173 64.855 -18.417 1.00 0.00 H ATOM 4882 HB2 LYS A 348 10.365 66.176 -16.714 1.00 0.00 H ATOM 4883 HB3 LYS A 348 9.736 64.531 -16.455 1.00 0.00 H ATOM 4884 HG2 LYS A 348 11.029 65.342 -19.056 1.00 0.00 H ATOM 4885 HG3 LYS A 348 11.989 64.801 -17.659 1.00 0.00 H ATOM 4886 HD2 LYS A 348 9.765 62.986 -18.162 1.00 0.00 H ATOM 4887 HD3 LYS A 348 10.768 63.184 -19.618 1.00 0.00 H ATOM 4888 HE2 LYS A 348 11.324 61.346 -17.844 1.00 0.00 H ATOM 4889 HE3 LYS A 348 12.081 62.704 -16.978 1.00 0.00 H ATOM 4890 HZ1 LYS A 348 12.686 61.868 -19.769 1.00 0.00 H ATOM 4891 HZ2 LYS A 348 13.409 63.164 -18.942 1.00 0.00 H ATOM 4892 HZ3 LYS A 348 13.658 61.571 -18.407 1.00 0.00 H ATOM 4893 H LYS A 348 9.530 67.455 -18.839 1.00 0.00 H ATOM 4894 N ASP A 349 7.431 67.405 -16.637 1.00 47.82 N ATOM 4895 CA ASP A 349 6.477 67.911 -15.671 1.00 45.81 C ATOM 4896 C ASP A 349 5.793 69.172 -16.184 1.00 44.94 C ATOM 4897 O ASP A 349 5.915 70.250 -15.594 1.00 44.00 O ATOM 4898 CB ASP A 349 7.198 68.196 -14.361 1.00 45.56 C ATOM 4899 CG ASP A 349 6.264 68.256 -13.160 1.00 43.75 C ATOM 4900 OD1 ASP A 349 5.168 67.633 -13.177 1.00 40.77 O ATOM 4901 OD2 ASP A 349 6.666 68.912 -12.170 1.00 41.80 O ATOM 4902 HA ASP A 349 5.705 67.159 -15.510 1.00 0.00 H ATOM 4903 HB2 ASP A 349 7.931 67.407 -14.191 1.00 0.00 H ATOM 4904 HB3 ASP A 349 7.711 69.154 -14.449 1.00 0.00 H ATOM 4905 H ASP A 349 7.958 68.081 -17.226 1.00 0.00 H ATOM 4906 N THR A 350 5.063 69.018 -17.287 1.00 44.28 N ATOM 4907 CA THR A 350 4.522 70.173 -18.010 1.00 43.95 C ATOM 4908 C THR A 350 3.333 70.849 -17.339 1.00 43.33 C ATOM 4909 O THR A 350 3.049 71.984 -17.685 1.00 43.30 O ATOM 4910 CB THR A 350 4.145 69.845 -19.519 1.00 44.65 C ATOM 4911 OG1 THR A 350 3.004 68.961 -19.581 1.00 43.76 O ATOM 4912 CG2 THR A 350 5.340 69.225 -20.279 1.00 42.48 C ATOM 4913 HA THR A 350 5.353 70.878 -17.990 1.00 0.00 H ATOM 4914 HB THR A 350 3.888 70.787 -20.003 1.00 0.00 H ATOM 4915 HG1 THR A 350 2.228 69.394 -19.144 1.00 0.00 H ATOM 4916 HG23 THR A 350 6.193 69.901 -20.225 1.00 0.00 H ATOM 4917 HG21 THR A 350 5.602 68.270 -19.824 1.00 0.00 H ATOM 4918 HG22 THR A 350 5.064 69.069 -21.322 1.00 0.00 H ATOM 4919 H THR A 350 4.873 68.059 -17.643 1.00 0.00 H ATOM 4920 N ILE A 351 2.633 70.185 -16.407 1.00 42.48 N ATOM 4921 CA ILE A 351 1.511 70.834 -15.699 1.00 41.48 C ATOM 4922 C ILE A 351 1.993 72.036 -14.907 1.00 41.76 C ATOM 4923 O ILE A 351 1.277 73.042 -14.727 1.00 41.07 O ATOM 4924 CB ILE A 351 0.773 69.875 -14.742 1.00 41.12 C ATOM 4925 CG1 ILE A 351 -0.605 70.453 -14.359 1.00 38.79 C ATOM 4926 CG2 ILE A 351 1.569 69.570 -13.442 1.00 40.36 C ATOM 4927 CD1 ILE A 351 -1.651 70.289 -15.410 1.00 35.10 C ATOM 4928 HA ILE A 351 0.811 71.149 -16.473 1.00 0.00 H ATOM 4929 HB ILE A 351 0.659 68.937 -15.286 1.00 0.00 H ATOM 4930 HG12 ILE A 351 -0.947 69.950 -13.454 1.00 0.00 H ATOM 4931 HG13 ILE A 351 -0.486 71.518 -14.158 1.00 0.00 H ATOM 4932 HD11 ILE A 351 -1.332 70.797 -16.320 1.00 0.00 H ATOM 4933 HD12 ILE A 351 -1.795 69.228 -15.616 1.00 0.00 H ATOM 4934 HD13 ILE A 351 -2.588 70.722 -15.059 1.00 0.00 H ATOM 4935 HG21 ILE A 351 2.522 69.108 -13.701 1.00 0.00 H ATOM 4936 HG22 ILE A 351 1.750 70.499 -12.902 1.00 0.00 H ATOM 4937 HG23 ILE A 351 0.992 68.890 -12.815 1.00 0.00 H ATOM 4938 H ILE A 351 2.883 69.201 -16.180 1.00 0.00 H ATOM 4939 N ARG A 352 3.226 71.899 -14.434 1.00 42.41 N ATOM 4940 CA ARG A 352 3.918 72.936 -13.694 1.00 43.20 C ATOM 4941 C ARG A 352 4.825 73.860 -14.589 1.00 44.63 C ATOM 4942 O ARG A 352 5.651 74.641 -14.085 1.00 44.87 O ATOM 4943 CB ARG A 352 4.711 72.244 -12.595 1.00 42.55 C ATOM 4944 CG ARG A 352 3.923 72.070 -11.335 1.00 41.89 C ATOM 4945 CD ARG A 352 4.559 71.090 -10.393 1.00 39.30 C ATOM 4946 NE ARG A 352 4.231 69.737 -10.793 1.00 37.77 N ATOM 4947 CZ ARG A 352 3.101 69.102 -10.495 1.00 40.26 C ATOM 4948 NH1 ARG A 352 2.140 69.685 -9.784 1.00 40.15 N ATOM 4949 NH2 ARG A 352 2.926 67.855 -10.923 1.00 42.57 N ATOM 4950 HA ARG A 352 3.186 73.625 -13.273 1.00 0.00 H ATOM 4951 HB2 ARG A 352 5.018 71.261 -12.953 1.00 0.00 H ATOM 4952 HB3 ARG A 352 5.595 72.842 -12.374 1.00 0.00 H ATOM 4953 HG2 ARG A 352 3.844 73.035 -10.835 1.00 0.00 H ATOM 4954 HG3 ARG A 352 2.926 71.712 -11.592 1.00 0.00 H ATOM 4955 HD2 ARG A 352 4.190 71.268 -9.383 1.00 0.00 H ATOM 4956 HD3 ARG A 352 5.641 71.220 -10.412 1.00 0.00 H ATOM 4957 HE ARG A 352 4.935 69.221 -11.358 1.00 0.00 H ATOM 4958 HH12 ARG A 352 1.266 69.165 -9.566 1.00 0.00 H ATOM 4959 HH11 ARG A 352 2.262 70.661 -9.446 1.00 0.00 H ATOM 4960 HH22 ARG A 352 2.047 67.346 -10.697 1.00 0.00 H ATOM 4961 HH21 ARG A 352 3.668 67.389 -11.483 1.00 0.00 H ATOM 4962 H ARG A 352 3.722 71.000 -14.603 1.00 0.00 H ATOM 4963 N LYS A 353 4.652 73.780 -15.904 1.00 45.77 N ATOM 4964 CA LYS A 353 5.345 74.678 -16.838 1.00 47.47 C ATOM 4965 C LYS A 353 5.539 76.118 -16.322 1.00 46.96 C ATOM 4966 O LYS A 353 6.643 76.634 -16.392 1.00 45.78 O ATOM 4967 CB LYS A 353 4.646 74.656 -18.212 1.00 47.89 C ATOM 4968 CG LYS A 353 4.226 75.996 -18.806 1.00 50.40 C ATOM 4969 CD LYS A 353 3.342 75.780 -20.088 1.00 51.29 C ATOM 4970 CE LYS A 353 1.864 76.083 -19.904 1.00 51.01 C ATOM 4971 NZ LYS A 353 1.112 75.417 -20.994 1.00 52.86 N ATOM 4972 HA LYS A 353 6.358 74.287 -16.938 1.00 0.00 H ATOM 4973 HB2 LYS A 353 5.328 74.184 -18.919 1.00 0.00 H ATOM 4974 HB3 LYS A 353 3.748 74.046 -18.113 1.00 0.00 H ATOM 4975 HG2 LYS A 353 3.653 76.553 -18.065 1.00 0.00 H ATOM 4976 HG3 LYS A 353 5.117 76.563 -19.076 1.00 0.00 H ATOM 4977 HD2 LYS A 353 3.725 76.427 -20.877 1.00 0.00 H ATOM 4978 HD3 LYS A 353 3.439 74.739 -20.395 1.00 0.00 H ATOM 4979 HE2 LYS A 353 1.700 77.160 -19.948 1.00 0.00 H ATOM 4980 HE3 LYS A 353 1.527 75.704 -18.939 1.00 0.00 H ATOM 4981 HZ1 LYS A 353 1.439 75.781 -21.912 1.00 0.00 H ATOM 4982 HZ2 LYS A 353 1.274 74.391 -20.949 1.00 0.00 H ATOM 4983 HZ3 LYS A 353 0.097 75.614 -20.884 1.00 0.00 H ATOM 4984 H LYS A 353 4.006 73.059 -16.284 1.00 0.00 H ATOM 4985 N GLU A 354 4.498 76.771 -15.797 1.00 46.85 N ATOM 4986 CA GLU A 354 4.693 78.158 -15.340 1.00 46.97 C ATOM 4987 C GLU A 354 5.649 78.254 -14.177 1.00 45.74 C ATOM 4988 O GLU A 354 6.319 79.270 -14.009 1.00 46.96 O ATOM 4989 CB GLU A 354 3.391 78.859 -14.970 1.00 47.13 C ATOM 4990 CG GLU A 354 2.578 79.253 -16.168 1.00 49.71 C ATOM 4991 CD GLU A 354 3.321 80.198 -17.110 1.00 53.09 C ATOM 4992 OE1 GLU A 354 3.832 81.246 -16.647 1.00 56.04 O ATOM 4993 OE2 GLU A 354 3.386 79.895 -18.317 1.00 54.60 O ATOM 4994 HA GLU A 354 5.125 78.669 -16.201 1.00 0.00 H ATOM 4995 HB2 GLU A 354 2.797 78.186 -14.352 1.00 0.00 H ATOM 4996 HB3 GLU A 354 3.629 79.757 -14.400 1.00 0.00 H ATOM 4997 HG2 GLU A 354 2.312 78.351 -16.719 1.00 0.00 H ATOM 4998 HG3 GLU A 354 1.670 79.748 -15.824 1.00 0.00 H ATOM 4999 H GLU A 354 3.570 76.310 -15.713 1.00 0.00 H ATOM 5000 N TYR A 355 5.726 77.202 -13.384 1.00 43.65 N ATOM 5001 CA TYR A 355 6.503 77.268 -12.167 1.00 42.63 C ATOM 5002 C TYR A 355 7.973 77.073 -12.486 1.00 43.66 C ATOM 5003 O TYR A 355 8.816 77.728 -11.909 1.00 43.19 O ATOM 5004 CB TYR A 355 6.022 76.226 -11.147 1.00 39.93 C ATOM 5005 CG TYR A 355 6.974 76.001 -9.989 1.00 37.95 C ATOM 5006 CD1 TYR A 355 7.064 76.916 -8.945 1.00 36.20 C ATOM 5007 CD2 TYR A 355 7.785 74.862 -9.935 1.00 36.31 C ATOM 5008 CE1 TYR A 355 7.922 76.685 -7.858 1.00 34.73 C ATOM 5009 CE2 TYR A 355 8.646 74.629 -8.861 1.00 33.57 C ATOM 5010 CZ TYR A 355 8.715 75.542 -7.821 1.00 34.80 C ATOM 5011 OH TYR A 355 9.609 75.333 -6.736 1.00 35.29 O ATOM 5012 HA TYR A 355 6.366 78.252 -11.719 1.00 0.00 H ATOM 5013 HB3 TYR A 355 5.885 75.277 -11.666 1.00 0.00 H ATOM 5014 HB2 TYR A 355 5.066 76.559 -10.743 1.00 0.00 H ATOM 5015 HD2 TYR A 355 7.744 74.140 -10.750 1.00 0.00 H ATOM 5016 HE2 TYR A 355 9.263 73.731 -8.841 1.00 0.00 H ATOM 5017 HE1 TYR A 355 7.967 77.404 -7.040 1.00 0.00 H ATOM 5018 HD1 TYR A 355 6.461 77.824 -8.971 1.00 0.00 H ATOM 5019 HH TYR A 355 9.524 76.080 -6.091 1.00 0.00 H ATOM 5020 H TYR A 355 5.227 76.325 -13.635 1.00 0.00 H ATOM 5021 N TRP A 356 8.255 76.138 -13.380 1.00 45.59 N ATOM 5022 CA TRP A 356 9.610 75.861 -13.817 1.00 47.57 C ATOM 5023 C TRP A 356 10.203 76.994 -14.666 1.00 49.67 C ATOM 5024 O TRP A 356 11.301 77.458 -14.411 1.00 49.93 O ATOM 5025 CB TRP A 356 9.637 74.551 -14.548 1.00 47.60 C ATOM 5026 CG TRP A 356 9.360 73.419 -13.617 1.00 48.39 C ATOM 5027 CD1 TRP A 356 8.344 72.493 -13.719 1.00 48.60 C ATOM 5028 CD2 TRP A 356 10.088 73.084 -12.416 1.00 48.65 C ATOM 5029 NE1 TRP A 356 8.412 71.604 -12.671 1.00 47.68 N ATOM 5030 CE2 TRP A 356 9.458 71.949 -11.849 1.00 47.01 C ATOM 5031 CE3 TRP A 356 11.206 73.640 -11.757 1.00 48.62 C ATOM 5032 CZ2 TRP A 356 9.915 71.349 -10.667 1.00 46.29 C ATOM 5033 CZ3 TRP A 356 11.653 73.048 -10.566 1.00 47.36 C ATOM 5034 CH2 TRP A 356 11.011 71.907 -10.043 1.00 47.51 C ATOM 5035 HA TRP A 356 10.244 75.794 -12.933 1.00 0.00 H ATOM 5036 HB2 TRP A 356 8.880 74.563 -15.332 1.00 0.00 H ATOM 5037 HB3 TRP A 356 10.620 74.412 -14.997 1.00 0.00 H ATOM 5038 HE1 TRP A 356 7.772 70.797 -12.524 1.00 0.00 H ATOM 5039 HD1 TRP A 356 7.597 72.469 -14.513 1.00 0.00 H ATOM 5040 HZ2 TRP A 356 9.420 70.470 -10.255 1.00 0.00 H ATOM 5041 HH2 TRP A 356 11.389 71.456 -9.126 1.00 0.00 H ATOM 5042 HZ3 TRP A 356 12.506 73.475 -10.039 1.00 0.00 H ATOM 5043 HE3 TRP A 356 11.713 74.514 -12.166 1.00 0.00 H ATOM 5044 H TRP A 356 7.475 75.581 -13.784 1.00 0.00 H ATOM 5045 N ARG A 357 9.466 77.481 -15.641 1.00 52.33 N ATOM 5046 CA ARG A 357 9.847 78.734 -16.300 1.00 54.71 C ATOM 5047 C ARG A 357 10.282 79.771 -15.281 1.00 54.10 C ATOM 5048 O ARG A 357 11.228 80.477 -15.518 1.00 55.67 O ATOM 5049 CB ARG A 357 8.705 79.319 -17.145 1.00 56.06 C ATOM 5050 CG ARG A 357 8.792 79.051 -18.638 1.00 61.10 C ATOM 5051 CD ARG A 357 8.933 77.595 -18.924 1.00 67.38 C ATOM 5052 NE ARG A 357 8.252 77.252 -20.171 1.00 71.69 N ATOM 5053 CZ ARG A 357 8.841 76.771 -21.267 1.00 75.55 C ATOM 5054 NH1 ARG A 357 10.157 76.542 -21.312 1.00 78.82 N ATOM 5055 NH2 ARG A 357 8.105 76.489 -22.331 1.00 75.08 N ATOM 5056 HA ARG A 357 10.678 78.491 -16.962 1.00 0.00 H ATOM 5057 HB2 ARG A 357 7.768 78.897 -16.782 1.00 0.00 H ATOM 5058 HB3 ARG A 357 8.697 80.399 -16.997 1.00 0.00 H ATOM 5059 HG2 ARG A 357 7.886 79.420 -19.118 1.00 0.00 H ATOM 5060 HG3 ARG A 357 9.656 79.577 -19.043 1.00 0.00 H ATOM 5061 HD2 ARG A 357 8.494 77.024 -18.106 1.00 0.00 H ATOM 5062 HD3 ARG A 357 9.991 77.347 -19.012 1.00 0.00 H ATOM 5063 HE ARG A 357 7.222 77.395 -20.207 1.00 0.00 H ATOM 5064 HH12 ARG A 357 10.590 76.167 -22.180 1.00 0.00 H ATOM 5065 HH11 ARG A 357 10.748 76.739 -20.479 1.00 0.00 H ATOM 5066 HH22 ARG A 357 8.555 76.114 -23.190 1.00 0.00 H ATOM 5067 HH21 ARG A 357 7.077 76.643 -22.308 1.00 0.00 H ATOM 5068 H ARG A 357 8.610 76.975 -15.945 1.00 0.00 H ATOM 5069 N TYR A 358 9.589 79.886 -14.163 1.00 53.07 N ATOM 5070 CA TYR A 358 9.908 80.940 -13.202 1.00 52.50 C ATOM 5071 C TYR A 358 11.156 80.599 -12.367 1.00 52.36 C ATOM 5072 O TYR A 358 11.924 81.493 -12.026 1.00 51.90 O ATOM 5073 CB TYR A 358 8.696 81.206 -12.313 1.00 51.51 C ATOM 5074 CG TYR A 358 9.003 81.880 -11.003 1.00 50.72 C ATOM 5075 CD1 TYR A 358 8.836 83.252 -10.850 1.00 50.48 C ATOM 5076 CD2 TYR A 358 9.438 81.139 -9.899 1.00 50.65 C ATOM 5077 CE1 TYR A 358 9.094 83.877 -9.640 1.00 50.13 C ATOM 5078 CE2 TYR A 358 9.711 81.758 -8.669 1.00 49.69 C ATOM 5079 CZ TYR A 358 9.536 83.123 -8.549 1.00 49.90 C ATOM 5080 OH TYR A 358 9.779 83.748 -7.350 1.00 49.62 O ATOM 5081 HA TYR A 358 10.147 81.849 -13.755 1.00 0.00 H ATOM 5082 HB3 TYR A 358 8.218 80.250 -12.098 1.00 0.00 H ATOM 5083 HB2 TYR A 358 8.004 81.841 -12.866 1.00 0.00 H ATOM 5084 HD2 TYR A 358 9.567 80.061 -9.996 1.00 0.00 H ATOM 5085 HE2 TYR A 358 10.057 81.169 -7.819 1.00 0.00 H ATOM 5086 HE1 TYR A 358 8.953 84.953 -9.539 1.00 0.00 H ATOM 5087 HD1 TYR A 358 8.496 83.847 -11.697 1.00 0.00 H ATOM 5088 HH TYR A 358 9.604 84.718 -7.443 1.00 0.00 H ATOM 5089 H TYR A 358 8.812 79.223 -13.965 1.00 0.00 H ATOM 5090 N ILE A 359 11.345 79.320 -12.036 1.00 52.05 N ATOM 5091 CA ILE A 359 12.561 78.912 -11.354 1.00 52.88 C ATOM 5092 C ILE A 359 13.757 79.135 -12.281 1.00 54.18 C ATOM 5093 O ILE A 359 14.766 79.707 -11.871 1.00 54.77 O ATOM 5094 CB ILE A 359 12.539 77.444 -10.837 1.00 52.00 C ATOM 5095 CG1 ILE A 359 11.516 77.264 -9.706 1.00 51.49 C ATOM 5096 CG2 ILE A 359 13.861 77.080 -10.272 1.00 51.13 C ATOM 5097 CD1 ILE A 359 11.517 78.360 -8.638 1.00 48.29 C ATOM 5098 HA ILE A 359 12.644 79.532 -10.461 1.00 0.00 H ATOM 5099 HB ILE A 359 12.280 76.815 -11.688 1.00 0.00 H ATOM 5100 HG12 ILE A 359 10.523 77.231 -10.153 1.00 0.00 H ATOM 5101 HG13 ILE A 359 11.723 76.314 -9.213 1.00 0.00 H ATOM 5102 HD11 ILE A 359 12.497 78.402 -8.164 1.00 0.00 H ATOM 5103 HD12 ILE A 359 11.296 79.320 -9.104 1.00 0.00 H ATOM 5104 HD13 ILE A 359 10.758 78.136 -7.888 1.00 0.00 H ATOM 5105 HG21 ILE A 359 14.624 77.175 -11.045 1.00 0.00 H ATOM 5106 HG22 ILE A 359 14.097 77.747 -9.443 1.00 0.00 H ATOM 5107 HG23 ILE A 359 13.831 76.051 -9.914 1.00 0.00 H ATOM 5108 H ILE A 359 10.619 78.612 -12.267 1.00 0.00 H ATOM 5109 N GLY A 360 13.631 78.701 -13.528 1.00 55.59 N ATOM 5110 CA GLY A 360 14.650 78.950 -14.560 1.00 56.44 C ATOM 5111 C GLY A 360 15.054 80.407 -14.604 1.00 57.08 C ATOM 5112 O GLY A 360 16.240 80.720 -14.577 1.00 57.39 O ATOM 5113 HA3 GLY A 360 14.247 78.665 -15.532 1.00 0.00 H ATOM 5114 HA2 GLY A 360 15.530 78.345 -14.342 1.00 0.00 H ATOM 5115 H GLY A 360 12.779 78.164 -13.786 1.00 0.00 H ATOM 5116 N ARG A 361 14.055 81.283 -14.617 1.00 57.65 N ATOM 5117 CA ARG A 361 14.268 82.719 -14.669 1.00 58.85 C ATOM 5118 C ARG A 361 14.833 83.251 -13.387 1.00 60.17 C ATOM 5119 O ARG A 361 15.608 84.187 -13.412 1.00 60.87 O ATOM 5120 CB ARG A 361 12.967 83.476 -14.960 1.00 58.63 C ATOM 5121 CG ARG A 361 12.450 83.259 -16.348 1.00 58.65 C ATOM 5122 CD ARG A 361 11.546 84.376 -16.808 1.00 58.91 C ATOM 5123 NE ARG A 361 10.279 84.507 -16.086 1.00 59.60 N ATOM 5124 CZ ARG A 361 9.265 83.634 -16.133 1.00 58.10 C ATOM 5125 NH1 ARG A 361 9.353 82.517 -16.832 1.00 57.35 N ATOM 5126 NH2 ARG A 361 8.142 83.871 -15.458 1.00 58.13 N ATOM 5127 HA ARG A 361 14.981 82.880 -15.478 1.00 0.00 H ATOM 5128 HB2 ARG A 361 12.208 83.143 -14.252 1.00 0.00 H ATOM 5129 HB3 ARG A 361 13.149 84.542 -14.821 1.00 0.00 H ATOM 5130 HG2 ARG A 361 13.297 83.191 -17.030 1.00 0.00 H ATOM 5131 HG3 ARG A 361 11.890 82.324 -16.371 1.00 0.00 H ATOM 5132 HD2 ARG A 361 11.316 84.209 -17.860 1.00 0.00 H ATOM 5133 HD3 ARG A 361 12.091 85.314 -16.701 1.00 0.00 H ATOM 5134 HE ARG A 361 10.157 85.348 -15.487 1.00 0.00 H ATOM 5135 HH12 ARG A 361 8.553 81.853 -16.854 1.00 0.00 H ATOM 5136 HH11 ARG A 361 10.223 82.301 -17.360 1.00 0.00 H ATOM 5137 HH22 ARG A 361 7.358 83.189 -15.498 1.00 0.00 H ATOM 5138 HH21 ARG A 361 8.049 84.738 -14.891 1.00 0.00 H ATOM 5139 H ARG A 361 13.079 80.925 -14.589 1.00 0.00 H ATOM 5140 N SER A 362 14.406 82.702 -12.253 1.00 61.55 N ATOM 5141 CA SER A 362 14.935 83.159 -10.971 1.00 62.37 C ATOM 5142 C SER A 362 16.429 82.864 -10.826 1.00 63.32 C ATOM 5143 O SER A 362 17.166 83.684 -10.310 1.00 62.50 O ATOM 5144 CB SER A 362 14.141 82.583 -9.809 1.00 61.59 C ATOM 5145 OG SER A 362 13.106 83.491 -9.484 1.00 61.87 O ATOM 5146 HA SER A 362 14.822 84.243 -10.948 1.00 0.00 H ATOM 5147 HB2 SER A 362 14.795 82.445 -8.948 1.00 0.00 H ATOM 5148 HB3 SER A 362 13.713 81.623 -10.095 1.00 0.00 H ATOM 5149 HG SER A 362 13.501 84.362 -9.227 1.00 0.00 H ATOM 5150 H SER A 362 13.693 81.945 -12.280 1.00 0.00 H ATOM 5151 N LEU A 363 16.851 81.707 -11.319 1.00 65.13 N ATOM 5152 CA LEU A 363 18.256 81.279 -11.264 1.00 67.09 C ATOM 5153 C LEU A 363 19.182 82.031 -12.240 1.00 69.89 C ATOM 5154 O LEU A 363 20.369 82.194 -11.962 1.00 69.77 O ATOM 5155 CB LEU A 363 18.358 79.768 -11.541 1.00 66.45 C ATOM 5156 CG LEU A 363 17.743 78.810 -10.528 1.00 63.96 C ATOM 5157 CD1 LEU A 363 17.991 77.386 -10.968 1.00 61.89 C ATOM 5158 CD2 LEU A 363 18.341 79.060 -9.184 1.00 61.31 C ATOM 5159 HA LEU A 363 18.598 81.519 -10.257 1.00 0.00 H ATOM 5160 HB2 LEU A 363 17.874 79.581 -12.499 1.00 0.00 H ATOM 5161 HB3 LEU A 363 19.417 79.523 -11.617 1.00 0.00 H ATOM 5162 HG LEU A 363 16.667 78.973 -10.467 1.00 0.00 H ATOM 5163 HD21 LEU A 363 19.418 78.899 -9.231 1.00 0.00 H ATOM 5164 HD22 LEU A 363 18.139 80.088 -8.883 1.00 0.00 H ATOM 5165 HD23 LEU A 363 17.901 78.375 -8.459 1.00 0.00 H ATOM 5166 HD11 LEU A 363 17.536 77.224 -11.945 1.00 0.00 H ATOM 5167 HD12 LEU A 363 19.065 77.209 -11.032 1.00 0.00 H ATOM 5168 HD13 LEU A 363 17.551 76.701 -10.243 1.00 0.00 H ATOM 5169 H LEU A 363 16.156 81.074 -11.765 1.00 0.00 H ATOM 5170 N GLN A 364 18.648 82.443 -13.391 1.00 72.75 N ATOM 5171 CA GLN A 364 19.390 83.289 -14.300 1.00 75.38 C ATOM 5172 C GLN A 364 19.548 84.676 -13.713 1.00 77.07 C ATOM 5173 O GLN A 364 20.643 85.238 -13.732 1.00 77.93 O ATOM 5174 CB GLN A 364 18.715 83.378 -15.669 1.00 76.02 C ATOM 5175 CG GLN A 364 19.089 82.231 -16.623 1.00 77.31 C ATOM 5176 CD GLN A 364 19.603 82.730 -17.967 1.00 78.82 C ATOM 5177 OE1 GLN A 364 18.935 82.583 -18.998 1.00 78.12 O ATOM 5178 NE2 GLN A 364 20.798 83.336 -17.956 1.00 78.86 N ATOM 5179 HA GLN A 364 20.373 82.839 -14.439 1.00 0.00 H ATOM 5180 HB2 GLN A 364 17.635 83.364 -15.521 1.00 0.00 H ATOM 5181 HB3 GLN A 364 19.004 84.320 -16.134 1.00 0.00 H ATOM 5182 HG2 GLN A 364 19.866 81.626 -16.155 1.00 0.00 H ATOM 5183 HG3 GLN A 364 18.205 81.616 -16.793 1.00 0.00 H ATOM 5184 HE22 GLN A 364 21.322 83.436 -17.063 1.00 0.00 H ATOM 5185 HE21 GLN A 364 21.201 83.707 -18.840 1.00 0.00 H ATOM 5186 H GLN A 364 17.681 82.151 -13.639 1.00 0.00 H ATOM 5187 N SER A 365 18.464 85.235 -13.196 1.00 78.63 N ATOM 5188 CA SER A 365 18.507 86.587 -12.660 1.00 80.38 C ATOM 5189 C SER A 365 19.475 86.657 -11.489 1.00 82.29 C ATOM 5190 O SER A 365 20.082 87.689 -11.252 1.00 82.75 O ATOM 5191 CB SER A 365 17.119 87.061 -12.228 1.00 80.02 C ATOM 5192 OG SER A 365 17.209 88.110 -11.280 1.00 79.04 O ATOM 5193 HA SER A 365 18.855 87.250 -13.452 1.00 0.00 H ATOM 5194 HB2 SER A 365 16.580 86.225 -11.783 1.00 0.00 H ATOM 5195 HB3 SER A 365 16.576 87.418 -13.103 1.00 0.00 H ATOM 5196 HG SER A 365 17.697 87.790 -10.481 1.00 0.00 H ATOM 5197 H SER A 365 17.572 84.701 -13.173 1.00 0.00 H ATOM 5198 N LYS A 366 19.617 85.553 -10.762 1.00 83.96 N ATOM 5199 CA LYS A 366 20.454 85.513 -9.575 1.00 85.41 C ATOM 5200 C LYS A 366 21.898 85.307 -9.916 1.00 87.12 C ATOM 5201 O LYS A 366 22.751 85.969 -9.365 1.00 87.08 O ATOM 5202 CB LYS A 366 20.048 84.352 -8.666 1.00 84.65 C ATOM 5203 HA LYS A 366 20.319 86.473 -9.077 1.00 0.00 H ATOM 5204 HB2 LYS A 366 19.009 84.477 -8.361 1.00 0.00 H ATOM 5205 HB3 LYS A 366 20.158 83.412 -9.207 1.00 0.00 H ATOM 5206 H LYS A 366 19.113 84.691 -11.052 1.00 0.00 H ATOM 5207 N HIS A 367 22.162 84.384 -10.829 1.00 89.25 N ATOM 5208 CA HIS A 367 23.435 83.690 -10.837 1.00 91.79 C ATOM 5209 C HIS A 367 24.215 83.624 -12.185 1.00 93.67 C ATOM 5210 O HIS A 367 24.813 82.584 -12.489 1.00 93.49 O ATOM 5211 CB HIS A 367 23.228 82.257 -10.293 1.00 90.39 C ATOM 5212 CG HIS A 367 22.647 82.179 -8.906 1.00 88.98 C ATOM 5213 ND1 HIS A 367 22.978 83.058 -7.898 1.00 87.73 N ATOM 5214 CD2 HIS A 367 21.798 81.281 -8.352 1.00 86.73 C ATOM 5215 CE1 HIS A 367 22.332 82.725 -6.795 1.00 86.89 C ATOM 5216 NE2 HIS A 367 21.614 81.647 -7.043 1.00 86.01 N ATOM 5217 HA HIS A 367 24.075 84.303 -10.202 1.00 0.00 H ATOM 5218 HB2 HIS A 367 22.556 81.732 -10.971 1.00 0.00 H ATOM 5219 HB3 HIS A 367 24.196 81.756 -10.283 1.00 0.00 H ATOM 5220 HD2 HIS A 367 21.345 80.426 -8.853 1.00 0.00 H ATOM 5221 HE1 HIS A 367 22.384 83.252 -5.842 1.00 0.00 H ATOM 5222 H HIS A 367 21.447 84.154 -11.549 1.00 0.00 H ATOM 5223 N SER A 368 24.327 84.717 -12.923 1.00 96.55 N ATOM 5224 CA SER A 368 25.283 84.746 -14.026 1.00 98.33 C ATOM 5225 C SER A 368 25.955 86.115 -14.259 1.00100.81 C ATOM 5226 O SER A 368 26.932 86.211 -15.014 1.00101.09 O ATOM 5227 CB SER A 368 24.619 84.272 -15.295 1.00 98.12 C ATOM 5228 OG SER A 368 23.765 85.262 -15.778 1.00 97.43 O ATOM 5229 HA SER A 368 26.088 84.070 -13.737 1.00 0.00 H ATOM 5230 HB2 SER A 368 24.046 83.368 -15.088 1.00 0.00 H ATOM 5231 HB3 SER A 368 25.381 84.054 -16.043 1.00 0.00 H ATOM 5232 HG SER A 368 23.332 84.946 -16.610 1.00 0.00 H ATOM 5233 H SER A 368 23.738 85.549 -12.719 1.00 0.00 H ATOM 5234 N ARG A 369 25.437 87.161 -13.609 1.00102.42 N ATOM 5235 CA ARG A 369 25.945 88.508 -13.808 1.00103.23 C ATOM 5236 C ARG A 369 26.673 88.529 -15.118 1.00104.10 C ATOM 5237 O ARG A 369 26.146 88.069 -16.117 1.00103.98 O ATOM 5238 CB ARG A 369 26.867 88.950 -12.675 1.00 20.00 C ATOM 5239 HA ARG A 369 25.111 89.210 -13.814 1.00 0.00 H ATOM 5240 HB2 ARG A 369 26.319 88.930 -11.733 1.00 0.00 H ATOM 5241 HB3 ARG A 369 27.718 88.272 -12.616 1.00 0.00 H ATOM 5242 H ARG A 369 24.652 87.008 -12.945 1.00 0.00 H TER 5243 ARG A 369 ATOM 5244 N TRP B 19 -4.899 68.726 -37.591 1.00 69.15 N ATOM 5245 CA TRP B 19 -3.923 67.739 -37.159 1.00 70.31 C ATOM 5246 C TRP B 19 -3.740 67.688 -35.654 1.00 71.14 C ATOM 5247 O TRP B 19 -3.605 66.624 -35.066 1.00 71.64 O ATOM 5248 CB TRP B 19 -2.577 68.027 -37.796 1.00 70.07 C ATOM 5249 HA TRP B 19 -4.313 66.772 -37.477 1.00 0.00 H ATOM 5250 HB2 TRP B 19 -2.674 67.986 -38.881 1.00 0.00 H ATOM 5251 HB3 TRP B 19 -2.240 69.020 -37.498 1.00 0.00 H ATOM 5252 HN3 TRP B 19 -4.595 69.671 -37.281 1.00 0.00 H ATOM 5253 HN2 TRP B 19 -5.824 68.504 -37.171 1.00 0.00 H ATOM 5254 HN1 TRP B 19 -4.974 68.707 -38.628 1.00 0.00 H ATOM 5255 N SER B 20 -3.734 68.867 -35.052 1.00 71.37 N ATOM 5256 CA SER B 20 -3.364 69.059 -33.671 1.00 71.10 C ATOM 5257 C SER B 20 -4.514 69.432 -32.758 1.00 70.10 C ATOM 5258 O SER B 20 -5.322 70.285 -33.089 1.00 69.79 O ATOM 5259 CB SER B 20 -2.334 70.175 -33.608 1.00 20.00 C ATOM 5260 HA SER B 20 -2.982 68.101 -33.317 1.00 0.00 H ATOM 5261 HB2 SER B 20 -1.460 69.895 -34.196 1.00 0.00 H ATOM 5262 HB3 SER B 20 -2.767 71.090 -34.012 1.00 0.00 H ATOM 5263 H SER B 20 -4.012 69.702 -35.606 1.00 0.00 H ATOM 5264 N GLU B 21 -4.532 68.811 -31.582 1.00 68.23 N ATOM 5265 CA GLU B 21 -5.537 69.061 -30.512 1.00 66.48 C ATOM 5266 C GLU B 21 -5.405 70.425 -29.867 1.00 63.09 C ATOM 5267 O GLU B 21 -4.341 70.773 -29.386 1.00 62.49 O ATOM 5268 CB GLU B 21 -5.437 68.023 -29.388 1.00 66.26 C ATOM 5269 CG GLU B 21 -5.864 66.607 -29.759 1.00 67.82 C ATOM 5270 CD GLU B 21 -7.369 66.461 -29.982 1.00 70.26 C ATOM 5271 OE1 GLU B 21 -8.126 67.410 -29.629 1.00 69.96 O ATOM 5272 OE2 GLU B 21 -7.780 65.392 -30.520 1.00 69.75 O ATOM 5273 HA GLU B 21 -6.497 68.996 -31.023 1.00 0.00 H ATOM 5274 HB2 GLU B 21 -4.399 67.985 -29.058 1.00 0.00 H ATOM 5275 HB3 GLU B 21 -6.067 68.359 -28.564 1.00 0.00 H ATOM 5276 HG2 GLU B 21 -5.350 66.321 -30.677 1.00 0.00 H ATOM 5277 HG3 GLU B 21 -5.568 65.935 -28.953 1.00 0.00 H ATOM 5278 H GLU B 21 -3.794 68.102 -31.397 1.00 0.00 H ATOM 5279 N PRO B 22 -6.490 71.209 -29.865 1.00 59.83 N ATOM 5280 CA PRO B 22 -6.436 72.408 -29.036 1.00 57.82 C ATOM 5281 C PRO B 22 -6.489 72.105 -27.526 1.00 55.28 C ATOM 5282 O PRO B 22 -5.966 72.896 -26.743 1.00 54.36 O ATOM 5283 CB PRO B 22 -7.670 73.205 -29.492 1.00 58.06 C ATOM 5284 CG PRO B 22 -8.590 72.196 -30.026 1.00 58.50 C ATOM 5285 CD PRO B 22 -7.754 71.107 -30.613 1.00 59.37 C ATOM 5286 HA PRO B 22 -5.496 72.946 -29.160 1.00 0.00 H ATOM 5287 HD3 PRO B 22 -8.219 70.133 -30.463 1.00 0.00 H ATOM 5288 HD2 PRO B 22 -7.592 71.270 -31.678 1.00 0.00 H ATOM 5289 HG3 PRO B 22 -9.224 72.637 -30.795 1.00 0.00 H ATOM 5290 HG2 PRO B 22 -9.215 71.798 -29.226 1.00 0.00 H ATOM 5291 HB2 PRO B 22 -8.121 73.730 -28.650 1.00 0.00 H ATOM 5292 HB3 PRO B 22 -7.399 73.925 -30.264 1.00 0.00 H ATOM 5293 N LEU B 23 -7.104 70.972 -27.145 1.00 52.71 N ATOM 5294 CA LEU B 23 -7.311 70.618 -25.736 1.00 50.23 C ATOM 5295 C LEU B 23 -6.210 69.730 -25.152 1.00 49.18 C ATOM 5296 O LEU B 23 -6.024 68.569 -25.561 1.00 48.98 O ATOM 5297 CB LEU B 23 -8.681 69.971 -25.515 1.00 49.58 C ATOM 5298 CG LEU B 23 -9.943 70.821 -25.760 1.00 47.69 C ATOM 5299 CD1 LEU B 23 -11.185 69.984 -25.399 1.00 42.83 C ATOM 5300 CD2 LEU B 23 -9.928 72.140 -25.013 1.00 43.06 C ATOM 5301 HA LEU B 23 -7.268 71.564 -25.197 1.00 0.00 H ATOM 5302 HB2 LEU B 23 -8.740 69.108 -26.178 1.00 0.00 H ATOM 5303 HB3 LEU B 23 -8.715 69.635 -24.479 1.00 0.00 H ATOM 5304 HG LEU B 23 -9.970 71.089 -26.816 1.00 0.00 H ATOM 5305 HD21 LEU B 23 -9.862 71.949 -23.942 1.00 0.00 H ATOM 5306 HD22 LEU B 23 -9.067 72.727 -25.333 1.00 0.00 H ATOM 5307 HD23 LEU B 23 -10.845 72.689 -25.229 1.00 0.00 H ATOM 5308 HD11 LEU B 23 -11.214 69.091 -26.024 1.00 0.00 H ATOM 5309 HD12 LEU B 23 -11.133 69.693 -24.350 1.00 0.00 H ATOM 5310 HD13 LEU B 23 -12.083 70.577 -25.569 1.00 0.00 H ATOM 5311 H LEU B 23 -7.447 70.320 -27.879 1.00 0.00 H ATOM 5312 N TYR B 24 -5.550 70.286 -24.131 1.00 47.70 N ATOM 5313 CA TYR B 24 -4.354 69.718 -23.494 1.00 47.03 C ATOM 5314 C TYR B 24 -4.571 68.343 -22.906 1.00 46.81 C ATOM 5315 O TYR B 24 -3.654 67.515 -22.933 1.00 47.21 O ATOM 5316 CB TYR B 24 -3.862 70.683 -22.410 1.00 46.50 C ATOM 5317 CG TYR B 24 -2.717 70.239 -21.492 1.00 46.46 C ATOM 5318 CD1 TYR B 24 -1.373 70.409 -21.875 1.00 46.83 C ATOM 5319 CD2 TYR B 24 -2.970 69.727 -20.202 1.00 44.69 C ATOM 5320 CE1 TYR B 24 -0.299 70.034 -21.012 1.00 46.81 C ATOM 5321 CE2 TYR B 24 -1.910 69.350 -19.330 1.00 45.51 C ATOM 5322 CZ TYR B 24 -0.570 69.518 -19.744 1.00 46.63 C ATOM 5323 OH TYR B 24 0.485 69.196 -18.919 1.00 45.17 O ATOM 5324 HA TYR B 24 -3.604 69.593 -24.275 1.00 0.00 H ATOM 5325 HB3 TYR B 24 -4.716 70.910 -21.771 1.00 0.00 H ATOM 5326 HB2 TYR B 24 -3.535 71.592 -22.914 1.00 0.00 H ATOM 5327 HD2 TYR B 24 -4.001 69.618 -19.865 1.00 0.00 H ATOM 5328 HE2 TYR B 24 -2.131 68.934 -18.347 1.00 0.00 H ATOM 5329 HE1 TYR B 24 0.733 70.151 -21.344 1.00 0.00 H ATOM 5330 HD1 TYR B 24 -1.147 70.836 -22.852 1.00 0.00 H ATOM 5331 HH TYR B 24 1.337 69.383 -19.387 1.00 0.00 H ATOM 5332 H TYR B 24 -5.910 71.188 -23.760 1.00 0.00 H ATOM 5333 N SER B 25 -5.766 68.081 -22.376 1.00 46.23 N ATOM 5334 CA SER B 25 -6.054 66.770 -21.797 1.00 45.90 C ATOM 5335 C SER B 25 -6.378 65.746 -22.873 1.00 46.09 C ATOM 5336 O SER B 25 -6.408 64.568 -22.593 1.00 44.61 O ATOM 5337 CB SER B 25 -7.206 66.833 -20.814 1.00 46.02 C ATOM 5338 OG SER B 25 -7.301 68.107 -20.213 1.00 46.79 O ATOM 5339 HA SER B 25 -5.152 66.462 -21.268 1.00 0.00 H ATOM 5340 HB2 SER B 25 -7.051 66.085 -20.037 1.00 0.00 H ATOM 5341 HB3 SER B 25 -8.135 66.619 -21.342 1.00 0.00 H ATOM 5342 HG SER B 25 -7.447 68.791 -20.914 1.00 0.00 H ATOM 5343 H SER B 25 -6.501 68.817 -22.374 1.00 0.00 H ATOM 5344 N LEU B 26 -6.613 66.180 -24.110 1.00 47.52 N ATOM 5345 CA LEU B 26 -6.952 65.213 -25.175 1.00 48.69 C ATOM 5346 C LEU B 26 -5.771 64.860 -26.067 1.00 50.17 C ATOM 5347 O LEU B 26 -5.871 63.971 -26.903 1.00 50.27 O ATOM 5348 CB LEU B 26 -8.132 65.687 -26.020 1.00 48.11 C ATOM 5349 CG LEU B 26 -9.489 65.923 -25.348 1.00 47.97 C ATOM 5350 CD1 LEU B 26 -10.626 65.854 -26.400 1.00 45.74 C ATOM 5351 CD2 LEU B 26 -9.723 64.922 -24.216 1.00 47.83 C ATOM 5352 HA LEU B 26 -7.242 64.301 -24.653 1.00 0.00 H ATOM 5353 HB2 LEU B 26 -7.836 66.630 -26.479 1.00 0.00 H ATOM 5354 HB3 LEU B 26 -8.288 64.939 -26.797 1.00 0.00 H ATOM 5355 HG LEU B 26 -9.488 66.920 -24.908 1.00 0.00 H ATOM 5356 HD21 LEU B 26 -9.704 63.909 -24.618 1.00 0.00 H ATOM 5357 HD22 LEU B 26 -8.938 65.032 -23.467 1.00 0.00 H ATOM 5358 HD23 LEU B 26 -10.693 65.114 -23.758 1.00 0.00 H ATOM 5359 HD11 LEU B 26 -10.464 66.620 -27.158 1.00 0.00 H ATOM 5360 HD12 LEU B 26 -10.626 64.870 -26.869 1.00 0.00 H ATOM 5361 HD13 LEU B 26 -11.584 66.023 -25.909 1.00 0.00 H ATOM 5362 H LEU B 26 -6.558 67.196 -24.326 1.00 0.00 H ATOM 5363 N ARG B 27 -4.652 65.547 -25.882 1.00 51.68 N ATOM 5364 CA ARG B 27 -3.493 65.308 -26.719 1.00 52.91 C ATOM 5365 C ARG B 27 -2.984 63.910 -26.486 1.00 53.96 C ATOM 5366 O ARG B 27 -3.184 63.370 -25.402 1.00 54.42 O ATOM 5367 CB ARG B 27 -2.432 66.331 -26.407 1.00 53.08 C ATOM 5368 CG ARG B 27 -2.961 67.712 -26.704 1.00 53.13 C ATOM 5369 CD ARG B 27 -1.878 68.697 -26.872 1.00 52.72 C ATOM 5370 NE ARG B 27 -2.444 70.012 -27.098 1.00 51.70 N ATOM 5371 CZ ARG B 27 -2.112 71.115 -26.438 1.00 51.09 C ATOM 5372 NH1 ARG B 27 -1.193 71.080 -25.477 1.00 51.91 N ATOM 5373 NH2 ARG B 27 -2.709 72.265 -26.739 1.00 50.25 N ATOM 5374 HA ARG B 27 -3.765 65.402 -27.770 1.00 0.00 H ATOM 5375 HB2 ARG B 27 -2.161 66.264 -25.353 1.00 0.00 H ATOM 5376 HB3 ARG B 27 -1.551 66.140 -27.020 1.00 0.00 H ATOM 5377 HG2 ARG B 27 -3.547 67.674 -27.622 1.00 0.00 H ATOM 5378 HG3 ARG B 27 -3.600 68.029 -25.879 1.00 0.00 H ATOM 5379 HD2 ARG B 27 -1.262 68.416 -27.726 1.00 0.00 H ATOM 5380 HD3 ARG B 27 -1.263 68.717 -25.972 1.00 0.00 H ATOM 5381 HE ARG B 27 -3.170 70.099 -27.838 1.00 0.00 H ATOM 5382 HH12 ARG B 27 -0.941 71.950 -24.967 1.00 0.00 H ATOM 5383 HH11 ARG B 27 -0.727 70.182 -25.236 1.00 0.00 H ATOM 5384 HH22 ARG B 27 -2.454 73.133 -26.226 1.00 0.00 H ATOM 5385 HH21 ARG B 27 -3.431 72.296 -27.487 1.00 0.00 H ATOM 5386 H ARG B 27 -4.606 66.264 -25.130 1.00 0.00 H ATOM 5387 N PRO B 28 -2.388 63.282 -27.520 1.00 55.41 N ATOM 5388 CA PRO B 28 -1.853 61.915 -27.330 1.00 55.82 C ATOM 5389 C PRO B 28 -0.801 61.805 -26.214 1.00 55.75 C ATOM 5390 O PRO B 28 -0.837 60.845 -25.417 1.00 54.82 O ATOM 5391 CB PRO B 28 -1.249 61.553 -28.707 1.00 56.29 C ATOM 5392 CG PRO B 28 -1.273 62.803 -29.537 1.00 55.87 C ATOM 5393 CD PRO B 28 -2.236 63.765 -28.913 1.00 55.84 C ATOM 5394 HA PRO B 28 -2.640 61.233 -27.007 1.00 0.00 H ATOM 5395 HD3 PRO B 28 -1.834 64.778 -28.929 1.00 0.00 H ATOM 5396 HD2 PRO B 28 -3.193 63.747 -29.435 1.00 0.00 H ATOM 5397 HG3 PRO B 28 -1.594 62.566 -30.551 1.00 0.00 H ATOM 5398 HG2 PRO B 28 -0.277 63.245 -29.566 1.00 0.00 H ATOM 5399 HB2 PRO B 28 -0.224 61.203 -28.586 1.00 0.00 H ATOM 5400 HB3 PRO B 28 -1.844 60.774 -29.184 1.00 0.00 H ATOM 5401 N GLU B 29 0.102 62.785 -26.150 1.00 55.92 N ATOM 5402 CA GLU B 29 1.210 62.740 -25.188 1.00 56.64 C ATOM 5403 C GLU B 29 0.732 62.765 -23.735 1.00 56.43 C ATOM 5404 O GLU B 29 1.447 62.338 -22.822 1.00 56.70 O ATOM 5405 CB GLU B 29 2.241 63.859 -25.437 1.00 56.97 C ATOM 5406 CG GLU B 29 1.717 65.303 -25.439 1.00 57.73 C ATOM 5407 CD GLU B 29 1.240 65.797 -26.823 1.00 60.45 C ATOM 5408 OE1 GLU B 29 0.901 64.943 -27.701 1.00 60.44 O ATOM 5409 OE2 GLU B 29 1.183 67.048 -27.011 1.00 60.19 O ATOM 5410 HA GLU B 29 1.704 61.782 -25.353 1.00 0.00 H ATOM 5411 HB2 GLU B 29 3.001 63.786 -24.659 1.00 0.00 H ATOM 5412 HB3 GLU B 29 2.699 63.674 -26.409 1.00 0.00 H ATOM 5413 HG2 GLU B 29 0.879 65.365 -24.745 1.00 0.00 H ATOM 5414 HG3 GLU B 29 2.518 65.959 -25.098 1.00 0.00 H ATOM 5415 H GLU B 29 0.019 63.597 -26.794 1.00 0.00 H ATOM 5416 N HIS B 30 -0.483 63.257 -23.525 1.00 55.86 N ATOM 5417 CA HIS B 30 -1.070 63.298 -22.203 1.00 55.20 C ATOM 5418 C HIS B 30 -1.201 61.920 -21.506 1.00 55.33 C ATOM 5419 O HIS B 30 -1.183 61.864 -20.274 1.00 54.70 O ATOM 5420 CB HIS B 30 -2.432 63.974 -22.291 1.00 54.57 C ATOM 5421 CG HIS B 30 -2.968 64.415 -20.968 1.00 53.37 C ATOM 5422 ND1 HIS B 30 -3.947 63.718 -20.295 1.00 51.35 N ATOM 5423 CD2 HIS B 30 -2.650 65.473 -20.186 1.00 51.67 C ATOM 5424 CE1 HIS B 30 -4.224 64.341 -19.165 1.00 50.70 C ATOM 5425 NE2 HIS B 30 -3.448 65.406 -19.073 1.00 49.88 N ATOM 5426 HA HIS B 30 -0.382 63.866 -21.577 1.00 0.00 H ATOM 5427 HB2 HIS B 30 -2.342 64.849 -22.935 1.00 0.00 H ATOM 5428 HB3 HIS B 30 -3.138 63.271 -22.732 1.00 0.00 H ATOM 5429 HD2 HIS B 30 -1.901 66.235 -20.401 1.00 0.00 H ATOM 5430 HE1 HIS B 30 -4.968 64.029 -18.431 1.00 0.00 H ATOM 5431 H HIS B 30 -1.027 63.623 -24.332 1.00 0.00 H ATOM 5432 N ALA B 31 -1.328 60.839 -22.294 1.00 55.83 N ATOM 5433 CA ALA B 31 -1.511 59.449 -21.797 1.00 56.14 C ATOM 5434 C ALA B 31 -0.405 59.046 -20.843 1.00 56.82 C ATOM 5435 O ALA B 31 -0.590 58.167 -19.996 1.00 55.57 O ATOM 5436 CB ALA B 31 -1.542 58.462 -22.969 1.00 56.15 C ATOM 5437 HA ALA B 31 -2.460 59.421 -21.262 1.00 0.00 H ATOM 5438 HB1 ALA B 31 -2.369 58.714 -23.633 1.00 0.00 H ATOM 5439 HB2 ALA B 31 -0.602 58.522 -23.518 1.00 0.00 H ATOM 5440 HB3 ALA B 31 -1.677 57.450 -22.587 1.00 0.00 H ATOM 5441 H ALA B 31 -1.296 60.984 -23.323 1.00 0.00 H ATOM 5442 N ARG B 32 0.746 59.699 -21.043 1.00 57.95 N ATOM 5443 CA ARG B 32 1.985 59.499 -20.288 1.00 58.78 C ATOM 5444 C ARG B 32 1.902 60.019 -18.885 1.00 57.89 C ATOM 5445 O ARG B 32 2.667 59.618 -18.007 1.00 58.22 O ATOM 5446 CB ARG B 32 3.109 60.274 -20.939 1.00 59.43 C ATOM 5447 CG ARG B 32 3.473 59.798 -22.308 1.00 63.03 C ATOM 5448 CD ARG B 32 4.738 60.502 -22.714 1.00 68.25 C ATOM 5449 NE ARG B 32 4.832 60.696 -24.147 1.00 70.33 N ATOM 5450 CZ ARG B 32 5.565 61.641 -24.736 1.00 72.79 C ATOM 5451 NH1 ARG B 32 6.277 62.500 -24.009 1.00 73.40 N ATOM 5452 NH2 ARG B 32 5.588 61.727 -26.071 1.00 72.86 N ATOM 5453 HA ARG B 32 2.156 58.423 -20.278 1.00 0.00 H ATOM 5454 HB2 ARG B 32 2.807 61.319 -21.010 1.00 0.00 H ATOM 5455 HB3 ARG B 32 3.991 60.194 -20.304 1.00 0.00 H ATOM 5456 HG2 ARG B 32 3.635 58.720 -22.296 1.00 0.00 H ATOM 5457 HG3 ARG B 32 2.673 60.036 -23.009 1.00 0.00 H ATOM 5458 HD2 ARG B 32 5.590 59.907 -22.385 1.00 0.00 H ATOM 5459 HD3 ARG B 32 4.767 61.477 -22.227 1.00 0.00 H ATOM 5460 HE ARG B 32 4.290 60.053 -24.759 1.00 0.00 H ATOM 5461 HH12 ARG B 32 6.845 63.233 -24.479 1.00 0.00 H ATOM 5462 HH11 ARG B 32 6.265 62.438 -22.971 1.00 0.00 H ATOM 5463 HH22 ARG B 32 6.158 62.463 -26.535 1.00 0.00 H ATOM 5464 HH21 ARG B 32 5.036 61.058 -26.645 1.00 0.00 H ATOM 5465 H ARG B 32 0.762 60.411 -21.801 1.00 0.00 H ATOM 5466 N GLU B 33 0.992 60.949 -18.680 1.00 56.84 N ATOM 5467 CA GLU B 33 0.796 61.518 -17.370 1.00 55.94 C ATOM 5468 C GLU B 33 0.003 60.607 -16.407 1.00 54.87 C ATOM 5469 O GLU B 33 -0.277 61.006 -15.291 1.00 54.54 O ATOM 5470 CB GLU B 33 0.147 62.891 -17.529 1.00 55.86 C ATOM 5471 CG GLU B 33 1.009 63.886 -18.359 1.00 57.20 C ATOM 5472 CD GLU B 33 2.294 64.281 -17.636 1.00 59.44 C ATOM 5473 OE1 GLU B 33 2.344 65.392 -17.054 1.00 58.85 O ATOM 5474 OE2 GLU B 33 3.244 63.463 -17.621 1.00 62.14 O ATOM 5475 HA GLU B 33 1.772 61.622 -16.896 1.00 0.00 H ATOM 5476 HB2 GLU B 33 -0.813 62.764 -18.029 1.00 0.00 H ATOM 5477 HB3 GLU B 33 -0.014 63.315 -16.538 1.00 0.00 H ATOM 5478 HG2 GLU B 33 1.270 63.417 -19.308 1.00 0.00 H ATOM 5479 HG3 GLU B 33 0.422 64.785 -18.549 1.00 0.00 H ATOM 5480 H GLU B 33 0.407 61.277 -19.474 1.00 0.00 H ATOM 5481 N ARG B 34 -0.315 59.379 -16.807 1.00 54.40 N ATOM 5482 CA ARG B 34 -1.022 58.454 -15.905 1.00 54.67 C ATOM 5483 C ARG B 34 -0.161 57.961 -14.753 1.00 54.64 C ATOM 5484 O ARG B 34 1.050 57.983 -14.817 1.00 54.90 O ATOM 5485 CB ARG B 34 -1.566 57.237 -16.656 1.00 54.60 C ATOM 5486 CG ARG B 34 -2.664 57.567 -17.637 1.00 56.14 C ATOM 5487 CD ARG B 34 -3.966 57.851 -16.939 1.00 58.14 C ATOM 5488 NE ARG B 34 -4.554 56.625 -16.401 1.00 59.17 N ATOM 5489 CZ ARG B 34 -5.352 55.797 -17.076 1.00 60.65 C ATOM 5490 NH1 ARG B 34 -5.690 56.024 -18.339 1.00 61.30 N ATOM 5491 NH2 ARG B 34 -5.831 54.725 -16.474 1.00 62.12 N ATOM 5492 HA ARG B 34 -1.844 59.039 -15.494 1.00 0.00 H ATOM 5493 HB2 ARG B 34 -0.744 56.775 -17.203 1.00 0.00 H ATOM 5494 HB3 ARG B 34 -1.959 56.529 -15.926 1.00 0.00 H ATOM 5495 HG2 ARG B 34 -2.372 58.446 -18.212 1.00 0.00 H ATOM 5496 HG3 ARG B 34 -2.801 56.722 -18.312 1.00 0.00 H ATOM 5497 HD2 ARG B 34 -4.661 58.297 -17.650 1.00 0.00 H ATOM 5498 HD3 ARG B 34 -3.787 58.549 -16.121 1.00 0.00 H ATOM 5499 HE ARG B 34 -4.333 56.380 -15.415 1.00 0.00 H ATOM 5500 HH12 ARG B 34 -6.315 55.359 -18.838 1.00 0.00 H ATOM 5501 HH11 ARG B 34 -5.330 56.867 -18.830 1.00 0.00 H ATOM 5502 HH22 ARG B 34 -6.454 54.073 -16.992 1.00 0.00 H ATOM 5503 HH21 ARG B 34 -5.585 54.532 -15.482 1.00 0.00 H ATOM 5504 H ARG B 34 -0.062 59.069 -17.767 1.00 0.00 H ATOM 5505 N LEU B 35 -0.817 57.478 -13.711 1.00 54.76 N ATOM 5506 CA LEU B 35 -0.130 57.025 -12.521 1.00 54.97 C ATOM 5507 C LEU B 35 0.854 55.944 -12.871 1.00 56.42 C ATOM 5508 O LEU B 35 0.524 55.057 -13.647 1.00 56.33 O ATOM 5509 CB LEU B 35 -1.126 56.466 -11.509 1.00 54.50 C ATOM 5510 CG LEU B 35 -0.513 55.887 -10.233 1.00 53.77 C ATOM 5511 CD1 LEU B 35 0.193 57.006 -9.414 1.00 50.51 C ATOM 5512 CD2 LEU B 35 -1.586 55.126 -9.416 1.00 54.27 C ATOM 5513 HA LEU B 35 0.392 57.878 -12.088 1.00 0.00 H ATOM 5514 HB2 LEU B 35 -1.801 57.272 -11.222 1.00 0.00 H ATOM 5515 HB3 LEU B 35 -1.694 55.675 -11.998 1.00 0.00 H ATOM 5516 HG LEU B 35 0.255 55.160 -10.497 1.00 0.00 H ATOM 5517 HD21 LEU B 35 -2.389 55.812 -9.145 1.00 0.00 H ATOM 5518 HD22 LEU B 35 -1.989 54.312 -10.018 1.00 0.00 H ATOM 5519 HD23 LEU B 35 -1.132 54.721 -8.512 1.00 0.00 H ATOM 5520 HD11 LEU B 35 0.983 57.452 -10.017 1.00 0.00 H ATOM 5521 HD12 LEU B 35 -0.535 57.771 -9.143 1.00 0.00 H ATOM 5522 HD13 LEU B 35 0.623 56.576 -8.510 1.00 0.00 H ATOM 5523 H LEU B 35 -1.855 57.422 -13.748 1.00 0.00 H ATOM 5524 N GLN B 36 2.056 56.026 -12.299 1.00 57.77 N ATOM 5525 CA GLN B 36 2.990 54.918 -12.327 1.00 59.19 C ATOM 5526 C GLN B 36 3.124 54.402 -10.928 1.00 59.94 C ATOM 5527 O GLN B 36 3.772 55.015 -10.090 1.00 58.84 O ATOM 5528 CB GLN B 36 4.359 55.339 -12.829 1.00 59.75 C ATOM 5529 CG GLN B 36 4.387 55.912 -14.217 1.00 59.73 C ATOM 5530 CD GLN B 36 5.748 56.473 -14.564 1.00 59.90 C ATOM 5531 OE1 GLN B 36 5.873 57.630 -14.940 1.00 58.56 O ATOM 5532 NE2 GLN B 36 6.786 55.657 -14.410 1.00 61.69 N ATOM 5533 HA GLN B 36 2.611 54.156 -13.008 1.00 0.00 H ATOM 5534 HB2 GLN B 36 4.751 56.092 -12.146 1.00 0.00 H ATOM 5535 HB3 GLN B 36 5.008 54.463 -12.813 1.00 0.00 H ATOM 5536 HG2 GLN B 36 4.137 55.126 -14.929 1.00 0.00 H ATOM 5537 HG3 GLN B 36 3.648 56.710 -14.285 1.00 0.00 H ATOM 5538 HE22 GLN B 36 6.636 54.680 -14.088 1.00 0.00 H ATOM 5539 HE21 GLN B 36 7.748 55.996 -14.612 1.00 0.00 H ATOM 5540 H GLN B 36 2.330 56.908 -11.821 1.00 0.00 H ATOM 5541 N ASP B 37 2.508 53.260 -10.685 1.00 61.49 N ATOM 5542 CA ASP B 37 2.518 52.674 -9.374 1.00 62.90 C ATOM 5543 C ASP B 37 3.799 51.870 -9.049 1.00 64.51 C ATOM 5544 O ASP B 37 3.863 51.232 -8.003 1.00 64.71 O ATOM 5545 CB ASP B 37 1.254 51.824 -9.178 1.00 62.72 C ATOM 5546 CG ASP B 37 1.264 50.532 -9.981 1.00 63.36 C ATOM 5547 OD1 ASP B 37 2.209 50.273 -10.774 1.00 62.70 O ATOM 5548 OD2 ASP B 37 0.297 49.761 -9.801 1.00 62.72 O ATOM 5549 HA ASP B 37 2.520 53.498 -8.661 1.00 0.00 H ATOM 5550 HB2 ASP B 37 1.166 51.573 -8.121 1.00 0.00 H ATOM 5551 HB3 ASP B 37 0.390 52.414 -9.483 1.00 0.00 H ATOM 5552 H ASP B 37 2.006 52.776 -11.457 1.00 0.00 H ATOM 5553 N ASP B 38 4.804 51.886 -9.929 1.00 66.18 N ATOM 5554 CA ASP B 38 6.070 51.170 -9.688 1.00 67.25 C ATOM 5555 C ASP B 38 5.830 49.705 -9.271 1.00 68.22 C ATOM 5556 O ASP B 38 6.595 49.141 -8.499 1.00 68.38 O ATOM 5557 CB ASP B 38 6.909 51.865 -8.585 1.00 66.99 C ATOM 5558 CG ASP B 38 7.112 53.353 -8.826 1.00 65.14 C ATOM 5559 OD1 ASP B 38 7.185 53.756 -9.988 1.00 65.10 O ATOM 5560 OD2 ASP B 38 7.229 54.129 -7.857 1.00 61.01 O ATOM 5561 HA ASP B 38 6.616 51.189 -10.631 1.00 0.00 H ATOM 5562 HB2 ASP B 38 6.399 51.736 -7.630 1.00 0.00 H ATOM 5563 HB3 ASP B 38 7.887 51.386 -8.541 1.00 0.00 H ATOM 5564 H ASP B 38 4.690 52.421 -10.813 1.00 0.00 H ATOM 5565 N SER B 39 4.762 49.100 -9.767 1.00 68.61 N ATOM 5566 CA SER B 39 4.368 47.752 -9.353 1.00 69.48 C ATOM 5567 C SER B 39 4.187 47.544 -7.833 1.00 69.02 C ATOM 5568 O SER B 39 4.363 46.458 -7.300 1.00 69.77 O ATOM 5569 CB SER B 39 5.336 46.733 -9.930 1.00 70.01 C ATOM 5570 OG SER B 39 4.941 46.434 -11.247 1.00 70.28 O ATOM 5571 HA SER B 39 3.368 47.606 -9.760 1.00 0.00 H ATOM 5572 HB2 SER B 39 5.318 45.826 -9.326 1.00 0.00 H ATOM 5573 HB3 SER B 39 6.345 47.146 -9.934 1.00 0.00 H ATOM 5574 HG SER B 39 5.565 45.770 -11.635 1.00 0.00 H ATOM 5575 H SER B 39 4.184 49.598 -10.474 1.00 0.00 H ATOM 5576 N VAL B 40 3.809 48.597 -7.143 1.00 67.47 N ATOM 5577 CA VAL B 40 3.592 48.523 -5.726 1.00 66.16 C ATOM 5578 C VAL B 40 2.252 49.207 -5.471 1.00 64.64 C ATOM 5579 O VAL B 40 2.095 50.408 -5.705 1.00 63.36 O ATOM 5580 CB VAL B 40 4.763 49.153 -4.982 1.00 66.15 C ATOM 5581 CG1 VAL B 40 4.503 49.232 -3.486 1.00 64.79 C ATOM 5582 CG2 VAL B 40 5.996 48.344 -5.261 1.00 65.24 C ATOM 5583 HA VAL B 40 3.545 47.499 -5.354 1.00 0.00 H ATOM 5584 HB VAL B 40 4.897 50.176 -5.334 1.00 0.00 H ATOM 5585 HG11 VAL B 40 3.615 49.838 -3.304 1.00 0.00 H ATOM 5586 HG12 VAL B 40 4.346 48.228 -3.092 1.00 0.00 H ATOM 5587 HG13 VAL B 40 5.362 49.687 -2.993 1.00 0.00 H ATOM 5588 HG21 VAL B 40 5.843 47.321 -4.917 1.00 0.00 H ATOM 5589 HG22 VAL B 40 6.193 48.343 -6.333 1.00 0.00 H ATOM 5590 HG23 VAL B 40 6.844 48.783 -4.735 1.00 0.00 H ATOM 5591 H VAL B 40 3.664 49.502 -7.634 1.00 0.00 H ATOM 5592 N GLU B 41 1.286 48.390 -5.049 1.00 63.33 N ATOM 5593 CA GLU B 41 -0.100 48.792 -4.864 1.00 61.80 C ATOM 5594 C GLU B 41 -0.380 49.102 -3.407 1.00 59.34 C ATOM 5595 O GLU B 41 -0.047 48.308 -2.537 1.00 59.72 O ATOM 5596 CB GLU B 41 -1.050 47.673 -5.293 1.00 62.31 C ATOM 5597 CG GLU B 41 -0.692 47.005 -6.598 1.00 64.31 C ATOM 5598 CD GLU B 41 -1.905 46.544 -7.376 1.00 66.35 C ATOM 5599 OE1 GLU B 41 -2.857 46.021 -6.756 1.00 67.78 O ATOM 5600 OE2 GLU B 41 -1.905 46.706 -8.616 1.00 66.71 O ATOM 5601 HA GLU B 41 -0.262 49.680 -5.476 1.00 0.00 H ATOM 5602 HB2 GLU B 41 -1.053 46.913 -4.512 1.00 0.00 H ATOM 5603 HB3 GLU B 41 -2.050 48.096 -5.391 1.00 0.00 H ATOM 5604 HG2 GLU B 41 -0.135 47.714 -7.210 1.00 0.00 H ATOM 5605 HG3 GLU B 41 -0.065 46.139 -6.385 1.00 0.00 H ATOM 5606 H GLU B 41 1.539 47.403 -4.839 1.00 0.00 H ATOM 5607 N THR B 42 -0.983 50.257 -3.150 1.00 55.89 N ATOM 5608 CA THR B 42 -1.556 50.553 -1.852 1.00 53.14 C ATOM 5609 C THR B 42 -2.938 51.164 -2.070 1.00 50.70 C ATOM 5610 O THR B 42 -3.322 51.480 -3.191 1.00 50.50 O ATOM 5611 CB THR B 42 -0.690 51.529 -1.060 1.00 52.96 C ATOM 5612 OG1 THR B 42 -0.696 52.806 -1.711 1.00 52.05 O ATOM 5613 CG2 THR B 42 0.734 51.024 -0.956 1.00 52.78 C ATOM 5614 HA THR B 42 -1.620 49.629 -1.277 1.00 0.00 H ATOM 5615 HB THR B 42 -1.100 51.620 -0.054 1.00 0.00 H ATOM 5616 HG1 THR B 42 -0.134 53.439 -1.198 1.00 0.00 H ATOM 5617 HG23 THR B 42 0.739 50.053 -0.461 1.00 0.00 H ATOM 5618 HG21 THR B 42 1.157 50.926 -1.956 1.00 0.00 H ATOM 5619 HG22 THR B 42 1.328 51.731 -0.377 1.00 0.00 H ATOM 5620 H THR B 42 -1.046 50.971 -3.903 1.00 0.00 H ATOM 5621 N VAL B 43 -3.685 51.320 -0.983 1.00 47.64 N ATOM 5622 CA VAL B 43 -4.999 51.943 -1.021 1.00 44.68 C ATOM 5623 C VAL B 43 -4.870 53.247 -1.817 1.00 43.58 C ATOM 5624 O VAL B 43 -5.662 53.497 -2.716 1.00 43.45 O ATOM 5625 CB VAL B 43 -5.572 52.170 0.432 1.00 43.96 C ATOM 5626 CG1 VAL B 43 -6.913 52.827 0.382 1.00 42.02 C ATOM 5627 CG2 VAL B 43 -5.672 50.844 1.194 1.00 41.05 C ATOM 5628 HA VAL B 43 -5.719 51.290 -1.514 1.00 0.00 H ATOM 5629 HB VAL B 43 -4.880 52.827 0.959 1.00 0.00 H ATOM 5630 HG11 VAL B 43 -6.824 53.793 -0.114 1.00 0.00 H ATOM 5631 HG12 VAL B 43 -7.606 52.194 -0.173 1.00 0.00 H ATOM 5632 HG13 VAL B 43 -7.284 52.971 1.397 1.00 0.00 H ATOM 5633 HG21 VAL B 43 -6.336 50.167 0.657 1.00 0.00 H ATOM 5634 HG22 VAL B 43 -4.681 50.396 1.273 1.00 0.00 H ATOM 5635 HG23 VAL B 43 -6.070 51.029 2.192 1.00 0.00 H ATOM 5636 H VAL B 43 -3.317 50.984 -0.070 1.00 0.00 H ATOM 5637 N THR B 44 -3.840 54.041 -1.529 1.00 42.17 N ATOM 5638 CA THR B 44 -3.627 55.306 -2.237 1.00 41.47 C ATOM 5639 C THR B 44 -3.507 55.136 -3.754 1.00 41.87 C ATOM 5640 O THR B 44 -4.065 55.950 -4.492 1.00 42.64 O ATOM 5641 CB THR B 44 -2.367 56.070 -1.722 1.00 41.21 C ATOM 5642 OG1 THR B 44 -2.574 56.447 -0.370 1.00 39.70 O ATOM 5643 CG2 THR B 44 -2.084 57.338 -2.538 1.00 39.55 C ATOM 5644 HA THR B 44 -4.521 55.892 -2.023 1.00 0.00 H ATOM 5645 HB THR B 44 -1.513 55.400 -1.823 1.00 0.00 H ATOM 5646 HG1 THR B 44 -2.720 55.636 0.179 1.00 0.00 H ATOM 5647 HG23 THR B 44 -1.922 57.068 -3.582 1.00 0.00 H ATOM 5648 HG21 THR B 44 -2.936 58.014 -2.464 1.00 0.00 H ATOM 5649 HG22 THR B 44 -1.194 57.830 -2.146 1.00 0.00 H ATOM 5650 H THR B 44 -3.172 53.757 -0.785 1.00 0.00 H ATOM 5651 N SER B 45 -2.808 54.107 -4.229 1.00 41.63 N ATOM 5652 CA SER B 45 -2.627 53.984 -5.660 1.00 41.91 C ATOM 5653 C SER B 45 -3.863 53.386 -6.284 1.00 42.58 C ATOM 5654 O SER B 45 -4.323 53.845 -7.326 1.00 43.54 O ATOM 5655 CB SER B 45 -1.372 53.188 -6.028 1.00 42.37 C ATOM 5656 OG SER B 45 -1.423 51.854 -5.562 1.00 41.43 O ATOM 5657 HA SER B 45 -2.477 54.986 -6.063 1.00 0.00 H ATOM 5658 HB2 SER B 45 -0.504 53.680 -5.588 1.00 0.00 H ATOM 5659 HB3 SER B 45 -1.270 53.176 -7.113 1.00 0.00 H ATOM 5660 HG SER B 45 -2.204 51.396 -5.962 1.00 0.00 H ATOM 5661 H SER B 45 -2.399 53.403 -3.582 1.00 0.00 H ATOM 5662 N ILE B 46 -4.409 52.360 -5.663 1.00 42.81 N ATOM 5663 CA ILE B 46 -5.622 51.773 -6.166 1.00 43.50 C ATOM 5664 C ILE B 46 -6.636 52.895 -6.369 1.00 42.74 C ATOM 5665 O ILE B 46 -7.186 53.037 -7.435 1.00 42.25 O ATOM 5666 CB ILE B 46 -6.138 50.667 -5.190 1.00 44.49 C ATOM 5667 CG1 ILE B 46 -5.222 49.441 -5.271 1.00 46.57 C ATOM 5668 CG2 ILE B 46 -7.581 50.260 -5.465 1.00 43.49 C ATOM 5669 CD1 ILE B 46 -4.884 48.855 -3.872 1.00 49.75 C ATOM 5670 HA ILE B 46 -5.450 51.278 -7.122 1.00 0.00 H ATOM 5671 HB ILE B 46 -6.116 51.088 -4.185 1.00 0.00 H ATOM 5672 HG12 ILE B 46 -5.719 48.671 -5.861 1.00 0.00 H ATOM 5673 HG13 ILE B 46 -4.293 49.731 -5.762 1.00 0.00 H ATOM 5674 HD11 ILE B 46 -4.378 49.613 -3.275 1.00 0.00 H ATOM 5675 HD12 ILE B 46 -5.805 48.553 -3.374 1.00 0.00 H ATOM 5676 HD13 ILE B 46 -4.233 47.989 -3.990 1.00 0.00 H ATOM 5677 HG21 ILE B 46 -8.229 51.129 -5.356 1.00 0.00 H ATOM 5678 HG22 ILE B 46 -7.660 49.871 -6.480 1.00 0.00 H ATOM 5679 HG23 ILE B 46 -7.881 49.489 -4.755 1.00 0.00 H ATOM 5680 H ILE B 46 -3.962 51.974 -4.807 1.00 0.00 H ATOM 5681 N GLU B 47 -6.843 53.733 -5.357 1.00 42.51 N ATOM 5682 CA GLU B 47 -7.902 54.754 -5.429 1.00 41.83 C ATOM 5683 C GLU B 47 -7.586 55.792 -6.466 1.00 41.51 C ATOM 5684 O GLU B 47 -8.470 56.237 -7.174 1.00 41.69 O ATOM 5685 CB GLU B 47 -8.138 55.438 -4.076 1.00 41.35 C ATOM 5686 CG GLU B 47 -8.797 54.546 -3.022 1.00 43.10 C ATOM 5687 CD GLU B 47 -10.116 53.912 -3.511 1.00 46.92 C ATOM 5688 OE1 GLU B 47 -11.099 54.677 -3.684 1.00 47.05 O ATOM 5689 OE2 GLU B 47 -10.167 52.661 -3.725 1.00 46.75 O ATOM 5690 HA GLU B 47 -8.816 54.231 -5.711 1.00 0.00 H ATOM 5691 HB2 GLU B 47 -7.174 55.769 -3.689 1.00 0.00 H ATOM 5692 HB3 GLU B 47 -8.779 56.304 -4.239 1.00 0.00 H ATOM 5693 HG2 GLU B 47 -8.103 53.747 -2.759 1.00 0.00 H ATOM 5694 HG3 GLU B 47 -9.007 55.149 -2.138 1.00 0.00 H ATOM 5695 H GLU B 47 -6.250 53.666 -4.505 1.00 0.00 H ATOM 5696 N GLN B 48 -6.325 56.179 -6.562 1.00 41.63 N ATOM 5697 CA GLN B 48 -5.930 57.187 -7.547 1.00 41.94 C ATOM 5698 C GLN B 48 -6.070 56.624 -8.969 1.00 42.50 C ATOM 5699 O GLN B 48 -6.467 57.341 -9.894 1.00 42.38 O ATOM 5700 CB GLN B 48 -4.507 57.680 -7.248 1.00 42.05 C ATOM 5701 CG GLN B 48 -3.860 58.557 -8.313 1.00 41.80 C ATOM 5702 CD GLN B 48 -4.498 59.907 -8.456 1.00 41.05 C ATOM 5703 OE1 GLN B 48 -5.133 60.417 -7.513 1.00 40.94 O ATOM 5704 NE2 GLN B 48 -4.314 60.525 -9.634 1.00 36.49 N ATOM 5705 HA GLN B 48 -6.594 58.049 -7.479 1.00 0.00 H ATOM 5706 HB2 GLN B 48 -4.541 58.253 -6.321 1.00 0.00 H ATOM 5707 HB3 GLN B 48 -3.874 56.804 -7.109 1.00 0.00 H ATOM 5708 HG2 GLN B 48 -2.811 58.698 -8.052 1.00 0.00 H ATOM 5709 HG3 GLN B 48 -3.928 58.041 -9.271 1.00 0.00 H ATOM 5710 HE22 GLN B 48 -3.775 60.055 -10.389 1.00 0.00 H ATOM 5711 HE21 GLN B 48 -4.710 61.474 -9.791 1.00 0.00 H ATOM 5712 H GLN B 48 -5.609 55.764 -5.933 1.00 0.00 H ATOM 5713 N ALA B 49 -5.778 55.337 -9.137 1.00 42.96 N ATOM 5714 CA ALA B 49 -5.972 54.670 -10.444 1.00 43.28 C ATOM 5715 C ALA B 49 -7.446 54.597 -10.814 1.00 42.88 C ATOM 5716 O ALA B 49 -7.827 54.825 -11.962 1.00 43.86 O ATOM 5717 CB ALA B 49 -5.355 53.277 -10.459 1.00 43.05 C ATOM 5718 HA ALA B 49 -5.459 55.276 -11.191 1.00 0.00 H ATOM 5719 HB1 ALA B 49 -4.285 53.353 -10.266 1.00 0.00 H ATOM 5720 HB2 ALA B 49 -5.822 52.666 -9.687 1.00 0.00 H ATOM 5721 HB3 ALA B 49 -5.518 52.819 -11.435 1.00 0.00 H ATOM 5722 H ALA B 49 -5.406 54.789 -8.335 1.00 0.00 H ATOM 5723 N LYS B 50 -8.283 54.288 -9.843 1.00 42.63 N ATOM 5724 CA LYS B 50 -9.719 54.349 -10.055 1.00 42.29 C ATOM 5725 C LYS B 50 -10.230 55.714 -10.614 1.00 41.49 C ATOM 5726 O LYS B 50 -11.010 55.733 -11.598 1.00 42.23 O ATOM 5727 CB LYS B 50 -10.444 53.919 -8.785 1.00 41.86 C ATOM 5728 CG LYS B 50 -10.784 52.465 -8.859 1.00 44.65 C ATOM 5729 CD LYS B 50 -10.596 51.702 -7.581 1.00 48.24 C ATOM 5730 CE LYS B 50 -11.717 51.882 -6.595 1.00 49.78 C ATOM 5731 NZ LYS B 50 -11.376 51.094 -5.357 1.00 51.84 N ATOM 5732 HA LYS B 50 -9.957 53.643 -10.851 1.00 0.00 H ATOM 5733 HB2 LYS B 50 -9.800 54.096 -7.924 1.00 0.00 H ATOM 5734 HB3 LYS B 50 -11.360 54.499 -8.678 1.00 0.00 H ATOM 5735 HG2 LYS B 50 -11.829 52.377 -9.155 1.00 0.00 H ATOM 5736 HG3 LYS B 50 -10.153 52.009 -9.621 1.00 0.00 H ATOM 5737 HD2 LYS B 50 -10.517 50.642 -7.822 1.00 0.00 H ATOM 5738 HD3 LYS B 50 -9.670 52.037 -7.114 1.00 0.00 H ATOM 5739 HE2 LYS B 50 -12.650 51.515 -7.023 1.00 0.00 H ATOM 5740 HE3 LYS B 50 -11.825 52.937 -6.345 1.00 0.00 H ATOM 5741 HZ1 LYS B 50 -11.272 50.089 -5.605 1.00 0.00 H ATOM 5742 HZ2 LYS B 50 -10.484 51.448 -4.957 1.00 0.00 H ATOM 5743 HZ3 LYS B 50 -12.138 51.202 -4.658 1.00 0.00 H ATOM 5744 H LYS B 50 -7.911 53.998 -8.916 1.00 0.00 H ATOM 5745 N VAL B 51 -9.791 56.832 -10.037 1.00 39.69 N ATOM 5746 CA VAL B 51 -10.250 58.131 -10.513 1.00 38.55 C ATOM 5747 C VAL B 51 -9.745 58.393 -11.921 1.00 40.00 C ATOM 5748 O VAL B 51 -10.494 58.825 -12.773 1.00 39.81 O ATOM 5749 CB VAL B 51 -9.868 59.298 -9.537 1.00 37.96 C ATOM 5750 CG1 VAL B 51 -10.084 60.667 -10.184 1.00 33.09 C ATOM 5751 CG2 VAL B 51 -10.660 59.169 -8.225 1.00 34.05 C ATOM 5752 HA VAL B 51 -11.339 58.100 -10.539 1.00 0.00 H ATOM 5753 HB VAL B 51 -8.805 59.219 -9.310 1.00 0.00 H ATOM 5754 HG11 VAL B 51 -9.464 60.747 -11.077 1.00 0.00 H ATOM 5755 HG12 VAL B 51 -11.133 60.776 -10.458 1.00 0.00 H ATOM 5756 HG13 VAL B 51 -9.808 61.449 -9.477 1.00 0.00 H ATOM 5757 HG21 VAL B 51 -11.727 59.216 -8.440 1.00 0.00 H ATOM 5758 HG22 VAL B 51 -10.425 58.215 -7.753 1.00 0.00 H ATOM 5759 HG23 VAL B 51 -10.387 59.984 -7.555 1.00 0.00 H ATOM 5760 H VAL B 51 -9.119 56.778 -9.245 1.00 0.00 H ATOM 5761 N GLU B 52 -8.474 58.097 -12.166 1.00 42.38 N ATOM 5762 CA GLU B 52 -7.854 58.320 -13.474 1.00 44.19 C ATOM 5763 C GLU B 52 -8.566 57.541 -14.562 1.00 45.16 C ATOM 5764 O GLU B 52 -8.687 58.008 -15.687 1.00 46.00 O ATOM 5765 CB GLU B 52 -6.371 57.938 -13.464 1.00 44.75 C ATOM 5766 CG GLU B 52 -5.534 58.744 -12.443 1.00 45.47 C ATOM 5767 CD GLU B 52 -4.030 58.768 -12.723 1.00 46.25 C ATOM 5768 OE1 GLU B 52 -3.522 58.018 -13.601 1.00 48.09 O ATOM 5769 OE2 GLU B 52 -3.345 59.558 -12.028 1.00 49.96 O ATOM 5770 HA GLU B 52 -7.942 59.386 -13.686 1.00 0.00 H ATOM 5771 HB2 GLU B 52 -6.289 56.879 -13.219 1.00 0.00 H ATOM 5772 HB3 GLU B 52 -5.963 58.112 -14.460 1.00 0.00 H ATOM 5773 HG2 GLU B 52 -5.896 59.772 -12.444 1.00 0.00 H ATOM 5774 HG3 GLU B 52 -5.689 58.307 -11.457 1.00 0.00 H ATOM 5775 H GLU B 52 -7.898 57.692 -11.401 1.00 0.00 H ATOM 5776 N GLU B 53 -9.052 56.360 -14.226 1.00 46.53 N ATOM 5777 CA GLU B 53 -9.847 55.582 -15.173 1.00 46.56 C ATOM 5778 C GLU B 53 -11.119 56.373 -15.534 1.00 44.53 C ATOM 5779 O GLU B 53 -11.444 56.510 -16.712 1.00 45.27 O ATOM 5780 CB GLU B 53 -10.168 54.181 -14.601 1.00 47.65 C ATOM 5781 CG GLU B 53 -10.522 53.053 -15.638 1.00 51.14 C ATOM 5782 CD GLU B 53 -9.755 53.157 -16.992 1.00 59.73 C ATOM 5783 OE1 GLU B 53 -8.548 52.796 -17.043 1.00 62.24 O ATOM 5784 OE2 GLU B 53 -10.371 53.599 -18.016 1.00 64.74 O ATOM 5785 HA GLU B 53 -9.277 55.418 -16.087 1.00 0.00 H ATOM 5786 HB2 GLU B 53 -9.297 53.848 -14.036 1.00 0.00 H ATOM 5787 HB3 GLU B 53 -11.018 54.287 -13.927 1.00 0.00 H ATOM 5788 HG2 GLU B 53 -10.288 52.089 -15.186 1.00 0.00 H ATOM 5789 HG3 GLU B 53 -11.591 53.105 -15.847 1.00 0.00 H ATOM 5790 H GLU B 53 -8.867 55.979 -13.276 1.00 0.00 H ATOM 5791 N LYS B 54 -11.807 56.916 -14.541 1.00 42.00 N ATOM 5792 CA LYS B 54 -13.046 57.666 -14.792 1.00 41.08 C ATOM 5793 C LYS B 54 -12.792 58.930 -15.582 1.00 40.04 C ATOM 5794 O LYS B 54 -13.501 59.227 -16.537 1.00 39.89 O ATOM 5795 CB LYS B 54 -13.746 58.030 -13.488 1.00 40.43 C ATOM 5796 CG LYS B 54 -14.649 56.929 -12.943 1.00 44.71 C ATOM 5797 CD LYS B 54 -14.976 57.083 -11.404 1.00 44.70 C ATOM 5798 CE LYS B 54 -14.359 55.956 -10.501 1.00 49.20 C ATOM 5799 NZ LYS B 54 -14.158 56.347 -9.025 1.00 49.99 N ATOM 5800 HA LYS B 54 -13.688 57.009 -15.379 1.00 0.00 H ATOM 5801 HB2 LYS B 54 -12.985 58.252 -12.740 1.00 0.00 H ATOM 5802 HB3 LYS B 54 -14.354 58.918 -13.661 1.00 0.00 H ATOM 5803 HG2 LYS B 54 -15.587 56.946 -13.498 1.00 0.00 H ATOM 5804 HG3 LYS B 54 -14.154 55.970 -13.096 1.00 0.00 H ATOM 5805 HD2 LYS B 54 -14.588 58.044 -11.066 1.00 0.00 H ATOM 5806 HD3 LYS B 54 -16.059 57.066 -11.281 1.00 0.00 H ATOM 5807 HE2 LYS B 54 -13.388 55.683 -10.915 1.00 0.00 H ATOM 5808 HE3 LYS B 54 -15.023 55.092 -10.536 1.00 0.00 H ATOM 5809 HZ1 LYS B 54 -13.515 57.162 -8.968 1.00 0.00 H ATOM 5810 HZ2 LYS B 54 -15.076 56.598 -8.606 1.00 0.00 H ATOM 5811 HZ3 LYS B 54 -13.747 55.544 -8.508 1.00 0.00 H ATOM 5812 H LYS B 54 -11.464 56.810 -13.565 1.00 0.00 H ATOM 5813 N ILE B 55 -11.769 59.677 -15.199 1.00 40.02 N ATOM 5814 CA ILE B 55 -11.496 60.915 -15.897 1.00 40.04 C ATOM 5815 C ILE B 55 -11.087 60.590 -17.329 1.00 41.31 C ATOM 5816 O ILE B 55 -11.481 61.269 -18.254 1.00 40.97 O ATOM 5817 CB ILE B 55 -10.430 61.742 -15.181 1.00 39.51 C ATOM 5818 CG1 ILE B 55 -10.935 62.140 -13.773 1.00 37.73 C ATOM 5819 CG2 ILE B 55 -10.031 62.948 -16.038 1.00 35.88 C ATOM 5820 CD1 ILE B 55 -12.255 62.836 -13.739 1.00 33.70 C ATOM 5821 HA ILE B 55 -12.398 61.527 -15.911 1.00 0.00 H ATOM 5822 HB ILE B 55 -9.527 61.148 -15.041 1.00 0.00 H ATOM 5823 HG12 ILE B 55 -11.018 61.232 -13.176 1.00 0.00 H ATOM 5824 HG13 ILE B 55 -10.194 62.802 -13.324 1.00 0.00 H ATOM 5825 HD11 ILE B 55 -12.193 63.758 -14.317 1.00 0.00 H ATOM 5826 HD12 ILE B 55 -13.018 62.187 -14.169 1.00 0.00 H ATOM 5827 HD13 ILE B 55 -12.515 63.070 -12.706 1.00 0.00 H ATOM 5828 HG21 ILE B 55 -9.632 62.599 -16.991 1.00 0.00 H ATOM 5829 HG22 ILE B 55 -10.907 63.572 -16.216 1.00 0.00 H ATOM 5830 HG23 ILE B 55 -9.271 63.528 -15.515 1.00 0.00 H ATOM 5831 H ILE B 55 -11.168 59.378 -14.405 1.00 0.00 H ATOM 5832 N GLN B 56 -10.331 59.522 -17.515 1.00 43.05 N ATOM 5833 CA GLN B 56 -9.967 59.113 -18.860 1.00 44.51 C ATOM 5834 C GLN B 56 -11.213 58.850 -19.701 1.00 45.41 C ATOM 5835 O GLN B 56 -11.228 59.233 -20.868 1.00 45.25 O ATOM 5836 CB GLN B 56 -9.059 57.879 -18.855 1.00 45.18 C ATOM 5837 CG GLN B 56 -8.524 57.456 -20.238 1.00 46.46 C ATOM 5838 CD GLN B 56 -7.763 58.578 -20.965 1.00 48.13 C ATOM 5839 OE1 GLN B 56 -8.369 59.357 -21.705 1.00 47.48 O ATOM 5840 NE2 GLN B 56 -6.428 58.666 -20.743 1.00 48.47 N ATOM 5841 HA GLN B 56 -9.407 59.935 -19.307 1.00 0.00 H ATOM 5842 HB2 GLN B 56 -8.205 58.091 -18.212 1.00 0.00 H ATOM 5843 HB3 GLN B 56 -9.625 57.044 -18.442 1.00 0.00 H ATOM 5844 HG2 GLN B 56 -7.850 56.610 -20.105 1.00 0.00 H ATOM 5845 HG3 GLN B 56 -9.368 57.152 -20.858 1.00 0.00 H ATOM 5846 HE22 GLN B 56 -5.960 57.986 -20.110 1.00 0.00 H ATOM 5847 HE21 GLN B 56 -5.872 59.414 -21.205 1.00 0.00 H ATOM 5848 H GLN B 56 -9.996 58.974 -16.697 1.00 0.00 H ATOM 5849 N GLU B 57 -12.243 58.213 -19.130 1.00 45.97 N ATOM 5850 CA GLU B 57 -13.469 57.961 -19.899 1.00 47.65 C ATOM 5851 C GLU B 57 -14.063 59.277 -20.358 1.00 45.63 C ATOM 5852 O GLU B 57 -14.448 59.382 -21.520 1.00 47.05 O ATOM 5853 CB GLU B 57 -14.563 57.251 -19.116 1.00 47.93 C ATOM 5854 CG GLU B 57 -14.251 55.866 -18.661 1.00 52.03 C ATOM 5855 CD GLU B 57 -15.293 55.326 -17.644 1.00 52.67 C ATOM 5856 OE1 GLU B 57 -16.451 55.031 -18.062 1.00 57.12 O ATOM 5857 OE2 GLU B 57 -14.941 55.201 -16.433 1.00 58.46 O ATOM 5858 HA GLU B 57 -13.159 57.318 -20.723 1.00 0.00 H ATOM 5859 HB2 GLU B 57 -14.783 57.850 -18.233 1.00 0.00 H ATOM 5860 HB3 GLU B 57 -15.448 57.202 -19.750 1.00 0.00 H ATOM 5861 HG2 GLU B 57 -14.236 55.207 -19.529 1.00 0.00 H ATOM 5862 HG3 GLU B 57 -13.269 55.866 -18.189 1.00 0.00 H ATOM 5863 H GLU B 57 -12.175 57.897 -18.142 1.00 0.00 H ATOM 5864 N VAL B 58 -14.161 60.253 -19.451 1.00 42.80 N ATOM 5865 CA VAL B 58 -14.707 61.553 -19.805 1.00 40.97 C ATOM 5866 C VAL B 58 -13.866 62.147 -20.893 1.00 40.85 C ATOM 5867 O VAL B 58 -14.394 62.442 -21.935 1.00 40.43 O ATOM 5868 CB VAL B 58 -14.796 62.540 -18.626 1.00 40.54 C ATOM 5869 CG1 VAL B 58 -15.286 63.892 -19.109 1.00 37.59 C ATOM 5870 CG2 VAL B 58 -15.704 61.993 -17.517 1.00 37.49 C ATOM 5871 HA VAL B 58 -15.732 61.386 -20.135 1.00 0.00 H ATOM 5872 HB VAL B 58 -13.798 62.664 -18.206 1.00 0.00 H ATOM 5873 HG11 VAL B 58 -14.591 64.285 -19.852 1.00 0.00 H ATOM 5874 HG12 VAL B 58 -16.274 63.780 -19.557 1.00 0.00 H ATOM 5875 HG13 VAL B 58 -15.344 64.579 -18.265 1.00 0.00 H ATOM 5876 HG21 VAL B 58 -16.706 61.833 -17.915 1.00 0.00 H ATOM 5877 HG22 VAL B 58 -15.301 61.048 -17.152 1.00 0.00 H ATOM 5878 HG23 VAL B 58 -15.748 62.711 -16.698 1.00 0.00 H ATOM 5879 H VAL B 58 -13.842 60.080 -18.476 1.00 0.00 H ATOM 5880 N PHE B 59 -12.558 62.264 -20.685 1.00 41.63 N ATOM 5881 CA PHE B 59 -11.645 62.807 -21.734 1.00 42.48 C ATOM 5882 C PHE B 59 -11.798 62.112 -23.094 1.00 44.69 C ATOM 5883 O PHE B 59 -11.932 62.771 -24.113 1.00 45.49 O ATOM 5884 CB PHE B 59 -10.165 62.756 -21.304 1.00 41.34 C ATOM 5885 CG PHE B 59 -9.797 63.690 -20.133 1.00 40.71 C ATOM 5886 CD1 PHE B 59 -8.668 63.411 -19.339 1.00 38.12 C ATOM 5887 CD2 PHE B 59 -10.566 64.832 -19.818 1.00 38.80 C ATOM 5888 CE1 PHE B 59 -8.325 64.244 -18.258 1.00 38.33 C ATOM 5889 CE2 PHE B 59 -10.219 65.673 -18.748 1.00 37.78 C ATOM 5890 CZ PHE B 59 -9.104 65.385 -17.967 1.00 38.40 C ATOM 5891 HA PHE B 59 -11.949 63.847 -21.851 1.00 0.00 H ATOM 5892 HB2 PHE B 59 -9.933 61.733 -21.007 1.00 0.00 H ATOM 5893 HB3 PHE B 59 -9.553 63.032 -22.163 1.00 0.00 H ATOM 5894 HD2 PHE B 59 -11.446 65.065 -20.417 1.00 0.00 H ATOM 5895 HE2 PHE B 59 -10.824 66.553 -18.529 1.00 0.00 H ATOM 5896 HZ PHE B 59 -8.834 66.036 -17.136 1.00 0.00 H ATOM 5897 HE1 PHE B 59 -7.456 64.008 -17.644 1.00 0.00 H ATOM 5898 HD1 PHE B 59 -8.053 62.540 -19.564 1.00 0.00 H ATOM 5899 H PHE B 59 -12.161 61.970 -19.770 1.00 0.00 H ATOM 5900 N SER B 60 -11.808 60.788 -23.096 1.00 47.73 N ATOM 5901 CA SER B 60 -11.875 59.977 -24.326 1.00 50.16 C ATOM 5902 C SER B 60 -13.198 59.992 -25.040 1.00 52.56 C ATOM 5903 O SER B 60 -13.286 59.477 -26.154 1.00 53.10 O ATOM 5904 CB SER B 60 -11.622 58.490 -24.003 1.00 50.49 C ATOM 5905 OG SER B 60 -10.261 58.165 -24.085 1.00 49.84 O ATOM 5906 HA SER B 60 -11.120 60.432 -24.966 1.00 0.00 H ATOM 5907 HB2 SER B 60 -12.176 57.875 -24.713 1.00 0.00 H ATOM 5908 HB3 SER B 60 -11.974 58.283 -22.993 1.00 0.00 H ATOM 5909 HG SER B 60 -9.752 58.716 -23.439 1.00 0.00 H ATOM 5910 H SER B 60 -11.766 60.294 -22.182 1.00 0.00 H ATOM 5911 N SER B 61 -14.246 60.488 -24.389 1.00 55.20 N ATOM 5912 CA SER B 61 -15.608 60.214 -24.846 1.00 57.53 C ATOM 5913 C SER B 61 -15.938 60.975 -26.125 1.00 60.02 C ATOM 5914 O SER B 61 -16.892 60.634 -26.834 1.00 61.05 O ATOM 5915 CB SER B 61 -16.606 60.605 -23.794 1.00 56.81 C ATOM 5916 OG SER B 61 -16.760 61.994 -23.859 1.00 58.32 O ATOM 5917 HA SER B 61 -15.665 59.143 -25.043 1.00 0.00 H ATOM 5918 HB2 SER B 61 -16.241 60.316 -22.808 1.00 0.00 H ATOM 5919 HB3 SER B 61 -17.561 60.115 -23.985 1.00 0.00 H ATOM 5920 HG SER B 61 -15.888 62.430 -23.689 1.00 0.00 H ATOM 5921 H SER B 61 -14.095 61.077 -23.545 1.00 0.00 H ATOM 5922 N TYR B 62 -15.146 62.000 -26.427 1.00 62.29 N ATOM 5923 CA TYR B 62 -15.272 62.720 -27.706 1.00 63.93 C ATOM 5924 C TYR B 62 -14.814 61.825 -28.890 1.00 65.30 C ATOM 5925 O TYR B 62 -15.532 61.685 -29.872 1.00 65.20 O ATOM 5926 CB TYR B 62 -14.552 64.085 -27.634 1.00 63.50 C ATOM 5927 CG TYR B 62 -15.005 64.916 -26.443 1.00 63.05 C ATOM 5928 CD1 TYR B 62 -14.397 64.791 -25.198 1.00 62.54 C ATOM 5929 CD2 TYR B 62 -16.073 65.811 -26.557 1.00 63.73 C ATOM 5930 CE1 TYR B 62 -14.822 65.564 -24.100 1.00 62.57 C ATOM 5931 CE2 TYR B 62 -16.520 66.585 -25.470 1.00 62.50 C ATOM 5932 CZ TYR B 62 -15.883 66.472 -24.244 1.00 62.64 C ATOM 5933 OH TYR B 62 -16.328 67.240 -23.172 1.00 61.75 O ATOM 5934 HA TYR B 62 -16.322 62.945 -27.895 1.00 0.00 H ATOM 5935 HB3 TYR B 62 -14.761 64.640 -28.549 1.00 0.00 H ATOM 5936 HB2 TYR B 62 -13.479 63.912 -27.553 1.00 0.00 H ATOM 5937 HD2 TYR B 62 -16.576 65.913 -27.519 1.00 0.00 H ATOM 5938 HE2 TYR B 62 -17.361 67.268 -25.591 1.00 0.00 H ATOM 5939 HE1 TYR B 62 -14.326 65.457 -23.136 1.00 0.00 H ATOM 5940 HD1 TYR B 62 -13.578 64.083 -25.070 1.00 0.00 H ATOM 5941 HH TYR B 62 -15.774 67.045 -22.375 1.00 0.00 H ATOM 5942 H TYR B 62 -14.421 62.300 -25.744 1.00 0.00 H ATOM 5943 N LYS B 63 -13.646 61.198 -28.766 1.00 67.17 N ATOM 5944 CA LYS B 63 -13.176 60.214 -29.754 1.00 69.01 C ATOM 5945 C LYS B 63 -14.109 58.995 -29.839 1.00 70.80 C ATOM 5946 O LYS B 63 -14.446 58.574 -30.945 1.00 71.84 O ATOM 5947 CB LYS B 63 -11.740 59.754 -29.470 1.00 68.52 C ATOM 5948 HA LYS B 63 -13.188 60.724 -30.717 1.00 0.00 H ATOM 5949 HB2 LYS B 63 -11.071 60.614 -29.501 1.00 0.00 H ATOM 5950 HB3 LYS B 63 -11.696 59.294 -28.483 1.00 0.00 H ATOM 5951 H LYS B 63 -13.046 61.411 -27.944 1.00 0.00 H ATOM 5952 N PHE B 64 -14.534 58.427 -28.704 1.00 72.09 N ATOM 5953 CA PHE B 64 -15.393 57.206 -28.732 1.00 73.50 C ATOM 5954 C PHE B 64 -16.738 57.474 -29.410 1.00 74.40 C ATOM 5955 O PHE B 64 -17.259 56.605 -30.109 1.00 75.21 O ATOM 5956 CB PHE B 64 -15.622 56.583 -27.333 1.00 72.94 C ATOM 5957 HA PHE B 64 -14.836 56.478 -29.322 1.00 0.00 H ATOM 5958 HB2 PHE B 64 -14.662 56.299 -26.902 1.00 0.00 H ATOM 5959 HB3 PHE B 64 -16.110 57.313 -26.687 1.00 0.00 H ATOM 5960 H PHE B 64 -14.262 58.842 -27.790 1.00 0.00 H ATOM 5961 N ASN B 65 -17.284 58.676 -29.217 1.00 74.75 N ATOM 5962 CA ASN B 65 -18.565 59.058 -29.847 1.00 75.27 C ATOM 5963 C ASN B 65 -18.461 59.613 -31.272 1.00 75.31 C ATOM 5964 O ASN B 65 -19.491 59.840 -31.902 1.00 75.51 O ATOM 5965 CB ASN B 65 -19.304 60.099 -28.989 1.00 75.05 C ATOM 5966 CG ASN B 65 -19.882 59.522 -27.728 1.00 74.80 C ATOM 5967 OD1 ASN B 65 -20.319 58.368 -27.702 1.00 73.95 O ATOM 5968 ND2 ASN B 65 -19.915 60.331 -26.672 1.00 73.58 N ATOM 5969 HA ASN B 65 -19.112 58.118 -29.913 1.00 0.00 H ATOM 5970 HB2 ASN B 65 -18.602 60.888 -28.720 1.00 0.00 H ATOM 5971 HB3 ASN B 65 -20.116 60.523 -29.580 1.00 0.00 H ATOM 5972 HD22 ASN B 65 -19.534 61.296 -26.744 1.00 0.00 H ATOM 5973 HD21 ASN B 65 -20.322 59.998 -25.775 1.00 0.00 H ATOM 5974 H ASN B 65 -16.795 59.362 -28.607 1.00 0.00 H ATOM 5975 N HIS B 66 -17.245 59.852 -31.762 1.00 75.07 N ATOM 5976 CA HIS B 66 -17.027 60.364 -33.125 1.00 75.28 C ATOM 5977 C HIS B 66 -17.625 61.776 -33.294 1.00 74.39 C ATOM 5978 O HIS B 66 -18.229 62.106 -34.311 1.00 74.27 O ATOM 5979 CB HIS B 66 -17.545 59.361 -34.168 1.00 75.92 C ATOM 5980 CG HIS B 66 -17.100 57.951 -33.913 1.00 76.90 C ATOM 5981 ND1 HIS B 66 -15.777 57.564 -33.994 1.00 77.34 N ATOM 5982 CD2 HIS B 66 -17.794 56.843 -33.551 1.00 77.17 C ATOM 5983 CE1 HIS B 66 -15.676 56.279 -33.699 1.00 77.87 C ATOM 5984 NE2 HIS B 66 -16.885 55.818 -33.427 1.00 78.24 N ATOM 5985 HA HIS B 66 -15.955 60.468 -33.294 1.00 0.00 H ATOM 5986 HB2 HIS B 66 -18.635 59.386 -34.160 1.00 0.00 H ATOM 5987 HB3 HIS B 66 -17.183 59.665 -35.150 1.00 0.00 H ATOM 5988 HD2 HIS B 66 -18.870 56.777 -33.389 1.00 0.00 H ATOM 5989 HE1 HIS B 66 -14.753 55.699 -33.683 1.00 0.00 H ATOM 5990 H HIS B 66 -16.418 59.670 -31.158 1.00 0.00 H ATOM 5991 N LEU B 67 -17.432 62.594 -32.256 1.00 73.20 N ATOM 5992 CA LEU B 67 -17.921 63.975 -32.191 1.00 72.16 C ATOM 5993 C LEU B 67 -16.751 64.927 -31.957 1.00 71.11 C ATOM 5994 O LEU B 67 -15.791 64.596 -31.235 1.00 71.04 O ATOM 5995 CB LEU B 67 -18.959 64.152 -31.059 1.00 71.51 C ATOM 5996 CG LEU B 67 -20.158 63.185 -31.037 1.00 70.81 C ATOM 5997 CD1 LEU B 67 -21.206 63.621 -29.997 1.00 68.40 C ATOM 5998 CD2 LEU B 67 -20.773 63.036 -32.433 1.00 67.42 C ATOM 5999 HA LEU B 67 -18.405 64.205 -33.140 1.00 0.00 H ATOM 6000 HB2 LEU B 67 -18.432 64.041 -30.112 1.00 0.00 H ATOM 6001 HB3 LEU B 67 -19.357 65.164 -31.135 1.00 0.00 H ATOM 6002 HG LEU B 67 -19.792 62.204 -30.736 1.00 0.00 H ATOM 6003 HD21 LEU B 67 -21.116 64.009 -32.783 1.00 0.00 H ATOM 6004 HD22 LEU B 67 -20.022 62.645 -33.120 1.00 0.00 H ATOM 6005 HD23 LEU B 67 -21.617 62.348 -32.385 1.00 0.00 H ATOM 6006 HD11 LEU B 67 -20.750 63.633 -29.007 1.00 0.00 H ATOM 6007 HD12 LEU B 67 -21.568 64.619 -30.244 1.00 0.00 H ATOM 6008 HD13 LEU B 67 -22.039 62.918 -30.006 1.00 0.00 H ATOM 6009 H LEU B 67 -16.900 62.228 -31.441 1.00 0.00 H ATOM 6010 N VAL B 68 -16.841 66.107 -32.568 1.00 70.01 N ATOM 6011 CA VAL B 68 -15.852 67.185 -32.357 1.00 68.42 C ATOM 6012 C VAL B 68 -16.064 67.776 -30.944 1.00 67.17 C ATOM 6013 O VAL B 68 -17.203 68.090 -30.580 1.00 66.18 O ATOM 6014 CB VAL B 68 -15.891 68.281 -33.517 1.00 68.60 C ATOM 6015 CG1 VAL B 68 -17.270 68.317 -34.227 1.00 68.54 C ATOM 6016 CG2 VAL B 68 -15.497 69.653 -32.993 1.00 67.67 C ATOM 6017 HA VAL B 68 -14.844 66.773 -32.411 1.00 0.00 H ATOM 6018 HB VAL B 68 -15.153 67.990 -34.265 1.00 0.00 H ATOM 6019 HG11 VAL B 68 -17.475 67.342 -34.669 1.00 0.00 H ATOM 6020 HG12 VAL B 68 -18.045 68.559 -33.500 1.00 0.00 H ATOM 6021 HG13 VAL B 68 -17.255 69.076 -35.009 1.00 0.00 H ATOM 6022 HG21 VAL B 68 -16.190 69.953 -32.207 1.00 0.00 H ATOM 6023 HG22 VAL B 68 -14.485 69.610 -32.589 1.00 0.00 H ATOM 6024 HG23 VAL B 68 -15.534 70.376 -33.808 1.00 0.00 H ATOM 6025 H VAL B 68 -17.636 66.276 -33.217 1.00 0.00 H ATOM 6026 N PRO B 69 -14.978 67.863 -30.121 1.00 66.56 N ATOM 6027 CA PRO B 69 -15.095 68.483 -28.764 1.00 65.59 C ATOM 6028 C PRO B 69 -15.299 70.004 -28.763 1.00 64.10 C ATOM 6029 O PRO B 69 -14.891 70.708 -29.689 1.00 64.85 O ATOM 6030 CB PRO B 69 -13.779 68.106 -28.049 1.00 65.23 C ATOM 6031 CG PRO B 69 -12.925 67.412 -29.039 1.00 65.69 C ATOM 6032 CD PRO B 69 -13.605 67.368 -30.384 1.00 66.80 C ATOM 6033 HA PRO B 69 -15.990 68.110 -28.267 1.00 0.00 H ATOM 6034 HD3 PRO B 69 -13.092 68.014 -31.097 1.00 0.00 H ATOM 6035 HD2 PRO B 69 -13.630 66.349 -30.771 1.00 0.00 H ATOM 6036 HG3 PRO B 69 -12.736 66.394 -28.699 1.00 0.00 H ATOM 6037 HG2 PRO B 69 -11.978 67.944 -29.132 1.00 0.00 H ATOM 6038 HB2 PRO B 69 -13.279 69.005 -27.689 1.00 0.00 H ATOM 6039 HB3 PRO B 69 -13.987 67.446 -27.207 1.00 0.00 H ATOM 6040 N ARG B 70 -15.953 70.489 -27.719 1.00 62.29 N ATOM 6041 CA ARG B 70 -16.284 71.911 -27.584 1.00 60.92 C ATOM 6042 C ARG B 70 -16.734 72.135 -26.139 1.00 57.12 C ATOM 6043 O ARG B 70 -17.600 71.396 -25.649 1.00 56.65 O ATOM 6044 CB ARG B 70 -17.399 72.327 -28.580 1.00 62.74 C ATOM 6045 CG ARG B 70 -17.428 73.853 -28.934 1.00 65.72 C ATOM 6046 CD ARG B 70 -16.092 74.361 -29.537 1.00 71.13 C ATOM 6047 NE ARG B 70 -15.956 75.827 -29.503 1.00 72.60 N ATOM 6048 CZ ARG B 70 -14.799 76.519 -29.528 1.00 76.13 C ATOM 6049 NH1 ARG B 70 -13.618 75.896 -29.577 1.00 76.90 N ATOM 6050 NH2 ARG B 70 -14.816 77.867 -29.491 1.00 75.37 N ATOM 6051 HA ARG B 70 -15.414 72.525 -27.817 1.00 0.00 H ATOM 6052 HB2 ARG B 70 -17.255 71.767 -29.504 1.00 0.00 H ATOM 6053 HB3 ARG B 70 -18.361 72.062 -28.142 1.00 0.00 H ATOM 6054 HG2 ARG B 70 -18.224 74.027 -29.658 1.00 0.00 H ATOM 6055 HG3 ARG B 70 -17.636 74.417 -28.025 1.00 0.00 H ATOM 6056 HD2 ARG B 70 -16.033 74.032 -30.575 1.00 0.00 H ATOM 6057 HD3 ARG B 70 -15.269 73.924 -28.972 1.00 0.00 H ATOM 6058 HE ARG B 70 -16.835 76.381 -29.455 1.00 0.00 H ATOM 6059 HH12 ARG B 70 -12.738 76.450 -29.596 1.00 0.00 H ATOM 6060 HH11 ARG B 70 -13.579 74.857 -29.597 1.00 0.00 H ATOM 6061 HH22 ARG B 70 -13.923 78.399 -29.510 1.00 0.00 H ATOM 6062 HH21 ARG B 70 -15.723 78.374 -29.443 1.00 0.00 H ATOM 6063 H ARG B 70 -16.244 69.835 -26.964 1.00 0.00 H ATOM 6064 N LEU B 71 -16.161 73.139 -25.462 1.00 52.43 N ATOM 6065 CA LEU B 71 -16.421 73.323 -24.027 1.00 48.59 C ATOM 6066 C LEU B 71 -17.373 74.475 -23.731 1.00 45.62 C ATOM 6067 O LEU B 71 -17.091 75.639 -24.017 1.00 45.15 O ATOM 6068 CB LEU B 71 -15.110 73.467 -23.238 1.00 48.37 C ATOM 6069 CG LEU B 71 -14.111 72.318 -23.451 1.00 48.18 C ATOM 6070 CD1 LEU B 71 -12.872 72.507 -22.572 1.00 45.24 C ATOM 6071 CD2 LEU B 71 -14.780 70.971 -23.229 1.00 45.59 C ATOM 6072 HA LEU B 71 -16.927 72.418 -23.691 1.00 0.00 H ATOM 6073 HB2 LEU B 71 -14.630 74.397 -23.541 1.00 0.00 H ATOM 6074 HB3 LEU B 71 -15.354 73.515 -22.177 1.00 0.00 H ATOM 6075 HG LEU B 71 -13.773 72.336 -24.487 1.00 0.00 H ATOM 6076 HD21 LEU B 71 -15.162 70.920 -22.209 1.00 0.00 H ATOM 6077 HD22 LEU B 71 -15.604 70.855 -23.933 1.00 0.00 H ATOM 6078 HD23 LEU B 71 -14.052 70.175 -23.386 1.00 0.00 H ATOM 6079 HD11 LEU B 71 -12.386 73.449 -22.828 1.00 0.00 H ATOM 6080 HD12 LEU B 71 -13.171 72.525 -21.524 1.00 0.00 H ATOM 6081 HD13 LEU B 71 -12.180 71.682 -22.740 1.00 0.00 H ATOM 6082 H LEU B 71 -15.525 73.796 -25.957 1.00 0.00 H ATOM 6083 N VAL B 72 -18.510 74.132 -23.144 1.00 42.61 N ATOM 6084 CA VAL B 72 -19.511 75.103 -22.822 1.00 40.83 C ATOM 6085 C VAL B 72 -19.759 75.085 -21.333 1.00 39.76 C ATOM 6086 O VAL B 72 -20.025 74.044 -20.736 1.00 39.80 O ATOM 6087 CB VAL B 72 -20.855 74.827 -23.589 1.00 41.36 C ATOM 6088 CG1 VAL B 72 -21.868 75.982 -23.404 1.00 40.03 C ATOM 6089 CG2 VAL B 72 -20.601 74.639 -25.058 1.00 39.49 C ATOM 6090 HA VAL B 72 -19.149 76.083 -23.132 1.00 0.00 H ATOM 6091 HB VAL B 72 -21.277 73.916 -23.166 1.00 0.00 H ATOM 6092 HG11 VAL B 72 -22.095 76.098 -22.344 1.00 0.00 H ATOM 6093 HG12 VAL B 72 -21.437 76.907 -23.788 1.00 0.00 H ATOM 6094 HG13 VAL B 72 -22.783 75.752 -23.950 1.00 0.00 H ATOM 6095 HG21 VAL B 72 -20.142 75.540 -25.464 1.00 0.00 H ATOM 6096 HG22 VAL B 72 -19.931 73.791 -25.204 1.00 0.00 H ATOM 6097 HG23 VAL B 72 -21.546 74.449 -25.567 1.00 0.00 H ATOM 6098 H VAL B 72 -18.679 73.133 -22.911 1.00 0.00 H ATOM 6099 N LEU B 73 -19.662 76.260 -20.734 1.00 38.79 N ATOM 6100 CA LEU B 73 -20.164 76.478 -19.386 1.00 37.80 C ATOM 6101 C LEU B 73 -21.688 76.618 -19.471 1.00 38.13 C ATOM 6102 O LEU B 73 -22.190 77.587 -20.024 1.00 38.11 O ATOM 6103 CB LEU B 73 -19.583 77.750 -18.756 1.00 37.25 C ATOM 6104 CG LEU B 73 -20.203 78.078 -17.403 1.00 36.17 C ATOM 6105 CD1 LEU B 73 -19.704 77.047 -16.401 1.00 34.78 C ATOM 6106 CD2 LEU B 73 -19.929 79.506 -16.951 1.00 36.26 C ATOM 6107 HA LEU B 73 -19.868 75.635 -18.761 1.00 0.00 H ATOM 6108 HB2 LEU B 73 -18.510 77.614 -18.623 1.00 0.00 H ATOM 6109 HB3 LEU B 73 -19.761 78.586 -19.432 1.00 0.00 H ATOM 6110 HG LEU B 73 -21.289 78.024 -17.483 1.00 0.00 H ATOM 6111 HD21 LEU B 73 -18.853 79.659 -16.868 1.00 0.00 H ATOM 6112 HD22 LEU B 73 -20.341 80.202 -17.681 1.00 0.00 H ATOM 6113 HD23 LEU B 73 -20.397 79.675 -15.981 1.00 0.00 H ATOM 6114 HD11 LEU B 73 -20.006 76.051 -16.725 1.00 0.00 H ATOM 6115 HD12 LEU B 73 -18.617 77.096 -16.342 1.00 0.00 H ATOM 6116 HD13 LEU B 73 -20.133 77.257 -15.421 1.00 0.00 H ATOM 6117 H LEU B 73 -19.214 77.050 -21.241 1.00 0.00 H ATOM 6118 N GLN B 74 -22.407 75.663 -18.887 1.00 37.79 N ATOM 6119 CA GLN B 74 -23.853 75.568 -19.033 1.00 37.66 C ATOM 6120 C GLN B 74 -24.576 76.614 -18.167 1.00 37.58 C ATOM 6121 O GLN B 74 -25.334 76.267 -17.241 1.00 36.92 O ATOM 6122 CB GLN B 74 -24.285 74.141 -18.675 1.00 37.64 C ATOM 6123 CG GLN B 74 -23.765 73.050 -19.647 1.00 38.07 C ATOM 6124 CD GLN B 74 -24.345 73.184 -21.052 1.00 40.40 C ATOM 6125 OE1 GLN B 74 -25.557 73.311 -21.244 1.00 44.39 O ATOM 6126 NE2 GLN B 74 -23.483 73.181 -22.035 1.00 41.95 N ATOM 6127 HA GLN B 74 -24.131 75.782 -20.065 1.00 0.00 H ATOM 6128 HB2 GLN B 74 -23.913 73.913 -17.676 1.00 0.00 H ATOM 6129 HB3 GLN B 74 -25.374 74.105 -18.673 1.00 0.00 H ATOM 6130 HG2 GLN B 74 -22.680 73.127 -19.709 1.00 0.00 H ATOM 6131 HG3 GLN B 74 -24.036 72.072 -19.250 1.00 0.00 H ATOM 6132 HE22 GLN B 74 -22.468 73.072 -21.836 1.00 0.00 H ATOM 6133 HE21 GLN B 74 -23.812 73.288 -23.016 1.00 0.00 H ATOM 6134 H GLN B 74 -21.917 74.956 -18.303 1.00 0.00 H ATOM 6135 N ARG B 75 -24.370 77.884 -18.520 1.00 37.57 N ATOM 6136 CA ARG B 75 -24.792 79.036 -17.684 1.00 38.03 C ATOM 6137 C ARG B 75 -26.290 79.043 -17.349 1.00 38.31 C ATOM 6138 O ARG B 75 -26.674 79.327 -16.224 1.00 37.70 O ATOM 6139 CB ARG B 75 -24.432 80.410 -18.329 1.00 37.80 C ATOM 6140 CG ARG B 75 -23.035 80.562 -18.947 1.00 38.92 C ATOM 6141 CD ARG B 75 -22.777 81.958 -19.632 1.00 38.71 C ATOM 6142 NE ARG B 75 -22.641 83.025 -18.635 1.00 39.79 N ATOM 6143 CZ ARG B 75 -21.486 83.541 -18.201 1.00 40.82 C ATOM 6144 NH1 ARG B 75 -20.313 83.131 -18.697 1.00 41.79 N ATOM 6145 NH2 ARG B 75 -21.502 84.511 -17.285 1.00 39.13 N ATOM 6146 HA ARG B 75 -24.230 78.903 -16.760 1.00 0.00 H ATOM 6147 HB2 ARG B 75 -25.160 80.601 -19.117 1.00 0.00 H ATOM 6148 HB3 ARG B 75 -24.530 81.170 -17.554 1.00 0.00 H ATOM 6149 HG2 ARG B 75 -22.296 80.427 -18.158 1.00 0.00 H ATOM 6150 HG3 ARG B 75 -22.908 79.784 -19.699 1.00 0.00 H ATOM 6151 HD2 ARG B 75 -23.614 82.191 -20.290 1.00 0.00 H ATOM 6152 HD3 ARG B 75 -21.860 81.902 -20.219 1.00 0.00 H ATOM 6153 HE ARG B 75 -23.517 83.413 -18.231 1.00 0.00 H ATOM 6154 HH12 ARG B 75 -19.426 83.545 -18.345 1.00 0.00 H ATOM 6155 HH11 ARG B 75 -20.288 82.398 -19.434 1.00 0.00 H ATOM 6156 HH22 ARG B 75 -20.608 84.917 -16.942 1.00 0.00 H ATOM 6157 HH21 ARG B 75 -22.408 84.861 -16.914 1.00 0.00 H ATOM 6158 H ARG B 75 -23.891 78.076 -19.423 1.00 0.00 H ATOM 6159 N GLU B 76 -27.134 78.779 -18.333 1.00 39.60 N ATOM 6160 CA GLU B 76 -28.576 78.860 -18.090 1.00 41.15 C ATOM 6161 C GLU B 76 -28.993 77.809 -17.053 1.00 39.23 C ATOM 6162 O GLU B 76 -29.695 78.118 -16.079 1.00 38.79 O ATOM 6163 CB GLU B 76 -29.373 78.679 -19.388 1.00 42.62 C ATOM 6164 CG GLU B 76 -30.897 78.844 -19.220 1.00 49.14 C ATOM 6165 CD GLU B 76 -31.343 80.311 -18.900 1.00 57.43 C ATOM 6166 OE1 GLU B 76 -30.618 81.270 -19.317 1.00 59.62 O ATOM 6167 OE2 GLU B 76 -32.423 80.487 -18.234 1.00 60.98 O ATOM 6168 HA GLU B 76 -28.800 79.853 -17.701 1.00 0.00 H ATOM 6169 HB2 GLU B 76 -29.026 79.419 -20.109 1.00 0.00 H ATOM 6170 HB3 GLU B 76 -29.177 77.678 -19.773 1.00 0.00 H ATOM 6171 HG2 GLU B 76 -31.381 78.532 -20.145 1.00 0.00 H ATOM 6172 HG3 GLU B 76 -31.225 78.199 -18.405 1.00 0.00 H ATOM 6173 H GLU B 76 -26.776 78.516 -19.273 1.00 0.00 H ATOM 6174 N LYS B 77 -28.547 76.578 -17.255 1.00 37.70 N ATOM 6175 CA LYS B 77 -28.887 75.542 -16.311 1.00 37.76 C ATOM 6176 C LYS B 77 -28.342 75.835 -14.890 1.00 36.73 C ATOM 6177 O LYS B 77 -29.086 75.664 -13.907 1.00 36.86 O ATOM 6178 CB LYS B 77 -28.511 74.166 -16.869 1.00 37.89 C ATOM 6179 CG LYS B 77 -29.454 73.764 -18.036 1.00 40.65 C ATOM 6180 CD LYS B 77 -29.184 72.377 -18.590 1.00 41.86 C ATOM 6181 CE LYS B 77 -28.065 72.384 -19.623 1.00 44.90 C ATOM 6182 NZ LYS B 77 -27.302 71.093 -19.697 1.00 44.94 N ATOM 6183 HA LYS B 77 -29.969 75.530 -16.179 1.00 0.00 H ATOM 6184 HB2 LYS B 77 -27.484 74.197 -17.234 1.00 0.00 H ATOM 6185 HB3 LYS B 77 -28.590 73.424 -16.074 1.00 0.00 H ATOM 6186 HG2 LYS B 77 -30.482 73.796 -17.675 1.00 0.00 H ATOM 6187 HG3 LYS B 77 -29.331 74.487 -18.843 1.00 0.00 H ATOM 6188 HD2 LYS B 77 -28.901 71.718 -17.769 1.00 0.00 H ATOM 6189 HD3 LYS B 77 -30.094 72.001 -19.059 1.00 0.00 H ATOM 6190 HE2 LYS B 77 -27.367 73.182 -19.369 1.00 0.00 H ATOM 6191 HE3 LYS B 77 -28.501 72.582 -20.602 1.00 0.00 H ATOM 6192 HZ1 LYS B 77 -26.869 70.894 -18.773 1.00 0.00 H ATOM 6193 HZ2 LYS B 77 -27.952 70.322 -19.950 1.00 0.00 H ATOM 6194 HZ3 LYS B 77 -26.558 71.172 -20.420 1.00 0.00 H ATOM 6195 H LYS B 77 -27.959 76.361 -18.085 1.00 0.00 H ATOM 6196 N HIS B 78 -27.099 76.328 -14.764 1.00 35.37 N ATOM 6197 CA HIS B 78 -26.549 76.690 -13.428 1.00 34.53 C ATOM 6198 C HIS B 78 -27.393 77.787 -12.746 1.00 34.30 C ATOM 6199 O HIS B 78 -27.659 77.728 -11.528 1.00 34.10 O ATOM 6200 CB HIS B 78 -25.054 77.118 -13.454 1.00 33.59 C ATOM 6201 CG HIS B 78 -24.127 76.089 -14.032 1.00 32.60 C ATOM 6202 ND1 HIS B 78 -24.263 74.739 -13.795 1.00 32.48 N ATOM 6203 CD2 HIS B 78 -23.067 76.214 -14.870 1.00 32.51 C ATOM 6204 CE1 HIS B 78 -23.324 74.077 -14.457 1.00 32.77 C ATOM 6205 NE2 HIS B 78 -22.585 74.948 -15.119 1.00 32.08 N ATOM 6206 HA HIS B 78 -26.605 75.771 -12.845 1.00 0.00 H ATOM 6207 HB2 HIS B 78 -24.969 78.027 -14.049 1.00 0.00 H ATOM 6208 HB3 HIS B 78 -24.740 77.325 -12.431 1.00 0.00 H ATOM 6209 HD2 HIS B 78 -22.670 77.146 -15.272 1.00 0.00 H ATOM 6210 HE1 HIS B 78 -23.186 72.996 -14.455 1.00 0.00 H ATOM 6211 H HIS B 78 -26.512 76.459 -15.612 1.00 0.00 H ATOM 6212 N PHE B 79 -27.811 78.762 -13.542 1.00 34.10 N ATOM 6213 CA PHE B 79 -28.638 79.854 -13.081 1.00 34.42 C ATOM 6214 C PHE B 79 -29.984 79.371 -12.481 1.00 34.87 C ATOM 6215 O PHE B 79 -30.328 79.785 -11.363 1.00 34.96 O ATOM 6216 CB PHE B 79 -28.883 80.837 -14.247 1.00 35.64 C ATOM 6217 CG PHE B 79 -29.901 81.913 -13.942 1.00 36.45 C ATOM 6218 CD1 PHE B 79 -29.667 82.848 -12.947 1.00 36.10 C ATOM 6219 CD2 PHE B 79 -31.103 81.973 -14.643 1.00 40.28 C ATOM 6220 CE1 PHE B 79 -30.590 83.844 -12.650 1.00 36.89 C ATOM 6221 CE2 PHE B 79 -32.053 82.972 -14.352 1.00 40.59 C ATOM 6222 CZ PHE B 79 -31.784 83.908 -13.337 1.00 38.73 C ATOM 6223 HA PHE B 79 -28.105 80.359 -12.275 1.00 0.00 H ATOM 6224 HB2 PHE B 79 -27.937 81.320 -14.493 1.00 0.00 H ATOM 6225 HB3 PHE B 79 -29.234 80.267 -15.108 1.00 0.00 H ATOM 6226 HD2 PHE B 79 -31.311 81.241 -15.423 1.00 0.00 H ATOM 6227 HE2 PHE B 79 -32.989 83.019 -14.909 1.00 0.00 H ATOM 6228 HZ PHE B 79 -32.515 84.679 -13.095 1.00 0.00 H ATOM 6229 HE1 PHE B 79 -30.370 84.576 -11.873 1.00 0.00 H ATOM 6230 HD1 PHE B 79 -28.736 82.801 -12.383 1.00 0.00 H ATOM 6231 H PHE B 79 -27.531 78.740 -14.543 1.00 0.00 H ATOM 6232 N HIS B 80 -30.730 78.529 -13.212 1.00 34.89 N ATOM 6233 CA HIS B 80 -32.018 77.947 -12.749 1.00 34.97 C ATOM 6234 C HIS B 80 -31.853 77.294 -11.383 1.00 34.02 C ATOM 6235 O HIS B 80 -32.641 77.507 -10.466 1.00 33.33 O ATOM 6236 CB HIS B 80 -32.560 76.896 -13.763 1.00 35.34 C ATOM 6237 CG HIS B 80 -33.837 76.212 -13.333 1.00 36.04 C ATOM 6238 ND1 HIS B 80 -35.092 76.684 -13.668 1.00 38.22 N ATOM 6239 CD2 HIS B 80 -34.047 75.091 -12.596 1.00 34.84 C ATOM 6240 CE1 HIS B 80 -36.016 75.888 -13.154 1.00 37.38 C ATOM 6241 NE2 HIS B 80 -35.405 74.920 -12.489 1.00 35.74 N ATOM 6242 HA HIS B 80 -32.736 78.763 -12.674 1.00 0.00 H ATOM 6243 HB2 HIS B 80 -32.746 77.401 -14.711 1.00 0.00 H ATOM 6244 HB3 HIS B 80 -31.795 76.132 -13.904 1.00 0.00 H ATOM 6245 HD2 HIS B 80 -33.279 74.446 -12.168 1.00 0.00 H ATOM 6246 HE1 HIS B 80 -37.094 76.009 -13.260 1.00 0.00 H ATOM 6247 H HIS B 80 -30.387 78.268 -14.159 1.00 0.00 H ATOM 6248 N TYR B 81 -30.821 76.466 -11.277 1.00 33.21 N ATOM 6249 CA TYR B 81 -30.461 75.757 -10.017 1.00 31.80 C ATOM 6250 C TYR B 81 -30.154 76.773 -8.910 1.00 30.81 C ATOM 6251 O TYR B 81 -30.638 76.633 -7.821 1.00 28.23 O ATOM 6252 CB TYR B 81 -29.274 74.826 -10.294 1.00 31.22 C ATOM 6253 CG TYR B 81 -28.633 74.088 -9.147 1.00 30.64 C ATOM 6254 CD1 TYR B 81 -29.238 72.965 -8.577 1.00 30.96 C ATOM 6255 CD2 TYR B 81 -27.367 74.446 -8.697 1.00 28.77 C ATOM 6256 CE1 TYR B 81 -28.618 72.251 -7.559 1.00 30.31 C ATOM 6257 CE2 TYR B 81 -26.734 73.736 -7.675 1.00 29.66 C ATOM 6258 CZ TYR B 81 -27.358 72.656 -7.102 1.00 30.85 C ATOM 6259 OH TYR B 81 -26.730 71.981 -6.074 1.00 30.88 O ATOM 6260 HA TYR B 81 -31.297 75.150 -9.669 1.00 0.00 H ATOM 6261 HB3 TYR B 81 -28.495 75.432 -10.758 1.00 0.00 H ATOM 6262 HB2 TYR B 81 -29.618 74.074 -11.004 1.00 0.00 H ATOM 6263 HD2 TYR B 81 -26.859 75.297 -9.151 1.00 0.00 H ATOM 6264 HE2 TYR B 81 -25.745 74.039 -7.332 1.00 0.00 H ATOM 6265 HE1 TYR B 81 -29.109 71.382 -7.120 1.00 0.00 H ATOM 6266 HD1 TYR B 81 -30.215 72.643 -8.938 1.00 0.00 H ATOM 6267 HH TYR B 81 -27.305 71.234 -5.772 1.00 0.00 H ATOM 6268 H TYR B 81 -30.232 76.303 -12.119 1.00 0.00 H ATOM 6269 N LEU B 82 -29.389 77.812 -9.215 1.00 31.05 N ATOM 6270 CA LEU B 82 -29.063 78.799 -8.201 1.00 32.19 C ATOM 6271 C LEU B 82 -30.309 79.573 -7.789 1.00 33.33 C ATOM 6272 O LEU B 82 -30.563 79.813 -6.588 1.00 33.66 O ATOM 6273 CB LEU B 82 -27.949 79.751 -8.680 1.00 32.03 C ATOM 6274 CG LEU B 82 -26.568 79.086 -8.885 1.00 31.87 C ATOM 6275 CD1 LEU B 82 -25.630 79.898 -9.784 1.00 29.67 C ATOM 6276 CD2 LEU B 82 -25.901 78.770 -7.565 1.00 29.50 C ATOM 6277 HA LEU B 82 -28.684 78.271 -7.326 1.00 0.00 H ATOM 6278 HB2 LEU B 82 -28.260 80.186 -9.630 1.00 0.00 H ATOM 6279 HB3 LEU B 82 -27.837 80.542 -7.939 1.00 0.00 H ATOM 6280 HG LEU B 82 -26.768 78.150 -9.407 1.00 0.00 H ATOM 6281 HD21 LEU B 82 -25.759 79.692 -7.001 1.00 0.00 H ATOM 6282 HD22 LEU B 82 -26.531 78.087 -6.995 1.00 0.00 H ATOM 6283 HD23 LEU B 82 -24.933 78.304 -7.751 1.00 0.00 H ATOM 6284 HD11 LEU B 82 -26.085 80.019 -10.767 1.00 0.00 H ATOM 6285 HD12 LEU B 82 -25.460 80.878 -9.338 1.00 0.00 H ATOM 6286 HD13 LEU B 82 -24.680 79.373 -9.884 1.00 0.00 H ATOM 6287 H LEU B 82 -29.022 77.920 -10.182 1.00 0.00 H ATOM 6288 N LYS B 83 -31.107 79.946 -8.787 1.00 34.76 N ATOM 6289 CA LYS B 83 -32.238 80.848 -8.560 1.00 35.19 C ATOM 6290 C LYS B 83 -33.230 80.199 -7.594 1.00 34.31 C ATOM 6291 O LYS B 83 -33.680 80.814 -6.621 1.00 33.72 O ATOM 6292 CB LYS B 83 -32.844 81.272 -9.913 1.00 35.34 C ATOM 6293 CG LYS B 83 -34.223 81.977 -9.902 1.00 38.27 C ATOM 6294 CD LYS B 83 -34.752 82.339 -11.347 1.00 40.11 C ATOM 6295 CE LYS B 83 -36.306 82.010 -11.490 1.00 44.93 C ATOM 6296 NZ LYS B 83 -37.076 82.906 -12.443 1.00 45.59 N ATOM 6297 HA LYS B 83 -31.914 81.770 -8.077 1.00 0.00 H ATOM 6298 HB2 LYS B 83 -32.136 81.952 -10.387 1.00 0.00 H ATOM 6299 HB3 LYS B 83 -32.944 80.372 -10.520 1.00 0.00 H ATOM 6300 HG2 LYS B 83 -34.946 81.316 -9.424 1.00 0.00 H ATOM 6301 HG3 LYS B 83 -34.137 82.897 -9.324 1.00 0.00 H ATOM 6302 HD2 LYS B 83 -34.595 83.402 -11.528 1.00 0.00 H ATOM 6303 HD3 LYS B 83 -34.196 81.761 -12.085 1.00 0.00 H ATOM 6304 HE2 LYS B 83 -36.761 82.098 -10.503 1.00 0.00 H ATOM 6305 HE3 LYS B 83 -36.402 80.983 -11.842 1.00 0.00 H ATOM 6306 HZ1 LYS B 83 -37.012 83.892 -12.118 1.00 0.00 H ATOM 6307 HZ2 LYS B 83 -36.669 82.827 -13.397 1.00 0.00 H ATOM 6308 HZ3 LYS B 83 -38.073 82.611 -12.465 1.00 0.00 H ATOM 6309 H LYS B 83 -30.924 79.590 -9.747 1.00 0.00 H ATOM 6310 N ARG B 84 -33.506 78.929 -7.829 1.00 34.26 N ATOM 6311 CA ARG B 84 -34.439 78.196 -7.010 1.00 35.31 C ATOM 6312 C ARG B 84 -33.856 77.932 -5.589 1.00 34.86 C ATOM 6313 O ARG B 84 -34.541 78.086 -4.545 1.00 34.56 O ATOM 6314 CB ARG B 84 -34.823 76.895 -7.733 1.00 36.07 C ATOM 6315 CG ARG B 84 -35.716 76.024 -6.891 1.00 39.45 C ATOM 6316 CD ARG B 84 -36.418 74.949 -7.647 1.00 45.94 C ATOM 6317 NE ARG B 84 -36.637 73.765 -6.795 1.00 53.23 N ATOM 6318 CZ ARG B 84 -37.400 73.704 -5.679 1.00 56.90 C ATOM 6319 NH1 ARG B 84 -38.095 74.758 -5.235 1.00 59.93 N ATOM 6320 NH2 ARG B 84 -37.469 72.561 -4.987 1.00 55.92 N ATOM 6321 HA ARG B 84 -35.341 78.789 -6.862 1.00 0.00 H ATOM 6322 HB2 ARG B 84 -35.345 77.146 -8.656 1.00 0.00 H ATOM 6323 HB3 ARG B 84 -33.914 76.342 -7.970 1.00 0.00 H ATOM 6324 HG2 ARG B 84 -35.106 75.555 -6.119 1.00 0.00 H ATOM 6325 HG3 ARG B 84 -36.468 76.659 -6.423 1.00 0.00 H ATOM 6326 HD2 ARG B 84 -35.813 74.663 -8.507 1.00 0.00 H ATOM 6327 HD3 ARG B 84 -37.382 75.325 -7.991 1.00 0.00 H ATOM 6328 HE ARG B 84 -36.156 72.888 -7.081 1.00 0.00 H ATOM 6329 HH12 ARG B 84 -38.671 74.675 -4.373 1.00 0.00 H ATOM 6330 HH11 ARG B 84 -38.059 75.660 -5.752 1.00 0.00 H ATOM 6331 HH22 ARG B 84 -38.054 72.507 -4.128 1.00 0.00 H ATOM 6332 HH21 ARG B 84 -36.938 71.726 -5.308 1.00 0.00 H ATOM 6333 H ARG B 84 -33.039 78.446 -8.623 1.00 0.00 H ATOM 6334 N GLY B 85 -32.583 77.548 -5.560 1.00 34.14 N ATOM 6335 CA GLY B 85 -31.894 77.250 -4.310 1.00 33.58 C ATOM 6336 C GLY B 85 -31.827 78.401 -3.341 1.00 32.87 C ATOM 6337 O GLY B 85 -31.800 78.188 -2.124 1.00 32.20 O ATOM 6338 HA3 GLY B 85 -30.875 76.945 -4.548 1.00 0.00 H ATOM 6339 HA2 GLY B 85 -32.414 76.425 -3.823 1.00 0.00 H ATOM 6340 H GLY B 85 -32.063 77.458 -6.456 1.00 0.00 H ATOM 6341 N LEU B 86 -31.786 79.614 -3.876 1.00 32.84 N ATOM 6342 CA LEU B 86 -31.719 80.807 -3.043 1.00 32.66 C ATOM 6343 C LEU B 86 -32.981 81.000 -2.230 1.00 33.55 C ATOM 6344 O LEU B 86 -32.942 81.701 -1.209 1.00 33.01 O ATOM 6345 CB LEU B 86 -31.459 82.040 -3.891 1.00 32.63 C ATOM 6346 CG LEU B 86 -31.242 83.396 -3.198 1.00 32.64 C ATOM 6347 CD1 LEU B 86 -30.141 83.323 -2.139 1.00 26.94 C ATOM 6348 CD2 LEU B 86 -30.897 84.454 -4.310 1.00 32.00 C ATOM 6349 HA LEU B 86 -30.890 80.666 -2.349 1.00 0.00 H ATOM 6350 HB2 LEU B 86 -30.566 81.838 -4.482 1.00 0.00 H ATOM 6351 HB3 LEU B 86 -32.315 82.155 -4.556 1.00 0.00 H ATOM 6352 HG LEU B 86 -32.149 83.688 -2.669 1.00 0.00 H ATOM 6353 HD21 LEU B 86 -29.992 84.147 -4.834 1.00 0.00 H ATOM 6354 HD22 LEU B 86 -31.724 84.518 -5.018 1.00 0.00 H ATOM 6355 HD23 LEU B 86 -30.738 85.428 -3.846 1.00 0.00 H ATOM 6356 HD11 LEU B 86 -30.416 82.590 -1.380 1.00 0.00 H ATOM 6357 HD12 LEU B 86 -29.204 83.025 -2.610 1.00 0.00 H ATOM 6358 HD13 LEU B 86 -30.020 84.302 -1.674 1.00 0.00 H ATOM 6359 H LEU B 86 -31.802 79.715 -4.911 1.00 0.00 H ATOM 6360 N ARG B 87 -34.089 80.394 -2.691 1.00 34.51 N ATOM 6361 CA ARG B 87 -35.367 80.418 -1.964 1.00 35.67 C ATOM 6362 C ARG B 87 -35.668 79.174 -1.207 1.00 34.72 C ATOM 6363 O ARG B 87 -36.145 79.257 -0.110 1.00 35.49 O ATOM 6364 CB ARG B 87 -36.559 80.549 -2.908 1.00 37.03 C ATOM 6365 CG ARG B 87 -36.760 81.911 -3.364 1.00 40.52 C ATOM 6366 CD ARG B 87 -37.299 82.792 -2.242 1.00 42.42 C ATOM 6367 NE ARG B 87 -37.164 84.162 -2.700 1.00 42.31 N ATOM 6368 CZ ARG B 87 -37.370 85.233 -1.963 1.00 43.35 C ATOM 6369 NH1 ARG B 87 -37.724 85.132 -0.676 1.00 43.27 N ATOM 6370 NH2 ARG B 87 -37.220 86.412 -2.540 1.00 44.58 N ATOM 6371 HA ARG B 87 -35.240 81.269 -1.294 1.00 0.00 H ATOM 6372 HB2 ARG B 87 -36.390 79.911 -3.776 1.00 0.00 H ATOM 6373 HB3 ARG B 87 -37.457 80.219 -2.385 1.00 0.00 H ATOM 6374 HG2 ARG B 87 -35.808 82.315 -3.709 1.00 0.00 H ATOM 6375 HG3 ARG B 87 -37.472 81.909 -4.189 1.00 0.00 H ATOM 6376 HD2 ARG B 87 -36.721 82.639 -1.331 1.00 0.00 H ATOM 6377 HD3 ARG B 87 -38.346 82.560 -2.049 1.00 0.00 H ATOM 6378 HE ARG B 87 -36.882 84.310 -3.690 1.00 0.00 H ATOM 6379 HH12 ARG B 87 -37.882 85.991 -0.111 1.00 0.00 H ATOM 6380 HH11 ARG B 87 -37.841 84.195 -0.241 1.00 0.00 H ATOM 6381 HH22 ARG B 87 -37.374 87.282 -1.992 1.00 0.00 H ATOM 6382 HH21 ARG B 87 -36.948 86.470 -3.542 1.00 0.00 H ATOM 6383 H ARG B 87 -34.040 79.888 -3.598 1.00 0.00 H ATOM 6384 N GLN B 88 -35.478 78.029 -1.835 1.00 34.16 N ATOM 6385 CA GLN B 88 -35.884 76.774 -1.256 1.00 34.40 C ATOM 6386 C GLN B 88 -34.915 75.648 -1.535 1.00 33.61 C ATOM 6387 O GLN B 88 -34.286 75.610 -2.563 1.00 33.54 O ATOM 6388 CB GLN B 88 -37.227 76.363 -1.854 1.00 35.29 C ATOM 6389 CG GLN B 88 -38.203 75.907 -0.837 1.00 36.59 C ATOM 6390 CD GLN B 88 -39.600 75.792 -1.404 1.00 39.44 C ATOM 6391 OE1 GLN B 88 -39.839 75.017 -2.351 1.00 43.62 O ATOM 6392 NE2 GLN B 88 -40.530 76.556 -0.845 1.00 35.49 N ATOM 6393 HA GLN B 88 -35.931 76.931 -0.178 1.00 0.00 H ATOM 6394 HB2 GLN B 88 -37.649 77.219 -2.380 1.00 0.00 H ATOM 6395 HB3 GLN B 88 -37.058 75.551 -2.561 1.00 0.00 H ATOM 6396 HG2 GLN B 88 -37.893 74.931 -0.464 1.00 0.00 H ATOM 6397 HG3 GLN B 88 -38.215 76.622 -0.014 1.00 0.00 H ATOM 6398 HE22 GLN B 88 -40.280 77.187 -0.057 1.00 0.00 H ATOM 6399 HE21 GLN B 88 -41.509 76.524 -1.195 1.00 0.00 H ATOM 6400 H GLN B 88 -35.024 78.033 -2.771 1.00 0.00 H ATOM 6401 N LEU B 89 -34.871 74.688 -0.627 1.00 33.75 N ATOM 6402 CA LEU B 89 -33.924 73.581 -0.670 1.00 33.01 C ATOM 6403 C LEU B 89 -34.635 72.334 -0.152 1.00 33.58 C ATOM 6404 O LEU B 89 -35.473 72.416 0.762 1.00 34.54 O ATOM 6405 CB LEU B 89 -32.706 73.925 0.206 1.00 32.00 C ATOM 6406 CG LEU B 89 -31.850 75.159 -0.193 1.00 31.76 C ATOM 6407 CD1 LEU B 89 -30.993 75.702 0.966 1.00 29.44 C ATOM 6408 CD2 LEU B 89 -30.985 74.880 -1.440 1.00 28.02 C ATOM 6409 HA LEU B 89 -33.573 73.401 -1.686 1.00 0.00 H ATOM 6410 HB2 LEU B 89 -33.072 74.097 1.218 1.00 0.00 H ATOM 6411 HB3 LEU B 89 -32.047 73.057 0.202 1.00 0.00 H ATOM 6412 HG LEU B 89 -32.563 75.943 -0.446 1.00 0.00 H ATOM 6413 HD21 LEU B 89 -30.311 74.048 -1.235 1.00 0.00 H ATOM 6414 HD22 LEU B 89 -31.632 74.626 -2.280 1.00 0.00 H ATOM 6415 HD23 LEU B 89 -30.403 75.769 -1.683 1.00 0.00 H ATOM 6416 HD11 LEU B 89 -31.644 76.003 1.787 1.00 0.00 H ATOM 6417 HD12 LEU B 89 -30.311 74.923 1.308 1.00 0.00 H ATOM 6418 HD13 LEU B 89 -30.420 76.563 0.620 1.00 0.00 H ATOM 6419 H LEU B 89 -35.549 74.725 0.161 1.00 0.00 H ATOM 6420 N THR B 90 -34.297 71.192 -0.737 1.00 33.71 N ATOM 6421 CA THR B 90 -34.782 69.876 -0.305 1.00 33.69 C ATOM 6422 C THR B 90 -34.232 69.520 1.106 1.00 33.91 C ATOM 6423 O THR B 90 -33.342 70.181 1.628 1.00 32.17 O ATOM 6424 CB THR B 90 -34.354 68.742 -1.328 1.00 33.88 C ATOM 6425 OG1 THR B 90 -32.956 68.394 -1.160 1.00 32.34 O ATOM 6426 CG2 THR B 90 -34.576 69.190 -2.762 1.00 32.25 C ATOM 6427 HA THR B 90 -35.870 69.930 -0.268 1.00 0.00 H ATOM 6428 HB THR B 90 -34.974 67.870 -1.120 1.00 0.00 H ATOM 6429 HG1 THR B 90 -32.713 67.686 -1.808 1.00 0.00 H ATOM 6430 HG23 THR B 90 -35.624 69.454 -2.901 1.00 0.00 H ATOM 6431 HG21 THR B 90 -33.950 70.058 -2.971 1.00 0.00 H ATOM 6432 HG22 THR B 90 -34.312 68.378 -3.440 1.00 0.00 H ATOM 6433 H THR B 90 -33.650 71.232 -1.550 1.00 0.00 H ATOM 6434 N ASP B 91 -34.763 68.444 1.690 1.00 34.40 N ATOM 6435 CA ASP B 91 -34.393 68.009 3.028 1.00 34.61 C ATOM 6436 C ASP B 91 -33.033 67.346 3.088 1.00 33.38 C ATOM 6437 O ASP B 91 -32.560 66.986 4.168 1.00 33.25 O ATOM 6438 CB ASP B 91 -35.483 67.108 3.660 1.00 35.48 C ATOM 6439 CG ASP B 91 -35.677 65.791 2.934 1.00 39.17 C ATOM 6440 OD1 ASP B 91 -34.996 65.530 1.904 1.00 42.92 O ATOM 6441 OD2 ASP B 91 -36.541 64.999 3.411 1.00 45.41 O ATOM 6442 HA ASP B 91 -34.317 68.919 3.624 1.00 0.00 H ATOM 6443 HB2 ASP B 91 -35.200 66.895 4.691 1.00 0.00 H ATOM 6444 HB3 ASP B 91 -36.428 67.651 3.649 1.00 0.00 H ATOM 6445 H ASP B 91 -35.472 67.893 1.166 1.00 0.00 H ATOM 6446 N ALA B 92 -32.442 67.166 1.920 1.00 32.92 N ATOM 6447 CA ALA B 92 -31.029 66.849 1.747 1.00 32.48 C ATOM 6448 C ALA B 92 -30.097 67.936 2.338 1.00 32.58 C ATOM 6449 O ALA B 92 -28.957 67.659 2.707 1.00 33.20 O ATOM 6450 CB ALA B 92 -30.747 66.666 0.267 1.00 31.71 C ATOM 6451 HA ALA B 92 -30.820 65.930 2.294 1.00 0.00 H ATOM 6452 HB1 ALA B 92 -31.359 65.852 -0.120 1.00 0.00 H ATOM 6453 HB2 ALA B 92 -30.987 67.587 -0.264 1.00 0.00 H ATOM 6454 HB3 ALA B 92 -29.693 66.428 0.126 1.00 0.00 H ATOM 6455 H ALA B 92 -33.025 67.257 1.064 1.00 0.00 H ATOM 6456 N TYR B 93 -30.569 69.170 2.447 1.00 32.46 N ATOM 6457 CA TYR B 93 -29.801 70.209 3.117 1.00 32.05 C ATOM 6458 C TYR B 93 -30.146 70.326 4.623 1.00 31.79 C ATOM 6459 O TYR B 93 -29.705 71.261 5.271 1.00 30.77 O ATOM 6460 CB TYR B 93 -29.939 71.547 2.337 1.00 32.75 C ATOM 6461 CG TYR B 93 -29.184 71.505 1.019 1.00 32.40 C ATOM 6462 CD1 TYR B 93 -29.773 70.975 -0.134 1.00 31.72 C ATOM 6463 CD2 TYR B 93 -27.852 71.921 0.948 1.00 33.37 C ATOM 6464 CE1 TYR B 93 -29.074 70.891 -1.338 1.00 31.25 C ATOM 6465 CE2 TYR B 93 -27.130 71.852 -0.257 1.00 34.28 C ATOM 6466 CZ TYR B 93 -27.752 71.324 -1.398 1.00 34.55 C ATOM 6467 OH TYR B 93 -27.029 71.248 -2.581 1.00 34.42 O ATOM 6468 HA TYR B 93 -28.747 69.930 3.104 1.00 0.00 H ATOM 6469 HB3 TYR B 93 -29.540 72.356 2.948 1.00 0.00 H ATOM 6470 HB2 TYR B 93 -30.994 71.732 2.135 1.00 0.00 H ATOM 6471 HD2 TYR B 93 -27.363 72.306 1.843 1.00 0.00 H ATOM 6472 HE2 TYR B 93 -26.100 72.205 -0.304 1.00 0.00 H ATOM 6473 HE1 TYR B 93 -29.560 70.489 -2.227 1.00 0.00 H ATOM 6474 HD1 TYR B 93 -30.802 70.619 -0.090 1.00 0.00 H ATOM 6475 HH TYR B 93 -27.599 70.857 -3.290 1.00 0.00 H ATOM 6476 H TYR B 93 -31.502 69.399 2.048 1.00 0.00 H ATOM 6477 N GLU B 94 -30.880 69.360 5.195 1.00 31.54 N ATOM 6478 CA GLU B 94 -31.010 69.287 6.669 1.00 31.77 C ATOM 6479 C GLU B 94 -29.641 69.360 7.364 1.00 31.36 C ATOM 6480 O GLU B 94 -29.506 69.973 8.419 1.00 31.03 O ATOM 6481 CB GLU B 94 -31.770 68.033 7.143 1.00 31.42 C ATOM 6482 CG GLU B 94 -33.323 68.171 7.053 1.00 33.42 C ATOM 6483 CD GLU B 94 -34.114 66.856 7.230 1.00 34.48 C ATOM 6484 OE1 GLU B 94 -35.374 66.900 7.179 1.00 36.81 O ATOM 6485 OE2 GLU B 94 -33.493 65.782 7.437 1.00 36.48 O ATOM 6486 HA GLU B 94 -31.600 70.158 6.955 1.00 0.00 H ATOM 6487 HB2 GLU B 94 -31.462 67.189 6.525 1.00 0.00 H ATOM 6488 HB3 GLU B 94 -31.501 67.839 8.181 1.00 0.00 H ATOM 6489 HG2 GLU B 94 -33.645 68.865 7.829 1.00 0.00 H ATOM 6490 HG3 GLU B 94 -33.569 68.583 6.074 1.00 0.00 H ATOM 6491 H GLU B 94 -31.362 68.657 4.599 1.00 0.00 H ATOM 6492 N CYS B 95 -28.613 68.766 6.761 1.00 30.73 N ATOM 6493 CA CYS B 95 -27.291 68.785 7.381 1.00 30.62 C ATOM 6494 C CYS B 95 -26.598 70.134 7.293 1.00 29.58 C ATOM 6495 O CYS B 95 -25.578 70.322 7.924 1.00 27.97 O ATOM 6496 CB CYS B 95 -26.385 67.693 6.791 1.00 30.68 C ATOM 6497 SG CYS B 95 -25.978 68.001 5.061 1.00 31.55 S ATOM 6498 HA CYS B 95 -27.462 68.584 8.439 1.00 0.00 H ATOM 6499 HB2 CYS B 95 -26.898 66.734 6.865 1.00 0.00 H ATOM 6500 HB3 CYS B 95 -25.461 67.655 7.367 1.00 0.00 H ATOM 6501 HG CYS B 95 -27.140 68.041 4.317 1.00 0.00 H ATOM 6502 H CYS B 95 -28.752 68.288 5.848 1.00 0.00 H ATOM 6503 N LEU B 96 -27.165 71.070 6.532 1.00 29.58 N ATOM 6504 CA LEU B 96 -26.650 72.432 6.498 1.00 29.37 C ATOM 6505 C LEU B 96 -27.587 73.434 7.197 1.00 28.82 C ATOM 6506 O LEU B 96 -27.502 74.641 6.987 1.00 28.59 O ATOM 6507 CB LEU B 96 -26.312 72.809 5.050 1.00 29.33 C ATOM 6508 CG LEU B 96 -25.005 72.116 4.562 1.00 27.79 C ATOM 6509 CD1 LEU B 96 -24.902 72.049 3.056 1.00 21.08 C ATOM 6510 CD2 LEU B 96 -23.751 72.791 5.190 1.00 21.98 C ATOM 6511 HA LEU B 96 -25.728 72.480 7.078 1.00 0.00 H ATOM 6512 HB2 LEU B 96 -27.136 72.504 4.404 1.00 0.00 H ATOM 6513 HB3 LEU B 96 -26.183 73.890 4.987 1.00 0.00 H ATOM 6514 HG LEU B 96 -25.048 71.083 4.908 1.00 0.00 H ATOM 6515 HD21 LEU B 96 -23.721 73.841 4.899 1.00 0.00 H ATOM 6516 HD22 LEU B 96 -23.804 72.715 6.276 1.00 0.00 H ATOM 6517 HD23 LEU B 96 -22.852 72.288 4.833 1.00 0.00 H ATOM 6518 HD11 LEU B 96 -25.746 71.484 2.660 1.00 0.00 H ATOM 6519 HD12 LEU B 96 -24.916 73.059 2.647 1.00 0.00 H ATOM 6520 HD13 LEU B 96 -23.971 71.556 2.778 1.00 0.00 H ATOM 6521 H LEU B 96 -27.991 70.823 5.951 1.00 0.00 H ATOM 6522 N ASP B 97 -28.438 72.931 8.072 1.00 28.11 N ATOM 6523 CA ASP B 97 -29.354 73.788 8.813 1.00 29.19 C ATOM 6524 C ASP B 97 -28.648 74.705 9.841 1.00 28.85 C ATOM 6525 O ASP B 97 -29.217 75.713 10.259 1.00 28.96 O ATOM 6526 CB ASP B 97 -30.437 72.943 9.492 1.00 28.97 C ATOM 6527 CG ASP B 97 -31.547 73.781 10.101 1.00 30.90 C ATOM 6528 OD1 ASP B 97 -32.112 74.653 9.404 1.00 31.86 O ATOM 6529 OD2 ASP B 97 -31.878 73.549 11.289 1.00 34.26 O ATOM 6530 HA ASP B 97 -29.814 74.455 8.084 1.00 0.00 H ATOM 6531 HB2 ASP B 97 -30.873 72.275 8.750 1.00 0.00 H ATOM 6532 HB3 ASP B 97 -29.973 72.353 10.282 1.00 0.00 H ATOM 6533 H ASP B 97 -28.455 71.904 8.235 1.00 0.00 H ATOM 6534 N ALA B 98 -27.429 74.358 10.253 1.00 28.20 N ATOM 6535 CA ALA B 98 -26.613 75.269 11.058 1.00 28.17 C ATOM 6536 C ALA B 98 -25.640 76.100 10.162 1.00 27.84 C ATOM 6537 O ALA B 98 -24.696 76.683 10.641 1.00 26.74 O ATOM 6538 CB ALA B 98 -25.849 74.488 12.180 1.00 26.86 C ATOM 6539 HA ALA B 98 -27.280 75.978 11.548 1.00 0.00 H ATOM 6540 HB1 ALA B 98 -26.569 73.993 12.831 1.00 0.00 H ATOM 6541 HB2 ALA B 98 -25.198 73.743 11.723 1.00 0.00 H ATOM 6542 HB3 ALA B 98 -25.250 75.187 12.764 1.00 0.00 H ATOM 6543 H ALA B 98 -27.051 73.423 9.998 1.00 0.00 H ATOM 6544 N SER B 99 -25.900 76.153 8.862 1.00 28.22 N ATOM 6545 CA SER B 99 -25.015 76.807 7.905 1.00 28.38 C ATOM 6546 C SER B 99 -25.769 77.659 6.885 1.00 28.34 C ATOM 6547 O SER B 99 -25.377 77.746 5.740 1.00 27.23 O ATOM 6548 CB SER B 99 -24.250 75.730 7.129 1.00 28.37 C ATOM 6549 OG SER B 99 -23.126 75.259 7.831 1.00 28.91 O ATOM 6550 HA SER B 99 -24.354 77.460 8.475 1.00 0.00 H ATOM 6551 HB2 SER B 99 -23.919 76.151 6.180 1.00 0.00 H ATOM 6552 HB3 SER B 99 -24.921 74.892 6.939 1.00 0.00 H ATOM 6553 HG SER B 99 -22.667 74.568 7.291 1.00 0.00 H ATOM 6554 H SER B 99 -26.772 75.709 8.510 1.00 0.00 H ATOM 6555 N ARG B 100 -26.863 78.280 7.267 1.00 28.83 N ATOM 6556 CA ARG B 100 -27.642 78.962 6.242 1.00 29.71 C ATOM 6557 C ARG B 100 -26.990 80.189 5.631 1.00 29.81 C ATOM 6558 O ARG B 100 -27.085 80.391 4.431 1.00 29.27 O ATOM 6559 CB ARG B 100 -29.071 79.173 6.710 1.00 29.80 C ATOM 6560 CG ARG B 100 -29.776 77.798 6.610 1.00 31.00 C ATOM 6561 CD ARG B 100 -31.120 77.747 7.207 1.00 30.60 C ATOM 6562 NE ARG B 100 -32.059 78.527 6.414 1.00 30.11 N ATOM 6563 CZ ARG B 100 -33.188 78.997 6.905 1.00 29.98 C ATOM 6564 NH1 ARG B 100 -33.513 78.745 8.163 1.00 29.40 N ATOM 6565 NH2 ARG B 100 -33.980 79.717 6.134 1.00 31.79 N ATOM 6566 HA ARG B 100 -27.675 78.288 5.386 1.00 0.00 H ATOM 6567 HB2 ARG B 100 -29.081 79.527 7.741 1.00 0.00 H ATOM 6568 HB3 ARG B 100 -29.573 79.901 6.072 1.00 0.00 H ATOM 6569 HG2 ARG B 100 -29.863 77.538 5.555 1.00 0.00 H ATOM 6570 HG3 ARG B 100 -29.153 77.060 7.115 1.00 0.00 H ATOM 6571 HD2 ARG B 100 -31.080 78.153 8.218 1.00 0.00 H ATOM 6572 HD3 ARG B 100 -31.457 76.711 7.246 1.00 0.00 H ATOM 6573 HE ARG B 100 -31.829 78.721 5.418 1.00 0.00 H ATOM 6574 HH12 ARG B 100 -34.403 79.114 8.554 1.00 0.00 H ATOM 6575 HH11 ARG B 100 -32.878 78.178 8.760 1.00 0.00 H ATOM 6576 HH22 ARG B 100 -34.873 80.092 6.512 1.00 0.00 H ATOM 6577 HH21 ARG B 100 -33.711 79.909 5.148 1.00 0.00 H ATOM 6578 H ARG B 100 -27.161 78.284 8.263 1.00 0.00 H ATOM 6579 N PRO B 101 -26.302 81.000 6.442 1.00 30.59 N ATOM 6580 CA PRO B 101 -25.547 82.048 5.817 1.00 31.01 C ATOM 6581 C PRO B 101 -24.561 81.513 4.799 1.00 30.73 C ATOM 6582 O PRO B 101 -24.322 82.164 3.815 1.00 31.15 O ATOM 6583 CB PRO B 101 -24.836 82.704 6.995 1.00 30.84 C ATOM 6584 CG PRO B 101 -25.785 82.475 8.124 1.00 31.12 C ATOM 6585 CD PRO B 101 -26.200 81.074 7.910 1.00 30.72 C ATOM 6586 HA PRO B 101 -26.172 82.738 5.250 1.00 0.00 H ATOM 6587 HD3 PRO B 101 -25.453 80.378 8.290 1.00 0.00 H ATOM 6588 HD2 PRO B 101 -27.160 80.869 8.384 1.00 0.00 H ATOM 6589 HG3 PRO B 101 -26.637 83.152 8.067 1.00 0.00 H ATOM 6590 HG2 PRO B 101 -25.289 82.597 9.087 1.00 0.00 H ATOM 6591 HB2 PRO B 101 -23.874 82.229 7.188 1.00 0.00 H ATOM 6592 HB3 PRO B 101 -24.685 83.769 6.819 1.00 0.00 H ATOM 6593 N TRP B 102 -24.019 80.325 4.984 1.00 30.07 N ATOM 6594 CA TRP B 102 -23.112 79.823 3.972 1.00 30.17 C ATOM 6595 C TRP B 102 -23.793 79.680 2.631 1.00 29.89 C ATOM 6596 O TRP B 102 -23.242 80.035 1.607 1.00 30.33 O ATOM 6597 CB TRP B 102 -22.514 78.495 4.371 1.00 30.14 C ATOM 6598 CG TRP B 102 -21.252 78.594 5.128 1.00 29.85 C ATOM 6599 CD1 TRP B 102 -21.048 78.143 6.359 1.00 29.62 C ATOM 6600 CD2 TRP B 102 -20.013 79.154 4.692 1.00 30.56 C ATOM 6601 NE1 TRP B 102 -19.756 78.367 6.760 1.00 29.84 N ATOM 6602 CE2 TRP B 102 -19.095 78.997 5.744 1.00 31.70 C ATOM 6603 CE3 TRP B 102 -19.581 79.750 3.515 1.00 30.33 C ATOM 6604 CZ2 TRP B 102 -17.755 79.424 5.657 1.00 30.65 C ATOM 6605 CZ3 TRP B 102 -18.236 80.168 3.440 1.00 30.53 C ATOM 6606 CH2 TRP B 102 -17.358 80.006 4.512 1.00 29.41 C ATOM 6607 HA TRP B 102 -22.313 80.559 3.884 1.00 0.00 H ATOM 6608 HB2 TRP B 102 -23.240 77.966 4.988 1.00 0.00 H ATOM 6609 HB3 TRP B 102 -22.323 77.921 3.464 1.00 0.00 H ATOM 6610 HE1 TRP B 102 -19.349 78.103 7.680 1.00 0.00 H ATOM 6611 HD1 TRP B 102 -21.808 77.658 6.971 1.00 0.00 H ATOM 6612 HZ2 TRP B 102 -17.064 79.287 6.489 1.00 0.00 H ATOM 6613 HH2 TRP B 102 -16.331 80.358 4.419 1.00 0.00 H ATOM 6614 HZ3 TRP B 102 -17.873 80.629 2.521 1.00 0.00 H ATOM 6615 HE3 TRP B 102 -20.261 79.891 2.674 1.00 0.00 H ATOM 6616 H TRP B 102 -24.237 79.764 5.832 1.00 0.00 H ATOM 6617 N LEU B 103 -25.006 79.158 2.665 1.00 30.01 N ATOM 6618 CA LEU B 103 -25.827 78.951 1.471 1.00 29.74 C ATOM 6619 C LEU B 103 -26.145 80.247 0.775 1.00 29.60 C ATOM 6620 O LEU B 103 -26.114 80.302 -0.437 1.00 29.37 O ATOM 6621 CB LEU B 103 -27.111 78.208 1.848 1.00 29.61 C ATOM 6622 CG LEU B 103 -26.825 76.742 2.249 1.00 28.68 C ATOM 6623 CD1 LEU B 103 -27.857 76.205 3.216 1.00 27.84 C ATOM 6624 CD2 LEU B 103 -26.707 75.847 0.995 1.00 26.30 C ATOM 6625 HA LEU B 103 -25.254 78.345 0.769 1.00 0.00 H ATOM 6626 HB2 LEU B 103 -27.582 78.719 2.688 1.00 0.00 H ATOM 6627 HB3 LEU B 103 -27.788 78.216 0.994 1.00 0.00 H ATOM 6628 HG LEU B 103 -25.868 76.725 2.771 1.00 0.00 H ATOM 6629 HD21 LEU B 103 -27.641 75.884 0.434 1.00 0.00 H ATOM 6630 HD22 LEU B 103 -25.891 76.207 0.368 1.00 0.00 H ATOM 6631 HD23 LEU B 103 -26.506 74.820 1.301 1.00 0.00 H ATOM 6632 HD11 LEU B 103 -27.855 76.812 4.121 1.00 0.00 H ATOM 6633 HD12 LEU B 103 -28.843 76.245 2.752 1.00 0.00 H ATOM 6634 HD13 LEU B 103 -27.614 75.173 3.468 1.00 0.00 H ATOM 6635 H LEU B 103 -25.398 78.880 3.587 1.00 0.00 H ATOM 6636 N CYS B 104 -26.442 81.288 1.542 1.00 29.80 N ATOM 6637 CA CYS B 104 -26.621 82.632 0.990 1.00 30.22 C ATOM 6638 C CYS B 104 -25.399 83.042 0.212 1.00 30.11 C ATOM 6639 O CYS B 104 -25.474 83.371 -0.977 1.00 30.43 O ATOM 6640 CB CYS B 104 -26.887 83.643 2.099 1.00 30.25 C ATOM 6641 SG CYS B 104 -28.505 83.350 2.919 1.00 33.28 S ATOM 6642 HA CYS B 104 -27.483 82.612 0.323 1.00 0.00 H ATOM 6643 HB2 CYS B 104 -26.885 84.645 1.671 1.00 0.00 H ATOM 6644 HB3 CYS B 104 -26.095 83.566 2.844 1.00 0.00 H ATOM 6645 HG CYS B 104 -28.516 82.086 3.473 1.00 0.00 H ATOM 6646 H CYS B 104 -26.551 81.145 2.566 1.00 0.00 H ATOM 6647 N TYR B 105 -24.252 82.961 0.869 1.00 29.99 N ATOM 6648 CA TYR B 105 -23.026 83.382 0.242 1.00 29.76 C ATOM 6649 C TYR B 105 -22.716 82.506 -0.970 1.00 29.85 C ATOM 6650 O TYR B 105 -22.485 83.054 -2.047 1.00 30.26 O ATOM 6651 CB TYR B 105 -21.877 83.405 1.240 1.00 29.63 C ATOM 6652 CG TYR B 105 -20.512 83.422 0.580 1.00 29.46 C ATOM 6653 CD1 TYR B 105 -20.062 84.541 -0.116 1.00 30.65 C ATOM 6654 CD2 TYR B 105 -19.671 82.326 0.651 1.00 27.62 C ATOM 6655 CE1 TYR B 105 -18.808 84.557 -0.756 1.00 28.63 C ATOM 6656 CE2 TYR B 105 -18.436 82.344 0.029 1.00 29.83 C ATOM 6657 CZ TYR B 105 -18.026 83.463 -0.690 1.00 28.56 C ATOM 6658 OH TYR B 105 -16.799 83.467 -1.293 1.00 30.83 O ATOM 6659 HA TYR B 105 -23.154 84.404 -0.115 1.00 0.00 H ATOM 6660 HB3 TYR B 105 -21.947 82.518 1.869 1.00 0.00 H ATOM 6661 HB2 TYR B 105 -21.974 84.297 1.859 1.00 0.00 H ATOM 6662 HD2 TYR B 105 -19.985 81.440 1.202 1.00 0.00 H ATOM 6663 HE2 TYR B 105 -17.780 81.477 0.102 1.00 0.00 H ATOM 6664 HE1 TYR B 105 -18.475 85.443 -1.297 1.00 0.00 H ATOM 6665 HD1 TYR B 105 -20.696 85.426 -0.167 1.00 0.00 H ATOM 6666 HH TYR B 105 -16.664 84.330 -1.759 1.00 0.00 H ATOM 6667 H TYR B 105 -24.237 82.592 1.841 1.00 0.00 H ATOM 6668 N TRP B 106 -22.727 81.173 -0.831 1.00 29.22 N ATOM 6669 CA TRP B 106 -22.311 80.320 -1.948 1.00 29.23 C ATOM 6670 C TRP B 106 -23.166 80.645 -3.176 1.00 29.01 C ATOM 6671 O TRP B 106 -22.656 80.781 -4.304 1.00 27.51 O ATOM 6672 CB TRP B 106 -22.392 78.809 -1.636 1.00 28.98 C ATOM 6673 CG TRP B 106 -21.446 78.314 -0.556 1.00 28.64 C ATOM 6674 CD1 TRP B 106 -20.194 78.764 -0.300 1.00 28.08 C ATOM 6675 CD2 TRP B 106 -21.701 77.281 0.398 1.00 27.29 C ATOM 6676 NE1 TRP B 106 -19.667 78.111 0.774 1.00 27.83 N ATOM 6677 CE2 TRP B 106 -20.570 77.189 1.220 1.00 26.88 C ATOM 6678 CE3 TRP B 106 -22.794 76.457 0.664 1.00 27.67 C ATOM 6679 CZ2 TRP B 106 -20.484 76.301 2.279 1.00 25.88 C ATOM 6680 CZ3 TRP B 106 -22.701 75.564 1.712 1.00 28.46 C ATOM 6681 CH2 TRP B 106 -21.544 75.495 2.509 1.00 26.70 C ATOM 6682 HA TRP B 106 -21.260 80.536 -2.138 1.00 0.00 H ATOM 6683 HB2 TRP B 106 -23.411 78.585 -1.319 1.00 0.00 H ATOM 6684 HB3 TRP B 106 -22.170 78.264 -2.553 1.00 0.00 H ATOM 6685 HE1 TRP B 106 -18.729 78.287 1.187 1.00 0.00 H ATOM 6686 HD1 TRP B 106 -19.681 79.538 -0.871 1.00 0.00 H ATOM 6687 HZ2 TRP B 106 -19.593 76.254 2.905 1.00 0.00 H ATOM 6688 HH2 TRP B 106 -21.502 74.777 3.328 1.00 0.00 H ATOM 6689 HZ3 TRP B 106 -23.539 74.900 1.926 1.00 0.00 H ATOM 6690 HE3 TRP B 106 -23.699 76.517 0.059 1.00 0.00 H ATOM 6691 H TRP B 106 -23.030 80.745 0.067 1.00 0.00 H ATOM 6692 N ILE B 107 -24.461 80.795 -2.934 1.00 29.08 N ATOM 6693 CA ILE B 107 -25.423 80.999 -4.022 1.00 29.71 C ATOM 6694 C ILE B 107 -25.287 82.418 -4.626 1.00 30.54 C ATOM 6695 O ILE B 107 -25.139 82.561 -5.858 1.00 30.10 O ATOM 6696 CB ILE B 107 -26.883 80.674 -3.576 1.00 29.82 C ATOM 6697 CG1 ILE B 107 -26.993 79.155 -3.267 1.00 29.29 C ATOM 6698 CG2 ILE B 107 -27.861 81.123 -4.644 1.00 27.77 C ATOM 6699 CD1 ILE B 107 -28.266 78.674 -2.573 1.00 28.97 C ATOM 6700 HA ILE B 107 -25.185 80.291 -4.815 1.00 0.00 H ATOM 6701 HB ILE B 107 -27.136 81.218 -2.666 1.00 0.00 H ATOM 6702 HG12 ILE B 107 -26.914 78.621 -4.214 1.00 0.00 H ATOM 6703 HG13 ILE B 107 -26.151 78.888 -2.629 1.00 0.00 H ATOM 6704 HD11 ILE B 107 -28.365 79.175 -1.610 1.00 0.00 H ATOM 6705 HD12 ILE B 107 -29.129 78.908 -3.197 1.00 0.00 H ATOM 6706 HD13 ILE B 107 -28.209 77.596 -2.419 1.00 0.00 H ATOM 6707 HG21 ILE B 107 -27.762 82.198 -4.797 1.00 0.00 H ATOM 6708 HG22 ILE B 107 -27.644 80.601 -5.576 1.00 0.00 H ATOM 6709 HG23 ILE B 107 -28.877 80.892 -4.324 1.00 0.00 H ATOM 6710 H ILE B 107 -24.802 80.767 -1.952 1.00 0.00 H ATOM 6711 N LEU B 108 -25.278 83.441 -3.771 1.00 30.39 N ATOM 6712 CA LEU B 108 -25.089 84.784 -4.262 1.00 31.16 C ATOM 6713 C LEU B 108 -23.775 84.972 -5.024 1.00 31.66 C ATOM 6714 O LEU B 108 -23.732 85.632 -6.063 1.00 32.24 O ATOM 6715 CB LEU B 108 -25.183 85.787 -3.136 1.00 31.47 C ATOM 6716 CG LEU B 108 -26.573 85.961 -2.521 1.00 30.72 C ATOM 6717 CD1 LEU B 108 -26.439 86.897 -1.339 1.00 28.81 C ATOM 6718 CD2 LEU B 108 -27.571 86.462 -3.532 1.00 28.35 C ATOM 6719 HA LEU B 108 -25.895 84.959 -4.974 1.00 0.00 H ATOM 6720 HB2 LEU B 108 -24.503 85.469 -2.345 1.00 0.00 H ATOM 6721 HB3 LEU B 108 -24.863 86.755 -3.521 1.00 0.00 H ATOM 6722 HG LEU B 108 -26.958 84.998 -2.185 1.00 0.00 H ATOM 6723 HD21 LEU B 108 -27.242 87.427 -3.917 1.00 0.00 H ATOM 6724 HD22 LEU B 108 -27.645 85.748 -4.352 1.00 0.00 H ATOM 6725 HD23 LEU B 108 -28.545 86.572 -3.055 1.00 0.00 H ATOM 6726 HD11 LEU B 108 -25.753 86.465 -0.611 1.00 0.00 H ATOM 6727 HD12 LEU B 108 -26.052 87.857 -1.680 1.00 0.00 H ATOM 6728 HD13 LEU B 108 -27.416 87.041 -0.878 1.00 0.00 H ATOM 6729 H LEU B 108 -25.407 83.271 -2.753 1.00 0.00 H ATOM 6730 N HIS B 109 -22.703 84.390 -4.526 1.00 31.42 N ATOM 6731 CA HIS B 109 -21.417 84.544 -5.165 1.00 31.03 C ATOM 6732 C HIS B 109 -21.432 83.864 -6.523 1.00 31.27 C ATOM 6733 O HIS B 109 -20.864 84.381 -7.486 1.00 32.77 O ATOM 6734 CB HIS B 109 -20.282 83.969 -4.284 1.00 30.53 C ATOM 6735 CG HIS B 109 -18.914 84.137 -4.879 1.00 30.25 C ATOM 6736 ND1 HIS B 109 -18.449 85.350 -5.354 1.00 31.38 N ATOM 6737 CD2 HIS B 109 -17.915 83.247 -5.090 1.00 31.32 C ATOM 6738 CE1 HIS B 109 -17.227 85.197 -5.836 1.00 32.12 C ATOM 6739 NE2 HIS B 109 -16.869 83.933 -5.673 1.00 32.67 N ATOM 6740 HA HIS B 109 -21.225 85.608 -5.300 1.00 0.00 H ATOM 6741 HB2 HIS B 109 -20.303 84.477 -3.320 1.00 0.00 H ATOM 6742 HB3 HIS B 109 -20.465 82.905 -4.137 1.00 0.00 H ATOM 6743 HD2 HIS B 109 -17.934 82.185 -4.845 1.00 0.00 H ATOM 6744 HE1 HIS B 109 -16.618 85.979 -6.290 1.00 0.00 H ATOM 6745 H HIS B 109 -22.784 83.814 -3.664 1.00 0.00 H ATOM 6746 N SER B 110 -22.035 82.689 -6.612 1.00 30.94 N ATOM 6747 CA SER B 110 -22.129 82.024 -7.899 1.00 31.36 C ATOM 6748 C SER B 110 -22.925 82.901 -8.899 1.00 32.43 C ATOM 6749 O SER B 110 -22.560 83.012 -10.064 1.00 32.61 O ATOM 6750 CB SER B 110 -22.781 80.645 -7.737 1.00 31.42 C ATOM 6751 OG SER B 110 -21.994 79.800 -6.904 1.00 30.57 O ATOM 6752 HA SER B 110 -21.125 81.880 -8.298 1.00 0.00 H ATOM 6753 HB2 SER B 110 -22.884 80.182 -8.718 1.00 0.00 H ATOM 6754 HB3 SER B 110 -23.767 80.768 -7.290 1.00 0.00 H ATOM 6755 HG SER B 110 -21.901 80.214 -6.009 1.00 0.00 H ATOM 6756 H SER B 110 -22.440 82.244 -5.764 1.00 0.00 H ATOM 6757 N LEU B 111 -24.004 83.509 -8.417 1.00 33.41 N ATOM 6758 CA LEU B 111 -24.836 84.367 -9.251 1.00 34.22 C ATOM 6759 C LEU B 111 -24.062 85.596 -9.717 1.00 34.98 C ATOM 6760 O LEU B 111 -24.232 86.057 -10.846 1.00 34.38 O ATOM 6761 CB LEU B 111 -26.094 84.795 -8.493 1.00 34.08 C ATOM 6762 CG LEU B 111 -27.211 83.753 -8.390 1.00 34.10 C ATOM 6763 CD1 LEU B 111 -28.353 84.272 -7.530 1.00 28.86 C ATOM 6764 CD2 LEU B 111 -27.710 83.363 -9.773 1.00 31.20 C ATOM 6765 HA LEU B 111 -25.131 83.794 -10.130 1.00 0.00 H ATOM 6766 HB2 LEU B 111 -25.796 85.064 -7.480 1.00 0.00 H ATOM 6767 HB3 LEU B 111 -26.503 85.672 -8.995 1.00 0.00 H ATOM 6768 HG LEU B 111 -26.804 82.862 -7.912 1.00 0.00 H ATOM 6769 HD21 LEU B 111 -28.097 84.247 -10.281 1.00 0.00 H ATOM 6770 HD22 LEU B 111 -26.886 82.942 -10.350 1.00 0.00 H ATOM 6771 HD23 LEU B 111 -28.503 82.622 -9.676 1.00 0.00 H ATOM 6772 HD11 LEU B 111 -27.982 84.491 -6.529 1.00 0.00 H ATOM 6773 HD12 LEU B 111 -28.758 85.180 -7.976 1.00 0.00 H ATOM 6774 HD13 LEU B 111 -29.135 83.515 -7.471 1.00 0.00 H ATOM 6775 H LEU B 111 -24.261 83.369 -7.419 1.00 0.00 H ATOM 6776 N GLU B 112 -23.213 86.121 -8.840 1.00 35.61 N ATOM 6777 CA GLU B 112 -22.407 87.293 -9.161 1.00 36.55 C ATOM 6778 C GLU B 112 -21.329 86.954 -10.185 1.00 35.54 C ATOM 6779 O GLU B 112 -21.031 87.751 -11.075 1.00 35.76 O ATOM 6780 CB GLU B 112 -21.769 87.868 -7.895 1.00 35.93 C ATOM 6781 CG GLU B 112 -20.288 88.180 -8.034 1.00 38.40 C ATOM 6782 CD GLU B 112 -19.688 88.736 -6.758 1.00 39.32 C ATOM 6783 OE1 GLU B 112 -19.667 88.008 -5.743 1.00 39.47 O ATOM 6784 OE2 GLU B 112 -19.237 89.900 -6.769 1.00 43.34 O ATOM 6785 HA GLU B 112 -23.067 88.044 -9.596 1.00 0.00 H ATOM 6786 HB2 GLU B 112 -22.291 88.790 -7.637 1.00 0.00 H ATOM 6787 HB3 GLU B 112 -21.893 87.144 -7.090 1.00 0.00 H ATOM 6788 HG2 GLU B 112 -19.761 87.263 -8.298 1.00 0.00 H ATOM 6789 HG3 GLU B 112 -20.159 88.914 -8.830 1.00 0.00 H ATOM 6790 H GLU B 112 -23.121 85.685 -7.900 1.00 0.00 H ATOM 6791 N LEU B 113 -20.748 85.766 -10.052 1.00 35.48 N ATOM 6792 CA LEU B 113 -19.706 85.317 -10.968 1.00 35.53 C ATOM 6793 C LEU B 113 -20.256 85.137 -12.379 1.00 35.78 C ATOM 6794 O LEU B 113 -19.606 85.498 -13.360 1.00 35.67 O ATOM 6795 CB LEU B 113 -19.086 84.008 -10.474 1.00 34.79 C ATOM 6796 CG LEU B 113 -18.016 84.132 -9.388 1.00 34.56 C ATOM 6797 CD1 LEU B 113 -17.721 82.776 -8.766 1.00 34.27 C ATOM 6798 CD2 LEU B 113 -16.748 84.756 -9.952 1.00 33.65 C ATOM 6799 HA LEU B 113 -18.933 86.085 -10.998 1.00 0.00 H ATOM 6800 HB2 LEU B 113 -19.890 83.388 -10.079 1.00 0.00 H ATOM 6801 HB3 LEU B 113 -18.633 83.510 -11.332 1.00 0.00 H ATOM 6802 HG LEU B 113 -18.398 84.788 -8.605 1.00 0.00 H ATOM 6803 HD21 LEU B 113 -16.363 84.130 -10.757 1.00 0.00 H ATOM 6804 HD22 LEU B 113 -16.975 85.749 -10.339 1.00 0.00 H ATOM 6805 HD23 LEU B 113 -16.001 84.834 -9.162 1.00 0.00 H ATOM 6806 HD11 LEU B 113 -18.632 82.376 -8.320 1.00 0.00 H ATOM 6807 HD12 LEU B 113 -17.363 82.094 -9.537 1.00 0.00 H ATOM 6808 HD13 LEU B 113 -16.957 82.889 -7.997 1.00 0.00 H ATOM 6809 H LEU B 113 -21.044 85.141 -9.275 1.00 0.00 H ATOM 6810 N LEU B 114 -21.484 84.619 -12.441 1.00 36.33 N ATOM 6811 CA LEU B 114 -22.255 84.408 -13.656 1.00 37.56 C ATOM 6812 C LEU B 114 -22.943 85.658 -14.162 1.00 39.98 C ATOM 6813 O LEU B 114 -23.714 85.597 -15.077 1.00 40.71 O ATOM 6814 CB LEU B 114 -23.335 83.368 -13.420 1.00 37.07 C ATOM 6815 CG LEU B 114 -22.953 81.951 -13.083 1.00 36.40 C ATOM 6816 CD1 LEU B 114 -24.110 81.177 -12.541 1.00 32.99 C ATOM 6817 CD2 LEU B 114 -22.312 81.271 -14.236 1.00 34.46 C ATOM 6818 HA LEU B 114 -21.531 84.083 -14.403 1.00 0.00 H ATOM 6819 HB2 LEU B 114 -23.950 83.733 -12.597 1.00 0.00 H ATOM 6820 HB3 LEU B 114 -23.935 83.325 -14.329 1.00 0.00 H ATOM 6821 HG LEU B 114 -22.209 81.995 -12.287 1.00 0.00 H ATOM 6822 HD21 LEU B 114 -23.006 81.251 -15.076 1.00 0.00 H ATOM 6823 HD22 LEU B 114 -21.410 81.813 -14.521 1.00 0.00 H ATOM 6824 HD23 LEU B 114 -22.050 80.251 -13.955 1.00 0.00 H ATOM 6825 HD11 LEU B 114 -24.474 81.658 -11.633 1.00 0.00 H ATOM 6826 HD12 LEU B 114 -24.907 81.149 -13.284 1.00 0.00 H ATOM 6827 HD13 LEU B 114 -23.790 80.161 -12.311 1.00 0.00 H ATOM 6828 H LEU B 114 -21.928 84.342 -11.542 1.00 0.00 H ATOM 6829 N ASP B 115 -22.695 86.778 -13.516 1.00 42.77 N ATOM 6830 CA ASP B 115 -23.236 88.061 -13.922 1.00 45.24 C ATOM 6831 C ASP B 115 -24.750 88.151 -13.954 1.00 46.59 C ATOM 6832 O ASP B 115 -25.309 88.626 -14.895 1.00 46.62 O ATOM 6833 CB ASP B 115 -22.659 88.463 -15.267 1.00 46.01 C ATOM 6834 CG ASP B 115 -22.814 89.934 -15.560 1.00 47.67 C ATOM 6835 OD1 ASP B 115 -22.744 90.758 -14.659 1.00 49.06 O ATOM 6836 OD2 ASP B 115 -23.021 90.266 -16.723 1.00 51.25 O ATOM 6837 HA ASP B 115 -22.931 88.758 -13.141 1.00 0.00 H ATOM 6838 HB2 ASP B 115 -21.597 88.217 -15.277 1.00 0.00 H ATOM 6839 HB3 ASP B 115 -23.169 87.898 -16.047 1.00 0.00 H ATOM 6840 H ASP B 115 -22.083 86.741 -12.676 1.00 0.00 H ATOM 6841 N GLU B 116 -25.406 87.717 -12.901 1.00 48.45 N ATOM 6842 CA GLU B 116 -26.835 87.799 -12.820 1.00 49.99 C ATOM 6843 C GLU B 116 -27.202 88.778 -11.736 1.00 51.56 C ATOM 6844 O GLU B 116 -26.748 88.649 -10.646 1.00 51.53 O ATOM 6845 CB GLU B 116 -27.412 86.434 -12.498 1.00 49.82 C ATOM 6846 CG GLU B 116 -27.009 85.347 -13.461 1.00 50.31 C ATOM 6847 CD GLU B 116 -27.883 85.312 -14.681 1.00 52.20 C ATOM 6848 OE1 GLU B 116 -28.781 86.134 -14.791 1.00 51.26 O ATOM 6849 OE2 GLU B 116 -27.676 84.456 -15.516 1.00 54.94 O ATOM 6850 HA GLU B 116 -27.241 88.134 -13.774 1.00 0.00 H ATOM 6851 HB2 GLU B 116 -27.077 86.148 -11.501 1.00 0.00 H ATOM 6852 HB3 GLU B 116 -28.499 86.512 -12.506 1.00 0.00 H ATOM 6853 HG2 GLU B 116 -25.979 85.519 -13.773 1.00 0.00 H ATOM 6854 HG3 GLU B 116 -27.078 84.385 -12.953 1.00 0.00 H ATOM 6855 H GLU B 116 -24.876 87.304 -12.107 1.00 0.00 H ATOM 6856 N PRO B 117 -28.043 89.756 -12.042 1.00 54.09 N ATOM 6857 CA PRO B 117 -28.417 90.788 -11.063 1.00 54.57 C ATOM 6858 C PRO B 117 -29.259 90.168 -9.958 1.00 54.02 C ATOM 6859 O PRO B 117 -30.089 89.329 -10.255 1.00 53.79 O ATOM 6860 CB PRO B 117 -29.260 91.786 -11.892 1.00 55.49 C ATOM 6861 CG PRO B 117 -29.773 90.988 -13.112 1.00 55.82 C ATOM 6862 CD PRO B 117 -28.790 89.844 -13.325 1.00 54.75 C ATOM 6863 HA PRO B 117 -27.560 91.259 -10.581 1.00 0.00 H ATOM 6864 HD3 PRO B 117 -29.319 88.913 -13.529 1.00 0.00 H ATOM 6865 HD2 PRO B 117 -28.114 90.064 -14.151 1.00 0.00 H ATOM 6866 HG3 PRO B 117 -29.804 91.627 -13.994 1.00 0.00 H ATOM 6867 HG2 PRO B 117 -30.770 90.596 -12.913 1.00 0.00 H ATOM 6868 HB2 PRO B 117 -30.097 92.159 -11.302 1.00 0.00 H ATOM 6869 HB3 PRO B 117 -28.645 92.625 -12.218 1.00 0.00 H ATOM 6870 N ILE B 118 -29.045 90.561 -8.709 1.00 53.50 N ATOM 6871 CA ILE B 118 -29.922 90.134 -7.636 1.00 53.30 C ATOM 6872 C ILE B 118 -31.153 91.045 -7.639 1.00 54.13 C ATOM 6873 O ILE B 118 -31.034 92.233 -7.384 1.00 54.31 O ATOM 6874 CB ILE B 118 -29.252 90.232 -6.230 1.00 53.13 C ATOM 6875 CG1 ILE B 118 -27.793 89.807 -6.278 1.00 54.05 C ATOM 6876 CG2 ILE B 118 -29.980 89.360 -5.239 1.00 51.50 C ATOM 6877 CD1 ILE B 118 -27.636 88.517 -6.922 1.00 54.88 C ATOM 6878 HA ILE B 118 -30.175 89.088 -7.811 1.00 0.00 H ATOM 6879 HB ILE B 118 -29.306 91.275 -5.918 1.00 0.00 H ATOM 6880 HG12 ILE B 118 -27.225 90.552 -6.834 1.00 0.00 H ATOM 6881 HG13 ILE B 118 -27.408 89.744 -5.260 1.00 0.00 H ATOM 6882 HD11 ILE B 118 -28.197 87.765 -6.367 1.00 0.00 H ATOM 6883 HD12 ILE B 118 -28.013 88.574 -7.943 1.00 0.00 H ATOM 6884 HD13 ILE B 118 -26.580 88.246 -6.938 1.00 0.00 H ATOM 6885 HG21 ILE B 118 -31.017 89.687 -5.162 1.00 0.00 H ATOM 6886 HG22 ILE B 118 -29.948 88.324 -5.577 1.00 0.00 H ATOM 6887 HG23 ILE B 118 -29.499 89.441 -4.264 1.00 0.00 H ATOM 6888 H ILE B 118 -28.239 91.183 -8.497 1.00 0.00 H ATOM 6889 N PRO B 119 -32.351 90.505 -7.921 1.00 55.41 N ATOM 6890 CA PRO B 119 -33.541 91.379 -7.727 1.00 56.95 C ATOM 6891 C PRO B 119 -33.594 92.064 -6.346 1.00 58.31 C ATOM 6892 O PRO B 119 -33.347 91.410 -5.338 1.00 58.08 O ATOM 6893 CB PRO B 119 -34.725 90.415 -7.866 1.00 56.83 C ATOM 6894 CG PRO B 119 -34.171 89.167 -8.489 1.00 55.76 C ATOM 6895 CD PRO B 119 -32.693 89.166 -8.434 1.00 54.38 C ATOM 6896 HA PRO B 119 -33.533 92.200 -8.444 1.00 0.00 H ATOM 6897 HD3 PRO B 119 -32.331 88.389 -7.760 1.00 0.00 H ATOM 6898 HD2 PRO B 119 -32.269 89.011 -9.426 1.00 0.00 H ATOM 6899 HG3 PRO B 119 -34.491 89.114 -9.530 1.00 0.00 H ATOM 6900 HG2 PRO B 119 -34.550 88.299 -7.949 1.00 0.00 H ATOM 6901 HB2 PRO B 119 -35.150 90.193 -6.887 1.00 0.00 H ATOM 6902 HB3 PRO B 119 -35.494 90.849 -8.505 1.00 0.00 H ATOM 6903 N GLN B 120 -33.902 93.361 -6.312 1.00 60.35 N ATOM 6904 CA GLN B 120 -34.045 94.102 -5.054 1.00 62.03 C ATOM 6905 C GLN B 120 -34.866 93.358 -4.023 1.00 61.56 C ATOM 6906 O GLN B 120 -34.471 93.284 -2.875 1.00 61.66 O ATOM 6907 CB GLN B 120 -34.713 95.466 -5.266 1.00 63.03 C ATOM 6908 CG GLN B 120 -34.487 96.443 -4.078 1.00 65.31 C ATOM 6909 CD GLN B 120 -35.198 97.808 -4.214 1.00 66.31 C ATOM 6910 OE1 GLN B 120 -35.911 98.235 -3.294 1.00 70.44 O ATOM 6911 NE2 GLN B 120 -34.993 98.500 -5.347 1.00 68.85 N ATOM 6912 HA GLN B 120 -33.025 94.226 -4.690 1.00 0.00 H ATOM 6913 HB2 GLN B 120 -34.304 95.917 -6.170 1.00 0.00 H ATOM 6914 HB3 GLN B 120 -35.785 95.313 -5.391 1.00 0.00 H ATOM 6915 HG2 GLN B 120 -34.849 95.961 -3.170 1.00 0.00 H ATOM 6916 HG3 GLN B 120 -33.416 96.626 -3.989 1.00 0.00 H ATOM 6917 HE22 GLN B 120 -34.387 98.106 -6.095 1.00 0.00 H ATOM 6918 HE21 GLN B 120 -35.440 99.430 -5.476 1.00 0.00 H ATOM 6919 H GLN B 120 -34.046 93.866 -7.210 1.00 0.00 H ATOM 6920 N ILE B 121 -36.010 92.818 -4.422 1.00 61.26 N ATOM 6921 CA ILE B 121 -36.862 92.122 -3.481 1.00 60.98 C ATOM 6922 C ILE B 121 -36.114 90.965 -2.772 1.00 59.72 C ATOM 6923 O ILE B 121 -36.235 90.800 -1.545 1.00 60.06 O ATOM 6924 CB ILE B 121 -38.157 91.626 -4.187 1.00 61.98 C ATOM 6925 CG1 ILE B 121 -39.335 91.528 -3.187 1.00 63.29 C ATOM 6926 CG2 ILE B 121 -37.894 90.325 -4.970 1.00 60.82 C ATOM 6927 CD1 ILE B 121 -39.296 90.294 -2.245 1.00 64.50 C ATOM 6928 HA ILE B 121 -37.150 92.827 -2.702 1.00 0.00 H ATOM 6929 HB ILE B 121 -38.461 92.365 -4.929 1.00 0.00 H ATOM 6930 HG12 ILE B 121 -39.330 92.426 -2.569 1.00 0.00 H ATOM 6931 HG13 ILE B 121 -40.262 91.488 -3.759 1.00 0.00 H ATOM 6932 HD11 ILE B 121 -39.316 89.382 -2.842 1.00 0.00 H ATOM 6933 HD12 ILE B 121 -38.383 90.321 -1.651 1.00 0.00 H ATOM 6934 HD13 ILE B 121 -40.162 90.316 -1.584 1.00 0.00 H ATOM 6935 HG21 ILE B 121 -37.130 90.506 -5.726 1.00 0.00 H ATOM 6936 HG22 ILE B 121 -37.551 89.552 -4.283 1.00 0.00 H ATOM 6937 HG23 ILE B 121 -38.816 90.001 -5.453 1.00 0.00 H ATOM 6938 H ILE B 121 -36.297 92.895 -5.419 1.00 0.00 H ATOM 6939 N VAL B 122 -35.344 90.193 -3.552 1.00 58.03 N ATOM 6940 CA VAL B 122 -34.447 89.125 -3.070 1.00 55.86 C ATOM 6941 C VAL B 122 -33.330 89.659 -2.182 1.00 53.98 C ATOM 6942 O VAL B 122 -33.056 89.122 -1.119 1.00 53.04 O ATOM 6943 CB VAL B 122 -33.796 88.385 -4.272 1.00 55.97 C ATOM 6944 CG1 VAL B 122 -32.702 87.417 -3.829 1.00 54.98 C ATOM 6945 CG2 VAL B 122 -34.847 87.677 -5.064 1.00 56.03 C ATOM 6946 HA VAL B 122 -35.065 88.446 -2.483 1.00 0.00 H ATOM 6947 HB VAL B 122 -33.316 89.133 -4.903 1.00 0.00 H ATOM 6948 HG11 VAL B 122 -31.920 87.969 -3.306 1.00 0.00 H ATOM 6949 HG12 VAL B 122 -33.129 86.669 -3.161 1.00 0.00 H ATOM 6950 HG13 VAL B 122 -32.278 86.925 -4.704 1.00 0.00 H ATOM 6951 HG21 VAL B 122 -35.354 86.952 -4.427 1.00 0.00 H ATOM 6952 HG22 VAL B 122 -35.570 88.403 -5.437 1.00 0.00 H ATOM 6953 HG23 VAL B 122 -34.381 87.161 -5.904 1.00 0.00 H ATOM 6954 H VAL B 122 -35.382 90.360 -4.578 1.00 0.00 H ATOM 6955 N ALA B 123 -32.681 90.719 -2.624 1.00 52.84 N ATOM 6956 CA ALA B 123 -31.707 91.401 -1.777 1.00 52.24 C ATOM 6957 C ALA B 123 -32.300 91.759 -0.416 1.00 52.04 C ATOM 6958 O ALA B 123 -31.679 91.519 0.612 1.00 51.96 O ATOM 6959 CB ALA B 123 -31.180 92.631 -2.455 1.00 51.76 C ATOM 6960 HA ALA B 123 -30.880 90.711 -1.611 1.00 0.00 H ATOM 6961 HB1 ALA B 123 -30.697 92.350 -3.391 1.00 0.00 H ATOM 6962 HB2 ALA B 123 -32.005 93.312 -2.661 1.00 0.00 H ATOM 6963 HB3 ALA B 123 -30.456 93.121 -1.804 1.00 0.00 H ATOM 6964 H ALA B 123 -32.865 91.072 -3.585 1.00 0.00 H ATOM 6965 N THR B 124 -33.508 92.316 -0.394 1.00 52.23 N ATOM 6966 CA THR B 124 -34.133 92.706 0.895 1.00 51.92 C ATOM 6967 C THR B 124 -34.411 91.500 1.777 1.00 49.62 C ATOM 6968 O THR B 124 -34.204 91.554 2.970 1.00 49.09 O ATOM 6969 CB THR B 124 -35.458 93.531 0.730 1.00 52.30 C ATOM 6970 OG1 THR B 124 -35.291 94.479 -0.319 1.00 55.61 O ATOM 6971 CG2 THR B 124 -35.757 94.314 1.974 1.00 50.78 C ATOM 6972 HA THR B 124 -33.396 93.351 1.373 1.00 0.00 H ATOM 6973 HB THR B 124 -36.265 92.829 0.521 1.00 0.00 H ATOM 6974 HG1 THR B 124 -35.088 94.003 -1.163 1.00 0.00 H ATOM 6975 HG23 THR B 124 -35.894 93.628 2.810 1.00 0.00 H ATOM 6976 HG21 THR B 124 -34.926 94.987 2.187 1.00 0.00 H ATOM 6977 HG22 THR B 124 -36.668 94.895 1.826 1.00 0.00 H ATOM 6978 H THR B 124 -34.018 92.479 -1.286 1.00 0.00 H ATOM 6979 N ASP B 125 -34.888 90.419 1.190 1.00 47.68 N ATOM 6980 CA ASP B 125 -35.186 89.229 1.980 1.00 46.23 C ATOM 6981 C ASP B 125 -33.944 88.555 2.548 1.00 43.31 C ATOM 6982 O ASP B 125 -33.978 88.100 3.685 1.00 42.15 O ATOM 6983 CB ASP B 125 -35.965 88.227 1.151 1.00 47.03 C ATOM 6984 CG ASP B 125 -37.308 88.763 0.694 1.00 50.08 C ATOM 6985 OD1 ASP B 125 -37.753 88.244 -0.345 1.00 53.77 O ATOM 6986 OD2 ASP B 125 -37.914 89.669 1.345 1.00 51.48 O ATOM 6987 HA ASP B 125 -35.784 89.569 2.825 1.00 0.00 H ATOM 6988 HB2 ASP B 125 -35.375 87.968 0.272 1.00 0.00 H ATOM 6989 HB3 ASP B 125 -36.132 87.333 1.751 1.00 0.00 H ATOM 6990 H ASP B 125 -35.052 90.415 0.163 1.00 0.00 H ATOM 6991 N VAL B 126 -32.860 88.503 1.766 1.00 41.06 N ATOM 6992 CA VAL B 126 -31.568 88.056 2.286 1.00 39.36 C ATOM 6993 C VAL B 126 -31.140 88.894 3.474 1.00 39.74 C ATOM 6994 O VAL B 126 -30.764 88.358 4.537 1.00 39.59 O ATOM 6995 CB VAL B 126 -30.447 88.142 1.271 1.00 38.73 C ATOM 6996 CG1 VAL B 126 -29.151 87.818 1.946 1.00 35.37 C ATOM 6997 CG2 VAL B 126 -30.702 87.197 0.082 1.00 38.00 C ATOM 6998 HA VAL B 126 -31.727 87.013 2.561 1.00 0.00 H ATOM 6999 HB VAL B 126 -30.402 89.155 0.872 1.00 0.00 H ATOM 7000 HG11 VAL B 126 -28.974 88.531 2.751 1.00 0.00 H ATOM 7001 HG12 VAL B 126 -29.199 86.809 2.357 1.00 0.00 H ATOM 7002 HG13 VAL B 126 -28.340 87.878 1.220 1.00 0.00 H ATOM 7003 HG21 VAL B 126 -30.768 86.171 0.443 1.00 0.00 H ATOM 7004 HG22 VAL B 126 -31.637 87.473 -0.406 1.00 0.00 H ATOM 7005 HG23 VAL B 126 -29.881 87.281 -0.630 1.00 0.00 H ATOM 7006 H VAL B 126 -32.937 88.786 0.768 1.00 0.00 H ATOM 7007 N CYS B 127 -31.204 90.206 3.293 1.00 39.96 N ATOM 7008 CA CYS B 127 -30.908 91.152 4.353 1.00 40.49 C ATOM 7009 C CYS B 127 -31.689 90.897 5.619 1.00 40.16 C ATOM 7010 O CYS B 127 -31.103 90.859 6.701 1.00 39.60 O ATOM 7011 CB CYS B 127 -31.215 92.569 3.893 1.00 41.45 C ATOM 7012 SG CYS B 127 -29.883 93.245 2.906 1.00 42.84 S ATOM 7013 HA CYS B 127 -29.849 91.025 4.576 1.00 0.00 H ATOM 7014 HB2 CYS B 127 -31.363 93.201 4.769 1.00 0.00 H ATOM 7015 HB3 CYS B 127 -32.127 92.558 3.296 1.00 0.00 H ATOM 7016 HG CYS B 127 -29.693 92.456 1.790 1.00 0.00 H ATOM 7017 H CYS B 127 -31.476 90.570 2.358 1.00 0.00 H ATOM 7018 N GLN B 128 -33.001 90.764 5.492 1.00 39.64 N ATOM 7019 CA GLN B 128 -33.853 90.542 6.656 1.00 40.67 C ATOM 7020 C GLN B 128 -33.518 89.238 7.306 1.00 38.72 C ATOM 7021 O GLN B 128 -33.507 89.127 8.517 1.00 38.34 O ATOM 7022 CB GLN B 128 -35.346 90.531 6.289 1.00 40.89 C ATOM 7023 CG GLN B 128 -35.830 91.915 5.868 1.00 43.47 C ATOM 7024 CD GLN B 128 -37.351 92.028 5.619 1.00 44.72 C ATOM 7025 OE1 GLN B 128 -38.078 91.018 5.424 1.00 45.88 O ATOM 7026 NE2 GLN B 128 -37.829 93.284 5.592 1.00 45.68 N ATOM 7027 HA GLN B 128 -33.667 91.370 7.341 1.00 0.00 H ATOM 7028 HB2 GLN B 128 -35.503 89.835 5.465 1.00 0.00 H ATOM 7029 HB3 GLN B 128 -35.921 90.203 7.155 1.00 0.00 H ATOM 7030 HG2 GLN B 128 -35.563 92.621 6.655 1.00 0.00 H ATOM 7031 HG3 GLN B 128 -35.315 92.188 4.947 1.00 0.00 H ATOM 7032 HE22 GLN B 128 -37.190 94.087 5.759 1.00 0.00 H ATOM 7033 HE21 GLN B 128 -38.838 93.452 5.404 1.00 0.00 H ATOM 7034 H GLN B 128 -33.431 90.819 4.547 1.00 0.00 H ATOM 7035 N PHE B 129 -33.248 88.243 6.474 1.00 37.87 N ATOM 7036 CA PHE B 129 -32.905 86.925 6.972 1.00 36.35 C ATOM 7037 C PHE B 129 -31.563 86.921 7.727 1.00 35.96 C ATOM 7038 O PHE B 129 -31.445 86.292 8.786 1.00 35.08 O ATOM 7039 CB PHE B 129 -32.845 85.925 5.859 1.00 35.13 C ATOM 7040 CG PHE B 129 -32.346 84.623 6.301 1.00 33.46 C ATOM 7041 CD1 PHE B 129 -33.146 83.810 7.065 1.00 34.08 C ATOM 7042 CD2 PHE B 129 -31.063 84.217 6.006 1.00 33.15 C ATOM 7043 CE1 PHE B 129 -32.684 82.578 7.515 1.00 34.98 C ATOM 7044 CE2 PHE B 129 -30.586 82.965 6.437 1.00 33.47 C ATOM 7045 CZ PHE B 129 -31.390 82.154 7.198 1.00 33.36 C ATOM 7046 HA PHE B 129 -33.695 86.646 7.670 1.00 0.00 H ATOM 7047 HB2 PHE B 129 -33.847 85.795 5.451 1.00 0.00 H ATOM 7048 HB3 PHE B 129 -32.184 86.307 5.081 1.00 0.00 H ATOM 7049 HD2 PHE B 129 -30.409 84.873 5.432 1.00 0.00 H ATOM 7050 HE2 PHE B 129 -29.581 82.640 6.167 1.00 0.00 H ATOM 7051 HZ PHE B 129 -31.024 81.190 7.551 1.00 0.00 H ATOM 7052 HE1 PHE B 129 -33.333 81.941 8.117 1.00 0.00 H ATOM 7053 HD1 PHE B 129 -34.155 84.134 7.322 1.00 0.00 H ATOM 7054 H PHE B 129 -33.283 88.410 5.448 1.00 0.00 H ATOM 7055 N LEU B 130 -30.568 87.624 7.197 1.00 35.60 N ATOM 7056 CA LEU B 130 -29.285 87.681 7.881 1.00 35.86 C ATOM 7057 C LEU B 130 -29.391 88.426 9.207 1.00 36.78 C ATOM 7058 O LEU B 130 -28.669 88.136 10.155 1.00 37.52 O ATOM 7059 CB LEU B 130 -28.213 88.227 6.965 1.00 35.45 C ATOM 7060 CG LEU B 130 -27.952 87.259 5.800 1.00 34.76 C ATOM 7061 CD1 LEU B 130 -26.921 87.840 4.837 1.00 36.58 C ATOM 7062 CD2 LEU B 130 -27.511 85.870 6.309 1.00 31.67 C ATOM 7063 HA LEU B 130 -28.982 86.666 8.139 1.00 0.00 H ATOM 7064 HB2 LEU B 130 -28.537 89.188 6.567 1.00 0.00 H ATOM 7065 HB3 LEU B 130 -27.292 88.362 7.532 1.00 0.00 H ATOM 7066 HG LEU B 130 -28.889 87.128 5.259 1.00 0.00 H ATOM 7067 HD21 LEU B 130 -26.593 85.971 6.888 1.00 0.00 H ATOM 7068 HD22 LEU B 130 -28.295 85.450 6.939 1.00 0.00 H ATOM 7069 HD23 LEU B 130 -27.335 85.212 5.458 1.00 0.00 H ATOM 7070 HD11 LEU B 130 -27.291 88.783 4.436 1.00 0.00 H ATOM 7071 HD12 LEU B 130 -25.985 88.012 5.369 1.00 0.00 H ATOM 7072 HD13 LEU B 130 -26.752 87.138 4.021 1.00 0.00 H ATOM 7073 H LEU B 130 -30.705 88.130 6.299 1.00 0.00 H ATOM 7074 N GLU B 131 -30.373 89.293 9.302 1.00 38.09 N ATOM 7075 CA GLU B 131 -30.646 90.050 10.508 1.00 40.34 C ATOM 7076 C GLU B 131 -31.227 89.166 11.589 1.00 38.88 C ATOM 7077 O GLU B 131 -30.946 89.354 12.754 1.00 39.08 O ATOM 7078 CB GLU B 131 -31.646 91.166 10.174 1.00 41.46 C ATOM 7079 CG GLU B 131 -31.698 92.360 11.129 1.00 44.43 C ATOM 7080 CD GLU B 131 -32.026 93.702 10.401 1.00 46.93 C ATOM 7081 OE1 GLU B 131 -32.534 93.690 9.221 1.00 51.03 O ATOM 7082 OE2 GLU B 131 -31.747 94.769 11.025 1.00 55.07 O ATOM 7083 HA GLU B 131 -29.710 90.469 10.878 1.00 0.00 H ATOM 7084 HB2 GLU B 131 -31.396 91.547 9.184 1.00 0.00 H ATOM 7085 HB3 GLU B 131 -32.640 90.720 10.150 1.00 0.00 H ATOM 7086 HG2 GLU B 131 -32.466 92.173 11.879 1.00 0.00 H ATOM 7087 HG3 GLU B 131 -30.729 92.457 11.619 1.00 0.00 H ATOM 7088 H GLU B 131 -30.983 89.444 8.473 1.00 0.00 H ATOM 7089 N LEU B 132 -32.070 88.222 11.196 1.00 38.39 N ATOM 7090 CA LEU B 132 -32.611 87.234 12.123 1.00 37.44 C ATOM 7091 C LEU B 132 -31.521 86.304 12.645 1.00 36.87 C ATOM 7092 O LEU B 132 -31.650 85.735 13.721 1.00 37.71 O ATOM 7093 CB LEU B 132 -33.671 86.382 11.416 1.00 37.12 C ATOM 7094 CG LEU B 132 -34.995 87.060 11.123 1.00 37.32 C ATOM 7095 CD1 LEU B 132 -35.942 86.067 10.440 1.00 34.98 C ATOM 7096 CD2 LEU B 132 -35.579 87.590 12.415 1.00 35.70 C ATOM 7097 HA LEU B 132 -33.049 87.777 12.961 1.00 0.00 H ATOM 7098 HB2 LEU B 132 -33.251 86.050 10.467 1.00 0.00 H ATOM 7099 HB3 LEU B 132 -33.874 85.515 12.045 1.00 0.00 H ATOM 7100 HG LEU B 132 -34.848 87.900 10.445 1.00 0.00 H ATOM 7101 HD21 LEU B 132 -35.736 86.763 13.107 1.00 0.00 H ATOM 7102 HD22 LEU B 132 -34.889 88.309 12.856 1.00 0.00 H ATOM 7103 HD23 LEU B 132 -36.531 88.078 12.208 1.00 0.00 H ATOM 7104 HD11 LEU B 132 -35.496 85.725 9.506 1.00 0.00 H ATOM 7105 HD12 LEU B 132 -36.109 85.215 11.098 1.00 0.00 H ATOM 7106 HD13 LEU B 132 -36.892 86.558 10.231 1.00 0.00 H ATOM 7107 H LEU B 132 -32.355 88.184 10.196 1.00 0.00 H ATOM 7108 N CYS B 133 -30.480 86.112 11.845 1.00 35.87 N ATOM 7109 CA CYS B 133 -29.349 85.305 12.224 1.00 35.47 C ATOM 7110 C CYS B 133 -28.341 86.036 13.086 1.00 35.16 C ATOM 7111 O CYS B 133 -27.458 85.417 13.636 1.00 34.36 O ATOM 7112 CB CYS B 133 -28.604 84.845 10.965 1.00 35.73 C ATOM 7113 SG CYS B 133 -29.443 83.590 10.029 1.00 35.45 S ATOM 7114 HA CYS B 133 -29.758 84.475 12.799 1.00 0.00 H ATOM 7115 HB2 CYS B 133 -27.633 84.452 11.268 1.00 0.00 H ATOM 7116 HB3 CYS B 133 -28.459 85.711 10.320 1.00 0.00 H ATOM 7117 HG CYS B 133 -30.670 84.069 9.617 1.00 0.00 H ATOM 7118 H CYS B 133 -30.481 86.562 10.907 1.00 0.00 H ATOM 7119 N GLN B 134 -28.410 87.357 13.119 1.00 36.16 N ATOM 7120 CA GLN B 134 -27.431 88.150 13.821 1.00 36.51 C ATOM 7121 C GLN B 134 -27.731 87.966 15.267 1.00 37.14 C ATOM 7122 O GLN B 134 -28.899 87.959 15.638 1.00 37.24 O ATOM 7123 CB GLN B 134 -27.546 89.628 13.458 1.00 36.87 C ATOM 7124 CG GLN B 134 -26.503 90.515 14.176 1.00 36.89 C ATOM 7125 CD GLN B 134 -26.193 91.787 13.405 1.00 37.73 C ATOM 7126 OE1 GLN B 134 -25.033 92.236 13.292 1.00 36.06 O ATOM 7127 NE2 GLN B 134 -27.230 92.362 12.849 1.00 35.65 N ATOM 7128 HA GLN B 134 -26.420 87.838 13.560 1.00 0.00 H ATOM 7129 HB2 GLN B 134 -27.408 89.732 12.382 1.00 0.00 H ATOM 7130 HB3 GLN B 134 -28.543 89.975 13.730 1.00 0.00 H ATOM 7131 HG2 GLN B 134 -26.891 90.787 15.158 1.00 0.00 H ATOM 7132 HG3 GLN B 134 -25.582 89.945 14.296 1.00 0.00 H ATOM 7133 HE22 GLN B 134 -28.178 91.953 12.970 1.00 0.00 H ATOM 7134 HE21 GLN B 134 -27.105 93.228 12.287 1.00 0.00 H ATOM 7135 H GLN B 134 -29.190 87.836 12.626 1.00 0.00 H ATOM 7136 N SER B 135 -26.688 87.823 16.078 1.00 37.86 N ATOM 7137 CA SER B 135 -26.838 87.659 17.522 1.00 39.01 C ATOM 7138 C SER B 135 -26.782 88.993 18.248 1.00 40.38 C ATOM 7139 O SER B 135 -26.090 89.903 17.814 1.00 41.54 O ATOM 7140 CB SER B 135 -25.714 86.778 18.071 1.00 38.97 C ATOM 7141 OG SER B 135 -25.552 86.993 19.451 1.00 37.06 O ATOM 7142 HA SER B 135 -27.811 87.198 17.691 1.00 0.00 H ATOM 7143 HB2 SER B 135 -24.784 87.021 17.558 1.00 0.00 H ATOM 7144 HB3 SER B 135 -25.961 85.731 17.897 1.00 0.00 H ATOM 7145 HG SER B 135 -24.822 86.416 19.790 1.00 0.00 H ATOM 7146 H SER B 135 -25.731 87.828 15.670 1.00 0.00 H ATOM 7147 N PRO B 136 -27.437 89.095 19.406 1.00 41.46 N ATOM 7148 CA PRO B 136 -27.347 90.408 20.071 1.00 42.09 C ATOM 7149 C PRO B 136 -25.989 90.710 20.721 1.00 42.02 C ATOM 7150 O PRO B 136 -25.689 91.874 20.959 1.00 43.01 O ATOM 7151 CB PRO B 136 -28.452 90.375 21.138 1.00 42.31 C ATOM 7152 CG PRO B 136 -29.118 88.978 21.020 1.00 43.05 C ATOM 7153 CD PRO B 136 -28.213 88.108 20.184 1.00 41.77 C ATOM 7154 HA PRO B 136 -27.462 91.201 19.332 1.00 0.00 H ATOM 7155 HD3 PRO B 136 -27.560 87.502 20.812 1.00 0.00 H ATOM 7156 HD2 PRO B 136 -28.790 87.457 19.528 1.00 0.00 H ATOM 7157 HG3 PRO B 136 -30.092 89.070 20.540 1.00 0.00 H ATOM 7158 HG2 PRO B 136 -29.242 88.541 22.011 1.00 0.00 H ATOM 7159 HB2 PRO B 136 -28.024 90.508 22.132 1.00 0.00 H ATOM 7160 HB3 PRO B 136 -29.184 91.161 20.951 1.00 0.00 H ATOM 7161 N ASP B 137 -25.146 89.740 20.897 1.00 41.40 N ATOM 7162 CA ASP B 137 -23.886 90.043 21.473 1.00 41.92 C ATOM 7163 C ASP B 137 -22.814 90.140 20.412 1.00 40.92 C ATOM 7164 O ASP B 137 -21.658 90.283 20.712 1.00 41.84 O ATOM 7165 CB ASP B 137 -23.578 89.007 22.532 1.00 20.00 C ATOM 7166 CG ASP B 137 -24.547 89.067 23.667 1.00 20.00 C ATOM 7167 OD1 ASP B 137 -24.752 90.189 24.153 1.00 20.00 O ATOM 7168 OD2 ASP B 137 -25.119 88.029 24.045 1.00 20.00 O ATOM 7169 HA ASP B 137 -23.915 91.022 21.952 1.00 0.00 H ATOM 7170 HB2 ASP B 137 -23.625 88.016 22.080 1.00 0.00 H ATOM 7171 HB3 ASP B 137 -22.573 89.183 22.916 1.00 0.00 H ATOM 7172 H ASP B 137 -25.388 88.766 20.623 1.00 0.00 H ATOM 7173 N GLY B 138 -23.236 90.072 19.163 1.00 39.89 N ATOM 7174 CA GLY B 138 -22.363 90.218 17.996 1.00 39.25 C ATOM 7175 C GLY B 138 -22.171 88.927 17.209 1.00 38.57 C ATOM 7176 O GLY B 138 -22.356 87.825 17.742 1.00 38.05 O ATOM 7177 HA3 GLY B 138 -21.387 90.562 18.337 1.00 0.00 H ATOM 7178 HA2 GLY B 138 -22.798 90.965 17.332 1.00 0.00 H ATOM 7179 H GLY B 138 -24.249 89.905 18.998 1.00 0.00 H ATOM 7180 N GLY B 139 -21.782 89.066 15.941 1.00 37.22 N ATOM 7181 CA GLY B 139 -21.606 87.923 15.083 1.00 35.89 C ATOM 7182 C GLY B 139 -22.943 87.418 14.577 1.00 35.17 C ATOM 7183 O GLY B 139 -23.995 87.970 14.929 1.00 34.27 O ATOM 7184 HA3 GLY B 139 -21.112 87.129 15.643 1.00 0.00 H ATOM 7185 HA2 GLY B 139 -20.986 88.206 14.233 1.00 0.00 H ATOM 7186 H GLY B 139 -21.602 90.019 15.564 1.00 0.00 H ATOM 7187 N PHE B 140 -22.877 86.388 13.729 1.00 34.02 N ATOM 7188 CA PHE B 140 -24.059 85.729 13.199 1.00 34.17 C ATOM 7189 C PHE B 140 -23.990 84.233 13.478 1.00 33.49 C ATOM 7190 O PHE B 140 -22.920 83.637 13.394 1.00 34.09 O ATOM 7191 CB PHE B 140 -24.166 85.882 11.680 1.00 33.98 C ATOM 7192 CG PHE B 140 -24.303 87.299 11.209 1.00 35.00 C ATOM 7193 CD1 PHE B 140 -23.171 88.135 11.138 1.00 33.84 C ATOM 7194 CD2 PHE B 140 -25.540 87.781 10.790 1.00 32.72 C ATOM 7195 CE1 PHE B 140 -23.285 89.407 10.709 1.00 33.53 C ATOM 7196 CE2 PHE B 140 -25.658 89.056 10.344 1.00 33.96 C ATOM 7197 CZ PHE B 140 -24.523 89.890 10.316 1.00 35.61 C ATOM 7198 HA PHE B 140 -24.917 86.195 13.683 1.00 0.00 H ATOM 7199 HB2 PHE B 140 -23.268 85.458 11.230 1.00 0.00 H ATOM 7200 HB3 PHE B 140 -25.039 85.324 11.341 1.00 0.00 H ATOM 7201 HD2 PHE B 140 -26.415 87.132 10.821 1.00 0.00 H ATOM 7202 HE2 PHE B 140 -26.624 89.433 10.009 1.00 0.00 H ATOM 7203 HZ PHE B 140 -24.619 90.923 9.983 1.00 0.00 H ATOM 7204 HE1 PHE B 140 -22.408 90.053 10.671 1.00 0.00 H ATOM 7205 HD1 PHE B 140 -22.195 87.749 11.433 1.00 0.00 H ATOM 7206 H PHE B 140 -21.941 86.043 13.436 1.00 0.00 H ATOM 7207 N GLY B 141 -25.140 83.632 13.744 1.00 32.17 N ATOM 7208 CA GLY B 141 -25.245 82.189 13.809 1.00 32.28 C ATOM 7209 C GLY B 141 -25.644 81.510 12.511 1.00 31.89 C ATOM 7210 O GLY B 141 -25.903 82.156 11.502 1.00 32.46 O ATOM 7211 HA3 GLY B 141 -25.991 81.939 14.564 1.00 0.00 H ATOM 7212 HA2 GLY B 141 -24.276 81.794 14.112 1.00 0.00 H ATOM 7213 H GLY B 141 -25.988 84.210 13.910 1.00 0.00 H ATOM 7214 N GLY B 142 -25.728 80.190 12.560 1.00 31.68 N ATOM 7215 CA GLY B 142 -26.023 79.365 11.383 1.00 31.76 C ATOM 7216 C GLY B 142 -27.449 79.425 10.879 1.00 31.78 C ATOM 7217 O GLY B 142 -27.748 78.893 9.809 1.00 32.09 O ATOM 7218 HA3 GLY B 142 -25.801 78.328 11.636 1.00 0.00 H ATOM 7219 HA2 GLY B 142 -25.368 79.689 10.574 1.00 0.00 H ATOM 7220 H GLY B 142 -25.578 79.716 13.474 1.00 0.00 H ATOM 7221 N GLY B 143 -28.306 80.057 11.675 1.00 31.42 N ATOM 7222 CA GLY B 143 -29.688 80.287 11.376 1.00 31.98 C ATOM 7223 C GLY B 143 -30.332 81.140 12.473 1.00 32.52 C ATOM 7224 O GLY B 143 -29.693 81.494 13.468 1.00 31.70 O ATOM 7225 HA3 GLY B 143 -30.207 79.331 11.312 1.00 0.00 H ATOM 7226 HA2 GLY B 143 -29.768 80.807 10.421 1.00 0.00 H ATOM 7227 H GLY B 143 -27.946 80.411 12.584 1.00 0.00 H ATOM 7228 N PRO B 144 -31.618 81.465 12.311 1.00 33.04 N ATOM 7229 CA PRO B 144 -32.282 82.320 13.313 1.00 33.83 C ATOM 7230 C PRO B 144 -32.310 81.698 14.711 1.00 33.91 C ATOM 7231 O PRO B 144 -32.807 80.608 14.890 1.00 34.10 O ATOM 7232 CB PRO B 144 -33.698 82.480 12.762 1.00 33.94 C ATOM 7233 CG PRO B 144 -33.605 82.087 11.288 1.00 33.69 C ATOM 7234 CD PRO B 144 -32.529 81.043 11.237 1.00 33.04 C ATOM 7235 HA PRO B 144 -31.752 83.263 13.448 1.00 0.00 H ATOM 7236 HD3 PRO B 144 -32.934 80.050 11.432 1.00 0.00 H ATOM 7237 HD2 PRO B 144 -32.025 81.044 10.270 1.00 0.00 H ATOM 7238 HG3 PRO B 144 -33.334 82.948 10.677 1.00 0.00 H ATOM 7239 HG2 PRO B 144 -34.553 81.679 10.938 1.00 0.00 H ATOM 7240 HB2 PRO B 144 -34.390 81.823 13.290 1.00 0.00 H ATOM 7241 HB3 PRO B 144 -34.032 83.513 12.862 1.00 0.00 H ATOM 7242 N GLY B 145 -31.707 82.367 15.683 1.00 34.54 N ATOM 7243 CA GLY B 145 -31.734 81.897 17.083 1.00 34.23 C ATOM 7244 C GLY B 145 -30.625 80.954 17.505 1.00 33.93 C ATOM 7245 O GLY B 145 -30.653 80.436 18.641 1.00 33.62 O ATOM 7246 HA3 GLY B 145 -32.683 81.384 17.241 1.00 0.00 H ATOM 7247 HA2 GLY B 145 -31.685 82.775 17.728 1.00 0.00 H ATOM 7248 H GLY B 145 -31.201 83.246 15.454 1.00 0.00 H ATOM 7249 N GLN B 146 -29.691 80.692 16.585 1.00 33.03 N ATOM 7250 CA GLN B 146 -28.569 79.814 16.830 1.00 32.39 C ATOM 7251 C GLN B 146 -27.491 80.711 17.391 1.00 32.87 C ATOM 7252 O GLN B 146 -27.476 81.869 17.082 1.00 32.79 O ATOM 7253 CB GLN B 146 -28.093 79.159 15.535 1.00 31.99 C ATOM 7254 CG GLN B 146 -29.020 78.093 15.015 1.00 31.70 C ATOM 7255 CD GLN B 146 -28.537 77.464 13.728 1.00 31.17 C ATOM 7256 OE1 GLN B 146 -27.382 77.044 13.631 1.00 29.26 O ATOM 7257 NE2 GLN B 146 -29.425 77.373 12.737 1.00 25.88 N ATOM 7258 HA GLN B 146 -28.831 79.002 17.509 1.00 0.00 H ATOM 7259 HB2 GLN B 146 -27.998 79.933 14.773 1.00 0.00 H ATOM 7260 HB3 GLN B 146 -27.118 78.708 15.717 1.00 0.00 H ATOM 7261 HG2 GLN B 146 -29.110 77.313 15.771 1.00 0.00 H ATOM 7262 HG3 GLN B 146 -29.998 78.540 14.837 1.00 0.00 H ATOM 7263 HE22 GLN B 146 -30.389 77.742 12.867 1.00 0.00 H ATOM 7264 HE21 GLN B 146 -29.154 76.933 11.835 1.00 0.00 H ATOM 7265 H GLN B 146 -29.775 81.140 15.650 1.00 0.00 H ATOM 7266 N TYR B 147 -26.606 80.196 18.234 1.00 32.83 N ATOM 7267 CA TYR B 147 -25.541 81.010 18.757 1.00 33.34 C ATOM 7268 C TYR B 147 -24.620 81.445 17.618 1.00 33.35 C ATOM 7269 O TYR B 147 -24.515 80.771 16.598 1.00 33.00 O ATOM 7270 CB TYR B 147 -24.721 80.237 19.771 1.00 33.69 C ATOM 7271 CG TYR B 147 -25.464 79.801 20.982 1.00 34.69 C ATOM 7272 CD1 TYR B 147 -25.084 78.687 21.664 1.00 34.82 C ATOM 7273 CD2 TYR B 147 -26.569 80.497 21.451 1.00 38.43 C ATOM 7274 CE1 TYR B 147 -25.746 78.286 22.790 1.00 36.20 C ATOM 7275 CE2 TYR B 147 -27.244 80.093 22.585 1.00 36.98 C ATOM 7276 CZ TYR B 147 -26.820 78.996 23.244 1.00 35.65 C ATOM 7277 OH TYR B 147 -27.473 78.584 24.366 1.00 37.06 O ATOM 7278 HA TYR B 147 -25.985 81.880 19.241 1.00 0.00 H ATOM 7279 HB3 TYR B 147 -23.895 80.871 20.092 1.00 0.00 H ATOM 7280 HB2 TYR B 147 -24.325 79.348 19.279 1.00 0.00 H ATOM 7281 HD2 TYR B 147 -26.911 81.381 20.913 1.00 0.00 H ATOM 7282 HE2 TYR B 147 -28.108 80.653 22.943 1.00 0.00 H ATOM 7283 HE1 TYR B 147 -25.416 77.397 23.327 1.00 0.00 H ATOM 7284 HD1 TYR B 147 -24.236 78.104 21.306 1.00 0.00 H ATOM 7285 HH TYR B 147 -27.035 77.771 24.721 1.00 0.00 H ATOM 7286 H TYR B 147 -26.682 79.199 18.518 1.00 0.00 H ATOM 7287 N PRO B 148 -23.924 82.563 17.803 1.00 33.24 N ATOM 7288 CA PRO B 148 -23.000 83.027 16.767 1.00 32.99 C ATOM 7289 C PRO B 148 -21.739 82.186 16.652 1.00 32.84 C ATOM 7290 O PRO B 148 -21.323 81.554 17.609 1.00 34.06 O ATOM 7291 CB PRO B 148 -22.661 84.429 17.227 1.00 33.32 C ATOM 7292 CG PRO B 148 -22.840 84.364 18.732 1.00 33.45 C ATOM 7293 CD PRO B 148 -23.971 83.459 18.972 1.00 32.92 C ATOM 7294 HA PRO B 148 -23.448 82.968 15.775 1.00 0.00 H ATOM 7295 HD3 PRO B 148 -23.839 82.902 19.900 1.00 0.00 H ATOM 7296 HD2 PRO B 148 -24.912 84.007 19.010 1.00 0.00 H ATOM 7297 HG3 PRO B 148 -23.058 85.355 19.130 1.00 0.00 H ATOM 7298 HG2 PRO B 148 -21.938 83.975 19.204 1.00 0.00 H ATOM 7299 HB2 PRO B 148 -21.634 84.686 16.968 1.00 0.00 H ATOM 7300 HB3 PRO B 148 -23.340 85.159 16.785 1.00 0.00 H ATOM 7301 N HIS B 149 -21.126 82.208 15.482 1.00 32.09 N ATOM 7302 CA HIS B 149 -19.994 81.375 15.190 1.00 31.89 C ATOM 7303 C HIS B 149 -19.282 82.107 14.045 1.00 32.00 C ATOM 7304 O HIS B 149 -19.945 82.764 13.238 1.00 32.01 O ATOM 7305 CB HIS B 149 -20.539 80.007 14.793 1.00 31.29 C ATOM 7306 CG HIS B 149 -19.500 78.976 14.452 1.00 31.31 C ATOM 7307 ND1 HIS B 149 -18.669 79.080 13.357 1.00 29.13 N ATOM 7308 CD2 HIS B 149 -19.214 77.777 15.030 1.00 28.81 C ATOM 7309 CE1 HIS B 149 -17.905 78.000 13.290 1.00 29.04 C ATOM 7310 NE2 HIS B 149 -18.222 77.191 14.287 1.00 25.31 N ATOM 7311 HA HIS B 149 -19.297 81.211 16.011 1.00 0.00 H ATOM 7312 HB2 HIS B 149 -21.132 79.626 15.625 1.00 0.00 H ATOM 7313 HB3 HIS B 149 -21.181 80.140 13.922 1.00 0.00 H ATOM 7314 HD2 HIS B 149 -19.687 77.360 15.919 1.00 0.00 H ATOM 7315 HE1 HIS B 149 -17.141 77.809 12.537 1.00 0.00 H ATOM 7316 H HIS B 149 -21.477 82.853 14.745 1.00 0.00 H ATOM 7317 N LEU B 150 -17.959 82.045 13.995 1.00 31.52 N ATOM 7318 CA LEU B 150 -17.200 82.856 13.048 1.00 31.93 C ATOM 7319 C LEU B 150 -17.358 82.483 11.566 1.00 31.67 C ATOM 7320 O LEU B 150 -17.205 83.353 10.701 1.00 32.53 O ATOM 7321 CB LEU B 150 -15.709 82.853 13.384 1.00 32.07 C ATOM 7322 CG LEU B 150 -15.249 84.015 14.280 1.00 32.82 C ATOM 7323 CD1 LEU B 150 -13.849 83.743 14.726 1.00 31.02 C ATOM 7324 CD2 LEU B 150 -15.340 85.411 13.598 1.00 29.51 C ATOM 7325 HA LEU B 150 -17.637 83.847 13.167 1.00 0.00 H ATOM 7326 HB2 LEU B 150 -15.478 81.918 13.895 1.00 0.00 H ATOM 7327 HB3 LEU B 150 -15.150 82.903 12.450 1.00 0.00 H ATOM 7328 HG LEU B 150 -15.930 84.063 15.130 1.00 0.00 H ATOM 7329 HD21 LEU B 150 -14.711 85.421 12.708 1.00 0.00 H ATOM 7330 HD22 LEU B 150 -16.374 85.610 13.316 1.00 0.00 H ATOM 7331 HD23 LEU B 150 -14.998 86.177 14.294 1.00 0.00 H ATOM 7332 HD11 LEU B 150 -13.822 82.808 15.285 1.00 0.00 H ATOM 7333 HD12 LEU B 150 -13.200 83.665 13.854 1.00 0.00 H ATOM 7334 HD13 LEU B 150 -13.507 84.559 15.363 1.00 0.00 H ATOM 7335 H LEU B 150 -17.453 81.407 14.642 1.00 0.00 H ATOM 7336 N ALA B 151 -17.618 81.220 11.256 1.00 30.36 N ATOM 7337 CA ALA B 151 -17.830 80.817 9.857 1.00 30.30 C ATOM 7338 C ALA B 151 -19.103 81.467 9.239 1.00 29.96 C ATOM 7339 O ALA B 151 -19.024 82.141 8.208 1.00 29.59 O ATOM 7340 CB ALA B 151 -17.847 79.254 9.700 1.00 29.51 C ATOM 7341 HA ALA B 151 -16.978 81.195 9.292 1.00 0.00 H ATOM 7342 HB1 ALA B 151 -16.893 78.846 10.035 1.00 0.00 H ATOM 7343 HB2 ALA B 151 -18.654 78.838 10.304 1.00 0.00 H ATOM 7344 HB3 ALA B 151 -18.006 78.997 8.653 1.00 0.00 H ATOM 7345 H ALA B 151 -17.673 80.506 12.010 1.00 0.00 H ATOM 7346 N PRO B 152 -20.275 81.259 9.860 1.00 29.24 N ATOM 7347 CA PRO B 152 -21.438 82.008 9.372 1.00 29.75 C ATOM 7348 C PRO B 152 -21.320 83.516 9.487 1.00 30.01 C ATOM 7349 O PRO B 152 -21.926 84.187 8.689 1.00 30.45 O ATOM 7350 CB PRO B 152 -22.614 81.466 10.209 1.00 29.69 C ATOM 7351 CG PRO B 152 -21.964 80.813 11.405 1.00 29.38 C ATOM 7352 CD PRO B 152 -20.614 80.332 10.939 1.00 28.22 C ATOM 7353 HA PRO B 152 -21.560 81.859 8.299 1.00 0.00 H ATOM 7354 HD3 PRO B 152 -19.881 80.386 11.744 1.00 0.00 H ATOM 7355 HD2 PRO B 152 -20.671 79.308 10.570 1.00 0.00 H ATOM 7356 HG3 PRO B 152 -22.566 79.973 11.751 1.00 0.00 H ATOM 7357 HG2 PRO B 152 -21.850 81.534 12.214 1.00 0.00 H ATOM 7358 HB2 PRO B 152 -23.269 82.278 10.523 1.00 0.00 H ATOM 7359 HB3 PRO B 152 -23.189 80.737 9.638 1.00 0.00 H ATOM 7360 N THR B 153 -20.585 84.043 10.462 1.00 30.49 N ATOM 7361 CA THR B 153 -20.284 85.483 10.518 1.00 31.06 C ATOM 7362 C THR B 153 -19.513 85.933 9.238 1.00 31.39 C ATOM 7363 O THR B 153 -19.815 86.942 8.619 1.00 30.58 O ATOM 7364 CB THR B 153 -19.458 85.826 11.805 1.00 31.46 C ATOM 7365 OG1 THR B 153 -20.246 85.599 12.994 1.00 31.60 O ATOM 7366 CG2 THR B 153 -18.990 87.279 11.806 1.00 31.02 C ATOM 7367 HA THR B 153 -21.228 86.027 10.561 1.00 0.00 H ATOM 7368 HB THR B 153 -18.587 85.171 11.802 1.00 0.00 H ATOM 7369 HG1 THR B 153 -20.518 84.648 13.032 1.00 0.00 H ATOM 7370 HG23 THR B 153 -18.393 87.468 10.914 1.00 0.00 H ATOM 7371 HG21 THR B 153 -19.858 87.939 11.810 1.00 0.00 H ATOM 7372 HG22 THR B 153 -18.387 87.464 12.695 1.00 0.00 H ATOM 7373 H THR B 153 -20.212 83.420 11.206 1.00 0.00 H ATOM 7374 N TYR B 154 -18.521 85.162 8.839 1.00 31.54 N ATOM 7375 CA TYR B 154 -17.804 85.454 7.611 1.00 32.46 C ATOM 7376 C TYR B 154 -18.695 85.399 6.368 1.00 32.62 C ATOM 7377 O TYR B 154 -18.577 86.241 5.448 1.00 33.34 O ATOM 7378 CB TYR B 154 -16.659 84.461 7.447 1.00 32.71 C ATOM 7379 CG TYR B 154 -16.108 84.338 6.050 1.00 33.44 C ATOM 7380 CD1 TYR B 154 -15.082 85.169 5.608 1.00 33.49 C ATOM 7381 CD2 TYR B 154 -16.581 83.360 5.181 1.00 33.92 C ATOM 7382 CE1 TYR B 154 -14.550 85.042 4.317 1.00 33.77 C ATOM 7383 CE2 TYR B 154 -16.036 83.219 3.882 1.00 33.47 C ATOM 7384 CZ TYR B 154 -15.028 84.061 3.463 1.00 33.27 C ATOM 7385 OH TYR B 154 -14.523 83.945 2.181 1.00 33.48 O ATOM 7386 HA TYR B 154 -17.431 86.475 7.696 1.00 0.00 H ATOM 7387 HB3 TYR B 154 -17.018 83.479 7.755 1.00 0.00 H ATOM 7388 HB2 TYR B 154 -15.846 84.772 8.104 1.00 0.00 H ATOM 7389 HD2 TYR B 154 -17.381 82.694 5.504 1.00 0.00 H ATOM 7390 HE2 TYR B 154 -16.413 82.445 3.213 1.00 0.00 H ATOM 7391 HE1 TYR B 154 -13.760 85.715 3.985 1.00 0.00 H ATOM 7392 HD1 TYR B 154 -14.685 85.932 6.278 1.00 0.00 H ATOM 7393 HH TYR B 154 -14.147 83.038 2.057 1.00 0.00 H ATOM 7394 H TYR B 154 -18.249 84.336 9.410 1.00 0.00 H ATOM 7395 N ALA B 155 -19.551 84.387 6.331 1.00 32.57 N ATOM 7396 CA ALA B 155 -20.429 84.141 5.190 1.00 32.31 C ATOM 7397 C ALA B 155 -21.413 85.263 5.063 1.00 32.99 C ATOM 7398 O ALA B 155 -21.609 85.756 3.971 1.00 33.86 O ATOM 7399 CB ALA B 155 -21.168 82.839 5.353 1.00 31.50 C ATOM 7400 HA ALA B 155 -19.817 84.082 4.290 1.00 0.00 H ATOM 7401 HB1 ALA B 155 -20.450 82.022 5.427 1.00 0.00 H ATOM 7402 HB2 ALA B 155 -21.772 82.877 6.260 1.00 0.00 H ATOM 7403 HB3 ALA B 155 -21.815 82.679 4.490 1.00 0.00 H ATOM 7404 H ALA B 155 -19.599 83.743 7.146 1.00 0.00 H ATOM 7405 N ALA B 156 -22.024 85.656 6.187 1.00 33.43 N ATOM 7406 CA ALA B 156 -23.087 86.646 6.222 1.00 33.68 C ATOM 7407 C ALA B 156 -22.501 87.968 5.760 1.00 34.48 C ATOM 7408 O ALA B 156 -23.025 88.592 4.848 1.00 35.58 O ATOM 7409 CB ALA B 156 -23.662 86.765 7.629 1.00 33.20 C ATOM 7410 HA ALA B 156 -23.905 86.350 5.565 1.00 0.00 H ATOM 7411 HB1 ALA B 156 -24.066 85.801 7.938 1.00 0.00 H ATOM 7412 HB2 ALA B 156 -22.873 87.068 8.318 1.00 0.00 H ATOM 7413 HB3 ALA B 156 -24.456 87.511 7.634 1.00 0.00 H ATOM 7414 H ALA B 156 -21.721 85.229 7.086 1.00 0.00 H ATOM 7415 N VAL B 157 -21.389 88.369 6.359 1.00 34.60 N ATOM 7416 CA VAL B 157 -20.706 89.575 5.962 1.00 34.83 C ATOM 7417 C VAL B 157 -20.370 89.542 4.490 1.00 34.78 C ATOM 7418 O VAL B 157 -20.611 90.526 3.808 1.00 34.80 O ATOM 7419 CB VAL B 157 -19.408 89.822 6.791 1.00 35.67 C ATOM 7420 CG1 VAL B 157 -18.506 90.865 6.096 1.00 34.56 C ATOM 7421 CG2 VAL B 157 -19.760 90.244 8.237 1.00 34.21 C ATOM 7422 HA VAL B 157 -21.391 90.400 6.160 1.00 0.00 H ATOM 7423 HB VAL B 157 -18.847 88.889 6.846 1.00 0.00 H ATOM 7424 HG11 VAL B 157 -18.229 90.502 5.106 1.00 0.00 H ATOM 7425 HG12 VAL B 157 -19.048 91.806 6.000 1.00 0.00 H ATOM 7426 HG13 VAL B 157 -17.607 91.021 6.692 1.00 0.00 H ATOM 7427 HG21 VAL B 157 -20.346 91.163 8.214 1.00 0.00 H ATOM 7428 HG22 VAL B 157 -20.340 89.454 8.714 1.00 0.00 H ATOM 7429 HG23 VAL B 157 -18.841 90.412 8.799 1.00 0.00 H ATOM 7430 H VAL B 157 -20.999 87.799 7.136 1.00 0.00 H ATOM 7431 N ASN B 158 -19.850 88.435 3.973 1.00 34.35 N ATOM 7432 CA ASN B 158 -19.581 88.386 2.525 1.00 34.82 C ATOM 7433 C ASN B 158 -20.847 88.514 1.664 1.00 34.98 C ATOM 7434 O ASN B 158 -20.888 89.242 0.650 1.00 34.76 O ATOM 7435 CB ASN B 158 -18.847 87.114 2.138 1.00 34.90 C ATOM 7436 CG ASN B 158 -17.355 87.282 2.159 1.00 35.51 C ATOM 7437 OD1 ASN B 158 -16.836 88.203 2.771 1.00 37.02 O ATOM 7438 ND2 ASN B 158 -16.651 86.388 1.488 1.00 35.22 N ATOM 7439 HA ASN B 158 -18.952 89.253 2.324 1.00 0.00 H ATOM 7440 HB2 ASN B 158 -19.120 86.325 2.839 1.00 0.00 H ATOM 7441 HB3 ASN B 158 -19.153 86.826 1.132 1.00 0.00 H ATOM 7442 HD22 ASN B 158 -17.135 85.620 0.981 1.00 0.00 H ATOM 7443 HD21 ASN B 158 -15.613 86.453 1.467 1.00 0.00 H ATOM 7444 H ASN B 158 -19.636 87.617 4.579 1.00 0.00 H ATOM 7445 N ALA B 159 -21.881 87.818 2.084 1.00 34.49 N ATOM 7446 CA ALA B 159 -23.124 87.857 1.368 1.00 35.15 C ATOM 7447 C ALA B 159 -23.660 89.312 1.342 1.00 36.15 C ATOM 7448 O ALA B 159 -24.178 89.779 0.304 1.00 35.12 O ATOM 7449 CB ALA B 159 -24.132 86.880 1.993 1.00 33.93 C ATOM 7450 HA ALA B 159 -22.967 87.538 0.338 1.00 0.00 H ATOM 7451 HB1 ALA B 159 -23.729 85.868 1.951 1.00 0.00 H ATOM 7452 HB2 ALA B 159 -24.311 87.159 3.031 1.00 0.00 H ATOM 7453 HB3 ALA B 159 -25.069 86.922 1.438 1.00 0.00 H ATOM 7454 H ALA B 159 -21.797 87.235 2.941 1.00 0.00 H ATOM 7455 N LEU B 160 -23.502 90.019 2.472 1.00 36.93 N ATOM 7456 CA LEU B 160 -24.060 91.364 2.617 1.00 37.90 C ATOM 7457 C LEU B 160 -23.303 92.351 1.684 1.00 39.01 C ATOM 7458 O LEU B 160 -23.897 93.213 1.054 1.00 39.05 O ATOM 7459 CB LEU B 160 -24.045 91.809 4.079 1.00 37.43 C ATOM 7460 CG LEU B 160 -25.147 91.339 5.060 1.00 37.24 C ATOM 7461 CD1 LEU B 160 -24.945 91.829 6.522 1.00 33.63 C ATOM 7462 CD2 LEU B 160 -26.554 91.737 4.593 1.00 37.17 C ATOM 7463 HA LEU B 160 -25.106 91.356 2.310 1.00 0.00 H ATOM 7464 HB2 LEU B 160 -23.094 91.477 4.496 1.00 0.00 H ATOM 7465 HB3 LEU B 160 -24.077 92.899 4.073 1.00 0.00 H ATOM 7466 HG LEU B 160 -25.054 90.253 5.057 1.00 0.00 H ATOM 7467 HD21 LEU B 160 -26.615 92.822 4.512 1.00 0.00 H ATOM 7468 HD22 LEU B 160 -26.754 91.287 3.621 1.00 0.00 H ATOM 7469 HD23 LEU B 160 -27.289 91.384 5.316 1.00 0.00 H ATOM 7470 HD11 LEU B 160 -23.995 91.454 6.902 1.00 0.00 H ATOM 7471 HD12 LEU B 160 -24.940 92.919 6.541 1.00 0.00 H ATOM 7472 HD13 LEU B 160 -25.759 91.457 7.144 1.00 0.00 H ATOM 7473 H LEU B 160 -22.971 89.601 3.263 1.00 0.00 H ATOM 7474 N CYS B 161 -21.998 92.163 1.551 1.00 39.31 N ATOM 7475 CA CYS B 161 -21.225 92.913 0.595 1.00 39.54 C ATOM 7476 C CYS B 161 -21.497 92.586 -0.854 1.00 39.94 C ATOM 7477 O CYS B 161 -21.207 93.422 -1.726 1.00 40.76 O ATOM 7478 CB CYS B 161 -19.755 92.657 0.832 1.00 39.47 C ATOM 7479 SG CYS B 161 -19.232 93.229 2.423 1.00 39.46 S ATOM 7480 HA CYS B 161 -21.518 93.951 0.754 1.00 0.00 H ATOM 7481 HB2 CYS B 161 -19.179 93.174 0.065 1.00 0.00 H ATOM 7482 HB3 CYS B 161 -19.568 91.585 0.764 1.00 0.00 H ATOM 7483 HG CYS B 161 -19.949 92.574 3.404 1.00 0.00 H ATOM 7484 H CYS B 161 -21.522 91.459 2.150 1.00 0.00 H ATOM 7485 N ILE B 162 -21.955 91.366 -1.142 1.00 39.35 N ATOM 7486 CA ILE B 162 -22.206 91.004 -2.516 1.00 38.69 C ATOM 7487 C ILE B 162 -23.412 91.818 -2.898 1.00 40.27 C ATOM 7488 O ILE B 162 -23.407 92.477 -3.922 1.00 40.04 O ATOM 7489 CB ILE B 162 -22.391 89.496 -2.718 1.00 38.64 C ATOM 7490 CG1 ILE B 162 -21.027 88.817 -2.564 1.00 37.90 C ATOM 7491 CG2 ILE B 162 -23.003 89.175 -4.115 1.00 34.32 C ATOM 7492 CD1 ILE B 162 -21.045 87.281 -2.745 1.00 36.92 C ATOM 7493 HA ILE B 162 -21.355 91.222 -3.161 1.00 0.00 H ATOM 7494 HB ILE B 162 -23.088 89.119 -1.970 1.00 0.00 H ATOM 7495 HG12 ILE B 162 -20.352 89.239 -3.308 1.00 0.00 H ATOM 7496 HG13 ILE B 162 -20.649 89.037 -1.566 1.00 0.00 H ATOM 7497 HD11 ILE B 162 -21.705 86.836 -2.000 1.00 0.00 H ATOM 7498 HD12 ILE B 162 -21.407 87.038 -3.744 1.00 0.00 H ATOM 7499 HD13 ILE B 162 -20.036 86.890 -2.618 1.00 0.00 H ATOM 7500 HG21 ILE B 162 -23.977 89.657 -4.203 1.00 0.00 H ATOM 7501 HG22 ILE B 162 -22.340 89.548 -4.895 1.00 0.00 H ATOM 7502 HG23 ILE B 162 -23.119 88.096 -4.220 1.00 0.00 H ATOM 7503 H ILE B 162 -22.130 90.680 -0.380 1.00 0.00 H ATOM 7504 N ILE B 163 -24.400 91.846 -2.011 1.00 42.27 N ATOM 7505 CA ILE B 163 -25.576 92.721 -2.161 1.00 44.21 C ATOM 7506 C ILE B 163 -25.196 94.205 -2.184 1.00 46.88 C ATOM 7507 O ILE B 163 -25.704 94.970 -3.008 1.00 47.86 O ATOM 7508 CB ILE B 163 -26.617 92.463 -1.065 1.00 43.90 C ATOM 7509 CG1 ILE B 163 -27.200 91.049 -1.231 1.00 43.22 C ATOM 7510 CG2 ILE B 163 -27.733 93.515 -1.127 1.00 43.89 C ATOM 7511 CD1 ILE B 163 -27.893 90.543 -0.001 1.00 42.29 C ATOM 7512 HA ILE B 163 -26.018 92.472 -3.126 1.00 0.00 H ATOM 7513 HB ILE B 163 -26.135 92.537 -0.090 1.00 0.00 H ATOM 7514 HG12 ILE B 163 -27.918 91.065 -2.051 1.00 0.00 H ATOM 7515 HG13 ILE B 163 -26.387 90.366 -1.475 1.00 0.00 H ATOM 7516 HD11 ILE B 163 -27.184 90.511 0.827 1.00 0.00 H ATOM 7517 HD12 ILE B 163 -28.717 91.210 0.251 1.00 0.00 H ATOM 7518 HD13 ILE B 163 -28.279 89.541 -0.189 1.00 0.00 H ATOM 7519 HG21 ILE B 163 -27.304 94.507 -0.983 1.00 0.00 H ATOM 7520 HG22 ILE B 163 -28.222 93.467 -2.100 1.00 0.00 H ATOM 7521 HG23 ILE B 163 -28.462 93.316 -0.342 1.00 0.00 H ATOM 7522 H ILE B 163 -24.341 91.226 -1.178 1.00 0.00 H ATOM 7523 N GLY B 164 -24.315 94.602 -1.272 1.00 49.56 N ATOM 7524 CA GLY B 164 -23.658 95.909 -1.303 1.00 51.53 C ATOM 7525 C GLY B 164 -24.534 97.132 -1.520 1.00 53.79 C ATOM 7526 O GLY B 164 -24.149 98.024 -2.273 1.00 54.26 O ATOM 7527 HA3 GLY B 164 -22.924 95.886 -2.108 1.00 0.00 H ATOM 7528 HA2 GLY B 164 -23.146 96.039 -0.350 1.00 0.00 H ATOM 7529 H GLY B 164 -24.080 93.950 -0.496 1.00 0.00 H ATOM 7530 N THR B 165 -25.706 97.156 -0.880 1.00 55.97 N ATOM 7531 CA THR B 165 -26.565 98.343 -0.799 1.00 57.92 C ATOM 7532 C THR B 165 -26.405 98.949 0.596 1.00 60.17 C ATOM 7533 O THR B 165 -25.706 98.395 1.445 1.00 60.21 O ATOM 7534 CB THR B 165 -28.070 97.989 -0.975 1.00 57.95 C ATOM 7535 OG1 THR B 165 -28.463 97.070 0.057 1.00 58.68 O ATOM 7536 CG2 THR B 165 -28.376 97.381 -2.359 1.00 55.35 C ATOM 7537 HA THR B 165 -26.269 99.027 -1.594 1.00 0.00 H ATOM 7538 HB THR B 165 -28.639 98.916 -0.899 1.00 0.00 H ATOM 7539 HG1 THR B 165 -29.420 96.843 -0.052 1.00 0.00 H ATOM 7540 HG23 THR B 165 -28.076 98.083 -3.137 1.00 0.00 H ATOM 7541 HG21 THR B 165 -27.823 96.449 -2.475 1.00 0.00 H ATOM 7542 HG22 THR B 165 -29.445 97.183 -2.439 1.00 0.00 H ATOM 7543 H THR B 165 -26.028 96.284 -0.413 1.00 0.00 H ATOM 7544 N GLU B 166 -27.066 100.077 0.845 1.00 62.49 N ATOM 7545 CA GLU B 166 -27.109 100.663 2.194 1.00 63.72 C ATOM 7546 C GLU B 166 -27.847 99.798 3.217 1.00 62.59 C ATOM 7547 O GLU B 166 -27.446 99.724 4.370 1.00 62.01 O ATOM 7548 CB GLU B 166 -27.793 102.013 2.139 1.00 65.29 C ATOM 7549 CG GLU B 166 -26.887 103.141 1.734 1.00 69.27 C ATOM 7550 CD GLU B 166 -26.181 103.762 2.923 1.00 74.66 C ATOM 7551 OE1 GLU B 166 -26.774 103.813 4.039 1.00 76.11 O ATOM 7552 OE2 GLU B 166 -25.022 104.203 2.729 1.00 78.82 O ATOM 7553 HA GLU B 166 -26.072 100.746 2.520 1.00 0.00 H ATOM 7554 HB2 GLU B 166 -28.610 101.954 1.420 1.00 0.00 H ATOM 7555 HB3 GLU B 166 -28.195 102.234 3.128 1.00 0.00 H ATOM 7556 HG2 GLU B 166 -26.138 102.759 1.041 1.00 0.00 H ATOM 7557 HG3 GLU B 166 -27.481 103.908 1.238 1.00 0.00 H ATOM 7558 H GLU B 166 -27.564 100.556 0.068 1.00 0.00 H ATOM 7559 N GLU B 167 -28.948 99.190 2.791 1.00 61.56 N ATOM 7560 CA GLU B 167 -29.736 98.311 3.639 1.00 60.99 C ATOM 7561 C GLU B 167 -28.814 97.210 4.198 1.00 59.47 C ATOM 7562 O GLU B 167 -28.766 96.951 5.400 1.00 58.44 O ATOM 7563 CB GLU B 167 -30.868 97.683 2.805 1.00 61.00 C ATOM 7564 CG GLU B 167 -32.040 97.156 3.609 1.00 61.64 C ATOM 7565 CD GLU B 167 -32.977 96.250 2.814 1.00 61.85 C ATOM 7566 OE1 GLU B 167 -32.890 96.173 1.573 1.00 60.46 O ATOM 7567 OE2 GLU B 167 -33.825 95.590 3.454 1.00 66.65 O ATOM 7568 HA GLU B 167 -30.175 98.871 4.464 1.00 0.00 H ATOM 7569 HB2 GLU B 167 -31.243 98.442 2.118 1.00 0.00 H ATOM 7570 HB3 GLU B 167 -30.448 96.854 2.235 1.00 0.00 H ATOM 7571 HG2 GLU B 167 -31.650 96.590 4.455 1.00 0.00 H ATOM 7572 HG3 GLU B 167 -32.614 98.006 3.977 1.00 0.00 H ATOM 7573 H GLU B 167 -29.259 99.349 1.811 1.00 0.00 H ATOM 7574 N ALA B 168 -28.050 96.610 3.285 1.00 58.11 N ATOM 7575 CA ALA B 168 -27.201 95.469 3.573 1.00 56.36 C ATOM 7576 C ALA B 168 -26.067 95.845 4.521 1.00 55.33 C ATOM 7577 O ALA B 168 -25.809 95.136 5.508 1.00 55.02 O ATOM 7578 CB ALA B 168 -26.654 94.861 2.263 1.00 55.48 C ATOM 7579 HA ALA B 168 -27.806 94.714 4.075 1.00 0.00 H ATOM 7580 HB1 ALA B 168 -27.487 94.536 1.639 1.00 0.00 H ATOM 7581 HB2 ALA B 168 -26.071 95.613 1.731 1.00 0.00 H ATOM 7582 HB3 ALA B 168 -26.019 94.006 2.498 1.00 0.00 H ATOM 7583 H ALA B 168 -28.063 96.980 2.313 1.00 0.00 H ATOM 7584 N TYR B 169 -25.393 96.953 4.231 1.00 54.59 N ATOM 7585 CA TYR B 169 -24.276 97.385 5.057 1.00 53.71 C ATOM 7586 C TYR B 169 -24.800 97.676 6.448 1.00 52.97 C ATOM 7587 O TYR B 169 -24.175 97.319 7.435 1.00 52.09 O ATOM 7588 CB TYR B 169 -23.555 98.615 4.489 1.00 53.90 C ATOM 7589 CG TYR B 169 -22.815 98.465 3.153 1.00 54.05 C ATOM 7590 CD1 TYR B 169 -22.706 99.554 2.268 1.00 55.53 C ATOM 7591 CD2 TYR B 169 -22.212 97.280 2.774 1.00 52.41 C ATOM 7592 CE1 TYR B 169 -22.030 99.450 1.044 1.00 53.78 C ATOM 7593 CE2 TYR B 169 -21.531 97.173 1.543 1.00 52.62 C ATOM 7594 CZ TYR B 169 -21.458 98.257 0.690 1.00 53.02 C ATOM 7595 OH TYR B 169 -20.792 98.143 -0.497 1.00 52.82 O ATOM 7596 HA TYR B 169 -23.536 96.585 5.079 1.00 0.00 H ATOM 7597 HB3 TYR B 169 -22.823 98.933 5.231 1.00 0.00 H ATOM 7598 HB2 TYR B 169 -24.302 99.398 4.359 1.00 0.00 H ATOM 7599 HD2 TYR B 169 -22.263 96.416 3.436 1.00 0.00 H ATOM 7600 HE2 TYR B 169 -21.060 96.230 1.264 1.00 0.00 H ATOM 7601 HE1 TYR B 169 -21.960 100.311 0.380 1.00 0.00 H ATOM 7602 HD1 TYR B 169 -23.160 100.506 2.542 1.00 0.00 H ATOM 7603 HH TYR B 169 -21.213 97.433 -1.044 1.00 0.00 H ATOM 7604 H TYR B 169 -25.668 97.519 3.403 1.00 0.00 H ATOM 7605 N ASN B 170 -25.973 98.251 6.532 1.00 52.95 N ATOM 7606 CA ASN B 170 -26.498 98.665 7.815 1.00 53.62 C ATOM 7607 C ASN B 170 -26.945 97.558 8.724 1.00 52.20 C ATOM 7608 O ASN B 170 -27.159 97.792 9.880 1.00 52.38 O ATOM 7609 CB ASN B 170 -27.666 99.631 7.661 1.00 20.00 C ATOM 7610 CG ASN B 170 -27.252 101.021 7.255 1.00 20.00 C ATOM 7611 OD1 ASN B 170 -28.058 101.748 6.719 1.00 20.00 O ATOM 7612 ND2 ASN B 170 -26.015 101.389 7.496 1.00 20.00 N ATOM 7613 HA ASN B 170 -25.638 99.143 8.283 1.00 0.00 H ATOM 7614 HB2 ASN B 170 -28.341 99.237 6.901 1.00 0.00 H ATOM 7615 HB3 ASN B 170 -28.190 99.692 8.615 1.00 0.00 H ATOM 7616 HD22 ASN B 170 -25.357 100.730 7.959 1.00 0.00 H ATOM 7617 HD21 ASN B 170 -25.693 102.340 7.224 1.00 0.00 H ATOM 7618 H ASN B 170 -26.532 98.411 5.670 1.00 0.00 H ATOM 7619 N VAL B 171 -27.057 96.357 8.196 1.00 50.54 N ATOM 7620 CA VAL B 171 -27.422 95.206 8.977 1.00 49.45 C ATOM 7621 C VAL B 171 -26.369 94.897 10.008 1.00 48.69 C ATOM 7622 O VAL B 171 -26.692 94.626 11.112 1.00 47.94 O ATOM 7623 CB VAL B 171 -27.609 93.982 8.095 1.00 20.00 C ATOM 7624 CG1 VAL B 171 -27.665 92.730 8.929 1.00 20.00 C ATOM 7625 CG2 VAL B 171 -28.848 94.116 7.252 1.00 20.00 C ATOM 7626 HA VAL B 171 -28.363 95.444 9.474 1.00 0.00 H ATOM 7627 HB VAL B 171 -26.751 93.909 7.427 1.00 0.00 H ATOM 7628 HG11 VAL B 171 -26.735 92.625 9.487 1.00 0.00 H ATOM 7629 HG12 VAL B 171 -28.502 92.795 9.625 1.00 0.00 H ATOM 7630 HG13 VAL B 171 -27.799 91.867 8.277 1.00 0.00 H ATOM 7631 HG21 VAL B 171 -29.718 94.219 7.901 1.00 0.00 H ATOM 7632 HG22 VAL B 171 -28.760 94.998 6.617 1.00 0.00 H ATOM 7633 HG23 VAL B 171 -28.960 93.228 6.630 1.00 0.00 H ATOM 7634 H VAL B 171 -26.875 96.237 7.179 1.00 0.00 H ATOM 7635 N ILE B 172 -25.112 94.963 9.633 1.00 48.19 N ATOM 7636 CA ILE B 172 -24.013 94.613 10.501 1.00 48.19 C ATOM 7637 C ILE B 172 -23.921 95.642 11.610 1.00 50.04 C ATOM 7638 O ILE B 172 -24.057 96.838 11.379 1.00 50.94 O ATOM 7639 CB ILE B 172 -22.687 94.539 9.766 1.00 47.77 C ATOM 7640 CG1 ILE B 172 -22.805 93.566 8.595 1.00 46.70 C ATOM 7641 CG2 ILE B 172 -21.591 94.103 10.728 1.00 46.80 C ATOM 7642 CD1 ILE B 172 -21.756 93.689 7.546 1.00 43.62 C ATOM 7643 HA ILE B 172 -24.210 93.619 10.904 1.00 0.00 H ATOM 7644 HB ILE B 172 -22.428 95.522 9.373 1.00 0.00 H ATOM 7645 HG12 ILE B 172 -22.762 92.553 8.995 1.00 0.00 H ATOM 7646 HG13 ILE B 172 -23.773 93.727 8.121 1.00 0.00 H ATOM 7647 HD11 ILE B 172 -21.789 94.690 7.117 1.00 0.00 H ATOM 7648 HD12 ILE B 172 -20.776 93.515 7.991 1.00 0.00 H ATOM 7649 HD13 ILE B 172 -21.937 92.951 6.764 1.00 0.00 H ATOM 7650 HG21 ILE B 172 -21.514 94.825 11.541 1.00 0.00 H ATOM 7651 HG22 ILE B 172 -21.835 93.121 11.134 1.00 0.00 H ATOM 7652 HG23 ILE B 172 -20.641 94.051 10.196 1.00 0.00 H ATOM 7653 H ILE B 172 -24.899 95.282 8.666 1.00 0.00 H ATOM 7654 N ASN B 173 -23.740 95.144 12.826 1.00 51.08 N ATOM 7655 CA ASN B 173 -23.691 95.949 14.017 1.00 52.10 C ATOM 7656 C ASN B 173 -22.240 95.899 14.390 1.00 53.31 C ATOM 7657 O ASN B 173 -21.800 94.916 15.003 1.00 53.52 O ATOM 7658 CB ASN B 173 -24.584 95.313 15.093 1.00 51.68 C ATOM 7659 CG ASN B 173 -24.503 96.016 16.470 1.00 51.82 C ATOM 7660 OD1 ASN B 173 -23.495 96.642 16.840 1.00 49.97 O ATOM 7661 ND2 ASN B 173 -25.574 95.867 17.249 1.00 49.41 N ATOM 7662 HA ASN B 173 -24.049 96.971 13.894 1.00 0.00 H ATOM 7663 HB2 ASN B 173 -25.617 95.351 14.748 1.00 0.00 H ATOM 7664 HB3 ASN B 173 -24.282 94.273 15.220 1.00 0.00 H ATOM 7665 HD22 ASN B 173 -26.399 95.336 16.903 1.00 0.00 H ATOM 7666 HD21 ASN B 173 -25.585 96.282 18.203 1.00 0.00 H ATOM 7667 H ASN B 173 -23.627 94.115 12.924 1.00 0.00 H ATOM 7668 N ARG B 174 -21.490 96.946 14.032 1.00 55.01 N ATOM 7669 CA ARG B 174 -20.017 96.862 14.071 1.00 56.02 C ATOM 7670 C ARG B 174 -19.414 96.839 15.492 1.00 56.37 C ATOM 7671 O ARG B 174 -18.396 96.178 15.725 1.00 55.93 O ATOM 7672 CB ARG B 174 -19.361 97.948 13.208 1.00 55.96 C ATOM 7673 CG ARG B 174 -20.132 98.297 11.941 1.00 57.47 C ATOM 7674 CD ARG B 174 -19.275 98.817 10.749 1.00 58.61 C ATOM 7675 NE ARG B 174 -17.978 99.389 11.096 1.00 60.82 N ATOM 7676 CZ ARG B 174 -17.800 100.541 11.749 1.00 63.68 C ATOM 7677 NH1 ARG B 174 -18.843 101.266 12.176 1.00 65.23 N ATOM 7678 NH2 ARG B 174 -16.565 100.954 12.009 1.00 63.10 N ATOM 7679 HA ARG B 174 -19.783 95.888 13.640 1.00 0.00 H ATOM 7680 HB2 ARG B 174 -19.267 98.852 13.810 1.00 0.00 H ATOM 7681 HB3 ARG B 174 -18.369 97.601 12.919 1.00 0.00 H ATOM 7682 HG2 ARG B 174 -20.656 97.400 11.610 1.00 0.00 H ATOM 7683 HG3 ARG B 174 -20.859 99.069 12.193 1.00 0.00 H ATOM 7684 HD2 ARG B 174 -19.851 99.585 10.233 1.00 0.00 H ATOM 7685 HD3 ARG B 174 -19.101 97.980 10.073 1.00 0.00 H ATOM 7686 HE ARG B 174 -17.128 98.860 10.814 1.00 0.00 H ATOM 7687 HH12 ARG B 174 -18.682 102.160 12.682 1.00 0.00 H ATOM 7688 HH11 ARG B 174 -19.813 100.935 12.001 1.00 0.00 H ATOM 7689 HH22 ARG B 174 -16.412 101.849 12.517 1.00 0.00 H ATOM 7690 HH21 ARG B 174 -15.751 100.383 11.705 1.00 0.00 H ATOM 7691 H ARG B 174 -21.948 97.827 13.723 1.00 0.00 H ATOM 7692 N GLU B 175 -20.035 97.539 16.442 1.00 57.46 N ATOM 7693 CA GLU B 175 -19.497 97.586 17.816 1.00 57.95 C ATOM 7694 C GLU B 175 -19.516 96.193 18.347 1.00 55.74 C ATOM 7695 O GLU B 175 -18.530 95.700 18.875 1.00 54.80 O ATOM 7696 CB GLU B 175 -20.340 98.448 18.776 1.00 59.14 C ATOM 7697 CG GLU B 175 -20.180 99.952 18.613 1.00 63.35 C ATOM 7698 CD GLU B 175 -20.918 100.517 17.383 1.00 66.98 C ATOM 7699 OE1 GLU B 175 -21.692 99.777 16.695 1.00 67.19 O ATOM 7700 OE2 GLU B 175 -20.700 101.720 17.114 1.00 69.48 O ATOM 7701 HA GLU B 175 -18.501 98.025 17.764 1.00 0.00 H ATOM 7702 HB2 GLU B 175 -21.390 98.202 18.616 1.00 0.00 H ATOM 7703 HB3 GLU B 175 -20.059 98.188 19.797 1.00 0.00 H ATOM 7704 HG2 GLU B 175 -20.572 100.440 19.505 1.00 0.00 H ATOM 7705 HG3 GLU B 175 -19.118 100.178 18.513 1.00 0.00 H ATOM 7706 H GLU B 175 -20.907 98.057 16.213 1.00 0.00 H ATOM 7707 N LYS B 176 -20.685 95.580 18.207 1.00 54.23 N ATOM 7708 CA LYS B 176 -20.921 94.253 18.748 1.00 53.05 C ATOM 7709 C LYS B 176 -20.088 93.183 18.033 1.00 50.19 C ATOM 7710 O LYS B 176 -19.564 92.268 18.678 1.00 49.67 O ATOM 7711 CB LYS B 176 -22.420 93.957 18.786 1.00 53.53 C ATOM 7712 CG LYS B 176 -23.003 94.496 20.059 1.00 56.42 C ATOM 7713 CD LYS B 176 -24.530 94.534 20.116 1.00 58.81 C ATOM 7714 CE LYS B 176 -25.041 94.812 21.582 1.00 59.24 C ATOM 7715 NZ LYS B 176 -26.548 94.713 21.770 1.00 60.29 N ATOM 7716 HA LYS B 176 -20.572 94.225 19.780 1.00 0.00 H ATOM 7717 HB2 LYS B 176 -22.906 94.431 17.934 1.00 0.00 H ATOM 7718 HB3 LYS B 176 -22.579 92.880 18.740 1.00 0.00 H ATOM 7719 HG2 LYS B 176 -22.651 93.873 20.881 1.00 0.00 H ATOM 7720 HG3 LYS B 176 -22.636 95.513 20.193 1.00 0.00 H ATOM 7721 HD2 LYS B 176 -24.891 95.324 19.458 1.00 0.00 H ATOM 7722 HD3 LYS B 176 -24.922 93.575 19.779 1.00 0.00 H ATOM 7723 HE2 LYS B 176 -24.731 95.818 21.863 1.00 0.00 H ATOM 7724 HE3 LYS B 176 -24.569 94.089 22.247 1.00 0.00 H ATOM 7725 HZ1 LYS B 176 -27.019 95.406 21.154 1.00 0.00 H ATOM 7726 HZ2 LYS B 176 -26.865 93.754 21.521 1.00 0.00 H ATOM 7727 HZ3 LYS B 176 -26.786 94.911 22.763 1.00 0.00 H ATOM 7728 H LYS B 176 -21.452 96.063 17.697 1.00 0.00 H ATOM 7729 N LEU B 177 -19.903 93.346 16.729 1.00 47.28 N ATOM 7730 CA LEU B 177 -18.999 92.480 16.004 1.00 45.31 C ATOM 7731 C LEU B 177 -17.592 92.475 16.591 1.00 45.21 C ATOM 7732 O LEU B 177 -16.986 91.414 16.759 1.00 44.19 O ATOM 7733 CB LEU B 177 -18.965 92.854 14.517 1.00 44.96 C ATOM 7734 CG LEU B 177 -18.097 91.955 13.635 1.00 41.87 C ATOM 7735 CD1 LEU B 177 -18.568 90.537 13.726 1.00 35.94 C ATOM 7736 CD2 LEU B 177 -18.114 92.468 12.204 1.00 43.67 C ATOM 7737 HA LEU B 177 -19.386 91.466 16.105 1.00 0.00 H ATOM 7738 HB2 LEU B 177 -19.986 92.815 14.136 1.00 0.00 H ATOM 7739 HB3 LEU B 177 -18.587 93.873 14.435 1.00 0.00 H ATOM 7740 HG LEU B 177 -17.065 91.980 13.986 1.00 0.00 H ATOM 7741 HD21 LEU B 177 -19.138 92.462 11.829 1.00 0.00 H ATOM 7742 HD22 LEU B 177 -17.723 93.485 12.179 1.00 0.00 H ATOM 7743 HD23 LEU B 177 -17.494 91.823 11.581 1.00 0.00 H ATOM 7744 HD11 LEU B 177 -18.500 90.199 14.760 1.00 0.00 H ATOM 7745 HD12 LEU B 177 -19.603 90.477 13.390 1.00 0.00 H ATOM 7746 HD13 LEU B 177 -17.943 89.906 13.094 1.00 0.00 H ATOM 7747 H LEU B 177 -20.411 94.101 16.225 1.00 0.00 H ATOM 7748 N LEU B 178 -17.082 93.660 16.904 1.00 46.60 N ATOM 7749 CA LEU B 178 -15.754 93.797 17.529 1.00 47.28 C ATOM 7750 C LEU B 178 -15.733 93.164 18.929 1.00 46.86 C ATOM 7751 O LEU B 178 -14.778 92.444 19.289 1.00 46.69 O ATOM 7752 CB LEU B 178 -15.303 95.269 17.563 1.00 47.99 C ATOM 7753 CG LEU B 178 -13.894 95.582 18.113 1.00 48.76 C ATOM 7754 CD1 LEU B 178 -12.753 95.036 17.222 1.00 49.14 C ATOM 7755 CD2 LEU B 178 -13.721 97.086 18.321 1.00 49.02 C ATOM 7756 HA LEU B 178 -15.037 93.253 16.915 1.00 0.00 H ATOM 7757 HB2 LEU B 178 -15.343 95.645 16.541 1.00 0.00 H ATOM 7758 HB3 LEU B 178 -16.020 95.814 18.177 1.00 0.00 H ATOM 7759 HG LEU B 178 -13.820 95.066 19.070 1.00 0.00 H ATOM 7760 HD21 LEU B 178 -13.852 97.601 17.369 1.00 0.00 H ATOM 7761 HD22 LEU B 178 -14.466 97.441 19.033 1.00 0.00 H ATOM 7762 HD23 LEU B 178 -12.722 97.285 18.709 1.00 0.00 H ATOM 7763 HD11 LEU B 178 -12.842 93.952 17.143 1.00 0.00 H ATOM 7764 HD12 LEU B 178 -12.824 95.481 16.229 1.00 0.00 H ATOM 7765 HD13 LEU B 178 -11.792 95.292 17.668 1.00 0.00 H ATOM 7766 H LEU B 178 -17.636 94.517 16.702 1.00 0.00 H ATOM 7767 N GLN B 179 -16.801 93.364 19.697 1.00 46.36 N ATOM 7768 CA GLN B 179 -16.885 92.713 21.009 1.00 46.35 C ATOM 7769 C GLN B 179 -16.744 91.221 20.859 1.00 44.29 C ATOM 7770 O GLN B 179 -15.912 90.588 21.519 1.00 44.23 O ATOM 7771 CB GLN B 179 -18.213 92.998 21.688 1.00 47.31 C ATOM 7772 CG GLN B 179 -18.467 94.481 21.940 1.00 50.79 C ATOM 7773 CD GLN B 179 -19.261 94.727 23.203 1.00 55.15 C ATOM 7774 OE1 GLN B 179 -19.936 93.819 23.725 1.00 56.25 O ATOM 7775 NE2 GLN B 179 -19.184 95.966 23.713 1.00 58.28 N ATOM 7776 HA GLN B 179 -16.076 93.114 21.620 1.00 0.00 H ATOM 7777 HB2 GLN B 179 -19.013 92.614 21.055 1.00 0.00 H ATOM 7778 HB3 GLN B 179 -18.229 92.478 22.646 1.00 0.00 H ATOM 7779 HG2 GLN B 179 -17.507 94.991 22.025 1.00 0.00 H ATOM 7780 HG3 GLN B 179 -19.020 94.890 21.094 1.00 0.00 H ATOM 7781 HE22 GLN B 179 -18.606 96.689 23.238 1.00 0.00 H ATOM 7782 HE21 GLN B 179 -19.702 96.203 24.583 1.00 0.00 H ATOM 7783 H GLN B 179 -17.573 93.979 19.369 1.00 0.00 H ATOM 7784 N TYR B 180 -17.565 90.672 19.965 1.00 42.05 N ATOM 7785 CA TYR B 180 -17.585 89.242 19.725 1.00 40.35 C ATOM 7786 C TYR B 180 -16.177 88.748 19.396 1.00 39.99 C ATOM 7787 O TYR B 180 -15.683 87.814 20.040 1.00 38.90 O ATOM 7788 CB TYR B 180 -18.599 88.881 18.607 1.00 39.38 C ATOM 7789 CG TYR B 180 -18.713 87.391 18.355 1.00 37.34 C ATOM 7790 CD1 TYR B 180 -19.124 86.523 19.367 1.00 35.62 C ATOM 7791 CD2 TYR B 180 -18.411 86.846 17.102 1.00 37.18 C ATOM 7792 CE1 TYR B 180 -19.228 85.123 19.140 1.00 35.90 C ATOM 7793 CE2 TYR B 180 -18.521 85.433 16.857 1.00 36.74 C ATOM 7794 CZ TYR B 180 -18.928 84.587 17.883 1.00 36.21 C ATOM 7795 OH TYR B 180 -19.014 83.219 17.656 1.00 36.05 O ATOM 7796 HA TYR B 180 -17.917 88.736 20.631 1.00 0.00 H ATOM 7797 HB3 TYR B 180 -18.282 89.365 17.683 1.00 0.00 H ATOM 7798 HB2 TYR B 180 -19.580 89.259 18.895 1.00 0.00 H ATOM 7799 HD2 TYR B 180 -18.086 87.505 16.297 1.00 0.00 H ATOM 7800 HE2 TYR B 180 -18.287 85.028 15.873 1.00 0.00 H ATOM 7801 HE1 TYR B 180 -19.543 84.464 19.949 1.00 0.00 H ATOM 7802 HD1 TYR B 180 -19.370 86.925 20.350 1.00 0.00 H ATOM 7803 HH TYR B 180 -19.316 82.767 18.483 1.00 0.00 H ATOM 7804 H TYR B 180 -18.209 91.285 19.425 1.00 0.00 H ATOM 7805 N LEU B 181 -15.525 89.409 18.424 1.00 40.38 N ATOM 7806 CA LEU B 181 -14.160 89.003 17.995 1.00 40.78 C ATOM 7807 C LEU B 181 -13.187 88.963 19.187 1.00 41.69 C ATOM 7808 O LEU B 181 -12.506 87.949 19.396 1.00 41.75 O ATOM 7809 CB LEU B 181 -13.602 89.894 16.873 1.00 40.27 C ATOM 7810 CG LEU B 181 -14.239 89.767 15.481 1.00 40.20 C ATOM 7811 CD1 LEU B 181 -13.431 90.599 14.447 1.00 36.71 C ATOM 7812 CD2 LEU B 181 -14.368 88.285 15.032 1.00 37.98 C ATOM 7813 HA LEU B 181 -14.254 87.996 17.589 1.00 0.00 H ATOM 7814 HB2 LEU B 181 -13.717 90.930 17.191 1.00 0.00 H ATOM 7815 HB3 LEU B 181 -12.542 89.663 16.769 1.00 0.00 H ATOM 7816 HG LEU B 181 -15.252 90.166 15.538 1.00 0.00 H ATOM 7817 HD21 LEU B 181 -13.378 87.830 14.997 1.00 0.00 H ATOM 7818 HD22 LEU B 181 -14.993 87.744 15.743 1.00 0.00 H ATOM 7819 HD23 LEU B 181 -14.823 88.245 14.043 1.00 0.00 H ATOM 7820 HD11 LEU B 181 -13.430 91.647 14.747 1.00 0.00 H ATOM 7821 HD12 LEU B 181 -12.406 90.230 14.407 1.00 0.00 H ATOM 7822 HD13 LEU B 181 -13.892 90.501 13.464 1.00 0.00 H ATOM 7823 H LEU B 181 -15.984 90.220 17.963 1.00 0.00 H ATOM 7824 N TYR B 182 -13.144 90.047 19.970 1.00 42.60 N ATOM 7825 CA TYR B 182 -12.343 90.066 21.205 1.00 43.21 C ATOM 7826 C TYR B 182 -12.672 88.868 22.080 1.00 42.48 C ATOM 7827 O TYR B 182 -11.762 88.224 22.623 1.00 42.14 O ATOM 7828 CB TYR B 182 -12.568 91.361 22.003 1.00 44.74 C ATOM 7829 CG TYR B 182 -11.639 92.474 21.602 1.00 46.06 C ATOM 7830 CD1 TYR B 182 -12.116 93.625 21.026 1.00 46.32 C ATOM 7831 CD2 TYR B 182 -10.253 92.343 21.773 1.00 48.78 C ATOM 7832 CE1 TYR B 182 -11.258 94.634 20.648 1.00 48.45 C ATOM 7833 CE2 TYR B 182 -9.384 93.336 21.393 1.00 49.37 C ATOM 7834 CZ TYR B 182 -9.894 94.495 20.835 1.00 49.08 C ATOM 7835 OH TYR B 182 -9.035 95.506 20.458 1.00 49.10 O ATOM 7836 HA TYR B 182 -11.295 90.019 20.909 1.00 0.00 H ATOM 7837 HB3 TYR B 182 -12.416 91.147 23.061 1.00 0.00 H ATOM 7838 HB2 TYR B 182 -13.594 91.692 21.844 1.00 0.00 H ATOM 7839 HD2 TYR B 182 -9.856 91.431 22.218 1.00 0.00 H ATOM 7840 HE2 TYR B 182 -8.309 93.213 21.529 1.00 0.00 H ATOM 7841 HE1 TYR B 182 -11.655 95.545 20.200 1.00 0.00 H ATOM 7842 HD1 TYR B 182 -13.188 93.742 20.866 1.00 0.00 H ATOM 7843 HH TYR B 182 -8.405 95.164 19.775 1.00 0.00 H ATOM 7844 H TYR B 182 -13.687 90.892 19.701 1.00 0.00 H ATOM 7845 N SER B 183 -13.963 88.545 22.198 1.00 41.36 N ATOM 7846 CA SER B 183 -14.357 87.463 23.094 1.00 40.80 C ATOM 7847 C SER B 183 -13.724 86.166 22.670 1.00 40.17 C ATOM 7848 O SER B 183 -13.547 85.317 23.511 1.00 40.17 O ATOM 7849 CB SER B 183 -15.879 87.304 23.188 1.00 40.71 C ATOM 7850 OG SER B 183 -16.417 86.533 22.113 1.00 41.57 O ATOM 7851 HA SER B 183 -13.998 87.730 24.088 1.00 0.00 H ATOM 7852 HB2 SER B 183 -16.336 88.294 23.171 1.00 0.00 H ATOM 7853 HB3 SER B 183 -16.121 86.809 24.129 1.00 0.00 H ATOM 7854 HG SER B 183 -16.209 86.978 21.253 1.00 0.00 H ATOM 7855 H SER B 183 -14.683 89.062 21.654 1.00 0.00 H ATOM 7856 N LEU B 184 -13.377 86.021 21.380 1.00 39.70 N ATOM 7857 CA LEU B 184 -12.836 84.770 20.838 1.00 39.32 C ATOM 7858 C LEU B 184 -11.312 84.729 20.784 1.00 40.80 C ATOM 7859 O LEU B 184 -10.717 83.632 20.702 1.00 39.80 O ATOM 7860 CB LEU B 184 -13.378 84.521 19.420 1.00 38.82 C ATOM 7861 CG LEU B 184 -14.890 84.467 19.226 1.00 37.51 C ATOM 7862 CD1 LEU B 184 -15.256 84.366 17.743 1.00 37.04 C ATOM 7863 CD2 LEU B 184 -15.385 83.308 19.952 1.00 34.37 C ATOM 7864 HA LEU B 184 -13.162 83.991 21.527 1.00 0.00 H ATOM 7865 HB2 LEU B 184 -12.998 85.320 18.784 1.00 0.00 H ATOM 7866 HB3 LEU B 184 -12.974 83.567 19.082 1.00 0.00 H ATOM 7867 HG LEU B 184 -15.345 85.382 19.605 1.00 0.00 H ATOM 7868 HD21 LEU B 184 -14.918 82.406 19.556 1.00 0.00 H ATOM 7869 HD22 LEU B 184 -15.140 83.411 21.009 1.00 0.00 H ATOM 7870 HD23 LEU B 184 -16.466 83.241 19.833 1.00 0.00 H ATOM 7871 HD11 LEU B 184 -14.868 85.237 17.214 1.00 0.00 H ATOM 7872 HD12 LEU B 184 -14.819 83.460 17.323 1.00 0.00 H ATOM 7873 HD13 LEU B 184 -16.340 84.329 17.639 1.00 0.00 H ATOM 7874 H LEU B 184 -13.497 86.831 20.738 1.00 0.00 H ATOM 7875 N LYS B 185 -10.688 85.916 20.815 1.00 43.58 N ATOM 7876 CA LYS B 185 -9.216 86.081 20.722 1.00 44.84 C ATOM 7877 C LYS B 185 -8.483 85.441 21.861 1.00 45.94 C ATOM 7878 O LYS B 185 -8.817 85.694 23.009 1.00 45.74 O ATOM 7879 CB LYS B 185 -8.843 87.563 20.738 1.00 46.19 C ATOM 7880 CG LYS B 185 -7.299 87.867 20.793 1.00 47.21 C ATOM 7881 CD LYS B 185 -6.578 87.597 19.441 1.00 49.35 C ATOM 7882 CE LYS B 185 -5.073 87.892 19.507 1.00 49.86 C ATOM 7883 NZ LYS B 185 -4.798 89.347 19.772 1.00 49.41 N ATOM 7884 HA LYS B 185 -8.927 85.598 19.789 1.00 0.00 H ATOM 7885 HB2 LYS B 185 -9.245 88.022 19.835 1.00 0.00 H ATOM 7886 HB3 LYS B 185 -9.308 88.018 21.613 1.00 0.00 H ATOM 7887 HG2 LYS B 185 -7.160 88.915 21.058 1.00 0.00 H ATOM 7888 HG3 LYS B 185 -6.848 87.237 21.560 1.00 0.00 H ATOM 7889 HD2 LYS B 185 -6.718 86.550 19.173 1.00 0.00 H ATOM 7890 HD3 LYS B 185 -7.025 88.229 18.674 1.00 0.00 H ATOM 7891 HE2 LYS B 185 -4.617 87.614 18.557 1.00 0.00 H ATOM 7892 HE3 LYS B 185 -4.632 87.298 20.308 1.00 0.00 H ATOM 7893 HZ1 LYS B 185 -5.210 89.921 19.009 1.00 0.00 H ATOM 7894 HZ2 LYS B 185 -5.224 89.619 20.681 1.00 0.00 H ATOM 7895 HZ3 LYS B 185 -3.770 89.503 19.809 1.00 0.00 H ATOM 7896 H LYS B 185 -11.271 86.772 20.910 1.00 0.00 H ATOM 7897 N GLN B 186 -7.443 84.674 21.537 1.00 47.75 N ATOM 7898 CA GLN B 186 -6.621 83.958 22.547 1.00 49.29 C ATOM 7899 C GLN B 186 -5.291 84.632 22.911 1.00 51.43 C ATOM 7900 O GLN B 186 -4.670 85.288 22.052 1.00 52.44 O ATOM 7901 CB GLN B 186 -6.266 82.556 22.050 1.00 48.82 C ATOM 7902 CG GLN B 186 -7.442 81.648 21.827 1.00 49.17 C ATOM 7903 CD GLN B 186 -8.365 81.590 23.041 1.00 48.57 C ATOM 7904 OE1 GLN B 186 -8.439 80.573 23.709 1.00 46.70 O ATOM 7905 NE2 GLN B 186 -9.050 82.698 23.336 1.00 47.19 N ATOM 7906 HA GLN B 186 -7.253 83.953 23.435 1.00 0.00 H ATOM 7907 HB2 GLN B 186 -5.731 82.656 21.105 1.00 0.00 H ATOM 7908 HB3 GLN B 186 -5.613 82.090 22.788 1.00 0.00 H ATOM 7909 HG2 GLN B 186 -8.010 82.013 20.971 1.00 0.00 H ATOM 7910 HG3 GLN B 186 -7.075 80.643 21.617 1.00 0.00 H ATOM 7911 HE22 GLN B 186 -8.955 83.543 22.737 1.00 0.00 H ATOM 7912 HE21 GLN B 186 -9.678 82.716 24.165 1.00 0.00 H ATOM 7913 H GLN B 186 -7.195 84.572 20.532 1.00 0.00 H ATOM 7914 N PRO B 187 -4.829 84.446 24.176 1.00 53.27 N ATOM 7915 CA PRO B 187 -3.472 84.826 24.548 1.00 53.90 C ATOM 7916 C PRO B 187 -2.451 84.578 23.433 1.00 53.18 C ATOM 7917 O PRO B 187 -1.784 85.519 23.036 1.00 53.12 O ATOM 7918 CB PRO B 187 -3.178 83.939 25.787 1.00 54.23 C ATOM 7919 CG PRO B 187 -4.434 83.135 26.035 1.00 54.22 C ATOM 7920 CD PRO B 187 -5.525 83.895 25.352 1.00 53.63 C ATOM 7921 HA PRO B 187 -3.391 85.895 24.746 1.00 0.00 H ATOM 7922 HD3 PRO B 187 -6.341 83.236 25.056 1.00 0.00 H ATOM 7923 HD2 PRO B 187 -5.914 84.689 25.990 1.00 0.00 H ATOM 7924 HG3 PRO B 187 -4.633 83.056 27.104 1.00 0.00 H ATOM 7925 HG2 PRO B 187 -4.339 82.136 25.610 1.00 0.00 H ATOM 7926 HB2 PRO B 187 -2.337 83.275 25.586 1.00 0.00 H ATOM 7927 HB3 PRO B 187 -2.950 84.561 26.652 1.00 0.00 H ATOM 7928 N ASP B 188 -2.368 83.359 22.899 1.00 51.90 N ATOM 7929 CA ASP B 188 -1.281 83.025 21.957 1.00 51.47 C ATOM 7930 C ASP B 188 -1.499 83.513 20.517 1.00 50.46 C ATOM 7931 O ASP B 188 -0.859 83.000 19.611 1.00 50.67 O ATOM 7932 CB ASP B 188 -0.971 81.523 21.971 1.00 50.86 C ATOM 7933 CG ASP B 188 -2.029 80.696 21.282 1.00 51.17 C ATOM 7934 OD1 ASP B 188 -1.868 79.457 21.217 1.00 49.08 O ATOM 7935 OD2 ASP B 188 -3.024 81.274 20.787 1.00 52.04 O ATOM 7936 HA ASP B 188 -0.419 83.580 22.327 1.00 0.00 H ATOM 7937 HB2 ASP B 188 -0.019 81.360 21.466 1.00 0.00 H ATOM 7938 HB3 ASP B 188 -0.893 81.194 23.007 1.00 0.00 H ATOM 7939 H ASP B 188 -3.075 82.638 23.148 1.00 0.00 H ATOM 7940 N GLY B 189 -2.391 84.486 20.312 1.00 49.07 N ATOM 7941 CA GLY B 189 -2.620 85.083 18.995 1.00 47.84 C ATOM 7942 C GLY B 189 -3.781 84.508 18.166 1.00 46.14 C ATOM 7943 O GLY B 189 -4.262 85.168 17.221 1.00 46.15 O ATOM 7944 HA3 GLY B 189 -1.706 84.960 18.413 1.00 0.00 H ATOM 7945 HA2 GLY B 189 -2.815 86.145 19.143 1.00 0.00 H ATOM 7946 H GLY B 189 -2.945 84.833 21.121 1.00 0.00 H ATOM 7947 N SER B 190 -4.223 83.292 18.518 1.00 43.61 N ATOM 7948 CA SER B 190 -5.228 82.550 17.761 1.00 41.55 C ATOM 7949 C SER B 190 -6.648 82.945 18.146 1.00 40.20 C ATOM 7950 O SER B 190 -6.849 83.699 19.132 1.00 39.91 O ATOM 7951 CB SER B 190 -5.043 81.049 17.982 1.00 41.90 C ATOM 7952 OG SER B 190 -5.642 80.616 19.198 1.00 42.33 O ATOM 7953 HA SER B 190 -5.087 82.797 16.709 1.00 0.00 H ATOM 7954 HB2 SER B 190 -3.977 80.826 18.015 1.00 0.00 H ATOM 7955 HB3 SER B 190 -5.500 80.511 17.152 1.00 0.00 H ATOM 7956 HG SER B 190 -5.227 81.096 19.958 1.00 0.00 H ATOM 7957 H SER B 190 -3.829 82.854 19.375 1.00 0.00 H ATOM 7958 N PHE B 191 -7.629 82.449 17.365 1.00 38.37 N ATOM 7959 CA PHE B 191 -9.074 82.674 17.673 1.00 37.18 C ATOM 7960 C PHE B 191 -9.901 81.409 17.826 1.00 36.12 C ATOM 7961 O PHE B 191 -9.720 80.442 17.119 1.00 36.20 O ATOM 7962 CB PHE B 191 -9.757 83.480 16.599 1.00 36.89 C ATOM 7963 CG PHE B 191 -9.377 84.917 16.566 1.00 37.70 C ATOM 7964 CD1 PHE B 191 -8.172 85.324 16.006 1.00 37.87 C ATOM 7965 CD2 PHE B 191 -10.259 85.887 17.008 1.00 39.12 C ATOM 7966 CE1 PHE B 191 -7.832 86.698 15.919 1.00 37.97 C ATOM 7967 CE2 PHE B 191 -9.914 87.272 16.930 1.00 39.30 C ATOM 7968 CZ PHE B 191 -8.696 87.662 16.380 1.00 37.27 C ATOM 7969 HA PHE B 191 -9.038 83.197 18.628 1.00 0.00 H ATOM 7970 HB2 PHE B 191 -9.508 83.040 15.633 1.00 0.00 H ATOM 7971 HB3 PHE B 191 -10.833 83.416 16.759 1.00 0.00 H ATOM 7972 HD2 PHE B 191 -11.225 85.593 17.419 1.00 0.00 H ATOM 7973 HE2 PHE B 191 -10.607 88.026 17.303 1.00 0.00 H ATOM 7974 HZ PHE B 191 -8.431 88.717 16.316 1.00 0.00 H ATOM 7975 HE1 PHE B 191 -6.877 86.992 15.483 1.00 0.00 H ATOM 7976 HD1 PHE B 191 -7.477 84.575 15.627 1.00 0.00 H ATOM 7977 H PHE B 191 -7.373 81.894 16.524 1.00 0.00 H ATOM 7978 N LEU B 192 -10.838 81.443 18.750 1.00 36.09 N ATOM 7979 CA LEU B 192 -11.834 80.411 18.835 1.00 35.95 C ATOM 7980 C LEU B 192 -12.833 80.570 17.682 1.00 35.60 C ATOM 7981 O LEU B 192 -13.118 81.715 17.302 1.00 36.28 O ATOM 7982 CB LEU B 192 -12.571 80.541 20.159 1.00 36.07 C ATOM 7983 CG LEU B 192 -11.755 80.359 21.435 1.00 35.65 C ATOM 7984 CD1 LEU B 192 -12.693 80.632 22.625 1.00 32.29 C ATOM 7985 CD2 LEU B 192 -11.072 78.962 21.486 1.00 32.13 C ATOM 7986 HA LEU B 192 -11.357 79.433 18.771 1.00 0.00 H ATOM 7987 HB2 LEU B 192 -13.013 81.537 20.192 1.00 0.00 H ATOM 7988 HB3 LEU B 192 -13.364 79.793 20.168 1.00 0.00 H ATOM 7989 HG LEU B 192 -10.926 81.066 21.471 1.00 0.00 H ATOM 7990 HD21 LEU B 192 -11.835 78.184 21.452 1.00 0.00 H ATOM 7991 HD22 LEU B 192 -10.403 78.854 20.632 1.00 0.00 H ATOM 7992 HD23 LEU B 192 -10.501 78.872 22.410 1.00 0.00 H ATOM 7993 HD11 LEU B 192 -13.076 81.650 22.558 1.00 0.00 H ATOM 7994 HD12 LEU B 192 -13.525 79.928 22.600 1.00 0.00 H ATOM 7995 HD13 LEU B 192 -12.141 80.510 23.557 1.00 0.00 H ATOM 7996 H LEU B 192 -10.858 82.230 19.430 1.00 0.00 H ATOM 7997 N MET B 193 -13.355 79.456 17.145 1.00 34.51 N ATOM 7998 CA MET B 193 -14.424 79.505 16.118 1.00 34.33 C ATOM 7999 C MET B 193 -15.724 80.020 16.755 1.00 34.50 C ATOM 8000 O MET B 193 -16.477 80.765 16.131 1.00 34.64 O ATOM 8001 CB MET B 193 -14.692 78.137 15.461 1.00 33.93 C ATOM 8002 CG MET B 193 -13.834 77.744 14.236 1.00 35.48 C ATOM 8003 SD MET B 193 -13.616 79.056 12.957 1.00 39.45 S ATOM 8004 CE MET B 193 -14.578 78.596 11.538 1.00 34.99 C ATOM 8005 HA MET B 193 -14.079 80.179 15.334 1.00 0.00 H ATOM 8006 HB2 MET B 193 -14.538 77.374 16.224 1.00 0.00 H ATOM 8007 HB3 MET B 193 -15.735 78.127 15.144 1.00 0.00 H ATOM 8008 HG2 MET B 193 -14.306 76.885 13.758 1.00 0.00 H ATOM 8009 HG3 MET B 193 -12.845 77.460 14.597 1.00 0.00 H ATOM 8010 HE1 MET B 193 -14.228 77.636 11.159 1.00 0.00 H ATOM 8011 HE2 MET B 193 -15.627 78.515 11.823 1.00 0.00 H ATOM 8012 HE3 MET B 193 -14.468 79.356 10.764 1.00 0.00 H ATOM 8013 H MET B 193 -12.999 78.530 17.459 1.00 0.00 H ATOM 8014 N HIS B 194 -15.991 79.626 17.993 1.00 34.51 N ATOM 8015 CA HIS B 194 -17.126 80.187 18.740 1.00 35.45 C ATOM 8016 C HIS B 194 -16.866 80.075 20.226 1.00 35.20 C ATOM 8017 O HIS B 194 -15.889 79.467 20.605 1.00 36.51 O ATOM 8018 CB HIS B 194 -18.425 79.487 18.363 1.00 35.33 C ATOM 8019 CG HIS B 194 -18.382 78.030 18.602 1.00 36.84 C ATOM 8020 ND1 HIS B 194 -18.817 77.466 19.782 1.00 38.74 N ATOM 8021 CD2 HIS B 194 -17.882 77.016 17.853 1.00 38.31 C ATOM 8022 CE1 HIS B 194 -18.625 76.157 19.731 1.00 38.99 C ATOM 8023 NE2 HIS B 194 -18.070 75.856 18.567 1.00 37.87 N ATOM 8024 HA HIS B 194 -17.231 81.240 18.479 1.00 0.00 H ATOM 8025 HB2 HIS B 194 -19.235 79.913 18.955 1.00 0.00 H ATOM 8026 HB3 HIS B 194 -18.620 79.661 17.305 1.00 0.00 H ATOM 8027 HD2 HIS B 194 -17.419 77.104 16.870 1.00 0.00 H ATOM 8028 HE1 HIS B 194 -18.881 75.446 20.516 1.00 0.00 H ATOM 8029 H HIS B 194 -15.387 78.908 18.443 1.00 0.00 H ATOM 8030 N VAL B 195 -17.690 80.697 21.061 1.00 35.24 N ATOM 8031 CA VAL B 195 -17.490 80.618 22.521 1.00 35.70 C ATOM 8032 C VAL B 195 -17.514 79.137 22.956 1.00 35.93 C ATOM 8033 O VAL B 195 -18.351 78.352 22.524 1.00 35.81 O ATOM 8034 CB VAL B 195 -18.526 81.481 23.337 1.00 36.34 C ATOM 8035 CG1 VAL B 195 -18.307 81.290 24.854 1.00 35.98 C ATOM 8036 CG2 VAL B 195 -18.410 82.978 22.965 1.00 33.48 C ATOM 8037 HA VAL B 195 -16.516 81.050 22.750 1.00 0.00 H ATOM 8038 HB VAL B 195 -19.529 81.141 23.080 1.00 0.00 H ATOM 8039 HG11 VAL B 195 -18.440 80.239 25.109 1.00 0.00 H ATOM 8040 HG12 VAL B 195 -17.297 81.604 25.116 1.00 0.00 H ATOM 8041 HG13 VAL B 195 -19.030 81.893 25.403 1.00 0.00 H ATOM 8042 HG21 VAL B 195 -17.404 83.330 23.191 1.00 0.00 H ATOM 8043 HG22 VAL B 195 -18.609 83.103 21.901 1.00 0.00 H ATOM 8044 HG23 VAL B 195 -19.135 83.552 23.542 1.00 0.00 H ATOM 8045 H VAL B 195 -18.487 81.247 20.681 1.00 0.00 H ATOM 8046 N GLY B 196 -16.528 78.730 23.737 1.00 36.08 N ATOM 8047 CA GLY B 196 -16.425 77.328 24.121 1.00 36.11 C ATOM 8048 C GLY B 196 -16.206 76.364 22.973 1.00 36.58 C ATOM 8049 O GLY B 196 -16.408 75.157 23.135 1.00 37.06 O ATOM 8050 HA3 GLY B 196 -17.349 77.047 24.627 1.00 0.00 H ATOM 8051 HA2 GLY B 196 -15.588 77.227 24.812 1.00 0.00 H ATOM 8052 H GLY B 196 -15.823 79.414 24.079 1.00 0.00 H ATOM 8053 N GLY B 197 -15.783 76.878 21.810 1.00 36.97 N ATOM 8054 CA GLY B 197 -15.410 76.027 20.663 1.00 36.39 C ATOM 8055 C GLY B 197 -13.891 75.918 20.582 1.00 37.26 C ATOM 8056 O GLY B 197 -13.149 76.223 21.542 1.00 37.82 O ATOM 8057 HA3 GLY B 197 -15.792 76.469 19.743 1.00 0.00 H ATOM 8058 HA2 GLY B 197 -15.839 75.034 20.793 1.00 0.00 H ATOM 8059 H GLY B 197 -15.715 77.911 21.712 1.00 0.00 H ATOM 8060 N GLU B 198 -13.393 75.515 19.426 1.00 37.55 N ATOM 8061 CA GLU B 198 -11.946 75.326 19.305 1.00 37.74 C ATOM 8062 C GLU B 198 -11.315 76.262 18.300 1.00 36.96 C ATOM 8063 O GLU B 198 -12.004 76.922 17.510 1.00 37.92 O ATOM 8064 CB GLU B 198 -11.700 73.911 18.811 1.00 39.04 C ATOM 8065 CG GLU B 198 -10.629 73.145 19.543 1.00 42.24 C ATOM 8066 CD GLU B 198 -10.888 71.654 19.404 1.00 45.55 C ATOM 8067 OE1 GLU B 198 -10.480 71.075 18.353 1.00 48.49 O ATOM 8068 OE2 GLU B 198 -11.520 71.098 20.331 1.00 43.81 O ATOM 8069 HA GLU B 198 -11.506 75.523 20.282 1.00 0.00 H ATOM 8070 HB2 GLU B 198 -12.633 73.356 18.904 1.00 0.00 H ATOM 8071 HB3 GLU B 198 -11.415 73.967 17.760 1.00 0.00 H ATOM 8072 HG2 GLU B 198 -9.655 73.386 19.118 1.00 0.00 H ATOM 8073 HG3 GLU B 198 -10.642 73.420 20.598 1.00 0.00 H ATOM 8074 H GLU B 198 -14.019 75.335 18.615 1.00 0.00 H ATOM 8075 N VAL B 199 -9.990 76.231 18.294 1.00 36.02 N ATOM 8076 CA VAL B 199 -9.151 77.024 17.416 1.00 35.40 C ATOM 8077 C VAL B 199 -8.715 76.319 16.108 1.00 34.49 C ATOM 8078 O VAL B 199 -8.436 75.127 16.076 1.00 33.54 O ATOM 8079 CB VAL B 199 -7.885 77.458 18.191 1.00 36.00 C ATOM 8080 CG1 VAL B 199 -6.791 77.871 17.232 1.00 36.78 C ATOM 8081 CG2 VAL B 199 -8.233 78.605 19.194 1.00 36.68 C ATOM 8082 HA VAL B 199 -9.764 77.871 17.108 1.00 0.00 H ATOM 8083 HB VAL B 199 -7.514 76.610 18.767 1.00 0.00 H ATOM 8084 HG11 VAL B 199 -6.540 77.030 16.586 1.00 0.00 H ATOM 8085 HG12 VAL B 199 -7.138 78.707 16.625 1.00 0.00 H ATOM 8086 HG13 VAL B 199 -5.909 78.173 17.797 1.00 0.00 H ATOM 8087 HG21 VAL B 199 -8.626 79.460 18.644 1.00 0.00 H ATOM 8088 HG22 VAL B 199 -8.982 78.252 19.902 1.00 0.00 H ATOM 8089 HG23 VAL B 199 -7.333 78.901 19.733 1.00 0.00 H ATOM 8090 H VAL B 199 -9.519 75.593 18.966 1.00 0.00 H ATOM 8091 N ASP B 200 -8.674 77.077 15.016 1.00 34.21 N ATOM 8092 CA ASP B 200 -7.773 76.733 13.929 1.00 34.12 C ATOM 8093 C ASP B 200 -7.620 77.887 12.957 1.00 33.88 C ATOM 8094 O ASP B 200 -8.354 78.866 13.054 1.00 34.97 O ATOM 8095 CB ASP B 200 -8.168 75.417 13.246 1.00 34.44 C ATOM 8096 CG ASP B 200 -9.579 75.403 12.779 1.00 35.69 C ATOM 8097 OD1 ASP B 200 -9.870 76.161 11.830 1.00 33.82 O ATOM 8098 OD2 ASP B 200 -10.379 74.615 13.360 1.00 38.92 O ATOM 8099 HA ASP B 200 -6.787 76.555 14.358 1.00 0.00 H ATOM 8100 HB2 ASP B 200 -7.516 75.263 12.386 1.00 0.00 H ATOM 8101 HB3 ASP B 200 -8.029 74.602 13.956 1.00 0.00 H ATOM 8102 H ASP B 200 -9.286 77.915 14.940 1.00 0.00 H ATOM 8103 N VAL B 201 -6.672 77.772 12.027 1.00 33.44 N ATOM 8104 CA VAL B 201 -6.327 78.884 11.129 1.00 33.16 C ATOM 8105 C VAL B 201 -7.504 79.460 10.387 1.00 32.62 C ATOM 8106 O VAL B 201 -7.488 80.618 9.994 1.00 32.31 O ATOM 8107 CB VAL B 201 -5.206 78.495 10.123 1.00 32.99 C ATOM 8108 CG1 VAL B 201 -5.601 77.307 9.333 1.00 32.62 C ATOM 8109 CG2 VAL B 201 -4.823 79.677 9.199 1.00 33.54 C ATOM 8110 HA VAL B 201 -5.956 79.666 11.792 1.00 0.00 H ATOM 8111 HB VAL B 201 -4.318 78.242 10.703 1.00 0.00 H ATOM 8112 HG11 VAL B 201 -5.778 76.468 10.005 1.00 0.00 H ATOM 8113 HG12 VAL B 201 -6.512 77.528 8.778 1.00 0.00 H ATOM 8114 HG13 VAL B 201 -4.802 77.053 8.636 1.00 0.00 H ATOM 8115 HG21 VAL B 201 -5.699 79.991 8.631 1.00 0.00 H ATOM 8116 HG22 VAL B 201 -4.465 80.509 9.805 1.00 0.00 H ATOM 8117 HG23 VAL B 201 -4.037 79.361 8.513 1.00 0.00 H ATOM 8118 H VAL B 201 -6.162 76.870 11.934 1.00 0.00 H ATOM 8119 N ARG B 202 -8.533 78.650 10.217 1.00 32.79 N ATOM 8120 CA ARG B 202 -9.772 79.080 9.571 1.00 33.73 C ATOM 8121 C ARG B 202 -10.371 80.261 10.299 1.00 32.83 C ATOM 8122 O ARG B 202 -10.871 81.188 9.668 1.00 33.36 O ATOM 8123 CB ARG B 202 -10.756 77.943 9.627 1.00 33.78 C ATOM 8124 CG ARG B 202 -11.478 77.670 8.396 1.00 37.38 C ATOM 8125 CD ARG B 202 -12.537 76.512 8.598 1.00 40.27 C ATOM 8126 NE ARG B 202 -12.035 75.359 9.358 1.00 42.37 N ATOM 8127 CZ ARG B 202 -12.547 74.903 10.512 1.00 45.18 C ATOM 8128 NH1 ARG B 202 -13.614 75.452 11.094 1.00 44.87 N ATOM 8129 NH2 ARG B 202 -11.973 73.861 11.105 1.00 47.54 N ATOM 8130 HA ARG B 202 -9.555 79.367 8.542 1.00 0.00 H ATOM 8131 HB2 ARG B 202 -10.210 77.041 9.902 1.00 0.00 H ATOM 8132 HB3 ARG B 202 -11.489 78.172 10.401 1.00 0.00 H ATOM 8133 HG2 ARG B 202 -11.996 78.575 8.079 1.00 0.00 H ATOM 8134 HG3 ARG B 202 -10.767 77.372 7.625 1.00 0.00 H ATOM 8135 HD2 ARG B 202 -12.852 76.162 7.615 1.00 0.00 H ATOM 8136 HD3 ARG B 202 -13.396 76.923 9.129 1.00 0.00 H ATOM 8137 HE ARG B 202 -11.214 74.854 8.969 1.00 0.00 H ATOM 8138 HH12 ARG B 202 -13.975 75.064 11.989 1.00 0.00 H ATOM 8139 HH11 ARG B 202 -14.085 76.268 10.653 1.00 0.00 H ATOM 8140 HH22 ARG B 202 -12.357 73.495 12.000 1.00 0.00 H ATOM 8141 HH21 ARG B 202 -11.140 73.412 10.674 1.00 0.00 H ATOM 8142 H ARG B 202 -8.459 77.669 10.555 1.00 0.00 H ATOM 8143 N SER B 203 -10.314 80.236 11.628 1.00 32.43 N ATOM 8144 CA SER B 203 -10.961 81.259 12.446 1.00 33.07 C ATOM 8145 C SER B 203 -10.216 82.596 12.330 1.00 33.53 C ATOM 8146 O SER B 203 -10.834 83.677 12.398 1.00 33.89 O ATOM 8147 CB SER B 203 -11.000 80.829 13.928 1.00 33.61 C ATOM 8148 OG SER B 203 -9.666 80.775 14.459 1.00 34.88 O ATOM 8149 HA SER B 203 -11.980 81.381 12.080 1.00 0.00 H ATOM 8150 HB2 SER B 203 -11.460 79.844 14.006 1.00 0.00 H ATOM 8151 HB3 SER B 203 -11.587 81.549 14.498 1.00 0.00 H ATOM 8152 HG SER B 203 -9.133 80.120 13.943 1.00 0.00 H ATOM 8153 H SER B 203 -9.795 79.467 12.097 1.00 0.00 H ATOM 8154 N ALA B 204 -8.895 82.518 12.188 1.00 33.59 N ATOM 8155 CA ALA B 204 -8.064 83.727 12.001 1.00 34.15 C ATOM 8156 C ALA B 204 -8.495 84.463 10.729 1.00 33.82 C ATOM 8157 O ALA B 204 -8.842 85.648 10.781 1.00 33.46 O ATOM 8158 CB ALA B 204 -6.597 83.371 11.938 1.00 33.63 C ATOM 8159 HA ALA B 204 -8.211 84.385 12.858 1.00 0.00 H ATOM 8160 HB1 ALA B 204 -6.302 82.884 12.868 1.00 0.00 H ATOM 8161 HB2 ALA B 204 -6.424 82.694 11.101 1.00 0.00 H ATOM 8162 HB3 ALA B 204 -6.010 84.279 11.800 1.00 0.00 H ATOM 8163 H ALA B 204 -8.436 81.585 12.209 1.00 0.00 H ATOM 8164 N TYR B 205 -8.526 83.741 9.609 1.00 33.14 N ATOM 8165 CA TYR B 205 -8.996 84.305 8.343 1.00 32.94 C ATOM 8166 C TYR B 205 -10.386 84.888 8.442 1.00 33.15 C ATOM 8167 O TYR B 205 -10.630 85.988 7.965 1.00 33.62 O ATOM 8168 CB TYR B 205 -9.014 83.237 7.259 1.00 32.90 C ATOM 8169 CG TYR B 205 -9.734 83.629 5.984 1.00 31.70 C ATOM 8170 CD1 TYR B 205 -9.214 84.614 5.150 1.00 30.57 C ATOM 8171 CD2 TYR B 205 -10.914 83.010 5.607 1.00 32.61 C ATOM 8172 CE1 TYR B 205 -9.830 84.959 3.969 1.00 31.91 C ATOM 8173 CE2 TYR B 205 -11.577 83.363 4.392 1.00 33.04 C ATOM 8174 CZ TYR B 205 -11.008 84.337 3.586 1.00 32.23 C ATOM 8175 OH TYR B 205 -11.599 84.716 2.421 1.00 30.97 O ATOM 8176 HA TYR B 205 -8.299 85.105 8.094 1.00 0.00 H ATOM 8177 HB3 TYR B 205 -9.503 82.351 7.665 1.00 0.00 H ATOM 8178 HB2 TYR B 205 -7.982 82.996 7.004 1.00 0.00 H ATOM 8179 HD2 TYR B 205 -11.344 82.241 6.248 1.00 0.00 H ATOM 8180 HE2 TYR B 205 -12.510 82.877 4.105 1.00 0.00 H ATOM 8181 HE1 TYR B 205 -9.389 85.725 3.331 1.00 0.00 H ATOM 8182 HD1 TYR B 205 -8.296 85.125 5.439 1.00 0.00 H ATOM 8183 HH TYR B 205 -11.051 85.417 1.987 1.00 0.00 H ATOM 8184 H TYR B 205 -8.208 82.751 9.635 1.00 0.00 H ATOM 8185 N CYS B 206 -11.299 84.131 9.036 1.00 33.42 N ATOM 8186 CA CYS B 206 -12.675 84.574 9.174 1.00 33.77 C ATOM 8187 C CYS B 206 -12.724 85.896 9.903 1.00 33.97 C ATOM 8188 O CYS B 206 -13.374 86.819 9.435 1.00 33.79 O ATOM 8189 CB CYS B 206 -13.516 83.565 9.975 1.00 34.12 C ATOM 8190 SG CYS B 206 -14.150 82.126 9.110 1.00 34.21 S ATOM 8191 HA CYS B 206 -13.083 84.669 8.168 1.00 0.00 H ATOM 8192 HB2 CYS B 206 -14.373 84.105 10.379 1.00 0.00 H ATOM 8193 HB3 CYS B 206 -12.896 83.204 10.795 1.00 0.00 H ATOM 8194 HG CYS B 206 -13.095 81.394 8.603 1.00 0.00 H ATOM 8195 H CYS B 206 -11.024 83.201 9.411 1.00 0.00 H ATOM 8196 N ALA B 207 -12.081 85.945 11.076 1.00 34.49 N ATOM 8197 CA ALA B 207 -11.899 87.199 11.854 1.00 34.91 C ATOM 8198 C ALA B 207 -11.237 88.321 11.025 1.00 35.26 C ATOM 8199 O ALA B 207 -11.690 89.445 11.033 1.00 34.58 O ATOM 8200 CB ALA B 207 -11.064 86.933 13.113 1.00 33.83 C ATOM 8201 HA ALA B 207 -12.896 87.539 12.135 1.00 0.00 H ATOM 8202 HB1 ALA B 207 -11.574 86.199 13.737 1.00 0.00 H ATOM 8203 HB2 ALA B 207 -10.085 86.549 12.824 1.00 0.00 H ATOM 8204 HB3 ALA B 207 -10.942 87.862 13.669 1.00 0.00 H ATOM 8205 H ALA B 207 -11.689 85.062 11.462 1.00 0.00 H ATOM 8206 N ALA B 208 -10.143 88.007 10.338 1.00 36.10 N ATOM 8207 CA ALA B 208 -9.405 89.027 9.553 1.00 37.20 C ATOM 8208 C ALA B 208 -10.278 89.596 8.426 1.00 37.64 C ATOM 8209 O ALA B 208 -10.221 90.787 8.129 1.00 37.01 O ATOM 8210 CB ALA B 208 -8.141 88.456 8.981 1.00 36.58 C ATOM 8211 HA ALA B 208 -9.145 89.837 10.234 1.00 0.00 H ATOM 8212 HB1 ALA B 208 -7.501 88.109 9.792 1.00 0.00 H ATOM 8213 HB2 ALA B 208 -8.385 87.620 8.326 1.00 0.00 H ATOM 8214 HB3 ALA B 208 -7.621 89.226 8.411 1.00 0.00 H ATOM 8215 H ALA B 208 -9.797 87.026 10.351 1.00 0.00 H ATOM 8216 N SER B 209 -11.110 88.728 7.840 1.00 37.44 N ATOM 8217 CA SER B 209 -11.927 89.094 6.702 1.00 37.38 C ATOM 8218 C SER B 209 -13.041 90.056 7.070 1.00 37.77 C ATOM 8219 O SER B 209 -13.228 91.072 6.426 1.00 37.60 O ATOM 8220 CB SER B 209 -12.508 87.837 6.076 1.00 37.11 C ATOM 8221 OG SER B 209 -13.161 88.123 4.862 1.00 35.52 O ATOM 8222 HA SER B 209 -11.287 89.611 5.987 1.00 0.00 H ATOM 8223 HB2 SER B 209 -13.224 87.394 6.768 1.00 0.00 H ATOM 8224 HB3 SER B 209 -11.701 87.129 5.887 1.00 0.00 H ATOM 8225 HG SER B 209 -13.899 88.762 5.028 1.00 0.00 H ATOM 8226 H SER B 209 -11.172 87.759 8.214 1.00 0.00 H ATOM 8227 N VAL B 210 -13.797 89.725 8.103 1.00 38.35 N ATOM 8228 CA VAL B 210 -14.886 90.602 8.528 1.00 39.14 C ATOM 8229 C VAL B 210 -14.368 91.876 9.186 1.00 40.48 C ATOM 8230 O VAL B 210 -14.993 92.919 9.078 1.00 40.87 O ATOM 8231 CB VAL B 210 -15.903 89.886 9.463 1.00 38.51 C ATOM 8232 CG1 VAL B 210 -16.730 88.861 8.643 1.00 37.89 C ATOM 8233 CG2 VAL B 210 -15.194 89.251 10.641 1.00 37.65 C ATOM 8234 HA VAL B 210 -15.416 90.878 7.616 1.00 0.00 H ATOM 8235 HB VAL B 210 -16.597 90.617 9.878 1.00 0.00 H ATOM 8236 HG11 VAL B 210 -17.269 89.381 7.851 1.00 0.00 H ATOM 8237 HG12 VAL B 210 -16.059 88.123 8.204 1.00 0.00 H ATOM 8238 HG13 VAL B 210 -17.441 88.361 9.300 1.00 0.00 H ATOM 8239 HG21 VAL B 210 -14.473 88.519 10.278 1.00 0.00 H ATOM 8240 HG22 VAL B 210 -14.675 90.022 11.210 1.00 0.00 H ATOM 8241 HG23 VAL B 210 -15.925 88.757 11.280 1.00 0.00 H ATOM 8242 H VAL B 210 -13.616 88.838 8.615 1.00 0.00 H ATOM 8243 N ALA B 211 -13.238 91.781 9.868 1.00 42.06 N ATOM 8244 CA ALA B 211 -12.660 92.937 10.566 1.00 43.93 C ATOM 8245 C ALA B 211 -12.254 93.989 9.557 1.00 45.25 C ATOM 8246 O ALA B 211 -12.571 95.150 9.707 1.00 45.44 O ATOM 8247 CB ALA B 211 -11.456 92.530 11.382 1.00 43.68 C ATOM 8248 HA ALA B 211 -13.414 93.342 11.241 1.00 0.00 H ATOM 8249 HB1 ALA B 211 -11.754 91.787 12.122 1.00 0.00 H ATOM 8250 HB2 ALA B 211 -10.699 92.104 10.723 1.00 0.00 H ATOM 8251 HB3 ALA B 211 -11.049 93.405 11.888 1.00 0.00 H ATOM 8252 H ALA B 211 -12.747 90.865 9.911 1.00 0.00 H ATOM 8253 N SER B 212 -11.575 93.547 8.509 1.00 46.43 N ATOM 8254 CA SER B 212 -11.022 94.447 7.538 1.00 47.47 C ATOM 8255 C SER B 212 -12.062 94.994 6.557 1.00 48.52 C ATOM 8256 O SER B 212 -11.930 96.126 6.129 1.00 50.10 O ATOM 8257 CB SER B 212 -9.882 93.782 6.789 1.00 47.10 C ATOM 8258 OG SER B 212 -10.384 93.093 5.686 1.00 47.81 O ATOM 8259 HA SER B 212 -10.642 95.305 8.093 1.00 0.00 H ATOM 8260 HB2 SER B 212 -9.371 93.083 7.452 1.00 0.00 H ATOM 8261 HB3 SER B 212 -9.177 94.542 6.452 1.00 0.00 H ATOM 8262 HG SER B 212 -9.637 92.661 5.200 1.00 0.00 H ATOM 8263 H SER B 212 -11.439 92.523 8.387 1.00 0.00 H ATOM 8264 N LEU B 213 -13.083 94.222 6.179 1.00 48.56 N ATOM 8265 CA LEU B 213 -14.116 94.766 5.311 1.00 48.66 C ATOM 8266 C LEU B 213 -14.890 95.878 6.042 1.00 49.84 C ATOM 8267 O LEU B 213 -15.190 96.936 5.448 1.00 50.08 O ATOM 8268 CB LEU B 213 -15.056 93.680 4.799 1.00 47.53 C ATOM 8269 CG LEU B 213 -14.442 92.751 3.742 1.00 47.14 C ATOM 8270 CD1 LEU B 213 -15.270 91.482 3.599 1.00 43.88 C ATOM 8271 CD2 LEU B 213 -14.279 93.423 2.360 1.00 45.75 C ATOM 8272 HA LEU B 213 -13.630 95.198 4.437 1.00 0.00 H ATOM 8273 HB2 LEU B 213 -15.367 93.071 5.648 1.00 0.00 H ATOM 8274 HB3 LEU B 213 -15.929 94.164 4.361 1.00 0.00 H ATOM 8275 HG LEU B 213 -13.442 92.505 4.100 1.00 0.00 H ATOM 8276 HD21 LEU B 213 -15.256 93.739 1.994 1.00 0.00 H ATOM 8277 HD22 LEU B 213 -13.627 94.291 2.454 1.00 0.00 H ATOM 8278 HD23 LEU B 213 -13.840 92.711 1.661 1.00 0.00 H ATOM 8279 HD11 LEU B 213 -15.300 90.959 4.555 1.00 0.00 H ATOM 8280 HD12 LEU B 213 -16.283 91.743 3.295 1.00 0.00 H ATOM 8281 HD13 LEU B 213 -14.818 90.838 2.845 1.00 0.00 H ATOM 8282 H LEU B 213 -13.140 93.236 6.504 1.00 0.00 H ATOM 8283 N THR B 214 -15.189 95.640 7.318 1.00 50.28 N ATOM 8284 CA THR B 214 -16.015 96.559 8.114 1.00 51.29 C ATOM 8285 C THR B 214 -15.219 97.624 8.903 1.00 53.56 C ATOM 8286 O THR B 214 -15.812 98.422 9.615 1.00 53.22 O ATOM 8287 CB THR B 214 -17.009 95.789 9.078 1.00 50.46 C ATOM 8288 OG1 THR B 214 -16.292 95.038 10.064 1.00 46.83 O ATOM 8289 CG2 THR B 214 -17.912 94.872 8.277 1.00 48.81 C ATOM 8290 HA THR B 214 -16.595 97.104 7.369 1.00 0.00 H ATOM 8291 HB THR B 214 -17.621 96.529 9.593 1.00 0.00 H ATOM 8292 HG1 THR B 214 -15.710 94.376 9.614 1.00 0.00 H ATOM 8293 HG23 THR B 214 -18.451 95.456 7.531 1.00 0.00 H ATOM 8294 HG21 THR B 214 -17.308 94.113 7.779 1.00 0.00 H ATOM 8295 HG22 THR B 214 -18.624 94.390 8.947 1.00 0.00 H ATOM 8296 H THR B 214 -14.826 94.775 7.766 1.00 0.00 H ATOM 8297 N ASN B 215 -13.891 97.642 8.767 1.00 55.89 N ATOM 8298 CA ASN B 215 -13.071 98.667 9.414 1.00 58.05 C ATOM 8299 C ASN B 215 -13.271 98.685 10.927 1.00 59.16 C ATOM 8300 O ASN B 215 -13.626 99.713 11.518 1.00 59.32 O ATOM 8301 CB ASN B 215 -13.425 100.044 8.832 1.00 59.03 C ATOM 8302 CG ASN B 215 -12.546 101.148 9.355 1.00 59.19 C ATOM 8303 OD1 ASN B 215 -11.367 100.937 9.631 1.00 60.53 O ATOM 8304 ND2 ASN B 215 -13.120 102.335 9.504 1.00 57.92 N ATOM 8305 HA ASN B 215 -12.025 98.431 9.221 1.00 0.00 H ATOM 8306 HB2 ASN B 215 -13.320 100.000 7.748 1.00 0.00 H ATOM 8307 HB3 ASN B 215 -14.460 100.273 9.087 1.00 0.00 H ATOM 8308 HD22 ASN B 215 -14.122 102.463 9.256 1.00 0.00 H ATOM 8309 HD21 ASN B 215 -12.568 103.137 9.869 1.00 0.00 H ATOM 8310 H ASN B 215 -13.429 96.912 8.189 1.00 0.00 H ATOM 8311 N ILE B 216 -13.089 97.530 11.544 1.00 59.54 N ATOM 8312 CA ILE B 216 -13.118 97.440 12.985 1.00 60.13 C ATOM 8313 C ILE B 216 -11.759 96.996 13.521 1.00 61.19 C ATOM 8314 O ILE B 216 -11.628 96.737 14.716 1.00 60.98 O ATOM 8315 CB ILE B 216 -14.271 96.530 13.490 1.00 59.44 C ATOM 8316 CG1 ILE B 216 -14.131 95.099 12.959 1.00 58.87 C ATOM 8317 CG2 ILE B 216 -15.600 97.099 13.057 1.00 58.37 C ATOM 8318 CD1 ILE B 216 -15.129 94.145 13.539 1.00 58.76 C ATOM 8319 HA ILE B 216 -13.323 98.436 13.378 1.00 0.00 H ATOM 8320 HB ILE B 216 -14.218 96.497 14.578 1.00 0.00 H ATOM 8321 HG12 ILE B 216 -14.261 95.118 11.877 1.00 0.00 H ATOM 8322 HG13 ILE B 216 -13.130 94.739 13.198 1.00 0.00 H ATOM 8323 HD11 ILE B 216 -15.005 94.105 14.621 1.00 0.00 H ATOM 8324 HD12 ILE B 216 -16.137 94.485 13.299 1.00 0.00 H ATOM 8325 HD13 ILE B 216 -14.969 93.153 13.117 1.00 0.00 H ATOM 8326 HG21 ILE B 216 -15.720 98.098 13.476 1.00 0.00 H ATOM 8327 HG22 ILE B 216 -15.633 97.153 11.969 1.00 0.00 H ATOM 8328 HG23 ILE B 216 -16.403 96.455 13.415 1.00 0.00 H ATOM 8329 H ILE B 216 -12.922 96.671 10.982 1.00 0.00 H ATOM 8330 N ILE B 217 -10.741 96.944 12.661 1.00 62.76 N ATOM 8331 CA ILE B 217 -9.420 96.512 13.107 1.00 64.46 C ATOM 8332 C ILE B 217 -8.777 97.553 14.043 1.00 67.11 C ATOM 8333 O ILE B 217 -8.542 98.681 13.636 1.00 68.11 O ATOM 8334 CB ILE B 217 -8.479 96.206 11.938 1.00 64.49 C ATOM 8335 CG1 ILE B 217 -9.045 95.058 11.084 1.00 63.36 C ATOM 8336 CG2 ILE B 217 -7.082 95.848 12.475 1.00 63.86 C ATOM 8337 CD1 ILE B 217 -8.217 94.719 9.866 1.00 62.45 C ATOM 8338 HA ILE B 217 -9.572 95.585 13.661 1.00 0.00 H ATOM 8339 HB ILE B 217 -8.395 97.090 11.306 1.00 0.00 H ATOM 8340 HG12 ILE B 217 -9.112 94.168 11.710 1.00 0.00 H ATOM 8341 HG13 ILE B 217 -10.043 95.341 10.750 1.00 0.00 H ATOM 8342 HD11 ILE B 217 -8.149 95.594 9.219 1.00 0.00 H ATOM 8343 HD12 ILE B 217 -7.217 94.419 10.180 1.00 0.00 H ATOM 8344 HD13 ILE B 217 -8.689 93.900 9.324 1.00 0.00 H ATOM 8345 HG21 ILE B 217 -6.687 96.688 13.046 1.00 0.00 H ATOM 8346 HG22 ILE B 217 -7.155 94.972 13.119 1.00 0.00 H ATOM 8347 HG23 ILE B 217 -6.417 95.631 11.639 1.00 0.00 H ATOM 8348 H ILE B 217 -10.889 97.213 11.667 1.00 0.00 H ATOM 8349 N THR B 218 -8.545 97.155 15.298 1.00 69.12 N ATOM 8350 CA THR B 218 -7.834 97.943 16.306 1.00 70.97 C ATOM 8351 C THR B 218 -6.396 97.431 16.396 1.00 72.91 C ATOM 8352 O THR B 218 -6.121 96.279 16.036 1.00 73.18 O ATOM 8353 CB THR B 218 -8.435 97.745 17.707 1.00 70.72 C ATOM 8354 OG1 THR B 218 -8.291 96.373 18.081 1.00 69.80 O ATOM 8355 CG2 THR B 218 -9.895 98.155 17.757 1.00 69.45 C ATOM 8356 HA THR B 218 -7.901 98.990 16.012 1.00 0.00 H ATOM 8357 HB THR B 218 -7.899 98.384 18.409 1.00 0.00 H ATOM 8358 HG1 THR B 218 -8.676 96.236 18.983 1.00 0.00 H ATOM 8359 HG23 THR B 218 -9.987 99.202 17.469 1.00 0.00 H ATOM 8360 HG21 THR B 218 -10.469 97.536 17.067 1.00 0.00 H ATOM 8361 HG22 THR B 218 -10.274 98.020 18.770 1.00 0.00 H ATOM 8362 H THR B 218 -8.895 96.217 15.579 1.00 0.00 H ATOM 8363 N PRO B 219 -5.475 98.255 16.925 1.00 75.04 N ATOM 8364 CA PRO B 219 -4.066 97.858 16.850 1.00 75.36 C ATOM 8365 C PRO B 219 -3.659 96.694 17.747 1.00 74.34 C ATOM 8366 O PRO B 219 -2.579 96.139 17.532 1.00 73.68 O ATOM 8367 CB PRO B 219 -3.311 99.127 17.236 1.00 76.44 C ATOM 8368 CG PRO B 219 -4.269 99.951 17.991 1.00 76.88 C ATOM 8369 CD PRO B 219 -5.659 99.555 17.594 1.00 76.00 C ATOM 8370 HA PRO B 219 -3.843 97.479 15.853 1.00 0.00 H ATOM 8371 HD3 PRO B 219 -6.300 99.454 18.470 1.00 0.00 H ATOM 8372 HD2 PRO B 219 -6.092 100.286 16.911 1.00 0.00 H ATOM 8373 HG3 PRO B 219 -4.108 101.004 17.762 1.00 0.00 H ATOM 8374 HG2 PRO B 219 -4.132 99.788 19.060 1.00 0.00 H ATOM 8375 HB2 PRO B 219 -2.449 98.882 17.857 1.00 0.00 H ATOM 8376 HB3 PRO B 219 -2.976 99.656 16.344 1.00 0.00 H ATOM 8377 N ASP B 220 -4.494 96.319 18.721 1.00 72.88 N ATOM 8378 CA ASP B 220 -4.219 95.090 19.497 1.00 71.98 C ATOM 8379 C ASP B 220 -4.973 93.836 18.999 1.00 69.39 C ATOM 8380 O ASP B 220 -4.513 92.726 19.273 1.00 68.87 O ATOM 8381 CB ASP B 220 -4.403 95.265 21.022 1.00 72.10 C ATOM 8382 CG ASP B 220 -5.806 95.649 21.401 1.00 73.44 C ATOM 8383 OD1 ASP B 220 -6.300 96.656 20.850 1.00 76.62 O ATOM 8384 OD2 ASP B 220 -6.417 94.971 22.252 1.00 73.50 O ATOM 8385 HA ASP B 220 -3.160 94.913 19.310 1.00 0.00 H ATOM 8386 HB2 ASP B 220 -4.155 94.324 21.513 1.00 0.00 H ATOM 8387 HB3 ASP B 220 -3.723 96.044 21.368 1.00 0.00 H ATOM 8388 H ASP B 220 -5.336 96.891 18.933 1.00 0.00 H ATOM 8389 N LEU B 221 -6.074 93.999 18.254 1.00 66.36 N ATOM 8390 CA LEU B 221 -6.902 92.841 17.827 1.00 63.74 C ATOM 8391 C LEU B 221 -6.093 91.639 17.333 1.00 61.54 C ATOM 8392 O LEU B 221 -6.278 90.530 17.829 1.00 60.47 O ATOM 8393 CB LEU B 221 -7.916 93.240 16.747 1.00 63.25 C ATOM 8394 CG LEU B 221 -8.973 92.186 16.377 1.00 63.40 C ATOM 8395 CD1 LEU B 221 -9.657 91.574 17.612 1.00 60.28 C ATOM 8396 CD2 LEU B 221 -10.025 92.761 15.408 1.00 62.50 C ATOM 8397 HA LEU B 221 -7.422 92.530 18.733 1.00 0.00 H ATOM 8398 HB2 LEU B 221 -8.442 94.128 17.098 1.00 0.00 H ATOM 8399 HB3 LEU B 221 -7.359 93.483 15.842 1.00 0.00 H ATOM 8400 HG LEU B 221 -8.438 91.382 15.872 1.00 0.00 H ATOM 8401 HD21 LEU B 221 -10.528 93.606 15.879 1.00 0.00 H ATOM 8402 HD22 LEU B 221 -9.532 93.093 14.494 1.00 0.00 H ATOM 8403 HD23 LEU B 221 -10.756 91.989 15.168 1.00 0.00 H ATOM 8404 HD11 LEU B 221 -8.907 91.091 18.239 1.00 0.00 H ATOM 8405 HD12 LEU B 221 -10.153 92.362 18.179 1.00 0.00 H ATOM 8406 HD13 LEU B 221 -10.393 90.837 17.290 1.00 0.00 H ATOM 8407 H LEU B 221 -6.356 94.958 17.968 1.00 0.00 H ATOM 8408 N PHE B 222 -5.175 91.864 16.396 1.00 59.85 N ATOM 8409 CA PHE B 222 -4.480 90.764 15.710 1.00 58.44 C ATOM 8410 C PHE B 222 -3.028 90.545 16.133 1.00 58.51 C ATOM 8411 O PHE B 222 -2.208 89.941 15.421 1.00 57.42 O ATOM 8412 CB PHE B 222 -4.608 90.950 14.200 1.00 57.31 C ATOM 8413 CG PHE B 222 -5.988 90.726 13.715 1.00 56.05 C ATOM 8414 CD1 PHE B 222 -6.813 91.792 13.405 1.00 54.86 C ATOM 8415 CD2 PHE B 222 -6.506 89.430 13.649 1.00 54.22 C ATOM 8416 CE1 PHE B 222 -8.122 91.567 12.979 1.00 54.68 C ATOM 8417 CE2 PHE B 222 -7.814 89.210 13.226 1.00 52.47 C ATOM 8418 CZ PHE B 222 -8.618 90.270 12.891 1.00 52.87 C ATOM 8419 HA PHE B 222 -4.978 89.846 16.021 1.00 0.00 H ATOM 8420 HB2 PHE B 222 -4.309 91.967 13.946 1.00 0.00 H ATOM 8421 HB3 PHE B 222 -3.944 90.243 13.703 1.00 0.00 H ATOM 8422 HD2 PHE B 222 -5.880 88.583 13.931 1.00 0.00 H ATOM 8423 HE2 PHE B 222 -8.200 88.193 13.161 1.00 0.00 H ATOM 8424 HZ PHE B 222 -9.641 90.097 12.557 1.00 0.00 H ATOM 8425 HE1 PHE B 222 -8.759 92.411 12.714 1.00 0.00 H ATOM 8426 HD1 PHE B 222 -6.439 92.812 13.494 1.00 0.00 H ATOM 8427 H PHE B 222 -4.942 92.845 16.142 1.00 0.00 H ATOM 8428 N GLU B 223 -2.743 91.012 17.334 1.00 58.81 N ATOM 8429 CA GLU B 223 -1.448 90.846 17.956 1.00 58.84 C ATOM 8430 C GLU B 223 -1.239 89.369 18.222 1.00 56.06 C ATOM 8431 O GLU B 223 -2.075 88.700 18.816 1.00 54.56 O ATOM 8432 CB GLU B 223 -1.449 91.636 19.252 1.00 60.31 C ATOM 8433 CG GLU B 223 -0.130 91.881 19.904 1.00 64.08 C ATOM 8434 CD GLU B 223 -0.271 92.963 20.973 1.00 69.36 C ATOM 8435 OE1 GLU B 223 0.504 93.946 20.942 1.00 73.08 O ATOM 8436 OE2 GLU B 223 -1.190 92.850 21.824 1.00 71.72 O ATOM 8437 HA GLU B 223 -0.641 91.207 17.318 1.00 0.00 H ATOM 8438 HB2 GLU B 223 -1.897 92.607 19.043 1.00 0.00 H ATOM 8439 HB3 GLU B 223 -2.072 91.096 19.965 1.00 0.00 H ATOM 8440 HG2 GLU B 223 0.221 90.959 20.367 1.00 0.00 H ATOM 8441 HG3 GLU B 223 0.590 92.206 19.153 1.00 0.00 H ATOM 8442 H GLU B 223 -3.483 91.522 17.857 1.00 0.00 H ATOM 8443 N GLY B 224 -0.117 88.872 17.735 1.00 53.97 N ATOM 8444 CA GLY B 224 0.228 87.468 17.817 1.00 51.98 C ATOM 8445 C GLY B 224 -0.325 86.589 16.713 1.00 49.58 C ATOM 8446 O GLY B 224 0.152 85.466 16.543 1.00 48.31 O ATOM 8447 HA3 GLY B 224 -0.145 87.086 18.768 1.00 0.00 H ATOM 8448 HA2 GLY B 224 1.315 87.388 17.796 1.00 0.00 H ATOM 8449 H GLY B 224 0.551 89.520 17.270 1.00 0.00 H ATOM 8450 N THR B 225 -1.323 87.085 15.969 1.00 47.47 N ATOM 8451 CA THR B 225 -2.069 86.249 15.021 1.00 45.57 C ATOM 8452 C THR B 225 -1.187 85.776 13.855 1.00 44.60 C ATOM 8453 O THR B 225 -1.141 84.576 13.547 1.00 42.52 O ATOM 8454 CB THR B 225 -3.361 86.956 14.510 1.00 45.86 C ATOM 8455 OG1 THR B 225 -4.206 87.332 15.632 1.00 45.67 O ATOM 8456 CG2 THR B 225 -4.114 86.039 13.544 1.00 42.72 C ATOM 8457 HA THR B 225 -2.384 85.361 15.568 1.00 0.00 H ATOM 8458 HB THR B 225 -3.082 87.864 13.975 1.00 0.00 H ATOM 8459 HG1 THR B 225 -4.459 86.520 16.139 1.00 0.00 H ATOM 8460 HG23 THR B 225 -3.460 85.772 12.714 1.00 0.00 H ATOM 8461 HG21 THR B 225 -4.423 85.135 14.069 1.00 0.00 H ATOM 8462 HG22 THR B 225 -4.993 86.558 13.163 1.00 0.00 H ATOM 8463 H THR B 225 -1.576 88.089 16.066 1.00 0.00 H ATOM 8464 N ALA B 226 -0.444 86.707 13.256 1.00 44.23 N ATOM 8465 CA ALA B 226 0.434 86.382 12.127 1.00 44.02 C ATOM 8466 C ALA B 226 1.460 85.357 12.535 1.00 44.14 C ATOM 8467 O ALA B 226 1.832 84.480 11.762 1.00 43.94 O ATOM 8468 CB ALA B 226 1.111 87.616 11.614 1.00 43.98 C ATOM 8469 HA ALA B 226 -0.178 85.964 11.328 1.00 0.00 H ATOM 8470 HB1 ALA B 226 0.358 88.331 11.282 1.00 0.00 H ATOM 8471 HB2 ALA B 226 1.708 88.059 12.411 1.00 0.00 H ATOM 8472 HB3 ALA B 226 1.758 87.353 10.777 1.00 0.00 H ATOM 8473 H ALA B 226 -0.488 87.688 13.598 1.00 0.00 H ATOM 8474 N GLU B 227 1.905 85.464 13.771 1.00 45.14 N ATOM 8475 CA GLU B 227 2.943 84.592 14.296 1.00 46.14 C ATOM 8476 C GLU B 227 2.415 83.198 14.620 1.00 44.64 C ATOM 8477 O GLU B 227 3.126 82.212 14.404 1.00 44.60 O ATOM 8478 CB GLU B 227 3.599 85.247 15.525 1.00 47.90 C ATOM 8479 CG GLU B 227 4.475 86.510 15.214 1.00 50.95 C ATOM 8480 CD GLU B 227 3.710 87.842 15.138 1.00 55.06 C ATOM 8481 OE1 GLU B 227 2.517 87.900 15.544 1.00 52.36 O ATOM 8482 OE2 GLU B 227 4.337 88.840 14.662 1.00 60.01 O ATOM 8483 HA GLU B 227 3.699 84.459 13.522 1.00 0.00 H ATOM 8484 HB2 GLU B 227 2.808 85.545 16.213 1.00 0.00 H ATOM 8485 HB3 GLU B 227 4.235 84.504 16.006 1.00 0.00 H ATOM 8486 HG2 GLU B 227 5.228 86.599 15.997 1.00 0.00 H ATOM 8487 HG3 GLU B 227 4.968 86.350 14.255 1.00 0.00 H ATOM 8488 H GLU B 227 1.501 86.195 14.390 1.00 0.00 H ATOM 8489 N TRP B 228 1.171 83.121 15.107 1.00 43.07 N ATOM 8490 CA TRP B 228 0.470 81.838 15.268 1.00 41.55 C ATOM 8491 C TRP B 228 0.202 81.143 13.898 1.00 40.59 C ATOM 8492 O TRP B 228 0.512 79.965 13.720 1.00 40.33 O ATOM 8493 CB TRP B 228 -0.836 82.020 16.084 1.00 41.22 C ATOM 8494 CG TRP B 228 -1.487 80.710 16.404 1.00 40.58 C ATOM 8495 CD1 TRP B 228 -1.246 79.909 17.488 1.00 41.43 C ATOM 8496 CD2 TRP B 228 -2.424 80.010 15.592 1.00 39.94 C ATOM 8497 NE1 TRP B 228 -1.997 78.741 17.404 1.00 41.12 N ATOM 8498 CE2 TRP B 228 -2.729 78.784 16.250 1.00 40.39 C ATOM 8499 CE3 TRP B 228 -3.043 80.292 14.377 1.00 39.33 C ATOM 8500 CZ2 TRP B 228 -3.623 77.855 15.722 1.00 39.30 C ATOM 8501 CZ3 TRP B 228 -3.928 79.366 13.853 1.00 39.27 C ATOM 8502 CH2 TRP B 228 -4.213 78.162 14.528 1.00 38.86 C ATOM 8503 HA TRP B 228 1.126 81.174 15.831 1.00 0.00 H ATOM 8504 HB2 TRP B 228 -0.600 82.533 17.017 1.00 0.00 H ATOM 8505 HB3 TRP B 228 -1.532 82.626 15.504 1.00 0.00 H ATOM 8506 HE1 TRP B 228 -2.001 77.968 18.100 1.00 0.00 H ATOM 8507 HD1 TRP B 228 -0.563 80.152 18.302 1.00 0.00 H ATOM 8508 HZ2 TRP B 228 -3.843 76.922 16.240 1.00 0.00 H ATOM 8509 HH2 TRP B 228 -4.920 77.459 14.088 1.00 0.00 H ATOM 8510 HZ3 TRP B 228 -4.414 79.572 12.899 1.00 0.00 H ATOM 8511 HE3 TRP B 228 -2.835 81.223 13.849 1.00 0.00 H ATOM 8512 H TRP B 228 0.683 83.998 15.381 1.00 0.00 H ATOM 8513 N ILE B 229 -0.340 81.868 12.923 1.00 39.73 N ATOM 8514 CA ILE B 229 -0.483 81.329 11.565 1.00 39.25 C ATOM 8515 C ILE B 229 0.874 80.785 11.040 1.00 40.15 C ATOM 8516 O ILE B 229 0.946 79.686 10.462 1.00 38.56 O ATOM 8517 CB ILE B 229 -0.990 82.395 10.579 1.00 39.30 C ATOM 8518 CG1 ILE B 229 -2.390 82.881 10.970 1.00 39.74 C ATOM 8519 CG2 ILE B 229 -1.017 81.843 9.163 1.00 38.18 C ATOM 8520 CD1 ILE B 229 -2.714 84.240 10.425 1.00 40.42 C ATOM 8521 HA ILE B 229 -1.212 80.521 11.626 1.00 0.00 H ATOM 8522 HB ILE B 229 -0.302 83.240 10.619 1.00 0.00 H ATOM 8523 HG12 ILE B 229 -3.123 82.170 10.589 1.00 0.00 H ATOM 8524 HG13 ILE B 229 -2.453 82.919 12.058 1.00 0.00 H ATOM 8525 HD11 ILE B 229 -1.994 84.964 10.806 1.00 0.00 H ATOM 8526 HD12 ILE B 229 -2.664 84.215 9.336 1.00 0.00 H ATOM 8527 HD13 ILE B 229 -3.718 84.525 10.738 1.00 0.00 H ATOM 8528 HG21 ILE B 229 -0.010 81.542 8.872 1.00 0.00 H ATOM 8529 HG22 ILE B 229 -1.681 80.980 9.124 1.00 0.00 H ATOM 8530 HG23 ILE B 229 -1.379 82.613 8.481 1.00 0.00 H ATOM 8531 H ILE B 229 -0.668 82.834 13.126 1.00 0.00 H ATOM 8532 N ALA B 230 1.957 81.538 11.272 1.00 40.71 N ATOM 8533 CA ALA B 230 3.280 81.115 10.785 1.00 40.68 C ATOM 8534 C ALA B 230 3.704 79.781 11.370 1.00 40.06 C ATOM 8535 O ALA B 230 4.366 79.017 10.682 1.00 39.44 O ATOM 8536 CB ALA B 230 4.326 82.174 11.048 1.00 41.11 C ATOM 8537 HA ALA B 230 3.192 80.983 9.707 1.00 0.00 H ATOM 8538 HB1 ALA B 230 4.046 83.095 10.537 1.00 0.00 H ATOM 8539 HB2 ALA B 230 4.393 82.358 12.120 1.00 0.00 H ATOM 8540 HB3 ALA B 230 5.291 81.830 10.676 1.00 0.00 H ATOM 8541 H ALA B 230 1.862 82.429 11.800 1.00 0.00 H ATOM 8542 N ARG B 231 3.299 79.472 12.611 1.00 39.21 N ATOM 8543 CA ARG B 231 3.648 78.177 13.216 1.00 38.70 C ATOM 8544 C ARG B 231 2.914 77.004 12.566 1.00 38.12 C ATOM 8545 O ARG B 231 3.231 75.823 12.803 1.00 37.64 O ATOM 8546 CB ARG B 231 3.324 78.199 14.687 1.00 38.66 C ATOM 8547 CG ARG B 231 4.113 79.237 15.475 1.00 41.31 C ATOM 8548 CD ARG B 231 3.608 79.362 16.907 1.00 42.79 C ATOM 8549 NE ARG B 231 3.404 78.023 17.462 1.00 43.61 N ATOM 8550 CZ ARG B 231 2.519 77.703 18.402 1.00 42.36 C ATOM 8551 NH1 ARG B 231 1.748 78.626 18.970 1.00 42.72 N ATOM 8552 NH2 ARG B 231 2.402 76.435 18.767 1.00 41.48 N ATOM 8553 HA ARG B 231 4.716 78.031 13.055 1.00 0.00 H ATOM 8554 HB2 ARG B 231 2.262 78.414 14.802 1.00 0.00 H ATOM 8555 HB3 ARG B 231 3.541 77.215 15.102 1.00 0.00 H ATOM 8556 HG2 ARG B 231 5.162 78.943 15.495 1.00 0.00 H ATOM 8557 HG3 ARG B 231 4.017 80.204 14.981 1.00 0.00 H ATOM 8558 HD2 ARG B 231 2.665 79.908 16.915 1.00 0.00 H ATOM 8559 HD3 ARG B 231 4.342 79.898 17.508 1.00 0.00 H ATOM 8560 HE ARG B 231 4.001 77.257 17.090 1.00 0.00 H ATOM 8561 HH12 ARG B 231 1.063 78.352 19.703 1.00 0.00 H ATOM 8562 HH11 ARG B 231 1.830 79.622 18.681 1.00 0.00 H ATOM 8563 HH22 ARG B 231 1.715 76.166 19.500 1.00 0.00 H ATOM 8564 HH21 ARG B 231 2.997 75.708 18.320 1.00 0.00 H ATOM 8565 H ARG B 231 2.732 80.156 13.152 1.00 0.00 H ATOM 8566 N CYS B 232 1.902 77.333 11.761 1.00 37.80 N ATOM 8567 CA CYS B 232 1.070 76.325 11.106 1.00 37.12 C ATOM 8568 C CYS B 232 1.706 75.876 9.804 1.00 36.54 C ATOM 8569 O CYS B 232 1.392 74.797 9.321 1.00 34.99 O ATOM 8570 CB CYS B 232 -0.378 76.801 10.900 1.00 36.64 C ATOM 8571 SG CYS B 232 -1.328 77.018 12.465 1.00 38.09 S ATOM 8572 HA CYS B 232 1.013 75.464 11.772 1.00 0.00 H ATOM 8573 HB2 CYS B 232 -0.896 76.066 10.284 1.00 0.00 H ATOM 8574 HB3 CYS B 232 -0.353 77.758 10.379 1.00 0.00 H ATOM 8575 HG CYS B 232 -0.699 77.957 13.256 1.00 0.00 H ATOM 8576 H CYS B 232 1.698 78.339 11.594 1.00 0.00 H ATOM 8577 N GLN B 233 2.637 76.663 9.264 1.00 36.62 N ATOM 8578 CA GLN B 233 3.391 76.199 8.105 1.00 36.74 C ATOM 8579 C GLN B 233 4.268 75.066 8.587 1.00 37.13 C ATOM 8580 O GLN B 233 4.818 75.158 9.653 1.00 37.19 O ATOM 8581 CB GLN B 233 4.207 77.323 7.512 1.00 36.95 C ATOM 8582 CG GLN B 233 4.860 76.951 6.194 1.00 38.98 C ATOM 8583 CD GLN B 233 5.484 78.141 5.492 1.00 39.57 C ATOM 8584 OE1 GLN B 233 5.926 79.101 6.136 1.00 43.55 O ATOM 8585 NE2 GLN B 233 5.528 78.084 4.171 1.00 39.60 N ATOM 8586 HA GLN B 233 2.727 75.855 7.312 1.00 0.00 H ATOM 8587 HB2 GLN B 233 3.552 78.178 7.346 1.00 0.00 H ATOM 8588 HB3 GLN B 233 4.988 77.597 8.221 1.00 0.00 H ATOM 8589 HG2 GLN B 233 5.638 76.212 6.387 1.00 0.00 H ATOM 8590 HG3 GLN B 233 4.103 76.518 5.540 1.00 0.00 H ATOM 8591 HE22 GLN B 233 5.144 77.256 3.673 1.00 0.00 H ATOM 8592 HE21 GLN B 233 5.947 78.867 3.630 1.00 0.00 H ATOM 8593 H GLN B 233 2.825 77.603 9.667 1.00 0.00 H ATOM 8594 N ASN B 234 4.348 73.978 7.833 1.00 37.67 N ATOM 8595 CA ASN B 234 5.111 72.808 8.243 1.00 37.51 C ATOM 8596 C ASN B 234 6.179 72.438 7.215 1.00 38.42 C ATOM 8597 O ASN B 234 6.476 73.199 6.303 1.00 37.79 O ATOM 8598 CB ASN B 234 4.160 71.626 8.520 1.00 37.33 C ATOM 8599 CG ASN B 234 3.667 70.923 7.260 1.00 36.03 C ATOM 8600 OD1 ASN B 234 3.961 71.332 6.154 1.00 38.98 O ATOM 8601 ND2 ASN B 234 2.934 69.841 7.435 1.00 33.05 N ATOM 8602 HA ASN B 234 5.637 73.052 9.166 1.00 0.00 H ATOM 8603 HB2 ASN B 234 4.687 70.898 9.136 1.00 0.00 H ATOM 8604 HB3 ASN B 234 3.294 72.002 9.065 1.00 0.00 H ATOM 8605 HD22 ASN B 234 2.702 69.520 8.397 1.00 0.00 H ATOM 8606 HD21 ASN B 234 2.588 69.308 6.611 1.00 0.00 H ATOM 8607 H ASN B 234 3.850 73.960 6.920 1.00 0.00 H ATOM 8608 N TRP B 235 6.738 71.251 7.386 1.00 39.23 N ATOM 8609 CA TRP B 235 7.798 70.732 6.559 1.00 40.61 C ATOM 8610 C TRP B 235 7.469 70.554 5.074 1.00 40.64 C ATOM 8611 O TRP B 235 8.371 70.345 4.253 1.00 40.82 O ATOM 8612 CB TRP B 235 8.257 69.384 7.128 1.00 41.58 C ATOM 8613 CG TRP B 235 7.180 68.373 7.184 1.00 41.64 C ATOM 8614 CD1 TRP B 235 6.239 68.217 8.160 1.00 41.74 C ATOM 8615 CD2 TRP B 235 6.932 67.369 6.226 1.00 39.94 C ATOM 8616 NE1 TRP B 235 5.404 67.184 7.841 1.00 40.47 N ATOM 8617 CE2 TRP B 235 5.816 66.645 6.658 1.00 40.14 C ATOM 8618 CE3 TRP B 235 7.528 67.027 5.030 1.00 41.07 C ATOM 8619 CZ2 TRP B 235 5.293 65.596 5.933 1.00 41.51 C ATOM 8620 CZ3 TRP B 235 7.018 65.985 4.311 1.00 41.26 C ATOM 8621 CH2 TRP B 235 5.914 65.275 4.758 1.00 41.65 C ATOM 8622 HA TRP B 235 8.578 71.493 6.589 1.00 0.00 H ATOM 8623 HB2 TRP B 235 9.060 68.999 6.500 1.00 0.00 H ATOM 8624 HB3 TRP B 235 8.633 69.545 8.138 1.00 0.00 H ATOM 8625 HE1 TRP B 235 4.591 66.863 8.405 1.00 0.00 H ATOM 8626 HD1 TRP B 235 6.165 68.826 9.061 1.00 0.00 H ATOM 8627 HZ2 TRP B 235 4.420 65.045 6.282 1.00 0.00 H ATOM 8628 HH2 TRP B 235 5.534 64.446 4.162 1.00 0.00 H ATOM 8629 HZ3 TRP B 235 7.487 65.706 3.368 1.00 0.00 H ATOM 8630 HE3 TRP B 235 8.393 67.580 4.665 1.00 0.00 H ATOM 8631 H TRP B 235 6.391 70.656 8.165 1.00 0.00 H ATOM 8632 N GLU B 236 6.184 70.614 4.729 1.00 39.31 N ATOM 8633 CA GLU B 236 5.765 70.388 3.364 1.00 37.55 C ATOM 8634 C GLU B 236 5.797 71.666 2.590 1.00 35.98 C ATOM 8635 O GLU B 236 5.821 71.633 1.347 1.00 34.85 O ATOM 8636 CB GLU B 236 4.343 69.853 3.336 1.00 37.47 C ATOM 8637 CG GLU B 236 4.113 68.647 4.183 1.00 37.88 C ATOM 8638 CD GLU B 236 2.760 68.003 3.925 1.00 38.76 C ATOM 8639 OE1 GLU B 236 1.926 67.939 4.877 1.00 37.30 O ATOM 8640 OE2 GLU B 236 2.554 67.566 2.769 1.00 36.96 O ATOM 8641 HA GLU B 236 6.449 69.666 2.917 1.00 0.00 H ATOM 8642 HB2 GLU B 236 3.676 70.643 3.682 1.00 0.00 H ATOM 8643 HB3 GLU B 236 4.097 69.596 2.306 1.00 0.00 H ATOM 8644 HG2 GLU B 236 4.894 67.917 3.971 1.00 0.00 H ATOM 8645 HG3 GLU B 236 4.166 68.941 5.231 1.00 0.00 H ATOM 8646 H GLU B 236 5.470 70.827 5.454 1.00 0.00 H ATOM 8647 N GLY B 237 5.762 72.784 3.317 1.00 34.32 N ATOM 8648 CA GLY B 237 5.587 74.098 2.711 1.00 33.62 C ATOM 8649 C GLY B 237 4.210 74.708 2.897 1.00 32.77 C ATOM 8650 O GLY B 237 4.067 75.921 2.936 1.00 31.98 O ATOM 8651 HA3 GLY B 237 5.775 74.006 1.641 1.00 0.00 H ATOM 8652 HA2 GLY B 237 6.320 74.775 3.151 1.00 0.00 H ATOM 8653 H GLY B 237 5.863 72.716 4.350 1.00 0.00 H ATOM 8654 N GLY B 238 3.185 73.869 3.010 1.00 32.62 N ATOM 8655 CA GLY B 238 1.797 74.353 3.149 1.00 32.82 C ATOM 8656 C GLY B 238 1.466 74.645 4.605 1.00 32.87 C ATOM 8657 O GLY B 238 2.344 74.548 5.470 1.00 33.60 O ATOM 8658 HA3 GLY B 238 1.114 73.591 2.773 1.00 0.00 H ATOM 8659 HA2 GLY B 238 1.677 75.266 2.566 1.00 0.00 H ATOM 8660 H GLY B 238 3.366 72.845 3.000 1.00 0.00 H ATOM 8661 N ILE B 239 0.208 74.975 4.879 1.00 32.13 N ATOM 8662 CA ILE B 239 -0.239 75.275 6.247 1.00 31.79 C ATOM 8663 C ILE B 239 -1.283 74.241 6.648 1.00 31.82 C ATOM 8664 O ILE B 239 -2.166 73.868 5.804 1.00 32.14 O ATOM 8665 CB ILE B 239 -0.847 76.697 6.343 1.00 31.83 C ATOM 8666 CG1 ILE B 239 0.185 77.754 5.927 1.00 31.88 C ATOM 8667 CG2 ILE B 239 -1.377 76.993 7.694 1.00 28.91 C ATOM 8668 CD1 ILE B 239 -0.417 79.041 5.456 1.00 27.93 C ATOM 8669 HA ILE B 239 0.619 75.236 6.918 1.00 0.00 H ATOM 8670 HB ILE B 239 -1.690 76.732 5.653 1.00 0.00 H ATOM 8671 HG12 ILE B 239 0.822 77.967 6.785 1.00 0.00 H ATOM 8672 HG13 ILE B 239 0.791 77.343 5.119 1.00 0.00 H ATOM 8673 HD11 ILE B 239 -1.049 78.849 4.589 1.00 0.00 H ATOM 8674 HD12 ILE B 239 -1.017 79.474 6.256 1.00 0.00 H ATOM 8675 HD13 ILE B 239 0.379 79.734 5.181 1.00 0.00 H ATOM 8676 HG21 ILE B 239 -2.158 76.274 7.942 1.00 0.00 H ATOM 8677 HG22 ILE B 239 -0.570 76.921 8.423 1.00 0.00 H ATOM 8678 HG23 ILE B 239 -1.791 78.001 7.707 1.00 0.00 H ATOM 8679 H ILE B 239 -0.481 75.022 4.102 1.00 0.00 H ATOM 8680 N GLY B 240 -1.169 73.781 7.905 1.00 30.74 N ATOM 8681 CA GLY B 240 -2.126 72.872 8.560 1.00 30.44 C ATOM 8682 C GLY B 240 -3.092 73.639 9.464 1.00 30.54 C ATOM 8683 O GLY B 240 -2.896 74.818 9.716 1.00 29.53 O ATOM 8684 HA3 GLY B 240 -1.575 72.149 9.161 1.00 0.00 H ATOM 8685 HA2 GLY B 240 -2.697 72.346 7.795 1.00 0.00 H ATOM 8686 H GLY B 240 -0.343 74.090 8.457 1.00 0.00 H ATOM 8687 N GLY B 241 -4.152 72.988 9.957 1.00 30.10 N ATOM 8688 CA GLY B 241 -5.165 73.715 10.707 1.00 29.07 C ATOM 8689 C GLY B 241 -4.649 74.227 12.031 1.00 28.70 C ATOM 8690 O GLY B 241 -5.022 75.300 12.480 1.00 27.57 O ATOM 8691 HA3 GLY B 241 -6.007 73.049 10.894 1.00 0.00 H ATOM 8692 HA2 GLY B 241 -5.500 74.564 10.110 1.00 0.00 H ATOM 8693 H GLY B 241 -4.252 71.964 9.804 1.00 0.00 H ATOM 8694 N VAL B 242 -3.828 73.421 12.676 1.00 28.97 N ATOM 8695 CA VAL B 242 -3.094 73.840 13.870 1.00 29.09 C ATOM 8696 C VAL B 242 -1.628 73.319 13.799 1.00 30.24 C ATOM 8697 O VAL B 242 -1.311 72.376 13.040 1.00 29.90 O ATOM 8698 CB VAL B 242 -3.812 73.334 15.162 1.00 29.01 C ATOM 8699 CG1 VAL B 242 -5.244 73.857 15.231 1.00 24.65 C ATOM 8700 CG2 VAL B 242 -3.758 71.814 15.245 1.00 25.32 C ATOM 8701 HA VAL B 242 -3.071 74.929 13.910 1.00 0.00 H ATOM 8702 HB VAL B 242 -3.283 73.729 16.029 1.00 0.00 H ATOM 8703 HG11 VAL B 242 -5.231 74.947 15.241 1.00 0.00 H ATOM 8704 HG12 VAL B 242 -5.800 73.507 14.361 1.00 0.00 H ATOM 8705 HG13 VAL B 242 -5.720 73.490 16.140 1.00 0.00 H ATOM 8706 HG21 VAL B 242 -4.254 71.386 14.374 1.00 0.00 H ATOM 8707 HG22 VAL B 242 -2.718 71.489 15.268 1.00 0.00 H ATOM 8708 HG23 VAL B 242 -4.264 71.483 16.152 1.00 0.00 H ATOM 8709 H VAL B 242 -3.698 72.452 12.323 1.00 0.00 H ATOM 8710 N PRO B 243 -0.716 73.942 14.560 1.00 31.60 N ATOM 8711 CA PRO B 243 0.693 73.540 14.528 1.00 32.05 C ATOM 8712 C PRO B 243 0.882 72.051 14.664 1.00 32.61 C ATOM 8713 O PRO B 243 0.291 71.427 15.555 1.00 33.73 O ATOM 8714 CB PRO B 243 1.276 74.285 15.720 1.00 32.40 C ATOM 8715 CG PRO B 243 0.518 75.571 15.748 1.00 31.80 C ATOM 8716 CD PRO B 243 -0.912 75.102 15.458 1.00 32.30 C ATOM 8717 HA PRO B 243 1.173 73.778 13.579 1.00 0.00 H ATOM 8718 HD3 PRO B 243 -1.419 74.804 16.376 1.00 0.00 H ATOM 8719 HD2 PRO B 243 -1.487 75.885 14.964 1.00 0.00 H ATOM 8720 HG3 PRO B 243 0.874 76.258 14.980 1.00 0.00 H ATOM 8721 HG2 PRO B 243 0.588 76.051 16.724 1.00 0.00 H ATOM 8722 HB2 PRO B 243 1.122 73.724 16.641 1.00 0.00 H ATOM 8723 HB3 PRO B 243 2.342 74.466 15.581 1.00 0.00 H ATOM 8724 N GLY B 244 1.641 71.478 13.739 1.00 32.81 N ATOM 8725 CA GLY B 244 1.949 70.056 13.741 1.00 32.88 C ATOM 8726 C GLY B 244 1.168 69.236 12.749 1.00 32.36 C ATOM 8727 O GLY B 244 1.533 68.097 12.430 1.00 31.51 O ATOM 8728 HA3 GLY B 244 1.744 69.666 14.738 1.00 0.00 H ATOM 8729 HA2 GLY B 244 3.009 69.939 13.517 1.00 0.00 H ATOM 8730 H GLY B 244 2.033 72.071 12.980 1.00 0.00 H ATOM 8731 N MET B 245 0.084 69.817 12.254 1.00 32.39 N ATOM 8732 CA MET B 245 -0.831 69.077 11.382 1.00 32.42 C ATOM 8733 C MET B 245 -0.423 69.114 9.914 1.00 31.87 C ATOM 8734 O MET B 245 0.215 70.056 9.447 1.00 30.88 O ATOM 8735 CB MET B 245 -2.262 69.618 11.547 1.00 32.54 C ATOM 8736 CG MET B 245 -3.032 68.976 12.719 1.00 34.22 C ATOM 8737 SD MET B 245 -3.070 67.161 12.503 1.00 39.52 S ATOM 8738 CE MET B 245 -4.026 66.993 10.959 1.00 38.75 C ATOM 8739 HA MET B 245 -0.786 68.033 11.691 1.00 0.00 H ATOM 8740 HB2 MET B 245 -2.207 70.693 11.718 1.00 0.00 H ATOM 8741 HB3 MET B 245 -2.812 69.425 10.626 1.00 0.00 H ATOM 8742 HG2 MET B 245 -4.051 69.361 12.739 1.00 0.00 H ATOM 8743 HG3 MET B 245 -2.535 69.220 13.658 1.00 0.00 H ATOM 8744 HE1 MET B 245 -5.015 67.431 11.096 1.00 0.00 H ATOM 8745 HE2 MET B 245 -3.506 67.511 10.153 1.00 0.00 H ATOM 8746 HE3 MET B 245 -4.126 65.937 10.708 1.00 0.00 H ATOM 8747 H MET B 245 -0.119 70.810 12.488 1.00 0.00 H ATOM 8748 N GLU B 246 -0.843 68.080 9.190 1.00 31.65 N ATOM 8749 CA GLU B 246 -0.636 67.974 7.750 1.00 30.81 C ATOM 8750 C GLU B 246 -1.059 69.222 6.994 1.00 30.37 C ATOM 8751 O GLU B 246 -2.036 69.856 7.336 1.00 31.42 O ATOM 8752 CB GLU B 246 -1.390 66.778 7.203 1.00 30.24 C ATOM 8753 CG GLU B 246 -0.954 66.382 5.824 1.00 30.74 C ATOM 8754 CD GLU B 246 -1.787 65.283 5.218 1.00 31.53 C ATOM 8755 OE1 GLU B 246 -2.827 64.886 5.825 1.00 30.81 O ATOM 8756 OE2 GLU B 246 -1.401 64.836 4.109 1.00 30.11 O ATOM 8757 HA GLU B 246 0.437 67.851 7.600 1.00 0.00 H ATOM 8758 HB2 GLU B 246 -1.231 65.933 7.873 1.00 0.00 H ATOM 8759 HB3 GLU B 246 -2.452 67.022 7.174 1.00 0.00 H ATOM 8760 HG2 GLU B 246 -1.017 67.258 5.178 1.00 0.00 H ATOM 8761 HG3 GLU B 246 0.081 66.042 5.874 1.00 0.00 H ATOM 8762 H GLU B 246 -1.344 67.308 9.675 1.00 0.00 H ATOM 8763 N ALA B 247 -0.295 69.566 5.969 1.00 30.60 N ATOM 8764 CA ALA B 247 -0.594 70.660 5.064 1.00 30.75 C ATOM 8765 C ALA B 247 -1.873 70.388 4.223 1.00 31.03 C ATOM 8766 O ALA B 247 -2.020 69.338 3.596 1.00 29.89 O ATOM 8767 CB ALA B 247 0.580 70.865 4.132 1.00 30.65 C ATOM 8768 HA ALA B 247 -0.773 71.552 5.664 1.00 0.00 H ATOM 8769 HB1 ALA B 247 1.469 71.104 4.716 1.00 0.00 H ATOM 8770 HB2 ALA B 247 0.753 69.953 3.561 1.00 0.00 H ATOM 8771 HB3 ALA B 247 0.361 71.686 3.449 1.00 0.00 H ATOM 8772 H ALA B 247 0.573 69.018 5.802 1.00 0.00 H ATOM 8773 N HIS B 248 -2.757 71.383 4.197 1.00 31.34 N ATOM 8774 CA HIS B 248 -4.049 71.255 3.586 1.00 31.09 C ATOM 8775 C HIS B 248 -4.462 72.506 2.834 1.00 29.85 C ATOM 8776 O HIS B 248 -4.361 73.626 3.346 1.00 28.80 O ATOM 8777 CB HIS B 248 -5.121 70.948 4.646 1.00 31.64 C ATOM 8778 CG HIS B 248 -6.393 70.453 4.037 1.00 34.39 C ATOM 8779 ND1 HIS B 248 -7.409 71.301 3.633 1.00 34.92 N ATOM 8780 CD2 HIS B 248 -6.760 69.206 3.650 1.00 35.27 C ATOM 8781 CE1 HIS B 248 -8.364 70.584 3.067 1.00 36.85 C ATOM 8782 NE2 HIS B 248 -7.998 69.312 3.064 1.00 37.06 N ATOM 8783 HA HIS B 248 -3.970 70.433 2.874 1.00 0.00 H ATOM 8784 HB2 HIS B 248 -4.736 70.186 5.324 1.00 0.00 H ATOM 8785 HB3 HIS B 248 -5.331 71.859 5.207 1.00 0.00 H ATOM 8786 HD2 HIS B 248 -6.181 68.291 3.780 1.00 0.00 H ATOM 8787 HE1 HIS B 248 -9.300 70.976 2.668 1.00 0.00 H ATOM 8788 H HIS B 248 -2.501 72.290 4.637 1.00 0.00 H ATOM 8789 N GLY B 249 -4.987 72.290 1.634 1.00 29.39 N ATOM 8790 CA GLY B 249 -5.297 73.393 0.719 1.00 29.69 C ATOM 8791 C GLY B 249 -6.224 74.436 1.301 1.00 29.73 C ATOM 8792 O GLY B 249 -6.009 75.622 1.117 1.00 30.76 O ATOM 8793 HA3 GLY B 249 -5.766 72.977 -0.173 1.00 0.00 H ATOM 8794 HA2 GLY B 249 -4.363 73.881 0.442 1.00 0.00 H ATOM 8795 H GLY B 249 -5.183 71.313 1.335 1.00 0.00 H ATOM 8796 N GLY B 250 -7.268 73.998 1.996 1.00 29.48 N ATOM 8797 CA GLY B 250 -8.199 74.917 2.609 1.00 29.24 C ATOM 8798 C GLY B 250 -7.583 75.740 3.734 1.00 29.46 C ATOM 8799 O GLY B 250 -7.832 76.940 3.840 1.00 29.15 O ATOM 8800 HA3 GLY B 250 -9.033 74.345 3.015 1.00 0.00 H ATOM 8801 HA2 GLY B 250 -8.567 75.599 1.843 1.00 0.00 H ATOM 8802 H GLY B 250 -7.418 72.974 2.101 1.00 0.00 H ATOM 8803 N TYR B 251 -6.800 75.113 4.600 1.00 29.63 N ATOM 8804 CA TYR B 251 -6.144 75.881 5.659 1.00 30.14 C ATOM 8805 C TYR B 251 -5.050 76.793 5.129 1.00 29.71 C ATOM 8806 O TYR B 251 -4.836 77.878 5.685 1.00 30.23 O ATOM 8807 CB TYR B 251 -5.553 74.962 6.703 1.00 31.15 C ATOM 8808 CG TYR B 251 -6.587 74.235 7.462 1.00 32.43 C ATOM 8809 CD1 TYR B 251 -6.650 72.846 7.434 1.00 34.69 C ATOM 8810 CD2 TYR B 251 -7.521 74.927 8.224 1.00 32.55 C ATOM 8811 CE1 TYR B 251 -7.630 72.169 8.164 1.00 34.61 C ATOM 8812 CE2 TYR B 251 -8.490 74.265 8.958 1.00 32.47 C ATOM 8813 CZ TYR B 251 -8.549 72.897 8.909 1.00 33.06 C ATOM 8814 OH TYR B 251 -9.512 72.252 9.631 1.00 35.78 O ATOM 8815 HA TYR B 251 -6.919 76.504 6.105 1.00 0.00 H ATOM 8816 HB3 TYR B 251 -4.961 75.557 7.399 1.00 0.00 H ATOM 8817 HB2 TYR B 251 -4.908 74.237 6.207 1.00 0.00 H ATOM 8818 HD2 TYR B 251 -7.490 76.016 8.244 1.00 0.00 H ATOM 8819 HE2 TYR B 251 -9.198 74.826 9.568 1.00 0.00 H ATOM 8820 HE1 TYR B 251 -7.673 71.080 8.149 1.00 0.00 H ATOM 8821 HD1 TYR B 251 -5.931 72.283 6.839 1.00 0.00 H ATOM 8822 HH TYR B 251 -9.427 71.275 9.494 1.00 0.00 H ATOM 8823 H TYR B 251 -6.653 74.086 4.528 1.00 0.00 H ATOM 8824 N THR B 252 -4.350 76.350 4.083 1.00 29.39 N ATOM 8825 CA THR B 252 -3.261 77.136 3.495 1.00 29.76 C ATOM 8826 C THR B 252 -3.848 78.398 2.905 1.00 30.50 C ATOM 8827 O THR B 252 -3.341 79.498 3.148 1.00 31.21 O ATOM 8828 CB THR B 252 -2.524 76.339 2.470 1.00 29.62 C ATOM 8829 OG1 THR B 252 -1.991 75.194 3.128 1.00 30.77 O ATOM 8830 CG2 THR B 252 -1.411 77.133 1.818 1.00 29.17 C ATOM 8831 HA THR B 252 -2.536 77.403 4.264 1.00 0.00 H ATOM 8832 HB THR B 252 -3.209 76.056 1.671 1.00 0.00 H ATOM 8833 HG1 THR B 252 -2.731 74.663 3.516 1.00 0.00 H ATOM 8834 HG23 THR B 252 -1.833 78.005 1.319 1.00 0.00 H ATOM 8835 HG21 THR B 252 -0.702 77.456 2.580 1.00 0.00 H ATOM 8836 HG22 THR B 252 -0.900 76.507 1.087 1.00 0.00 H ATOM 8837 H THR B 252 -4.583 75.423 3.674 1.00 0.00 H ATOM 8838 N PHE B 253 -4.963 78.255 2.199 1.00 30.75 N ATOM 8839 CA PHE B 253 -5.644 79.413 1.676 1.00 31.17 C ATOM 8840 C PHE B 253 -5.919 80.398 2.776 1.00 31.38 C ATOM 8841 O PHE B 253 -5.515 81.538 2.658 1.00 32.22 O ATOM 8842 CB PHE B 253 -6.973 79.098 0.979 1.00 30.89 C ATOM 8843 CG PHE B 253 -7.673 80.339 0.535 1.00 31.05 C ATOM 8844 CD1 PHE B 253 -7.216 81.035 -0.598 1.00 31.40 C ATOM 8845 CD2 PHE B 253 -8.696 80.889 1.303 1.00 30.75 C ATOM 8846 CE1 PHE B 253 -7.814 82.204 -0.983 1.00 30.74 C ATOM 8847 CE2 PHE B 253 -9.319 82.079 0.931 1.00 29.58 C ATOM 8848 CZ PHE B 253 -8.883 82.738 -0.217 1.00 30.83 C ATOM 8849 HA PHE B 253 -4.969 79.826 0.927 1.00 0.00 H ATOM 8850 HB2 PHE B 253 -6.776 78.473 0.108 1.00 0.00 H ATOM 8851 HB3 PHE B 253 -7.617 78.558 1.674 1.00 0.00 H ATOM 8852 HD2 PHE B 253 -9.016 80.379 2.212 1.00 0.00 H ATOM 8853 HE2 PHE B 253 -10.134 82.488 1.528 1.00 0.00 H ATOM 8854 HZ PHE B 253 -9.364 83.666 -0.527 1.00 0.00 H ATOM 8855 HE1 PHE B 253 -7.470 82.724 -1.877 1.00 0.00 H ATOM 8856 HD1 PHE B 253 -6.379 80.640 -1.174 1.00 0.00 H ATOM 8857 H PHE B 253 -5.347 77.305 2.023 1.00 0.00 H ATOM 8858 N CYS B 254 -6.591 79.944 3.829 1.00 31.59 N ATOM 8859 CA CYS B 254 -6.974 80.777 4.963 1.00 32.67 C ATOM 8860 C CYS B 254 -5.801 81.457 5.661 1.00 33.44 C ATOM 8861 O CYS B 254 -5.938 82.594 6.111 1.00 33.39 O ATOM 8862 CB CYS B 254 -7.705 79.959 6.027 1.00 33.30 C ATOM 8863 SG CYS B 254 -9.404 79.449 5.637 1.00 35.42 S ATOM 8864 HA CYS B 254 -7.616 81.543 4.527 1.00 0.00 H ATOM 8865 HB2 CYS B 254 -7.740 80.557 6.938 1.00 0.00 H ATOM 8866 HB3 CYS B 254 -7.122 79.056 6.209 1.00 0.00 H ATOM 8867 HG CYS B 254 -9.398 78.668 4.500 1.00 0.00 H ATOM 8868 H CYS B 254 -6.858 78.939 3.845 1.00 0.00 H ATOM 8869 N GLY B 255 -4.679 80.747 5.810 1.00 33.80 N ATOM 8870 CA GLY B 255 -3.521 81.326 6.466 1.00 34.69 C ATOM 8871 C GLY B 255 -2.910 82.458 5.653 1.00 35.59 C ATOM 8872 O GLY B 255 -2.757 83.618 6.149 1.00 35.80 O ATOM 8873 HA3 GLY B 255 -2.770 80.548 6.606 1.00 0.00 H ATOM 8874 HA2 GLY B 255 -3.825 81.715 7.438 1.00 0.00 H ATOM 8875 H GLY B 255 -4.635 79.771 5.453 1.00 0.00 H ATOM 8876 N LEU B 256 -2.584 82.138 4.393 1.00 35.87 N ATOM 8877 CA LEU B 256 -1.975 83.132 3.507 1.00 36.30 C ATOM 8878 C LEU B 256 -2.881 84.320 3.377 1.00 36.41 C ATOM 8879 O LEU B 256 -2.435 85.430 3.573 1.00 38.37 O ATOM 8880 CB LEU B 256 -1.659 82.576 2.111 1.00 36.68 C ATOM 8881 CG LEU B 256 -0.787 83.551 1.282 1.00 37.67 C ATOM 8882 CD1 LEU B 256 0.368 84.072 2.160 1.00 39.04 C ATOM 8883 CD2 LEU B 256 -0.242 82.901 0.009 1.00 35.78 C ATOM 8884 HA LEU B 256 -1.028 83.421 3.962 1.00 0.00 H ATOM 8885 HB2 LEU B 256 -1.125 81.632 2.220 1.00 0.00 H ATOM 8886 HB3 LEU B 256 -2.595 82.403 1.581 1.00 0.00 H ATOM 8887 HG LEU B 256 -1.417 84.383 0.966 1.00 0.00 H ATOM 8888 HD21 LEU B 256 0.372 82.041 0.276 1.00 0.00 H ATOM 8889 HD22 LEU B 256 -1.074 82.575 -0.616 1.00 0.00 H ATOM 8890 HD23 LEU B 256 0.363 83.625 -0.537 1.00 0.00 H ATOM 8891 HD11 LEU B 256 -0.042 84.593 3.025 1.00 0.00 H ATOM 8892 HD12 LEU B 256 0.976 83.231 2.495 1.00 0.00 H ATOM 8893 HD13 LEU B 256 0.983 84.759 1.579 1.00 0.00 H ATOM 8894 H LEU B 256 -2.765 81.176 4.042 1.00 0.00 H ATOM 8895 N ALA B 257 -4.159 84.093 3.080 1.00 35.48 N ATOM 8896 CA ALA B 257 -5.091 85.209 2.895 1.00 35.13 C ATOM 8897 C ALA B 257 -5.204 86.108 4.159 1.00 35.11 C ATOM 8898 O ALA B 257 -5.257 87.331 4.052 1.00 33.85 O ATOM 8899 CB ALA B 257 -6.502 84.705 2.396 1.00 33.45 C ATOM 8900 HA ALA B 257 -4.675 85.842 2.111 1.00 0.00 H ATOM 8901 HB1 ALA B 257 -6.386 84.189 1.443 1.00 0.00 H ATOM 8902 HB2 ALA B 257 -6.923 84.020 3.132 1.00 0.00 H ATOM 8903 HB3 ALA B 257 -7.168 85.559 2.270 1.00 0.00 H ATOM 8904 H ALA B 257 -4.499 83.115 2.978 1.00 0.00 H ATOM 8905 N ALA B 258 -5.217 85.494 5.342 1.00 35.36 N ATOM 8906 CA ALA B 258 -5.283 86.259 6.592 1.00 36.38 C ATOM 8907 C ALA B 258 -4.021 87.100 6.687 1.00 37.51 C ATOM 8908 O ALA B 258 -4.075 88.264 7.085 1.00 37.47 O ATOM 8909 CB ALA B 258 -5.429 85.354 7.829 1.00 35.38 C ATOM 8910 HA ALA B 258 -6.171 86.891 6.576 1.00 0.00 H ATOM 8911 HB1 ALA B 258 -6.345 84.769 7.744 1.00 0.00 H ATOM 8912 HB2 ALA B 258 -4.572 84.683 7.890 1.00 0.00 H ATOM 8913 HB3 ALA B 258 -5.473 85.971 8.726 1.00 0.00 H ATOM 8914 H ALA B 258 -5.180 84.455 5.379 1.00 0.00 H ATOM 8915 N LEU B 259 -2.895 86.521 6.270 1.00 38.76 N ATOM 8916 CA LEU B 259 -1.618 87.264 6.261 1.00 39.82 C ATOM 8917 C LEU B 259 -1.566 88.404 5.230 1.00 40.52 C ATOM 8918 O LEU B 259 -1.088 89.499 5.548 1.00 40.76 O ATOM 8919 CB LEU B 259 -0.428 86.312 6.131 1.00 39.61 C ATOM 8920 CG LEU B 259 -0.294 85.471 7.400 1.00 38.36 C ATOM 8921 CD1 LEU B 259 0.907 84.608 7.321 1.00 37.04 C ATOM 8922 CD2 LEU B 259 -0.230 86.346 8.612 1.00 39.76 C ATOM 8923 HA LEU B 259 -1.550 87.760 7.229 1.00 0.00 H ATOM 8924 HB2 LEU B 259 -0.583 85.654 5.276 1.00 0.00 H ATOM 8925 HB3 LEU B 259 0.484 86.891 5.983 1.00 0.00 H ATOM 8926 HG LEU B 259 -1.175 84.835 7.485 1.00 0.00 H ATOM 8927 HD21 LEU B 259 0.632 87.008 8.535 1.00 0.00 H ATOM 8928 HD22 LEU B 259 -1.141 86.940 8.678 1.00 0.00 H ATOM 8929 HD23 LEU B 259 -0.135 85.725 9.502 1.00 0.00 H ATOM 8930 HD11 LEU B 259 0.820 83.944 6.461 1.00 0.00 H ATOM 8931 HD12 LEU B 259 1.794 85.232 7.212 1.00 0.00 H ATOM 8932 HD13 LEU B 259 0.988 84.016 8.232 1.00 0.00 H ATOM 8933 H LEU B 259 -2.916 85.533 5.947 1.00 0.00 H ATOM 8934 N VAL B 260 -2.097 88.189 4.031 1.00 40.90 N ATOM 8935 CA VAL B 260 -2.251 89.315 3.105 1.00 41.19 C ATOM 8936 C VAL B 260 -3.089 90.416 3.734 1.00 42.25 C ATOM 8937 O VAL B 260 -2.740 91.570 3.609 1.00 42.99 O ATOM 8938 CB VAL B 260 -2.911 88.920 1.785 1.00 40.93 C ATOM 8939 CG1 VAL B 260 -3.320 90.159 0.997 1.00 39.46 C ATOM 8940 CG2 VAL B 260 -2.006 88.013 0.968 1.00 40.42 C ATOM 8941 HA VAL B 260 -1.239 89.663 2.896 1.00 0.00 H ATOM 8942 HB VAL B 260 -3.815 88.355 2.012 1.00 0.00 H ATOM 8943 HG11 VAL B 260 -4.027 90.745 1.584 1.00 0.00 H ATOM 8944 HG12 VAL B 260 -2.436 90.761 0.784 1.00 0.00 H ATOM 8945 HG13 VAL B 260 -3.788 89.855 0.061 1.00 0.00 H ATOM 8946 HG21 VAL B 260 -1.074 88.534 0.749 1.00 0.00 H ATOM 8947 HG22 VAL B 260 -1.793 87.107 1.536 1.00 0.00 H ATOM 8948 HG23 VAL B 260 -2.504 87.750 0.035 1.00 0.00 H ATOM 8949 H VAL B 260 -2.400 87.234 3.753 1.00 0.00 H ATOM 8950 N ILE B 261 -4.182 90.082 4.422 1.00 43.07 N ATOM 8951 CA ILE B 261 -5.021 91.122 4.987 1.00 44.16 C ATOM 8952 C ILE B 261 -4.208 91.832 6.054 1.00 46.44 C ATOM 8953 O ILE B 261 -4.188 93.042 6.091 1.00 46.17 O ATOM 8954 CB ILE B 261 -6.351 90.587 5.594 1.00 44.32 C ATOM 8955 CG1 ILE B 261 -7.299 90.070 4.501 1.00 44.01 C ATOM 8956 CG2 ILE B 261 -7.105 91.676 6.440 1.00 42.81 C ATOM 8957 CD1 ILE B 261 -8.600 89.433 5.069 1.00 42.70 C ATOM 8958 HA ILE B 261 -5.317 91.798 4.185 1.00 0.00 H ATOM 8959 HB ILE B 261 -6.067 89.767 6.254 1.00 0.00 H ATOM 8960 HG12 ILE B 261 -7.574 90.905 3.857 1.00 0.00 H ATOM 8961 HG13 ILE B 261 -6.773 89.318 3.913 1.00 0.00 H ATOM 8962 HD11 ILE B 261 -8.341 88.588 5.707 1.00 0.00 H ATOM 8963 HD12 ILE B 261 -9.143 90.177 5.652 1.00 0.00 H ATOM 8964 HD13 ILE B 261 -9.224 89.089 4.245 1.00 0.00 H ATOM 8965 HG21 ILE B 261 -6.467 92.002 7.261 1.00 0.00 H ATOM 8966 HG22 ILE B 261 -7.344 92.528 5.803 1.00 0.00 H ATOM 8967 HG23 ILE B 261 -8.025 91.251 6.840 1.00 0.00 H ATOM 8968 H ILE B 261 -4.431 89.081 4.553 1.00 0.00 H ATOM 8969 N LEU B 262 -3.517 91.075 6.905 1.00 48.70 N ATOM 8970 CA LEU B 262 -2.733 91.660 8.000 1.00 50.83 C ATOM 8971 C LEU B 262 -1.429 92.332 7.518 1.00 53.87 C ATOM 8972 O LEU B 262 -0.747 92.990 8.302 1.00 54.15 O ATOM 8973 CB LEU B 262 -2.413 90.608 9.079 1.00 49.74 C ATOM 8974 CG LEU B 262 -3.578 90.062 9.907 1.00 48.58 C ATOM 8975 CD1 LEU B 262 -3.014 89.156 10.981 1.00 48.03 C ATOM 8976 CD2 LEU B 262 -4.472 91.124 10.525 1.00 44.84 C ATOM 8977 HA LEU B 262 -3.359 92.441 8.432 1.00 0.00 H ATOM 8978 HB2 LEU B 262 -1.943 89.761 8.579 1.00 0.00 H ATOM 8979 HB3 LEU B 262 -1.703 91.058 9.773 1.00 0.00 H ATOM 8980 HG LEU B 262 -4.228 89.517 9.222 1.00 0.00 H ATOM 8981 HD21 LEU B 262 -3.880 91.753 11.190 1.00 0.00 H ATOM 8982 HD22 LEU B 262 -4.907 91.736 9.735 1.00 0.00 H ATOM 8983 HD23 LEU B 262 -5.268 90.642 11.092 1.00 0.00 H ATOM 8984 HD11 LEU B 262 -2.470 88.335 10.513 1.00 0.00 H ATOM 8985 HD12 LEU B 262 -2.337 89.726 11.617 1.00 0.00 H ATOM 8986 HD13 LEU B 262 -3.830 88.756 11.583 1.00 0.00 H ATOM 8987 H LEU B 262 -3.533 90.041 6.791 1.00 0.00 H ATOM 8988 N LYS B 263 -1.101 92.171 6.239 1.00 56.74 N ATOM 8989 CA LYS B 263 0.157 92.674 5.655 1.00 60.06 C ATOM 8990 C LYS B 263 1.369 92.057 6.338 1.00 60.33 C ATOM 8991 O LYS B 263 2.290 92.751 6.703 1.00 61.19 O ATOM 8992 CB LYS B 263 0.230 94.212 5.654 1.00 60.87 C ATOM 8993 CG LYS B 263 -0.934 94.860 4.887 1.00 62.82 C ATOM 8994 CD LYS B 263 -0.918 96.406 4.923 1.00 63.91 C ATOM 8995 CE LYS B 263 -2.132 97.018 4.159 1.00 64.92 C ATOM 8996 NZ LYS B 263 -2.328 98.483 4.430 1.00 65.84 N ATOM 8997 HA LYS B 263 0.168 92.362 4.611 1.00 0.00 H ATOM 8998 HB2 LYS B 263 0.207 94.563 6.686 1.00 0.00 H ATOM 8999 HB3 LYS B 263 1.167 94.517 5.189 1.00 0.00 H ATOM 9000 HG2 LYS B 263 -0.882 94.539 3.847 1.00 0.00 H ATOM 9001 HG3 LYS B 263 -1.870 94.515 5.326 1.00 0.00 H ATOM 9002 HD2 LYS B 263 -0.953 96.735 5.962 1.00 0.00 H ATOM 9003 HD3 LYS B 263 0.004 96.760 4.462 1.00 0.00 H ATOM 9004 HE2 LYS B 263 -3.035 96.486 4.461 1.00 0.00 H ATOM 9005 HE3 LYS B 263 -1.972 96.882 3.089 1.00 0.00 H ATOM 9006 HZ1 LYS B 263 -2.492 98.627 5.447 1.00 0.00 H ATOM 9007 HZ2 LYS B 263 -1.478 99.005 4.137 1.00 0.00 H ATOM 9008 HZ3 LYS B 263 -3.149 98.827 3.893 1.00 0.00 H ATOM 9009 H LYS B 263 -1.765 91.665 5.619 1.00 0.00 H ATOM 9010 N LYS B 264 1.388 90.753 6.487 1.00 60.51 N ATOM 9011 CA LYS B 264 2.496 90.109 7.108 1.00 60.94 C ATOM 9012 C LYS B 264 2.776 88.931 6.273 1.00 60.10 C ATOM 9013 O LYS B 264 3.309 87.953 6.711 1.00 59.73 O ATOM 9014 CB LYS B 264 2.188 89.745 8.538 1.00 20.00 C ATOM 9015 CG LYS B 264 1.695 90.924 9.348 1.00 20.00 C ATOM 9016 CD LYS B 264 2.763 91.384 10.302 1.00 20.00 C ATOM 9017 CE LYS B 264 2.228 92.348 11.343 1.00 20.00 C ATOM 9018 NZ LYS B 264 3.012 92.220 12.591 1.00 20.00 N ATOM 9019 HA LYS B 264 3.369 90.759 7.169 1.00 0.00 H ATOM 9020 HB2 LYS B 264 1.419 88.972 8.544 1.00 0.00 H ATOM 9021 HB3 LYS B 264 3.095 89.357 9.002 1.00 0.00 H ATOM 9022 HG2 LYS B 264 1.438 91.741 8.674 1.00 0.00 H ATOM 9023 HG3 LYS B 264 0.811 90.628 9.913 1.00 0.00 H ATOM 9024 HD2 LYS B 264 3.178 90.514 10.810 1.00 0.00 H ATOM 9025 HD3 LYS B 264 3.550 91.881 9.735 1.00 0.00 H ATOM 9026 HE2 LYS B 264 1.182 92.118 11.547 1.00 0.00 H ATOM 9027 HE3 LYS B 264 2.308 93.368 10.968 1.00 0.00 H ATOM 9028 HZ1 LYS B 264 2.934 91.247 12.949 1.00 0.00 H ATOM 9029 HZ2 LYS B 264 4.010 92.441 12.396 1.00 0.00 H ATOM 9030 HZ3 LYS B 264 2.641 92.883 13.301 1.00 0.00 H ATOM 9031 H LYS B 264 0.586 90.184 6.148 1.00 0.00 H ATOM 9032 N GLU B 265 2.415 89.058 5.021 1.00 60.16 N ATOM 9033 CA GLU B 265 2.749 88.068 4.047 1.00 60.86 C ATOM 9034 C GLU B 265 4.083 87.478 4.427 1.00 60.94 C ATOM 9035 O GLU B 265 4.265 86.291 4.412 1.00 60.06 O ATOM 9036 CB GLU B 265 2.830 88.717 2.661 1.00 61.30 C ATOM 9037 CG GLU B 265 1.535 89.276 2.134 1.00 62.92 C ATOM 9038 CD GLU B 265 1.351 90.734 2.455 1.00 64.84 C ATOM 9039 OE1 GLU B 265 2.044 91.189 3.346 1.00 68.90 O ATOM 9040 OE2 GLU B 265 0.523 91.435 1.857 1.00 63.79 O ATOM 9041 HA GLU B 265 1.990 87.286 4.015 1.00 0.00 H ATOM 9042 HB2 GLU B 265 3.552 89.532 2.712 1.00 0.00 H ATOM 9043 HB3 GLU B 265 3.183 87.964 1.957 1.00 0.00 H ATOM 9044 HG2 GLU B 265 1.519 89.154 1.051 1.00 0.00 H ATOM 9045 HG3 GLU B 265 0.710 88.716 2.574 1.00 0.00 H ATOM 9046 H GLU B 265 1.874 89.897 4.730 1.00 0.00 H ATOM 9047 N ARG B 266 5.025 88.339 4.769 1.00 61.80 N ATOM 9048 CA ARG B 266 6.414 87.946 4.984 1.00 62.15 C ATOM 9049 C ARG B 266 6.708 87.023 6.159 1.00 61.04 C ATOM 9050 O ARG B 266 7.792 86.514 6.264 1.00 60.13 O ATOM 9051 CB ARG B 266 7.304 89.185 5.061 1.00 62.62 C ATOM 9052 HA ARG B 266 6.641 87.333 4.112 1.00 0.00 H ATOM 9053 HB2 ARG B 266 7.230 89.743 4.127 1.00 0.00 H ATOM 9054 HB3 ARG B 266 6.977 89.815 5.889 1.00 0.00 H ATOM 9055 H ARG B 266 4.766 89.339 4.890 1.00 0.00 H ATOM 9056 N SER B 267 5.738 86.786 7.026 1.00 59.91 N ATOM 9057 CA SER B 267 5.953 85.876 8.139 1.00 59.17 C ATOM 9058 C SER B 267 6.187 84.436 7.750 1.00 57.82 C ATOM 9059 O SER B 267 6.705 83.677 8.511 1.00 57.47 O ATOM 9060 CB SER B 267 4.841 85.999 9.148 1.00 58.98 C ATOM 9061 OG SER B 267 4.568 87.339 9.443 1.00 58.37 O ATOM 9062 HA SER B 267 6.892 86.192 8.593 1.00 0.00 H ATOM 9063 HB2 SER B 267 5.134 85.486 10.064 1.00 0.00 H ATOM 9064 HB3 SER B 267 3.942 85.534 8.744 1.00 0.00 H ATOM 9065 HG SER B 267 4.296 87.809 8.615 1.00 0.00 H ATOM 9066 H SER B 267 4.816 87.253 6.911 1.00 0.00 H ATOM 9067 N LEU B 268 5.859 84.081 6.533 1.00 56.23 N ATOM 9068 CA LEU B 268 5.929 82.705 6.031 1.00 55.30 C ATOM 9069 C LEU B 268 7.089 82.432 5.070 1.00 54.79 C ATOM 9070 O LEU B 268 7.481 83.304 4.329 1.00 55.45 O ATOM 9071 CB LEU B 268 4.638 82.404 5.266 1.00 55.15 C ATOM 9072 CG LEU B 268 3.301 82.336 6.018 1.00 55.39 C ATOM 9073 CD1 LEU B 268 2.125 82.479 5.035 1.00 54.54 C ATOM 9074 CD2 LEU B 268 3.186 81.041 6.830 1.00 55.22 C ATOM 9075 HA LEU B 268 6.078 82.076 6.908 1.00 0.00 H ATOM 9076 HB2 LEU B 268 4.534 83.179 4.506 1.00 0.00 H ATOM 9077 HB3 LEU B 268 4.777 81.438 4.781 1.00 0.00 H ATOM 9078 HG LEU B 268 3.264 83.168 6.722 1.00 0.00 H ATOM 9079 HD21 LEU B 268 3.251 80.185 6.158 1.00 0.00 H ATOM 9080 HD22 LEU B 268 3.997 80.996 7.557 1.00 0.00 H ATOM 9081 HD23 LEU B 268 2.228 81.024 7.350 1.00 0.00 H ATOM 9082 HD11 LEU B 268 2.196 83.438 4.522 1.00 0.00 H ATOM 9083 HD12 LEU B 268 2.164 81.671 4.304 1.00 0.00 H ATOM 9084 HD13 LEU B 268 1.185 82.429 5.585 1.00 0.00 H ATOM 9085 H LEU B 268 5.528 84.821 5.882 1.00 0.00 H ATOM 9086 N ASN B 269 7.594 81.205 5.019 1.00 53.46 N ATOM 9087 CA ASN B 269 8.449 80.808 3.907 1.00 52.81 C ATOM 9088 C ASN B 269 7.620 80.707 2.610 1.00 52.64 C ATOM 9089 O ASN B 269 7.065 79.635 2.252 1.00 51.39 O ATOM 9090 CB ASN B 269 9.146 79.484 4.189 1.00 52.10 C ATOM 9091 CG ASN B 269 10.181 79.122 3.126 1.00 51.40 C ATOM 9092 OD1 ASN B 269 10.219 79.700 2.033 1.00 49.41 O ATOM 9093 ND2 ASN B 269 11.012 78.142 3.434 1.00 47.03 N ATOM 9094 HA ASN B 269 9.217 81.572 3.783 1.00 0.00 H ATOM 9095 HB2 ASN B 269 9.647 79.553 5.154 1.00 0.00 H ATOM 9096 HB3 ASN B 269 8.394 78.695 4.227 1.00 0.00 H ATOM 9097 HD22 ASN B 269 10.949 77.680 4.364 1.00 0.00 H ATOM 9098 HD21 ASN B 269 11.729 77.833 2.747 1.00 0.00 H ATOM 9099 H ASN B 269 7.379 80.524 5.775 1.00 0.00 H ATOM 9100 N LEU B 270 7.536 81.832 1.909 1.00 52.31 N ATOM 9101 CA LEU B 270 6.789 81.876 0.661 1.00 51.97 C ATOM 9102 C LEU B 270 7.370 80.989 -0.439 1.00 52.21 C ATOM 9103 O LEU B 270 6.639 80.596 -1.319 1.00 52.29 O ATOM 9104 CB LEU B 270 6.674 83.297 0.132 1.00 51.77 C ATOM 9105 CG LEU B 270 5.887 84.284 0.982 1.00 50.53 C ATOM 9106 CD1 LEU B 270 5.937 85.676 0.352 1.00 49.17 C ATOM 9107 CD2 LEU B 270 4.464 83.824 1.180 1.00 46.48 C ATOM 9108 HA LEU B 270 5.803 81.486 0.914 1.00 0.00 H ATOM 9109 HB2 LEU B 270 7.684 83.690 0.020 1.00 0.00 H ATOM 9110 HB3 LEU B 270 6.194 83.247 -0.846 1.00 0.00 H ATOM 9111 HG LEU B 270 6.349 84.334 1.968 1.00 0.00 H ATOM 9112 HD21 LEU B 270 3.975 83.733 0.210 1.00 0.00 H ATOM 9113 HD22 LEU B 270 4.463 82.856 1.681 1.00 0.00 H ATOM 9114 HD23 LEU B 270 3.930 84.552 1.791 1.00 0.00 H ATOM 9115 HD11 LEU B 270 6.974 86.007 0.286 1.00 0.00 H ATOM 9116 HD12 LEU B 270 5.503 85.637 -0.647 1.00 0.00 H ATOM 9117 HD13 LEU B 270 5.370 86.373 0.969 1.00 0.00 H ATOM 9118 H LEU B 270 8.009 82.691 2.256 1.00 0.00 H ATOM 9119 N LYS B 271 8.663 80.675 -0.412 1.00 52.46 N ATOM 9120 CA LYS B 271 9.260 79.853 -1.477 1.00 51.88 C ATOM 9121 C LYS B 271 8.776 78.389 -1.348 1.00 50.58 C ATOM 9122 O LYS B 271 8.354 77.761 -2.336 1.00 49.23 O ATOM 9123 CB LYS B 271 10.805 79.961 -1.493 1.00 51.87 C ATOM 9124 HA LYS B 271 8.923 80.237 -2.440 1.00 0.00 H ATOM 9125 HB2 LYS B 271 11.094 80.999 -1.660 1.00 0.00 H ATOM 9126 HB3 LYS B 271 11.202 79.621 -0.536 1.00 0.00 H ATOM 9127 H LYS B 271 9.258 81.014 0.370 1.00 0.00 H ATOM 9128 N SER B 272 8.819 77.852 -0.131 1.00 49.44 N ATOM 9129 CA SER B 272 8.351 76.477 0.071 1.00 48.72 C ATOM 9130 C SER B 272 6.794 76.358 -0.035 1.00 46.50 C ATOM 9131 O SER B 272 6.282 75.352 -0.471 1.00 45.75 O ATOM 9132 CB SER B 272 8.886 75.885 1.381 1.00 48.91 C ATOM 9133 OG SER B 272 8.327 76.551 2.491 1.00 49.88 O ATOM 9134 HA SER B 272 8.761 75.880 -0.743 1.00 0.00 H ATOM 9135 HB2 SER B 272 9.970 75.993 1.407 1.00 0.00 H ATOM 9136 HB3 SER B 272 8.626 74.828 1.429 1.00 0.00 H ATOM 9137 HG SER B 272 8.684 76.156 3.326 1.00 0.00 H ATOM 9138 H SER B 272 9.182 78.404 0.672 1.00 0.00 H ATOM 9139 N LEU B 273 6.061 77.391 0.326 1.00 44.73 N ATOM 9140 CA LEU B 273 4.652 77.417 0.047 1.00 44.05 C ATOM 9141 C LEU B 273 4.350 77.354 -1.467 1.00 43.85 C ATOM 9142 O LEU B 273 3.480 76.592 -1.927 1.00 43.53 O ATOM 9143 CB LEU B 273 4.037 78.651 0.696 1.00 43.86 C ATOM 9144 CG LEU B 273 2.582 79.028 0.421 1.00 43.71 C ATOM 9145 CD1 LEU B 273 1.738 77.815 0.053 1.00 43.19 C ATOM 9146 CD2 LEU B 273 2.015 79.765 1.631 1.00 41.65 C ATOM 9147 HA LEU B 273 4.198 76.523 0.475 1.00 0.00 H ATOM 9148 HB2 LEU B 273 4.126 78.515 1.774 1.00 0.00 H ATOM 9149 HB3 LEU B 273 4.644 79.502 0.387 1.00 0.00 H ATOM 9150 HG LEU B 273 2.551 79.691 -0.444 1.00 0.00 H ATOM 9151 HD21 LEU B 273 2.066 79.117 2.506 1.00 0.00 H ATOM 9152 HD22 LEU B 273 2.599 80.668 1.811 1.00 0.00 H ATOM 9153 HD23 LEU B 273 0.977 80.035 1.437 1.00 0.00 H ATOM 9154 HD11 LEU B 273 2.145 77.350 -0.845 1.00 0.00 H ATOM 9155 HD12 LEU B 273 1.755 77.099 0.875 1.00 0.00 H ATOM 9156 HD13 LEU B 273 0.712 78.131 -0.134 1.00 0.00 H ATOM 9157 H LEU B 273 6.505 78.193 0.816 1.00 0.00 H ATOM 9158 N LEU B 274 5.091 78.120 -2.253 1.00 43.80 N ATOM 9159 CA LEU B 274 4.904 78.084 -3.681 1.00 42.63 C ATOM 9160 C LEU B 274 5.196 76.697 -4.199 1.00 42.24 C ATOM 9161 O LEU B 274 4.434 76.187 -5.022 1.00 42.78 O ATOM 9162 CB LEU B 274 5.795 79.083 -4.394 1.00 43.33 C ATOM 9163 CG LEU B 274 5.678 79.037 -5.925 1.00 42.78 C ATOM 9164 CD1 LEU B 274 4.385 79.749 -6.351 1.00 40.29 C ATOM 9165 CD2 LEU B 274 6.959 79.609 -6.607 1.00 40.93 C ATOM 9166 HA LEU B 274 3.867 78.352 -3.883 1.00 0.00 H ATOM 9167 HB2 LEU B 274 5.526 80.085 -4.059 1.00 0.00 H ATOM 9168 HB3 LEU B 274 6.830 78.876 -4.122 1.00 0.00 H ATOM 9169 HG LEU B 274 5.611 78.003 -6.264 1.00 0.00 H ATOM 9170 HD21 LEU B 274 7.101 80.645 -6.300 1.00 0.00 H ATOM 9171 HD22 LEU B 274 7.824 79.018 -6.306 1.00 0.00 H ATOM 9172 HD23 LEU B 274 6.844 79.562 -7.690 1.00 0.00 H ATOM 9173 HD11 LEU B 274 3.529 79.245 -5.902 1.00 0.00 H ATOM 9174 HD12 LEU B 274 4.415 80.786 -6.016 1.00 0.00 H ATOM 9175 HD13 LEU B 274 4.296 79.720 -7.437 1.00 0.00 H ATOM 9176 H LEU B 274 5.809 78.748 -1.839 1.00 0.00 H ATOM 9177 N GLN B 275 6.280 76.060 -3.771 1.00 41.01 N ATOM 9178 CA GLN B 275 6.561 74.771 -4.418 1.00 40.44 C ATOM 9179 C GLN B 275 5.479 73.730 -4.022 1.00 37.79 C ATOM 9180 O GLN B 275 5.170 72.796 -4.822 1.00 35.98 O ATOM 9181 CB GLN B 275 8.026 74.277 -4.254 1.00 40.67 C ATOM 9182 CG GLN B 275 8.410 73.487 -3.010 1.00 44.26 C ATOM 9183 CD GLN B 275 7.814 72.045 -2.851 1.00 46.31 C ATOM 9184 OE1 GLN B 275 7.881 71.484 -1.740 1.00 47.98 O ATOM 9185 NE2 GLN B 275 7.266 71.447 -3.944 1.00 44.24 N ATOM 9186 HA GLN B 275 6.488 74.920 -5.495 1.00 0.00 H ATOM 9187 HB2 GLN B 275 8.247 73.645 -5.114 1.00 0.00 H ATOM 9188 HB3 GLN B 275 8.665 75.160 -4.280 1.00 0.00 H ATOM 9189 HG2 GLN B 275 9.496 73.393 -3.006 1.00 0.00 H ATOM 9190 HG3 GLN B 275 8.093 74.068 -2.144 1.00 0.00 H ATOM 9191 HE22 GLN B 275 7.232 71.954 -4.852 1.00 0.00 H ATOM 9192 HE21 GLN B 275 6.882 70.483 -3.872 1.00 0.00 H ATOM 9193 H GLN B 275 6.891 76.449 -3.025 1.00 0.00 H ATOM 9194 N TRP B 276 4.901 73.943 -2.830 1.00 35.06 N ATOM 9195 CA TRP B 276 3.832 73.073 -2.307 1.00 33.80 C ATOM 9196 C TRP B 276 2.520 73.224 -3.107 1.00 32.07 C ATOM 9197 O TRP B 276 1.966 72.251 -3.575 1.00 29.83 O ATOM 9198 CB TRP B 276 3.576 73.322 -0.819 1.00 33.11 C ATOM 9199 CG TRP B 276 2.530 72.368 -0.276 1.00 33.81 C ATOM 9200 CD1 TRP B 276 2.726 71.083 0.116 1.00 33.25 C ATOM 9201 CD2 TRP B 276 1.126 72.638 -0.075 1.00 31.60 C ATOM 9202 NE1 TRP B 276 1.545 70.530 0.538 1.00 32.88 N ATOM 9203 CE2 TRP B 276 0.548 71.458 0.429 1.00 31.52 C ATOM 9204 CE3 TRP B 276 0.316 73.751 -0.295 1.00 31.63 C ATOM 9205 CZ2 TRP B 276 -0.791 71.356 0.733 1.00 31.99 C ATOM 9206 CZ3 TRP B 276 -1.031 73.659 0.013 1.00 32.91 C ATOM 9207 CH2 TRP B 276 -1.570 72.462 0.520 1.00 32.73 C ATOM 9208 HA TRP B 276 4.184 72.048 -2.427 1.00 0.00 H ATOM 9209 HB2 TRP B 276 4.506 73.180 -0.269 1.00 0.00 H ATOM 9210 HB3 TRP B 276 3.228 74.346 -0.684 1.00 0.00 H ATOM 9211 HE1 TRP B 276 1.426 69.557 0.886 1.00 0.00 H ATOM 9212 HD1 TRP B 276 3.685 70.565 0.098 1.00 0.00 H ATOM 9213 HZ2 TRP B 276 -1.214 70.432 1.127 1.00 0.00 H ATOM 9214 HH2 TRP B 276 -2.635 72.414 0.749 1.00 0.00 H ATOM 9215 HZ3 TRP B 276 -1.680 74.522 -0.139 1.00 0.00 H ATOM 9216 HE3 TRP B 276 0.733 74.673 -0.700 1.00 0.00 H ATOM 9217 H TRP B 276 5.218 74.750 -2.255 1.00 0.00 H ATOM 9218 N VAL B 277 2.058 74.450 -3.283 1.00 31.51 N ATOM 9219 CA VAL B 277 0.787 74.631 -3.926 1.00 31.98 C ATOM 9220 C VAL B 277 0.885 74.160 -5.374 1.00 32.47 C ATOM 9221 O VAL B 277 0.027 73.421 -5.818 1.00 32.28 O ATOM 9222 CB VAL B 277 0.252 76.066 -3.819 1.00 32.15 C ATOM 9223 CG1 VAL B 277 1.047 76.997 -4.706 1.00 32.54 C ATOM 9224 CG2 VAL B 277 -1.240 76.099 -4.155 1.00 30.84 C ATOM 9225 HA VAL B 277 0.053 74.021 -3.399 1.00 0.00 H ATOM 9226 HB VAL B 277 0.370 76.414 -2.793 1.00 0.00 H ATOM 9227 HG11 VAL B 277 2.093 76.985 -4.398 1.00 0.00 H ATOM 9228 HG12 VAL B 277 0.968 76.666 -5.741 1.00 0.00 H ATOM 9229 HG13 VAL B 277 0.652 78.009 -4.615 1.00 0.00 H ATOM 9230 HG21 VAL B 277 -1.390 75.736 -5.172 1.00 0.00 H ATOM 9231 HG22 VAL B 277 -1.783 75.462 -3.457 1.00 0.00 H ATOM 9232 HG23 VAL B 277 -1.607 77.122 -4.075 1.00 0.00 H ATOM 9233 H VAL B 277 2.607 75.272 -2.960 1.00 0.00 H ATOM 9234 N THR B 278 1.963 74.503 -6.079 1.00 32.96 N ATOM 9235 CA THR B 278 2.067 74.127 -7.491 1.00 33.24 C ATOM 9236 C THR B 278 2.094 72.626 -7.663 1.00 32.60 C ATOM 9237 O THR B 278 1.510 72.099 -8.625 1.00 32.16 O ATOM 9238 CB THR B 278 3.304 74.753 -8.203 1.00 34.38 C ATOM 9239 OG1 THR B 278 4.504 74.443 -7.462 1.00 37.61 O ATOM 9240 CG2 THR B 278 3.132 76.291 -8.354 1.00 31.75 C ATOM 9241 HA THR B 278 1.173 74.531 -7.966 1.00 0.00 H ATOM 9242 HB THR B 278 3.388 74.326 -9.202 1.00 0.00 H ATOM 9243 HG1 THR B 278 4.616 73.461 -7.414 1.00 0.00 H ATOM 9244 HG23 THR B 278 2.221 76.500 -8.915 1.00 0.00 H ATOM 9245 HG21 THR B 278 3.064 76.746 -7.366 1.00 0.00 H ATOM 9246 HG22 THR B 278 3.991 76.701 -8.886 1.00 0.00 H ATOM 9247 H THR B 278 2.731 75.038 -5.626 1.00 0.00 H ATOM 9248 N SER B 279 2.751 71.949 -6.719 1.00 32.52 N ATOM 9249 CA SER B 279 2.761 70.466 -6.639 1.00 32.14 C ATOM 9250 C SER B 279 1.411 69.782 -6.495 1.00 31.50 C ATOM 9251 O SER B 279 1.284 68.633 -6.840 1.00 32.82 O ATOM 9252 CB SER B 279 3.598 70.024 -5.451 1.00 32.40 C ATOM 9253 OG SER B 279 4.961 70.215 -5.742 1.00 35.76 O ATOM 9254 HA SER B 279 3.165 70.164 -7.605 1.00 0.00 H ATOM 9255 HB2 SER B 279 3.414 68.969 -5.248 1.00 0.00 H ATOM 9256 HB3 SER B 279 3.327 70.614 -4.575 1.00 0.00 H ATOM 9257 HG SER B 279 5.127 71.174 -5.925 1.00 0.00 H ATOM 9258 H SER B 279 3.282 72.486 -6.004 1.00 0.00 H ATOM 9259 N ARG B 280 0.414 70.468 -5.952 1.00 31.26 N ATOM 9260 CA ARG B 280 -0.936 69.873 -5.767 1.00 31.26 C ATOM 9261 C ARG B 280 -1.829 69.868 -7.059 1.00 31.16 C ATOM 9262 O ARG B 280 -2.982 69.401 -7.037 1.00 30.02 O ATOM 9263 CB ARG B 280 -1.704 70.606 -4.641 1.00 31.39 C ATOM 9264 CG ARG B 280 -0.928 70.867 -3.321 1.00 30.83 C ATOM 9265 CD ARG B 280 -1.037 69.693 -2.391 1.00 30.47 C ATOM 9266 NE ARG B 280 -0.428 68.549 -3.006 1.00 30.05 N ATOM 9267 CZ ARG B 280 0.871 68.326 -2.999 1.00 33.09 C ATOM 9268 NH1 ARG B 280 1.683 69.186 -2.394 1.00 33.60 N ATOM 9269 NH2 ARG B 280 1.368 67.253 -3.589 1.00 35.86 N ATOM 9270 HA ARG B 280 -0.748 68.832 -5.505 1.00 0.00 H ATOM 9271 HB2 ARG B 280 -2.023 71.572 -5.033 1.00 0.00 H ATOM 9272 HB3 ARG B 280 -2.581 70.007 -4.396 1.00 0.00 H ATOM 9273 HG2 ARG B 280 0.123 71.042 -3.553 1.00 0.00 H ATOM 9274 HG3 ARG B 280 -1.342 71.749 -2.832 1.00 0.00 H ATOM 9275 HD2 ARG B 280 -2.087 69.483 -2.189 1.00 0.00 H ATOM 9276 HD3 ARG B 280 -0.526 69.920 -1.455 1.00 0.00 H ATOM 9277 HE ARG B 280 -1.044 67.859 -3.482 1.00 0.00 H ATOM 9278 HH12 ARG B 280 2.709 69.015 -2.386 1.00 0.00 H ATOM 9279 HH11 ARG B 280 1.293 70.030 -1.929 1.00 0.00 H ATOM 9280 HH22 ARG B 280 2.394 67.083 -3.580 1.00 0.00 H ATOM 9281 HH21 ARG B 280 0.733 66.579 -4.062 1.00 0.00 H ATOM 9282 H ARG B 280 0.581 71.448 -5.648 1.00 0.00 H ATOM 9283 N GLN B 281 -1.307 70.381 -8.172 1.00 31.50 N ATOM 9284 CA GLN B 281 -2.028 70.255 -9.421 1.00 32.02 C ATOM 9285 C GLN B 281 -1.700 68.896 -10.014 1.00 32.69 C ATOM 9286 O GLN B 281 -0.534 68.533 -10.118 1.00 34.16 O ATOM 9287 CB GLN B 281 -1.700 71.395 -10.403 1.00 32.12 C ATOM 9288 CG GLN B 281 -2.671 71.418 -11.563 1.00 33.59 C ATOM 9289 CD GLN B 281 -2.635 72.671 -12.381 1.00 35.31 C ATOM 9290 OE1 GLN B 281 -1.717 73.485 -12.243 1.00 38.19 O ATOM 9291 NE2 GLN B 281 -3.658 72.849 -13.248 1.00 31.85 N ATOM 9292 HA GLN B 281 -3.098 70.333 -9.230 1.00 0.00 H ATOM 9293 HB2 GLN B 281 -1.756 72.347 -9.874 1.00 0.00 H ATOM 9294 HB3 GLN B 281 -0.690 71.253 -10.788 1.00 0.00 H ATOM 9295 HG2 GLN B 281 -2.439 70.578 -12.217 1.00 0.00 H ATOM 9296 HG3 GLN B 281 -3.679 71.300 -11.165 1.00 0.00 H ATOM 9297 HE22 GLN B 281 -4.406 72.131 -13.324 1.00 0.00 H ATOM 9298 HE21 GLN B 281 -3.696 73.704 -13.838 1.00 0.00 H ATOM 9299 H GLN B 281 -0.389 70.868 -8.144 1.00 0.00 H ATOM 9300 N MET B 282 -2.725 68.141 -10.405 1.00 33.12 N ATOM 9301 CA MET B 282 -2.529 66.750 -10.794 1.00 33.29 C ATOM 9302 C MET B 282 -2.126 66.666 -12.260 1.00 34.13 C ATOM 9303 O MET B 282 -2.822 67.148 -13.181 1.00 33.45 O ATOM 9304 CB MET B 282 -3.796 65.939 -10.572 1.00 33.18 C ATOM 9305 CG MET B 282 -4.490 66.162 -9.263 1.00 35.19 C ATOM 9306 SD MET B 282 -3.785 65.291 -7.859 1.00 41.91 S ATOM 9307 CE MET B 282 -3.896 63.541 -8.364 1.00 35.54 C ATOM 9308 HA MET B 282 -1.735 66.337 -10.173 1.00 0.00 H ATOM 9309 HB2 MET B 282 -4.497 66.187 -11.369 1.00 0.00 H ATOM 9310 HB3 MET B 282 -3.533 64.883 -10.636 1.00 0.00 H ATOM 9311 HG2 MET B 282 -5.526 65.841 -9.372 1.00 0.00 H ATOM 9312 HG3 MET B 282 -4.463 67.230 -9.045 1.00 0.00 H ATOM 9313 HE1 MET B 282 -4.940 63.280 -8.538 1.00 0.00 H ATOM 9314 HE2 MET B 282 -3.325 63.392 -9.280 1.00 0.00 H ATOM 9315 HE3 MET B 282 -3.489 62.910 -7.574 1.00 0.00 H ATOM 9316 H MET B 282 -3.681 68.550 -10.433 1.00 0.00 H ATOM 9317 N ARG B 283 -1.001 66.018 -12.496 1.00 35.68 N ATOM 9318 CA ARG B 283 -0.499 65.887 -13.876 1.00 36.51 C ATOM 9319 C ARG B 283 -1.594 65.347 -14.837 1.00 36.32 C ATOM 9320 O ARG B 283 -1.680 65.775 -16.016 1.00 36.34 O ATOM 9321 CB ARG B 283 0.787 65.074 -13.953 1.00 36.88 C ATOM 9322 CG ARG B 283 0.691 63.725 -13.327 1.00 40.33 C ATOM 9323 CD ARG B 283 1.996 62.985 -13.405 1.00 47.56 C ATOM 9324 NE ARG B 283 3.010 63.635 -12.583 1.00 49.76 N ATOM 9325 CZ ARG B 283 4.011 64.411 -13.035 1.00 55.05 C ATOM 9326 NH1 ARG B 283 4.206 64.678 -14.348 1.00 54.32 N ATOM 9327 NH2 ARG B 283 4.840 64.943 -12.136 1.00 57.41 N ATOM 9328 HA ARG B 283 -0.244 66.891 -14.214 1.00 0.00 H ATOM 9329 HB2 ARG B 283 1.050 64.947 -15.003 1.00 0.00 H ATOM 9330 HB3 ARG B 283 1.576 65.631 -13.447 1.00 0.00 H ATOM 9331 HG2 ARG B 283 0.411 63.840 -12.280 1.00 0.00 H ATOM 9332 HG3 ARG B 283 -0.075 63.148 -13.845 1.00 0.00 H ATOM 9333 HD2 ARG B 283 2.334 62.965 -14.441 1.00 0.00 H ATOM 9334 HD3 ARG B 283 1.850 61.964 -13.052 1.00 0.00 H ATOM 9335 HE ARG B 283 2.954 63.485 -11.555 1.00 0.00 H ATOM 9336 HH12 ARG B 283 4.997 65.285 -14.643 1.00 0.00 H ATOM 9337 HH11 ARG B 283 3.565 64.276 -15.061 1.00 0.00 H ATOM 9338 HH22 ARG B 283 5.626 65.549 -12.448 1.00 0.00 H ATOM 9339 HH21 ARG B 283 4.701 64.752 -11.123 1.00 0.00 H ATOM 9340 H ARG B 283 -0.468 65.599 -11.707 1.00 0.00 H ATOM 9341 N PHE B 284 -2.444 64.447 -14.358 1.00 35.35 N ATOM 9342 CA PHE B 284 -3.380 63.875 -15.282 1.00 35.27 C ATOM 9343 C PHE B 284 -4.712 64.607 -15.339 1.00 34.41 C ATOM 9344 O PHE B 284 -5.140 65.013 -16.409 1.00 34.14 O ATOM 9345 CB PHE B 284 -3.587 62.411 -15.011 1.00 36.33 C ATOM 9346 CG PHE B 284 -4.418 61.759 -16.044 1.00 37.78 C ATOM 9347 CD1 PHE B 284 -3.949 61.651 -17.348 1.00 40.14 C ATOM 9348 CD2 PHE B 284 -5.680 61.302 -15.748 1.00 37.43 C ATOM 9349 CE1 PHE B 284 -4.725 61.077 -18.331 1.00 39.34 C ATOM 9350 CE2 PHE B 284 -6.446 60.721 -16.722 1.00 38.75 C ATOM 9351 CZ PHE B 284 -5.967 60.603 -18.019 1.00 38.06 C ATOM 9352 HA PHE B 284 -2.928 63.992 -16.267 1.00 0.00 H ATOM 9353 HB2 PHE B 284 -2.615 61.919 -14.982 1.00 0.00 H ATOM 9354 HB3 PHE B 284 -4.078 62.300 -14.044 1.00 0.00 H ATOM 9355 HD2 PHE B 284 -6.071 61.402 -14.736 1.00 0.00 H ATOM 9356 HE2 PHE B 284 -7.440 60.348 -16.477 1.00 0.00 H ATOM 9357 HZ PHE B 284 -6.581 60.133 -18.787 1.00 0.00 H ATOM 9358 HE1 PHE B 284 -4.350 61.002 -19.352 1.00 0.00 H ATOM 9359 HD1 PHE B 284 -2.956 62.025 -17.596 1.00 0.00 H ATOM 9360 H PHE B 284 -2.432 64.169 -13.356 1.00 0.00 H ATOM 9361 N GLU B 285 -5.365 64.777 -14.200 1.00 33.46 N ATOM 9362 CA GLU B 285 -6.713 65.315 -14.183 1.00 33.19 C ATOM 9363 C GLU B 285 -6.726 66.792 -14.530 1.00 33.12 C ATOM 9364 O GLU B 285 -7.669 67.255 -15.166 1.00 34.17 O ATOM 9365 CB GLU B 285 -7.386 65.089 -12.824 1.00 33.24 C ATOM 9366 CG GLU B 285 -7.406 63.617 -12.373 1.00 35.14 C ATOM 9367 CD GLU B 285 -6.155 63.206 -11.564 1.00 37.95 C ATOM 9368 OE1 GLU B 285 -5.017 63.249 -12.102 1.00 38.50 O ATOM 9369 OE2 GLU B 285 -6.320 62.809 -10.387 1.00 40.15 O ATOM 9370 HA GLU B 285 -7.280 64.779 -14.944 1.00 0.00 H ATOM 9371 HB2 GLU B 285 -6.849 65.670 -12.074 1.00 0.00 H ATOM 9372 HB3 GLU B 285 -8.415 65.442 -12.888 1.00 0.00 H ATOM 9373 HG2 GLU B 285 -8.287 63.458 -11.752 1.00 0.00 H ATOM 9374 HG3 GLU B 285 -7.468 62.985 -13.259 1.00 0.00 H ATOM 9375 H GLU B 285 -4.905 64.521 -13.303 1.00 0.00 H ATOM 9376 N GLY B 286 -5.700 67.544 -14.128 1.00 32.65 N ATOM 9377 CA GLY B 286 -5.678 69.012 -14.356 1.00 32.15 C ATOM 9378 C GLY B 286 -6.231 69.837 -13.214 1.00 31.57 C ATOM 9379 O GLY B 286 -5.942 71.033 -13.083 1.00 31.56 O ATOM 9380 HA3 GLY B 286 -6.268 69.227 -15.247 1.00 0.00 H ATOM 9381 HA2 GLY B 286 -4.644 69.314 -14.525 1.00 0.00 H ATOM 9382 H GLY B 286 -4.898 67.093 -13.644 1.00 0.00 H ATOM 9383 N GLY B 287 -7.018 69.178 -12.367 1.00 30.65 N ATOM 9384 CA GLY B 287 -7.513 69.772 -11.153 1.00 29.69 C ATOM 9385 C GLY B 287 -6.458 69.720 -10.076 1.00 29.49 C ATOM 9386 O GLY B 287 -5.325 69.262 -10.291 1.00 29.52 O ATOM 9387 HA3 GLY B 287 -8.395 69.226 -10.819 1.00 0.00 H ATOM 9388 HA2 GLY B 287 -7.781 70.811 -11.344 1.00 0.00 H ATOM 9389 H GLY B 287 -7.285 68.198 -12.590 1.00 0.00 H ATOM 9390 N PHE B 288 -6.858 70.208 -8.916 1.00 28.76 N ATOM 9391 CA PHE B 288 -6.050 70.177 -7.757 1.00 28.81 C ATOM 9392 C PHE B 288 -6.585 69.203 -6.726 1.00 29.44 C ATOM 9393 O PHE B 288 -7.826 68.989 -6.627 1.00 29.15 O ATOM 9394 CB PHE B 288 -6.041 71.543 -7.131 1.00 29.11 C ATOM 9395 CG PHE B 288 -5.110 72.517 -7.789 1.00 29.40 C ATOM 9396 CD1 PHE B 288 -5.531 73.268 -8.872 1.00 30.39 C ATOM 9397 CD2 PHE B 288 -3.824 72.746 -7.255 1.00 30.83 C ATOM 9398 CE1 PHE B 288 -4.675 74.245 -9.445 1.00 32.74 C ATOM 9399 CE2 PHE B 288 -2.954 73.703 -7.804 1.00 29.91 C ATOM 9400 CZ PHE B 288 -3.363 74.452 -8.895 1.00 31.93 C ATOM 9401 HA PHE B 288 -5.050 69.863 -8.058 1.00 0.00 H ATOM 9402 HB2 PHE B 288 -7.051 71.949 -7.181 1.00 0.00 H ATOM 9403 HB3 PHE B 288 -5.744 71.439 -6.087 1.00 0.00 H ATOM 9404 HD2 PHE B 288 -3.497 72.165 -6.393 1.00 0.00 H ATOM 9405 HE2 PHE B 288 -1.964 73.855 -7.374 1.00 0.00 H ATOM 9406 HZ PHE B 288 -2.695 75.193 -9.333 1.00 0.00 H ATOM 9407 HE1 PHE B 288 -5.011 74.835 -10.298 1.00 0.00 H ATOM 9408 HD1 PHE B 288 -6.526 73.109 -9.288 1.00 0.00 H ATOM 9409 H PHE B 288 -7.806 70.632 -8.853 1.00 0.00 H ATOM 9410 N GLN B 289 -5.635 68.634 -5.956 1.00 29.58 N ATOM 9411 CA GLN B 289 -5.908 67.905 -4.698 1.00 29.10 C ATOM 9412 C GLN B 289 -5.706 68.803 -3.481 1.00 28.92 C ATOM 9413 O GLN B 289 -5.026 69.831 -3.560 1.00 28.36 O ATOM 9414 CB GLN B 289 -4.990 66.696 -4.563 1.00 29.65 C ATOM 9415 CG GLN B 289 -3.522 67.079 -4.362 1.00 29.69 C ATOM 9416 CD GLN B 289 -2.536 65.936 -4.521 1.00 29.56 C ATOM 9417 OE1 GLN B 289 -1.363 66.183 -4.492 1.00 30.28 O ATOM 9418 NE2 GLN B 289 -3.004 64.692 -4.664 1.00 31.26 N ATOM 9419 HA GLN B 289 -6.947 67.579 -4.738 1.00 0.00 H ATOM 9420 HB2 GLN B 289 -5.316 66.106 -3.706 1.00 0.00 H ATOM 9421 HB3 GLN B 289 -5.072 66.095 -5.469 1.00 0.00 H ATOM 9422 HG2 GLN B 289 -3.270 67.848 -5.092 1.00 0.00 H ATOM 9423 HG3 GLN B 289 -3.412 67.484 -3.356 1.00 0.00 H ATOM 9424 HE22 GLN B 289 -4.030 64.521 -4.684 1.00 0.00 H ATOM 9425 HE21 GLN B 289 -2.342 63.895 -4.755 1.00 0.00 H ATOM 9426 H GLN B 289 -4.646 68.713 -6.267 1.00 0.00 H ATOM 9427 N GLY B 290 -6.287 68.391 -2.354 1.00 28.60 N ATOM 9428 CA GLY B 290 -6.266 69.203 -1.129 1.00 28.80 C ATOM 9429 C GLY B 290 -5.001 68.989 -0.334 1.00 29.05 C ATOM 9430 O GLY B 290 -4.529 69.879 0.379 1.00 29.28 O ATOM 9431 HA3 GLY B 290 -7.121 68.931 -0.511 1.00 0.00 H ATOM 9432 HA2 GLY B 290 -6.337 70.256 -1.402 1.00 0.00 H ATOM 9433 H GLY B 290 -6.769 67.469 -2.341 1.00 0.00 H ATOM 9434 N ARG B 291 -4.487 67.782 -0.459 1.00 29.33 N ATOM 9435 CA ARG B 291 -3.306 67.333 0.224 1.00 30.50 C ATOM 9436 C ARG B 291 -2.565 66.374 -0.707 1.00 30.60 C ATOM 9437 O ARG B 291 -3.160 65.759 -1.605 1.00 29.36 O ATOM 9438 CB ARG B 291 -3.621 66.516 1.482 1.00 30.55 C ATOM 9439 CG ARG B 291 -4.402 67.186 2.512 1.00 31.60 C ATOM 9440 CD ARG B 291 -4.625 66.247 3.708 1.00 31.58 C ATOM 9441 NE ARG B 291 -5.966 65.662 3.723 1.00 31.31 N ATOM 9442 CZ ARG B 291 -6.366 64.725 4.565 1.00 31.28 C ATOM 9443 NH1 ARG B 291 -5.543 64.241 5.475 1.00 33.06 N ATOM 9444 NH2 ARG B 291 -7.599 64.260 4.483 1.00 32.84 N ATOM 9445 HA ARG B 291 -2.737 68.221 0.500 1.00 0.00 H ATOM 9446 HB2 ARG B 291 -4.173 65.629 1.172 1.00 0.00 H ATOM 9447 HB3 ARG B 291 -2.673 66.215 1.928 1.00 0.00 H ATOM 9448 HG2 ARG B 291 -3.868 68.075 2.847 1.00 0.00 H ATOM 9449 HG3 ARG B 291 -5.367 67.478 2.099 1.00 0.00 H ATOM 9450 HD2 ARG B 291 -4.481 66.813 4.628 1.00 0.00 H ATOM 9451 HD3 ARG B 291 -3.893 65.441 3.660 1.00 0.00 H ATOM 9452 HE ARG B 291 -6.652 66.008 3.022 1.00 0.00 H ATOM 9453 HH12 ARG B 291 -5.870 63.504 6.132 1.00 0.00 H ATOM 9454 HH11 ARG B 291 -4.568 64.597 5.536 1.00 0.00 H ATOM 9455 HH22 ARG B 291 -7.922 63.523 5.142 1.00 0.00 H ATOM 9456 HH21 ARG B 291 -8.248 64.631 3.760 1.00 0.00 H ATOM 9457 H ARG B 291 -4.967 67.112 -1.093 1.00 0.00 H ATOM 9458 N CYS B 292 -1.280 66.227 -0.405 1.00 30.89 N ATOM 9459 CA CYS B 292 -0.398 65.341 -1.095 1.00 31.86 C ATOM 9460 C CYS B 292 -0.890 63.913 -1.012 1.00 31.83 C ATOM 9461 O CYS B 292 -1.379 63.487 0.031 1.00 32.26 O ATOM 9462 CB CYS B 292 0.993 65.418 -0.452 1.00 32.92 C ATOM 9463 SG CYS B 292 2.165 64.292 -1.248 1.00 33.16 S ATOM 9464 HA CYS B 292 -0.358 65.640 -2.142 1.00 0.00 H ATOM 9465 HB2 CYS B 292 0.910 65.154 0.602 1.00 0.00 H ATOM 9466 HB3 CYS B 292 1.367 66.438 -0.541 1.00 0.00 H ATOM 9467 HG CYS B 292 3.396 64.401 -0.633 1.00 0.00 H ATOM 9468 H CYS B 292 -0.894 66.790 0.380 1.00 0.00 H ATOM 9469 N ASN B 293 -0.774 63.184 -2.115 1.00 31.87 N ATOM 9470 CA ASN B 293 -1.233 61.802 -2.181 1.00 32.34 C ATOM 9471 C ASN B 293 -2.767 61.549 -1.946 1.00 32.57 C ATOM 9472 O ASN B 293 -3.197 60.420 -1.636 1.00 33.45 O ATOM 9473 CB ASN B 293 -0.333 60.924 -1.280 1.00 32.60 C ATOM 9474 CG ASN B 293 0.838 60.328 -2.047 1.00 33.58 C ATOM 9475 OD1 ASN B 293 0.723 60.052 -3.217 1.00 31.92 O ATOM 9476 ND2 ASN B 293 1.966 60.142 -1.386 1.00 35.15 N ATOM 9477 HA ASN B 293 -1.127 61.507 -3.225 1.00 0.00 H ATOM 9478 HB2 ASN B 293 0.055 61.537 -0.466 1.00 0.00 H ATOM 9479 HB3 ASN B 293 -0.933 60.113 -0.868 1.00 0.00 H ATOM 9480 HD22 ASN B 293 2.026 60.392 -0.378 1.00 0.00 H ATOM 9481 HD21 ASN B 293 2.795 59.745 -1.873 1.00 0.00 H ATOM 9482 H ASN B 293 -0.342 63.612 -2.959 1.00 0.00 H ATOM 9483 N LYS B 294 -3.596 62.565 -2.155 1.00 32.33 N ATOM 9484 CA LYS B 294 -5.065 62.368 -2.154 1.00 32.42 C ATOM 9485 C LYS B 294 -5.742 62.682 -3.520 1.00 32.42 C ATOM 9486 O LYS B 294 -5.061 62.987 -4.505 1.00 33.04 O ATOM 9487 CB LYS B 294 -5.702 63.159 -1.029 1.00 32.02 C ATOM 9488 CG LYS B 294 -5.228 62.651 0.339 1.00 33.73 C ATOM 9489 CD LYS B 294 -6.265 62.865 1.447 1.00 32.39 C ATOM 9490 CE LYS B 294 -7.441 61.918 1.256 1.00 33.59 C ATOM 9491 NZ LYS B 294 -8.484 62.052 2.341 1.00 34.41 N ATOM 9492 HA LYS B 294 -5.234 61.304 -1.985 1.00 0.00 H ATOM 9493 HB2 LYS B 294 -5.430 64.209 -1.133 1.00 0.00 H ATOM 9494 HB3 LYS B 294 -6.786 63.058 -1.091 1.00 0.00 H ATOM 9495 HG2 LYS B 294 -5.018 61.584 0.260 1.00 0.00 H ATOM 9496 HG3 LYS B 294 -4.315 63.181 0.610 1.00 0.00 H ATOM 9497 HD2 LYS B 294 -5.802 62.674 2.415 1.00 0.00 H ATOM 9498 HD3 LYS B 294 -6.622 63.894 1.413 1.00 0.00 H ATOM 9499 HE2 LYS B 294 -7.067 60.894 1.256 1.00 0.00 H ATOM 9500 HE3 LYS B 294 -7.908 62.132 0.295 1.00 0.00 H ATOM 9501 HZ1 LYS B 294 -8.052 61.841 3.263 1.00 0.00 H ATOM 9502 HZ2 LYS B 294 -8.855 63.023 2.345 1.00 0.00 H ATOM 9503 HZ3 LYS B 294 -9.260 61.384 2.159 1.00 0.00 H ATOM 9504 H LYS B 294 -3.208 63.515 -2.322 1.00 0.00 H ATOM 9505 N LEU B 295 -7.072 62.599 -3.591 1.00 31.53 N ATOM 9506 CA LEU B 295 -7.736 62.671 -4.884 1.00 30.83 C ATOM 9507 C LEU B 295 -8.016 64.102 -5.287 1.00 29.59 C ATOM 9508 O LEU B 295 -8.083 64.990 -4.452 1.00 28.56 O ATOM 9509 CB LEU B 295 -9.026 61.830 -4.893 1.00 30.91 C ATOM 9510 CG LEU B 295 -8.814 60.409 -4.379 1.00 31.03 C ATOM 9511 CD1 LEU B 295 -10.149 59.674 -4.310 1.00 25.44 C ATOM 9512 CD2 LEU B 295 -7.745 59.646 -5.224 1.00 27.76 C ATOM 9513 HA LEU B 295 -7.055 62.250 -5.624 1.00 0.00 H ATOM 9514 HB2 LEU B 295 -9.766 62.322 -4.261 1.00 0.00 H ATOM 9515 HB3 LEU B 295 -9.400 61.778 -5.915 1.00 0.00 H ATOM 9516 HG LEU B 295 -8.413 60.457 -3.366 1.00 0.00 H ATOM 9517 HD21 LEU B 295 -8.075 59.592 -6.261 1.00 0.00 H ATOM 9518 HD22 LEU B 295 -6.795 60.177 -5.171 1.00 0.00 H ATOM 9519 HD23 LEU B 295 -7.622 58.638 -4.827 1.00 0.00 H ATOM 9520 HD11 LEU B 295 -10.820 60.204 -3.634 1.00 0.00 H ATOM 9521 HD12 LEU B 295 -10.592 59.634 -5.305 1.00 0.00 H ATOM 9522 HD13 LEU B 295 -9.986 58.661 -3.942 1.00 0.00 H ATOM 9523 H LEU B 295 -7.633 62.483 -2.723 1.00 0.00 H ATOM 9524 N VAL B 296 -8.161 64.301 -6.592 1.00 29.20 N ATOM 9525 CA VAL B 296 -8.537 65.584 -7.151 1.00 28.40 C ATOM 9526 C VAL B 296 -9.909 65.940 -6.629 1.00 28.51 C ATOM 9527 O VAL B 296 -10.641 65.070 -6.253 1.00 28.40 O ATOM 9528 CB VAL B 296 -8.582 65.519 -8.699 1.00 28.36 C ATOM 9529 CG1 VAL B 296 -9.715 64.626 -9.157 1.00 25.57 C ATOM 9530 CG2 VAL B 296 -8.678 66.892 -9.295 1.00 24.34 C ATOM 9531 HA VAL B 296 -7.802 66.334 -6.861 1.00 0.00 H ATOM 9532 HB VAL B 296 -7.649 65.082 -9.055 1.00 0.00 H ATOM 9533 HG11 VAL B 296 -9.566 63.621 -8.763 1.00 0.00 H ATOM 9534 HG12 VAL B 296 -10.661 65.024 -8.790 1.00 0.00 H ATOM 9535 HG13 VAL B 296 -9.732 64.592 -10.246 1.00 0.00 H ATOM 9536 HG21 VAL B 296 -9.586 67.378 -8.939 1.00 0.00 H ATOM 9537 HG22 VAL B 296 -7.809 67.478 -8.995 1.00 0.00 H ATOM 9538 HG23 VAL B 296 -8.708 66.814 -10.382 1.00 0.00 H ATOM 9539 H VAL B 296 -7.998 63.503 -7.239 1.00 0.00 H ATOM 9540 N ASP B 297 -10.257 67.223 -6.635 1.00 28.71 N ATOM 9541 CA ASP B 297 -11.554 67.685 -6.191 1.00 27.88 C ATOM 9542 C ASP B 297 -11.801 69.139 -6.641 1.00 27.80 C ATOM 9543 O ASP B 297 -11.064 70.084 -6.288 1.00 26.20 O ATOM 9544 CB ASP B 297 -11.636 67.556 -4.668 1.00 27.72 C ATOM 9545 CG ASP B 297 -12.964 68.006 -4.105 1.00 27.88 C ATOM 9546 OD1 ASP B 297 -13.734 68.713 -4.794 1.00 26.76 O ATOM 9547 OD2 ASP B 297 -13.222 67.666 -2.936 1.00 28.94 O ATOM 9548 HA ASP B 297 -12.332 67.070 -6.643 1.00 0.00 H ATOM 9549 HB2 ASP B 297 -11.481 66.511 -4.399 1.00 0.00 H ATOM 9550 HB3 ASP B 297 -10.847 68.164 -4.225 1.00 0.00 H ATOM 9551 H ASP B 297 -9.568 67.924 -6.973 1.00 0.00 H ATOM 9552 N GLY B 298 -12.871 69.286 -7.416 1.00 27.95 N ATOM 9553 CA GLY B 298 -13.343 70.566 -7.912 1.00 27.53 C ATOM 9554 C GLY B 298 -13.251 71.763 -6.991 1.00 27.19 C ATOM 9555 O GLY B 298 -12.970 72.842 -7.463 1.00 26.32 O ATOM 9556 HA3 GLY B 298 -14.392 70.443 -8.180 1.00 0.00 H ATOM 9557 HA2 GLY B 298 -12.766 70.800 -8.807 1.00 0.00 H ATOM 9558 H GLY B 298 -13.402 68.433 -7.683 1.00 0.00 H ATOM 9559 N CYS B 299 -13.481 71.616 -5.688 1.00 27.40 N ATOM 9560 CA CYS B 299 -13.473 72.825 -4.830 1.00 27.53 C ATOM 9561 C CYS B 299 -12.090 73.376 -4.599 1.00 27.28 C ATOM 9562 O CYS B 299 -11.941 74.551 -4.417 1.00 27.25 O ATOM 9563 CB CYS B 299 -14.193 72.650 -3.494 1.00 27.25 C ATOM 9564 SG CYS B 299 -13.601 71.354 -2.477 1.00 29.21 S ATOM 9565 HA CYS B 299 -14.042 73.552 -5.409 1.00 0.00 H ATOM 9566 HB2 CYS B 299 -15.245 72.458 -3.703 1.00 0.00 H ATOM 9567 HB3 CYS B 299 -14.099 73.583 -2.938 1.00 0.00 H ATOM 9568 HG CYS B 299 -13.726 70.153 -3.145 1.00 0.00 H ATOM 9569 H CYS B 299 -13.662 70.676 -5.282 1.00 0.00 H ATOM 9570 N TYR B 300 -11.069 72.532 -4.632 1.00 28.01 N ATOM 9571 CA TYR B 300 -9.693 73.031 -4.538 1.00 28.34 C ATOM 9572 C TYR B 300 -9.285 73.841 -5.761 1.00 28.76 C ATOM 9573 O TYR B 300 -8.248 74.500 -5.736 1.00 30.18 O ATOM 9574 CB TYR B 300 -8.698 71.902 -4.298 1.00 28.20 C ATOM 9575 CG TYR B 300 -8.990 71.179 -3.014 1.00 28.60 C ATOM 9576 CD1 TYR B 300 -9.294 69.816 -3.009 1.00 28.42 C ATOM 9577 CD2 TYR B 300 -9.028 71.862 -1.805 1.00 27.94 C ATOM 9578 CE1 TYR B 300 -9.602 69.162 -1.834 1.00 27.26 C ATOM 9579 CE2 TYR B 300 -9.335 71.212 -0.645 1.00 28.78 C ATOM 9580 CZ TYR B 300 -9.614 69.870 -0.669 1.00 27.77 C ATOM 9581 OH TYR B 300 -9.919 69.251 0.494 1.00 30.00 O ATOM 9582 HA TYR B 300 -9.672 73.698 -3.676 1.00 0.00 H ATOM 9583 HB3 TYR B 300 -7.692 72.319 -4.250 1.00 0.00 H ATOM 9584 HB2 TYR B 300 -8.757 71.195 -5.125 1.00 0.00 H ATOM 9585 HD2 TYR B 300 -8.810 72.930 -1.783 1.00 0.00 H ATOM 9586 HE2 TYR B 300 -9.358 71.758 0.298 1.00 0.00 H ATOM 9587 HE1 TYR B 300 -9.832 68.097 -1.837 1.00 0.00 H ATOM 9588 HD1 TYR B 300 -9.288 69.261 -3.947 1.00 0.00 H ATOM 9589 HH TYR B 300 -9.159 69.340 1.123 1.00 0.00 H ATOM 9590 H TYR B 300 -11.244 71.511 -4.725 1.00 0.00 H ATOM 9591 N SER B 301 -10.093 73.815 -6.815 1.00 28.18 N ATOM 9592 CA SER B 301 -9.880 74.738 -7.896 1.00 28.58 C ATOM 9593 C SER B 301 -9.852 76.167 -7.345 1.00 28.85 C ATOM 9594 O SER B 301 -9.238 77.011 -7.957 1.00 28.82 O ATOM 9595 CB SER B 301 -10.970 74.613 -8.963 1.00 28.40 C ATOM 9596 OG SER B 301 -11.082 73.277 -9.430 1.00 27.49 O ATOM 9597 HA SER B 301 -8.925 74.501 -8.366 1.00 0.00 H ATOM 9598 HB2 SER B 301 -10.723 75.263 -9.802 1.00 0.00 H ATOM 9599 HB3 SER B 301 -11.924 74.921 -8.535 1.00 0.00 H ATOM 9600 HG SER B 301 -11.311 72.682 -8.673 1.00 0.00 H ATOM 9601 H SER B 301 -10.875 73.131 -6.858 1.00 0.00 H ATOM 9602 N PHE B 302 -10.524 76.446 -6.226 1.00 28.39 N ATOM 9603 CA PHE B 302 -10.377 77.738 -5.611 1.00 29.01 C ATOM 9604 C PHE B 302 -9.311 77.759 -4.503 1.00 29.43 C ATOM 9605 O PHE B 302 -8.375 78.554 -4.532 1.00 29.67 O ATOM 9606 CB PHE B 302 -11.680 78.282 -5.051 1.00 29.86 C ATOM 9607 CG PHE B 302 -11.491 79.587 -4.338 1.00 30.41 C ATOM 9608 CD1 PHE B 302 -11.333 80.757 -5.044 1.00 34.12 C ATOM 9609 CD2 PHE B 302 -11.368 79.634 -2.986 1.00 32.29 C ATOM 9610 CE1 PHE B 302 -11.108 81.988 -4.389 1.00 34.67 C ATOM 9611 CE2 PHE B 302 -11.155 80.851 -2.316 1.00 34.19 C ATOM 9612 CZ PHE B 302 -11.011 82.023 -3.021 1.00 33.25 C ATOM 9613 HA PHE B 302 -10.049 78.385 -6.424 1.00 0.00 H ATOM 9614 HB2 PHE B 302 -12.381 78.429 -5.873 1.00 0.00 H ATOM 9615 HB3 PHE B 302 -12.091 77.555 -4.350 1.00 0.00 H ATOM 9616 HD2 PHE B 302 -11.436 78.711 -2.410 1.00 0.00 H ATOM 9617 HE2 PHE B 302 -11.103 80.866 -1.227 1.00 0.00 H ATOM 9618 HZ PHE B 302 -10.823 82.963 -2.502 1.00 0.00 H ATOM 9619 HE1 PHE B 302 -11.012 82.906 -4.968 1.00 0.00 H ATOM 9620 HD1 PHE B 302 -11.383 80.734 -6.133 1.00 0.00 H ATOM 9621 H PHE B 302 -11.151 75.733 -5.801 1.00 0.00 H ATOM 9622 N TRP B 303 -9.433 76.910 -3.505 1.00 29.18 N ATOM 9623 CA TRP B 303 -8.592 77.104 -2.344 1.00 29.28 C ATOM 9624 C TRP B 303 -7.114 76.964 -2.657 1.00 30.19 C ATOM 9625 O TRP B 303 -6.297 77.663 -2.054 1.00 30.84 O ATOM 9626 CB TRP B 303 -8.911 76.130 -1.248 1.00 28.67 C ATOM 9627 CG TRP B 303 -10.323 76.027 -0.879 1.00 28.61 C ATOM 9628 CD1 TRP B 303 -11.125 74.956 -1.111 1.00 28.57 C ATOM 9629 CD2 TRP B 303 -11.114 76.976 -0.147 1.00 27.97 C ATOM 9630 NE1 TRP B 303 -12.368 75.180 -0.591 1.00 28.47 N ATOM 9631 CE2 TRP B 303 -12.404 76.410 -0.001 1.00 26.84 C ATOM 9632 CE3 TRP B 303 -10.865 78.245 0.390 1.00 28.29 C ATOM 9633 CZ2 TRP B 303 -13.452 77.060 0.658 1.00 26.92 C ATOM 9634 CZ3 TRP B 303 -11.911 78.898 1.070 1.00 28.39 C ATOM 9635 CH2 TRP B 303 -13.194 78.296 1.195 1.00 27.62 C ATOM 9636 HA TRP B 303 -8.802 78.123 -2.020 1.00 0.00 H ATOM 9637 HB2 TRP B 303 -8.576 75.144 -1.569 1.00 0.00 H ATOM 9638 HB3 TRP B 303 -8.354 76.431 -0.360 1.00 0.00 H ATOM 9639 HE1 TRP B 303 -13.166 74.514 -0.638 1.00 0.00 H ATOM 9640 HD1 TRP B 303 -10.821 74.050 -1.635 1.00 0.00 H ATOM 9641 HZ2 TRP B 303 -14.437 76.602 0.742 1.00 0.00 H ATOM 9642 HH2 TRP B 303 -13.985 78.825 1.726 1.00 0.00 H ATOM 9643 HZ3 TRP B 303 -11.735 79.881 1.508 1.00 0.00 H ATOM 9644 HE3 TRP B 303 -9.887 78.715 0.284 1.00 0.00 H ATOM 9645 H TRP B 303 -10.113 76.124 -3.550 1.00 0.00 H ATOM 9646 N GLN B 304 -6.770 76.044 -3.564 1.00 30.79 N ATOM 9647 CA GLN B 304 -5.373 75.896 -4.036 1.00 30.94 C ATOM 9648 C GLN B 304 -5.034 76.885 -5.172 1.00 31.35 C ATOM 9649 O GLN B 304 -4.090 77.642 -5.051 1.00 31.44 O ATOM 9650 CB GLN B 304 -5.085 74.474 -4.479 1.00 30.40 C ATOM 9651 CG GLN B 304 -5.362 73.446 -3.430 1.00 30.73 C ATOM 9652 CD GLN B 304 -4.229 73.218 -2.448 1.00 30.89 C ATOM 9653 OE1 GLN B 304 -3.547 74.150 -2.040 1.00 33.81 O ATOM 9654 NE2 GLN B 304 -4.056 71.971 -2.026 1.00 28.86 N ATOM 9655 HA GLN B 304 -4.734 76.132 -3.185 1.00 0.00 H ATOM 9656 HB2 GLN B 304 -5.704 74.253 -5.349 1.00 0.00 H ATOM 9657 HB3 GLN B 304 -4.033 74.407 -4.757 1.00 0.00 H ATOM 9658 HG2 GLN B 304 -6.240 73.763 -2.867 1.00 0.00 H ATOM 9659 HG3 GLN B 304 -5.574 72.500 -3.929 1.00 0.00 H ATOM 9660 HE22 GLN B 304 -4.657 71.208 -2.398 1.00 0.00 H ATOM 9661 HE21 GLN B 304 -3.320 71.757 -1.323 1.00 0.00 H ATOM 9662 H GLN B 304 -7.503 75.415 -3.949 1.00 0.00 H ATOM 9663 N ALA B 305 -5.810 76.931 -6.255 1.00 31.62 N ATOM 9664 CA ALA B 305 -5.378 77.796 -7.344 1.00 32.21 C ATOM 9665 C ALA B 305 -5.483 79.259 -6.939 1.00 32.25 C ATOM 9666 O ALA B 305 -4.711 80.046 -7.422 1.00 33.10 O ATOM 9667 CB ALA B 305 -6.079 77.497 -8.667 1.00 31.66 C ATOM 9668 HA ALA B 305 -4.327 77.577 -7.532 1.00 0.00 H ATOM 9669 HB1 ALA B 305 -5.872 76.468 -8.962 1.00 0.00 H ATOM 9670 HB2 ALA B 305 -7.154 77.632 -8.546 1.00 0.00 H ATOM 9671 HB3 ALA B 305 -5.710 78.178 -9.434 1.00 0.00 H ATOM 9672 H ALA B 305 -6.686 76.374 -6.319 1.00 0.00 H ATOM 9673 N GLY B 306 -6.376 79.615 -6.015 1.00 32.40 N ATOM 9674 CA GLY B 306 -6.460 81.002 -5.461 1.00 32.31 C ATOM 9675 C GLY B 306 -5.276 81.460 -4.586 1.00 33.05 C ATOM 9676 O GLY B 306 -5.109 82.663 -4.305 1.00 34.11 O ATOM 9677 HA3 GLY B 306 -7.364 81.064 -4.856 1.00 0.00 H ATOM 9678 HA2 GLY B 306 -6.539 81.692 -6.301 1.00 0.00 H ATOM 9679 H GLY B 306 -7.043 78.898 -5.665 1.00 0.00 H ATOM 9680 N LEU B 307 -4.444 80.527 -4.139 1.00 32.91 N ATOM 9681 CA LEU B 307 -3.182 80.897 -3.516 1.00 33.48 C ATOM 9682 C LEU B 307 -2.213 81.581 -4.518 1.00 35.12 C ATOM 9683 O LEU B 307 -1.421 82.482 -4.114 1.00 36.18 O ATOM 9684 CB LEU B 307 -2.495 79.671 -2.941 1.00 33.23 C ATOM 9685 CG LEU B 307 -3.088 79.087 -1.675 1.00 32.86 C ATOM 9686 CD1 LEU B 307 -2.629 77.640 -1.536 1.00 31.42 C ATOM 9687 CD2 LEU B 307 -2.715 79.952 -0.463 1.00 31.28 C ATOM 9688 HA LEU B 307 -3.421 81.606 -2.723 1.00 0.00 H ATOM 9689 HB2 LEU B 307 -2.515 78.893 -3.704 1.00 0.00 H ATOM 9690 HB3 LEU B 307 -1.461 79.942 -2.727 1.00 0.00 H ATOM 9691 HG LEU B 307 -4.177 79.087 -1.728 1.00 0.00 H ATOM 9692 HD21 LEU B 307 -1.630 79.988 -0.364 1.00 0.00 H ATOM 9693 HD22 LEU B 307 -3.102 80.961 -0.605 1.00 0.00 H ATOM 9694 HD23 LEU B 307 -3.149 79.519 0.438 1.00 0.00 H ATOM 9695 HD11 LEU B 307 -2.968 77.068 -2.400 1.00 0.00 H ATOM 9696 HD12 LEU B 307 -1.541 77.609 -1.482 1.00 0.00 H ATOM 9697 HD13 LEU B 307 -3.051 77.212 -0.627 1.00 0.00 H ATOM 9698 H LEU B 307 -4.696 79.523 -4.235 1.00 0.00 H ATOM 9699 N LEU B 308 -2.258 81.175 -5.802 1.00 35.12 N ATOM 9700 CA LEU B 308 -1.306 81.697 -6.791 1.00 35.39 C ATOM 9701 C LEU B 308 -1.412 83.209 -6.969 1.00 36.65 C ATOM 9702 O LEU B 308 -0.405 83.914 -6.893 1.00 37.42 O ATOM 9703 CB LEU B 308 -1.403 80.993 -8.135 1.00 34.70 C ATOM 9704 CG LEU B 308 -0.614 79.683 -8.165 1.00 34.56 C ATOM 9705 CD1 LEU B 308 0.642 79.800 -7.330 1.00 33.66 C ATOM 9706 CD2 LEU B 308 -1.448 78.535 -7.638 1.00 34.31 C ATOM 9707 HA LEU B 308 -0.321 81.480 -6.378 1.00 0.00 H ATOM 9708 HB2 LEU B 308 -2.451 80.776 -8.342 1.00 0.00 H ATOM 9709 HB3 LEU B 308 -1.011 81.656 -8.907 1.00 0.00 H ATOM 9710 HG LEU B 308 -0.347 79.485 -9.203 1.00 0.00 H ATOM 9711 HD21 LEU B 308 -1.742 78.743 -6.609 1.00 0.00 H ATOM 9712 HD22 LEU B 308 -2.339 78.421 -8.256 1.00 0.00 H ATOM 9713 HD23 LEU B 308 -0.862 77.617 -7.671 1.00 0.00 H ATOM 9714 HD11 LEU B 308 1.268 80.599 -7.727 1.00 0.00 H ATOM 9715 HD12 LEU B 308 0.371 80.027 -6.299 1.00 0.00 H ATOM 9716 HD13 LEU B 308 1.189 78.858 -7.365 1.00 0.00 H ATOM 9717 H LEU B 308 -2.976 80.483 -6.097 1.00 0.00 H ATOM 9718 N PRO B 309 -2.617 83.730 -7.142 1.00 36.97 N ATOM 9719 CA PRO B 309 -2.650 85.191 -7.168 1.00 37.52 C ATOM 9720 C PRO B 309 -2.164 85.817 -5.872 1.00 38.44 C ATOM 9721 O PRO B 309 -1.634 86.921 -5.891 1.00 39.29 O ATOM 9722 CB PRO B 309 -4.128 85.518 -7.391 1.00 37.00 C ATOM 9723 CG PRO B 309 -4.699 84.278 -7.992 1.00 37.28 C ATOM 9724 CD PRO B 309 -3.943 83.142 -7.323 1.00 36.85 C ATOM 9725 HA PRO B 309 -1.988 85.588 -7.938 1.00 0.00 H ATOM 9726 HD3 PRO B 309 -4.393 82.875 -6.367 1.00 0.00 H ATOM 9727 HD2 PRO B 309 -3.903 82.261 -7.963 1.00 0.00 H ATOM 9728 HG3 PRO B 309 -4.539 84.264 -9.070 1.00 0.00 H ATOM 9729 HG2 PRO B 309 -5.766 84.205 -7.783 1.00 0.00 H ATOM 9730 HB2 PRO B 309 -4.619 85.749 -6.446 1.00 0.00 H ATOM 9731 HB3 PRO B 309 -4.238 86.362 -8.072 1.00 0.00 H ATOM 9732 N LEU B 310 -2.335 85.129 -4.750 1.00 39.08 N ATOM 9733 CA LEU B 310 -1.956 85.729 -3.490 1.00 39.79 C ATOM 9734 C LEU B 310 -0.416 85.744 -3.370 1.00 41.24 C ATOM 9735 O LEU B 310 0.159 86.718 -2.911 1.00 40.94 O ATOM 9736 CB LEU B 310 -2.651 85.036 -2.298 1.00 39.29 C ATOM 9737 CG LEU B 310 -4.156 85.321 -2.102 1.00 38.12 C ATOM 9738 CD1 LEU B 310 -4.720 84.474 -0.969 1.00 36.84 C ATOM 9739 CD2 LEU B 310 -4.448 86.744 -1.817 1.00 37.05 C ATOM 9740 HA LEU B 310 -2.301 86.763 -3.464 1.00 0.00 H ATOM 9741 HB2 LEU B 310 -2.534 83.960 -2.429 1.00 0.00 H ATOM 9742 HB3 LEU B 310 -2.136 85.348 -1.390 1.00 0.00 H ATOM 9743 HG LEU B 310 -4.632 85.063 -3.048 1.00 0.00 H ATOM 9744 HD21 LEU B 310 -3.934 87.043 -0.904 1.00 0.00 H ATOM 9745 HD22 LEU B 310 -4.102 87.358 -2.648 1.00 0.00 H ATOM 9746 HD23 LEU B 310 -5.523 86.875 -1.690 1.00 0.00 H ATOM 9747 HD11 LEU B 310 -4.588 83.418 -1.206 1.00 0.00 H ATOM 9748 HD12 LEU B 310 -4.193 84.709 -0.044 1.00 0.00 H ATOM 9749 HD13 LEU B 310 -5.781 84.691 -0.849 1.00 0.00 H ATOM 9750 H LEU B 310 -2.737 84.170 -4.777 1.00 0.00 H ATOM 9751 N LEU B 311 0.234 84.670 -3.791 1.00 42.92 N ATOM 9752 CA LEU B 311 1.680 84.635 -3.863 1.00 44.88 C ATOM 9753 C LEU B 311 2.210 85.615 -4.912 1.00 47.25 C ATOM 9754 O LEU B 311 3.257 86.226 -4.725 1.00 48.49 O ATOM 9755 CB LEU B 311 2.181 83.222 -4.179 1.00 44.32 C ATOM 9756 CG LEU B 311 1.979 82.231 -3.040 1.00 42.48 C ATOM 9757 CD1 LEU B 311 2.242 80.807 -3.533 1.00 37.62 C ATOM 9758 CD2 LEU B 311 2.867 82.649 -1.865 1.00 37.19 C ATOM 9759 HA LEU B 311 2.058 84.934 -2.885 1.00 0.00 H ATOM 9760 HB2 LEU B 311 1.645 82.854 -5.054 1.00 0.00 H ATOM 9761 HB3 LEU B 311 3.246 83.277 -4.403 1.00 0.00 H ATOM 9762 HG LEU B 311 0.948 82.239 -2.687 1.00 0.00 H ATOM 9763 HD21 LEU B 311 3.910 82.645 -2.180 1.00 0.00 H ATOM 9764 HD22 LEU B 311 2.588 83.651 -1.539 1.00 0.00 H ATOM 9765 HD23 LEU B 311 2.732 81.947 -1.042 1.00 0.00 H ATOM 9766 HD11 LEU B 311 1.551 80.570 -4.342 1.00 0.00 H ATOM 9767 HD12 LEU B 311 3.267 80.733 -3.896 1.00 0.00 H ATOM 9768 HD13 LEU B 311 2.095 80.106 -2.711 1.00 0.00 H ATOM 9769 H LEU B 311 -0.308 83.830 -4.077 1.00 0.00 H ATOM 9770 N HIS B 312 1.488 85.779 -6.006 1.00 49.00 N ATOM 9771 CA HIS B 312 1.958 86.653 -7.053 1.00 50.94 C ATOM 9772 C HIS B 312 2.084 88.059 -6.532 1.00 52.83 C ATOM 9773 O HIS B 312 3.047 88.734 -6.853 1.00 52.86 O ATOM 9774 CB HIS B 312 1.023 86.655 -8.265 1.00 50.89 C ATOM 9775 CG HIS B 312 1.733 86.928 -9.546 1.00 51.74 C ATOM 9776 ND1 HIS B 312 2.179 85.920 -10.378 1.00 51.52 N ATOM 9777 CD2 HIS B 312 2.126 88.092 -10.114 1.00 52.38 C ATOM 9778 CE1 HIS B 312 2.792 86.457 -11.416 1.00 51.99 C ATOM 9779 NE2 HIS B 312 2.786 87.772 -11.274 1.00 52.43 N ATOM 9780 HA HIS B 312 2.930 86.277 -7.372 1.00 0.00 H ATOM 9781 HB2 HIS B 312 0.542 85.679 -8.335 1.00 0.00 H ATOM 9782 HB3 HIS B 312 0.264 87.423 -8.117 1.00 0.00 H ATOM 9783 HD2 HIS B 312 1.951 89.095 -9.724 1.00 0.00 H ATOM 9784 HE1 HIS B 312 3.230 85.909 -12.250 1.00 0.00 H ATOM 9785 H HIS B 312 0.582 85.279 -6.112 1.00 0.00 H ATOM 9786 N ARG B 313 1.101 88.497 -5.748 1.00 54.91 N ATOM 9787 CA ARG B 313 1.096 89.847 -5.251 1.00 58.13 C ATOM 9788 C ARG B 313 2.148 89.983 -4.162 1.00 59.18 C ATOM 9789 O ARG B 313 2.771 91.031 -4.032 1.00 59.61 O ATOM 9790 CB ARG B 313 -0.283 90.254 -4.760 1.00 57.41 C ATOM 9791 CG ARG B 313 -0.271 91.326 -3.709 1.00 61.03 C ATOM 9792 CD ARG B 313 -1.644 91.944 -3.472 1.00 63.85 C ATOM 9793 NE ARG B 313 -1.890 92.232 -2.043 1.00 69.38 N ATOM 9794 CZ ARG B 313 -2.785 93.112 -1.577 1.00 73.18 C ATOM 9795 NH1 ARG B 313 -3.544 93.835 -2.416 1.00 76.41 N ATOM 9796 NH2 ARG B 313 -2.935 93.279 -0.262 1.00 71.67 N ATOM 9797 HA ARG B 313 1.345 90.528 -6.065 1.00 0.00 H ATOM 9798 HB2 ARG B 313 -0.856 90.618 -5.613 1.00 0.00 H ATOM 9799 HB3 ARG B 313 -0.772 89.373 -4.344 1.00 0.00 H ATOM 9800 HG2 ARG B 313 0.081 90.891 -2.773 1.00 0.00 H ATOM 9801 HG3 ARG B 313 0.415 92.113 -4.023 1.00 0.00 H ATOM 9802 HD2 ARG B 313 -2.407 91.251 -3.827 1.00 0.00 H ATOM 9803 HD3 ARG B 313 -1.711 92.875 -4.034 1.00 0.00 H ATOM 9804 HE ARG B 313 -1.323 91.710 -1.345 1.00 0.00 H ATOM 9805 HH12 ARG B 313 -4.235 94.514 -2.038 1.00 0.00 H ATOM 9806 HH11 ARG B 313 -3.441 93.716 -3.444 1.00 0.00 H ATOM 9807 HH22 ARG B 313 -3.630 93.963 0.099 1.00 0.00 H ATOM 9808 HH21 ARG B 313 -2.357 92.725 0.402 1.00 0.00 H ATOM 9809 H ARG B 313 0.325 87.854 -5.491 1.00 0.00 H ATOM 9810 N ALA B 314 2.353 88.921 -3.396 1.00 60.52 N ATOM 9811 CA ALA B 314 3.276 88.967 -2.280 1.00 62.11 C ATOM 9812 C ALA B 314 4.724 89.037 -2.766 1.00 63.99 C ATOM 9813 O ALA B 314 5.523 89.794 -2.232 1.00 64.12 O ATOM 9814 CB ALA B 314 3.081 87.784 -1.395 1.00 61.14 C ATOM 9815 HA ALA B 314 3.068 89.871 -1.707 1.00 0.00 H ATOM 9816 HB1 ALA B 314 2.060 87.782 -1.012 1.00 0.00 H ATOM 9817 HB2 ALA B 314 3.258 86.872 -1.965 1.00 0.00 H ATOM 9818 HB3 ALA B 314 3.783 87.835 -0.562 1.00 0.00 H ATOM 9819 H ALA B 314 1.842 88.038 -3.600 1.00 0.00 H ATOM 9820 N LEU B 315 5.056 88.242 -3.773 1.00 65.55 N ATOM 9821 CA LEU B 315 6.418 88.200 -4.273 1.00 67.39 C ATOM 9822 C LEU B 315 6.722 89.485 -5.034 1.00 70.23 C ATOM 9823 O LEU B 315 7.800 90.049 -4.896 1.00 71.40 O ATOM 9824 CB LEU B 315 6.642 86.987 -5.172 1.00 66.69 C ATOM 9825 CG LEU B 315 6.744 85.595 -4.533 1.00 64.45 C ATOM 9826 CD1 LEU B 315 6.686 84.530 -5.620 1.00 61.76 C ATOM 9827 CD2 LEU B 315 7.997 85.435 -3.705 1.00 61.29 C ATOM 9828 HA LEU B 315 7.095 88.112 -3.423 1.00 0.00 H ATOM 9829 HB2 LEU B 315 5.812 86.955 -5.878 1.00 0.00 H ATOM 9830 HB3 LEU B 315 7.572 87.159 -5.714 1.00 0.00 H ATOM 9831 HG LEU B 315 5.899 85.477 -3.855 1.00 0.00 H ATOM 9832 HD21 LEU B 315 8.871 85.581 -4.339 1.00 0.00 H ATOM 9833 HD22 LEU B 315 7.999 86.175 -2.905 1.00 0.00 H ATOM 9834 HD23 LEU B 315 8.021 84.434 -3.275 1.00 0.00 H ATOM 9835 HD11 LEU B 315 5.742 84.614 -6.159 1.00 0.00 H ATOM 9836 HD12 LEU B 315 7.516 84.674 -6.312 1.00 0.00 H ATOM 9837 HD13 LEU B 315 6.759 83.543 -5.164 1.00 0.00 H ATOM 9838 H LEU B 315 4.330 87.640 -4.211 1.00 0.00 H ATOM 9839 N HIS B 316 5.760 89.939 -5.832 1.00 72.24 N ATOM 9840 CA HIS B 316 5.839 91.222 -6.502 1.00 74.05 C ATOM 9841 C HIS B 316 6.100 92.356 -5.514 1.00 75.70 C ATOM 9842 O HIS B 316 6.898 93.232 -5.794 1.00 76.56 O ATOM 9843 CB HIS B 316 4.551 91.479 -7.296 1.00 73.89 C ATOM 9844 CG HIS B 316 4.557 92.750 -8.081 1.00 73.84 C ATOM 9845 ND1 HIS B 316 4.974 92.816 -9.392 1.00 72.26 N ATOM 9846 CD2 HIS B 316 4.193 94.007 -7.733 1.00 74.11 C ATOM 9847 CE1 HIS B 316 4.858 94.061 -9.820 1.00 74.11 C ATOM 9848 NE2 HIS B 316 4.386 94.803 -8.832 1.00 74.47 N ATOM 9849 HA HIS B 316 6.682 91.193 -7.192 1.00 0.00 H ATOM 9850 HB2 HIS B 316 4.405 90.650 -7.989 1.00 0.00 H ATOM 9851 HB3 HIS B 316 3.718 91.515 -6.594 1.00 0.00 H ATOM 9852 HD2 HIS B 316 3.817 94.326 -6.761 1.00 0.00 H ATOM 9853 HE1 HIS B 316 5.109 94.417 -10.819 1.00 0.00 H ATOM 9854 H HIS B 316 4.916 89.349 -5.982 1.00 0.00 H ATOM 9855 N ALA B 317 5.466 92.344 -4.353 1.00 77.00 N ATOM 9856 CA ALA B 317 5.694 93.420 -3.386 1.00 78.82 C ATOM 9857 C ALA B 317 7.103 93.378 -2.746 1.00 80.48 C ATOM 9858 O ALA B 317 7.398 94.188 -1.879 1.00 80.35 O ATOM 9859 CB ALA B 317 4.609 93.424 -2.311 1.00 78.07 C ATOM 9860 HA ALA B 317 5.640 94.353 -3.947 1.00 0.00 H ATOM 9861 HB1 ALA B 317 3.636 93.573 -2.779 1.00 0.00 H ATOM 9862 HB2 ALA B 317 4.618 92.470 -1.784 1.00 0.00 H ATOM 9863 HB3 ALA B 317 4.801 94.232 -1.605 1.00 0.00 H ATOM 9864 H ALA B 317 4.807 91.572 -4.127 1.00 0.00 H ATOM 9865 N GLN B 318 7.917 92.474 -3.267 1.00 81.95 N ATOM 9866 CA GLN B 318 9.222 92.167 -2.758 1.00 83.62 C ATOM 9867 C GLN B 318 10.260 92.210 -3.866 1.00 84.42 C ATOM 9868 O GLN B 318 11.356 91.710 -3.725 1.00 84.28 O ATOM 9869 CB GLN B 318 9.194 90.768 -2.186 1.00 83.32 C ATOM 9870 CG GLN B 318 8.818 90.720 -0.747 1.00 83.46 C ATOM 9871 CD GLN B 318 8.736 89.318 -0.212 1.00 83.13 C ATOM 9872 OE1 GLN B 318 9.406 88.415 -0.690 1.00 82.36 O ATOM 9873 NE2 GLN B 318 7.913 89.133 0.798 1.00 82.60 N ATOM 9874 HA GLN B 318 9.486 92.902 -1.998 1.00 0.00 H ATOM 9875 HB2 GLN B 318 8.472 90.179 -2.751 1.00 0.00 H ATOM 9876 HB3 GLN B 318 10.186 90.330 -2.298 1.00 0.00 H ATOM 9877 HG2 GLN B 318 9.565 91.269 -0.173 1.00 0.00 H ATOM 9878 HG3 GLN B 318 7.845 91.197 -0.625 1.00 0.00 H ATOM 9879 HE22 GLN B 318 7.362 89.931 1.173 1.00 0.00 H ATOM 9880 HE21 GLN B 318 7.814 88.188 1.221 1.00 0.00 H ATOM 9881 H GLN B 318 7.588 91.950 -4.103 1.00 0.00 H ATOM 9882 N GLY B 319 9.889 92.779 -4.990 1.00 84.75 N ATOM 9883 CA GLY B 319 10.794 92.902 -6.094 1.00 85.28 C ATOM 9884 C GLY B 319 10.922 91.734 -7.027 1.00 84.44 C ATOM 9885 O GLY B 319 11.482 91.871 -8.085 1.00 84.84 O ATOM 9886 HA3 GLY B 319 11.784 93.100 -5.683 1.00 0.00 H ATOM 9887 HA2 GLY B 319 10.470 93.758 -6.686 1.00 0.00 H ATOM 9888 H GLY B 319 8.921 93.147 -5.080 1.00 0.00 H ATOM 9889 N ASP B 320 10.434 90.570 -6.659 1.00 83.42 N ATOM 9890 CA ASP B 320 10.632 89.439 -7.543 1.00 82.09 C ATOM 9891 C ASP B 320 10.491 89.927 -8.964 1.00 81.91 C ATOM 9892 O ASP B 320 9.471 90.452 -9.362 1.00 81.11 O ATOM 9893 CB ASP B 320 9.684 88.299 -7.239 1.00 80.85 C ATOM 9894 CG ASP B 320 10.230 86.992 -7.666 1.00 78.93 C ATOM 9895 OD1 ASP B 320 11.060 86.985 -8.576 1.00 77.34 O ATOM 9896 OD2 ASP B 320 9.860 85.966 -7.090 1.00 75.27 O ATOM 9897 HA ASP B 320 11.631 89.030 -7.391 1.00 0.00 H ATOM 9898 HB2 ASP B 320 9.502 88.270 -6.165 1.00 0.00 H ATOM 9899 HB3 ASP B 320 8.744 88.475 -7.761 1.00 0.00 H ATOM 9900 H ASP B 320 9.921 90.464 -5.760 1.00 0.00 H ATOM 9901 N PRO B 321 11.551 89.791 -9.726 1.00 82.17 N ATOM 9902 CA PRO B 321 11.598 90.361 -11.059 1.00 81.46 C ATOM 9903 C PRO B 321 11.417 89.252 -12.029 1.00 79.26 C ATOM 9904 O PRO B 321 11.403 89.446 -13.223 1.00 79.31 O ATOM 9905 CB PRO B 321 13.027 90.880 -11.143 1.00 82.40 C ATOM 9906 CG PRO B 321 13.755 90.124 -10.143 1.00 82.85 C ATOM 9907 CD PRO B 321 12.819 90.002 -9.029 1.00 82.71 C ATOM 9908 HA PRO B 321 10.848 91.126 -11.260 1.00 0.00 H ATOM 9909 HD3 PRO B 321 13.068 89.153 -8.392 1.00 0.00 H ATOM 9910 HD2 PRO B 321 12.796 90.911 -8.428 1.00 0.00 H ATOM 9911 HG3 PRO B 321 14.655 90.657 -9.835 1.00 0.00 H ATOM 9912 HG2 PRO B 321 14.030 89.141 -10.526 1.00 0.00 H ATOM 9913 HB2 PRO B 321 13.442 90.704 -12.135 1.00 0.00 H ATOM 9914 HB3 PRO B 321 13.062 91.946 -10.920 1.00 0.00 H ATOM 9915 N ALA B 322 11.292 88.061 -11.496 1.00 76.29 N ATOM 9916 CA ALA B 322 11.092 86.898 -12.359 1.00 73.80 C ATOM 9917 C ALA B 322 9.613 86.528 -12.606 1.00 70.97 C ATOM 9918 O ALA B 322 9.332 85.598 -13.349 1.00 69.03 O ATOM 9919 CB ALA B 322 11.869 85.708 -11.825 1.00 73.90 C ATOM 9920 HA ALA B 322 11.479 87.183 -13.337 1.00 0.00 H ATOM 9921 HB1 ALA B 322 12.931 85.953 -11.796 1.00 0.00 H ATOM 9922 HB2 ALA B 322 11.522 85.470 -10.819 1.00 0.00 H ATOM 9923 HB3 ALA B 322 11.710 84.850 -12.478 1.00 0.00 H ATOM 9924 H ALA B 322 11.335 87.944 -10.464 1.00 0.00 H ATOM 9925 N LEU B 323 8.680 87.273 -12.021 1.00 68.52 N ATOM 9926 CA LEU B 323 7.252 86.964 -12.166 1.00 66.50 C ATOM 9927 C LEU B 323 6.749 87.186 -13.593 1.00 65.53 C ATOM 9928 O LEU B 323 7.124 88.154 -14.234 1.00 65.61 O ATOM 9929 CB LEU B 323 6.413 87.803 -11.200 1.00 65.84 C ATOM 9930 CG LEU B 323 6.727 87.701 -9.702 1.00 64.02 C ATOM 9931 CD1 LEU B 323 5.961 88.754 -8.926 1.00 60.99 C ATOM 9932 CD2 LEU B 323 6.410 86.314 -9.211 1.00 61.62 C ATOM 9933 HA LEU B 323 7.140 85.906 -11.928 1.00 0.00 H ATOM 9934 HB2 LEU B 323 6.534 88.847 -11.487 1.00 0.00 H ATOM 9935 HB3 LEU B 323 5.372 87.509 -11.334 1.00 0.00 H ATOM 9936 HG LEU B 323 7.789 87.886 -9.542 1.00 0.00 H ATOM 9937 HD21 LEU B 323 5.353 86.105 -9.374 1.00 0.00 H ATOM 9938 HD22 LEU B 323 7.014 85.590 -9.758 1.00 0.00 H ATOM 9939 HD23 LEU B 323 6.635 86.247 -8.147 1.00 0.00 H ATOM 9940 HD11 LEU B 323 6.246 89.744 -9.281 1.00 0.00 H ATOM 9941 HD12 LEU B 323 4.891 88.607 -9.075 1.00 0.00 H ATOM 9942 HD13 LEU B 323 6.197 88.665 -7.866 1.00 0.00 H ATOM 9943 H LEU B 323 8.968 88.092 -11.448 1.00 0.00 H ATOM 9944 N SER B 324 5.906 86.273 -14.081 1.00 64.03 N ATOM 9945 CA SER B 324 5.206 86.443 -15.359 1.00 62.77 C ATOM 9946 C SER B 324 4.257 87.644 -15.313 1.00 62.87 C ATOM 9947 O SER B 324 3.693 87.962 -14.277 1.00 61.38 O ATOM 9948 CB SER B 324 4.440 85.165 -15.684 1.00 61.96 C ATOM 9949 OG SER B 324 3.745 85.254 -16.899 1.00 58.77 O ATOM 9950 HA SER B 324 5.940 86.636 -16.142 1.00 0.00 H ATOM 9951 HB2 SER B 324 3.725 84.972 -14.884 1.00 0.00 H ATOM 9952 HB3 SER B 324 5.147 84.338 -15.745 1.00 0.00 H ATOM 9953 HG SER B 324 3.265 84.404 -17.066 1.00 0.00 H ATOM 9954 H SER B 324 5.739 85.405 -13.532 1.00 0.00 H ATOM 9955 N MET B 325 4.115 88.343 -16.431 1.00 63.75 N ATOM 9956 CA MET B 325 3.165 89.461 -16.502 1.00 65.27 C ATOM 9957 C MET B 325 1.889 89.041 -17.250 1.00 61.73 C ATOM 9958 O MET B 325 1.071 89.895 -17.601 1.00 61.32 O ATOM 9959 CB MET B 325 3.743 90.692 -17.235 1.00 66.26 C ATOM 9960 CG MET B 325 5.108 91.248 -16.819 1.00 68.82 C ATOM 9961 SD MET B 325 5.904 92.204 -18.238 1.00 73.65 S ATOM 9962 CE MET B 325 5.756 91.132 -19.726 1.00 70.72 C ATOM 9963 HA MET B 325 2.949 89.730 -15.468 1.00 0.00 H ATOM 9964 HB2 MET B 325 3.817 90.427 -18.290 1.00 0.00 H ATOM 9965 HB3 MET B 325 3.022 91.500 -17.114 1.00 0.00 H ATOM 9966 HG2 MET B 325 5.759 90.421 -16.535 1.00 0.00 H ATOM 9967 HG3 MET B 325 4.978 91.915 -15.967 1.00 0.00 H ATOM 9968 HE1 MET B 325 6.275 90.190 -19.547 1.00 0.00 H ATOM 9969 HE2 MET B 325 4.703 90.935 -19.927 1.00 0.00 H ATOM 9970 HE3 MET B 325 6.203 91.637 -20.582 1.00 0.00 H ATOM 9971 H MET B 325 4.683 88.097 -17.267 1.00 0.00 H ATOM 9972 N SER B 326 1.729 87.747 -17.510 1.00 58.37 N ATOM 9973 CA SER B 326 0.538 87.249 -18.198 1.00 55.96 C ATOM 9974 C SER B 326 -0.163 86.025 -17.545 1.00 53.08 C ATOM 9975 O SER B 326 -1.354 85.845 -17.720 1.00 53.43 O ATOM 9976 CB SER B 326 0.888 86.921 -19.657 1.00 56.09 C ATOM 9977 OG SER B 326 1.791 85.828 -19.757 1.00 54.91 O ATOM 9978 HA SER B 326 -0.187 88.059 -18.125 1.00 0.00 H ATOM 9979 HB2 SER B 326 1.345 87.798 -20.115 1.00 0.00 H ATOM 9980 HB3 SER B 326 -0.029 86.670 -20.191 1.00 0.00 H ATOM 9981 HG SER B 326 1.381 85.024 -19.349 1.00 0.00 H ATOM 9982 H SER B 326 2.466 87.074 -17.218 1.00 0.00 H ATOM 9983 N HIS B 327 0.556 85.184 -16.820 1.00 49.26 N ATOM 9984 CA HIS B 327 -0.030 83.985 -16.285 1.00 46.27 C ATOM 9985 C HIS B 327 0.295 83.764 -14.813 1.00 43.83 C ATOM 9986 O HIS B 327 1.387 84.064 -14.349 1.00 44.20 O ATOM 9987 CB HIS B 327 0.460 82.797 -17.087 1.00 46.02 C ATOM 9988 CG HIS B 327 -0.029 82.776 -18.505 1.00 47.70 C ATOM 9989 ND1 HIS B 327 0.786 83.066 -19.580 1.00 49.21 N ATOM 9990 CD2 HIS B 327 -1.241 82.477 -19.026 1.00 46.89 C ATOM 9991 CE1 HIS B 327 0.098 82.939 -20.697 1.00 48.18 C ATOM 9992 NE2 HIS B 327 -1.133 82.583 -20.389 1.00 47.76 N ATOM 9993 HA HIS B 327 -1.112 84.094 -16.359 1.00 0.00 H ATOM 9994 HB2 HIS B 327 1.550 82.818 -17.100 1.00 0.00 H ATOM 9995 HB3 HIS B 327 0.121 81.886 -16.593 1.00 0.00 H ATOM 9996 HD2 HIS B 327 -2.136 82.203 -18.467 1.00 0.00 H ATOM 9997 HE1 HIS B 327 0.482 83.101 -21.704 1.00 0.00 H ATOM 9998 H HIS B 327 1.558 85.393 -16.635 1.00 0.00 H ATOM 9999 N TRP B 328 -0.654 83.199 -14.086 1.00 40.82 N ATOM 10000 CA TRP B 328 -0.412 82.748 -12.715 1.00 38.69 C ATOM 10001 C TRP B 328 0.482 81.523 -12.779 1.00 37.73 C ATOM 10002 O TRP B 328 0.578 80.907 -13.823 1.00 37.17 O ATOM 10003 CB TRP B 328 -1.711 82.342 -12.020 1.00 37.12 C ATOM 10004 CG TRP B 328 -2.798 83.347 -11.995 1.00 35.52 C ATOM 10005 CD1 TRP B 328 -4.040 83.185 -12.498 1.00 34.25 C ATOM 10006 CD2 TRP B 328 -2.763 84.663 -11.414 1.00 34.52 C ATOM 10007 NE1 TRP B 328 -4.792 84.315 -12.276 1.00 34.42 N ATOM 10008 CE2 TRP B 328 -4.041 85.230 -11.595 1.00 33.17 C ATOM 10009 CE3 TRP B 328 -1.784 85.406 -10.734 1.00 34.51 C ATOM 10010 CZ2 TRP B 328 -4.370 86.507 -11.142 1.00 34.91 C ATOM 10011 CZ3 TRP B 328 -2.113 86.690 -10.271 1.00 34.46 C ATOM 10012 CH2 TRP B 328 -3.391 87.222 -10.478 1.00 35.57 C ATOM 10013 HA TRP B 328 0.044 83.565 -12.155 1.00 0.00 H ATOM 10014 HB2 TRP B 328 -2.093 81.456 -12.526 1.00 0.00 H ATOM 10015 HB3 TRP B 328 -1.468 82.093 -10.987 1.00 0.00 H ATOM 10016 HE1 TRP B 328 -5.777 84.451 -12.579 1.00 0.00 H ATOM 10017 HD1 TRP B 328 -4.395 82.289 -13.006 1.00 0.00 H ATOM 10018 HZ2 TRP B 328 -5.363 86.926 -11.306 1.00 0.00 H ATOM 10019 HH2 TRP B 328 -3.619 88.221 -10.108 1.00 0.00 H ATOM 10020 HZ3 TRP B 328 -1.364 87.280 -9.744 1.00 0.00 H ATOM 10021 HE3 TRP B 328 -0.788 84.994 -10.569 1.00 0.00 H ATOM 10022 H TRP B 328 -1.599 83.071 -14.500 1.00 0.00 H ATOM 10023 N MET B 329 1.107 81.151 -11.668 1.00 36.86 N ATOM 10024 CA MET B 329 2.043 80.024 -11.680 1.00 37.14 C ATOM 10025 C MET B 329 1.369 78.635 -11.486 1.00 35.68 C ATOM 10026 O MET B 329 1.666 77.925 -10.539 1.00 34.89 O ATOM 10027 CB MET B 329 3.159 80.268 -10.645 1.00 37.82 C ATOM 10028 CG MET B 329 4.380 81.030 -11.186 1.00 39.43 C ATOM 10029 SD MET B 329 5.610 81.492 -9.884 1.00 41.55 S ATOM 10030 CE MET B 329 4.672 82.721 -8.975 1.00 40.18 C ATOM 10031 HA MET B 329 2.476 79.981 -12.680 1.00 0.00 H ATOM 10032 HB2 MET B 329 2.738 80.842 -9.820 1.00 0.00 H ATOM 10033 HB3 MET B 329 3.498 79.300 -10.276 1.00 0.00 H ATOM 10034 HG2 MET B 329 4.030 81.943 -11.668 1.00 0.00 H ATOM 10035 HG3 MET B 329 4.879 80.401 -11.923 1.00 0.00 H ATOM 10036 HE1 MET B 329 4.408 83.541 -9.642 1.00 0.00 H ATOM 10037 HE2 MET B 329 3.764 82.265 -8.581 1.00 0.00 H ATOM 10038 HE3 MET B 329 5.276 83.101 -8.151 1.00 0.00 H ATOM 10039 H MET B 329 0.930 81.665 -10.781 1.00 0.00 H ATOM 10040 N PHE B 330 0.448 78.292 -12.395 1.00 34.78 N ATOM 10041 CA PHE B 330 -0.192 76.951 -12.497 1.00 34.01 C ATOM 10042 C PHE B 330 -0.722 76.790 -13.932 1.00 33.55 C ATOM 10043 O PHE B 330 -0.689 77.752 -14.671 1.00 34.24 O ATOM 10044 CB PHE B 330 -1.295 76.700 -11.423 1.00 32.48 C ATOM 10045 CG PHE B 330 -2.601 77.481 -11.626 1.00 31.17 C ATOM 10046 CD1 PHE B 330 -3.661 76.941 -12.353 1.00 30.70 C ATOM 10047 CD2 PHE B 330 -2.796 78.717 -11.040 1.00 31.30 C ATOM 10048 CE1 PHE B 330 -4.883 77.635 -12.518 1.00 26.72 C ATOM 10049 CE2 PHE B 330 -4.027 79.411 -11.189 1.00 30.97 C ATOM 10050 CZ PHE B 330 -5.059 78.856 -11.952 1.00 28.07 C ATOM 10051 HA PHE B 330 0.556 76.187 -12.285 1.00 0.00 H ATOM 10052 HB2 PHE B 330 -1.534 75.637 -11.428 1.00 0.00 H ATOM 10053 HB3 PHE B 330 -0.886 76.974 -10.450 1.00 0.00 H ATOM 10054 HD2 PHE B 330 -1.994 79.166 -10.455 1.00 0.00 H ATOM 10055 HE2 PHE B 330 -4.167 80.379 -10.707 1.00 0.00 H ATOM 10056 HZ PHE B 330 -5.994 79.398 -12.091 1.00 0.00 H ATOM 10057 HE1 PHE B 330 -5.687 77.187 -13.102 1.00 0.00 H ATOM 10058 HD1 PHE B 330 -3.545 75.957 -12.807 1.00 0.00 H ATOM 10059 H PHE B 330 0.157 79.017 -13.082 1.00 0.00 H ATOM 10060 N HIS B 331 -1.150 75.591 -14.337 1.00 33.13 N ATOM 10061 CA HIS B 331 -1.642 75.359 -15.711 1.00 34.07 C ATOM 10062 C HIS B 331 -3.081 75.813 -15.761 1.00 34.09 C ATOM 10063 O HIS B 331 -3.990 75.038 -15.482 1.00 35.67 O ATOM 10064 CB HIS B 331 -1.573 73.866 -16.086 1.00 34.49 C ATOM 10065 CG HIS B 331 -1.360 73.608 -17.535 1.00 35.97 C ATOM 10066 ND1 HIS B 331 -2.334 73.841 -18.488 1.00 39.28 N ATOM 10067 CD2 HIS B 331 -0.280 73.131 -18.204 1.00 35.88 C ATOM 10068 CE1 HIS B 331 -1.860 73.526 -19.683 1.00 38.06 C ATOM 10069 NE2 HIS B 331 -0.613 73.096 -19.537 1.00 37.61 N ATOM 10070 HA HIS B 331 -1.021 75.911 -16.416 1.00 0.00 H ATOM 10071 HB2 HIS B 331 -0.750 73.413 -15.534 1.00 0.00 H ATOM 10072 HB3 HIS B 331 -2.510 73.396 -15.789 1.00 0.00 H ATOM 10073 HD2 HIS B 331 0.672 72.832 -17.766 1.00 0.00 H ATOM 10074 HE1 HIS B 331 -2.401 73.606 -20.626 1.00 0.00 H ATOM 10075 H HIS B 331 -1.137 74.797 -13.665 1.00 0.00 H ATOM 10076 N GLN B 332 -3.297 77.081 -16.054 1.00 34.06 N ATOM 10077 CA GLN B 332 -4.640 77.632 -16.107 1.00 34.11 C ATOM 10078 C GLN B 332 -5.545 76.904 -17.073 1.00 34.17 C ATOM 10079 O GLN B 332 -6.705 76.618 -16.753 1.00 34.58 O ATOM 10080 CB GLN B 332 -4.616 79.104 -16.471 1.00 34.30 C ATOM 10081 CG GLN B 332 -4.107 79.981 -15.330 1.00 33.43 C ATOM 10082 CD GLN B 332 -3.672 81.286 -15.882 1.00 33.49 C ATOM 10083 OE1 GLN B 332 -2.471 81.572 -15.961 1.00 33.72 O ATOM 10084 NE2 GLN B 332 -4.631 82.056 -16.373 1.00 28.90 N ATOM 10085 HA GLN B 332 -5.046 77.502 -15.104 1.00 0.00 H ATOM 10086 HB2 GLN B 332 -3.964 79.240 -17.334 1.00 0.00 H ATOM 10087 HB3 GLN B 332 -5.628 79.417 -16.728 1.00 0.00 H ATOM 10088 HG2 GLN B 332 -4.906 80.138 -14.605 1.00 0.00 H ATOM 10089 HG3 GLN B 332 -3.265 79.492 -14.840 1.00 0.00 H ATOM 10090 HE22 GLN B 332 -5.626 81.770 -16.280 1.00 0.00 H ATOM 10091 HE21 GLN B 332 -4.389 82.947 -16.851 1.00 0.00 H ATOM 10092 H GLN B 332 -2.486 77.701 -16.252 1.00 0.00 H ATOM 10093 N GLN B 333 -5.014 76.591 -18.238 1.00 33.97 N ATOM 10094 CA GLN B 333 -5.799 75.884 -19.230 1.00 33.95 C ATOM 10095 C GLN B 333 -6.272 74.496 -18.739 1.00 33.26 C ATOM 10096 O GLN B 333 -7.422 74.114 -18.947 1.00 33.97 O ATOM 10097 CB GLN B 333 -5.045 75.829 -20.578 1.00 33.96 C ATOM 10098 CG GLN B 333 -5.229 74.538 -21.326 1.00 34.54 C ATOM 10099 CD GLN B 333 -4.509 74.480 -22.647 1.00 35.71 C ATOM 10100 OE1 GLN B 333 -5.050 73.957 -23.600 1.00 39.20 O ATOM 10101 NE2 GLN B 333 -3.264 74.975 -22.705 1.00 37.69 N ATOM 10102 HA GLN B 333 -6.717 76.449 -19.395 1.00 0.00 H ATOM 10103 HB2 GLN B 333 -5.404 76.644 -21.206 1.00 0.00 H ATOM 10104 HB3 GLN B 333 -3.981 75.964 -20.382 1.00 0.00 H ATOM 10105 HG2 GLN B 333 -4.861 73.725 -20.700 1.00 0.00 H ATOM 10106 HG3 GLN B 333 -6.294 74.399 -21.511 1.00 0.00 H ATOM 10107 HE22 GLN B 333 -2.840 75.415 -21.864 1.00 0.00 H ATOM 10108 HE21 GLN B 333 -2.723 74.919 -23.591 1.00 0.00 H ATOM 10109 H GLN B 333 -4.029 76.852 -18.446 1.00 0.00 H ATOM 10110 N ALA B 334 -5.412 73.736 -18.089 1.00 33.25 N ATOM 10111 CA ALA B 334 -5.791 72.372 -17.667 1.00 32.87 C ATOM 10112 C ALA B 334 -6.822 72.422 -16.545 1.00 32.46 C ATOM 10113 O ALA B 334 -7.691 71.576 -16.481 1.00 33.02 O ATOM 10114 CB ALA B 334 -4.606 71.594 -17.225 1.00 32.81 C ATOM 10115 HA ALA B 334 -6.228 71.872 -18.531 1.00 0.00 H ATOM 10116 HB1 ALA B 334 -3.895 71.518 -18.048 1.00 0.00 H ATOM 10117 HB2 ALA B 334 -4.135 72.100 -16.382 1.00 0.00 H ATOM 10118 HB3 ALA B 334 -4.921 70.596 -16.922 1.00 0.00 H ATOM 10119 H ALA B 334 -4.462 74.099 -17.872 1.00 0.00 H ATOM 10120 N LEU B 335 -6.756 73.421 -15.671 1.00 31.90 N ATOM 10121 CA LEU B 335 -7.784 73.543 -14.652 1.00 31.26 C ATOM 10122 C LEU B 335 -9.153 73.820 -15.283 1.00 31.82 C ATOM 10123 O LEU B 335 -10.169 73.287 -14.814 1.00 31.63 O ATOM 10124 CB LEU B 335 -7.435 74.620 -13.635 1.00 31.20 C ATOM 10125 CG LEU B 335 -8.394 74.851 -12.464 1.00 29.65 C ATOM 10126 CD1 LEU B 335 -8.500 73.627 -11.583 1.00 29.41 C ATOM 10127 CD2 LEU B 335 -7.930 76.084 -11.666 1.00 29.38 C ATOM 10128 HA LEU B 335 -7.836 72.590 -14.125 1.00 0.00 H ATOM 10129 HB2 LEU B 335 -6.464 74.362 -13.211 1.00 0.00 H ATOM 10130 HB3 LEU B 335 -7.354 75.562 -14.177 1.00 0.00 H ATOM 10131 HG LEU B 335 -9.394 75.038 -12.856 1.00 0.00 H ATOM 10132 HD21 LEU B 335 -6.923 75.912 -11.287 1.00 0.00 H ATOM 10133 HD22 LEU B 335 -7.930 76.958 -12.318 1.00 0.00 H ATOM 10134 HD23 LEU B 335 -8.610 76.252 -10.831 1.00 0.00 H ATOM 10135 HD11 LEU B 335 -8.870 72.788 -12.172 1.00 0.00 H ATOM 10136 HD12 LEU B 335 -7.516 73.384 -11.181 1.00 0.00 H ATOM 10137 HD13 LEU B 335 -9.189 73.830 -10.763 1.00 0.00 H ATOM 10138 H LEU B 335 -5.977 74.108 -15.716 1.00 0.00 H ATOM 10139 N GLN B 336 -9.189 74.630 -16.342 1.00 32.05 N ATOM 10140 CA GLN B 336 -10.464 74.964 -16.970 1.00 32.48 C ATOM 10141 C GLN B 336 -11.009 73.699 -17.614 1.00 32.29 C ATOM 10142 O GLN B 336 -12.186 73.400 -17.495 1.00 32.54 O ATOM 10143 CB GLN B 336 -10.322 76.096 -17.982 1.00 32.25 C ATOM 10144 CG GLN B 336 -9.903 77.416 -17.345 1.00 33.65 C ATOM 10145 CD GLN B 336 -9.871 78.580 -18.324 1.00 34.58 C ATOM 10146 OE1 GLN B 336 -10.732 78.684 -19.213 1.00 39.05 O ATOM 10147 NE2 GLN B 336 -8.903 79.482 -18.151 1.00 34.68 N ATOM 10148 HA GLN B 336 -11.162 75.329 -16.216 1.00 0.00 H ATOM 10149 HB2 GLN B 336 -9.571 75.812 -18.719 1.00 0.00 H ATOM 10150 HB3 GLN B 336 -11.281 76.239 -18.480 1.00 0.00 H ATOM 10151 HG2 GLN B 336 -10.608 77.654 -16.549 1.00 0.00 H ATOM 10152 HG3 GLN B 336 -8.906 77.294 -16.921 1.00 0.00 H ATOM 10153 HE22 GLN B 336 -8.203 79.354 -17.393 1.00 0.00 H ATOM 10154 HE21 GLN B 336 -8.849 80.313 -18.774 1.00 0.00 H ATOM 10155 H GLN B 336 -8.305 75.025 -16.722 1.00 0.00 H ATOM 10156 N GLU B 337 -10.130 72.936 -18.245 1.00 32.46 N ATOM 10157 CA GLU B 337 -10.519 71.687 -18.894 1.00 32.81 C ATOM 10158 C GLU B 337 -11.137 70.725 -17.901 1.00 32.64 C ATOM 10159 O GLU B 337 -12.177 70.115 -18.192 1.00 32.83 O ATOM 10160 CB GLU B 337 -9.324 71.033 -19.608 1.00 32.95 C ATOM 10161 CG GLU B 337 -9.062 71.773 -20.925 1.00 34.90 C ATOM 10162 CD GLU B 337 -7.794 71.387 -21.617 1.00 36.17 C ATOM 10163 OE1 GLU B 337 -7.381 70.228 -21.516 1.00 35.69 O ATOM 10164 OE2 GLU B 337 -7.215 72.258 -22.291 1.00 40.98 O ATOM 10165 HA GLU B 337 -11.270 71.930 -19.646 1.00 0.00 H ATOM 10166 HB2 GLU B 337 -8.441 71.094 -18.972 1.00 0.00 H ATOM 10167 HB3 GLU B 337 -9.550 69.987 -19.815 1.00 0.00 H ATOM 10168 HG2 GLU B 337 -9.893 71.570 -21.600 1.00 0.00 H ATOM 10169 HG3 GLU B 337 -9.021 72.841 -20.712 1.00 0.00 H ATOM 10170 H GLU B 337 -9.134 73.235 -18.279 1.00 0.00 H ATOM 10171 N TYR B 338 -10.506 70.614 -16.731 1.00 32.09 N ATOM 10172 CA TYR B 338 -10.995 69.744 -15.678 1.00 31.73 C ATOM 10173 C TYR B 338 -12.391 70.212 -15.206 1.00 30.86 C ATOM 10174 O TYR B 338 -13.357 69.450 -15.202 1.00 31.10 O ATOM 10175 CB TYR B 338 -9.983 69.630 -14.503 1.00 31.44 C ATOM 10176 CG TYR B 338 -10.589 68.841 -13.375 1.00 31.40 C ATOM 10177 CD1 TYR B 338 -10.644 67.457 -13.435 1.00 31.12 C ATOM 10178 CD2 TYR B 338 -11.218 69.485 -12.303 1.00 30.67 C ATOM 10179 CE1 TYR B 338 -11.262 66.727 -12.444 1.00 31.04 C ATOM 10180 CE2 TYR B 338 -11.829 68.762 -11.304 1.00 30.81 C ATOM 10181 CZ TYR B 338 -11.845 67.377 -11.382 1.00 30.84 C ATOM 10182 OH TYR B 338 -12.466 66.637 -10.410 1.00 30.68 O ATOM 10183 HA TYR B 338 -11.098 68.738 -16.085 1.00 0.00 H ATOM 10184 HB3 TYR B 338 -9.727 70.629 -14.149 1.00 0.00 H ATOM 10185 HB2 TYR B 338 -9.081 69.127 -14.851 1.00 0.00 H ATOM 10186 HD2 TYR B 338 -11.224 70.574 -12.259 1.00 0.00 H ATOM 10187 HE2 TYR B 338 -12.295 69.272 -10.461 1.00 0.00 H ATOM 10188 HE1 TYR B 338 -11.289 65.639 -12.501 1.00 0.00 H ATOM 10189 HD1 TYR B 338 -10.191 66.938 -14.280 1.00 0.00 H ATOM 10190 HH TYR B 338 -13.424 66.884 -10.371 1.00 0.00 H ATOM 10191 H TYR B 338 -9.640 71.166 -16.569 1.00 0.00 H ATOM 10192 N ILE B 339 -12.487 71.472 -14.850 1.00 30.26 N ATOM 10193 CA ILE B 339 -13.736 72.002 -14.382 1.00 30.51 C ATOM 10194 C ILE B 339 -14.840 71.859 -15.440 1.00 31.44 C ATOM 10195 O ILE B 339 -15.924 71.356 -15.134 1.00 31.23 O ATOM 10196 CB ILE B 339 -13.625 73.498 -13.993 1.00 30.81 C ATOM 10197 CG1 ILE B 339 -12.578 73.706 -12.884 1.00 29.43 C ATOM 10198 CG2 ILE B 339 -15.006 74.027 -13.558 1.00 28.76 C ATOM 10199 CD1 ILE B 339 -12.389 75.125 -12.559 1.00 28.06 C ATOM 10200 HA ILE B 339 -13.994 71.420 -13.497 1.00 0.00 H ATOM 10201 HB ILE B 339 -13.292 74.062 -14.864 1.00 0.00 H ATOM 10202 HG12 ILE B 339 -12.907 73.181 -11.987 1.00 0.00 H ATOM 10203 HG13 ILE B 339 -11.626 73.292 -13.217 1.00 0.00 H ATOM 10204 HD11 ILE B 339 -12.052 75.658 -13.448 1.00 0.00 H ATOM 10205 HD12 ILE B 339 -13.334 75.547 -12.217 1.00 0.00 H ATOM 10206 HD13 ILE B 339 -11.641 75.220 -11.772 1.00 0.00 H ATOM 10207 HG21 ILE B 339 -15.711 73.919 -14.382 1.00 0.00 H ATOM 10208 HG22 ILE B 339 -15.359 73.455 -12.699 1.00 0.00 H ATOM 10209 HG23 ILE B 339 -14.921 75.079 -13.286 1.00 0.00 H ATOM 10210 H ILE B 339 -11.653 72.090 -14.907 1.00 0.00 H ATOM 10211 N LEU B 340 -14.572 72.304 -16.676 1.00 31.96 N ATOM 10212 CA LEU B 340 -15.600 72.300 -17.726 1.00 32.42 C ATOM 10213 C LEU B 340 -16.029 70.894 -18.182 1.00 32.69 C ATOM 10214 O LEU B 340 -17.183 70.691 -18.490 1.00 32.39 O ATOM 10215 CB LEU B 340 -15.152 73.141 -18.925 1.00 32.94 C ATOM 10216 CG LEU B 340 -15.254 74.651 -18.660 1.00 33.68 C ATOM 10217 CD1 LEU B 340 -14.328 75.450 -19.590 1.00 33.79 C ATOM 10218 CD2 LEU B 340 -16.681 75.122 -18.792 1.00 32.95 C ATOM 10219 HA LEU B 340 -16.485 72.749 -17.274 1.00 0.00 H ATOM 10220 HB2 LEU B 340 -14.115 72.896 -19.155 1.00 0.00 H ATOM 10221 HB3 LEU B 340 -15.781 72.893 -19.780 1.00 0.00 H ATOM 10222 HG LEU B 340 -14.926 74.829 -17.636 1.00 0.00 H ATOM 10223 HD21 LEU B 340 -17.038 74.916 -19.801 1.00 0.00 H ATOM 10224 HD22 LEU B 340 -17.305 74.595 -18.070 1.00 0.00 H ATOM 10225 HD23 LEU B 340 -16.728 76.194 -18.600 1.00 0.00 H ATOM 10226 HD11 LEU B 340 -13.296 75.140 -19.427 1.00 0.00 H ATOM 10227 HD12 LEU B 340 -14.606 75.262 -20.627 1.00 0.00 H ATOM 10228 HD13 LEU B 340 -14.427 76.514 -19.373 1.00 0.00 H ATOM 10229 H LEU B 340 -13.619 72.658 -16.896 1.00 0.00 H ATOM 10230 N MET B 341 -15.120 69.927 -18.185 1.00 33.20 N ATOM 10231 CA MET B 341 -15.424 68.597 -18.723 1.00 34.09 C ATOM 10232 C MET B 341 -15.883 67.595 -17.684 1.00 33.77 C ATOM 10233 O MET B 341 -16.649 66.691 -18.040 1.00 33.45 O ATOM 10234 CB MET B 341 -14.224 67.986 -19.466 1.00 33.93 C ATOM 10235 CG MET B 341 -14.061 68.446 -20.914 1.00 35.42 C ATOM 10236 SD MET B 341 -12.652 67.632 -21.768 1.00 37.92 S ATOM 10237 CE MET B 341 -11.283 68.743 -21.391 1.00 37.05 C ATOM 10238 HA MET B 341 -16.250 68.780 -19.410 1.00 0.00 H ATOM 10239 HB2 MET B 341 -13.318 68.252 -18.922 1.00 0.00 H ATOM 10240 HB3 MET B 341 -14.342 66.902 -19.466 1.00 0.00 H ATOM 10241 HG2 MET B 341 -13.897 69.524 -20.921 1.00 0.00 H ATOM 10242 HG3 MET B 341 -14.977 68.216 -21.458 1.00 0.00 H ATOM 10243 HE1 MET B 341 -11.503 69.735 -21.784 1.00 0.00 H ATOM 10244 HE2 MET B 341 -11.150 68.800 -20.311 1.00 0.00 H ATOM 10245 HE3 MET B 341 -10.371 68.363 -21.851 1.00 0.00 H ATOM 10246 H MET B 341 -14.173 70.116 -17.798 1.00 0.00 H ATOM 10247 N CYS B 342 -15.389 67.739 -16.435 1.00 33.95 N ATOM 10248 CA CYS B 342 -15.580 66.761 -15.336 1.00 33.69 C ATOM 10249 C CYS B 342 -16.384 67.266 -14.148 1.00 32.83 C ATOM 10250 O CYS B 342 -16.702 66.471 -13.249 1.00 32.27 O ATOM 10251 CB CYS B 342 -14.230 66.381 -14.742 1.00 34.49 C ATOM 10252 SG CYS B 342 -12.987 65.705 -15.892 1.00 40.66 S ATOM 10253 HA CYS B 342 -16.118 65.941 -15.812 1.00 0.00 H ATOM 10254 HB2 CYS B 342 -14.408 65.632 -13.971 1.00 0.00 H ATOM 10255 HB3 CYS B 342 -13.806 67.276 -14.287 1.00 0.00 H ATOM 10256 HG CYS B 342 -11.830 65.415 -15.198 1.00 0.00 H ATOM 10257 H CYS B 342 -14.836 68.595 -16.229 1.00 0.00 H ATOM 10258 N CYS B 343 -16.664 68.570 -14.087 1.00 32.23 N ATOM 10259 CA CYS B 343 -17.261 69.130 -12.872 1.00 32.01 C ATOM 10260 C CYS B 343 -18.639 69.708 -13.035 1.00 31.98 C ATOM 10261 O CYS B 343 -19.234 70.127 -12.064 1.00 32.31 O ATOM 10262 CB CYS B 343 -16.324 70.145 -12.207 1.00 31.90 C ATOM 10263 SG CYS B 343 -14.883 69.338 -11.477 1.00 29.67 S ATOM 10264 HA CYS B 343 -17.393 68.268 -12.218 1.00 0.00 H ATOM 10265 HB2 CYS B 343 -16.870 70.671 -11.424 1.00 0.00 H ATOM 10266 HB3 CYS B 343 -15.987 70.861 -12.957 1.00 0.00 H ATOM 10267 HG CYS B 343 -15.299 68.435 -10.520 1.00 0.00 H ATOM 10268 H CYS B 343 -16.459 69.186 -14.899 1.00 0.00 H ATOM 10269 N GLN B 344 -19.161 69.677 -14.250 1.00 32.48 N ATOM 10270 CA GLN B 344 -20.494 70.184 -14.532 1.00 32.45 C ATOM 10271 C GLN B 344 -21.543 69.090 -14.478 1.00 32.95 C ATOM 10272 O GLN B 344 -21.395 68.008 -15.037 1.00 32.63 O ATOM 10273 CB GLN B 344 -20.541 70.846 -15.898 1.00 32.41 C ATOM 10274 CG GLN B 344 -19.865 72.157 -15.956 1.00 33.14 C ATOM 10275 CD GLN B 344 -20.159 72.890 -17.247 1.00 34.92 C ATOM 10276 OE1 GLN B 344 -21.012 73.791 -17.274 1.00 35.10 O ATOM 10277 NE2 GLN B 344 -19.433 72.525 -18.330 1.00 33.10 N ATOM 10278 HA GLN B 344 -20.719 70.917 -13.757 1.00 0.00 H ATOM 10279 HB2 GLN B 344 -20.062 70.182 -16.617 1.00 0.00 H ATOM 10280 HB3 GLN B 344 -21.586 70.987 -16.175 1.00 0.00 H ATOM 10281 HG2 GLN B 344 -20.206 72.767 -15.119 1.00 0.00 H ATOM 10282 HG3 GLN B 344 -18.789 72.002 -15.876 1.00 0.00 H ATOM 10283 HE22 GLN B 344 -18.730 71.762 -18.252 1.00 0.00 H ATOM 10284 HE21 GLN B 344 -19.578 73.007 -19.240 1.00 0.00 H ATOM 10285 H GLN B 344 -18.600 69.277 -15.029 1.00 0.00 H ATOM 10286 N CYS B 345 -22.632 69.399 -13.816 1.00 34.09 N ATOM 10287 CA CYS B 345 -23.794 68.547 -13.857 1.00 34.71 C ATOM 10288 C CYS B 345 -24.668 69.026 -15.035 1.00 35.01 C ATOM 10289 O CYS B 345 -24.910 70.207 -15.171 1.00 35.27 O ATOM 10290 CB CYS B 345 -24.525 68.675 -12.536 1.00 34.82 C ATOM 10291 SG CYS B 345 -26.131 67.968 -12.537 1.00 37.56 S ATOM 10292 HA CYS B 345 -23.536 67.498 -14.003 1.00 0.00 H ATOM 10293 HB2 CYS B 345 -24.617 69.734 -12.296 1.00 0.00 H ATOM 10294 HB3 CYS B 345 -23.933 68.180 -11.767 1.00 0.00 H ATOM 10295 HG CYS B 345 -26.707 68.137 -11.295 1.00 0.00 H ATOM 10296 H CYS B 345 -22.658 70.273 -13.252 1.00 0.00 H ATOM 10297 N PRO B 346 -25.098 68.120 -15.913 1.00 35.15 N ATOM 10298 CA PRO B 346 -25.913 68.547 -17.068 1.00 35.49 C ATOM 10299 C PRO B 346 -27.216 69.178 -16.624 1.00 35.91 C ATOM 10300 O PRO B 346 -27.717 70.109 -17.264 1.00 35.83 O ATOM 10301 CB PRO B 346 -26.217 67.237 -17.805 1.00 36.24 C ATOM 10302 CG PRO B 346 -25.160 66.231 -17.289 1.00 36.31 C ATOM 10303 CD PRO B 346 -24.840 66.667 -15.888 1.00 35.28 C ATOM 10304 HA PRO B 346 -25.395 69.289 -17.676 1.00 0.00 H ATOM 10305 HD3 PRO B 346 -25.487 66.168 -15.167 1.00 0.00 H ATOM 10306 HD2 PRO B 346 -23.798 66.460 -15.643 1.00 0.00 H ATOM 10307 HG3 PRO B 346 -24.266 66.264 -17.912 1.00 0.00 H ATOM 10308 HG2 PRO B 346 -25.565 65.219 -17.290 1.00 0.00 H ATOM 10309 HB2 PRO B 346 -27.223 66.890 -17.570 1.00 0.00 H ATOM 10310 HB3 PRO B 346 -26.123 67.373 -18.882 1.00 0.00 H ATOM 10311 N ALA B 347 -27.740 68.694 -15.499 1.00 36.06 N ATOM 10312 CA ALA B 347 -28.948 69.294 -14.888 1.00 36.17 C ATOM 10313 C ALA B 347 -28.731 70.740 -14.350 1.00 35.78 C ATOM 10314 O ALA B 347 -29.708 71.475 -14.162 1.00 36.11 O ATOM 10315 CB ALA B 347 -29.494 68.374 -13.770 1.00 35.79 C ATOM 10316 HA ALA B 347 -29.683 69.381 -15.688 1.00 0.00 H ATOM 10317 HB1 ALA B 347 -29.752 67.403 -14.194 1.00 0.00 H ATOM 10318 HB2 ALA B 347 -28.731 68.245 -13.002 1.00 0.00 H ATOM 10319 HB3 ALA B 347 -30.382 68.827 -13.330 1.00 0.00 H ATOM 10320 H ALA B 347 -27.291 67.876 -15.040 1.00 0.00 H ATOM 10321 N GLY B 348 -27.473 71.143 -14.106 1.00 34.99 N ATOM 10322 CA GLY B 348 -27.188 72.431 -13.448 1.00 34.54 C ATOM 10323 C GLY B 348 -26.397 72.232 -12.161 1.00 33.99 C ATOM 10324 O GLY B 348 -26.517 71.179 -11.512 1.00 34.28 O ATOM 10325 HA3 GLY B 348 -28.130 72.926 -13.213 1.00 0.00 H ATOM 10326 HA2 GLY B 348 -26.610 73.057 -14.128 1.00 0.00 H ATOM 10327 H GLY B 348 -26.681 70.531 -14.388 1.00 0.00 H ATOM 10328 N GLY B 349 -25.588 73.228 -11.790 1.00 33.15 N ATOM 10329 CA GLY B 349 -24.719 73.139 -10.608 1.00 32.58 C ATOM 10330 C GLY B 349 -23.436 72.377 -10.913 1.00 31.91 C ATOM 10331 O GLY B 349 -23.291 71.801 -12.010 1.00 31.33 O ATOM 10332 HA3 GLY B 349 -25.256 72.624 -9.811 1.00 0.00 H ATOM 10333 HA2 GLY B 349 -24.463 74.146 -10.280 1.00 0.00 H ATOM 10334 H GLY B 349 -25.572 74.099 -12.359 1.00 0.00 H ATOM 10335 N LEU B 350 -22.488 72.400 -9.978 1.00 30.91 N ATOM 10336 CA LEU B 350 -21.202 71.717 -10.226 1.00 30.64 C ATOM 10337 C LEU B 350 -20.814 70.811 -9.090 1.00 30.48 C ATOM 10338 O LEU B 350 -21.495 70.760 -8.058 1.00 29.50 O ATOM 10339 CB LEU B 350 -20.064 72.699 -10.556 1.00 30.14 C ATOM 10340 CG LEU B 350 -20.192 73.503 -11.863 1.00 29.34 C ATOM 10341 CD1 LEU B 350 -21.117 74.639 -11.637 1.00 26.14 C ATOM 10342 CD2 LEU B 350 -18.821 74.050 -12.325 1.00 29.96 C ATOM 10343 HA LEU B 350 -21.360 71.097 -11.108 1.00 0.00 H ATOM 10344 HB2 LEU B 350 -19.997 73.413 -9.735 1.00 0.00 H ATOM 10345 HB3 LEU B 350 -19.139 72.125 -10.612 1.00 0.00 H ATOM 10346 HG LEU B 350 -20.574 72.841 -12.640 1.00 0.00 H ATOM 10347 HD21 LEU B 350 -18.414 74.704 -11.554 1.00 0.00 H ATOM 10348 HD22 LEU B 350 -18.138 73.218 -12.495 1.00 0.00 H ATOM 10349 HD23 LEU B 350 -18.949 74.612 -13.250 1.00 0.00 H ATOM 10350 HD11 LEU B 350 -22.094 74.257 -11.341 1.00 0.00 H ATOM 10351 HD12 LEU B 350 -20.720 75.277 -10.848 1.00 0.00 H ATOM 10352 HD13 LEU B 350 -21.215 75.215 -12.557 1.00 0.00 H ATOM 10353 H LEU B 350 -22.652 72.896 -9.079 1.00 0.00 H ATOM 10354 N LEU B 351 -19.723 70.077 -9.306 1.00 30.72 N ATOM 10355 CA LEU B 351 -19.366 68.987 -8.420 1.00 30.81 C ATOM 10356 C LEU B 351 -17.872 68.728 -8.217 1.00 30.43 C ATOM 10357 O LEU B 351 -17.022 69.238 -8.946 1.00 31.38 O ATOM 10358 CB LEU B 351 -20.096 67.713 -8.880 1.00 31.12 C ATOM 10359 CG LEU B 351 -20.399 67.489 -10.350 1.00 32.09 C ATOM 10360 CD1 LEU B 351 -19.284 66.674 -10.979 1.00 31.45 C ATOM 10361 CD2 LEU B 351 -21.740 66.814 -10.511 1.00 28.10 C ATOM 10362 HA LEU B 351 -19.692 69.300 -7.428 1.00 0.00 H ATOM 10363 HB2 LEU B 351 -19.488 66.869 -8.554 1.00 0.00 H ATOM 10364 HB3 LEU B 351 -21.052 67.694 -8.357 1.00 0.00 H ATOM 10365 HG LEU B 351 -20.452 68.449 -10.864 1.00 0.00 H ATOM 10366 HD21 LEU B 351 -21.725 65.852 -9.999 1.00 0.00 H ATOM 10367 HD22 LEU B 351 -22.517 67.445 -10.079 1.00 0.00 H ATOM 10368 HD23 LEU B 351 -21.943 66.660 -11.571 1.00 0.00 H ATOM 10369 HD11 LEU B 351 -18.342 67.213 -10.880 1.00 0.00 H ATOM 10370 HD12 LEU B 351 -19.209 65.712 -10.473 1.00 0.00 H ATOM 10371 HD13 LEU B 351 -19.504 66.514 -12.035 1.00 0.00 H ATOM 10372 H LEU B 351 -19.117 70.290 -10.124 1.00 0.00 H ATOM 10373 N ASP B 352 -17.597 67.944 -7.182 1.00 29.95 N ATOM 10374 CA ASP B 352 -16.280 67.491 -6.785 1.00 29.74 C ATOM 10375 C ASP B 352 -15.629 66.762 -7.937 1.00 29.76 C ATOM 10376 O ASP B 352 -14.639 67.229 -8.479 1.00 30.08 O ATOM 10377 CB ASP B 352 -16.444 66.620 -5.516 1.00 29.91 C ATOM 10378 CG ASP B 352 -15.275 65.678 -5.233 1.00 31.76 C ATOM 10379 OD1 ASP B 352 -14.444 65.356 -6.113 1.00 33.30 O ATOM 10380 OD2 ASP B 352 -15.222 65.208 -4.076 1.00 37.34 O ATOM 10381 HA ASP B 352 -15.618 68.321 -6.539 1.00 0.00 H ATOM 10382 HB2 ASP B 352 -16.560 67.285 -4.660 1.00 0.00 H ATOM 10383 HB3 ASP B 352 -17.345 66.018 -5.631 1.00 0.00 H ATOM 10384 H ASP B 352 -18.401 67.626 -6.603 1.00 0.00 H ATOM 10385 N LYS B 353 -16.182 65.630 -8.331 1.00 30.34 N ATOM 10386 CA LYS B 353 -15.665 64.909 -9.486 1.00 31.38 C ATOM 10387 C LYS B 353 -16.762 64.088 -10.203 1.00 32.22 C ATOM 10388 O LYS B 353 -17.858 63.902 -9.682 1.00 32.05 O ATOM 10389 CB LYS B 353 -14.472 64.047 -9.035 1.00 31.70 C ATOM 10390 CG LYS B 353 -14.804 62.998 -7.962 1.00 32.59 C ATOM 10391 CD LYS B 353 -13.610 62.077 -7.649 1.00 32.03 C ATOM 10392 CE LYS B 353 -12.548 62.778 -6.814 1.00 31.70 C ATOM 10393 NZ LYS B 353 -12.885 62.948 -5.384 1.00 27.79 N ATOM 10394 HA LYS B 353 -15.318 65.624 -10.232 1.00 0.00 H ATOM 10395 HB2 LYS B 353 -14.080 63.526 -9.909 1.00 0.00 H ATOM 10396 HB3 LYS B 353 -13.706 64.711 -8.635 1.00 0.00 H ATOM 10397 HG2 LYS B 353 -15.097 63.514 -7.048 1.00 0.00 H ATOM 10398 HG3 LYS B 353 -15.634 62.387 -8.315 1.00 0.00 H ATOM 10399 HD2 LYS B 353 -13.971 61.207 -7.100 1.00 0.00 H ATOM 10400 HD3 LYS B 353 -13.161 61.752 -8.588 1.00 0.00 H ATOM 10401 HE2 LYS B 353 -12.380 63.767 -7.241 1.00 0.00 H ATOM 10402 HE3 LYS B 353 -11.629 62.195 -6.878 1.00 0.00 H ATOM 10403 HZ1 LYS B 353 -13.753 63.515 -5.299 1.00 0.00 H ATOM 10404 HZ2 LYS B 353 -13.035 62.014 -4.951 1.00 0.00 H ATOM 10405 HZ3 LYS B 353 -12.103 63.434 -4.900 1.00 0.00 H ATOM 10406 H LYS B 353 -16.997 65.248 -7.810 1.00 0.00 H ATOM 10407 N PRO B 354 -16.476 63.559 -11.396 1.00 33.78 N ATOM 10408 CA PRO B 354 -17.537 62.802 -12.066 1.00 34.62 C ATOM 10409 C PRO B 354 -18.077 61.707 -11.139 1.00 35.77 C ATOM 10410 O PRO B 354 -17.290 61.078 -10.367 1.00 37.62 O ATOM 10411 CB PRO B 354 -16.804 62.150 -13.237 1.00 34.74 C ATOM 10412 CG PRO B 354 -15.681 63.003 -13.501 1.00 34.46 C ATOM 10413 CD PRO B 354 -15.224 63.516 -12.165 1.00 34.05 C ATOM 10414 HA PRO B 354 -18.383 63.423 -12.360 1.00 0.00 H ATOM 10415 HD3 PRO B 354 -14.503 62.838 -11.708 1.00 0.00 H ATOM 10416 HD2 PRO B 354 -14.782 64.508 -12.254 1.00 0.00 H ATOM 10417 HG3 PRO B 354 -15.978 63.832 -14.143 1.00 0.00 H ATOM 10418 HG2 PRO B 354 -14.883 62.439 -13.983 1.00 0.00 H ATOM 10419 HB2 PRO B 354 -16.469 61.148 -12.968 1.00 0.00 H ATOM 10420 HB3 PRO B 354 -17.454 62.092 -14.110 1.00 0.00 H ATOM 10421 N GLY B 355 -19.385 61.497 -11.155 1.00 35.91 N ATOM 10422 CA GLY B 355 -19.984 60.462 -10.315 1.00 35.50 C ATOM 10423 C GLY B 355 -20.369 60.904 -8.926 1.00 35.92 C ATOM 10424 O GLY B 355 -20.916 60.110 -8.165 1.00 37.68 O ATOM 10425 HA3 GLY B 355 -19.267 59.646 -10.223 1.00 0.00 H ATOM 10426 HA2 GLY B 355 -20.882 60.100 -10.815 1.00 0.00 H ATOM 10427 H GLY B 355 -19.992 62.075 -11.772 1.00 0.00 H ATOM 10428 N LYS B 356 -20.060 62.150 -8.557 1.00 35.55 N ATOM 10429 CA LYS B 356 -20.539 62.745 -7.301 1.00 34.44 C ATOM 10430 C LYS B 356 -21.735 63.528 -7.661 1.00 34.18 C ATOM 10431 O LYS B 356 -22.028 63.696 -8.837 1.00 35.57 O ATOM 10432 CB LYS B 356 -19.502 63.707 -6.695 1.00 34.55 C ATOM 10433 CG LYS B 356 -18.165 63.036 -6.366 1.00 34.58 C ATOM 10434 CD LYS B 356 -18.350 61.918 -5.357 1.00 33.03 C ATOM 10435 CE LYS B 356 -17.032 61.295 -4.959 1.00 35.46 C ATOM 10436 NZ LYS B 356 -16.947 61.159 -3.462 1.00 35.50 N ATOM 10437 HA LYS B 356 -20.735 61.963 -6.568 1.00 0.00 H ATOM 10438 HB2 LYS B 356 -19.319 64.511 -7.408 1.00 0.00 H ATOM 10439 HB3 LYS B 356 -19.914 64.125 -5.776 1.00 0.00 H ATOM 10440 HG2 LYS B 356 -17.738 62.624 -7.280 1.00 0.00 H ATOM 10441 HG3 LYS B 356 -17.485 63.780 -5.952 1.00 0.00 H ATOM 10442 HD2 LYS B 356 -18.832 62.322 -4.467 1.00 0.00 H ATOM 10443 HD3 LYS B 356 -18.986 61.149 -5.795 1.00 0.00 H ATOM 10444 HE2 LYS B 356 -16.216 61.926 -5.310 1.00 0.00 H ATOM 10445 HE3 LYS B 356 -16.948 60.308 -5.415 1.00 0.00 H ATOM 10446 HZ1 LYS B 356 -17.024 62.100 -3.025 1.00 0.00 H ATOM 10447 HZ2 LYS B 356 -17.724 60.555 -3.125 1.00 0.00 H ATOM 10448 HZ3 LYS B 356 -16.035 60.729 -3.205 1.00 0.00 H ATOM 10449 H LYS B 356 -19.457 62.721 -9.183 1.00 0.00 H ATOM 10450 N SER B 357 -22.430 64.048 -6.667 1.00 33.69 N ATOM 10451 CA SER B 357 -23.599 64.825 -6.975 1.00 33.73 C ATOM 10452 C SER B 357 -23.439 66.290 -6.613 1.00 32.66 C ATOM 10453 O SER B 357 -22.713 66.650 -5.700 1.00 32.61 O ATOM 10454 CB SER B 357 -24.797 64.223 -6.281 1.00 34.57 C ATOM 10455 OG SER B 357 -24.465 63.960 -4.939 1.00 37.93 O ATOM 10456 HA SER B 357 -23.747 64.794 -8.054 1.00 0.00 H ATOM 10457 HB2 SER B 357 -25.078 63.294 -6.777 1.00 0.00 H ATOM 10458 HB3 SER B 357 -25.632 64.922 -6.321 1.00 0.00 H ATOM 10459 HG SER B 357 -25.247 63.565 -4.478 1.00 0.00 H ATOM 10460 H SER B 357 -22.138 63.898 -5.680 1.00 0.00 H ATOM 10461 N ARG B 358 -24.147 67.126 -7.357 1.00 32.02 N ATOM 10462 CA ARG B 358 -23.993 68.551 -7.289 1.00 31.12 C ATOM 10463 C ARG B 358 -24.365 69.081 -5.940 1.00 30.70 C ATOM 10464 O ARG B 358 -25.164 68.497 -5.272 1.00 31.75 O ATOM 10465 CB ARG B 358 -24.943 69.179 -8.275 1.00 31.23 C ATOM 10466 CG ARG B 358 -26.406 68.973 -7.887 1.00 30.78 C ATOM 10467 CD ARG B 358 -27.254 69.238 -9.095 1.00 29.93 C ATOM 10468 NE ARG B 358 -28.677 69.196 -8.861 1.00 27.84 N ATOM 10469 CZ ARG B 358 -29.563 69.761 -9.673 1.00 31.31 C ATOM 10470 NH1 ARG B 358 -29.151 70.408 -10.767 1.00 33.28 N ATOM 10471 NH2 ARG B 358 -30.864 69.690 -9.414 1.00 29.03 N ATOM 10472 HA ARG B 358 -22.950 68.786 -7.500 1.00 0.00 H ATOM 10473 HB2 ARG B 358 -24.741 70.249 -8.323 1.00 0.00 H ATOM 10474 HB3 ARG B 358 -24.775 68.734 -9.256 1.00 0.00 H ATOM 10475 HG2 ARG B 358 -26.557 67.948 -7.548 1.00 0.00 H ATOM 10476 HG3 ARG B 358 -26.677 69.663 -7.088 1.00 0.00 H ATOM 10477 HD2 ARG B 358 -27.013 68.489 -9.849 1.00 0.00 H ATOM 10478 HD3 ARG B 358 -27.002 70.228 -9.475 1.00 0.00 H ATOM 10479 HE ARG B 358 -29.026 68.700 -8.016 1.00 0.00 H ATOM 10480 HH12 ARG B 358 -29.846 70.850 -11.402 1.00 0.00 H ATOM 10481 HH11 ARG B 358 -28.136 70.469 -10.983 1.00 0.00 H ATOM 10482 HH22 ARG B 358 -31.548 70.137 -10.058 1.00 0.00 H ATOM 10483 HH21 ARG B 358 -31.199 69.188 -8.567 1.00 0.00 H ATOM 10484 H ARG B 358 -24.845 66.732 -8.020 1.00 0.00 H ATOM 10485 N ASP B 359 -23.830 70.234 -5.577 1.00 30.07 N ATOM 10486 CA ASP B 359 -24.299 70.970 -4.424 1.00 29.21 C ATOM 10487 C ASP B 359 -23.849 72.413 -4.573 1.00 28.31 C ATOM 10488 O ASP B 359 -23.057 72.725 -5.432 1.00 27.51 O ATOM 10489 CB ASP B 359 -23.735 70.358 -3.148 1.00 29.20 C ATOM 10490 CG ASP B 359 -22.235 70.358 -3.145 1.00 29.55 C ATOM 10491 OD1 ASP B 359 -21.669 71.458 -2.997 1.00 29.14 O ATOM 10492 OD2 ASP B 359 -21.630 69.280 -3.343 1.00 28.00 O ATOM 10493 HA ASP B 359 -25.386 70.927 -4.361 1.00 0.00 H ATOM 10494 HB2 ASP B 359 -24.090 70.934 -2.293 1.00 0.00 H ATOM 10495 HB3 ASP B 359 -24.088 69.330 -3.063 1.00 0.00 H ATOM 10496 H ASP B 359 -23.047 70.624 -6.139 1.00 0.00 H ATOM 10497 N PHE B 360 -24.348 73.282 -3.710 1.00 28.19 N ATOM 10498 CA PHE B 360 -24.106 74.706 -3.838 1.00 28.72 C ATOM 10499 C PHE B 360 -22.656 75.109 -3.484 1.00 28.89 C ATOM 10500 O PHE B 360 -22.073 75.995 -4.111 1.00 29.00 O ATOM 10501 CB PHE B 360 -25.177 75.476 -3.051 1.00 28.81 C ATOM 10502 CG PHE B 360 -26.565 75.237 -3.586 1.00 28.91 C ATOM 10503 CD1 PHE B 360 -27.437 74.386 -2.933 1.00 28.30 C ATOM 10504 CD2 PHE B 360 -26.960 75.807 -4.807 1.00 30.11 C ATOM 10505 CE1 PHE B 360 -28.675 74.127 -3.462 1.00 29.32 C ATOM 10506 CE2 PHE B 360 -28.216 75.557 -5.355 1.00 29.77 C ATOM 10507 CZ PHE B 360 -29.076 74.720 -4.691 1.00 29.41 C ATOM 10508 HA PHE B 360 -24.199 74.984 -4.888 1.00 0.00 H ATOM 10509 HB2 PHE B 360 -25.143 75.157 -2.009 1.00 0.00 H ATOM 10510 HB3 PHE B 360 -24.957 76.542 -3.111 1.00 0.00 H ATOM 10511 HD2 PHE B 360 -26.268 76.460 -5.338 1.00 0.00 H ATOM 10512 HE2 PHE B 360 -28.511 76.019 -6.297 1.00 0.00 H ATOM 10513 HZ PHE B 360 -30.063 74.510 -5.104 1.00 0.00 H ATOM 10514 HE1 PHE B 360 -29.358 73.460 -2.936 1.00 0.00 H ATOM 10515 HD1 PHE B 360 -27.139 73.919 -1.994 1.00 0.00 H ATOM 10516 H PHE B 360 -24.929 72.935 -2.920 1.00 0.00 H ATOM 10517 N TYR B 361 -22.064 74.406 -2.532 1.00 28.53 N ATOM 10518 CA TYR B 361 -20.669 74.575 -2.219 1.00 28.23 C ATOM 10519 C TYR B 361 -19.739 74.379 -3.434 1.00 28.12 C ATOM 10520 O TYR B 361 -18.911 75.225 -3.710 1.00 27.59 O ATOM 10521 CB TYR B 361 -20.306 73.605 -1.094 1.00 28.27 C ATOM 10522 CG TYR B 361 -18.850 73.553 -0.733 1.00 28.46 C ATOM 10523 CD1 TYR B 361 -18.301 74.436 0.192 1.00 28.17 C ATOM 10524 CD2 TYR B 361 -18.020 72.629 -1.327 1.00 29.16 C ATOM 10525 CE1 TYR B 361 -16.958 74.364 0.524 1.00 28.93 C ATOM 10526 CE2 TYR B 361 -16.689 72.562 -1.002 1.00 28.90 C ATOM 10527 CZ TYR B 361 -16.168 73.439 -0.087 1.00 27.75 C ATOM 10528 OH TYR B 361 -14.843 73.345 0.212 1.00 28.35 O ATOM 10529 HA TYR B 361 -20.518 75.607 -1.903 1.00 0.00 H ATOM 10530 HB3 TYR B 361 -20.613 72.605 -1.400 1.00 0.00 H ATOM 10531 HB2 TYR B 361 -20.863 73.898 -0.204 1.00 0.00 H ATOM 10532 HD2 TYR B 361 -18.427 71.940 -2.067 1.00 0.00 H ATOM 10533 HE2 TYR B 361 -16.048 71.814 -1.470 1.00 0.00 H ATOM 10534 HE1 TYR B 361 -16.538 75.042 1.267 1.00 0.00 H ATOM 10535 HD1 TYR B 361 -18.933 75.191 0.659 1.00 0.00 H ATOM 10536 HH TYR B 361 -14.607 74.035 0.882 1.00 0.00 H ATOM 10537 H TYR B 361 -22.622 73.712 -1.995 1.00 0.00 H ATOM 10538 N HIS B 362 -19.869 73.264 -4.143 1.00 27.63 N ATOM 10539 CA HIS B 362 -19.010 72.996 -5.271 1.00 26.87 C ATOM 10540 C HIS B 362 -19.334 73.923 -6.427 1.00 27.04 C ATOM 10541 O HIS B 362 -18.443 74.328 -7.191 1.00 25.94 O ATOM 10542 CB HIS B 362 -19.071 71.526 -5.676 1.00 26.67 C ATOM 10543 CG HIS B 362 -18.248 70.646 -4.786 1.00 27.24 C ATOM 10544 ND1 HIS B 362 -18.786 69.945 -3.725 1.00 28.25 N ATOM 10545 CD2 HIS B 362 -16.915 70.396 -4.761 1.00 25.82 C ATOM 10546 CE1 HIS B 362 -17.819 69.304 -3.086 1.00 26.61 C ATOM 10547 NE2 HIS B 362 -16.677 69.549 -3.703 1.00 26.84 N ATOM 10548 HA HIS B 362 -17.981 73.198 -4.973 1.00 0.00 H ATOM 10549 HB2 HIS B 362 -20.108 71.195 -5.632 1.00 0.00 H ATOM 10550 HB3 HIS B 362 -18.704 71.430 -6.698 1.00 0.00 H ATOM 10551 HD2 HIS B 362 -16.170 70.793 -5.451 1.00 0.00 H ATOM 10552 HE1 HIS B 362 -17.944 68.680 -2.201 1.00 0.00 H ATOM 10553 H HIS B 362 -20.601 72.573 -3.881 1.00 0.00 H ATOM 10554 N THR B 363 -20.605 74.291 -6.553 1.00 27.10 N ATOM 10555 CA THR B 363 -20.971 75.268 -7.558 1.00 27.17 C ATOM 10556 C THR B 363 -20.231 76.586 -7.292 1.00 27.97 C ATOM 10557 O THR B 363 -19.705 77.240 -8.187 1.00 28.16 O ATOM 10558 CB THR B 363 -22.485 75.501 -7.594 1.00 27.26 C ATOM 10559 OG1 THR B 363 -23.136 74.262 -7.846 1.00 23.72 O ATOM 10560 CG2 THR B 363 -22.857 76.531 -8.683 1.00 24.88 C ATOM 10561 HA THR B 363 -20.678 74.879 -8.533 1.00 0.00 H ATOM 10562 HB THR B 363 -22.809 75.900 -6.633 1.00 0.00 H ATOM 10563 HG1 THR B 363 -22.913 73.621 -7.126 1.00 0.00 H ATOM 10564 HG23 THR B 363 -22.351 77.474 -8.477 1.00 0.00 H ATOM 10565 HG21 THR B 363 -22.546 76.156 -9.658 1.00 0.00 H ATOM 10566 HG22 THR B 363 -23.936 76.687 -8.680 1.00 0.00 H ATOM 10567 H THR B 363 -21.332 73.880 -5.934 1.00 0.00 H ATOM 10568 N CYS B 364 -20.168 76.969 -6.037 1.00 28.40 N ATOM 10569 CA CYS B 364 -19.536 78.219 -5.706 1.00 28.68 C ATOM 10570 C CYS B 364 -18.035 78.227 -6.025 1.00 28.65 C ATOM 10571 O CYS B 364 -17.556 79.131 -6.752 1.00 29.30 O ATOM 10572 CB CYS B 364 -19.804 78.525 -4.252 1.00 28.79 C ATOM 10573 SG CYS B 364 -18.807 79.805 -3.610 1.00 29.16 S ATOM 10574 HA CYS B 364 -19.965 79.003 -6.329 1.00 0.00 H ATOM 10575 HB2 CYS B 364 -19.621 77.621 -3.670 1.00 0.00 H ATOM 10576 HB3 CYS B 364 -20.849 78.817 -4.148 1.00 0.00 H ATOM 10577 HG CYS B 364 -19.123 80.011 -2.283 1.00 0.00 H ATOM 10578 H CYS B 364 -20.572 76.373 -5.287 1.00 0.00 H ATOM 10579 N TYR B 365 -17.323 77.209 -5.538 1.00 27.68 N ATOM 10580 CA TYR B 365 -15.860 77.160 -5.617 1.00 27.60 C ATOM 10581 C TYR B 365 -15.334 76.645 -6.943 1.00 27.83 C ATOM 10582 O TYR B 365 -14.286 77.064 -7.375 1.00 28.69 O ATOM 10583 CB TYR B 365 -15.235 76.416 -4.408 1.00 26.62 C ATOM 10584 CG TYR B 365 -15.528 77.164 -3.147 1.00 26.23 C ATOM 10585 CD1 TYR B 365 -16.521 76.728 -2.257 1.00 28.30 C ATOM 10586 CD2 TYR B 365 -14.871 78.345 -2.854 1.00 24.90 C ATOM 10587 CE1 TYR B 365 -16.824 77.444 -1.097 1.00 26.66 C ATOM 10588 CE2 TYR B 365 -15.158 79.056 -1.705 1.00 25.85 C ATOM 10589 CZ TYR B 365 -16.145 78.606 -0.837 1.00 26.28 C ATOM 10590 OH TYR B 365 -16.426 79.318 0.296 1.00 27.14 O ATOM 10591 HA TYR B 365 -15.532 78.198 -5.563 1.00 0.00 H ATOM 10592 HB3 TYR B 365 -14.156 76.345 -4.545 1.00 0.00 H ATOM 10593 HB2 TYR B 365 -15.658 75.414 -4.341 1.00 0.00 H ATOM 10594 HD2 TYR B 365 -14.114 78.721 -3.542 1.00 0.00 H ATOM 10595 HE2 TYR B 365 -14.610 79.971 -1.479 1.00 0.00 H ATOM 10596 HE1 TYR B 365 -17.589 77.084 -0.409 1.00 0.00 H ATOM 10597 HD1 TYR B 365 -17.068 75.811 -2.476 1.00 0.00 H ATOM 10598 HH TYR B 365 -16.719 80.230 0.047 1.00 0.00 H ATOM 10599 H TYR B 365 -17.826 76.419 -5.085 1.00 0.00 H ATOM 10600 N CYS B 366 -16.044 75.764 -7.614 1.00 28.52 N ATOM 10601 CA CYS B 366 -15.672 75.448 -8.994 1.00 28.88 C ATOM 10602 C CYS B 366 -15.726 76.696 -9.847 1.00 29.16 C ATOM 10603 O CYS B 366 -14.790 76.938 -10.641 1.00 30.52 O ATOM 10604 CB CYS B 366 -16.580 74.398 -9.617 1.00 28.66 C ATOM 10605 SG CYS B 366 -16.197 72.802 -9.001 1.00 31.81 S ATOM 10606 HA CYS B 366 -14.659 75.047 -8.959 1.00 0.00 H ATOM 10607 HB2 CYS B 366 -16.447 74.406 -10.699 1.00 0.00 H ATOM 10608 HB3 CYS B 366 -17.617 74.634 -9.378 1.00 0.00 H ATOM 10609 HG CYS B 366 -17.035 71.873 -9.583 1.00 0.00 H ATOM 10610 H CYS B 366 -16.860 75.297 -7.169 1.00 0.00 H ATOM 10611 N LEU B 367 -16.794 77.478 -9.709 1.00 28.29 N ATOM 10612 CA LEU B 367 -16.900 78.673 -10.499 1.00 28.88 C ATOM 10613 C LEU B 367 -15.818 79.690 -10.083 1.00 28.97 C ATOM 10614 O LEU B 367 -15.137 80.251 -10.940 1.00 28.63 O ATOM 10615 CB LEU B 367 -18.305 79.271 -10.461 1.00 29.09 C ATOM 10616 CG LEU B 367 -19.411 78.434 -11.119 1.00 28.25 C ATOM 10617 CD1 LEU B 367 -20.777 79.009 -10.696 1.00 26.79 C ATOM 10618 CD2 LEU B 367 -19.242 78.368 -12.605 1.00 26.76 C ATOM 10619 HA LEU B 367 -16.722 78.403 -11.540 1.00 0.00 H ATOM 10620 HB2 LEU B 367 -18.576 79.420 -9.416 1.00 0.00 H ATOM 10621 HB3 LEU B 367 -18.271 80.236 -10.967 1.00 0.00 H ATOM 10622 HG LEU B 367 -19.348 77.401 -10.777 1.00 0.00 H ATOM 10623 HD21 LEU B 367 -19.280 79.376 -13.019 1.00 0.00 H ATOM 10624 HD22 LEU B 367 -18.280 77.913 -12.840 1.00 0.00 H ATOM 10625 HD23 LEU B 367 -20.044 77.767 -13.034 1.00 0.00 H ATOM 10626 HD11 LEU B 367 -20.870 78.962 -9.611 1.00 0.00 H ATOM 10627 HD12 LEU B 367 -20.850 80.046 -11.023 1.00 0.00 H ATOM 10628 HD13 LEU B 367 -21.574 78.425 -11.156 1.00 0.00 H ATOM 10629 H LEU B 367 -17.545 77.226 -9.035 1.00 0.00 H ATOM 10630 N SER B 368 -15.619 79.888 -8.789 1.00 28.93 N ATOM 10631 CA SER B 368 -14.560 80.797 -8.334 1.00 28.68 C ATOM 10632 C SER B 368 -13.189 80.348 -8.912 1.00 29.27 C ATOM 10633 O SER B 368 -12.438 81.135 -9.486 1.00 29.23 O ATOM 10634 CB SER B 368 -14.526 80.879 -6.801 1.00 28.39 C ATOM 10635 OG SER B 368 -15.806 81.174 -6.247 1.00 24.66 O ATOM 10636 HA SER B 368 -14.774 81.799 -8.705 1.00 0.00 H ATOM 10637 HB2 SER B 368 -13.827 81.662 -6.507 1.00 0.00 H ATOM 10638 HB3 SER B 368 -14.185 79.922 -6.406 1.00 0.00 H ATOM 10639 HG SER B 368 -16.447 80.464 -6.503 1.00 0.00 H ATOM 10640 H SER B 368 -16.215 79.398 -8.092 1.00 0.00 H ATOM 10641 N GLY B 369 -12.882 79.067 -8.829 1.00 29.51 N ATOM 10642 CA GLY B 369 -11.650 78.574 -9.446 1.00 29.27 C ATOM 10643 C GLY B 369 -11.583 78.854 -10.944 1.00 29.37 C ATOM 10644 O GLY B 369 -10.530 79.203 -11.448 1.00 28.65 O ATOM 10645 HA3 GLY B 369 -11.590 77.497 -9.290 1.00 0.00 H ATOM 10646 HA2 GLY B 369 -10.801 79.058 -8.963 1.00 0.00 H ATOM 10647 H GLY B 369 -13.513 78.410 -8.327 1.00 0.00 H ATOM 10648 N LEU B 370 -12.690 78.653 -11.670 1.00 29.69 N ATOM 10649 CA LEU B 370 -12.721 78.940 -13.109 1.00 29.91 C ATOM 10650 C LEU B 370 -12.369 80.407 -13.310 1.00 30.95 C ATOM 10651 O LEU B 370 -11.506 80.717 -14.120 1.00 31.81 O ATOM 10652 CB LEU B 370 -14.092 78.623 -13.748 1.00 30.61 C ATOM 10653 CG LEU B 370 -14.195 78.617 -15.295 1.00 29.81 C ATOM 10654 CD1 LEU B 370 -13.196 77.710 -15.904 1.00 28.51 C ATOM 10655 CD2 LEU B 370 -15.546 78.234 -15.807 1.00 27.66 C ATOM 10656 HA LEU B 370 -11.995 78.296 -13.606 1.00 0.00 H ATOM 10657 HB2 LEU B 370 -14.390 77.634 -13.400 1.00 0.00 H ATOM 10658 HB3 LEU B 370 -14.800 79.365 -13.379 1.00 0.00 H ATOM 10659 HG LEU B 370 -14.001 79.649 -15.586 1.00 0.00 H ATOM 10660 HD21 LEU B 370 -15.793 77.230 -15.461 1.00 0.00 H ATOM 10661 HD22 LEU B 370 -16.288 78.941 -15.435 1.00 0.00 H ATOM 10662 HD23 LEU B 370 -15.539 78.253 -16.897 1.00 0.00 H ATOM 10663 HD11 LEU B 370 -12.194 78.037 -15.626 1.00 0.00 H ATOM 10664 HD12 LEU B 370 -13.362 76.695 -15.544 1.00 0.00 H ATOM 10665 HD13 LEU B 370 -13.300 77.733 -16.989 1.00 0.00 H ATOM 10666 H LEU B 370 -13.545 78.286 -11.205 1.00 0.00 H ATOM 10667 N SER B 371 -12.982 81.303 -12.543 1.00 31.36 N ATOM 10668 CA SER B 371 -12.716 82.720 -12.717 1.00 32.52 C ATOM 10669 C SER B 371 -11.222 83.059 -12.624 1.00 33.26 C ATOM 10670 O SER B 371 -10.655 83.767 -13.488 1.00 33.53 O ATOM 10671 CB SER B 371 -13.462 83.560 -11.708 1.00 32.49 C ATOM 10672 OG SER B 371 -13.349 84.930 -12.064 1.00 33.72 O ATOM 10673 HA SER B 371 -13.067 82.955 -13.722 1.00 0.00 H ATOM 10674 HB2 SER B 371 -13.035 83.404 -10.717 1.00 0.00 H ATOM 10675 HB3 SER B 371 -14.513 83.271 -11.699 1.00 0.00 H ATOM 10676 HG SER B 371 -12.394 85.190 -12.072 1.00 0.00 H ATOM 10677 H SER B 371 -13.655 80.988 -11.815 1.00 0.00 H ATOM 10678 N ILE B 372 -10.601 82.534 -11.575 1.00 33.27 N ATOM 10679 CA ILE B 372 -9.204 82.731 -11.336 1.00 33.28 C ATOM 10680 C ILE B 372 -8.416 82.215 -12.528 1.00 33.57 C ATOM 10681 O ILE B 372 -7.583 82.933 -13.073 1.00 34.11 O ATOM 10682 CB ILE B 372 -8.801 82.108 -9.974 1.00 33.40 C ATOM 10683 CG1 ILE B 372 -9.268 83.051 -8.839 1.00 32.53 C ATOM 10684 CG2 ILE B 372 -7.293 81.872 -9.887 1.00 34.03 C ATOM 10685 CD1 ILE B 372 -9.275 82.401 -7.504 1.00 32.89 C ATOM 10686 HA ILE B 372 -8.966 83.791 -11.247 1.00 0.00 H ATOM 10687 HB ILE B 372 -9.283 81.136 -9.874 1.00 0.00 H ATOM 10688 HG12 ILE B 372 -8.597 83.909 -8.803 1.00 0.00 H ATOM 10689 HG13 ILE B 372 -10.279 83.391 -9.064 1.00 0.00 H ATOM 10690 HD11 ILE B 372 -9.951 81.546 -7.521 1.00 0.00 H ATOM 10691 HD12 ILE B 372 -8.267 82.065 -7.260 1.00 0.00 H ATOM 10692 HD13 ILE B 372 -9.612 83.117 -6.754 1.00 0.00 H ATOM 10693 HG21 ILE B 372 -6.987 81.191 -10.681 1.00 0.00 H ATOM 10694 HG22 ILE B 372 -6.771 82.822 -9.999 1.00 0.00 H ATOM 10695 HG23 ILE B 372 -7.050 81.435 -8.918 1.00 0.00 H ATOM 10696 H ILE B 372 -11.149 81.959 -10.903 1.00 0.00 H ATOM 10697 N ALA B 373 -8.709 81.016 -12.991 1.00 33.13 N ATOM 10698 CA ALA B 373 -7.933 80.466 -14.075 1.00 33.78 C ATOM 10699 C ALA B 373 -8.105 81.286 -15.391 1.00 34.87 C ATOM 10700 O ALA B 373 -7.259 81.246 -16.306 1.00 34.62 O ATOM 10701 CB ALA B 373 -8.298 79.011 -14.268 1.00 33.76 C ATOM 10702 HA ALA B 373 -6.877 80.531 -13.814 1.00 0.00 H ATOM 10703 HB1 ALA B 373 -8.086 78.460 -13.352 1.00 0.00 H ATOM 10704 HB2 ALA B 373 -9.359 78.932 -14.503 1.00 0.00 H ATOM 10705 HB3 ALA B 373 -7.711 78.596 -15.087 1.00 0.00 H ATOM 10706 H ALA B 373 -9.493 80.471 -12.578 1.00 0.00 H ATOM 10707 N GLN B 374 -9.213 82.018 -15.486 1.00 35.62 N ATOM 10708 CA GLN B 374 -9.474 82.858 -16.645 1.00 36.52 C ATOM 10709 C GLN B 374 -8.782 84.238 -16.582 1.00 37.79 C ATOM 10710 O GLN B 374 -8.370 84.732 -17.622 1.00 37.57 O ATOM 10711 CB GLN B 374 -10.983 83.062 -16.808 1.00 35.74 C ATOM 10712 CG GLN B 374 -11.733 81.827 -17.256 1.00 35.24 C ATOM 10713 CD GLN B 374 -13.239 82.060 -17.314 1.00 35.76 C ATOM 10714 OE1 GLN B 374 -13.753 83.023 -16.740 1.00 37.04 O ATOM 10715 NE2 GLN B 374 -13.951 81.171 -17.985 1.00 32.10 N ATOM 10716 HA GLN B 374 -9.054 82.331 -17.502 1.00 0.00 H ATOM 10717 HB2 GLN B 374 -11.390 83.380 -15.848 1.00 0.00 H ATOM 10718 HB3 GLN B 374 -11.144 83.847 -17.547 1.00 0.00 H ATOM 10719 HG2 GLN B 374 -11.382 81.543 -18.248 1.00 0.00 H ATOM 10720 HG3 GLN B 374 -11.529 81.018 -16.555 1.00 0.00 H ATOM 10721 HE22 GLN B 374 -13.477 80.373 -18.455 1.00 0.00 H ATOM 10722 HE21 GLN B 374 -14.985 81.269 -18.043 1.00 0.00 H ATOM 10723 H GLN B 374 -9.909 81.989 -14.713 1.00 0.00 H ATOM 10724 N HIS B 375 -8.675 84.840 -15.378 1.00 39.27 N ATOM 10725 CA HIS B 375 -8.280 86.261 -15.196 1.00 40.38 C ATOM 10726 C HIS B 375 -6.964 86.502 -14.449 1.00 43.94 C ATOM 10727 O HIS B 375 -6.825 86.208 -13.271 1.00 43.29 O ATOM 10728 CB HIS B 375 -9.397 87.021 -14.505 1.00 39.84 C ATOM 10729 CG HIS B 375 -10.695 86.944 -15.247 1.00 40.26 C ATOM 10730 ND1 HIS B 375 -10.880 87.536 -16.478 1.00 41.76 N ATOM 10731 CD2 HIS B 375 -11.860 86.313 -14.959 1.00 40.52 C ATOM 10732 CE1 HIS B 375 -12.115 87.306 -16.895 1.00 41.09 C ATOM 10733 NE2 HIS B 375 -12.731 86.564 -15.995 1.00 38.83 N ATOM 10734 HA HIS B 375 -8.104 86.628 -16.207 1.00 0.00 H ATOM 10735 HB2 HIS B 375 -9.539 86.602 -13.509 1.00 0.00 H ATOM 10736 HB3 HIS B 375 -9.106 88.068 -14.420 1.00 0.00 H ATOM 10737 HD2 HIS B 375 -12.069 85.717 -14.071 1.00 0.00 H ATOM 10738 HE1 HIS B 375 -12.550 87.669 -17.826 1.00 0.00 H ATOM 10739 H HIS B 375 -8.881 84.276 -14.529 1.00 0.00 H ATOM 10740 N PHE B 376 -5.999 87.057 -15.178 1.00 48.84 N ATOM 10741 CA PHE B 376 -4.722 87.486 -14.631 1.00 52.24 C ATOM 10742 C PHE B 376 -4.652 89.007 -14.574 1.00 55.34 C ATOM 10743 O PHE B 376 -5.014 89.678 -15.536 1.00 55.22 O ATOM 10744 CB PHE B 376 -3.591 86.968 -15.500 1.00 52.99 C ATOM 10745 CG PHE B 376 -2.240 87.431 -15.061 1.00 53.96 C ATOM 10746 CD1 PHE B 376 -1.470 86.647 -14.214 1.00 54.25 C ATOM 10747 CD2 PHE B 376 -1.741 88.647 -15.498 1.00 54.27 C ATOM 10748 CE1 PHE B 376 -0.211 87.064 -13.809 1.00 55.25 C ATOM 10749 CE2 PHE B 376 -0.504 89.080 -15.092 1.00 54.70 C ATOM 10750 CZ PHE B 376 0.277 88.285 -14.252 1.00 54.79 C ATOM 10751 HA PHE B 376 -4.626 87.085 -13.622 1.00 0.00 H ATOM 10752 HB2 PHE B 376 -3.607 85.878 -15.474 1.00 0.00 H ATOM 10753 HB3 PHE B 376 -3.757 87.309 -16.522 1.00 0.00 H ATOM 10754 HD2 PHE B 376 -2.336 89.265 -16.170 1.00 0.00 H ATOM 10755 HE2 PHE B 376 -0.130 90.048 -15.427 1.00 0.00 H ATOM 10756 HZ PHE B 376 1.267 88.622 -13.945 1.00 0.00 H ATOM 10757 HE1 PHE B 376 0.390 86.438 -13.149 1.00 0.00 H ATOM 10758 HD1 PHE B 376 -1.859 85.692 -13.863 1.00 0.00 H ATOM 10759 H PHE B 376 -6.168 87.191 -16.195 1.00 0.00 H ATOM 10760 N GLY B 377 -4.182 89.519 -13.432 1.00 59.31 N ATOM 10761 CA GLY B 377 -4.046 90.960 -13.158 1.00 62.49 C ATOM 10762 C GLY B 377 -2.966 91.273 -12.132 1.00 65.40 C ATOM 10763 O GLY B 377 -3.115 90.903 -10.958 1.00 65.34 O ATOM 10764 HA3 GLY B 377 -4.999 91.334 -12.784 1.00 0.00 H ATOM 10765 HA2 GLY B 377 -3.798 91.469 -14.090 1.00 0.00 H ATOM 10766 H GLY B 377 -3.893 88.855 -12.686 1.00 0.00 H ATOM 10767 N SER B 378 -1.880 91.924 -12.592 1.00 68.78 N ATOM 10768 CA SER B 378 -0.719 92.339 -11.760 1.00 71.10 C ATOM 10769 C SER B 378 -0.237 93.755 -12.173 1.00 73.38 C ATOM 10770 O SER B 378 0.714 93.892 -12.956 1.00 74.19 O ATOM 10771 CB SER B 378 0.436 91.301 -11.865 1.00 71.07 C ATOM 10772 OG SER B 378 1.662 91.742 -11.271 1.00 70.79 O ATOM 10773 HA SER B 378 -1.037 92.378 -10.718 1.00 0.00 H ATOM 10774 HB2 SER B 378 0.619 91.095 -12.920 1.00 0.00 H ATOM 10775 HB3 SER B 378 0.122 90.384 -11.366 1.00 0.00 H ATOM 10776 HG SER B 378 1.967 92.569 -11.721 1.00 0.00 H ATOM 10777 H SER B 378 -1.851 92.154 -13.606 1.00 0.00 H ATOM 10778 N GLY B 379 -0.898 94.796 -11.658 1.00 74.87 N ATOM 10779 CA GLY B 379 -0.533 96.179 -11.982 1.00 76.43 C ATOM 10780 C GLY B 379 -1.423 96.735 -13.066 1.00 77.15 C ATOM 10781 O GLY B 379 -2.628 96.803 -12.880 1.00 77.20 O ATOM 10782 HA3 GLY B 379 0.502 96.204 -12.323 1.00 0.00 H ATOM 10783 HA2 GLY B 379 -0.635 96.793 -11.087 1.00 0.00 H ATOM 10784 H GLY B 379 -1.692 94.621 -11.010 1.00 0.00 H ATOM 10785 N ALA B 380 -0.841 97.138 -14.194 1.00 78.08 N ATOM 10786 CA ALA B 380 -1.635 97.492 -15.394 1.00 78.44 C ATOM 10787 C ALA B 380 -1.674 96.332 -16.403 1.00 77.53 C ATOM 10788 O ALA B 380 -2.225 96.457 -17.496 1.00 77.36 O ATOM 10789 CB ALA B 380 -1.078 98.767 -16.061 1.00 79.38 C ATOM 10790 HA ALA B 380 -2.656 97.688 -15.068 1.00 0.00 H ATOM 10791 HB1 ALA B 380 -1.121 99.595 -15.353 1.00 0.00 H ATOM 10792 HB2 ALA B 380 -0.044 98.597 -16.360 1.00 0.00 H ATOM 10793 HB3 ALA B 380 -1.677 99.007 -16.940 1.00 0.00 H ATOM 10794 H ALA B 380 0.196 97.206 -14.234 1.00 0.00 H ATOM 10795 N MET B 381 -1.067 95.213 -16.017 1.00 76.28 N ATOM 10796 CA MET B 381 -1.025 94.006 -16.834 1.00 74.86 C ATOM 10797 C MET B 381 -2.262 93.140 -16.582 1.00 71.70 C ATOM 10798 O MET B 381 -2.421 92.584 -15.511 1.00 71.05 O ATOM 10799 CB MET B 381 0.243 93.214 -16.485 1.00 75.51 C ATOM 10800 CG MET B 381 1.545 93.963 -16.730 1.00 78.20 C ATOM 10801 SD MET B 381 1.833 94.454 -18.467 1.00 85.23 S ATOM 10802 CE MET B 381 1.147 93.087 -19.459 1.00 83.18 C ATOM 10803 HA MET B 381 -1.013 94.287 -17.887 1.00 0.00 H ATOM 10804 HB2 MET B 381 0.198 92.947 -15.429 1.00 0.00 H ATOM 10805 HB3 MET B 381 0.254 92.306 -17.088 1.00 0.00 H ATOM 10806 HG2 MET B 381 2.369 93.322 -16.418 1.00 0.00 H ATOM 10807 HG3 MET B 381 1.537 94.866 -16.119 1.00 0.00 H ATOM 10808 HE1 MET B 381 1.667 92.162 -19.209 1.00 0.00 H ATOM 10809 HE2 MET B 381 0.085 92.979 -19.241 1.00 0.00 H ATOM 10810 HE3 MET B 381 1.281 93.306 -20.518 1.00 0.00 H ATOM 10811 H MET B 381 -0.600 95.198 -15.088 1.00 0.00 H ATOM 10812 N LEU B 382 -3.139 93.054 -17.566 1.00 68.84 N ATOM 10813 CA LEU B 382 -4.341 92.230 -17.493 1.00 66.24 C ATOM 10814 C LEU B 382 -4.191 91.270 -18.649 1.00 63.12 C ATOM 10815 O LEU B 382 -3.881 91.712 -19.718 1.00 63.16 O ATOM 10816 CB LEU B 382 -5.599 93.078 -17.722 1.00 66.42 C ATOM 10817 CG LEU B 382 -6.291 93.982 -16.669 1.00 68.00 C ATOM 10818 CD1 LEU B 382 -5.438 94.430 -15.457 1.00 68.91 C ATOM 10819 CD2 LEU B 382 -6.874 95.229 -17.378 1.00 67.27 C ATOM 10820 HA LEU B 382 -4.445 91.745 -16.522 1.00 0.00 H ATOM 10821 HB2 LEU B 382 -5.350 93.742 -18.550 1.00 0.00 H ATOM 10822 HB3 LEU B 382 -6.366 92.372 -18.042 1.00 0.00 H ATOM 10823 HG LEU B 382 -7.061 93.347 -16.230 1.00 0.00 H ATOM 10824 HD21 LEU B 382 -6.068 95.780 -17.863 1.00 0.00 H ATOM 10825 HD22 LEU B 382 -7.601 94.913 -18.126 1.00 0.00 H ATOM 10826 HD23 LEU B 382 -7.362 95.869 -16.643 1.00 0.00 H ATOM 10827 HD11 LEU B 382 -5.096 93.551 -14.910 1.00 0.00 H ATOM 10828 HD12 LEU B 382 -4.577 94.997 -15.810 1.00 0.00 H ATOM 10829 HD13 LEU B 382 -6.042 95.056 -14.800 1.00 0.00 H ATOM 10830 H LEU B 382 -2.964 93.600 -18.434 1.00 0.00 H ATOM 10831 N HIS B 383 -4.378 89.968 -18.439 1.00 59.64 N ATOM 10832 CA HIS B 383 -4.391 88.978 -19.534 1.00 56.90 C ATOM 10833 C HIS B 383 -5.358 87.835 -19.229 1.00 54.93 C ATOM 10834 O HIS B 383 -5.290 87.238 -18.165 1.00 53.96 O ATOM 10835 CB HIS B 383 -3.009 88.397 -19.758 1.00 56.53 C ATOM 10836 CG HIS B 383 -2.934 87.410 -20.879 1.00 55.09 C ATOM 10837 ND1 HIS B 383 -3.133 87.761 -22.195 1.00 54.73 N ATOM 10838 CD2 HIS B 383 -2.654 86.087 -20.883 1.00 54.45 C ATOM 10839 CE1 HIS B 383 -3.004 86.693 -22.959 1.00 54.10 C ATOM 10840 NE2 HIS B 383 -2.702 85.665 -22.188 1.00 54.75 N ATOM 10841 HA HIS B 383 -4.717 89.500 -20.433 1.00 0.00 H ATOM 10842 HB2 HIS B 383 -2.325 89.217 -19.977 1.00 0.00 H ATOM 10843 HB3 HIS B 383 -2.695 87.898 -18.841 1.00 0.00 H ATOM 10844 HD2 HIS B 383 -2.432 85.471 -20.012 1.00 0.00 H ATOM 10845 HE1 HIS B 383 -3.126 86.664 -24.042 1.00 0.00 H ATOM 10846 H HIS B 383 -4.521 89.635 -17.464 1.00 0.00 H ATOM 10847 N ASP B 384 -6.251 87.532 -20.171 1.00 53.12 N ATOM 10848 CA ASP B 384 -7.214 86.448 -20.008 1.00 51.52 C ATOM 10849 C ASP B 384 -6.892 85.221 -20.848 1.00 50.56 C ATOM 10850 O ASP B 384 -6.231 85.306 -21.882 1.00 51.43 O ATOM 10851 CB ASP B 384 -8.614 86.916 -20.355 1.00 51.26 C ATOM 10852 CG ASP B 384 -9.159 87.940 -19.378 1.00 52.49 C ATOM 10853 OD1 ASP B 384 -10.215 88.522 -19.703 1.00 52.94 O ATOM 10854 OD2 ASP B 384 -8.570 88.158 -18.289 1.00 54.44 O ATOM 10855 HA ASP B 384 -7.153 86.160 -18.959 1.00 0.00 H ATOM 10856 HB2 ASP B 384 -8.595 87.361 -21.350 1.00 0.00 H ATOM 10857 HB3 ASP B 384 -9.278 86.052 -20.358 1.00 0.00 H ATOM 10858 H ASP B 384 -6.262 88.086 -21.051 1.00 0.00 H ATOM 10859 N VAL B 385 -7.349 84.072 -20.362 1.00 48.81 N ATOM 10860 CA VAL B 385 -7.389 82.827 -21.119 1.00 47.25 C ATOM 10861 C VAL B 385 -8.818 82.310 -20.926 1.00 45.90 C ATOM 10862 O VAL B 385 -9.248 82.051 -19.784 1.00 46.61 O ATOM 10863 CB VAL B 385 -6.405 81.778 -20.558 1.00 47.08 C ATOM 10864 CG1 VAL B 385 -6.828 80.396 -20.998 1.00 47.27 C ATOM 10865 CG2 VAL B 385 -4.939 82.060 -20.977 1.00 48.08 C ATOM 10866 HA VAL B 385 -7.112 82.995 -22.160 1.00 0.00 H ATOM 10867 HB VAL B 385 -6.438 81.841 -19.470 1.00 0.00 H ATOM 10868 HG11 VAL B 385 -7.831 80.188 -20.624 1.00 0.00 H ATOM 10869 HG12 VAL B 385 -6.827 80.347 -22.087 1.00 0.00 H ATOM 10870 HG13 VAL B 385 -6.130 79.660 -20.599 1.00 0.00 H ATOM 10871 HG21 VAL B 385 -4.864 82.045 -22.064 1.00 0.00 H ATOM 10872 HG22 VAL B 385 -4.638 83.039 -20.604 1.00 0.00 H ATOM 10873 HG23 VAL B 385 -4.288 81.293 -20.556 1.00 0.00 H ATOM 10874 H VAL B 385 -7.699 84.060 -19.383 1.00 0.00 H ATOM 10875 N VAL B 386 -9.584 82.199 -22.001 1.00 43.95 N ATOM 10876 CA VAL B 386 -10.928 81.651 -21.875 1.00 41.71 C ATOM 10877 C VAL B 386 -10.983 80.424 -22.699 1.00 40.69 C ATOM 10878 O VAL B 386 -11.184 80.517 -23.884 1.00 40.83 O ATOM 10879 CB VAL B 386 -11.977 82.628 -22.364 1.00 41.57 C ATOM 10880 CG1 VAL B 386 -13.358 82.009 -22.222 1.00 41.02 C ATOM 10881 CG2 VAL B 386 -11.853 83.924 -21.586 1.00 39.73 C ATOM 10882 HA VAL B 386 -11.137 81.443 -20.826 1.00 0.00 H ATOM 10883 HB VAL B 386 -11.825 82.853 -23.420 1.00 0.00 H ATOM 10884 HG11 VAL B 386 -13.408 81.096 -22.816 1.00 0.00 H ATOM 10885 HG12 VAL B 386 -13.543 81.773 -21.174 1.00 0.00 H ATOM 10886 HG13 VAL B 386 -14.109 82.715 -22.575 1.00 0.00 H ATOM 10887 HG21 VAL B 386 -12.004 83.725 -20.525 1.00 0.00 H ATOM 10888 HG22 VAL B 386 -10.860 84.345 -21.740 1.00 0.00 H ATOM 10889 HG23 VAL B 386 -12.607 84.630 -21.935 1.00 0.00 H ATOM 10890 H VAL B 386 -9.228 82.501 -22.930 1.00 0.00 H ATOM 10891 N MET B 387 -10.809 79.266 -22.109 1.00 39.97 N ATOM 10892 CA MET B 387 -10.939 78.035 -22.836 1.00 39.84 C ATOM 10893 C MET B 387 -12.365 77.787 -23.197 1.00 40.28 C ATOM 10894 O MET B 387 -13.259 78.214 -22.510 1.00 40.26 O ATOM 10895 CB MET B 387 -10.497 76.866 -22.004 1.00 20.00 C ATOM 10896 CG MET B 387 -9.065 76.905 -21.592 1.00 20.00 C ATOM 10897 SD MET B 387 -8.143 76.855 -23.087 1.00 20.00 S ATOM 10898 CE MET B 387 -8.088 75.125 -23.377 1.00 20.00 C ATOM 10899 HA MET B 387 -10.318 78.130 -23.727 1.00 0.00 H ATOM 10900 HB2 MET B 387 -11.110 76.838 -21.103 1.00 0.00 H ATOM 10901 HB3 MET B 387 -10.661 75.956 -22.581 1.00 0.00 H ATOM 10902 HG2 MET B 387 -8.825 76.045 -20.967 1.00 0.00 H ATOM 10903 HG3 MET B 387 -8.851 77.822 -21.043 1.00 0.00 H ATOM 10904 HE1 MET B 387 -7.592 74.633 -22.540 1.00 0.00 H ATOM 10905 HE2 MET B 387 -9.104 74.742 -23.476 1.00 0.00 H ATOM 10906 HE3 MET B 387 -7.534 74.929 -24.295 1.00 0.00 H ATOM 10907 H MET B 387 -10.573 79.239 -21.097 1.00 0.00 H ATOM 10908 N GLY B 388 -12.561 77.067 -24.280 1.00 40.76 N ATOM 10909 CA GLY B 388 -13.903 76.703 -24.722 1.00 41.55 C ATOM 10910 C GLY B 388 -14.546 77.839 -25.475 1.00 42.40 C ATOM 10911 O GLY B 388 -13.863 78.627 -26.088 1.00 44.49 O ATOM 10912 HA3 GLY B 388 -14.513 76.461 -23.852 1.00 0.00 H ATOM 10913 HA2 GLY B 388 -13.841 75.832 -25.374 1.00 0.00 H ATOM 10914 H GLY B 388 -11.740 76.750 -24.834 1.00 0.00 H ATOM 10915 N VAL B 389 -15.861 77.956 -25.424 1.00 43.15 N ATOM 10916 CA VAL B 389 -16.514 79.047 -26.155 1.00 43.99 C ATOM 10917 C VAL B 389 -16.341 80.334 -25.365 1.00 43.74 C ATOM 10918 O VAL B 389 -16.139 80.290 -24.158 1.00 44.15 O ATOM 10919 CB VAL B 389 -18.024 78.748 -26.469 1.00 44.20 C ATOM 10920 CG1 VAL B 389 -18.161 77.433 -27.241 1.00 42.97 C ATOM 10921 CG2 VAL B 389 -18.862 78.711 -25.173 1.00 44.81 C ATOM 10922 HA VAL B 389 -16.035 79.151 -27.129 1.00 0.00 H ATOM 10923 HB VAL B 389 -18.407 79.555 -27.093 1.00 0.00 H ATOM 10924 HG11 VAL B 389 -17.611 77.505 -28.179 1.00 0.00 H ATOM 10925 HG12 VAL B 389 -17.755 76.618 -26.642 1.00 0.00 H ATOM 10926 HG13 VAL B 389 -19.214 77.243 -27.449 1.00 0.00 H ATOM 10927 HG21 VAL B 389 -18.479 77.929 -24.517 1.00 0.00 H ATOM 10928 HG22 VAL B 389 -18.793 79.675 -24.670 1.00 0.00 H ATOM 10929 HG23 VAL B 389 -19.903 78.502 -25.421 1.00 0.00 H ATOM 10930 H VAL B 389 -16.427 77.281 -24.871 1.00 0.00 H ATOM 10931 N PRO B 390 -16.368 81.484 -26.046 1.00 44.29 N ATOM 10932 CA PRO B 390 -16.052 82.788 -25.395 1.00 43.84 C ATOM 10933 C PRO B 390 -17.085 83.263 -24.395 1.00 43.33 C ATOM 10934 O PRO B 390 -16.765 84.027 -23.482 1.00 43.77 O ATOM 10935 CB PRO B 390 -15.967 83.761 -26.581 1.00 44.15 C ATOM 10936 CG PRO B 390 -15.755 82.860 -27.780 1.00 44.56 C ATOM 10937 CD PRO B 390 -16.587 81.650 -27.489 1.00 44.19 C ATOM 10938 HA PRO B 390 -15.142 82.709 -24.800 1.00 0.00 H ATOM 10939 HD3 PRO B 390 -17.639 81.826 -27.715 1.00 0.00 H ATOM 10940 HD2 PRO B 390 -16.237 80.782 -28.048 1.00 0.00 H ATOM 10941 HG3 PRO B 390 -14.703 82.591 -27.879 1.00 0.00 H ATOM 10942 HG2 PRO B 390 -16.091 83.349 -28.694 1.00 0.00 H ATOM 10943 HB2 PRO B 390 -16.891 84.330 -26.682 1.00 0.00 H ATOM 10944 HB3 PRO B 390 -15.130 84.448 -26.460 1.00 0.00 H ATOM 10945 N GLU B 391 -18.319 82.816 -24.561 1.00 42.51 N ATOM 10946 CA GLU B 391 -19.342 83.070 -23.552 1.00 41.88 C ATOM 10947 C GLU B 391 -19.007 82.445 -22.169 1.00 39.88 C ATOM 10948 O GLU B 391 -19.673 82.772 -21.161 1.00 40.27 O ATOM 10949 CB GLU B 391 -20.720 82.554 -24.025 1.00 42.50 C ATOM 10950 CG GLU B 391 -21.310 83.261 -25.245 1.00 45.70 C ATOM 10951 CD GLU B 391 -20.608 82.906 -26.570 1.00 50.87 C ATOM 10952 OE1 GLU B 391 -19.993 81.817 -26.657 1.00 52.00 O ATOM 10953 OE2 GLU B 391 -20.654 83.731 -27.522 1.00 54.46 O ATOM 10954 HA GLU B 391 -19.372 84.152 -23.424 1.00 0.00 H ATOM 10955 HB2 GLU B 391 -20.616 81.497 -24.268 1.00 0.00 H ATOM 10956 HB3 GLU B 391 -21.422 82.669 -23.199 1.00 0.00 H ATOM 10957 HG2 GLU B 391 -22.361 82.984 -25.328 1.00 0.00 H ATOM 10958 HG3 GLU B 391 -21.230 84.337 -25.091 1.00 0.00 H ATOM 10959 H GLU B 391 -18.562 82.279 -25.418 1.00 0.00 H ATOM 10960 N ASN B 392 -18.017 81.554 -22.103 1.00 37.52 N ATOM 10961 CA ASN B 392 -17.614 80.961 -20.820 1.00 36.41 C ATOM 10962 C ASN B 392 -17.050 81.996 -19.793 1.00 35.88 C ATOM 10963 O ASN B 392 -17.026 81.727 -18.604 1.00 35.70 O ATOM 10964 CB ASN B 392 -16.557 79.855 -21.038 1.00 36.42 C ATOM 10965 CG ASN B 392 -17.101 78.617 -21.758 1.00 35.84 C ATOM 10966 OD1 ASN B 392 -18.292 78.355 -21.747 1.00 35.01 O ATOM 10967 ND2 ASN B 392 -16.201 77.832 -22.362 1.00 37.19 N ATOM 10968 HA ASN B 392 -18.528 80.546 -20.396 1.00 0.00 H ATOM 10969 HB2 ASN B 392 -15.743 80.269 -21.632 1.00 0.00 H ATOM 10970 HB3 ASN B 392 -16.175 79.547 -20.065 1.00 0.00 H ATOM 10971 HD22 ASN B 392 -15.194 78.090 -22.349 1.00 0.00 H ATOM 10972 HD21 ASN B 392 -16.509 76.964 -22.844 1.00 0.00 H ATOM 10973 H ASN B 392 -17.522 81.274 -22.974 1.00 0.00 H ATOM 10974 N VAL B 393 -16.599 83.122 -20.248 1.00 35.54 N ATOM 10975 CA VAL B 393 -15.923 84.018 -19.389 1.00 35.40 C ATOM 10976 C VAL B 393 -16.771 84.476 -18.243 1.00 35.05 C ATOM 10977 O VAL B 393 -17.877 84.896 -18.401 1.00 35.06 O ATOM 10978 CB VAL B 393 -15.420 85.200 -20.172 1.00 20.00 C ATOM 10979 CG1 VAL B 393 -16.409 86.322 -20.093 1.00 20.00 C ATOM 10980 CG2 VAL B 393 -14.074 85.626 -19.658 1.00 20.00 C ATOM 10981 HA VAL B 393 -15.081 83.476 -18.959 1.00 0.00 H ATOM 10982 HB VAL B 393 -15.307 84.918 -21.219 1.00 0.00 H ATOM 10983 HG11 VAL B 393 -17.362 85.994 -20.508 1.00 0.00 H ATOM 10984 HG12 VAL B 393 -16.545 86.612 -19.051 1.00 0.00 H ATOM 10985 HG13 VAL B 393 -16.037 87.174 -20.663 1.00 0.00 H ATOM 10986 HG21 VAL B 393 -14.159 85.903 -18.607 1.00 0.00 H ATOM 10987 HG22 VAL B 393 -13.369 84.801 -19.762 1.00 0.00 H ATOM 10988 HG23 VAL B 393 -13.721 86.482 -20.233 1.00 0.00 H ATOM 10989 H VAL B 393 -16.735 83.368 -21.249 1.00 0.00 H ATOM 10990 N LEU B 394 -16.197 84.403 -17.066 1.00 34.88 N ATOM 10991 CA LEU B 394 -16.894 84.788 -15.851 1.00 34.70 C ATOM 10992 C LEU B 394 -16.419 86.133 -15.366 1.00 34.93 C ATOM 10993 O LEU B 394 -15.379 86.619 -15.799 1.00 35.61 O ATOM 10994 CB LEU B 394 -16.645 83.770 -14.754 1.00 34.67 C ATOM 10995 CG LEU B 394 -17.074 82.319 -14.955 1.00 34.10 C ATOM 10996 CD1 LEU B 394 -16.640 81.535 -13.701 1.00 32.43 C ATOM 10997 CD2 LEU B 394 -18.576 82.191 -15.196 1.00 32.86 C ATOM 10998 HA LEU B 394 -17.958 84.836 -16.082 1.00 0.00 H ATOM 10999 HB2 LEU B 394 -15.571 83.759 -14.571 1.00 0.00 H ATOM 11000 HB3 LEU B 394 -17.161 84.132 -13.864 1.00 0.00 H ATOM 11001 HG LEU B 394 -16.597 81.913 -15.847 1.00 0.00 H ATOM 11002 HD21 LEU B 394 -19.116 82.589 -14.337 1.00 0.00 H ATOM 11003 HD22 LEU B 394 -18.848 82.753 -16.090 1.00 0.00 H ATOM 11004 HD23 LEU B 394 -18.832 81.141 -15.333 1.00 0.00 H ATOM 11005 HD11 LEU B 394 -15.558 81.603 -13.588 1.00 0.00 H ATOM 11006 HD12 LEU B 394 -17.125 81.960 -12.822 1.00 0.00 H ATOM 11007 HD13 LEU B 394 -16.931 80.490 -13.809 1.00 0.00 H ATOM 11008 H LEU B 394 -15.217 84.061 -17.001 1.00 0.00 H ATOM 11009 N GLN B 395 -17.189 86.723 -14.463 1.00 35.01 N ATOM 11010 CA GLN B 395 -16.800 87.932 -13.784 1.00 36.17 C ATOM 11011 C GLN B 395 -15.607 87.611 -12.891 1.00 36.33 C ATOM 11012 O GLN B 395 -15.489 86.481 -12.384 1.00 36.45 O ATOM 11013 CB GLN B 395 -17.936 88.422 -12.888 1.00 36.71 C ATOM 11014 CG GLN B 395 -19.157 88.898 -13.625 1.00 38.79 C ATOM 11015 CD GLN B 395 -18.830 90.059 -14.554 1.00 41.00 C ATOM 11016 OE1 GLN B 395 -18.731 91.202 -14.127 1.00 40.51 O ATOM 11017 NE2 GLN B 395 -18.638 89.754 -15.826 1.00 42.23 N ATOM 11018 HA GLN B 395 -16.557 88.698 -14.520 1.00 0.00 H ATOM 11019 HB2 GLN B 395 -18.232 87.601 -12.235 1.00 0.00 H ATOM 11020 HB3 GLN B 395 -17.560 89.248 -12.284 1.00 0.00 H ATOM 11021 HG2 GLN B 395 -19.559 88.074 -14.215 1.00 0.00 H ATOM 11022 HG3 GLN B 395 -19.904 89.223 -12.901 1.00 0.00 H ATOM 11023 HE22 GLN B 395 -18.733 88.769 -16.144 1.00 0.00 H ATOM 11024 HE21 GLN B 395 -18.392 90.500 -16.508 1.00 0.00 H ATOM 11025 H GLN B 395 -18.110 86.296 -14.236 1.00 0.00 H ATOM 11026 N PRO B 396 -14.725 88.598 -12.667 1.00 36.51 N ATOM 11027 CA PRO B 396 -13.538 88.284 -11.851 1.00 36.23 C ATOM 11028 C PRO B 396 -13.895 88.147 -10.351 1.00 35.36 C ATOM 11029 O PRO B 396 -14.930 88.636 -9.936 1.00 34.45 O ATOM 11030 CB PRO B 396 -12.618 89.493 -12.118 1.00 36.32 C ATOM 11031 CG PRO B 396 -13.579 90.633 -12.315 1.00 35.78 C ATOM 11032 CD PRO B 396 -14.756 90.027 -13.064 1.00 36.59 C ATOM 11033 HA PRO B 396 -13.076 87.330 -12.106 1.00 0.00 H ATOM 11034 HD3 PRO B 396 -15.693 90.495 -12.761 1.00 0.00 H ATOM 11035 HD2 PRO B 396 -14.629 90.135 -14.141 1.00 0.00 H ATOM 11036 HG3 PRO B 396 -13.118 91.427 -12.903 1.00 0.00 H ATOM 11037 HG2 PRO B 396 -13.901 91.034 -11.354 1.00 0.00 H ATOM 11038 HB2 PRO B 396 -11.963 89.679 -11.267 1.00 0.00 H ATOM 11039 HB3 PRO B 396 -12.015 89.333 -13.012 1.00 0.00 H ATOM 11040 N THR B 397 -13.044 87.486 -9.567 1.00 35.58 N ATOM 11041 CA THR B 397 -13.232 87.391 -8.086 1.00 36.04 C ATOM 11042 C THR B 397 -12.004 87.879 -7.320 1.00 36.04 C ATOM 11043 O THR B 397 -10.878 87.699 -7.765 1.00 36.52 O ATOM 11044 CB THR B 397 -13.655 85.936 -7.628 1.00 35.61 C ATOM 11045 OG1 THR B 397 -14.012 85.952 -6.253 1.00 37.64 O ATOM 11046 CG2 THR B 397 -12.575 84.921 -7.821 1.00 34.09 C ATOM 11047 HA THR B 397 -14.057 88.059 -7.838 1.00 0.00 H ATOM 11048 HB THR B 397 -14.499 85.649 -8.256 1.00 0.00 H ATOM 11049 HG1 THR B 397 -14.276 85.040 -5.971 1.00 0.00 H ATOM 11050 HG23 THR B 397 -12.287 84.894 -8.872 1.00 0.00 H ATOM 11051 HG21 THR B 397 -11.711 85.191 -7.213 1.00 0.00 H ATOM 11052 HG22 THR B 397 -12.942 83.940 -7.518 1.00 0.00 H ATOM 11053 H THR B 397 -12.221 87.020 -10.000 1.00 0.00 H ATOM 11054 N HIS B 398 -12.207 88.539 -6.192 1.00 36.58 N ATOM 11055 CA HIS B 398 -11.052 88.936 -5.356 1.00 37.87 C ATOM 11056 C HIS B 398 -10.449 87.723 -4.643 1.00 37.19 C ATOM 11057 O HIS B 398 -11.145 87.039 -3.927 1.00 37.72 O ATOM 11058 CB HIS B 398 -11.450 89.959 -4.287 1.00 38.52 C ATOM 11059 CG HIS B 398 -10.286 90.740 -3.750 1.00 40.92 C ATOM 11060 ND1 HIS B 398 -9.264 90.158 -3.021 1.00 42.13 N ATOM 11061 CD2 HIS B 398 -9.988 92.060 -3.828 1.00 40.81 C ATOM 11062 CE1 HIS B 398 -8.392 91.091 -2.673 1.00 41.34 C ATOM 11063 NE2 HIS B 398 -8.807 92.251 -3.155 1.00 41.55 N ATOM 11064 HA HIS B 398 -10.322 89.380 -6.032 1.00 0.00 H ATOM 11065 HB2 HIS B 398 -12.163 90.657 -4.725 1.00 0.00 H ATOM 11066 HB3 HIS B 398 -11.923 89.429 -3.460 1.00 0.00 H ATOM 11067 HD2 HIS B 398 -10.577 92.827 -4.331 1.00 0.00 H ATOM 11068 HE1 HIS B 398 -7.486 90.931 -2.089 1.00 0.00 H ATOM 11069 H HIS B 398 -13.174 88.778 -5.894 1.00 0.00 H ATOM 11070 N PRO B 399 -9.157 87.440 -4.837 1.00 37.26 N ATOM 11071 CA PRO B 399 -8.610 86.211 -4.223 1.00 36.51 C ATOM 11072 C PRO B 399 -8.480 86.194 -2.722 1.00 36.30 C ATOM 11073 O PRO B 399 -8.216 85.147 -2.147 1.00 35.82 O ATOM 11074 CB PRO B 399 -7.238 86.063 -4.890 1.00 36.85 C ATOM 11075 CG PRO B 399 -6.873 87.432 -5.275 1.00 37.39 C ATOM 11076 CD PRO B 399 -8.167 88.092 -5.702 1.00 37.57 C ATOM 11077 HA PRO B 399 -9.306 85.388 -4.389 1.00 0.00 H ATOM 11078 HD3 PRO B 399 -8.138 89.167 -5.527 1.00 0.00 H ATOM 11079 HD2 PRO B 399 -8.378 87.903 -6.755 1.00 0.00 H ATOM 11080 HG3 PRO B 399 -6.161 87.419 -6.101 1.00 0.00 H ATOM 11081 HG2 PRO B 399 -6.436 87.962 -4.429 1.00 0.00 H ATOM 11082 HB2 PRO B 399 -6.511 85.651 -4.191 1.00 0.00 H ATOM 11083 HB3 PRO B 399 -7.302 85.419 -5.767 1.00 0.00 H ATOM 11084 N VAL B 400 -8.650 87.328 -2.070 1.00 36.86 N ATOM 11085 CA VAL B 400 -8.582 87.330 -0.610 1.00 36.53 C ATOM 11086 C VAL B 400 -9.944 86.962 -0.040 1.00 35.91 C ATOM 11087 O VAL B 400 -10.035 86.130 0.838 1.00 35.96 O ATOM 11088 CB VAL B 400 -8.073 88.686 -0.059 1.00 37.53 C ATOM 11089 CG1 VAL B 400 -8.117 88.717 1.496 1.00 37.28 C ATOM 11090 CG2 VAL B 400 -6.638 88.972 -0.596 1.00 35.97 C ATOM 11091 HA VAL B 400 -7.856 86.582 -0.292 1.00 0.00 H ATOM 11092 HB VAL B 400 -8.736 89.476 -0.411 1.00 0.00 H ATOM 11093 HG11 VAL B 400 -9.143 88.569 1.832 1.00 0.00 H ATOM 11094 HG12 VAL B 400 -7.485 87.922 1.892 1.00 0.00 H ATOM 11095 HG13 VAL B 400 -7.753 89.682 1.849 1.00 0.00 H ATOM 11096 HG21 VAL B 400 -5.966 88.177 -0.273 1.00 0.00 H ATOM 11097 HG22 VAL B 400 -6.660 89.011 -1.685 1.00 0.00 H ATOM 11098 HG23 VAL B 400 -6.288 89.927 -0.204 1.00 0.00 H ATOM 11099 H VAL B 400 -8.830 88.211 -2.589 1.00 0.00 H ATOM 11100 N TYR B 401 -10.995 87.563 -0.572 1.00 36.04 N ATOM 11101 CA TYR B 401 -12.354 87.486 -0.001 1.00 35.59 C ATOM 11102 C TYR B 401 -13.304 86.575 -0.789 1.00 35.11 C ATOM 11103 O TYR B 401 -14.286 86.080 -0.261 1.00 34.92 O ATOM 11104 CB TYR B 401 -12.946 88.890 0.046 1.00 36.34 C ATOM 11105 CG TYR B 401 -12.161 89.877 0.895 1.00 36.99 C ATOM 11106 CD1 TYR B 401 -11.267 90.789 0.313 1.00 39.61 C ATOM 11107 CD2 TYR B 401 -12.319 89.903 2.283 1.00 36.48 C ATOM 11108 CE1 TYR B 401 -10.563 91.710 1.105 1.00 39.19 C ATOM 11109 CE2 TYR B 401 -11.629 90.796 3.081 1.00 36.53 C ATOM 11110 CZ TYR B 401 -10.759 91.699 2.491 1.00 38.81 C ATOM 11111 OH TYR B 401 -10.066 92.559 3.299 1.00 38.69 O ATOM 11112 HA TYR B 401 -12.255 87.052 0.994 1.00 0.00 H ATOM 11113 HB3 TYR B 401 -13.956 88.821 0.450 1.00 0.00 H ATOM 11114 HB2 TYR B 401 -12.989 89.276 -0.973 1.00 0.00 H ATOM 11115 HD2 TYR B 401 -13.007 89.198 2.750 1.00 0.00 H ATOM 11116 HE2 TYR B 401 -11.768 90.790 4.162 1.00 0.00 H ATOM 11117 HE1 TYR B 401 -9.875 92.422 0.648 1.00 0.00 H ATOM 11118 HD1 TYR B 401 -11.117 90.782 -0.767 1.00 0.00 H ATOM 11119 HH TYR B 401 -10.705 93.118 3.809 1.00 0.00 H ATOM 11120 H TYR B 401 -10.857 88.120 -1.439 1.00 0.00 H ATOM 11121 N ASN B 402 -12.981 86.334 -2.051 1.00 35.35 N ATOM 11122 CA ASN B 402 -13.820 85.582 -2.957 1.00 34.81 C ATOM 11123 C ASN B 402 -15.207 86.179 -3.013 1.00 35.65 C ATOM 11124 O ASN B 402 -16.206 85.462 -2.899 1.00 34.90 O ATOM 11125 CB ASN B 402 -13.884 84.114 -2.559 1.00 34.52 C ATOM 11126 CG ASN B 402 -14.250 83.223 -3.713 1.00 32.81 C ATOM 11127 OD1 ASN B 402 -14.066 83.591 -4.852 1.00 32.22 O ATOM 11128 ND2 ASN B 402 -14.766 82.051 -3.422 1.00 31.44 N ATOM 11129 HA ASN B 402 -13.377 85.639 -3.951 1.00 0.00 H ATOM 11130 HB2 ASN B 402 -12.909 83.811 -2.178 1.00 0.00 H ATOM 11131 HB3 ASN B 402 -14.631 83.996 -1.774 1.00 0.00 H ATOM 11132 HD22 ASN B 402 -14.906 81.777 -2.429 1.00 0.00 H ATOM 11133 HD21 ASN B 402 -15.034 81.397 -4.185 1.00 0.00 H ATOM 11134 H ASN B 402 -12.077 86.705 -2.408 1.00 0.00 H ATOM 11135 N ILE B 403 -15.242 87.515 -3.102 1.00 36.38 N ATOM 11136 CA ILE B 403 -16.378 88.260 -3.660 1.00 36.11 C ATOM 11137 C ILE B 403 -15.771 89.114 -4.769 1.00 37.32 C ATOM 11138 O ILE B 403 -14.526 89.116 -4.952 1.00 37.73 O ATOM 11139 CB ILE B 403 -17.123 89.105 -2.634 1.00 36.16 C ATOM 11140 CG1 ILE B 403 -16.250 90.281 -2.133 1.00 37.13 C ATOM 11141 CG2 ILE B 403 -17.634 88.230 -1.464 1.00 33.62 C ATOM 11142 CD1 ILE B 403 -17.017 91.303 -1.216 1.00 35.19 C ATOM 11143 HA ILE B 403 -17.145 87.578 -4.027 1.00 0.00 H ATOM 11144 HB ILE B 403 -17.995 89.539 -3.124 1.00 0.00 H ATOM 11145 HG12 ILE B 403 -15.415 89.871 -1.565 1.00 0.00 H ATOM 11146 HG13 ILE B 403 -15.868 90.819 -3.001 1.00 0.00 H ATOM 11147 HD11 ILE B 403 -17.850 91.734 -1.772 1.00 0.00 H ATOM 11148 HD12 ILE B 403 -17.396 90.785 -0.335 1.00 0.00 H ATOM 11149 HD13 ILE B 403 -16.335 92.096 -0.908 1.00 0.00 H ATOM 11150 HG21 ILE B 403 -18.312 87.469 -1.850 1.00 0.00 H ATOM 11151 HG22 ILE B 403 -16.787 87.749 -0.974 1.00 0.00 H ATOM 11152 HG23 ILE B 403 -18.162 88.858 -0.746 1.00 0.00 H ATOM 11153 H ILE B 403 -14.421 88.053 -2.758 1.00 0.00 H ATOM 11154 N GLY B 404 -16.617 89.803 -5.533 1.00 37.60 N ATOM 11155 CA GLY B 404 -16.129 90.591 -6.652 1.00 38.12 C ATOM 11156 C GLY B 404 -15.264 91.743 -6.182 1.00 39.40 C ATOM 11157 O GLY B 404 -15.627 92.439 -5.229 1.00 39.02 O ATOM 11158 HA3 GLY B 404 -16.981 90.989 -7.204 1.00 0.00 H ATOM 11159 HA2 GLY B 404 -15.540 89.950 -7.308 1.00 0.00 H ATOM 11160 H GLY B 404 -17.636 89.777 -5.327 1.00 0.00 H ATOM 11161 N PRO B 405 -14.127 91.994 -6.875 1.00 41.42 N ATOM 11162 CA PRO B 405 -13.240 93.121 -6.523 1.00 43.04 C ATOM 11163 C PRO B 405 -13.954 94.476 -6.363 1.00 44.69 C ATOM 11164 O PRO B 405 -13.506 95.294 -5.594 1.00 45.45 O ATOM 11165 CB PRO B 405 -12.258 93.201 -7.708 1.00 42.82 C ATOM 11166 CG PRO B 405 -12.342 91.980 -8.404 1.00 41.93 C ATOM 11167 CD PRO B 405 -13.627 91.267 -8.054 1.00 41.32 C ATOM 11168 HA PRO B 405 -12.781 92.940 -5.551 1.00 0.00 H ATOM 11169 HD3 PRO B 405 -14.340 91.325 -8.877 1.00 0.00 H ATOM 11170 HD2 PRO B 405 -13.437 90.221 -7.813 1.00 0.00 H ATOM 11171 HG3 PRO B 405 -11.495 91.351 -8.131 1.00 0.00 H ATOM 11172 HG2 PRO B 405 -12.318 92.174 -9.476 1.00 0.00 H ATOM 11173 HB2 PRO B 405 -12.533 94.025 -8.366 1.00 0.00 H ATOM 11174 HB3 PRO B 405 -11.243 93.353 -7.342 1.00 0.00 H ATOM 11175 N ASP B 406 -15.034 94.693 -7.100 1.00 46.26 N ATOM 11176 CA ASP B 406 -15.833 95.893 -6.979 1.00 48.61 C ATOM 11177 C ASP B 406 -16.608 95.982 -5.681 1.00 49.08 C ATOM 11178 O ASP B 406 -16.665 97.048 -5.056 1.00 49.64 O ATOM 11179 CB ASP B 406 -16.790 96.023 -8.173 1.00 49.79 C ATOM 11180 CG ASP B 406 -17.733 94.834 -8.333 1.00 52.53 C ATOM 11181 OD1 ASP B 406 -18.531 94.847 -9.298 1.00 59.63 O ATOM 11182 OD2 ASP B 406 -17.689 93.877 -7.533 1.00 55.69 O ATOM 11183 HA ASP B 406 -15.127 96.724 -6.974 1.00 0.00 H ATOM 11184 HB2 ASP B 406 -17.390 96.923 -8.038 1.00 0.00 H ATOM 11185 HB3 ASP B 406 -16.196 96.117 -9.082 1.00 0.00 H ATOM 11186 H ASP B 406 -15.318 93.972 -7.793 1.00 0.00 H ATOM 11187 N LYS B 407 -17.185 94.848 -5.270 1.00 49.31 N ATOM 11188 CA LYS B 407 -17.849 94.720 -3.983 1.00 48.96 C ATOM 11189 C LYS B 407 -16.871 94.967 -2.847 1.00 49.06 C ATOM 11190 O LYS B 407 -17.238 95.570 -1.858 1.00 48.15 O ATOM 11191 CB LYS B 407 -18.453 93.322 -3.788 1.00 48.62 C ATOM 11192 CG LYS B 407 -19.367 92.822 -4.865 1.00 48.11 C ATOM 11193 CD LYS B 407 -20.579 93.680 -5.116 1.00 48.30 C ATOM 11194 CE LYS B 407 -21.425 93.004 -6.215 1.00 49.21 C ATOM 11195 NZ LYS B 407 -22.793 93.540 -6.398 1.00 50.27 N ATOM 11196 HA LYS B 407 -18.646 95.464 -3.971 1.00 0.00 H ATOM 11197 HB2 LYS B 407 -17.627 92.615 -3.702 1.00 0.00 H ATOM 11198 HB3 LYS B 407 -19.018 93.334 -2.856 1.00 0.00 H ATOM 11199 HG2 LYS B 407 -18.797 92.761 -5.792 1.00 0.00 H ATOM 11200 HG3 LYS B 407 -19.709 91.826 -4.584 1.00 0.00 H ATOM 11201 HD2 LYS B 407 -21.165 93.770 -4.201 1.00 0.00 H ATOM 11202 HD3 LYS B 407 -20.268 94.671 -5.446 1.00 0.00 H ATOM 11203 HE2 LYS B 407 -21.511 91.946 -5.968 1.00 0.00 H ATOM 11204 HE3 LYS B 407 -20.894 93.113 -7.161 1.00 0.00 H ATOM 11205 HZ1 LYS B 407 -23.327 93.433 -5.512 1.00 0.00 H ATOM 11206 HZ2 LYS B 407 -22.738 94.547 -6.651 1.00 0.00 H ATOM 11207 HZ3 LYS B 407 -23.271 93.015 -7.158 1.00 0.00 H ATOM 11208 H LYS B 407 -17.158 94.020 -5.899 1.00 0.00 H ATOM 11209 N VAL B 408 -15.642 94.484 -2.979 1.00 50.26 N ATOM 11210 CA VAL B 408 -14.621 94.713 -1.940 1.00 52.36 C ATOM 11211 C VAL B 408 -14.360 96.229 -1.735 1.00 54.82 C ATOM 11212 O VAL B 408 -14.453 96.739 -0.602 1.00 54.85 O ATOM 11213 CB VAL B 408 -13.277 93.982 -2.258 1.00 52.19 C ATOM 11214 CG1 VAL B 408 -12.208 94.344 -1.247 1.00 50.88 C ATOM 11215 CG2 VAL B 408 -13.479 92.467 -2.290 1.00 51.09 C ATOM 11216 HA VAL B 408 -15.020 94.292 -1.017 1.00 0.00 H ATOM 11217 HB VAL B 408 -12.945 94.311 -3.243 1.00 0.00 H ATOM 11218 HG11 VAL B 408 -12.035 95.420 -1.272 1.00 0.00 H ATOM 11219 HG12 VAL B 408 -12.538 94.051 -0.250 1.00 0.00 H ATOM 11220 HG13 VAL B 408 -11.284 93.821 -1.494 1.00 0.00 H ATOM 11221 HG21 VAL B 408 -13.843 92.130 -1.319 1.00 0.00 H ATOM 11222 HG22 VAL B 408 -14.208 92.215 -3.060 1.00 0.00 H ATOM 11223 HG23 VAL B 408 -12.530 91.980 -2.513 1.00 0.00 H ATOM 11224 H VAL B 408 -15.395 93.936 -3.828 1.00 0.00 H ATOM 11225 N ILE B 409 -14.042 96.911 -2.840 1.00 56.99 N ATOM 11226 CA ILE B 409 -13.892 98.380 -2.922 1.00 59.40 C ATOM 11227 C ILE B 409 -15.093 99.122 -2.383 1.00 59.75 C ATOM 11228 O ILE B 409 -14.989 99.947 -1.491 1.00 60.06 O ATOM 11229 CB ILE B 409 -13.686 98.819 -4.432 1.00 60.46 C ATOM 11230 CG1 ILE B 409 -12.200 98.796 -4.797 1.00 61.33 C ATOM 11231 CG2 ILE B 409 -14.283 100.211 -4.744 1.00 60.53 C ATOM 11232 CD1 ILE B 409 -11.954 98.718 -6.287 1.00 61.28 C ATOM 11233 HA ILE B 409 -13.026 98.635 -2.312 1.00 0.00 H ATOM 11234 HB ILE B 409 -14.228 98.095 -5.041 1.00 0.00 H ATOM 11235 HG12 ILE B 409 -11.735 99.705 -4.416 1.00 0.00 H ATOM 11236 HG13 ILE B 409 -11.740 97.929 -4.324 1.00 0.00 H ATOM 11237 HD11 ILE B 409 -12.405 97.807 -6.681 1.00 0.00 H ATOM 11238 HD12 ILE B 409 -12.400 99.586 -6.773 1.00 0.00 H ATOM 11239 HD13 ILE B 409 -10.881 98.705 -6.477 1.00 0.00 H ATOM 11240 HG21 ILE B 409 -15.355 100.198 -4.546 1.00 0.00 H ATOM 11241 HG22 ILE B 409 -13.805 100.960 -4.113 1.00 0.00 H ATOM 11242 HG23 ILE B 409 -14.109 100.453 -5.792 1.00 0.00 H ATOM 11243 H ILE B 409 -13.888 96.365 -3.712 1.00 0.00 H ATOM 11244 N GLN B 410 -16.248 98.825 -2.924 1.00 60.13 N ATOM 11245 CA GLN B 410 -17.412 99.529 -2.496 1.00 61.77 C ATOM 11246 C GLN B 410 -17.640 99.427 -0.968 1.00 62.95 C ATOM 11247 O GLN B 410 -17.973 100.417 -0.318 1.00 63.87 O ATOM 11248 CB GLN B 410 -18.587 98.998 -3.257 1.00 61.28 C ATOM 11249 CG GLN B 410 -19.807 99.817 -3.113 1.00 62.45 C ATOM 11250 CD GLN B 410 -20.920 99.225 -3.925 1.00 64.57 C ATOM 11251 OE1 GLN B 410 -20.689 98.756 -5.052 1.00 64.75 O ATOM 11252 NE2 GLN B 410 -22.132 99.189 -3.354 1.00 65.38 N ATOM 11253 HA GLN B 410 -17.278 100.591 -2.703 1.00 0.00 H ATOM 11254 HB2 GLN B 410 -18.323 98.957 -4.314 1.00 0.00 H ATOM 11255 HB3 GLN B 410 -18.803 97.992 -2.898 1.00 0.00 H ATOM 11256 HG2 GLN B 410 -20.101 99.846 -2.064 1.00 0.00 H ATOM 11257 HG3 GLN B 410 -19.605 100.830 -3.461 1.00 0.00 H ATOM 11258 HE22 GLN B 410 -22.273 99.596 -2.407 1.00 0.00 H ATOM 11259 HE21 GLN B 410 -22.931 98.754 -3.857 1.00 0.00 H ATOM 11260 H GLN B 410 -16.315 98.087 -3.654 1.00 0.00 H ATOM 11261 N ALA B 411 -17.432 98.247 -0.392 1.00 62.96 N ATOM 11262 CA ALA B 411 -17.693 98.057 1.018 1.00 63.51 C ATOM 11263 C ALA B 411 -16.613 98.678 1.892 1.00 64.70 C ATOM 11264 O ALA B 411 -16.927 99.340 2.854 1.00 63.42 O ATOM 11265 CB ALA B 411 -17.847 96.573 1.337 1.00 62.67 C ATOM 11266 HA ALA B 411 -18.628 98.570 1.245 1.00 0.00 H ATOM 11267 HB1 ALA B 411 -18.679 96.164 0.764 1.00 0.00 H ATOM 11268 HB2 ALA B 411 -16.929 96.049 1.072 1.00 0.00 H ATOM 11269 HB3 ALA B 411 -18.043 96.450 2.402 1.00 0.00 H ATOM 11270 H ALA B 411 -17.078 97.452 -0.961 1.00 0.00 H ATOM 11271 N THR B 412 -15.345 98.439 1.566 1.00 66.90 N ATOM 11272 CA THR B 412 -14.230 99.006 2.339 1.00 69.29 C ATOM 11273 C THR B 412 -14.311 100.532 2.325 1.00 71.34 C ATOM 11274 O THR B 412 -14.174 101.173 3.380 1.00 71.86 O ATOM 11275 CB THR B 412 -12.828 98.604 1.806 1.00 69.37 C ATOM 11276 OG1 THR B 412 -12.737 98.950 0.415 1.00 71.38 O ATOM 11277 CG2 THR B 412 -12.539 97.105 1.983 1.00 68.38 C ATOM 11278 HA THR B 412 -14.335 98.600 3.345 1.00 0.00 H ATOM 11279 HB THR B 412 -12.084 99.147 2.389 1.00 0.00 H ATOM 11280 HG1 THR B 412 -13.437 98.466 -0.091 1.00 0.00 H ATOM 11281 HG23 THR B 412 -12.609 96.845 3.039 1.00 0.00 H ATOM 11282 HG21 THR B 412 -13.268 96.526 1.416 1.00 0.00 H ATOM 11283 HG22 THR B 412 -11.536 96.884 1.619 1.00 0.00 H ATOM 11284 H THR B 412 -15.138 97.836 0.744 1.00 0.00 H ATOM 11285 N THR B 413 -14.550 101.111 1.144 1.00 72.80 N ATOM 11286 CA THR B 413 -14.730 102.555 1.044 1.00 74.14 C ATOM 11287 C THR B 413 -15.831 102.959 2.006 1.00 74.41 C ATOM 11288 O THR B 413 -15.577 103.659 2.975 1.00 75.19 O ATOM 11289 CB THR B 413 -15.058 103.029 -0.392 1.00 74.69 C ATOM 11290 OG1 THR B 413 -13.916 102.840 -1.243 1.00 73.75 O ATOM 11291 CG2 THR B 413 -15.436 104.507 -0.409 1.00 74.58 C ATOM 11292 HA THR B 413 -13.788 103.038 1.305 1.00 0.00 H ATOM 11293 HB THR B 413 -15.901 102.439 -0.752 1.00 0.00 H ATOM 11294 HG1 THR B 413 -13.676 101.880 -1.263 1.00 0.00 H ATOM 11295 HG23 THR B 413 -16.302 104.667 0.233 1.00 0.00 H ATOM 11296 HG21 THR B 413 -14.597 105.099 -0.044 1.00 0.00 H ATOM 11297 HG22 THR B 413 -15.678 104.807 -1.429 1.00 0.00 H ATOM 11298 H THR B 413 -14.608 100.525 0.287 1.00 0.00 H ATOM 11299 N HIS B 414 -17.021 102.430 1.833 1.00 74.08 N ATOM 11300 CA HIS B 414 -18.132 102.773 2.708 1.00 74.04 C ATOM 11301 C HIS B 414 -17.913 102.629 4.200 1.00 73.63 C ATOM 11302 O HIS B 414 -18.450 103.386 4.984 1.00 73.66 O ATOM 11303 CB HIS B 414 -19.381 102.033 2.268 1.00 20.00 C ATOM 11304 CG HIS B 414 -20.488 102.045 3.273 1.00 20.00 C ATOM 11305 ND1 HIS B 414 -20.399 101.437 4.430 1.00 20.00 N ATOM 11306 CD2 HIS B 414 -21.736 102.602 3.229 1.00 20.00 C ATOM 11307 CE1 HIS B 414 -21.527 101.602 5.107 1.00 20.00 C ATOM 11308 NE2 HIS B 414 -22.339 102.320 4.374 1.00 20.00 N ATOM 11309 HA HIS B 414 -18.243 103.850 2.585 1.00 0.00 H ATOM 11310 HB2 HIS B 414 -19.747 102.495 1.351 1.00 0.00 H ATOM 11311 HB3 HIS B 414 -19.112 100.996 2.069 1.00 0.00 H ATOM 11312 HD2 HIS B 414 -22.158 103.174 2.402 1.00 0.00 H ATOM 11313 HE1 HIS B 414 -21.741 101.208 6.101 1.00 0.00 H ATOM 11314 H HIS B 414 -17.172 101.754 1.057 1.00 0.00 H ATOM 11315 N PHE B 415 -17.133 101.667 4.628 1.00 72.81 N ATOM 11316 CA PHE B 415 -16.909 101.455 6.062 1.00 72.38 C ATOM 11317 C PHE B 415 -15.738 102.270 6.607 1.00 74.23 C ATOM 11318 O PHE B 415 -15.637 102.472 7.818 1.00 74.11 O ATOM 11319 CB PHE B 415 -16.754 99.960 6.408 1.00 70.12 C ATOM 11320 CG PHE B 415 -18.069 99.201 6.447 1.00 67.82 C ATOM 11321 CD1 PHE B 415 -18.360 98.229 5.500 1.00 64.77 C ATOM 11322 CD2 PHE B 415 -19.022 99.482 7.413 1.00 65.64 C ATOM 11323 CE1 PHE B 415 -19.568 97.554 5.520 1.00 63.56 C ATOM 11324 CE2 PHE B 415 -20.249 98.795 7.435 1.00 64.11 C ATOM 11325 CZ PHE B 415 -20.511 97.835 6.491 1.00 64.34 C ATOM 11326 HA PHE B 415 -17.807 101.821 6.560 1.00 0.00 H ATOM 11327 HB2 PHE B 415 -16.112 99.498 5.658 1.00 0.00 H ATOM 11328 HB3 PHE B 415 -16.282 99.881 7.387 1.00 0.00 H ATOM 11329 HD2 PHE B 415 -18.818 100.245 8.165 1.00 0.00 H ATOM 11330 HE2 PHE B 415 -20.990 99.025 8.201 1.00 0.00 H ATOM 11331 HZ PHE B 415 -21.458 97.296 6.506 1.00 0.00 H ATOM 11332 HE1 PHE B 415 -19.777 96.796 4.765 1.00 0.00 H ATOM 11333 HD1 PHE B 415 -17.626 97.994 4.729 1.00 0.00 H ATOM 11334 H PHE B 415 -16.665 101.044 3.940 1.00 0.00 H ATOM 11335 N LEU B 416 -14.864 102.750 5.724 1.00 76.28 N ATOM 11336 CA LEU B 416 -13.839 103.716 6.130 1.00 77.80 C ATOM 11337 C LEU B 416 -14.455 105.095 6.443 1.00 79.35 C ATOM 11338 O LEU B 416 -13.893 105.850 7.215 1.00 79.11 O ATOM 11339 CB LEU B 416 -12.707 103.795 5.099 1.00 77.91 C ATOM 11340 CG LEU B 416 -11.612 102.729 5.289 1.00 77.42 C ATOM 11341 CD1 LEU B 416 -10.879 102.413 3.981 1.00 77.81 C ATOM 11342 CD2 LEU B 416 -10.608 103.128 6.364 1.00 76.20 C ATOM 11343 HA LEU B 416 -13.391 103.360 7.058 1.00 0.00 H ATOM 11344 HB2 LEU B 416 -13.138 103.671 4.106 1.00 0.00 H ATOM 11345 HB3 LEU B 416 -12.244 104.779 5.172 1.00 0.00 H ATOM 11346 HG LEU B 416 -12.127 101.826 5.617 1.00 0.00 H ATOM 11347 HD21 LEU B 416 -10.127 104.064 6.081 1.00 0.00 H ATOM 11348 HD22 LEU B 416 -11.127 103.257 7.314 1.00 0.00 H ATOM 11349 HD23 LEU B 416 -9.854 102.347 6.464 1.00 0.00 H ATOM 11350 HD11 LEU B 416 -11.593 102.039 3.247 1.00 0.00 H ATOM 11351 HD12 LEU B 416 -10.408 103.320 3.602 1.00 0.00 H ATOM 11352 HD13 LEU B 416 -10.117 101.656 4.167 1.00 0.00 H ATOM 11353 H LEU B 416 -14.909 102.435 4.734 1.00 0.00 H ATOM 11354 N GLN B 417 -15.632 105.393 5.894 1.00 80.91 N ATOM 11355 CA GLN B 417 -16.418 106.555 6.326 1.00 82.81 C ATOM 11356 C GLN B 417 -16.664 106.600 7.827 1.00 83.50 C ATOM 11357 O GLN B 417 -17.035 107.629 8.347 1.00 84.07 O ATOM 11358 CB GLN B 417 -17.818 106.556 5.716 1.00 82.71 C ATOM 11359 CG GLN B 417 -17.943 106.700 4.226 1.00 83.07 C ATOM 11360 CD GLN B 417 -19.415 106.742 3.776 1.00 83.62 C ATOM 11361 OE1 GLN B 417 -20.319 106.240 4.470 1.00 83.78 O ATOM 11362 NE2 GLN B 417 -19.659 107.339 2.606 1.00 84.13 N ATOM 11363 HA GLN B 417 -15.814 107.402 6.000 1.00 0.00 H ATOM 11364 HB2 GLN B 417 -18.291 105.613 5.991 1.00 0.00 H ATOM 11365 HB3 GLN B 417 -18.367 107.382 6.168 1.00 0.00 H ATOM 11366 HG2 GLN B 417 -17.453 107.624 3.918 1.00 0.00 H ATOM 11367 HG3 GLN B 417 -17.452 105.853 3.747 1.00 0.00 H ATOM 11368 HE22 GLN B 417 -18.875 107.746 2.057 1.00 0.00 H ATOM 11369 HE21 GLN B 417 -20.633 107.397 2.245 1.00 0.00 H ATOM 11370 H GLN B 417 -16.005 104.785 5.137 1.00 0.00 H ATOM 11371 N LYS B 418 -16.556 105.477 8.516 1.00 84.10 N ATOM 11372 CA LYS B 418 -16.921 105.425 9.927 1.00 84.92 C ATOM 11373 C LYS B 418 -15.685 105.179 10.748 1.00 85.39 C ATOM 11374 O LYS B 418 -14.703 104.653 10.233 1.00 84.76 O ATOM 11375 CB LYS B 418 -17.938 104.309 10.195 1.00 84.47 C ATOM 11376 CG LYS B 418 -19.251 104.464 9.429 1.00 84.69 C ATOM 11377 CD LYS B 418 -20.216 103.318 9.698 1.00 83.77 C ATOM 11378 CE LYS B 418 -21.147 103.074 8.522 1.00 83.50 C ATOM 11379 NZ LYS B 418 -21.749 104.319 7.952 1.00 84.18 N ATOM 11380 HA LYS B 418 -17.376 106.377 10.202 1.00 0.00 H ATOM 11381 HB2 LYS B 418 -17.486 103.358 9.911 1.00 0.00 H ATOM 11382 HB3 LYS B 418 -18.163 104.299 11.262 1.00 0.00 H ATOM 11383 HG2 LYS B 418 -19.724 105.399 9.730 1.00 0.00 H ATOM 11384 HG3 LYS B 418 -19.033 104.495 8.362 1.00 0.00 H ATOM 11385 HD2 LYS B 418 -19.642 102.411 9.888 1.00 0.00 H ATOM 11386 HD3 LYS B 418 -20.814 103.559 10.577 1.00 0.00 H ATOM 11387 HE2 LYS B 418 -21.956 102.423 8.854 1.00 0.00 H ATOM 11388 HE3 LYS B 418 -20.581 102.575 7.735 1.00 0.00 H ATOM 11389 HZ1 LYS B 418 -22.303 104.803 8.687 1.00 0.00 H ATOM 11390 HZ2 LYS B 418 -20.991 104.948 7.618 1.00 0.00 H ATOM 11391 HZ3 LYS B 418 -22.370 104.069 7.156 1.00 0.00 H ATOM 11392 H LYS B 418 -16.206 104.618 8.045 1.00 0.00 H ATOM 11393 N PRO B 419 -15.725 105.559 12.037 1.00 86.43 N ATOM 11394 CA PRO B 419 -14.558 105.327 12.862 1.00 86.68 C ATOM 11395 C PRO B 419 -14.546 103.915 13.460 1.00 85.99 C ATOM 11396 O PRO B 419 -15.592 103.368 13.813 1.00 84.77 O ATOM 11397 CB PRO B 419 -14.681 106.402 13.942 1.00 87.19 C ATOM 11398 CG PRO B 419 -16.137 106.646 14.079 1.00 87.21 C ATOM 11399 CD PRO B 419 -16.808 106.217 12.793 1.00 86.71 C ATOM 11400 HA PRO B 419 -13.625 105.388 12.303 1.00 0.00 H ATOM 11401 HD3 PRO B 419 -17.622 105.520 12.992 1.00 0.00 H ATOM 11402 HD2 PRO B 419 -17.194 107.079 12.249 1.00 0.00 H ATOM 11403 HG3 PRO B 419 -16.319 107.706 14.256 1.00 0.00 H ATOM 11404 HG2 PRO B 419 -16.532 106.067 14.913 1.00 0.00 H ATOM 11405 HB2 PRO B 419 -14.261 106.049 14.884 1.00 0.00 H ATOM 11406 HB3 PRO B 419 -14.167 107.313 13.636 1.00 0.00 H ATOM 11407 N VAL B 420 -13.348 103.345 13.527 1.00 86.05 N ATOM 11408 CA VAL B 420 -13.087 102.122 14.264 1.00 85.93 C ATOM 11409 C VAL B 420 -13.666 102.247 15.669 1.00 86.54 C ATOM 11410 O VAL B 420 -13.291 103.155 16.389 1.00 87.00 O ATOM 11411 CB VAL B 420 -11.573 101.873 14.401 1.00 85.86 C ATOM 11412 CG1 VAL B 420 -11.316 100.760 15.386 1.00 84.98 C ATOM 11413 CG2 VAL B 420 -10.942 101.555 13.044 1.00 84.88 C ATOM 11414 HA VAL B 420 -13.545 101.296 13.720 1.00 0.00 H ATOM 11415 HB VAL B 420 -11.108 102.785 14.776 1.00 0.00 H ATOM 11416 HG11 VAL B 420 -11.723 101.036 16.359 1.00 0.00 H ATOM 11417 HG12 VAL B 420 -11.798 99.848 15.035 1.00 0.00 H ATOM 11418 HG13 VAL B 420 -10.242 100.594 15.473 1.00 0.00 H ATOM 11419 HG21 VAL B 420 -11.407 100.661 12.629 1.00 0.00 H ATOM 11420 HG22 VAL B 420 -11.098 102.395 12.367 1.00 0.00 H ATOM 11421 HG23 VAL B 420 -9.873 101.384 13.173 1.00 0.00 H ATOM 11422 H VAL B 420 -12.557 103.798 13.026 1.00 0.00 H ATOM 11423 N PRO B 421 -14.559 101.324 16.079 1.00 86.56 N ATOM 11424 CA PRO B 421 -15.282 101.533 17.333 1.00 87.05 C ATOM 11425 C PRO B 421 -14.315 101.630 18.486 1.00 87.96 C ATOM 11426 O PRO B 421 -13.381 100.829 18.570 1.00 87.39 O ATOM 11427 CB PRO B 421 -16.138 100.280 17.477 1.00 86.32 C ATOM 11428 CG PRO B 421 -16.152 99.650 16.154 1.00 85.91 C ATOM 11429 CD PRO B 421 -14.900 100.039 15.455 1.00 85.81 C ATOM 11430 HA PRO B 421 -15.868 102.452 17.331 1.00 0.00 H ATOM 11431 HD3 PRO B 421 -14.114 99.302 15.620 1.00 0.00 H ATOM 11432 HD2 PRO B 421 -15.069 100.155 14.384 1.00 0.00 H ATOM 11433 HG3 PRO B 421 -17.017 99.995 15.587 1.00 0.00 H ATOM 11434 HG2 PRO B 421 -16.197 98.566 16.259 1.00 0.00 H ATOM 11435 HB2 PRO B 421 -15.703 99.605 18.214 1.00 0.00 H ATOM 11436 HB3 PRO B 421 -17.150 100.545 17.782 1.00 0.00 H ATOM 11437 N GLY B 422 -14.526 102.627 19.345 1.00 89.14 N ATOM 11438 CA GLY B 422 -13.573 102.968 20.412 1.00 89.32 C ATOM 11439 C GLY B 422 -12.508 103.966 19.964 1.00 88.43 C ATOM 11440 O GLY B 422 -11.941 104.670 20.795 1.00 89.52 O ATOM 11441 HA3 GLY B 422 -13.077 102.054 20.740 1.00 0.00 H ATOM 11442 HA2 GLY B 422 -14.125 103.400 21.246 1.00 0.00 H ATOM 11443 H GLY B 422 -15.399 103.186 19.257 1.00 0.00 H ATOM 11444 N PHE B 423 -12.245 104.004 18.650 1.00 85.31 N ATOM 11445 CA PHE B 423 -11.392 104.999 17.968 1.00 82.82 C ATOM 11446 C PHE B 423 -9.913 104.814 18.346 1.00 82.67 C ATOM 11447 O PHE B 423 -9.035 104.751 17.479 1.00 81.98 O ATOM 11448 CB PHE B 423 -11.818 106.465 18.232 1.00 82.83 C ATOM 11449 CG PHE B 423 -13.330 106.753 18.166 1.00 81.43 C ATOM 11450 CD1 PHE B 423 -13.824 107.698 17.267 1.00 80.72 C ATOM 11451 CD2 PHE B 423 -14.234 106.189 19.071 1.00 80.74 C ATOM 11452 CE1 PHE B 423 -15.203 108.013 17.226 1.00 81.11 C ATOM 11453 CE2 PHE B 423 -15.611 106.500 19.018 1.00 80.77 C ATOM 11454 CZ PHE B 423 -16.087 107.398 18.099 1.00 80.64 C ATOM 11455 HA PHE B 423 -11.525 104.814 16.902 1.00 0.00 H ATOM 11456 HB2 PHE B 423 -11.469 106.739 19.228 1.00 0.00 H ATOM 11457 HB3 PHE B 423 -11.326 107.094 17.490 1.00 0.00 H ATOM 11458 HD2 PHE B 423 -13.870 105.497 19.831 1.00 0.00 H ATOM 11459 HE2 PHE B 423 -16.300 106.022 19.714 1.00 0.00 H ATOM 11460 HZ PHE B 423 -17.152 107.627 18.055 1.00 0.00 H ATOM 11461 HE1 PHE B 423 -15.572 108.742 16.505 1.00 0.00 H ATOM 11462 HD1 PHE B 423 -13.138 108.201 16.586 1.00 0.00 H ATOM 11463 H PHE B 423 -12.680 103.268 18.058 1.00 0.00 H TER 11464 PHE B 423 HETATM11465 ZN ZN A 1 -14.831 69.312 -2.720 1.00 30.15 ZN HETATM11466 O HOH 2 -19.086 69.493 11.245 1.00 29.42 O HETATM11467 O HOH 3 -26.974 61.333 18.856 1.00 39.62 O HETATM11468 O HOH 4 -35.531 76.916 6.865 1.00 34.67 O HETATM11469 O HOH 5 7.882 54.305 19.287 1.00 49.82 O HETATM11470 O HOH 6 4.538 70.152 16.650 1.00 51.95 O HETATM11471 O HOH 7 -4.946 56.143 24.979 1.00 41.18 O HETATM11472 O HOH 8 -18.890 69.904 19.963 1.00 34.98 O HETATM11473 O HOH 9 -2.427 53.141 19.268 1.00 36.90 O HETATM11474 O HOH 10 -7.727 54.243 4.847 1.00 48.25 O HETATM11475 O HOH 11 -9.648 58.395 27.087 1.00 32.03 O HETATM11476 O HOH 12 -46.326 66.452 23.298 1.00 45.01 O HETATM11477 O HOH 13 -29.220 62.496 25.384 1.00 51.40 O HETATM11478 O HOH 14 -15.734 68.137 8.082 1.00 41.99 O HETATM11479 O HOH 15 2.003 75.855 -14.749 1.00 46.55 O HETATM11480 O HOH 16 -20.442 73.589 20.205 1.00 39.44 O HETATM11481 O HOH 17 -18.653 61.533 8.588 1.00 37.71 O HETATM11482 O HOH 18 -39.403 63.912 15.558 1.00 38.88 O HETATM11483 O HOH 19 23.833 67.749 9.620 1.00 57.26 O HETATM11484 O HOH 20 -30.805 79.679 27.627 1.00 50.92 O HETATM11485 O HOH 21 9.343 68.560 1.200 1.00 38.14 O HETATM11486 O HOH 22 1.621 55.944 20.794 1.00 40.95 O HETATM11487 O HOH 23 -44.155 68.869 16.055 1.00 41.14 O HETATM11488 O HOH 24 -46.088 69.455 23.672 1.00 35.24 O HETATM11489 O HOH 25 -36.967 65.144 32.780 1.00 29.90 O HETATM11490 O HOH 26 5.949 48.906 14.218 1.00 48.42 O HETATM11491 O HOH 27 -26.243 64.303 11.673 1.00 33.91 O HETATM11492 O HOH 28 -24.965 67.293 9.732 1.00 34.54 O HETATM11493 O HOH 29 -24.066 60.260 30.992 1.00 35.79 O HETATM11494 O HOH 30 -30.898 75.362 16.778 1.00 29.00 O HETATM11495 O HOH 31 -19.731 53.366 22.449 1.00 31.22 O HETATM11496 O HOH 32 -8.789 58.804 2.870 1.00 53.75 O HETATM11497 O HOH 33 -42.889 68.341 11.923 1.00 44.51 O HETATM11498 O HOH 34 -4.861 50.724 10.880 1.00 46.27 O HETATM11499 O HOH 35 -47.312 59.170 24.901 1.00 42.56 O HETATM11500 O HOH 36 -30.554 58.382 25.757 1.00 38.85 O HETATM11501 O HOH 37 -5.266 57.405 32.579 1.00 55.03 O HETATM11502 O HOH 38 29.362 70.839 1.796 1.00 48.71 O HETATM11503 O HOH 39 18.953 69.040 10.824 1.00 47.79 O HETATM11504 O HOH 40 -19.735 74.455 26.129 1.00 47.65 O HETATM11505 O HOH 41 -9.890 61.323 5.010 1.00 39.09 O HETATM11506 O HOH 42 14.498 48.184 1.772 1.00 69.94 O HETATM11507 O HOH 43 7.216 68.261 -8.985 1.00 46.53 O HETATM11508 O HOH 44 -42.579 76.562 25.195 1.00 41.94 O HETATM11509 O HOH 45 24.850 64.398 16.842 1.00 52.28 O HETATM11510 O HOH 46 -28.210 61.373 35.713 1.00 56.16 O HETATM11511 O HOH 47 -39.191 68.721 33.417 1.00 44.61 O HETATM11512 O HOH 48 -15.146 71.549 34.236 1.00 52.10 O HETATM11513 O HOH 49 -21.875 73.502 11.597 1.00 42.81 O HETATM11514 O HOH 50 26.730 64.317 2.229 1.00 50.88 O HETATM11515 O HOH 51 -27.618 58.825 18.449 1.00 50.14 O HETATM11516 O HOH 52 -35.916 82.258 5.808 1.00 47.44 O HETATM11517 O HOH 53 7.768 56.785 19.840 1.00 50.33 O HETATM11518 O HOH 54 -26.718 58.160 25.037 1.00 47.51 O HETATM11519 O HOH 55 -38.422 54.138 24.608 1.00 46.61 O HETATM11520 O HOH 56 -13.014 59.038 7.719 1.00 39.39 O HETATM11521 O HOH 57 3.352 50.523 1.859 1.00 49.44 O HETATM11522 O HOH 58 -32.063 52.902 14.432 1.00 57.40 O HETATM11523 O HOH 59 4.224 54.538 -7.437 1.00 53.68 O HETATM11524 O HOH 60 -9.865 66.686 15.821 1.00 39.36 O HETATM11525 O HOH 61 -2.425 50.132 1.628 1.00 44.17 O HETATM11526 O HOH 62 -24.218 60.289 28.366 1.00 40.53 O HETATM11527 O HOH 63 -5.739 53.758 24.143 1.00 41.81 O HETATM11528 O HOH 64 -0.341 63.507 11.056 1.00 40.65 O HETATM11529 O HOH 65 -33.788 51.838 23.123 1.00 54.51 O HETATM11530 O HOH 66 -33.157 60.504 22.477 1.00 41.94 O HETATM11531 O HOH 67 -5.758 58.554 -0.458 1.00 40.79 O HETATM11532 O HOH 68 -39.805 61.755 25.155 1.00 38.28 O HETATM11533 O HOH 69 14.229 72.578 -0.143 1.00 54.18 O HETATM11534 O HOH 70 -23.025 53.682 28.512 1.00 45.02 O HETATM11535 O HOH 71 -40.635 74.990 12.529 1.00 40.93 O HETATM11536 O HOH 72 26.062 84.457 -6.380 1.00 58.92 O HETATM11537 O HOH 73 24.241 86.905 -11.608 1.00 61.48 O HETATM11538 O HOH 74 -46.206 60.274 15.994 1.00 43.73 O HETATM11539 O HOH 75 -43.239 70.441 13.985 1.00 41.33 O HETATM11540 O HOH 76 -17.560 51.797 12.058 1.00 50.73 O HETATM11541 O HOH 77 -25.744 58.457 31.626 1.00 47.23 O HETATM11542 O HOH 78 25.328 88.624 -9.085 1.00 65.25 O HETATM11543 O HOH 79 21.781 74.723 8.718 1.00 57.27 O HETATM11544 O HOH 80 -0.810 68.729 16.524 1.00 50.07 O HETATM11545 O HOH 81 -3.095 52.126 6.767 1.00 43.61 O HETATM11546 O HOH 82 -15.212 49.963 14.980 1.00 51.57 O HETATM11547 O HOH 83 22.195 55.806 -5.626 1.00 62.07 O HETATM11548 O HOH 84 -36.894 63.600 25.792 1.00 49.93 O HETATM11549 O HOH 85 27.666 71.570 -2.047 1.00 51.81 O HETATM11550 O HOH 86 8.877 50.445 5.943 1.00 56.85 O HETATM11551 O HOH 87 22.374 56.555 12.150 1.00 56.54 O HETATM11552 O HOH 88 -15.387 55.139 10.817 1.00 46.41 O HETATM11553 O HOH 89 11.179 81.414 -19.214 1.00 52.68 O HETATM11554 O HOH 90 -18.763 55.494 9.090 1.00 57.51 O HETATM11555 O HOH 91 16.571 69.620 11.594 1.00 57.32 O HETATM11556 O HOH 92 -35.878 52.227 20.663 1.00 49.91 O HETATM11557 O HOH 93 -35.388 79.859 20.255 1.00 51.81 O HETATM11558 O HOH 94 10.247 75.453 -26.020 1.00 57.31 O HETATM11559 O HOH 95 -36.967 59.804 20.887 1.00 42.66 O HETATM11560 O HOH 96 -1.209 54.265 6.204 1.00 45.53 O HETATM11561 O HOH 97 2.881 57.561 -5.882 1.00 48.76 O HETATM11562 O HOH 98 4.342 66.473 25.107 1.00 51.71 O HETATM11563 O HOH 99 -40.825 57.259 20.653 1.00 48.92 O HETATM11564 O HOH 100 9.398 71.786 1.998 1.00 43.77 O HETATM11565 O HOH 101 11.299 66.830 -4.772 1.00 49.61 O HETATM11566 O HOH 102 11.545 55.243 -11.934 1.00 51.55 O HETATM11567 O HOH 103 -36.182 86.699 4.444 1.00 46.68 O HETATM11568 O HOH 104 27.476 84.469 -13.338 1.00 61.08 O HETATM11569 O HOH 105 -41.502 64.857 30.982 1.00 49.28 O HETATM11570 O HOH 106 -31.786 57.424 17.617 1.00 45.36 O HETATM11571 O HOH 107 -25.832 59.666 34.952 1.00 45.72 O HETATM11572 O HOH 108 -40.263 77.637 25.498 1.00 49.05 O HETATM11573 O HOH 109 -8.757 72.553 35.967 1.00 52.24 O HETATM11574 O HOH 110 -16.158 54.874 28.858 1.00 51.05 O HETATM11575 O HOH 111 4.482 57.600 26.102 1.00 57.00 O HETATM11576 O HOH 112 12.848 79.114 -17.956 1.00 50.54 O HETATM11577 O HOH 113 14.575 61.105 -21.121 1.00 55.49 O HETATM11578 O HOH 114 -8.433 58.090 -0.405 1.00 46.93 O HETATM11579 O HOH 115 18.077 58.349 -16.394 1.00 57.11 O HETATM11580 O HOH 116 -42.550 67.936 5.354 1.00 53.92 O HETATM11581 O HOH 117 -45.190 59.037 29.053 1.00 50.77 O HETATM11582 O HOH 118 0.936 49.433 16.105 1.00 51.16 O HETATM11583 O HOH 119 -28.674 59.512 30.810 1.00 49.24 O HETATM11584 O HOH 120 20.672 66.324 -17.804 1.00 57.65 O HETATM11585 O HOH 121 28.326 89.572 -9.023 1.00 61.14 O HETATM11586 O HOH 122 10.583 78.464 -26.737 1.00 57.37 O HETATM11587 O HOH 123 12.806 59.777 -22.347 1.00 53.53 O HETATM11588 O HOH 124 11.812 61.689 -15.233 1.00 57.16 O HETATM11589 O HOH 125 -11.080 64.137 6.882 1.00 29.05 O HETATM11590 O HOH 126 0.098 68.318 2.049 1.00 30.09 O HETATM11591 O HOH 127 -26.023 76.302 15.518 1.00 30.68 O HETATM11592 O HOH 128 -12.792 69.852 2.010 1.00 38.59 O HETATM11593 O HOH 129 -26.775 75.794 -19.977 1.00 35.80 O HETATM11594 O HOH 130 -3.706 84.513 -18.183 1.00 46.75 O HETATM11595 O HOH 131 -23.152 98.397 9.886 1.00 44.57 O HETATM11596 O HOH 132 -26.320 78.429 -21.341 1.00 49.78 O HETATM11597 O HOH 133 -25.472 72.397 9.817 1.00 37.22 O HETATM11598 O HOH 134 -32.074 83.441 -17.892 1.00 57.92 O HETATM11599 O HOH 135 -11.297 86.400 -10.973 1.00 39.75 O HETATM11600 O HOH 136 -34.438 83.382 -6.402 1.00 40.99 O HETATM11601 O HOH 137 -2.965 62.518 3.633 1.00 35.41 O HETATM11602 O HOH 138 -18.956 71.133 -21.818 1.00 39.13 O HETATM11603 O HOH 139 -31.907 71.681 -2.981 1.00 40.04 O HETATM11604 O HOH 140 -4.137 60.356 -5.177 1.00 45.49 O HETATM11605 O HOH 141 -18.505 68.607 -16.903 1.00 40.02 O HETATM11606 O HOH 142 -35.531 90.638 10.297 1.00 41.08 O HETATM11607 O HOH 143 -0.074 67.211 -17.576 1.00 44.00 O HETATM11608 O HOH 144 -5.157 58.448 -3.660 1.00 34.44 O HETATM11609 O HOH 145 -21.285 65.621 -35.119 1.00 36.42 O HETATM11610 O HOH 146 -8.609 69.154 -28.596 1.00 52.59 O HETATM11611 O HOH 147 -11.001 86.820 24.964 1.00 44.40 O HETATM11612 O HOH 148 -12.506 53.616 -12.500 1.00 67.19 O HETATM11613 O HOH 149 -9.784 71.004 -8.681 1.00 28.43 O HETATM11614 O HOH 150 -22.366 66.744 -2.856 1.00 37.96 O HETATM11615 O HOH 151 -31.969 77.240 10.418 1.00 33.63 O HETATM11616 O HOH 152 0.769 65.850 -10.238 1.00 30.26 O HETATM11617 O HOH 153 -9.456 63.027 -1.578 1.00 46.35 O HETATM11618 O HOH 154 -10.330 76.828 -26.492 1.00 42.15 O HETATM11619 O HOH 155 -7.612 62.027 -28.968 1.00 53.99 O HETATM11620 O HOH 156 7.437 83.838 11.286 1.00 48.68 O HETATM11621 O HOH 157 12.599 85.780 -8.574 1.00 55.73 O HETATM11622 O HOH 158 -15.204 57.159 -23.577 1.00 57.89 O HETATM11623 O HOH 159 -2.839 82.179 -24.119 1.00 64.81 O HETATM11624 O HOH 160 -33.118 70.167 -11.508 1.00 47.48 O HETATM11625 O HOH 161 -32.415 85.408 -8.004 1.00 27.75 O HETATM11626 O HOH 162 -25.269 68.130 -0.092 1.00 33.68 O HETATM11627 O HOH 163 -29.405 91.816 15.551 1.00 60.26 O HETATM11628 O HOH 164 -0.589 67.944 -29.649 1.00 67.44 O HETATM11629 O HOH 165 -36.520 84.539 -5.310 1.00 37.13 O HETATM11630 O HOH 166 -8.579 95.541 -2.908 1.00 56.76 O HETATM11631 O HOH 167 3.335 91.046 -13.342 1.00 63.49 O HETATM11632 O HOH 168 -2.474 77.587 -19.214 1.00 45.20 O HETATM11633 O HOH 169 -27.817 96.438 13.097 1.00 60.18 O HETATM11634 O HOH 170 -9.422 103.103 9.669 1.00 52.93 O HETATM11635 O HOH 171 6.022 82.292 13.924 1.00 57.21 O HETATM11636 O HOH 172 -32.663 72.826 -10.629 1.00 50.78 O HETATM11637 O HOH 173 -3.737 79.417 -24.385 1.00 56.46 O HETATM11638 O HOH 174 -11.611 65.906 -1.846 1.00 35.38 O HETATM11639 O HOH 175 -1.827 61.129 1.343 1.00 39.59 O HETATM11640 O HOH 176 -30.221 71.875 12.937 1.00 33.48 O HETATM11641 O HOH 177 -14.764 72.964 -31.402 1.00 54.00 O HETATM11642 O HOH 178 -12.011 62.453 -27.021 1.00 45.98 O HETATM11643 O HOH 179 -32.207 74.377 -6.889 1.00 46.91 O HETATM11644 O HOH 180 6.493 71.045 10.584 1.00 49.60 O HETATM11645 O HOH 181 -19.836 95.629 -0.926 1.00 48.82 O HETATM11646 O HOH 182 -13.791 73.989 -26.670 1.00 46.85 O HETATM11647 O HOH 183 -1.002 67.159 -23.191 1.00 51.23 O HETATM11648 O HOH 184 -7.374 62.037 -8.138 1.00 36.17 O HETATM11649 O HOH 185 -19.927 81.986 19.598 1.00 46.78 O HETATM11650 O HOH 186 2.738 75.824 -11.586 1.00 50.15 O HETATM11651 O HOH 187 -26.128 65.134 -8.841 1.00 45.01 O HETATM11652 O HOH 188 -30.411 68.632 -18.449 1.00 54.03 O HETATM11653 O HOH 189 -33.904 74.627 12.323 1.00 44.17 O HETATM11654 O HOH 190 4.157 66.137 1.388 1.00 36.91 O HETATM11655 O HOH 191 -0.256 63.154 -4.942 1.00 43.61 O HETATM11656 O HOH 192 -28.351 70.299 -4.487 1.00 46.71 O HETATM11657 O HOH 193 -12.210 89.795 -18.343 1.00 49.92 O HETATM11658 O HOH 194 -32.127 78.308 13.452 1.00 40.09 O HETATM11659 O HOH 195 4.831 66.117 -18.243 1.00 44.53 O HETATM11660 O HOH 196 -31.394 88.845 15.242 1.00 50.70 O HETATM11661 O HOH 197 -7.546 65.629 -1.904 1.00 43.78 O HETATM11662 O HOH 198 2.630 81.456 18.281 1.00 54.42 O HETATM11663 O HOH 199 -0.770 60.488 -13.040 1.00 44.79 O HETATM11664 O HOH 200 5.752 86.664 12.495 1.00 53.34 O HETATM11665 O HOH 201 1.012 83.162 -9.572 1.00 46.99 O HETATM11666 O HOH 202 2.842 67.546 -15.689 1.00 44.65 O HETATM11667 O HOH 203 -15.019 81.869 0.551 1.00 44.43 O HETATM11668 O HOH 204 3.645 96.177 -5.784 1.00 53.30 O HETATM11669 O HOH 205 -15.793 88.200 5.545 1.00 50.92 O HETATM11670 O HOH 206 10.516 88.488 -3.107 1.00 57.96 O HETATM11671 O HOH 207 -6.905 80.928 14.610 1.00 49.52 O HETATM11672 O HOH 208 -38.812 88.440 5.124 1.00 49.17 O HETATM11673 O HOH 209 4.952 94.855 9.829 1.00 49.04 O HETATM11674 O HOH 210 -22.536 91.694 14.708 1.00 43.99 O HETATM11675 O HOH 211 0.866 73.960 -10.711 1.00 46.00 O HETATM11676 O HOH 212 -13.098 78.929 -19.955 1.00 42.42 O HETATM11677 O HOH 213 6.066 72.561 -7.572 1.00 46.64 O HETATM11678 O HOH 214 -6.436 87.088 24.630 1.00 53.38 O HETATM11679 O HOH 215 -1.172 73.409 -24.051 1.00 46.77 O HETATM11680 O HOH 216 -22.632 72.201 -24.854 1.00 49.63 O HETATM11681 O HOH 217 5.390 83.723 -12.509 1.00 49.98 O HETATM11682 O HOH 218 3.678 83.482 -18.309 1.00 55.98 O HETATM11683 O HOH 219 -8.209 90.198 -16.050 1.00 49.27 O HETATM11684 O HOH 220 -8.302 84.160 -24.213 1.00 51.60 O HETATM11685 O HOH 221 -29.559 66.333 5.000 1.00 47.87 O HETATM11686 O HOH 222 -2.069 51.167 -7.864 1.00 50.08 O HETATM11687 O HOH 223 2.574 60.260 -5.143 1.00 43.16 O HETATM11688 O HOH 224 -31.125 70.676 -4.990 1.00 46.30 O HETATM11689 O HOH 225 -14.212 59.968 -10.513 1.00 48.09 O HETATM11690 O HOH 226 -8.760 51.325 -2.234 1.00 52.83 O HETATM11691 O HOH 227 8.584 74.579 4.589 1.00 48.71 O HETATM11692 O HOH 228 -10.846 55.877 -6.397 1.00 46.02 O HETATM11693 O HOH 229 -31.605 81.466 20.807 1.00 48.11 O HETATM11694 O HOH 230 -32.313 94.819 6.985 1.00 49.21 O HETATM11695 O HOH 231 -10.261 98.035 -1.600 1.00 47.01 O HETATM11696 O HOH 232 -0.569 89.268 13.329 1.00 57.58 O HETATM11697 O HOH 233 -32.493 70.410 -15.712 1.00 47.23 O HETATM11698 O HOH 234 -6.658 89.686 -12.521 1.00 57.30 O HETATM11699 O HOH 235 -37.298 67.797 0.297 1.00 55.16 O HETATM11700 O HOH 236 -7.229 94.008 -0.724 1.00 53.46 O HETATM11701 O HOH 237 0.747 46.773 0.746 1.00 52.74 O HETATM11702 O HOH 238 7.569 73.159 -0.255 1.00 40.91 O HETATM11703 O HOH 239 -33.028 75.337 -16.968 1.00 52.24 O HETATM11704 O HOH 240 -29.479 65.440 -11.425 1.00 44.15 O HETATM11705 O HOH 241 9.709 84.408 1.864 1.00 38.88 O HETATM11706 O HOH 242 10.755 83.327 6.040 1.00 54.30 O HETATM11707 O HOH 243 -19.473 66.306 0.010 1.00 48.65 O HETATM11708 O HOH 244 -3.279 61.590 -36.503 1.00 50.60 O HETATM11709 O HOH 245 -2.796 74.101 -37.170 1.00 56.63 O HETATM11710 CAA UNN A 246 -21.198 64.594 3.646 1.00 0.06 C HETATM11711 OBG UNN A 246 -21.918 65.814 3.295 1.00 -0.32 O HETATM11712 CBM UNN A 246 -21.355 66.958 3.806 1.00 0.09 C HETATM11713 CAS UNN A 246 -22.072 68.155 3.843 1.00 -0.03 C HETATM11714 CAU UNN A 246 -21.473 69.306 4.389 1.00 -0.04 C HETATM11715 CBP UNN A 246 -20.157 69.280 4.887 1.00 0.10 C HETATM11716 CAT UNN A 246 -19.471 68.078 4.848 1.00 -0.04 C HETATM11717 CAR UNN A 246 -20.059 66.936 4.320 1.00 -0.03 C HETATM11718 H UNN A 246 -19.496 66.003 4.307 1.00 0.05 H HETATM11719 H UNN A 246 -18.454 68.027 5.237 1.00 0.06 H HETATM11720 SBW UNN A 246 -19.226 70.811 5.603 1.00 0.07 S HETATM11721 OAE UNN A 246 -18.230 70.355 6.672 1.00 -0.15 O HETATM11722 OAF UNN A 246 -20.208 71.827 6.226 1.00 -0.15 O HETATM11723 NBU UNN A 246 -18.261 71.696 4.388 1.00 -0.22 N HETATM11724 CBB UNN A 246 -19.136 72.185 3.307 1.00 0.06 C HETATM11725 CBO UNN A 246 -19.615 71.281 2.364 1.00 0.01 C HETATM11726 CAY UNN A 246 -20.784 71.771 1.768 1.00 -0.04 C HETATM11727 CBJ UNN A 246 -21.436 71.049 0.769 1.00 0.07 C HETATM11728 CAG UNN A 246 -22.632 71.622 0.193 1.00 0.08 C HETATM11729 NAC UNN A 246 -23.449 72.067 -0.169 1.00 -0.34 N HETATM11730 CAM UNN A 246 -20.900 69.842 0.319 1.00 -0.04 C HETATM11731 CAV UNN A 246 -19.751 69.348 0.918 1.00 -0.04 C HETATM11732 CBR UNN A 246 -19.090 70.049 1.965 1.00 0.06 C HETATM11733 NBT UNN A 246 -17.911 69.511 2.405 1.00 -0.29 N HETATM11734 CBC UNN A 246 -17.590 68.086 2.267 1.00 0.08 C HETATM11735 CBQ UNN A 246 -16.789 67.965 0.926 1.00 0.08 C HETATM11736 CAW UNN A 246 -16.421 68.971 0.106 1.00 -0.03 C HETATM11737 NBE UNN A 246 -15.735 68.446 -0.914 1.00 -0.34 N HETATM11738 CAX UNN A 246 -15.682 67.139 -0.734 1.00 0.09 C HETATM11739 NBV UNN A 246 -16.334 66.827 0.412 1.00 -0.25 N HETATM11740 CAB UNN A 246 -16.464 65.429 0.925 1.00 0.05 C HETATM11741 H UNN A 246 -16.003 65.361 1.910 1.00 0.06 H HETATM11742 H UNN A 246 -17.520 65.167 0.997 1.00 0.06 H HETATM11743 H UNN A 246 -15.964 64.744 0.240 1.00 0.06 H HETATM11744 H UNN A 246 -15.193 66.427 -1.399 1.00 0.12 H HETATM11745 H UNN A 246 -16.644 70.028 0.250 1.00 0.03 H HETATM11746 H UNN A 246 -18.491 67.473 2.250 1.00 0.07 H HETATM11747 H UNN A 246 -17.007 67.724 3.114 1.00 0.07 H HETATM11748 CBD UNN A 246 -16.769 70.347 2.772 1.00 0.05 C HETATM11749 CBS UNN A 246 -16.902 71.162 4.069 1.00 0.07 C HETATM11750 CBA UNN A 246 -15.792 72.237 3.954 1.00 -0.00 C HETATM11751 CBL UNN A 246 -15.953 73.234 4.906 1.00 -0.05 C HETATM11752 CAO UNN A 246 -16.718 74.364 4.595 1.00 -0.07 C HETATM11753 CAQ UNN A 246 -16.886 75.375 5.535 1.00 -0.03 C HETATM11754 CBN UNN A 246 -16.269 75.261 6.795 1.00 0.12 C HETATM11755 CAP UNN A 246 -15.500 74.130 7.117 1.00 -0.03 C HETATM11756 CAN UNN A 246 -15.335 73.125 6.160 1.00 -0.07 C HETATM11757 H UNN A 246 -14.723 72.252 6.389 1.00 0.05 H HETATM11758 H UNN A 246 -15.038 74.038 8.100 1.00 0.05 H HETATM11759 OBH UNN A 246 -16.471 76.256 7.719 1.00 -0.20 O HETATM11760 CBI UNN A 246 -17.426 75.762 8.604 1.00 0.34 C HETATM11761 OAD UNN A 246 -17.277 75.940 9.820 1.00 -0.37 O HETATM11762 NBF UNN A 246 -18.511 75.075 8.140 1.00 -0.25 N HETATM11763 CAZ UNN A 246 -19.516 74.467 8.976 1.00 0.07 C HETATM11764 CBK UNN A 246 -20.279 75.417 9.628 1.00 -0.02 C HETATM11765 CAK UNN A 246 -20.370 75.418 11.012 1.00 -0.06 C HETATM11766 CAI UNN A 246 -21.175 76.352 11.647 1.00 -0.07 C HETATM11767 CAH UNN A 246 -21.894 77.285 10.909 1.00 -0.07 C HETATM11768 CAJ UNN A 246 -21.808 77.285 9.528 1.00 -0.07 C HETATM11769 CAL UNN A 246 -20.999 76.341 8.899 1.00 -0.06 C HETATM11770 H UNN A 246 -20.934 76.332 7.811 1.00 0.06 H HETATM11771 H UNN A 246 -22.366 78.014 8.940 1.00 0.06 H HETATM11772 H UNN A 246 -22.524 78.015 11.417 1.00 0.06 H HETATM11773 H UNN A 246 -21.244 76.354 12.735 1.00 0.06 H HETATM11774 H UNN A 246 -19.811 74.688 11.598 1.00 0.06 H HETATM11775 H UNN A 246 -19.015 73.854 9.726 1.00 0.07 H HETATM11776 H UNN A 246 -20.175 73.871 8.344 1.00 0.07 H HETATM11777 H UNN A 246 -18.618 74.986 7.130 1.00 0.19 H HETATM11778 H UNN A 246 -17.491 76.250 5.298 1.00 0.05 H HETATM11779 H UNN A 246 -17.183 74.452 3.613 1.00 0.05 H HETATM11780 H UNN A 246 -15.850 72.690 2.964 1.00 0.04 H HETATM11781 H UNN A 246 -14.827 71.757 4.115 1.00 0.04 H HETATM11782 H UNN A 246 -16.771 70.519 4.939 1.00 0.06 H HETATM11783 H UNN A 246 -16.658 71.075 1.969 1.00 0.05 H HETATM11784 H UNN A 246 -15.934 69.664 2.929 1.00 0.05 H HETATM11785 H UNN A 246 -19.343 68.396 0.577 1.00 0.05 H HETATM11786 H UNN A 246 -21.378 69.294 -0.493 1.00 0.06 H HETATM11787 H UNN A 246 -21.190 72.730 2.090 1.00 0.06 H HETATM11788 H UNN A 246 -18.518 72.881 2.740 1.00 0.06 H HETATM11789 H UNN A 246 -20.026 72.559 3.814 1.00 0.06 H HETATM11790 H UNN A 246 -22.040 70.236 4.427 1.00 0.06 H HETATM11791 H UNN A 246 -23.088 68.198 3.452 1.00 0.05 H HETATM11792 H UNN A 246 -20.179 64.652 3.263 1.00 0.06 H HETATM11793 H UNN A 246 -21.175 64.487 4.731 1.00 0.06 H HETATM11794 H UNN A 246 -21.704 63.735 3.205 1.00 0.06 H CONECT 1 2 20 21 22 CONECT 20 1 CONECT 21 1 CONECT 22 1 CONECT 5244 5245 5252 5253 5254 CONECT 5252 5244 CONECT 5253 5244 CONECT 5254 5244 CONECT 9546 954511465 CONECT 9547 954511465 CONECT 9564 9563 956811465 CONECT10547105451054611465 CONECT11465 9546 9547 956410547 CONECT1171011711117921179311794 CONECT117111171011712 CONECT11712117111171311717 CONECT11713117121171411791 CONECT11714117131171511790 CONECT11715117141171611720 CONECT11716117151171711719 CONECT11717117121171611718 CONECT1171811717 CONECT1171911716 CONECT1172011715117211172211723 CONECT1172111720 CONECT1172211720 CONECT11723117201172411749 CONECT1172411723117251178811789 CONECT11725117241172611732 CONECT11726117251172711787 CONECT11727117261172811730 CONECT117281172711729 CONECT1172911728 CONECT11730117271173111786 CONECT11731117301173211785 CONECT11732117251173111733 CONECT11733117321173411748 CONECT1173411733117351174611747 CONECT11735117341173611739 CONECT11736117351173711745 CONECT117371173611738 CONECT11738117371173911744 CONECT11739117351173811740 CONECT1174011739117411174211743 CONECT1174111740 CONECT1174211740 CONECT1174311740 CONECT1174411738 CONECT1174511736 CONECT1174611734 CONECT1174711734 CONECT1174811733117491178311784 CONECT1174911723117481175011782 CONECT1175011749117511178011781 CONECT11751117501175211756 CONECT11752117511175311779 CONECT11753117521175411778 CONECT11754117531175511759 CONECT11755117541175611758 CONECT11756117511175511757 CONECT1175711756 CONECT1175811755 CONECT117591175411760 CONECT11760117591176111762 CONECT1176111760 CONECT11762117601176311777 CONECT1176311762117641177511776 CONECT11764117631176511769 CONECT11765117641176611774 CONECT11766117651176711773 CONECT11767117661176811772 CONECT11768117671176911771 CONECT11769117641176811770 CONECT1177011769 CONECT1177111768 CONECT1177211767 CONECT1177311766 CONECT1177411765 CONECT1177511763 CONECT1177611763 CONECT1177711762 CONECT1177811753 CONECT1177911752 CONECT1178011750 CONECT1178111750 CONECT1178211749 CONECT1178311748 CONECT1178411748 CONECT1178511731 CONECT1178611730 CONECT1178711726 CONECT1178811724 CONECT1178911724 CONECT1179011714 CONECT1179111713 CONECT1179211710 CONECT1179311710 CONECT1179411710 MASTER 0 0 0 0 0 0 0 011792 2 98 57 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 4gtq
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1fpp
RCSB PDB
PDBbind
377aa, >1FPP_2|Chain... at 92%
1ld7
RCSB PDB
PDBbind
382aa, >1LD7_1|Chain... *
1ld8
RCSB PDB
PDBbind
382aa, >1LD8_1|Chain... at 100%
1mzc
RCSB PDB
PDBbind
382aa, >1MZC_1|Chain... at 100%
1n94
RCSB PDB
PDBbind
315aa, >1N94_1|Chain... at 95%
1n95
RCSB PDB
PDBbind
315aa, >1N95_1|Chain... at 96%
1n9a
RCSB PDB
PDBbind
315aa, >1N9A_1|Chain... at 96%
1ni1
RCSB PDB
PDBbind
315aa, >1NI1_1|Chain... at 96%
1nl4
RCSB PDB
PDBbind
312aa, >1NL4_1|Chain... at 96%
1o1s
RCSB PDB
PDBbind
380aa, >1O1S_1|Chain... at 92%
1o5m
RCSB PDB
PDBbind
377aa, >1O5M_1|Chain... at 93%
1qbq
RCSB PDB
PDBbind
333aa, >1QBQ_1|Chain... at 94%
1s63
RCSB PDB
PDBbind
382aa, >1S63_1|Chain... at 100%
1x81
RCSB PDB
PDBbind
315aa, >1X81_1|Chain... at 95%
2bed
RCSB PDB
PDBbind
313aa, >2BED_1|Chain... at 96%
2r2l
RCSB PDB
PDBbind
315aa, >2R2L_1|Chain... at 96%
2zir
RCSB PDB
PDBbind
377aa, >2ZIR_1|Chain... at 93%
2zis
RCSB PDB
PDBbind
377aa, >2ZIS_1|Chain... at 93%
3e37
RCSB PDB
PDBbind
379aa, >3E37_1|Chain... at 100%
3eu5
RCSB PDB
PDBbind
377aa, >3EU5_1|Chain... at 92%
3ksl
RCSB PDB
PDBbind
377aa, >3KSL_1|Chain... at 93%
3ksq
RCSB PDB
PDBbind
377aa, >3KSQ_1|Chain... at 93%
3pz4
RCSB PDB
PDBbind
379aa, >3PZ4_1|Chain... at 92%
4gtm
RCSB PDB
PDBbind
377aa, >4GTM_1|Chain... at 92%
4gto
RCSB PDB
PDBbind
377aa, >4GTO_1|Chain... at 92%
4gtp
RCSB PDB
PDBbind
377aa, >4GTP_1|Chain... at 92%
4gtr
RCSB PDB
PDBbind
377aa, >4GTR_1|Chain... at 92%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
4gtt
RCSB PDB
PDBbind
7TQ
Entry Information
PDB ID
4gtq
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha; Protein farnesyltransferase subunit beta
Ligand Name
7TQ
EC.Number
E.C.2.5.1.58; E.C.2.5.1.59
Resolution
2.6(Å)
Affinity (Kd/Ki/IC50)
IC50<5nM
Release Year
2012
Protein/NA Sequence
Check fasta file
Primary Reference
(2012) J.Med.Chem. Vol. 55: pp. 8330-8340
Ligand Properties
Formula
C
3
7
H
3
6
N
6
O
5
S
Molecular Weight
676.784
Exact Mass
676.247
No. of atoms
85
No. of bonds
90
Polar Surface Area
138.17
LOGP Value
4.87 (
Computed with XLOGP3
)
6.89 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 5
No. of Rotatable Bonds: 12
No. of Nitrogen and Oxygen Atoms: 11
No. of Rings: 6
Canonical SMILES
COc1ccc(cc1)S(=O)(=O)N1Cc2cc(C#N)ccc2N(C[C@H]1Cc1ccc(cc1)OC(=O)NCc1ccccc1)Cc1cncn1C
InChI String
InChI=1S/C37H36N6O5S/c1-41-26-39-22-32(41)25-42-24-31(19-27-8-11-34(12-9-27)48-37(44)40-21-28-6-4-3-5-7-28)43(23-30-18-29(20-38)10-17-36(30)42)49(45,46)35-15-13-33(47-2)14-16-35/h3-18,22,26,31H,19,21,23-25H2,1-2H3,(H,40,44)/t31-/m1/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
Q02293
Q04631
Entrez Gene ID
NCBI Entrez Gene ID:
64511
25318
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com