Browse entries in the PDBbind-CN Database
HEADER 5UFP_COMPLEX COMPND 5UFP_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 91 LEU ASP SER LYS THR PHE LEU SER GLU HIS SER MET ASP SEQRES 2 A 91 MET LYS PHE THR TYR CYS ASP ASP ARG ILE THR GLU LEU SEQRES 3 A 91 ILE GLY TYR HIS PRO GLU GLU LEU LEU GLY ARG SER ALA SEQRES 4 A 91 TYR GLU PHE TYR HIS ALA LEU ASP SER GLU ASN MET THR SEQRES 5 A 91 LYS SER HIS GLN ASN LEU CYS THR LYS GLY GLN VAL VAL SEQRES 6 A 91 SER GLY GLN TYR ARG MET LEU ALA LYS HIS GLY GLY TYR SEQRES 7 A 91 VAL TRP LEU GLU THR GLN GLY THR VAL ILE TYR ASN PRO SEQRES 1 A 13 PRO GLN CYS ILE MET CYS VAL ASN TYR VAL LEU SER GLU SEQRES 1 B 110 CYS GLN PRO THR ARG PHE ILE SER ARG HIS ASN ILE GLU SEQRES 2 B 110 GLY ILE PHE THR PHE VAL ASP HIS ARG CYS VAL ALA THR SEQRES 3 B 110 VAL GLY TYR GLN PRO GLN GLU LEU LEU GLY LYS ASN ILE SEQRES 4 B 110 VAL GLU PHE CYS HIS PRO GLU ASP GLN GLN LEU LEU ARG SEQRES 5 B 110 ASP SER PHE GLN GLN VAL VAL LYS LEU LYS GLY GLN VAL SEQRES 6 B 110 LEU SER VAL MET PHE ARG PHE ARG SER LYS ASN GLN GLU SEQRES 7 B 110 TRP LEU TRP MET ARG THR SER SER PHE THR PHE GLN ASN SEQRES 8 B 110 PRO TYR SER ASP GLU ILE GLU TYR ILE ILE CYS THR ASN SEQRES 9 B 110 THR ASN VAL LYS ASN SER HET UNN A 275 38 ATOM 1 N LEU A 239 15.541 -15.786 -2.043 1.00 62.51 N ATOM 2 CA LEU A 239 16.956 -15.421 -2.401 1.00 59.80 C ATOM 3 C LEU A 239 17.120 -15.380 -3.908 1.00 53.18 C ATOM 4 O LEU A 239 17.328 -14.330 -4.534 1.00 49.18 O ATOM 5 CB LEU A 239 17.948 -16.458 -1.880 1.00 67.06 C ATOM 6 CG LEU A 239 18.439 -16.487 -0.437 1.00 67.02 C ATOM 7 CD1 LEU A 239 19.425 -17.646 -0.337 1.00 80.05 C ATOM 8 CD2 LEU A 239 19.098 -15.191 -0.017 1.00 57.73 C ATOM 9 HN3 LEU A 239 15.316 -16.722 -2.436 1.00 0.00 H ATOM 10 HN2 LEU A 239 14.891 -15.077 -2.438 1.00 0.00 H ATOM 11 HN1 LEU A 239 15.442 -15.811 -1.008 1.00 0.00 H ATOM 12 N ASP A 240 17.024 -16.556 -4.472 1.00 42.00 N ATOM 13 CA ASP A 240 17.113 -16.736 -5.872 1.00 48.47 C ATOM 14 C ASP A 240 15.983 -16.003 -6.646 1.00 43.88 C ATOM 15 O ASP A 240 16.207 -15.372 -7.693 1.00 39.53 O ATOM 16 CB ASP A 240 17.096 -18.223 -6.153 1.00 48.63 C ATOM 17 CG ASP A 240 17.380 -18.513 -7.575 1.00 54.44 C ATOM 18 OD1 ASP A 240 18.517 -18.946 -7.860 1.00 67.32 O ATOM 19 OD2 ASP A 240 16.495 -18.252 -8.420 1.00 51.85 O ATOM 20 H ASP A 240 16.877 -17.390 -3.868 1.00 0.00 H ATOM 21 N SER A 241 14.763 -16.054 -6.141 1.00 40.72 N ATOM 22 CA SER A 241 13.703 -15.381 -6.854 1.00 35.30 C ATOM 23 C SER A 241 13.757 -13.867 -6.518 1.00 33.91 C ATOM 24 O SER A 241 13.004 -13.091 -7.063 1.00 35.37 O ATOM 25 CB SER A 241 12.378 -16.001 -6.478 1.00 42.65 C ATOM 26 OG SER A 241 12.027 -15.433 -5.255 1.00 47.21 O ATOM 27 HG SER A 241 11.948 -14.452 -5.359 1.00 0.00 H ATOM 28 H SER A 241 14.572 -16.564 -5.255 1.00 0.00 H ATOM 29 N LYS A 242 14.672 -13.442 -5.636 1.00 26.09 N ATOM 30 CA LYS A 242 14.860 -11.995 -5.449 1.00 30.90 C ATOM 31 C LYS A 242 16.152 -11.454 -6.125 1.00 28.82 C ATOM 32 O LYS A 242 16.624 -10.342 -5.839 1.00 26.83 O ATOM 33 CB LYS A 242 14.841 -11.659 -3.945 1.00 37.06 C ATOM 34 CG LYS A 242 13.598 -12.206 -3.263 1.00 40.47 C ATOM 35 CD LYS A 242 13.528 -11.649 -1.872 1.00 43.51 C ATOM 36 CE LYS A 242 14.370 -12.471 -0.919 1.00 49.12 C ATOM 37 NZ LYS A 242 14.588 -11.632 0.294 1.00 58.52 N ATOM 38 HZ1 LYS A 242 15.081 -10.757 0.025 1.00 0.00 H ATOM 39 HZ2 LYS A 242 13.669 -11.396 0.721 1.00 0.00 H ATOM 40 HZ3 LYS A 242 15.165 -12.160 0.980 1.00 0.00 H ATOM 41 H LYS A 242 15.240 -14.124 -5.093 1.00 0.00 H ATOM 42 N THR A 243 16.729 -12.259 -7.028 1.00 29.23 N ATOM 43 CA THR A 243 18.008 -11.924 -7.584 1.00 28.45 C ATOM 44 C THR A 243 17.799 -11.816 -9.080 1.00 28.70 C ATOM 45 O THR A 243 17.082 -12.621 -9.672 1.00 29.71 O ATOM 46 CB THR A 243 19.117 -12.976 -7.225 1.00 30.28 C ATOM 47 OG1 THR A 243 19.213 -13.128 -5.798 1.00 29.51 O ATOM 48 CG2 THR A 243 20.476 -12.544 -7.751 1.00 27.93 C ATOM 49 HG1 THR A 243 18.343 -13.438 -5.441 1.00 0.00 H ATOM 50 H THR A 243 16.247 -13.131 -7.327 1.00 0.00 H ATOM 51 N PHE A 244 18.334 -10.742 -9.669 1.00 27.59 N ATOM 52 CA PHE A 244 18.240 -10.558 -11.115 1.00 26.79 C ATOM 53 C PHE A 244 19.486 -9.912 -11.642 1.00 24.36 C ATOM 54 O PHE A 244 20.123 -9.174 -10.937 1.00 24.10 O ATOM 55 CB PHE A 244 16.978 -9.740 -11.534 1.00 26.05 C ATOM 56 CG PHE A 244 16.960 -8.330 -11.035 1.00 26.36 C ATOM 57 CD1 PHE A 244 17.325 -7.281 -11.882 1.00 25.71 C ATOM 58 CD2 PHE A 244 16.573 -8.029 -9.708 1.00 26.66 C ATOM 59 CE1 PHE A 244 17.374 -5.986 -11.408 1.00 25.42 C ATOM 60 CE2 PHE A 244 16.578 -6.723 -9.248 1.00 24.67 C ATOM 61 CZ PHE A 244 16.985 -5.703 -10.087 1.00 28.35 C ATOM 62 H PHE A 244 18.823 -10.029 -9.091 1.00 0.00 H ATOM 63 N LEU A 245 19.810 -10.189 -12.922 1.00 25.25 N ATOM 64 CA LEU A 245 20.955 -9.510 -13.562 1.00 24.04 C ATOM 65 C LEU A 245 20.566 -8.289 -14.402 1.00 22.54 C ATOM 66 O LEU A 245 19.463 -8.227 -15.011 1.00 22.08 O ATOM 67 CB LEU A 245 21.670 -10.519 -14.489 1.00 26.16 C ATOM 68 CG LEU A 245 21.921 -11.963 -14.026 1.00 31.58 C ATOM 69 CD1 LEU A 245 22.793 -12.693 -15.043 1.00 27.49 C ATOM 70 CD2 LEU A 245 22.497 -12.074 -12.624 1.00 30.42 C ATOM 71 H LEU A 245 19.252 -10.883 -13.460 1.00 0.00 H ATOM 72 N SER A 246 21.432 -7.312 -14.449 1.00 19.30 N ATOM 73 CA SER A 246 21.389 -6.247 -15.422 1.00 20.11 C ATOM 74 C SER A 246 22.777 -6.006 -15.995 1.00 25.60 C ATOM 75 O SER A 246 23.762 -6.396 -15.350 1.00 23.89 O ATOM 76 CB SER A 246 20.879 -4.953 -14.808 1.00 20.62 C ATOM 77 OG SER A 246 21.620 -4.566 -13.671 1.00 24.65 O ATOM 78 HG SER A 246 22.567 -4.431 -13.926 1.00 0.00 H ATOM 79 H SER A 246 22.197 -7.301 -13.744 1.00 0.00 H ATOM 80 N GLU A 247 22.845 -5.347 -17.141 1.00 24.10 N ATOM 81 CA GLU A 247 24.125 -5.078 -17.813 1.00 23.00 C ATOM 82 C GLU A 247 24.058 -3.630 -18.141 1.00 24.38 C ATOM 83 O GLU A 247 22.983 -3.092 -18.422 1.00 22.68 O ATOM 84 CB GLU A 247 24.206 -5.901 -19.124 1.00 25.11 C ATOM 85 CG GLU A 247 25.489 -5.781 -19.968 1.00 30.44 C ATOM 86 CD GLU A 247 25.221 -6.389 -21.362 1.00 37.76 C ATOM 87 OE1 GLU A 247 25.584 -7.555 -21.556 1.00 33.26 O ATOM 88 OE2 GLU A 247 24.510 -5.776 -22.217 1.00 34.76 O ATOM 89 H GLU A 247 21.965 -5.009 -17.580 1.00 0.00 H ATOM 90 N HIS A 248 25.186 -2.946 -18.037 1.00 20.34 N ATOM 91 CA HIS A 248 25.215 -1.550 -18.205 1.00 22.37 C ATOM 92 C HIS A 248 26.377 -1.184 -19.060 1.00 29.06 C ATOM 93 O HIS A 248 27.420 -1.817 -18.917 1.00 25.20 O ATOM 94 CB HIS A 248 25.375 -0.857 -16.826 1.00 24.41 C ATOM 95 CG HIS A 248 24.215 -1.121 -15.918 1.00 26.47 C ATOM 96 ND1 HIS A 248 23.235 -0.194 -15.685 1.00 23.94 N ATOM 97 CD2 HIS A 248 23.811 -2.291 -15.275 1.00 26.90 C ATOM 98 CE1 HIS A 248 22.291 -0.755 -14.867 1.00 21.61 C ATOM 99 NE2 HIS A 248 22.598 -2.035 -14.694 1.00 25.01 N ATOM 100 H HIS A 248 26.070 -3.452 -17.827 1.00 0.00 H ATOM 101 N SER A 249 26.221 -0.133 -19.891 1.00 29.94 N ATOM 102 CA SER A 249 27.398 0.539 -20.521 1.00 32.69 C ATOM 103 C SER A 249 28.214 1.319 -19.468 1.00 34.09 C ATOM 104 O SER A 249 27.804 1.454 -18.271 1.00 33.38 O ATOM 105 CB SER A 249 26.976 1.436 -21.690 1.00 31.63 C ATOM 106 OG SER A 249 25.680 2.001 -21.407 1.00 35.74 O ATOM 107 HG SER A 249 25.729 2.537 -20.576 1.00 0.00 H ATOM 108 H SER A 249 25.263 0.216 -20.097 1.00 0.00 H ATOM 109 N MET A 250 29.413 1.765 -19.874 1.00 36.74 N ATOM 110 CA MET A 250 30.311 2.438 -18.943 1.00 36.42 C ATOM 111 C MET A 250 29.699 3.735 -18.392 1.00 40.35 C ATOM 112 O MET A 250 29.970 4.133 -17.238 1.00 39.35 O ATOM 113 CB MET A 250 31.660 2.686 -19.614 1.00 38.24 C ATOM 114 CG MET A 250 32.482 1.415 -19.746 1.00 39.90 C ATOM 115 SD MET A 250 32.287 0.205 -18.386 1.00 44.45 S ATOM 116 CE MET A 250 33.102 0.909 -16.965 1.00 35.21 C ATOM 117 H MET A 250 29.705 1.629 -20.863 1.00 0.00 H ATOM 118 N ASP A 251 28.772 4.316 -19.160 1.00 43.10 N ATOM 119 CA ASP A 251 28.006 5.476 -18.659 1.00 43.46 C ATOM 120 C ASP A 251 26.885 5.109 -17.683 1.00 47.36 C ATOM 121 O ASP A 251 26.043 5.957 -17.394 1.00 32.57 O ATOM 122 CB ASP A 251 27.449 6.312 -19.833 1.00 45.84 C ATOM 123 CG ASP A 251 26.556 5.494 -20.742 1.00 51.57 C ATOM 124 OD1 ASP A 251 26.206 4.349 -20.339 1.00 42.78 O ATOM 125 OD2 ASP A 251 26.239 5.969 -21.865 1.00 49.31 O ATOM 126 H ASP A 251 28.589 3.949 -20.116 1.00 0.00 H ATOM 127 N MET A 252 26.870 3.867 -17.158 1.00 40.58 N ATOM 128 CA MET A 252 25.772 3.394 -16.245 1.00 40.96 C ATOM 129 C MET A 252 24.416 3.154 -16.933 1.00 30.56 C ATOM 130 O MET A 252 23.416 2.841 -16.270 1.00 28.16 O ATOM 131 CB MET A 252 25.503 4.357 -15.073 1.00 45.15 C ATOM 132 CG MET A 252 26.667 4.736 -14.175 1.00 54.85 C ATOM 133 SD MET A 252 25.977 5.709 -12.785 1.00 74.09 S ATOM 134 CE MET A 252 27.455 6.139 -11.838 1.00 74.40 C ATOM 135 H MET A 252 27.644 3.214 -17.392 1.00 0.00 H ATOM 136 N LYS A 253 24.306 3.411 -18.227 1.00 29.42 N ATOM 137 CA LYS A 253 23.007 3.118 -18.861 1.00 29.76 C ATOM 138 C LYS A 253 22.704 1.585 -18.886 1.00 31.73 C ATOM 139 O LYS A 253 23.609 0.793 -19.161 1.00 27.69 O ATOM 140 CB LYS A 253 22.973 3.632 -20.299 1.00 35.59 C ATOM 141 CG LYS A 253 22.642 5.118 -20.466 1.00 37.62 C ATOM 142 CD LYS A 253 22.979 5.645 -21.859 1.00 38.10 C ATOM 143 CE LYS A 253 22.560 7.117 -22.034 1.00 38.49 C ATOM 144 NZ LYS A 253 22.311 7.286 -23.509 1.00 42.03 N ATOM 145 HZ1 LYS A 253 23.183 7.072 -24.033 1.00 0.00 H ATOM 146 HZ2 LYS A 253 21.557 6.636 -23.809 1.00 0.00 H ATOM 147 HZ3 LYS A 253 22.022 8.266 -23.700 1.00 0.00 H ATOM 148 H LYS A 253 25.100 3.802 -18.772 1.00 0.00 H ATOM 149 N PHE A 254 21.439 1.178 -18.644 1.00 26.31 N ATOM 150 CA PHE A 254 20.995 -0.188 -18.908 1.00 26.03 C ATOM 151 C PHE A 254 21.143 -0.546 -20.408 1.00 26.10 C ATOM 152 O PHE A 254 20.642 0.177 -21.259 1.00 26.85 O ATOM 153 CB PHE A 254 19.496 -0.377 -18.534 1.00 28.13 C ATOM 154 CG PHE A 254 19.203 -0.441 -17.022 1.00 27.51 C ATOM 155 CD1 PHE A 254 19.140 -1.697 -16.351 1.00 26.38 C ATOM 156 CD2 PHE A 254 18.978 0.736 -16.274 1.00 26.39 C ATOM 157 CE1 PHE A 254 18.840 -1.732 -14.970 1.00 26.30 C ATOM 158 CE2 PHE A 254 18.703 0.694 -14.896 1.00 24.29 C ATOM 159 CZ PHE A 254 18.613 -0.540 -14.257 1.00 25.06 C ATOM 160 H PHE A 254 20.757 1.861 -18.256 1.00 0.00 H ATOM 161 N THR A 255 21.665 -1.737 -20.695 1.00 23.98 N ATOM 162 CA THR A 255 21.724 -2.309 -22.023 1.00 24.55 C ATOM 163 C THR A 255 21.054 -3.650 -22.020 1.00 25.32 C ATOM 164 O THR A 255 20.770 -4.249 -23.040 1.00 27.93 O ATOM 165 CB THR A 255 23.216 -2.376 -22.486 1.00 28.20 C ATOM 166 OG1 THR A 255 23.979 -3.028 -21.482 1.00 25.38 O ATOM 167 CG2 THR A 255 23.780 -0.933 -22.584 1.00 24.43 C ATOM 168 HG1 THR A 255 23.629 -3.944 -21.345 1.00 0.00 H ATOM 169 H THR A 255 22.058 -2.295 -19.910 1.00 0.00 H ATOM 170 N TYR A 256 20.707 -4.136 -20.836 1.00 27.34 N ATOM 171 CA TYR A 256 19.995 -5.396 -20.692 1.00 24.00 C ATOM 172 C TYR A 256 19.435 -5.609 -19.288 1.00 25.59 C ATOM 173 O TYR A 256 20.079 -5.260 -18.305 1.00 28.69 O ATOM 174 CB TYR A 256 20.871 -6.643 -21.055 1.00 25.21 C ATOM 175 CG TYR A 256 20.298 -7.968 -20.539 1.00 30.10 C ATOM 176 CD1 TYR A 256 20.596 -8.431 -19.238 1.00 30.60 C ATOM 177 CD2 TYR A 256 19.488 -8.731 -21.326 1.00 29.95 C ATOM 178 CE1 TYR A 256 20.079 -9.608 -18.750 1.00 32.51 C ATOM 179 CE2 TYR A 256 18.961 -9.893 -20.855 1.00 31.24 C ATOM 180 CZ TYR A 256 19.273 -10.336 -19.582 1.00 36.24 C ATOM 181 OH TYR A 256 18.731 -11.491 -19.135 1.00 29.76 O ATOM 182 HH TYR A 256 17.744 -11.413 -19.135 1.00 0.00 H ATOM 183 H TYR A 256 20.952 -3.598 -19.981 1.00 0.00 H ATOM 184 N CYS A 257 18.254 -6.189 -19.152 1.00 23.28 N ATOM 185 CA CYS A 257 17.834 -6.550 -17.784 1.00 24.75 C ATOM 186 C CYS A 257 17.048 -7.882 -17.714 1.00 27.96 C ATOM 187 O CYS A 257 16.174 -8.092 -18.578 1.00 32.60 O ATOM 188 CB CYS A 257 17.125 -5.359 -17.131 1.00 23.14 C ATOM 189 SG CYS A 257 16.766 -5.543 -15.368 1.00 28.42 S ATOM 190 H CYS A 257 17.647 -6.382 -19.974 1.00 0.00 H ATOM 191 N ASP A 258 17.277 -8.760 -16.702 1.00 25.42 N ATOM 192 CA ASP A 258 16.401 -9.959 -16.532 1.00 25.52 C ATOM 193 C ASP A 258 14.965 -9.510 -16.409 1.00 28.86 C ATOM 194 O ASP A 258 14.696 -8.465 -15.821 1.00 28.41 O ATOM 195 CB ASP A 258 16.644 -10.800 -15.262 1.00 33.19 C ATOM 196 CG ASP A 258 17.932 -11.598 -15.296 1.00 29.32 C ATOM 197 OD1 ASP A 258 18.597 -11.699 -16.361 1.00 32.30 O ATOM 198 OD2 ASP A 258 18.276 -12.133 -14.247 1.00 32.82 O ATOM 199 H ASP A 258 18.065 -8.597 -16.043 1.00 0.00 H ATOM 200 N ASP A 259 14.048 -10.334 -16.888 1.00 29.20 N ATOM 201 CA ASP A 259 12.580 -10.044 -16.762 1.00 37.25 C ATOM 202 C ASP A 259 12.125 -10.122 -15.304 1.00 37.36 C ATOM 203 O ASP A 259 11.187 -9.434 -14.898 1.00 39.40 O ATOM 204 CB ASP A 259 11.745 -11.039 -17.593 1.00 33.54 C ATOM 205 CG ASP A 259 11.956 -10.877 -19.111 1.00 38.04 C ATOM 206 OD1 ASP A 259 12.221 -9.753 -19.585 1.00 44.94 O ATOM 207 OD2 ASP A 259 11.873 -11.898 -19.837 1.00 46.60 O ATOM 208 H ASP A 259 14.352 -11.207 -17.365 1.00 0.00 H ATOM 209 N ARG A 260 12.834 -10.921 -14.512 1.00 34.35 N ATOM 210 CA ARG A 260 12.540 -11.057 -13.081 1.00 34.42 C ATOM 211 C ARG A 260 12.401 -9.700 -12.342 1.00 30.73 C ATOM 212 O ARG A 260 11.817 -9.667 -11.230 1.00 33.08 O ATOM 213 CB ARG A 260 13.630 -11.911 -12.419 1.00 36.25 C ATOM 214 CG ARG A 260 13.314 -12.333 -10.995 1.00 42.31 C ATOM 215 CD ARG A 260 13.000 -13.804 -10.911 1.00 53.84 C ATOM 216 NE ARG A 260 14.192 -14.627 -10.804 1.00 52.58 N ATOM 217 CZ ARG A 260 14.175 -15.957 -10.899 1.00 63.46 C ATOM 218 NH1 ARG A 260 13.030 -16.595 -11.132 1.00 61.18 N ATOM 219 NH2 ARG A 260 15.303 -16.654 -10.778 1.00 70.55 N ATOM 220 HE ARG A 260 15.105 -14.155 -10.645 1.00 0.00 H ATOM 221 HH12 ARG A 260 13.018 -17.632 -11.206 1.00 0.00 H ATOM 222 HH11 ARG A 260 12.147 -16.056 -11.240 1.00 0.00 H ATOM 223 HH22 ARG A 260 15.284 -17.691 -10.853 1.00 0.00 H ATOM 224 HH21 ARG A 260 16.203 -16.161 -10.609 1.00 0.00 H ATOM 225 H ARG A 260 13.621 -11.466 -14.919 1.00 0.00 H ATOM 226 N ILE A 261 12.933 -8.600 -12.920 1.00 26.69 N ATOM 227 CA ILE A 261 12.836 -7.300 -12.290 1.00 27.23 C ATOM 228 C ILE A 261 11.360 -6.867 -12.289 1.00 31.20 C ATOM 229 O ILE A 261 10.931 -6.017 -11.458 1.00 31.08 O ATOM 230 CB ILE A 261 13.705 -6.203 -12.958 1.00 26.58 C ATOM 231 CG1 ILE A 261 13.874 -5.034 -12.019 1.00 25.47 C ATOM 232 CG2 ILE A 261 13.220 -5.780 -14.341 1.00 22.03 C ATOM 233 CD1 ILE A 261 14.774 -3.919 -12.589 1.00 26.46 C ATOM 234 H ILE A 261 13.421 -8.689 -13.834 1.00 0.00 H ATOM 235 N THR A 262 10.597 -7.464 -13.199 1.00 33.08 N ATOM 236 CA THR A 262 9.132 -7.141 -13.320 1.00 38.52 C ATOM 237 C THR A 262 8.323 -7.621 -12.079 1.00 40.49 C ATOM 238 O THR A 262 7.675 -6.810 -11.449 1.00 45.68 O ATOM 239 CB THR A 262 8.621 -7.559 -14.711 1.00 34.81 C ATOM 240 OG1 THR A 262 9.530 -6.980 -15.660 1.00 30.79 O ATOM 241 CG2 THR A 262 7.131 -6.986 -15.107 1.00 32.58 C ATOM 242 HG1 THR A 262 9.527 -5.995 -15.559 1.00 0.00 H ATOM 243 H THR A 262 11.020 -8.167 -13.839 1.00 0.00 H ATOM 244 N GLU A 263 8.439 -8.891 -11.690 1.00 45.83 N ATOM 245 CA GLU A 263 7.891 -9.384 -10.400 1.00 50.26 C ATOM 246 C GLU A 263 8.398 -8.673 -9.101 1.00 48.09 C ATOM 247 O GLU A 263 7.830 -8.842 -8.037 1.00 49.27 O ATOM 248 CB GLU A 263 8.092 -10.919 -10.247 1.00 56.83 C ATOM 249 CG GLU A 263 6.898 -11.795 -10.648 1.00 71.52 C ATOM 250 CD GLU A 263 5.708 -11.729 -9.665 1.00 82.92 C ATOM 251 OE1 GLU A 263 4.612 -11.197 -10.032 1.00 73.44 O ATOM 252 OE2 GLU A 263 5.862 -12.217 -8.515 1.00 82.36 O ATOM 253 H GLU A 263 8.932 -9.562 -12.313 1.00 0.00 H ATOM 254 N LEU A 264 9.458 -7.886 -9.179 1.00 40.06 N ATOM 255 CA LEU A 264 10.069 -7.382 -7.986 1.00 37.14 C ATOM 256 C LEU A 264 9.939 -5.858 -7.844 1.00 38.84 C ATOM 257 O LEU A 264 9.769 -5.332 -6.740 1.00 37.44 O ATOM 258 CB LEU A 264 11.574 -7.798 -7.958 1.00 35.19 C ATOM 259 CG LEU A 264 11.980 -9.307 -7.928 1.00 41.06 C ATOM 260 CD1 LEU A 264 13.483 -9.550 -8.157 1.00 36.23 C ATOM 261 CD2 LEU A 264 11.545 -10.031 -6.663 1.00 43.61 C ATOM 262 H LEU A 264 9.849 -7.633 -10.109 1.00 0.00 H ATOM 263 N ILE A 265 10.094 -5.127 -8.952 1.00 33.24 N ATOM 264 CA ILE A 265 10.146 -3.692 -8.883 1.00 34.36 C ATOM 265 C ILE A 265 9.130 -3.019 -9.820 1.00 36.65 C ATOM 266 O ILE A 265 9.003 -1.772 -9.805 1.00 41.21 O ATOM 267 CB ILE A 265 11.608 -3.170 -9.165 1.00 31.09 C ATOM 268 CG1 ILE A 265 12.614 -4.064 -8.399 1.00 34.46 C ATOM 269 CG2 ILE A 265 11.730 -1.709 -8.738 1.00 30.92 C ATOM 270 CD1 ILE A 265 14.034 -3.520 -8.172 1.00 33.37 C ATOM 271 H ILE A 265 10.178 -5.601 -9.874 1.00 0.00 H ATOM 272 N GLY A 266 8.487 -3.834 -10.661 1.00 39.39 N ATOM 273 CA GLY A 266 7.503 -3.410 -11.653 1.00 33.87 C ATOM 274 C GLY A 266 7.981 -3.019 -13.048 1.00 38.71 C ATOM 275 O GLY A 266 7.174 -2.995 -13.975 1.00 36.57 O ATOM 276 H GLY A 266 8.704 -4.850 -10.605 1.00 0.00 H ATOM 277 N TYR A 267 9.268 -2.674 -13.235 1.00 33.83 N ATOM 278 CA TYR A 267 9.717 -2.242 -14.559 1.00 31.27 C ATOM 279 C TYR A 267 9.754 -3.400 -15.561 1.00 29.52 C ATOM 280 O TYR A 267 9.987 -4.571 -15.188 1.00 33.71 O ATOM 281 CB TYR A 267 11.132 -1.636 -14.507 1.00 26.23 C ATOM 282 CG TYR A 267 11.192 -0.418 -13.683 1.00 29.26 C ATOM 283 CD1 TYR A 267 10.784 0.832 -14.211 1.00 28.50 C ATOM 284 CD2 TYR A 267 11.606 -0.488 -12.334 1.00 25.61 C ATOM 285 CE1 TYR A 267 10.835 1.977 -13.440 1.00 30.22 C ATOM 286 CE2 TYR A 267 11.635 0.656 -11.572 1.00 26.27 C ATOM 287 CZ TYR A 267 11.277 1.865 -12.132 1.00 27.05 C ATOM 288 OH TYR A 267 11.386 2.971 -11.355 1.00 31.40 O ATOM 289 HH TYR A 267 10.809 2.870 -10.557 1.00 0.00 H ATOM 290 H TYR A 267 9.940 -2.714 -12.443 1.00 0.00 H ATOM 291 N HIS A 268 9.517 -3.050 -16.828 1.00 30.50 N ATOM 292 CA HIS A 268 9.779 -3.928 -17.946 1.00 30.47 C ATOM 293 C HIS A 268 11.160 -3.660 -18.446 1.00 29.41 C ATOM 294 O HIS A 268 11.534 -2.508 -18.596 1.00 28.50 O ATOM 295 CB HIS A 268 8.779 -3.709 -19.033 1.00 34.70 C ATOM 296 CG HIS A 268 7.426 -4.267 -18.648 1.00 37.92 C ATOM 297 ND1 HIS A 268 7.176 -5.612 -18.622 1.00 40.22 N ATOM 298 CD2 HIS A 268 6.288 -3.635 -18.179 1.00 37.09 C ATOM 299 CE1 HIS A 268 5.915 -5.805 -18.211 1.00 41.52 C ATOM 300 NE2 HIS A 268 5.390 -4.591 -17.910 1.00 44.60 N ATOM 301 H HIS A 268 9.127 -2.105 -17.018 1.00 0.00 H ATOM 302 N PRO A 269 11.929 -4.721 -18.685 1.00 29.96 N ATOM 303 CA PRO A 269 13.322 -4.497 -19.049 1.00 30.78 C ATOM 304 C PRO A 269 13.433 -3.525 -20.243 1.00 35.04 C ATOM 305 O PRO A 269 14.259 -2.587 -20.230 1.00 32.36 O ATOM 306 CB PRO A 269 13.755 -5.895 -19.476 1.00 26.75 C ATOM 307 CG PRO A 269 13.055 -6.772 -18.495 1.00 29.32 C ATOM 308 CD PRO A 269 11.648 -6.172 -18.552 1.00 30.66 C ATOM 309 N GLU A 270 12.552 -3.691 -21.239 1.00 34.00 N ATOM 310 CA GLU A 270 12.601 -2.842 -22.442 1.00 36.08 C ATOM 311 C GLU A 270 12.469 -1.341 -22.102 1.00 35.13 C ATOM 312 O GLU A 270 13.028 -0.489 -22.790 1.00 32.68 O ATOM 313 CB GLU A 270 11.569 -3.311 -23.481 1.00 44.90 C ATOM 314 CG GLU A 270 10.130 -3.462 -22.940 1.00 48.11 C ATOM 315 CD GLU A 270 9.794 -4.866 -22.398 1.00 61.62 C ATOM 316 OE1 GLU A 270 10.512 -5.450 -21.538 1.00 53.97 O ATOM 317 OE2 GLU A 270 8.747 -5.408 -22.824 1.00 73.98 O ATOM 318 H GLU A 270 11.824 -4.429 -21.162 1.00 0.00 H ATOM 319 N GLU A 271 11.795 -0.998 -21.006 1.00 34.20 N ATOM 320 CA GLU A 271 11.644 0.436 -20.694 1.00 35.98 C ATOM 321 C GLU A 271 12.889 0.984 -19.974 1.00 33.97 C ATOM 322 O GLU A 271 13.024 2.177 -19.761 1.00 37.33 O ATOM 323 CB GLU A 271 10.380 0.714 -19.888 1.00 35.06 C ATOM 324 CG GLU A 271 10.412 0.224 -18.455 1.00 33.57 C ATOM 325 CD GLU A 271 9.066 0.343 -17.739 1.00 39.27 C ATOM 326 OE1 GLU A 271 8.499 1.474 -17.654 1.00 45.69 O ATOM 327 OE2 GLU A 271 8.615 -0.665 -17.186 1.00 31.78 O ATOM 328 H GLU A 271 11.385 -1.724 -20.385 1.00 0.00 H ATOM 329 N LEU A 272 13.792 0.085 -19.638 1.00 32.02 N ATOM 330 CA LEU A 272 14.948 0.482 -18.882 1.00 32.06 C ATOM 331 C LEU A 272 16.067 0.868 -19.796 1.00 28.28 C ATOM 332 O LEU A 272 16.837 1.725 -19.438 1.00 29.19 O ATOM 333 CB LEU A 272 15.371 -0.605 -17.894 1.00 25.85 C ATOM 334 CG LEU A 272 14.510 -0.924 -16.680 1.00 27.84 C ATOM 335 CD1 LEU A 272 15.121 -2.056 -15.874 1.00 26.68 C ATOM 336 CD2 LEU A 272 14.202 0.226 -15.762 1.00 25.49 C ATOM 337 H LEU A 272 13.669 -0.909 -19.919 1.00 0.00 H ATOM 338 N LEU A 273 16.129 0.265 -20.976 1.00 32.74 N ATOM 339 CA LEU A 273 17.312 0.357 -21.828 1.00 35.85 C ATOM 340 C LEU A 273 17.528 1.794 -22.286 1.00 34.63 C ATOM 341 O LEU A 273 16.581 2.511 -22.548 1.00 39.80 O ATOM 342 CB LEU A 273 17.182 -0.603 -23.034 1.00 39.74 C ATOM 343 CG LEU A 273 16.839 -2.086 -22.860 1.00 39.97 C ATOM 344 CD1 LEU A 273 17.065 -2.905 -24.126 1.00 37.69 C ATOM 345 CD2 LEU A 273 17.570 -2.731 -21.684 1.00 45.00 C ATOM 346 H LEU A 273 15.312 -0.289 -21.304 1.00 0.00 H ATOM 347 N GLY A 274 18.761 2.226 -22.389 1.00 31.06 N ATOM 348 CA GLY A 274 19.057 3.602 -22.720 1.00 32.83 C ATOM 349 C GLY A 274 19.050 4.559 -21.519 1.00 33.91 C ATOM 350 O GLY A 274 19.563 5.689 -21.611 1.00 36.15 O ATOM 351 H GLY A 274 19.546 1.563 -22.229 1.00 0.00 H ATOM 352 N ARG A 275 18.511 4.130 -20.382 1.00 34.50 N ATOM 353 CA ARG A 275 18.487 5.021 -19.207 1.00 32.76 C ATOM 354 C ARG A 275 19.544 4.808 -18.163 1.00 33.35 C ATOM 355 O ARG A 275 19.817 3.663 -17.791 1.00 27.67 O ATOM 356 CB ARG A 275 17.176 4.930 -18.538 1.00 31.12 C ATOM 357 CG ARG A 275 16.115 5.338 -19.530 1.00 34.46 C ATOM 358 CD ARG A 275 14.814 4.906 -19.031 1.00 28.81 C ATOM 359 NE ARG A 275 14.430 5.732 -17.898 1.00 36.68 N ATOM 360 CZ ARG A 275 13.361 5.452 -17.171 1.00 31.54 C ATOM 361 NH1 ARG A 275 12.702 4.337 -17.491 1.00 34.12 N ATOM 362 NH2 ARG A 275 13.030 6.197 -16.132 1.00 26.44 N ATOM 363 HE ARG A 275 15.008 6.561 -17.654 1.00 0.00 H ATOM 364 HH12 ARG A 275 11.853 4.063 -16.956 1.00 0.00 H ATOM 365 HH11 ARG A 275 13.037 3.742 -18.275 1.00 0.00 H ATOM 366 HH22 ARG A 275 12.186 5.962 -15.572 1.00 0.00 H ATOM 367 HH21 ARG A 275 13.613 7.019 -15.874 1.00 0.00 H ATOM 368 H ARG A 275 18.109 3.173 -20.322 1.00 0.00 H ATOM 369 N SER A 276 20.096 5.900 -17.633 1.00 35.80 N ATOM 370 CA SER A 276 21.109 5.743 -16.569 1.00 37.27 C ATOM 371 C SER A 276 20.531 5.150 -15.253 1.00 35.05 C ATOM 372 O SER A 276 19.380 5.435 -14.875 1.00 30.49 O ATOM 373 CB SER A 276 21.860 7.059 -16.304 1.00 41.76 C ATOM 374 OG SER A 276 22.708 6.966 -15.159 1.00 37.24 O ATOM 375 HG SER A 276 23.172 7.830 -15.022 1.00 0.00 H ATOM 376 H SER A 276 19.818 6.846 -17.963 1.00 0.00 H ATOM 377 N ALA A 277 21.354 4.321 -14.580 1.00 31.11 N ATOM 378 CA ALA A 277 21.072 3.832 -13.233 1.00 39.45 C ATOM 379 C ALA A 277 20.763 5.010 -12.361 1.00 34.20 C ATOM 380 O ALA A 277 19.908 4.946 -11.490 1.00 36.81 O ATOM 381 CB ALA A 277 22.286 3.058 -12.661 1.00 40.54 C ATOM 382 H ALA A 277 22.233 4.014 -15.043 1.00 0.00 H ATOM 383 N TYR A 278 21.505 6.089 -12.588 1.00 38.43 N ATOM 384 CA TYR A 278 21.304 7.325 -11.855 1.00 37.07 C ATOM 385 C TYR A 278 19.902 7.825 -11.757 1.00 36.87 C ATOM 386 O TYR A 278 19.521 8.306 -10.719 1.00 42.44 O ATOM 387 CB TYR A 278 22.180 8.438 -12.363 1.00 36.29 C ATOM 388 CG TYR A 278 23.210 8.549 -11.344 1.00 47.14 C ATOM 389 CD1 TYR A 278 22.867 8.957 -10.063 1.00 45.93 C ATOM 390 CD2 TYR A 278 24.510 8.116 -11.594 1.00 49.65 C ATOM 391 CE1 TYR A 278 23.835 9.009 -9.071 1.00 52.07 C ATOM 392 CE2 TYR A 278 25.475 8.161 -10.600 1.00 53.71 C ATOM 393 CZ TYR A 278 25.126 8.603 -9.363 1.00 51.75 C ATOM 394 OH TYR A 278 26.092 8.638 -8.396 1.00 76.07 O ATOM 395 HH TYR A 278 25.701 8.978 -7.552 1.00 0.00 H ATOM 396 H TYR A 278 22.251 6.046 -13.312 1.00 0.00 H ATOM 397 N GLU A 279 19.132 7.686 -12.825 1.00 35.03 N ATOM 398 CA GLU A 279 17.752 8.157 -12.811 1.00 32.75 C ATOM 399 C GLU A 279 17.013 7.515 -11.706 1.00 33.20 C ATOM 400 O GLU A 279 15.995 8.039 -11.282 1.00 35.74 O ATOM 401 CB GLU A 279 17.041 7.860 -14.139 1.00 31.20 C ATOM 402 CG GLU A 279 17.655 8.527 -15.342 1.00 30.75 C ATOM 403 CD GLU A 279 16.800 8.376 -16.593 1.00 40.06 C ATOM 404 OE1 GLU A 279 17.328 8.594 -17.727 1.00 39.17 O ATOM 405 OE2 GLU A 279 15.602 8.029 -16.441 1.00 34.24 O ATOM 406 H GLU A 279 19.515 7.237 -13.681 1.00 0.00 H ATOM 407 N PHE A 280 17.476 6.361 -11.222 1.00 32.46 N ATOM 408 CA PHE A 280 16.634 5.541 -10.330 1.00 29.69 C ATOM 409 C PHE A 280 16.958 5.535 -8.798 1.00 28.60 C ATOM 410 O PHE A 280 16.158 5.132 -7.997 1.00 28.80 O ATOM 411 CB PHE A 280 16.559 4.086 -10.863 1.00 31.66 C ATOM 412 CG PHE A 280 16.050 3.966 -12.292 1.00 30.14 C ATOM 413 CD1 PHE A 280 14.664 3.747 -12.556 1.00 30.12 C ATOM 414 CD2 PHE A 280 16.928 4.001 -13.369 1.00 30.38 C ATOM 415 CE1 PHE A 280 14.206 3.646 -13.883 1.00 27.04 C ATOM 416 CE2 PHE A 280 16.475 3.912 -14.702 1.00 28.50 C ATOM 417 CZ PHE A 280 15.098 3.713 -14.945 1.00 30.35 C ATOM 418 H PHE A 280 18.432 6.039 -11.474 1.00 0.00 H ATOM 419 N TYR A 281 18.175 5.910 -8.403 1.00 30.88 N ATOM 420 CA TYR A 281 18.499 5.952 -7.022 1.00 31.76 C ATOM 421 C TYR A 281 17.703 7.044 -6.298 1.00 37.58 C ATOM 422 O TYR A 281 17.465 8.134 -6.823 1.00 39.62 O ATOM 423 CB TYR A 281 20.000 6.282 -6.857 1.00 32.20 C ATOM 424 CG TYR A 281 20.947 5.321 -7.573 1.00 30.88 C ATOM 425 CD1 TYR A 281 20.733 3.944 -7.564 1.00 29.04 C ATOM 426 CD2 TYR A 281 22.058 5.789 -8.222 1.00 29.91 C ATOM 427 CE1 TYR A 281 21.595 3.083 -8.188 1.00 29.20 C ATOM 428 CE2 TYR A 281 22.952 4.922 -8.855 1.00 31.40 C ATOM 429 CZ TYR A 281 22.707 3.568 -8.828 1.00 30.79 C ATOM 430 OH TYR A 281 23.595 2.720 -9.476 1.00 30.76 O ATOM 431 HH TYR A 281 24.496 2.822 -9.079 1.00 0.00 H ATOM 432 H TYR A 281 18.890 6.173 -9.111 1.00 0.00 H ATOM 433 N HIS A 282 17.327 6.740 -5.073 1.00 37.13 N ATOM 434 CA HIS A 282 16.966 7.725 -4.075 1.00 35.97 C ATOM 435 C HIS A 282 18.011 8.787 -3.924 1.00 35.95 C ATOM 436 O HIS A 282 19.242 8.510 -4.043 1.00 32.73 O ATOM 437 CB HIS A 282 16.771 6.993 -2.742 1.00 39.57 C ATOM 438 CG HIS A 282 16.097 7.826 -1.706 1.00 39.64 C ATOM 439 ND1 HIS A 282 16.734 8.850 -1.051 1.00 41.02 N ATOM 440 CD2 HIS A 282 14.798 7.794 -1.231 1.00 36.74 C ATOM 441 CE1 HIS A 282 15.871 9.417 -0.196 1.00 43.53 C ATOM 442 NE2 HIS A 282 14.687 8.771 -0.301 1.00 42.45 N ATOM 443 H HIS A 282 17.287 5.735 -4.807 1.00 0.00 H ATOM 444 N ALA A 283 17.549 10.027 -3.672 1.00 31.40 N ATOM 445 CA ALA A 283 18.464 11.148 -3.588 1.00 33.69 C ATOM 446 C ALA A 283 19.521 10.899 -2.508 1.00 35.34 C ATOM 447 O ALA A 283 20.683 11.250 -2.696 1.00 38.19 O ATOM 448 CB ALA A 283 17.738 12.483 -3.405 1.00 35.12 C ATOM 449 H ALA A 283 16.529 10.181 -3.537 1.00 0.00 H ATOM 450 N LEU A 284 19.124 10.236 -1.427 1.00 38.69 N ATOM 451 CA LEU A 284 20.015 10.092 -0.286 1.00 45.65 C ATOM 452 C LEU A 284 21.097 9.054 -0.506 1.00 46.32 C ATOM 453 O LEU A 284 21.964 8.923 0.323 1.00 48.96 O ATOM 454 CB LEU A 284 19.238 9.860 1.010 1.00 40.82 C ATOM 455 CG LEU A 284 18.495 11.117 1.496 1.00 45.18 C ATOM 456 CD1 LEU A 284 17.779 10.867 2.812 1.00 41.52 C ATOM 457 CD2 LEU A 284 19.444 12.304 1.626 1.00 43.46 C ATOM 458 H LEU A 284 18.172 9.818 -1.396 1.00 0.00 H ATOM 459 N ASP A 285 21.087 8.374 -1.663 1.00 46.97 N ATOM 460 CA ASP A 285 22.024 7.278 -1.956 1.00 39.63 C ATOM 461 C ASP A 285 22.970 7.609 -3.059 1.00 41.86 C ATOM 462 O ASP A 285 23.956 6.917 -3.304 1.00 41.71 O ATOM 463 CB ASP A 285 21.247 6.031 -2.363 1.00 42.71 C ATOM 464 CG ASP A 285 20.479 5.450 -1.243 1.00 38.45 C ATOM 465 OD1 ASP A 285 20.947 5.518 -0.081 1.00 46.11 O ATOM 466 OD2 ASP A 285 19.376 4.970 -1.481 1.00 38.62 O ATOM 467 H ASP A 285 20.385 8.633 -2.385 1.00 0.00 H ATOM 468 N SER A 286 22.613 8.654 -3.770 1.00 42.96 N ATOM 469 CA SER A 286 23.256 8.990 -4.998 1.00 51.59 C ATOM 470 C SER A 286 24.766 9.231 -4.885 1.00 46.28 C ATOM 471 O SER A 286 25.528 8.630 -5.638 1.00 43.67 O ATOM 472 CB SER A 286 22.523 10.178 -5.608 1.00 55.65 C ATOM 473 OG SER A 286 21.124 9.891 -5.571 1.00 70.46 O ATOM 474 HG SER A 286 20.841 9.756 -4.632 1.00 0.00 H ATOM 475 H SER A 286 21.837 9.255 -3.427 1.00 0.00 H ATOM 476 N GLU A 287 25.214 10.088 -3.968 1.00 48.62 N ATOM 477 CA GLU A 287 26.677 10.315 -3.877 1.00 49.66 C ATOM 478 C GLU A 287 27.415 9.034 -3.528 1.00 45.21 C ATOM 479 O GLU A 287 28.417 8.731 -4.150 1.00 53.67 O ATOM 480 CB GLU A 287 27.069 11.442 -2.928 1.00 50.85 C ATOM 481 CG GLU A 287 26.375 12.770 -3.204 1.00 59.91 C ATOM 482 CD GLU A 287 26.753 13.464 -4.540 1.00 74.01 C ATOM 483 OE1 GLU A 287 27.872 14.038 -4.626 1.00 64.09 O ATOM 484 OE2 GLU A 287 25.906 13.495 -5.489 1.00 71.71 O ATOM 485 H GLU A 287 24.556 10.584 -3.334 1.00 0.00 H ATOM 486 N ASN A 288 26.909 8.272 -2.559 1.00 41.64 N ATOM 487 CA ASN A 288 27.414 6.891 -2.278 1.00 44.11 C ATOM 488 C ASN A 288 27.574 5.923 -3.437 1.00 43.90 C ATOM 489 O ASN A 288 28.602 5.242 -3.524 1.00 43.88 O ATOM 490 CB ASN A 288 26.578 6.215 -1.190 1.00 40.81 C ATOM 491 CG ASN A 288 27.016 6.657 0.171 1.00 44.67 C ATOM 492 OD1 ASN A 288 28.138 7.146 0.317 1.00 51.82 O ATOM 493 ND2 ASN A 288 26.170 6.521 1.156 1.00 37.95 N ATOM 494 HD22 ASN A 288 25.234 6.102 0.983 1.00 0.00 H ATOM 495 HD21 ASN A 288 26.432 6.831 2.113 1.00 0.00 H ATOM 496 H ASN A 288 26.135 8.651 -1.977 1.00 0.00 H ATOM 497 N MET A 289 26.558 5.865 -4.313 1.00 38.01 N ATOM 498 CA MET A 289 26.670 5.111 -5.536 1.00 37.82 C ATOM 499 C MET A 289 27.728 5.691 -6.438 1.00 46.19 C ATOM 500 O MET A 289 28.497 4.906 -7.011 1.00 44.68 O ATOM 501 CB MET A 289 25.340 5.031 -6.282 1.00 35.63 C ATOM 502 CG MET A 289 24.248 4.429 -5.404 1.00 34.40 C ATOM 503 SD MET A 289 24.590 2.759 -4.763 1.00 37.69 S ATOM 504 CE MET A 289 24.525 1.673 -6.217 1.00 29.50 C ATOM 505 H MET A 289 25.675 6.373 -4.105 1.00 0.00 H ATOM 506 N THR A 290 27.771 7.028 -6.599 1.00 40.84 N ATOM 507 CA THR A 290 28.882 7.606 -7.377 1.00 48.28 C ATOM 508 C THR A 290 30.225 7.113 -6.821 1.00 48.16 C ATOM 509 O THR A 290 31.143 6.800 -7.606 1.00 51.40 O ATOM 510 CB THR A 290 28.859 9.143 -7.427 1.00 50.58 C ATOM 511 OG1 THR A 290 27.816 9.564 -8.323 1.00 50.60 O ATOM 512 CG2 THR A 290 30.204 9.709 -7.925 1.00 47.09 C ATOM 513 HG1 THR A 290 26.945 9.226 -7.996 1.00 0.00 H ATOM 514 H THR A 290 27.038 7.638 -6.184 1.00 0.00 H ATOM 515 N LYS A 291 30.324 7.003 -5.486 1.00 47.52 N ATOM 516 CA LYS A 291 31.584 6.539 -4.864 1.00 53.91 C ATOM 517 C LYS A 291 31.854 5.046 -5.134 1.00 50.95 C ATOM 518 O LYS A 291 32.993 4.656 -5.414 1.00 53.75 O ATOM 519 CB LYS A 291 31.635 6.834 -3.344 1.00 53.70 C ATOM 520 CG LYS A 291 31.871 8.294 -2.948 1.00 60.51 C ATOM 521 CD LYS A 291 32.147 8.414 -1.444 1.00 62.94 C ATOM 522 CE LYS A 291 31.770 9.776 -0.864 1.00 66.25 C ATOM 523 NZ LYS A 291 30.334 10.134 -1.097 1.00 64.75 N ATOM 524 HZ1 LYS A 291 30.147 10.162 -2.120 1.00 0.00 H ATOM 525 HZ2 LYS A 291 29.723 9.420 -0.651 1.00 0.00 H ATOM 526 HZ3 LYS A 291 30.139 11.067 -0.681 1.00 0.00 H ATOM 527 H LYS A 291 29.510 7.245 -4.886 1.00 0.00 H ATOM 528 N SER A 292 30.813 4.219 -5.038 1.00 48.40 N ATOM 529 CA SER A 292 30.951 2.774 -5.300 1.00 48.21 C ATOM 530 C SER A 292 31.334 2.653 -6.749 1.00 47.57 C ATOM 531 O SER A 292 32.224 1.891 -7.092 1.00 49.36 O ATOM 532 CB SER A 292 29.639 2.033 -5.088 1.00 42.14 C ATOM 533 OG SER A 292 29.401 1.752 -3.734 1.00 51.18 O ATOM 534 HG SER A 292 28.540 1.271 -3.644 1.00 0.00 H ATOM 535 H SER A 292 29.883 4.601 -4.772 1.00 0.00 H ATOM 536 N HIS A 293 30.688 3.459 -7.599 1.00 46.39 N ATOM 537 CA HIS A 293 31.052 3.455 -8.981 1.00 45.48 C ATOM 538 C HIS A 293 32.512 3.680 -9.142 1.00 48.92 C ATOM 539 O HIS A 293 33.129 2.933 -9.846 1.00 46.24 O ATOM 540 CB HIS A 293 30.223 4.378 -9.875 1.00 40.66 C ATOM 541 CG HIS A 293 30.429 4.096 -11.367 1.00 47.42 C ATOM 542 ND1 HIS A 293 29.622 3.254 -12.083 1.00 44.89 N ATOM 543 CD2 HIS A 293 31.427 4.531 -12.258 1.00 50.59 C ATOM 544 CE1 HIS A 293 30.078 3.172 -13.352 1.00 51.01 C ATOM 545 NE2 HIS A 293 31.186 3.947 -13.460 1.00 48.72 N ATOM 546 H HIS A 293 29.929 4.082 -7.258 1.00 0.00 H ATOM 547 N GLN A 294 33.088 4.694 -8.488 1.00 50.55 N ATOM 548 CA GLN A 294 34.522 4.980 -8.687 1.00 54.37 C ATOM 549 C GLN A 294 35.446 3.838 -8.271 1.00 51.70 C ATOM 550 O GLN A 294 36.448 3.585 -8.961 1.00 54.81 O ATOM 551 CB GLN A 294 34.950 6.260 -7.955 1.00 64.33 C ATOM 552 CG GLN A 294 34.267 7.519 -8.429 1.00 71.03 C ATOM 553 CD GLN A 294 34.394 8.653 -7.421 1.00 80.28 C ATOM 554 OE1 GLN A 294 34.823 8.446 -6.272 1.00 82.57 O ATOM 555 NE2 GLN A 294 34.012 9.863 -7.843 1.00 66.84 N ATOM 556 HE22 GLN A 294 33.660 9.988 -8.813 1.00 0.00 H ATOM 557 HE21 GLN A 294 34.067 10.679 -7.201 1.00 0.00 H ATOM 558 H GLN A 294 32.526 5.281 -7.839 1.00 0.00 H ATOM 559 N ASN A 295 35.126 3.183 -7.146 1.00 49.87 N ATOM 560 CA ASN A 295 35.768 1.936 -6.752 1.00 52.16 C ATOM 561 C ASN A 295 35.696 0.850 -7.813 1.00 53.57 C ATOM 562 O ASN A 295 36.704 0.250 -8.169 1.00 54.24 O ATOM 563 CB ASN A 295 35.117 1.398 -5.485 1.00 56.61 C ATOM 564 CG ASN A 295 35.433 2.230 -4.276 1.00 66.67 C ATOM 565 OD1 ASN A 295 36.596 2.398 -3.913 1.00 67.20 O ATOM 566 ND2 ASN A 295 34.397 2.749 -3.631 1.00 67.15 N ATOM 567 HD22 ASN A 295 33.431 2.579 -3.977 1.00 0.00 H ATOM 568 HD21 ASN A 295 34.551 3.326 -2.780 1.00 0.00 H ATOM 569 H ASN A 295 34.389 3.581 -6.529 1.00 0.00 H ATOM 570 N LEU A 296 34.478 0.556 -8.284 1.00 57.59 N ATOM 571 CA LEU A 296 34.266 -0.343 -9.445 1.00 52.31 C ATOM 572 C LEU A 296 35.182 -0.057 -10.646 1.00 53.46 C ATOM 573 O LEU A 296 35.673 -0.990 -11.297 1.00 58.03 O ATOM 574 CB LEU A 296 32.784 -0.315 -9.909 1.00 43.30 C ATOM 575 CG LEU A 296 32.387 -1.193 -11.107 1.00 38.65 C ATOM 576 CD1 LEU A 296 32.697 -2.682 -10.870 1.00 32.94 C ATOM 577 CD2 LEU A 296 30.916 -0.963 -11.418 1.00 38.46 C ATOM 578 H LEU A 296 33.648 0.974 -7.818 1.00 0.00 H ATOM 579 N CYS A 297 35.379 1.219 -10.973 1.00 54.15 N ATOM 580 CA CYS A 297 36.181 1.547 -12.133 1.00 58.57 C ATOM 581 C CYS A 297 37.670 1.364 -11.816 1.00 63.13 C ATOM 582 O CYS A 297 38.422 0.836 -12.631 1.00 68.46 O ATOM 583 CB CYS A 297 35.852 2.930 -12.657 1.00 56.89 C ATOM 584 SG CYS A 297 34.287 2.976 -13.547 1.00 58.74 S ATOM 585 H CYS A 297 34.959 1.976 -10.398 1.00 0.00 H ATOM 586 N THR A 298 38.072 1.728 -10.608 1.00 60.04 N ATOM 587 CA THR A 298 39.469 1.564 -10.222 1.00 62.34 C ATOM 588 C THR A 298 39.822 0.126 -9.811 1.00 63.18 C ATOM 589 O THR A 298 40.851 -0.383 -10.244 1.00 61.49 O ATOM 590 CB THR A 298 39.949 2.627 -9.189 1.00 64.53 C ATOM 591 OG1 THR A 298 39.356 2.388 -7.897 1.00 69.21 O ATOM 592 CG2 THR A 298 39.654 4.071 -9.701 1.00 58.86 C ATOM 593 HG1 THR A 298 38.370 2.438 -7.973 1.00 0.00 H ATOM 594 H THR A 298 37.391 2.131 -9.934 1.00 0.00 H ATOM 595 N LYS A 299 38.972 -0.531 -9.014 1.00 56.79 N ATOM 596 CA LYS A 299 39.143 -1.970 -8.708 1.00 57.11 C ATOM 597 C LYS A 299 38.706 -3.005 -9.797 1.00 57.70 C ATOM 598 O LYS A 299 39.365 -4.014 -9.973 1.00 51.02 O ATOM 599 CB LYS A 299 38.486 -2.315 -7.356 1.00 61.69 C ATOM 600 CG LYS A 299 39.223 -1.735 -6.160 1.00 70.24 C ATOM 601 CD LYS A 299 38.330 -1.380 -4.977 1.00 70.90 C ATOM 602 CE LYS A 299 38.856 -0.097 -4.319 1.00 77.83 C ATOM 603 NZ LYS A 299 40.359 0.024 -4.231 1.00 68.75 N ATOM 604 HZ1 LYS A 299 40.737 -0.768 -3.672 1.00 0.00 H ATOM 605 HZ2 LYS A 299 40.764 -0.001 -5.188 1.00 0.00 H ATOM 606 HZ3 LYS A 299 40.607 0.924 -3.772 1.00 0.00 H ATOM 607 H LYS A 299 38.169 -0.017 -8.598 1.00 0.00 H ATOM 608 N GLY A 300 37.575 -2.800 -10.479 1.00 59.08 N ATOM 609 CA GLY A 300 37.084 -3.781 -11.476 1.00 56.88 C ATOM 610 C GLY A 300 35.910 -4.665 -11.032 1.00 51.83 C ATOM 611 O GLY A 300 35.262 -5.318 -11.839 1.00 51.66 O ATOM 612 H GLY A 300 37.027 -1.933 -10.306 1.00 0.00 H ATOM 613 N GLN A 301 35.668 -4.705 -9.736 1.00 49.39 N ATOM 614 CA GLN A 301 34.542 -5.407 -9.156 1.00 46.18 C ATOM 615 C GLN A 301 34.297 -4.693 -7.838 1.00 48.16 C ATOM 616 O GLN A 301 35.237 -4.123 -7.276 1.00 45.44 O ATOM 617 CB GLN A 301 34.828 -6.916 -8.986 1.00 51.36 C ATOM 618 CG GLN A 301 33.638 -7.730 -8.433 1.00 58.73 C ATOM 619 CD GLN A 301 33.901 -9.231 -8.286 1.00 59.18 C ATOM 620 OE1 GLN A 301 34.418 -9.680 -7.250 1.00 59.70 O ATOM 621 NE2 GLN A 301 33.515 -10.022 -9.311 1.00 46.55 N ATOM 622 HE22 GLN A 301 33.086 -9.601 -10.160 1.00 0.00 H ATOM 623 HE21 GLN A 301 33.647 -11.052 -9.251 1.00 0.00 H ATOM 624 H GLN A 301 36.320 -4.206 -9.097 1.00 0.00 H ATOM 625 N VAL A 302 33.040 -4.664 -7.369 1.00 43.84 N ATOM 626 CA VAL A 302 32.688 -4.039 -6.098 1.00 41.19 C ATOM 627 C VAL A 302 31.311 -4.480 -5.662 1.00 44.05 C ATOM 628 O VAL A 302 30.500 -4.925 -6.474 1.00 43.20 O ATOM 629 CB VAL A 302 32.702 -2.495 -6.201 1.00 47.55 C ATOM 630 CG1 VAL A 302 31.478 -1.997 -6.941 1.00 50.85 C ATOM 631 CG2 VAL A 302 32.680 -1.861 -4.827 1.00 45.73 C ATOM 632 H VAL A 302 32.286 -5.105 -7.934 1.00 0.00 H ATOM 633 N VAL A 303 31.051 -4.377 -4.368 1.00 46.50 N ATOM 634 CA VAL A 303 29.728 -4.572 -3.826 1.00 43.73 C ATOM 635 C VAL A 303 29.290 -3.181 -3.454 1.00 46.33 C ATOM 636 O VAL A 303 30.043 -2.422 -2.792 1.00 44.19 O ATOM 637 CB VAL A 303 29.718 -5.510 -2.578 1.00 49.73 C ATOM 638 CG1 VAL A 303 28.300 -5.718 -2.051 1.00 41.51 C ATOM 639 CG2 VAL A 303 30.322 -6.860 -2.919 1.00 45.62 C ATOM 640 H VAL A 303 31.829 -4.147 -3.718 1.00 0.00 H ATOM 641 N SER A 304 28.090 -2.835 -3.902 1.00 39.15 N ATOM 642 CA SER A 304 27.499 -1.530 -3.661 1.00 36.22 C ATOM 643 C SER A 304 27.248 -1.240 -2.181 1.00 42.02 C ATOM 644 O SER A 304 27.189 -0.066 -1.768 1.00 48.38 O ATOM 645 CB SER A 304 26.111 -1.431 -4.370 1.00 32.60 C ATOM 646 OG SER A 304 25.175 -2.102 -3.585 1.00 27.22 O ATOM 647 HG SER A 304 25.133 -1.680 -2.691 1.00 0.00 H ATOM 648 H SER A 304 27.547 -3.531 -4.452 1.00 0.00 H ATOM 649 N GLY A 305 26.965 -2.247 -1.372 1.00 40.94 N ATOM 650 CA GLY A 305 26.336 -1.843 -0.083 1.00 46.46 C ATOM 651 C GLY A 305 24.958 -1.257 -0.422 1.00 46.95 C ATOM 652 O GLY A 305 24.617 -1.160 -1.617 1.00 37.83 O ATOM 653 H GLY A 305 27.165 -3.238 -1.615 1.00 0.00 H ATOM 654 N GLN A 306 24.187 -0.881 0.606 1.00 40.72 N ATOM 655 CA GLN A 306 22.715 -0.789 0.519 1.00 41.14 C ATOM 656 C GLN A 306 22.183 0.525 -0.085 1.00 42.88 C ATOM 657 O GLN A 306 22.560 1.628 0.331 1.00 39.61 O ATOM 658 CB GLN A 306 22.029 -1.043 1.867 1.00 48.10 C ATOM 659 CG GLN A 306 22.419 -2.304 2.639 1.00 49.81 C ATOM 660 CD GLN A 306 21.510 -2.571 3.839 1.00 51.59 C ATOM 661 OE1 GLN A 306 21.012 -1.652 4.475 1.00 60.40 O ATOM 662 NE2 GLN A 306 21.267 -3.837 4.134 1.00 47.97 N ATOM 663 HE22 GLN A 306 21.706 -4.595 3.574 1.00 0.00 H ATOM 664 HE21 GLN A 306 20.637 -4.075 4.926 1.00 0.00 H ATOM 665 H GLN A 306 24.646 -0.642 1.508 1.00 0.00 H ATOM 666 N TYR A 307 21.346 0.399 -1.112 1.00 36.87 N ATOM 667 CA TYR A 307 20.790 1.589 -1.766 1.00 33.52 C ATOM 668 C TYR A 307 19.304 1.331 -2.096 1.00 34.58 C ATOM 669 O TYR A 307 18.848 0.185 -1.990 1.00 29.28 O ATOM 670 CB TYR A 307 21.622 2.019 -2.986 1.00 31.41 C ATOM 671 CG TYR A 307 21.552 1.086 -4.164 1.00 33.39 C ATOM 672 CD1 TYR A 307 22.366 -0.062 -4.217 1.00 37.63 C ATOM 673 CD2 TYR A 307 20.607 1.269 -5.191 1.00 32.07 C ATOM 674 CE1 TYR A 307 22.292 -0.961 -5.289 1.00 38.22 C ATOM 675 CE2 TYR A 307 20.530 0.375 -6.264 1.00 33.37 C ATOM 676 CZ TYR A 307 21.379 -0.743 -6.303 1.00 34.19 C ATOM 677 OH TYR A 307 21.340 -1.669 -7.321 1.00 38.46 O ATOM 678 HH TYR A 307 22.018 -2.371 -7.153 1.00 0.00 H ATOM 679 H TYR A 307 21.085 -0.548 -1.453 1.00 0.00 H ATOM 680 N ARG A 308 18.562 2.399 -2.430 1.00 28.60 N ATOM 681 CA ARG A 308 17.109 2.321 -2.740 1.00 36.34 C ATOM 682 C ARG A 308 16.907 2.622 -4.231 1.00 35.96 C ATOM 683 O ARG A 308 17.549 3.578 -4.760 1.00 30.42 O ATOM 684 CB ARG A 308 16.311 3.397 -1.947 1.00 36.10 C ATOM 685 CG ARG A 308 15.773 2.970 -0.567 1.00 40.59 C ATOM 686 CD ARG A 308 15.565 4.175 0.379 1.00 34.47 C ATOM 687 NE ARG A 308 16.900 4.758 0.568 1.00 44.64 N ATOM 688 CZ ARG A 308 17.194 5.791 1.365 1.00 47.78 C ATOM 689 NH1 ARG A 308 16.237 6.398 2.056 1.00 43.40 N ATOM 690 NH2 ARG A 308 18.448 6.238 1.454 1.00 44.00 N ATOM 691 HE ARG A 308 17.685 4.330 0.036 1.00 0.00 H ATOM 692 HH12 ARG A 308 16.471 7.201 2.674 1.00 0.00 H ATOM 693 HH11 ARG A 308 15.253 6.071 1.979 1.00 0.00 H ATOM 694 HH22 ARG A 308 18.671 7.042 2.075 1.00 0.00 H ATOM 695 HH21 ARG A 308 19.203 5.783 0.902 1.00 0.00 H ATOM 696 H ARG A 308 19.027 3.328 -2.474 1.00 0.00 H ATOM 697 N MET A 309 16.009 1.849 -4.883 1.00 32.31 N ATOM 698 CA MET A 309 15.619 2.089 -6.277 1.00 30.95 C ATOM 699 C MET A 309 14.156 2.508 -6.244 1.00 27.79 C ATOM 700 O MET A 309 13.388 1.846 -5.583 1.00 29.38 O ATOM 701 CB MET A 309 15.699 0.807 -7.125 1.00 32.62 C ATOM 702 CG MET A 309 15.408 1.035 -8.600 1.00 27.64 C ATOM 703 SD MET A 309 15.522 -0.509 -9.564 1.00 31.94 S ATOM 704 CE MET A 309 15.528 0.289 -11.178 1.00 26.09 C ATOM 705 H MET A 309 15.577 1.051 -4.375 1.00 0.00 H ATOM 706 N LEU A 310 13.817 3.594 -6.961 1.00 34.74 N ATOM 707 CA LEU A 310 12.431 4.068 -7.055 1.00 37.34 C ATOM 708 C LEU A 310 11.631 3.003 -7.774 1.00 35.58 C ATOM 709 O LEU A 310 11.988 2.592 -8.902 1.00 40.68 O ATOM 710 CB LEU A 310 12.378 5.416 -7.800 1.00 40.40 C ATOM 711 CG LEU A 310 10.947 5.862 -8.233 1.00 49.03 C ATOM 712 CD1 LEU A 310 10.029 6.071 -7.019 1.00 48.10 C ATOM 713 CD2 LEU A 310 10.885 7.060 -9.216 1.00 49.43 C ATOM 714 H LEU A 310 14.562 4.116 -7.466 1.00 0.00 H ATOM 715 N ALA A 311 10.561 2.524 -7.176 1.00 43.32 N ATOM 716 CA ALA A 311 9.818 1.431 -7.852 1.00 40.31 C ATOM 717 C ALA A 311 8.957 2.009 -8.965 1.00 49.29 C ATOM 718 O ALA A 311 8.634 3.195 -8.946 1.00 49.64 O ATOM 719 CB ALA A 311 9.009 0.608 -6.881 1.00 38.90 C ATOM 720 H ALA A 311 10.246 2.899 -6.259 1.00 0.00 H ATOM 721 N LYS A 312 8.655 1.186 -9.963 1.00 47.33 N ATOM 722 CA LYS A 312 7.723 1.568 -11.039 1.00 48.90 C ATOM 723 C LYS A 312 6.424 2.247 -10.544 1.00 50.07 C ATOM 724 O LYS A 312 5.998 3.223 -11.128 1.00 48.84 O ATOM 725 CB LYS A 312 7.395 0.360 -11.927 1.00 47.89 C ATOM 726 CG LYS A 312 6.256 0.559 -12.924 1.00 44.59 C ATOM 727 CD LYS A 312 6.762 1.010 -14.258 1.00 41.25 C ATOM 728 CE LYS A 312 5.618 0.979 -15.267 1.00 42.61 C ATOM 729 NZ LYS A 312 6.164 1.359 -16.583 1.00 41.54 N ATOM 730 HZ1 LYS A 312 6.569 2.315 -16.526 1.00 0.00 H ATOM 731 HZ2 LYS A 312 6.905 0.683 -16.858 1.00 0.00 H ATOM 732 HZ3 LYS A 312 5.402 1.345 -17.290 1.00 0.00 H ATOM 733 H LYS A 312 9.090 0.242 -9.986 1.00 0.00 H ATOM 734 N HIS A 313 5.804 1.762 -9.475 1.00 52.41 N ATOM 735 CA HIS A 313 4.567 2.409 -9.039 1.00 57.84 C ATOM 736 C HIS A 313 4.664 3.117 -7.719 1.00 57.30 C ATOM 737 O HIS A 313 3.772 3.011 -6.908 1.00 62.29 O ATOM 738 CB HIS A 313 3.407 1.430 -9.089 1.00 56.45 C ATOM 739 CG HIS A 313 3.264 0.736 -10.431 1.00 56.98 C ATOM 740 ND1 HIS A 313 2.835 1.384 -11.555 1.00 61.39 N ATOM 741 CD2 HIS A 313 3.513 -0.587 -10.805 1.00 59.99 C ATOM 742 CE1 HIS A 313 2.800 0.519 -12.578 1.00 59.77 C ATOM 743 NE2 HIS A 313 3.217 -0.695 -12.114 1.00 61.73 N ATOM 744 H HIS A 313 6.188 0.943 -8.961 1.00 0.00 H ATOM 745 N GLY A 314 5.742 3.888 -7.530 1.00 58.10 N ATOM 746 CA GLY A 314 5.965 4.706 -6.324 1.00 52.97 C ATOM 747 C GLY A 314 6.616 3.937 -5.194 1.00 48.25 C ATOM 748 O GLY A 314 6.538 2.717 -5.153 1.00 48.79 O ATOM 749 H GLY A 314 6.464 3.911 -8.278 1.00 0.00 H ATOM 750 N GLY A 315 7.254 4.628 -4.260 1.00 48.45 N ATOM 751 CA GLY A 315 7.953 3.927 -3.162 1.00 47.87 C ATOM 752 C GLY A 315 9.321 3.429 -3.626 1.00 45.68 C ATOM 753 O GLY A 315 9.640 3.493 -4.807 1.00 46.69 O ATOM 754 H GLY A 315 7.263 5.667 -4.300 1.00 0.00 H ATOM 755 N TYR A 316 10.156 2.986 -2.694 1.00 48.01 N ATOM 756 CA TYR A 316 11.521 2.609 -3.008 1.00 41.77 C ATOM 757 C TYR A 316 11.773 1.200 -2.504 1.00 44.82 C ATOM 758 O TYR A 316 11.269 0.868 -1.437 1.00 39.35 O ATOM 759 CB TYR A 316 12.495 3.574 -2.332 1.00 47.98 C ATOM 760 CG TYR A 316 12.589 4.953 -2.998 1.00 41.92 C ATOM 761 CD1 TYR A 316 13.558 5.220 -3.990 1.00 33.86 C ATOM 762 CD2 TYR A 316 11.716 5.991 -2.616 1.00 38.25 C ATOM 763 CE1 TYR A 316 13.630 6.468 -4.614 1.00 38.82 C ATOM 764 CE2 TYR A 316 11.775 7.221 -3.228 1.00 39.70 C ATOM 765 CZ TYR A 316 12.743 7.464 -4.200 1.00 38.82 C ATOM 766 OH TYR A 316 12.790 8.704 -4.745 1.00 44.71 O ATOM 767 HH TYR A 316 12.962 9.370 -4.033 1.00 0.00 H ATOM 768 H TYR A 316 9.822 2.907 -1.712 1.00 0.00 H ATOM 769 N VAL A 317 12.557 0.398 -3.254 1.00 42.54 N ATOM 770 CA VAL A 317 12.964 -0.979 -2.884 1.00 36.09 C ATOM 771 C VAL A 317 14.456 -0.993 -2.532 1.00 35.10 C ATOM 772 O VAL A 317 15.241 -0.317 -3.188 1.00 34.76 O ATOM 773 CB VAL A 317 12.720 -1.912 -4.072 1.00 43.55 C ATOM 774 CG1 VAL A 317 13.327 -3.273 -3.821 1.00 47.05 C ATOM 775 CG2 VAL A 317 11.226 -2.039 -4.323 1.00 48.00 C ATOM 776 H VAL A 317 12.902 0.774 -4.160 1.00 0.00 H ATOM 777 N TRP A 318 14.866 -1.714 -1.496 1.00 33.10 N ATOM 778 CA TRP A 318 16.318 -1.664 -1.106 1.00 35.72 C ATOM 779 C TRP A 318 17.035 -2.696 -1.890 1.00 28.44 C ATOM 780 O TRP A 318 16.510 -3.784 -2.057 1.00 27.03 O ATOM 781 CB TRP A 318 16.486 -1.981 0.389 1.00 37.73 C ATOM 782 CG TRP A 318 16.149 -0.829 1.315 1.00 34.81 C ATOM 783 CD1 TRP A 318 14.932 -0.576 1.968 1.00 34.86 C ATOM 784 CD2 TRP A 318 17.029 0.263 1.675 1.00 35.11 C ATOM 785 NE1 TRP A 318 15.016 0.574 2.725 1.00 38.31 N ATOM 786 CE2 TRP A 318 16.272 1.124 2.592 1.00 34.26 C ATOM 787 CE3 TRP A 318 18.375 0.573 1.403 1.00 37.36 C ATOM 788 CZ2 TRP A 318 16.830 2.248 3.155 1.00 34.26 C ATOM 789 CZ3 TRP A 318 18.933 1.723 1.982 1.00 35.78 C ATOM 790 CH2 TRP A 318 18.184 2.533 2.857 1.00 39.50 C ATOM 791 HE1 TRP A 318 14.248 0.966 3.307 1.00 0.00 H ATOM 792 H TRP A 318 14.195 -2.303 -0.963 1.00 0.00 H ATOM 793 N LEU A 319 18.277 -2.442 -2.277 1.00 31.51 N ATOM 794 CA LEU A 319 18.977 -3.463 -2.984 1.00 29.14 C ATOM 795 C LEU A 319 20.422 -3.434 -2.553 1.00 31.47 C ATOM 796 O LEU A 319 20.911 -2.452 -2.042 1.00 25.81 O ATOM 797 CB LEU A 319 18.920 -3.186 -4.533 1.00 31.82 C ATOM 798 CG LEU A 319 17.717 -3.090 -5.501 1.00 33.69 C ATOM 799 CD1 LEU A 319 18.199 -3.315 -6.921 1.00 32.70 C ATOM 800 CD2 LEU A 319 16.686 -4.167 -5.317 1.00 39.10 C ATOM 801 H LEU A 319 18.727 -1.527 -2.071 1.00 0.00 H ATOM 802 N GLU A 320 21.121 -4.501 -2.914 1.00 28.69 N ATOM 803 CA GLU A 320 22.543 -4.619 -2.772 1.00 36.57 C ATOM 804 C GLU A 320 22.894 -5.213 -4.134 1.00 31.44 C ATOM 805 O GLU A 320 22.187 -6.099 -4.591 1.00 27.29 O ATOM 806 CB GLU A 320 22.811 -5.684 -1.723 1.00 36.37 C ATOM 807 CG GLU A 320 23.995 -5.445 -0.834 1.00 56.60 C ATOM 808 CD GLU A 320 23.836 -6.265 0.438 1.00 58.40 C ATOM 809 OE1 GLU A 320 23.838 -7.515 0.309 1.00 60.02 O ATOM 810 OE2 GLU A 320 23.654 -5.673 1.539 1.00 66.16 O ATOM 811 H GLU A 320 20.605 -5.304 -3.327 1.00 0.00 H ATOM 812 N THR A 321 23.962 -4.715 -4.740 1.00 29.20 N ATOM 813 CA THR A 321 24.408 -5.135 -6.018 1.00 26.81 C ATOM 814 C THR A 321 25.865 -5.462 -5.945 1.00 33.15 C ATOM 815 O THR A 321 26.638 -4.698 -5.361 1.00 32.22 O ATOM 816 CB THR A 321 24.208 -3.999 -7.034 1.00 25.08 C ATOM 817 OG1 THR A 321 22.792 -3.920 -7.336 1.00 22.91 O ATOM 818 CG2 THR A 321 24.892 -4.348 -8.342 1.00 24.58 C ATOM 819 HG1 THR A 321 22.635 -3.194 -7.990 1.00 0.00 H ATOM 820 H THR A 321 24.503 -3.974 -4.250 1.00 0.00 H ATOM 821 N GLN A 322 26.242 -6.594 -6.570 1.00 33.05 N ATOM 822 CA GLN A 322 27.618 -6.797 -6.990 1.00 32.14 C ATOM 823 C GLN A 322 27.804 -6.433 -8.434 1.00 31.45 C ATOM 824 O GLN A 322 27.181 -7.055 -9.316 1.00 33.68 O ATOM 825 CB GLN A 322 27.996 -8.277 -6.821 1.00 40.46 C ATOM 826 CG GLN A 322 29.480 -8.576 -7.070 1.00 50.12 C ATOM 827 CD GLN A 322 29.776 -10.072 -7.114 1.00 55.49 C ATOM 828 OE1 GLN A 322 29.714 -10.778 -6.090 1.00 57.52 O ATOM 829 NE2 GLN A 322 30.052 -10.568 -8.304 1.00 49.10 N ATOM 830 HE22 GLN A 322 30.093 -9.940 -9.132 1.00 0.00 H ATOM 831 HE21 GLN A 322 30.228 -11.587 -8.415 1.00 0.00 H ATOM 832 H GLN A 322 25.536 -7.335 -6.755 1.00 0.00 H ATOM 833 N GLY A 323 28.745 -5.526 -8.694 1.00 30.12 N ATOM 834 CA GLY A 323 29.103 -5.134 -10.042 1.00 27.95 C ATOM 835 C GLY A 323 30.506 -5.594 -10.475 1.00 31.05 C ATOM 836 O GLY A 323 31.474 -5.584 -9.673 1.00 31.60 O ATOM 837 H GLY A 323 29.243 -5.081 -7.897 1.00 0.00 H ATOM 838 N THR A 324 30.618 -5.966 -11.733 1.00 28.74 N ATOM 839 CA THR A 324 31.865 -6.490 -12.288 1.00 29.95 C ATOM 840 C THR A 324 32.031 -5.897 -13.639 1.00 31.58 C ATOM 841 O THR A 324 31.099 -5.990 -14.489 1.00 35.82 O ATOM 842 CB THR A 324 31.725 -8.036 -12.368 1.00 28.28 C ATOM 843 OG1 THR A 324 31.313 -8.540 -11.092 1.00 29.16 O ATOM 844 CG2 THR A 324 33.003 -8.716 -12.749 1.00 32.82 C ATOM 845 HG1 THR A 324 30.442 -8.140 -10.846 1.00 0.00 H ATOM 846 H THR A 324 29.789 -5.884 -12.355 1.00 0.00 H ATOM 847 N VAL A 325 33.192 -5.297 -13.890 1.00 33.51 N ATOM 848 CA VAL A 325 33.498 -4.694 -15.208 1.00 34.28 C ATOM 849 C VAL A 325 33.964 -5.792 -16.120 1.00 35.41 C ATOM 850 O VAL A 325 34.792 -6.583 -15.722 1.00 41.32 O ATOM 851 CB VAL A 325 34.619 -3.605 -15.121 1.00 30.84 C ATOM 852 CG1 VAL A 325 34.950 -2.998 -16.470 1.00 29.97 C ATOM 853 CG2 VAL A 325 34.269 -2.544 -14.109 1.00 37.85 C ATOM 854 H VAL A 325 33.907 -5.250 -13.137 1.00 0.00 H ATOM 855 N ILE A 326 33.404 -5.871 -17.338 1.00 32.05 N ATOM 856 CA ILE A 326 33.918 -6.789 -18.368 1.00 35.12 C ATOM 857 C ILE A 326 34.774 -5.947 -19.317 1.00 39.46 C ATOM 858 O ILE A 326 34.239 -5.074 -19.988 1.00 35.56 O ATOM 859 CB ILE A 326 32.757 -7.464 -19.121 1.00 33.74 C ATOM 860 CG1 ILE A 326 31.821 -8.106 -18.098 1.00 35.51 C ATOM 861 CG2 ILE A 326 33.267 -8.456 -20.201 1.00 33.51 C ATOM 862 CD1 ILE A 326 32.491 -9.089 -17.138 1.00 36.01 C ATOM 863 H ILE A 326 32.586 -5.268 -17.559 1.00 0.00 H ATOM 864 N TYR A 327 36.096 -6.143 -19.272 1.00 43.51 N ATOM 865 CA TYR A 327 37.066 -5.490 -20.182 1.00 46.12 C ATOM 866 C TYR A 327 37.334 -6.494 -21.318 1.00 53.75 C ATOM 867 O TYR A 327 37.170 -7.688 -21.092 1.00 59.36 O ATOM 868 CB TYR A 327 38.368 -5.190 -19.416 1.00 41.09 C ATOM 869 CG TYR A 327 38.243 -4.453 -18.073 1.00 41.78 C ATOM 870 CD1 TYR A 327 38.338 -3.053 -17.984 1.00 40.93 C ATOM 871 CD2 TYR A 327 38.093 -5.163 -16.896 1.00 41.38 C ATOM 872 CE1 TYR A 327 38.273 -2.392 -16.739 1.00 35.17 C ATOM 873 CE2 TYR A 327 38.021 -4.527 -15.664 1.00 47.02 C ATOM 874 CZ TYR A 327 38.099 -3.135 -15.596 1.00 41.45 C ATOM 875 OH TYR A 327 37.977 -2.564 -14.342 1.00 42.07 O ATOM 876 HH TYR A 327 38.048 -1.580 -14.421 1.00 0.00 H ATOM 877 H TYR A 327 36.467 -6.796 -18.552 1.00 0.00 H ATOM 878 N ASN A 328 37.693 -6.085 -22.537 1.00 60.62 N ATOM 879 CA ASN A 328 38.029 -7.133 -23.559 1.00 73.07 C ATOM 880 C ASN A 328 39.559 -7.329 -23.904 1.00 74.81 C ATOM 881 O ASN A 328 40.362 -7.409 -22.965 1.00 67.54 O ATOM 882 CB ASN A 328 37.025 -7.185 -24.773 1.00 82.04 C ATOM 883 CG ASN A 328 36.035 -8.391 -24.712 1.00 87.62 C ATOM 884 OD1 ASN A 328 35.489 -8.725 -23.646 1.00 82.28 O ATOM 885 ND2 ASN A 328 35.792 -9.033 -25.876 1.00 70.76 N ATOM 886 HD22 ASN A 328 36.267 -8.726 -26.748 1.00 0.00 H ATOM 887 HD21 ASN A 328 35.130 -9.835 -25.899 1.00 0.00 H ATOM 888 H ASN A 328 37.739 -5.073 -22.772 1.00 0.00 H ATOM 889 N PRO A 329 39.962 -7.400 -25.213 1.00 74.08 N ATOM 890 CA PRO A 329 41.332 -7.823 -25.594 1.00 76.42 C ATOM 891 C PRO A 329 42.461 -7.508 -24.608 1.00 75.99 C ATOM 892 O PRO A 329 43.586 -7.186 -25.028 1.00 79.21 O ATOM 893 CB PRO A 329 41.589 -7.078 -26.923 1.00 78.06 C ATOM 894 CG PRO A 329 40.257 -6.621 -27.425 1.00 78.90 C ATOM 895 CD PRO A 329 39.192 -7.028 -26.421 1.00 81.68 C TER 896 PRO A 329 ATOM 897 N PRO A 334 37.234 -1.225 -21.075 1.00 44.02 N ATOM 898 CA PRO A 334 35.996 -1.604 -20.419 1.00 50.71 C ATOM 899 C PRO A 334 34.977 -1.775 -21.473 1.00 49.51 C ATOM 900 O PRO A 334 34.848 -0.890 -22.293 1.00 54.92 O ATOM 901 CB PRO A 334 35.655 -0.371 -19.581 1.00 51.85 C ATOM 902 CG PRO A 334 36.992 0.183 -19.220 1.00 55.10 C ATOM 903 CD PRO A 334 37.842 -0.036 -20.452 1.00 54.57 C ATOM 904 HN2 PRO A 334 37.036 -1.017 -22.075 1.00 0.00 H ATOM 905 HN1 PRO A 334 37.904 -2.018 -21.013 1.00 0.00 H ATOM 906 N GLN A 335 34.289 -2.909 -21.491 1.00 42.78 N ATOM 907 CA GLN A 335 33.234 -3.140 -22.484 1.00 47.87 C ATOM 908 C GLN A 335 31.825 -3.042 -21.912 1.00 44.51 C ATOM 909 O GLN A 335 30.868 -2.710 -22.630 1.00 48.81 O ATOM 910 CB GLN A 335 33.395 -4.517 -23.150 1.00 53.92 C ATOM 911 CG GLN A 335 34.816 -4.818 -23.611 1.00 63.30 C ATOM 912 CD GLN A 335 35.460 -3.611 -24.302 1.00 68.16 C ATOM 913 OE1 GLN A 335 34.871 -3.009 -25.214 1.00 69.51 O ATOM 914 NE2 GLN A 335 36.656 -3.231 -23.842 1.00 63.28 N ATOM 915 HE22 GLN A 335 37.112 -3.766 -23.076 1.00 0.00 H ATOM 916 HE21 GLN A 335 37.130 -2.400 -24.250 1.00 0.00 H ATOM 917 H GLN A 335 34.501 -3.647 -20.789 1.00 0.00 H ATOM 918 N CYS A 336 31.671 -3.414 -20.649 1.00 39.29 N ATOM 919 CA CYS A 336 30.373 -3.281 -19.972 1.00 39.28 C ATOM 920 C CYS A 336 30.441 -3.630 -18.485 1.00 35.87 C ATOM 921 O CYS A 336 31.495 -4.057 -17.980 1.00 35.36 O ATOM 922 CB CYS A 336 29.254 -4.067 -20.696 1.00 37.60 C ATOM 923 SG CYS A 336 29.296 -5.892 -20.575 1.00 43.31 S ATOM 924 H CYS A 336 32.482 -3.806 -20.129 1.00 0.00 H ATOM 925 N ILE A 337 29.327 -3.420 -17.784 1.00 26.17 N ATOM 926 CA ILE A 337 29.251 -3.774 -16.398 1.00 23.21 C ATOM 927 C ILE A 337 28.159 -4.754 -16.186 1.00 24.85 C ATOM 928 O ILE A 337 26.990 -4.533 -16.682 1.00 22.05 O ATOM 929 CB ILE A 337 29.107 -2.516 -15.473 1.00 26.44 C ATOM 930 CG1 ILE A 337 30.210 -1.486 -15.820 1.00 26.33 C ATOM 931 CG2 ILE A 337 29.102 -2.995 -14.022 1.00 22.78 C ATOM 932 CD1 ILE A 337 30.091 -0.083 -15.182 1.00 26.72 C ATOM 933 H ILE A 337 28.501 -2.993 -18.250 1.00 0.00 H ATOM 934 N MET A 338 28.501 -5.849 -15.493 1.00 24.99 N ATOM 935 CA MET A 338 27.505 -6.853 -15.112 1.00 27.56 C ATOM 936 C MET A 338 27.150 -6.598 -13.701 1.00 29.28 C ATOM 937 O MET A 338 28.022 -6.410 -12.851 1.00 32.48 O ATOM 938 CB MET A 338 27.964 -8.323 -15.255 1.00 29.51 C ATOM 939 CG MET A 338 28.116 -8.847 -16.674 1.00 35.57 C ATOM 940 SD MET A 338 26.576 -8.942 -17.616 1.00 44.18 S ATOM 941 CE MET A 338 25.471 -9.817 -16.479 1.00 47.44 C ATOM 942 H MET A 338 29.495 -5.989 -15.220 1.00 0.00 H ATOM 943 N CYS A 339 25.845 -6.568 -13.446 1.00 26.53 N ATOM 944 CA CYS A 339 25.342 -6.338 -12.160 1.00 25.37 C ATOM 945 C CYS A 339 24.499 -7.503 -11.729 1.00 26.17 C ATOM 946 O CYS A 339 23.463 -7.910 -12.395 1.00 27.44 O ATOM 947 CB CYS A 339 24.539 -5.027 -12.089 1.00 26.83 C ATOM 948 SG CYS A 339 25.546 -3.536 -12.139 1.00 29.44 S ATOM 949 H CYS A 339 25.176 -6.720 -14.228 1.00 0.00 H ATOM 950 N VAL A 340 24.869 -8.022 -10.561 1.00 25.05 N ATOM 951 CA VAL A 340 24.023 -9.032 -9.898 1.00 25.02 C ATOM 952 C VAL A 340 23.241 -8.282 -8.811 1.00 27.74 C ATOM 953 O VAL A 340 23.838 -7.829 -7.878 1.00 26.38 O ATOM 954 CB VAL A 340 24.797 -10.261 -9.330 1.00 27.22 C ATOM 955 CG1 VAL A 340 23.774 -11.283 -8.807 1.00 27.88 C ATOM 956 CG2 VAL A 340 25.616 -10.886 -10.427 1.00 24.01 C ATOM 957 H VAL A 340 25.757 -7.715 -10.115 1.00 0.00 H ATOM 958 N ASN A 341 21.902 -8.212 -8.895 1.00 27.69 N ATOM 959 CA ASN A 341 21.175 -7.277 -8.035 1.00 25.22 C ATOM 960 C ASN A 341 20.288 -8.096 -7.117 1.00 27.79 C ATOM 961 O ASN A 341 19.552 -8.950 -7.593 1.00 29.51 O ATOM 962 CB ASN A 341 20.352 -6.234 -8.846 1.00 26.48 C ATOM 963 CG ASN A 341 21.142 -5.607 -9.959 1.00 25.08 C ATOM 964 OD1 ASN A 341 22.028 -4.802 -9.713 1.00 30.62 O ATOM 965 ND2 ASN A 341 20.813 -5.952 -11.208 1.00 26.55 N ATOM 966 HD22 ASN A 341 20.052 -6.641 -11.374 1.00 0.00 H ATOM 967 HD21 ASN A 341 21.318 -5.531 -12.014 1.00 0.00 H ATOM 968 H ASN A 341 21.386 -8.817 -9.565 1.00 0.00 H ATOM 969 N TYR A 342 20.422 -7.894 -5.802 1.00 28.20 N ATOM 970 CA TYR A 342 19.619 -8.637 -4.808 1.00 26.43 C ATOM 971 C TYR A 342 18.703 -7.692 -4.073 1.00 27.06 C ATOM 972 O TYR A 342 19.150 -6.690 -3.531 1.00 29.20 O ATOM 973 CB TYR A 342 20.508 -9.328 -3.790 1.00 24.97 C ATOM 974 CG TYR A 342 19.787 -10.128 -2.716 1.00 21.42 C ATOM 975 CD1 TYR A 342 19.119 -11.288 -3.016 1.00 21.40 C ATOM 976 CD2 TYR A 342 19.848 -9.743 -1.399 1.00 23.92 C ATOM 977 CE1 TYR A 342 18.479 -12.020 -2.043 1.00 22.44 C ATOM 978 CE2 TYR A 342 19.227 -10.483 -0.410 1.00 22.34 C ATOM 979 CZ TYR A 342 18.544 -11.594 -0.741 1.00 22.72 C ATOM 980 OH TYR A 342 17.939 -12.306 0.265 1.00 24.15 O ATOM 981 HH TYR A 342 17.477 -13.092 -0.121 1.00 0.00 H ATOM 982 H TYR A 342 21.113 -7.192 -5.468 1.00 0.00 H ATOM 983 N VAL A 343 17.422 -8.028 -4.053 1.00 25.63 N ATOM 984 CA VAL A 343 16.436 -7.170 -3.437 1.00 27.94 C ATOM 985 C VAL A 343 16.396 -7.570 -1.973 1.00 31.92 C ATOM 986 O VAL A 343 16.079 -8.713 -1.611 1.00 32.83 O ATOM 987 CB VAL A 343 15.050 -7.408 -4.042 1.00 27.93 C ATOM 988 CG1 VAL A 343 14.004 -6.590 -3.318 1.00 33.51 C ATOM 989 CG2 VAL A 343 15.076 -7.059 -5.503 1.00 29.47 C ATOM 990 H VAL A 343 17.121 -8.924 -4.488 1.00 0.00 H ATOM 991 N LEU A 344 16.738 -6.600 -1.158 1.00 35.68 N ATOM 992 CA LEU A 344 16.620 -6.658 0.286 1.00 39.17 C ATOM 993 C LEU A 344 15.199 -6.554 0.846 1.00 44.20 C ATOM 994 O LEU A 344 14.927 -7.168 1.858 1.00 52.22 O ATOM 995 CB LEU A 344 17.548 -5.595 0.863 1.00 36.95 C ATOM 996 CG LEU A 344 18.973 -5.998 0.523 1.00 37.65 C ATOM 997 CD1 LEU A 344 20.060 -4.963 0.869 1.00 37.70 C ATOM 998 CD2 LEU A 344 19.191 -7.307 1.235 1.00 40.44 C ATOM 999 H LEU A 344 17.121 -5.728 -1.577 1.00 0.00 H ATOM 1000 N SER A 345 14.296 -5.834 0.182 1.00 50.13 N ATOM 1001 CA SER A 345 13.000 -5.402 0.750 1.00 55.88 C ATOM 1002 C SER A 345 11.803 -5.522 -0.208 1.00 66.25 C ATOM 1003 O SER A 345 12.006 -5.552 -1.427 1.00 65.20 O ATOM 1004 CB SER A 345 13.103 -3.918 1.066 1.00 58.13 C ATOM 1005 OG SER A 345 12.975 -3.170 -0.134 1.00 55.97 O ATOM 1006 HG SER A 345 12.096 -3.360 -0.548 1.00 0.00 H ATOM 1007 H SER A 345 14.516 -5.558 -0.796 1.00 0.00 H ATOM 1008 N GLU A 346 10.566 -5.531 0.329 1.00 71.41 N ATOM 1009 CA GLU A 346 9.338 -5.358 -0.506 1.00 73.86 C ATOM 1010 C GLU A 346 8.840 -3.913 -0.433 1.00 65.79 C ATOM 1011 O GLU A 346 9.518 -3.005 -0.918 1.00 63.06 O ATOM 1012 CB GLU A 346 8.169 -6.332 -0.179 1.00 75.86 C ATOM 1013 CG GLU A 346 8.369 -7.417 0.889 1.00 74.73 C ATOM 1014 CD GLU A 346 9.488 -8.424 0.611 1.00 76.19 C ATOM 1015 OE1 GLU A 346 9.374 -9.248 -0.343 1.00 68.27 O ATOM 1016 OE2 GLU A 346 10.470 -8.408 1.396 1.00 68.47 O ATOM 1017 H GLU A 346 10.463 -5.662 1.356 1.00 0.00 H TER 1018 GLU A 346 ATOM 1019 N CYS B 358 18.304 42.271 -5.846 1.00 62.51 N ATOM 1020 CA CYS B 358 19.198 41.086 -5.737 1.00 62.09 C ATOM 1021 C CYS B 358 19.111 40.221 -6.996 1.00 63.20 C ATOM 1022 O CYS B 358 18.025 39.828 -7.420 1.00 59.93 O ATOM 1023 CB CYS B 358 18.838 40.273 -4.478 1.00 61.98 C ATOM 1024 SG CYS B 358 19.830 38.783 -4.117 1.00 58.23 S ATOM 1025 HN3 CYS B 358 17.321 41.952 -5.967 1.00 0.00 H ATOM 1026 HN2 CYS B 358 18.588 42.843 -6.667 1.00 0.00 H ATOM 1027 HN1 CYS B 358 18.380 42.842 -4.980 1.00 0.00 H ATOM 1028 N GLN B 359 20.263 39.942 -7.603 1.00 73.26 N ATOM 1029 CA GLN B 359 20.341 39.045 -8.769 1.00 72.37 C ATOM 1030 C GLN B 359 19.733 37.683 -8.446 1.00 71.38 C ATOM 1031 O GLN B 359 19.955 37.151 -7.349 1.00 62.01 O ATOM 1032 CB GLN B 359 21.805 38.841 -9.179 1.00 73.70 C ATOM 1033 CG GLN B 359 22.259 39.677 -10.371 1.00 84.68 C ATOM 1034 CD GLN B 359 21.845 41.149 -10.302 1.00 84.93 C ATOM 1035 OE1 GLN B 359 20.844 41.551 -10.906 1.00 88.81 O ATOM 1036 NE2 GLN B 359 22.615 41.958 -9.570 1.00 75.73 N ATOM 1037 HE22 GLN B 359 23.449 41.578 -9.078 1.00 0.00 H ATOM 1038 HE21 GLN B 359 22.381 42.968 -9.492 1.00 0.00 H ATOM 1039 H GLN B 359 21.138 40.372 -7.241 1.00 0.00 H ATOM 1040 N PRO B 360 18.922 37.134 -9.365 1.00 69.55 N ATOM 1041 CA PRO B 360 18.653 35.693 -9.207 1.00 68.87 C ATOM 1042 C PRO B 360 19.925 34.836 -9.444 1.00 52.85 C ATOM 1043 O PRO B 360 20.806 35.251 -10.174 1.00 55.12 O ATOM 1044 CB PRO B 360 17.551 35.442 -10.252 1.00 68.98 C ATOM 1045 CG PRO B 360 16.785 36.743 -10.271 1.00 66.31 C ATOM 1046 CD PRO B 360 17.872 37.796 -10.173 1.00 75.28 C ATOM 1047 N THR B 361 20.055 33.686 -8.802 1.00 40.50 N ATOM 1048 CA THR B 361 21.213 32.842 -9.124 1.00 47.31 C ATOM 1049 C THR B 361 20.851 31.954 -10.323 1.00 45.25 C ATOM 1050 O THR B 361 19.735 31.405 -10.394 1.00 41.56 O ATOM 1051 CB THR B 361 21.636 31.929 -7.973 1.00 53.06 C ATOM 1052 OG1 THR B 361 21.343 32.549 -6.717 1.00 70.16 O ATOM 1053 CG2 THR B 361 23.136 31.601 -8.060 1.00 53.79 C ATOM 1054 HG1 THR B 361 21.621 31.948 -5.981 1.00 0.00 H ATOM 1055 H THR B 361 19.357 33.389 -8.090 1.00 0.00 H ATOM 1056 N ARG B 362 21.794 31.836 -11.252 1.00 39.59 N ATOM 1057 CA ARG B 362 21.562 31.212 -12.550 1.00 36.59 C ATOM 1058 C ARG B 362 22.840 30.910 -13.373 1.00 35.76 C ATOM 1059 O ARG B 362 23.886 31.634 -13.303 1.00 35.33 O ATOM 1060 CB ARG B 362 20.598 32.037 -13.373 1.00 34.57 C ATOM 1061 CG ARG B 362 21.264 32.979 -14.344 1.00 39.93 C ATOM 1062 CD ARG B 362 20.265 33.611 -15.287 1.00 40.69 C ATOM 1063 NE ARG B 362 20.880 34.828 -15.787 1.00 44.81 N ATOM 1064 CZ ARG B 362 20.680 36.027 -15.259 1.00 45.62 C ATOM 1065 NH1 ARG B 362 21.328 37.077 -15.741 1.00 40.89 N ATOM 1066 NH2 ARG B 362 19.837 36.180 -14.235 1.00 49.03 N ATOM 1067 HE ARG B 362 21.515 34.754 -16.608 1.00 0.00 H ATOM 1068 HH12 ARG B 362 21.172 38.019 -15.328 1.00 0.00 H ATOM 1069 HH11 ARG B 362 21.992 36.960 -16.532 1.00 0.00 H ATOM 1070 HH22 ARG B 362 19.684 37.123 -13.824 1.00 0.00 H ATOM 1071 HH21 ARG B 362 19.334 35.356 -13.848 1.00 0.00 H ATOM 1072 H ARG B 362 22.743 32.206 -11.044 1.00 0.00 H ATOM 1073 N PHE B 363 22.744 29.832 -14.153 1.00 32.26 N ATOM 1074 CA PHE B 363 23.804 29.432 -15.068 1.00 27.89 C ATOM 1075 C PHE B 363 23.259 28.909 -16.373 1.00 24.44 C ATOM 1076 O PHE B 363 22.055 28.534 -16.511 1.00 23.93 O ATOM 1077 CB PHE B 363 24.733 28.400 -14.419 1.00 28.52 C ATOM 1078 CG PHE B 363 24.122 27.006 -14.277 1.00 30.21 C ATOM 1079 CD1 PHE B 363 23.315 26.674 -13.175 1.00 34.50 C ATOM 1080 CD2 PHE B 363 24.353 26.027 -15.242 1.00 28.07 C ATOM 1081 CE1 PHE B 363 22.781 25.373 -13.034 1.00 33.54 C ATOM 1082 CE2 PHE B 363 23.820 24.748 -15.138 1.00 29.93 C ATOM 1083 CZ PHE B 363 23.031 24.425 -14.025 1.00 35.93 C ATOM 1084 H PHE B 363 21.880 29.256 -14.106 1.00 0.00 H ATOM 1085 N ILE B 364 24.074 29.112 -17.384 1.00 22.39 N ATOM 1086 CA ILE B 364 23.810 28.625 -18.709 1.00 23.78 C ATOM 1087 C ILE B 364 24.365 27.204 -18.881 1.00 24.01 C ATOM 1088 O ILE B 364 25.480 26.847 -18.430 1.00 23.37 O ATOM 1089 CB ILE B 364 24.505 29.505 -19.737 1.00 26.34 C ATOM 1090 CG1 ILE B 364 23.990 30.935 -19.627 1.00 27.09 C ATOM 1091 CG2 ILE B 364 24.390 28.851 -21.114 1.00 26.29 C ATOM 1092 CD1 ILE B 364 24.996 31.926 -20.132 1.00 35.32 C ATOM 1093 H ILE B 364 24.949 29.649 -17.217 1.00 0.00 H ATOM 1094 N SER B 365 23.607 26.378 -19.554 1.00 24.34 N ATOM 1095 CA SER B 365 24.132 25.074 -20.018 1.00 26.20 C ATOM 1096 C SER B 365 23.702 24.786 -21.455 1.00 26.20 C ATOM 1097 O SER B 365 22.733 25.411 -21.947 1.00 26.84 O ATOM 1098 CB SER B 365 23.611 23.974 -19.101 1.00 24.72 C ATOM 1099 OG SER B 365 22.148 23.984 -19.179 1.00 21.79 O ATOM 1100 HG SER B 365 21.867 23.815 -20.113 1.00 0.00 H ATOM 1101 H SER B 365 22.623 26.640 -19.766 1.00 0.00 H ATOM 1102 N ARG B 366 24.406 23.852 -22.115 1.00 25.24 N ATOM 1103 CA ARG B 366 24.031 23.369 -23.481 1.00 27.47 C ATOM 1104 C ARG B 366 23.932 21.856 -23.349 1.00 25.24 C ATOM 1105 O ARG B 366 24.711 21.247 -22.605 1.00 29.48 O ATOM 1106 CB ARG B 366 25.059 23.807 -24.538 1.00 30.15 C ATOM 1107 CG ARG B 366 24.944 23.058 -25.842 1.00 42.12 C ATOM 1108 CD ARG B 366 26.023 23.403 -26.880 1.00 49.02 C ATOM 1109 NE ARG B 366 27.179 22.514 -26.814 1.00 57.88 N ATOM 1110 CZ ARG B 366 28.448 22.921 -26.823 1.00 60.95 C ATOM 1111 NH1 ARG B 366 28.741 24.224 -26.915 1.00 60.30 N ATOM 1112 NH2 ARG B 366 29.424 22.016 -26.750 1.00 61.56 N ATOM 1113 HE ARG B 366 27.000 21.491 -26.756 1.00 0.00 H ATOM 1114 HH12 ARG B 366 29.734 24.535 -26.921 1.00 0.00 H ATOM 1115 HH11 ARG B 366 27.976 24.926 -26.980 1.00 0.00 H ATOM 1116 HH22 ARG B 366 30.418 22.322 -26.756 1.00 0.00 H ATOM 1117 HH21 ARG B 366 29.191 21.004 -26.687 1.00 0.00 H ATOM 1118 H ARG B 366 25.248 23.447 -21.657 1.00 0.00 H ATOM 1119 N HIS B 367 22.963 21.291 -24.044 1.00 23.77 N ATOM 1120 CA HIS B 367 22.668 19.880 -24.039 1.00 25.32 C ATOM 1121 C HIS B 367 22.456 19.367 -25.445 1.00 27.01 C ATOM 1122 O HIS B 367 22.083 20.132 -26.356 1.00 28.66 O ATOM 1123 CB HIS B 367 21.391 19.606 -23.279 1.00 21.85 C ATOM 1124 CG HIS B 367 21.373 20.152 -21.906 1.00 24.12 C ATOM 1125 ND1 HIS B 367 21.483 19.367 -20.804 1.00 25.84 N ATOM 1126 CD2 HIS B 367 21.267 21.484 -21.439 1.00 25.40 C ATOM 1127 CE1 HIS B 367 21.436 20.151 -19.698 1.00 24.01 C ATOM 1128 NE2 HIS B 367 21.330 21.440 -20.096 1.00 26.58 N ATOM 1129 H HIS B 367 22.371 21.907 -24.637 1.00 0.00 H ATOM 1130 N ASN B 368 22.592 18.044 -25.622 1.00 24.84 N ATOM 1131 CA ASN B 368 22.232 17.449 -26.840 1.00 29.74 C ATOM 1132 C ASN B 368 20.725 17.150 -26.732 1.00 29.08 C ATOM 1133 O ASN B 368 20.085 17.433 -25.694 1.00 27.55 O ATOM 1134 CB ASN B 368 23.126 16.236 -27.121 1.00 33.39 C ATOM 1135 CG ASN B 368 23.001 15.171 -26.067 1.00 38.80 C ATOM 1136 OD1 ASN B 368 21.932 14.997 -25.426 1.00 39.38 O ATOM 1137 ND2 ASN B 368 24.069 14.419 -25.903 1.00 44.62 N ATOM 1138 HD22 ASN B 368 24.927 14.607 -26.459 1.00 0.00 H ATOM 1139 HD21 ASN B 368 24.054 13.637 -25.217 1.00 0.00 H ATOM 1140 H ASN B 368 22.967 17.456 -24.851 1.00 0.00 H ATOM 1141 N ILE B 369 20.126 16.651 -27.790 1.00 34.20 N ATOM 1142 CA ILE B 369 18.658 16.557 -27.785 1.00 38.71 C ATOM 1143 C ILE B 369 18.164 15.487 -26.774 1.00 39.84 C ATOM 1144 O ILE B 369 16.994 15.442 -26.402 1.00 34.59 O ATOM 1145 CB ILE B 369 18.076 16.384 -29.234 1.00 45.30 C ATOM 1146 CG1 ILE B 369 18.476 15.015 -29.817 1.00 52.42 C ATOM 1147 CG2 ILE B 369 18.523 17.533 -30.155 1.00 45.89 C ATOM 1148 CD1 ILE B 369 17.661 14.543 -31.019 1.00 52.96 C ATOM 1149 H ILE B 369 20.677 16.330 -28.612 1.00 0.00 H ATOM 1150 N GLU B 370 19.078 14.621 -26.342 1.00 42.63 N ATOM 1151 CA GLU B 370 18.804 13.564 -25.375 1.00 46.07 C ATOM 1152 C GLU B 370 18.814 14.095 -23.919 1.00 42.79 C ATOM 1153 O GLU B 370 18.375 13.409 -22.999 1.00 44.36 O ATOM 1154 CB GLU B 370 19.856 12.450 -25.605 1.00 51.25 C ATOM 1155 CG GLU B 370 19.722 11.151 -24.818 1.00 65.56 C ATOM 1156 CD GLU B 370 21.063 10.406 -24.677 1.00 75.09 C ATOM 1157 OE1 GLU B 370 21.874 10.381 -25.662 1.00 71.01 O ATOM 1158 OE2 GLU B 370 21.315 9.860 -23.562 1.00 67.51 O ATOM 1159 H GLU B 370 20.045 14.703 -26.716 1.00 0.00 H ATOM 1160 N GLY B 371 19.330 15.304 -23.695 1.00 35.00 N ATOM 1161 CA GLY B 371 19.378 15.876 -22.332 1.00 28.17 C ATOM 1162 C GLY B 371 20.798 15.909 -21.723 1.00 29.58 C ATOM 1163 O GLY B 371 20.997 16.403 -20.621 1.00 32.53 O ATOM 1164 H GLY B 371 19.706 15.855 -24.493 1.00 0.00 H ATOM 1165 N ILE B 372 21.763 15.325 -22.402 1.00 26.33 N ATOM 1166 CA ILE B 372 23.141 15.203 -21.827 1.00 25.13 C ATOM 1167 C ILE B 372 23.741 16.574 -21.801 1.00 25.46 C ATOM 1168 O ILE B 372 23.704 17.264 -22.850 1.00 29.11 O ATOM 1169 CB ILE B 372 24.020 14.334 -22.726 1.00 27.87 C ATOM 1170 CG1 ILE B 372 23.475 12.912 -22.806 1.00 32.49 C ATOM 1171 CG2 ILE B 372 25.519 14.393 -22.309 1.00 26.14 C ATOM 1172 CD1 ILE B 372 23.271 12.279 -21.446 1.00 36.97 C ATOM 1173 H ILE B 372 21.566 14.944 -23.349 1.00 0.00 H ATOM 1174 N PHE B 373 24.293 17.014 -20.664 1.00 29.51 N ATOM 1175 CA PHE B 373 25.067 18.284 -20.575 1.00 29.74 C ATOM 1176 C PHE B 373 26.314 18.217 -21.462 1.00 34.85 C ATOM 1177 O PHE B 373 27.193 17.410 -21.208 1.00 32.36 O ATOM 1178 CB PHE B 373 25.612 18.575 -19.152 1.00 29.29 C ATOM 1179 CG PHE B 373 24.605 19.074 -18.128 1.00 27.97 C ATOM 1180 CD1 PHE B 373 24.013 18.163 -17.215 1.00 28.12 C ATOM 1181 CD2 PHE B 373 24.311 20.427 -18.011 1.00 28.90 C ATOM 1182 CE1 PHE B 373 23.103 18.581 -16.237 1.00 31.02 C ATOM 1183 CE2 PHE B 373 23.440 20.875 -17.007 1.00 30.04 C ATOM 1184 CZ PHE B 373 22.807 19.949 -16.136 1.00 31.48 C ATOM 1185 H PHE B 373 24.176 16.443 -19.803 1.00 0.00 H ATOM 1186 N THR B 374 26.449 19.137 -22.412 1.00 32.89 N ATOM 1187 CA THR B 374 27.611 19.205 -23.287 1.00 30.42 C ATOM 1188 C THR B 374 28.442 20.448 -23.019 1.00 34.08 C ATOM 1189 O THR B 374 29.580 20.510 -23.443 1.00 34.97 O ATOM 1190 CB THR B 374 27.196 19.254 -24.766 1.00 28.69 C ATOM 1191 OG1 THR B 374 26.291 20.354 -24.945 1.00 29.63 O ATOM 1192 CG2 THR B 374 26.579 17.957 -25.187 1.00 24.65 C ATOM 1193 HG1 THR B 374 25.494 20.221 -24.373 1.00 0.00 H ATOM 1194 H THR B 374 25.692 19.839 -22.536 1.00 0.00 H ATOM 1195 N PHE B 375 27.861 21.440 -22.308 1.00 32.81 N ATOM 1196 CA PHE B 375 28.564 22.626 -21.866 1.00 29.73 C ATOM 1197 C PHE B 375 27.924 23.149 -20.533 1.00 29.35 C ATOM 1198 O PHE B 375 26.698 23.208 -20.388 1.00 27.94 O ATOM 1199 CB PHE B 375 28.487 23.735 -22.921 1.00 31.14 C ATOM 1200 CG PHE B 375 29.001 25.022 -22.408 1.00 33.35 C ATOM 1201 CD1 PHE B 375 30.369 25.263 -22.393 1.00 40.31 C ATOM 1202 CD2 PHE B 375 28.149 25.956 -21.839 1.00 33.64 C ATOM 1203 CE1 PHE B 375 30.874 26.445 -21.863 1.00 39.94 C ATOM 1204 CE2 PHE B 375 28.638 27.154 -21.304 1.00 35.96 C ATOM 1205 CZ PHE B 375 30.011 27.382 -21.300 1.00 39.67 C ATOM 1206 H PHE B 375 26.854 21.346 -22.065 1.00 0.00 H ATOM 1207 N VAL B 376 28.718 23.526 -19.551 1.00 25.47 N ATOM 1208 CA VAL B 376 28.167 24.072 -18.250 1.00 28.07 C ATOM 1209 C VAL B 376 28.915 25.330 -17.866 1.00 30.87 C ATOM 1210 O VAL B 376 30.145 25.266 -17.608 1.00 30.24 O ATOM 1211 CB VAL B 376 28.203 23.070 -17.039 1.00 30.97 C ATOM 1212 CG1 VAL B 376 27.404 23.618 -15.865 1.00 30.70 C ATOM 1213 CG2 VAL B 376 27.634 21.702 -17.377 1.00 31.31 C ATOM 1214 H VAL B 376 29.748 23.447 -19.672 1.00 0.00 H ATOM 1215 N ASP B 377 28.192 26.456 -17.777 1.00 30.76 N ATOM 1216 CA ASP B 377 28.748 27.721 -17.269 1.00 31.14 C ATOM 1217 C ASP B 377 29.054 27.613 -15.740 1.00 35.52 C ATOM 1218 O ASP B 377 28.286 27.023 -14.989 1.00 32.67 O ATOM 1219 CB ASP B 377 27.866 28.896 -17.754 1.00 33.92 C ATOM 1220 CG ASP B 377 27.598 30.009 -16.718 1.00 32.77 C ATOM 1221 OD1 ASP B 377 28.515 30.481 -16.025 1.00 30.34 O ATOM 1222 OD2 ASP B 377 26.428 30.512 -16.695 1.00 29.85 O ATOM 1223 H ASP B 377 27.197 26.435 -18.079 1.00 0.00 H ATOM 1224 N HIS B 378 30.220 28.102 -15.335 1.00 29.82 N ATOM 1225 CA HIS B 378 30.769 27.948 -13.970 1.00 35.31 C ATOM 1226 C HIS B 378 29.948 28.640 -12.902 1.00 32.11 C ATOM 1227 O HIS B 378 30.061 28.336 -11.719 1.00 34.72 O ATOM 1228 CB HIS B 378 32.289 28.273 -13.950 1.00 34.20 C ATOM 1229 CG HIS B 378 32.871 28.530 -12.552 1.00 40.04 C ATOM 1230 ND1 HIS B 378 33.737 27.677 -11.950 1.00 44.84 N ATOM 1231 CD2 HIS B 378 32.709 29.602 -11.677 1.00 41.98 C ATOM 1232 CE1 HIS B 378 34.072 28.154 -10.743 1.00 41.12 C ATOM 1233 NE2 HIS B 378 33.431 29.333 -10.574 1.00 45.21 N ATOM 1234 H HIS B 378 30.788 28.631 -16.027 1.00 0.00 H ATOM 1235 N ARG B 379 29.060 29.552 -13.291 1.00 33.01 N ATOM 1236 CA ARG B 379 28.040 30.050 -12.329 1.00 33.07 C ATOM 1237 C ARG B 379 27.174 28.973 -11.636 1.00 34.90 C ATOM 1238 O ARG B 379 26.468 29.269 -10.630 1.00 34.04 O ATOM 1239 CB ARG B 379 27.171 31.121 -12.992 1.00 34.55 C ATOM 1240 CG ARG B 379 27.888 32.479 -13.133 1.00 35.72 C ATOM 1241 CD ARG B 379 26.964 33.523 -13.747 1.00 34.87 C ATOM 1242 NE ARG B 379 26.500 33.025 -15.035 1.00 36.31 N ATOM 1243 CZ ARG B 379 25.613 33.619 -15.799 1.00 27.48 C ATOM 1244 NH1 ARG B 379 25.120 34.778 -15.448 1.00 27.18 N ATOM 1245 NH2 ARG B 379 25.264 33.066 -16.939 1.00 29.46 N ATOM 1246 HE ARG B 379 26.903 32.129 -15.376 1.00 0.00 H ATOM 1247 HH12 ARG B 379 24.417 35.249 -16.053 1.00 0.00 H ATOM 1248 HH11 ARG B 379 25.431 35.229 -14.564 1.00 0.00 H ATOM 1249 HH22 ARG B 379 24.562 33.531 -17.549 1.00 0.00 H ATOM 1250 HH21 ARG B 379 25.690 32.163 -17.231 1.00 0.00 H ATOM 1251 H ARG B 379 29.079 29.916 -14.265 1.00 0.00 H ATOM 1252 N CYS B 380 27.184 27.762 -12.211 1.00 30.30 N ATOM 1253 CA CYS B 380 26.580 26.582 -11.611 1.00 31.02 C ATOM 1254 C CYS B 380 27.041 26.255 -10.189 1.00 35.59 C ATOM 1255 O CYS B 380 26.256 25.700 -9.395 1.00 31.60 O ATOM 1256 CB CYS B 380 26.787 25.332 -12.502 1.00 34.70 C ATOM 1257 SG CYS B 380 28.462 24.610 -12.557 1.00 32.41 S ATOM 1258 H CYS B 380 27.649 27.660 -13.136 1.00 0.00 H ATOM 1259 N VAL B 381 28.311 26.549 -9.853 1.00 34.71 N ATOM 1260 CA VAL B 381 28.792 26.206 -8.502 1.00 39.29 C ATOM 1261 C VAL B 381 27.964 26.879 -7.413 1.00 32.35 C ATOM 1262 O VAL B 381 27.606 26.255 -6.411 1.00 38.68 O ATOM 1263 CB VAL B 381 30.271 26.611 -8.269 1.00 42.43 C ATOM 1264 CG1 VAL B 381 30.726 26.116 -6.907 1.00 45.33 C ATOM 1265 CG2 VAL B 381 31.184 26.015 -9.325 1.00 36.93 C ATOM 1266 H VAL B 381 28.944 27.011 -10.537 1.00 0.00 H ATOM 1267 N ALA B 382 27.698 28.154 -7.590 1.00 28.22 N ATOM 1268 CA ALA B 382 26.969 28.929 -6.628 1.00 34.03 C ATOM 1269 C ALA B 382 25.452 28.681 -6.761 1.00 34.11 C ATOM 1270 O ALA B 382 24.679 28.847 -5.809 1.00 37.50 O ATOM 1271 CB ALA B 382 27.262 30.397 -6.866 1.00 33.24 C ATOM 1272 H ALA B 382 28.028 28.618 -8.460 1.00 0.00 H ATOM 1273 N THR B 383 25.027 28.295 -7.943 1.00 30.21 N ATOM 1274 CA THR B 383 23.610 27.960 -8.143 1.00 32.29 C ATOM 1275 C THR B 383 23.256 26.557 -7.573 1.00 34.52 C ATOM 1276 O THR B 383 22.249 26.401 -6.891 1.00 33.54 O ATOM 1277 CB THR B 383 23.246 27.884 -9.651 1.00 31.71 C ATOM 1278 OG1 THR B 383 23.817 28.996 -10.362 1.00 34.34 O ATOM 1279 CG2 THR B 383 21.684 27.933 -9.815 1.00 35.37 C ATOM 1280 HG1 THR B 383 24.802 28.976 -10.266 1.00 0.00 H ATOM 1281 H THR B 383 25.694 28.226 -8.738 1.00 0.00 H ATOM 1282 N VAL B 384 23.973 25.507 -7.987 1.00 28.66 N ATOM 1283 CA VAL B 384 23.584 24.183 -7.558 1.00 29.15 C ATOM 1284 C VAL B 384 24.710 23.474 -6.805 1.00 31.35 C ATOM 1285 O VAL B 384 24.612 22.280 -6.462 1.00 33.25 O ATOM 1286 CB VAL B 384 22.950 23.312 -8.686 1.00 28.93 C ATOM 1287 CG1 VAL B 384 21.602 23.864 -9.191 1.00 24.30 C ATOM 1288 CG2 VAL B 384 23.876 23.060 -9.838 1.00 21.72 C ATOM 1289 H VAL B 384 24.797 25.641 -8.607 1.00 0.00 H ATOM 1290 N GLY B 385 25.818 24.180 -6.631 1.00 30.95 N ATOM 1291 CA GLY B 385 26.954 23.599 -5.926 1.00 35.10 C ATOM 1292 C GLY B 385 27.859 22.552 -6.546 1.00 36.39 C ATOM 1293 O GLY B 385 28.847 22.164 -5.929 1.00 37.68 O ATOM 1294 H GLY B 385 25.877 25.151 -6.998 1.00 0.00 H ATOM 1295 N TYR B 386 27.543 22.046 -7.721 1.00 31.88 N ATOM 1296 CA TYR B 386 28.451 21.145 -8.366 1.00 33.30 C ATOM 1297 C TYR B 386 29.462 21.971 -9.191 1.00 39.97 C ATOM 1298 O TYR B 386 29.116 23.046 -9.672 1.00 38.19 O ATOM 1299 CB TYR B 386 27.717 20.178 -9.291 1.00 32.42 C ATOM 1300 CG TYR B 386 26.718 19.215 -8.638 1.00 37.58 C ATOM 1301 CD1 TYR B 386 27.118 17.970 -8.107 1.00 36.08 C ATOM 1302 CD2 TYR B 386 25.359 19.520 -8.621 1.00 40.75 C ATOM 1303 CE1 TYR B 386 26.190 17.101 -7.522 1.00 39.50 C ATOM 1304 CE2 TYR B 386 24.416 18.657 -8.057 1.00 37.25 C ATOM 1305 CZ TYR B 386 24.825 17.451 -7.501 1.00 45.55 C ATOM 1306 OH TYR B 386 23.858 16.591 -6.979 1.00 43.52 O ATOM 1307 HH TYR B 386 23.368 17.050 -6.251 1.00 0.00 H ATOM 1308 H TYR B 386 26.643 22.298 -8.176 1.00 0.00 H ATOM 1309 N GLN B 387 30.687 21.467 -9.365 1.00 37.05 N ATOM 1310 CA GLN B 387 31.614 21.982 -10.409 1.00 38.60 C ATOM 1311 C GLN B 387 31.073 21.606 -11.777 1.00 36.87 C ATOM 1312 O GLN B 387 30.469 20.548 -11.908 1.00 37.29 O ATOM 1313 CB GLN B 387 32.967 21.253 -10.350 1.00 37.20 C ATOM 1314 CG GLN B 387 33.836 21.557 -9.136 1.00 46.93 C ATOM 1315 CD GLN B 387 34.010 23.045 -8.925 1.00 47.14 C ATOM 1316 OE1 GLN B 387 34.409 23.762 -9.837 1.00 51.77 O ATOM 1317 NE2 GLN B 387 33.655 23.527 -7.731 1.00 50.34 N ATOM 1318 HE22 GLN B 387 33.322 22.881 -6.987 1.00 0.00 H ATOM 1319 HE21 GLN B 387 33.711 24.549 -7.545 1.00 0.00 H ATOM 1320 H GLN B 387 31.003 20.689 -8.751 1.00 0.00 H ATOM 1321 N PRO B 388 31.339 22.439 -12.819 1.00 36.55 N ATOM 1322 CA PRO B 388 31.035 22.089 -14.203 1.00 37.07 C ATOM 1323 C PRO B 388 31.288 20.617 -14.591 1.00 37.71 C ATOM 1324 O PRO B 388 30.440 19.977 -15.226 1.00 34.06 O ATOM 1325 CB PRO B 388 31.995 22.993 -14.996 1.00 38.50 C ATOM 1326 CG PRO B 388 32.262 24.177 -14.139 1.00 39.73 C ATOM 1327 CD PRO B 388 31.822 23.830 -12.716 1.00 44.22 C ATOM 1328 N GLN B 389 32.423 20.042 -14.182 1.00 42.80 N ATOM 1329 CA GLN B 389 32.768 18.675 -14.643 1.00 39.61 C ATOM 1330 C GLN B 389 31.964 17.574 -13.944 1.00 40.89 C ATOM 1331 O GLN B 389 31.904 16.424 -14.428 1.00 41.28 O ATOM 1332 CB GLN B 389 34.299 18.431 -14.584 1.00 45.62 C ATOM 1333 CG GLN B 389 34.989 18.856 -13.293 1.00 58.85 C ATOM 1334 CD GLN B 389 35.120 20.377 -13.074 1.00 63.13 C ATOM 1335 OE1 GLN B 389 34.513 21.189 -13.774 1.00 65.55 O ATOM 1336 NE2 GLN B 389 35.905 20.760 -12.062 1.00 67.96 N ATOM 1337 HE22 GLN B 389 36.403 20.047 -11.491 1.00 0.00 H ATOM 1338 HE21 GLN B 389 36.018 21.771 -11.845 1.00 0.00 H ATOM 1339 H GLN B 389 33.064 20.552 -13.541 1.00 0.00 H ATOM 1340 N GLU B 390 31.312 17.913 -12.823 1.00 38.11 N ATOM 1341 CA GLU B 390 30.425 16.943 -12.172 1.00 38.33 C ATOM 1342 C GLU B 390 29.096 16.899 -12.933 1.00 39.17 C ATOM 1343 O GLU B 390 28.276 15.968 -12.781 1.00 37.92 O ATOM 1344 CB GLU B 390 30.208 17.314 -10.696 1.00 43.65 C ATOM 1345 CG GLU B 390 31.497 17.395 -9.888 1.00 43.97 C ATOM 1346 CD GLU B 390 31.308 18.043 -8.530 1.00 49.28 C ATOM 1347 OE1 GLU B 390 31.146 17.281 -7.564 1.00 53.40 O ATOM 1348 OE2 GLU B 390 31.338 19.295 -8.398 1.00 54.40 O ATOM 1349 H GLU B 390 31.435 18.862 -12.416 1.00 0.00 H ATOM 1350 N LEU B 391 28.879 17.911 -13.773 1.00 36.78 N ATOM 1351 CA LEU B 391 27.677 17.969 -14.632 1.00 34.70 C ATOM 1352 C LEU B 391 27.910 17.445 -16.102 1.00 35.86 C ATOM 1353 O LEU B 391 27.019 16.777 -16.692 1.00 30.68 O ATOM 1354 CB LEU B 391 27.154 19.426 -14.642 1.00 34.46 C ATOM 1355 CG LEU B 391 26.633 20.030 -13.290 1.00 38.68 C ATOM 1356 CD1 LEU B 391 25.702 21.228 -13.419 1.00 29.67 C ATOM 1357 CD2 LEU B 391 25.908 18.964 -12.509 1.00 34.95 C ATOM 1358 H LEU B 391 29.575 18.682 -13.826 1.00 0.00 H ATOM 1359 N LEU B 392 29.075 17.782 -16.685 1.00 38.09 N ATOM 1360 CA LEU B 392 29.420 17.494 -18.102 1.00 36.48 C ATOM 1361 C LEU B 392 29.294 16.010 -18.432 1.00 41.45 C ATOM 1362 O LEU B 392 29.868 15.183 -17.738 1.00 41.68 O ATOM 1363 CB LEU B 392 30.866 17.939 -18.405 1.00 38.21 C ATOM 1364 CG LEU B 392 31.180 19.330 -18.983 1.00 40.37 C ATOM 1365 CD1 LEU B 392 32.605 19.347 -19.581 1.00 39.15 C ATOM 1366 CD2 LEU B 392 30.148 19.680 -20.055 1.00 28.68 C ATOM 1367 H LEU B 392 29.782 18.277 -16.105 1.00 0.00 H ATOM 1368 N GLY B 393 28.502 15.651 -19.443 1.00 36.41 N ATOM 1369 CA GLY B 393 28.442 14.254 -19.828 1.00 36.79 C ATOM 1370 C GLY B 393 27.315 13.511 -19.151 1.00 34.45 C ATOM 1371 O GLY B 393 26.989 12.412 -19.543 1.00 33.28 O ATOM 1372 H GLY B 393 27.936 16.362 -19.948 1.00 0.00 H ATOM 1373 N LYS B 394 26.684 14.106 -18.143 1.00 32.10 N ATOM 1374 CA LYS B 394 25.579 13.426 -17.509 1.00 28.83 C ATOM 1375 C LYS B 394 24.253 14.000 -17.996 1.00 31.19 C ATOM 1376 O LYS B 394 24.199 15.122 -18.500 1.00 31.24 O ATOM 1377 CB LYS B 394 25.723 13.445 -15.982 1.00 32.34 C ATOM 1378 CG LYS B 394 27.035 12.793 -15.520 1.00 36.11 C ATOM 1379 CD LYS B 394 27.204 12.832 -14.008 1.00 42.54 C ATOM 1380 CE LYS B 394 28.626 12.433 -13.618 1.00 44.63 C ATOM 1381 NZ LYS B 394 28.964 12.767 -12.199 1.00 56.73 N ATOM 1382 HZ1 LYS B 394 28.874 13.793 -12.055 1.00 0.00 H ATOM 1383 HZ2 LYS B 394 28.311 12.268 -11.562 1.00 0.00 H ATOM 1384 HZ3 LYS B 394 29.941 12.471 -11.998 1.00 0.00 H ATOM 1385 H LYS B 394 26.982 15.047 -17.816 1.00 0.00 H ATOM 1386 N ASN B 395 23.210 13.208 -17.965 1.00 25.49 N ATOM 1387 CA ASN B 395 21.897 13.715 -18.425 1.00 26.85 C ATOM 1388 C ASN B 395 21.218 14.592 -17.311 1.00 32.65 C ATOM 1389 O ASN B 395 21.330 14.308 -16.087 1.00 29.81 O ATOM 1390 CB ASN B 395 21.060 12.563 -18.840 1.00 27.98 C ATOM 1391 CG ASN B 395 19.851 12.982 -19.662 1.00 35.30 C ATOM 1392 OD1 ASN B 395 19.085 13.827 -19.221 1.00 33.75 O ATOM 1393 ND2 ASN B 395 19.687 12.412 -20.865 1.00 34.55 N ATOM 1394 HD22 ASN B 395 20.365 11.697 -21.198 1.00 0.00 H ATOM 1395 HD21 ASN B 395 18.882 12.685 -21.464 1.00 0.00 H ATOM 1396 H ASN B 395 23.303 12.231 -17.620 1.00 0.00 H ATOM 1397 N ILE B 396 20.533 15.657 -17.723 1.00 29.25 N ATOM 1398 CA ILE B 396 20.051 16.625 -16.729 1.00 31.57 C ATOM 1399 C ILE B 396 18.961 15.918 -15.898 1.00 28.54 C ATOM 1400 O ILE B 396 18.781 16.226 -14.706 1.00 28.68 O ATOM 1401 CB ILE B 396 19.602 17.973 -17.374 1.00 28.99 C ATOM 1402 CG1 ILE B 396 19.206 19.043 -16.304 1.00 30.20 C ATOM 1403 CG2 ILE B 396 18.427 17.761 -18.354 1.00 25.57 C ATOM 1404 CD1 ILE B 396 18.774 20.393 -16.946 1.00 27.31 C ATOM 1405 H ILE B 396 20.342 15.801 -18.735 1.00 0.00 H ATOM 1406 N VAL B 397 18.323 14.929 -16.513 1.00 28.27 N ATOM 1407 CA VAL B 397 17.294 14.090 -15.880 1.00 34.52 C ATOM 1408 C VAL B 397 17.763 13.255 -14.654 1.00 30.41 C ATOM 1409 O VAL B 397 16.971 12.908 -13.766 1.00 28.09 O ATOM 1410 CB VAL B 397 16.637 13.189 -16.947 1.00 36.51 C ATOM 1411 CG1 VAL B 397 15.574 12.322 -16.319 1.00 39.24 C ATOM 1412 CG2 VAL B 397 15.993 14.064 -18.001 1.00 41.73 C ATOM 1413 H VAL B 397 18.566 14.735 -17.505 1.00 0.00 H ATOM 1414 N GLU B 398 19.071 12.977 -14.591 1.00 27.93 N ATOM 1415 CA GLU B 398 19.699 12.364 -13.429 1.00 30.22 C ATOM 1416 C GLU B 398 19.772 13.218 -12.158 1.00 33.34 C ATOM 1417 O GLU B 398 20.166 12.711 -11.074 1.00 30.45 O ATOM 1418 CB GLU B 398 21.129 11.920 -13.790 1.00 31.25 C ATOM 1419 CG GLU B 398 21.128 10.877 -14.933 1.00 33.68 C ATOM 1420 CD GLU B 398 22.483 10.651 -15.627 1.00 38.60 C ATOM 1421 OE1 GLU B 398 23.572 10.906 -15.032 1.00 36.71 O ATOM 1422 OE2 GLU B 398 22.435 10.217 -16.808 1.00 43.03 O ATOM 1423 H GLU B 398 19.667 13.210 -15.411 1.00 0.00 H ATOM 1424 N PHE B 399 19.472 14.514 -12.274 1.00 29.43 N ATOM 1425 CA PHE B 399 19.613 15.388 -11.170 1.00 23.22 C ATOM 1426 C PHE B 399 18.225 15.795 -10.841 1.00 22.96 C ATOM 1427 O PHE B 399 17.999 16.646 -9.957 1.00 26.96 O ATOM 1428 CB PHE B 399 20.421 16.634 -11.564 1.00 23.93 C ATOM 1429 CG PHE B 399 21.963 16.350 -11.743 1.00 26.12 C ATOM 1430 CD1 PHE B 399 22.481 15.940 -13.003 1.00 26.01 C ATOM 1431 CD2 PHE B 399 22.833 16.512 -10.697 1.00 26.49 C ATOM 1432 CE1 PHE B 399 23.852 15.664 -13.147 1.00 31.45 C ATOM 1433 CE2 PHE B 399 24.215 16.250 -10.837 1.00 27.22 C ATOM 1434 CZ PHE B 399 24.712 15.809 -12.073 1.00 28.81 C ATOM 1435 H PHE B 399 19.132 14.885 -13.184 1.00 0.00 H ATOM 1436 N CYS B 400 17.305 15.284 -11.613 1.00 26.04 N ATOM 1437 CA CYS B 400 15.864 15.618 -11.462 1.00 23.11 C ATOM 1438 C CYS B 400 14.965 14.797 -10.512 1.00 29.82 C ATOM 1439 O CYS B 400 15.083 13.568 -10.434 1.00 28.22 O ATOM 1440 CB CYS B 400 15.260 15.693 -12.810 1.00 21.21 C ATOM 1441 SG CYS B 400 13.508 16.233 -12.943 1.00 28.26 S ATOM 1442 H CYS B 400 17.590 14.619 -12.360 1.00 0.00 H ATOM 1443 N HIS B 401 14.012 15.496 -9.851 1.00 26.21 N ATOM 1444 CA HIS B 401 13.157 14.819 -8.885 1.00 29.74 C ATOM 1445 C HIS B 401 12.318 13.787 -9.638 1.00 28.02 C ATOM 1446 O HIS B 401 11.836 14.088 -10.698 1.00 25.02 O ATOM 1447 CB HIS B 401 12.267 15.844 -8.175 1.00 28.46 C ATOM 1448 CG HIS B 401 11.388 15.253 -7.055 1.00 29.22 C ATOM 1449 ND1 HIS B 401 10.385 14.368 -7.290 1.00 29.56 N ATOM 1450 CD2 HIS B 401 11.354 15.535 -5.672 1.00 32.59 C ATOM 1451 CE1 HIS B 401 9.746 14.075 -6.107 1.00 30.11 C ATOM 1452 NE2 HIS B 401 10.366 14.774 -5.120 1.00 33.68 N ATOM 1453 H HIS B 401 13.891 16.513 -10.032 1.00 0.00 H ATOM 1454 N PRO B 402 12.123 12.561 -9.065 1.00 29.35 N ATOM 1455 CA PRO B 402 11.457 11.476 -9.734 1.00 29.55 C ATOM 1456 C PRO B 402 10.112 11.923 -10.289 1.00 27.98 C ATOM 1457 O PRO B 402 9.691 11.517 -11.389 1.00 28.95 O ATOM 1458 CB PRO B 402 11.211 10.454 -8.558 1.00 34.86 C ATOM 1459 CG PRO B 402 12.432 10.625 -7.702 1.00 31.83 C ATOM 1460 CD PRO B 402 12.812 12.101 -7.828 1.00 29.39 C ATOM 1461 N GLU B 403 9.433 12.772 -9.552 1.00 27.02 N ATOM 1462 CA GLU B 403 8.082 13.169 -10.023 1.00 30.42 C ATOM 1463 C GLU B 403 8.192 14.140 -11.164 1.00 26.74 C ATOM 1464 O GLU B 403 7.209 14.417 -11.800 1.00 27.15 O ATOM 1465 CB GLU B 403 7.264 13.844 -8.912 1.00 33.99 C ATOM 1466 CG GLU B 403 6.542 12.912 -7.955 1.00 43.70 C ATOM 1467 CD GLU B 403 6.257 13.638 -6.652 1.00 51.31 C ATOM 1468 OE1 GLU B 403 5.700 14.785 -6.694 1.00 54.68 O ATOM 1469 OE2 GLU B 403 6.646 13.079 -5.601 1.00 56.61 O ATOM 1470 H GLU B 403 9.828 13.153 -8.669 1.00 0.00 H ATOM 1471 N ASP B 404 9.372 14.685 -11.398 1.00 24.32 N ATOM 1472 CA ASP B 404 9.517 15.707 -12.465 1.00 25.44 C ATOM 1473 C ASP B 404 10.298 15.213 -13.706 1.00 26.65 C ATOM 1474 O ASP B 404 10.386 15.944 -14.695 1.00 24.44 O ATOM 1475 CB ASP B 404 10.200 16.991 -11.949 1.00 26.66 C ATOM 1476 CG ASP B 404 9.424 17.661 -10.824 1.00 31.38 C ATOM 1477 OD1 ASP B 404 8.144 17.653 -10.829 1.00 29.21 O ATOM 1478 OD2 ASP B 404 10.099 18.223 -9.953 1.00 24.68 O ATOM 1479 H ASP B 404 10.199 14.399 -10.836 1.00 0.00 H ATOM 1480 N GLN B 405 10.849 13.995 -13.643 1.00 25.52 N ATOM 1481 CA GLN B 405 11.705 13.450 -14.725 1.00 25.13 C ATOM 1482 C GLN B 405 10.991 13.354 -16.075 1.00 25.30 C ATOM 1483 O GLN B 405 11.532 13.765 -17.088 1.00 24.85 O ATOM 1484 CB GLN B 405 12.207 12.078 -14.313 1.00 25.31 C ATOM 1485 CG GLN B 405 13.329 12.194 -13.278 1.00 27.51 C ATOM 1486 CD GLN B 405 13.875 10.835 -12.899 1.00 28.61 C ATOM 1487 OE1 GLN B 405 13.294 9.795 -13.249 1.00 32.64 O ATOM 1488 NE2 GLN B 405 14.991 10.824 -12.233 1.00 27.59 N ATOM 1489 HE22 GLN B 405 15.443 11.720 -11.961 1.00 0.00 H ATOM 1490 HE21 GLN B 405 15.432 9.919 -11.973 1.00 0.00 H ATOM 1491 H GLN B 405 10.670 13.408 -12.803 1.00 0.00 H ATOM 1492 N GLN B 406 9.739 12.886 -16.072 1.00 23.92 N ATOM 1493 CA GLN B 406 9.085 12.707 -17.319 1.00 27.21 C ATOM 1494 C GLN B 406 8.748 14.101 -17.929 1.00 24.57 C ATOM 1495 O GLN B 406 8.849 14.285 -19.160 1.00 23.84 O ATOM 1496 CB GLN B 406 7.811 11.872 -17.140 1.00 23.92 C ATOM 1497 CG GLN B 406 7.259 11.376 -18.493 1.00 28.95 C ATOM 1498 CD GLN B 406 8.265 10.689 -19.387 1.00 32.52 C ATOM 1499 OE1 GLN B 406 9.043 9.804 -18.943 1.00 32.38 O ATOM 1500 NE2 GLN B 406 8.301 11.113 -20.666 1.00 28.59 N ATOM 1501 HE22 GLN B 406 7.639 11.847 -20.989 1.00 0.00 H ATOM 1502 HE21 GLN B 406 8.991 10.706 -21.329 1.00 0.00 H ATOM 1503 H GLN B 406 9.257 12.659 -15.179 1.00 0.00 H ATOM 1504 N LEU B 407 8.311 15.057 -17.109 1.00 26.32 N ATOM 1505 CA LEU B 407 8.101 16.433 -17.629 1.00 20.22 C ATOM 1506 C LEU B 407 9.351 16.954 -18.310 1.00 22.06 C ATOM 1507 O LEU B 407 9.322 17.529 -19.386 1.00 25.22 O ATOM 1508 CB LEU B 407 7.716 17.407 -16.490 1.00 23.13 C ATOM 1509 CG LEU B 407 7.180 18.837 -16.884 1.00 25.27 C ATOM 1510 CD1 LEU B 407 5.990 18.848 -17.829 1.00 24.85 C ATOM 1511 CD2 LEU B 407 6.870 19.692 -15.677 1.00 22.66 C ATOM 1512 H LEU B 407 8.118 14.841 -16.110 1.00 0.00 H ATOM 1513 N LEU B 408 10.463 16.788 -17.647 1.00 20.74 N ATOM 1514 CA LEU B 408 11.677 17.308 -18.202 1.00 22.90 C ATOM 1515 C LEU B 408 12.047 16.588 -19.531 1.00 24.69 C ATOM 1516 O LEU B 408 12.481 17.204 -20.520 1.00 23.87 O ATOM 1517 CB LEU B 408 12.758 17.064 -17.144 1.00 23.41 C ATOM 1518 CG LEU B 408 14.091 17.797 -17.354 1.00 30.78 C ATOM 1519 CD1 LEU B 408 13.809 19.319 -17.488 1.00 26.35 C ATOM 1520 CD2 LEU B 408 15.057 17.558 -16.169 1.00 26.66 C ATOM 1521 H LEU B 408 10.468 16.289 -16.735 1.00 0.00 H ATOM 1522 N ARG B 409 11.910 15.258 -19.568 1.00 25.78 N ATOM 1523 CA ARG B 409 12.144 14.546 -20.825 1.00 29.94 C ATOM 1524 C ARG B 409 11.172 15.012 -21.884 1.00 28.63 C ATOM 1525 O ARG B 409 11.584 15.205 -23.019 1.00 26.03 O ATOM 1526 CB ARG B 409 12.014 12.995 -20.656 1.00 31.94 C ATOM 1527 CG ARG B 409 13.108 12.307 -19.853 1.00 34.65 C ATOM 1528 CD ARG B 409 13.060 10.761 -19.894 1.00 36.11 C ATOM 1529 NE ARG B 409 12.013 10.319 -18.995 1.00 41.31 N ATOM 1530 CZ ARG B 409 12.157 9.938 -17.721 1.00 43.38 C ATOM 1531 NH1 ARG B 409 13.345 9.776 -17.116 1.00 41.17 N ATOM 1532 NH2 ARG B 409 11.073 9.667 -17.033 1.00 32.10 N ATOM 1533 HE ARG B 409 11.048 10.296 -19.381 1.00 0.00 H ATOM 1534 HH12 ARG B 409 13.385 9.477 -16.121 1.00 0.00 H ATOM 1535 HH11 ARG B 409 14.225 9.949 -17.643 1.00 0.00 H ATOM 1536 HH22 ARG B 409 11.149 9.368 -16.040 1.00 0.00 H ATOM 1537 HH21 ARG B 409 10.138 9.751 -17.481 1.00 0.00 H ATOM 1538 H ARG B 409 11.640 14.734 -18.711 1.00 0.00 H ATOM 1539 N ASP B 410 9.877 15.197 -21.566 1.00 26.51 N ATOM 1540 CA ASP B 410 9.006 15.661 -22.666 1.00 28.48 C ATOM 1541 C ASP B 410 9.348 17.118 -23.050 1.00 27.97 C ATOM 1542 O ASP B 410 9.084 17.546 -24.182 1.00 27.46 O ATOM 1543 CB ASP B 410 7.514 15.683 -22.331 1.00 27.81 C ATOM 1544 CG ASP B 410 7.030 14.485 -21.517 1.00 40.52 C ATOM 1545 OD1 ASP B 410 6.542 14.762 -20.410 1.00 50.31 O ATOM 1546 OD2 ASP B 410 7.049 13.330 -21.953 1.00 43.28 O ATOM 1547 H ASP B 410 9.513 15.024 -20.607 1.00 0.00 H ATOM 1548 N SER B 411 9.907 17.871 -22.093 1.00 25.38 N ATOM 1549 CA SER B 411 10.323 19.266 -22.395 1.00 26.92 C ATOM 1550 C SER B 411 11.465 19.305 -23.424 1.00 31.00 C ATOM 1551 O SER B 411 11.438 20.065 -24.400 1.00 25.20 O ATOM 1552 CB SER B 411 10.702 19.960 -21.112 1.00 25.95 C ATOM 1553 OG SER B 411 9.491 20.129 -20.394 1.00 30.10 O ATOM 1554 HG SER B 411 9.086 19.243 -20.218 1.00 0.00 H ATOM 1555 H SER B 411 10.050 17.480 -21.140 1.00 0.00 H ATOM 1556 N PHE B 412 12.501 18.512 -23.180 1.00 31.71 N ATOM 1557 CA PHE B 412 13.524 18.348 -24.186 1.00 31.09 C ATOM 1558 C PHE B 412 13.013 17.875 -25.540 1.00 29.79 C ATOM 1559 O PHE B 412 13.411 18.421 -26.559 1.00 29.67 O ATOM 1560 CB PHE B 412 14.635 17.497 -23.653 1.00 30.31 C ATOM 1561 CG PHE B 412 15.573 18.290 -22.884 1.00 31.82 C ATOM 1562 CD1 PHE B 412 15.232 18.773 -21.637 1.00 37.74 C ATOM 1563 CD2 PHE B 412 16.821 18.589 -23.401 1.00 38.49 C ATOM 1564 CE1 PHE B 412 16.109 19.586 -20.936 1.00 43.09 C ATOM 1565 CE2 PHE B 412 17.701 19.387 -22.691 1.00 36.05 C ATOM 1566 CZ PHE B 412 17.353 19.900 -21.473 1.00 33.71 C ATOM 1567 H PHE B 412 12.575 18.012 -22.271 1.00 0.00 H ATOM 1568 N GLN B 413 12.093 16.928 -25.562 1.00 30.23 N ATOM 1569 CA GLN B 413 11.530 16.488 -26.816 1.00 34.07 C ATOM 1570 C GLN B 413 10.805 17.629 -27.507 1.00 34.62 C ATOM 1571 O GLN B 413 10.923 17.787 -28.747 1.00 37.98 O ATOM 1572 CB GLN B 413 10.538 15.347 -26.626 1.00 33.66 C ATOM 1573 CG GLN B 413 11.136 13.975 -26.337 1.00 43.30 C ATOM 1574 CD GLN B 413 10.088 13.049 -25.681 1.00 48.34 C ATOM 1575 OE1 GLN B 413 10.375 12.416 -24.667 1.00 46.04 O ATOM 1576 NE2 GLN B 413 8.839 13.014 -26.249 1.00 45.81 N ATOM 1577 HE22 GLN B 413 8.643 13.567 -27.108 1.00 0.00 H ATOM 1578 HE21 GLN B 413 8.089 12.435 -25.821 1.00 0.00 H ATOM 1579 H GLN B 413 11.773 16.497 -24.671 1.00 0.00 H ATOM 1580 N GLN B 414 10.060 18.436 -26.746 1.00 30.82 N ATOM 1581 CA GLN B 414 9.330 19.505 -27.390 1.00 30.08 C ATOM 1582 C GLN B 414 10.101 20.700 -27.835 1.00 27.79 C ATOM 1583 O GLN B 414 9.783 21.247 -28.905 1.00 34.03 O ATOM 1584 CB GLN B 414 8.084 19.969 -26.663 1.00 29.86 C ATOM 1585 CG GLN B 414 7.079 20.373 -27.722 1.00 33.74 C ATOM 1586 CD GLN B 414 5.859 20.952 -27.105 1.00 35.83 C ATOM 1587 OE1 GLN B 414 5.947 21.854 -26.245 1.00 41.09 O ATOM 1588 NE2 GLN B 414 4.715 20.451 -27.506 1.00 38.12 N ATOM 1589 HE22 GLN B 414 4.700 19.700 -28.226 1.00 0.00 H ATOM 1590 HE21 GLN B 414 3.823 20.804 -27.104 1.00 0.00 H ATOM 1591 H GLN B 414 10.007 18.299 -25.716 1.00 0.00 H ATOM 1592 N VAL B 415 11.099 21.132 -27.065 1.00 26.63 N ATOM 1593 CA VAL B 415 11.822 22.313 -27.429 1.00 24.56 C ATOM 1594 C VAL B 415 12.300 22.171 -28.907 1.00 27.94 C ATOM 1595 O VAL B 415 12.325 23.178 -29.627 1.00 29.39 O ATOM 1596 CB VAL B 415 12.947 22.646 -26.430 1.00 24.02 C ATOM 1597 CG1 VAL B 415 14.065 21.685 -26.618 1.00 22.38 C ATOM 1598 CG2 VAL B 415 13.426 24.099 -26.571 1.00 26.07 C ATOM 1599 H VAL B 415 11.352 20.612 -26.201 1.00 0.00 H ATOM 1600 N VAL B 416 12.654 20.962 -29.364 1.00 26.36 N ATOM 1601 CA VAL B 416 13.145 20.822 -30.761 1.00 32.19 C ATOM 1602 C VAL B 416 12.062 20.970 -31.813 1.00 34.41 C ATOM 1603 O VAL B 416 12.359 21.147 -32.968 1.00 39.46 O ATOM 1604 CB VAL B 416 14.073 19.605 -31.058 1.00 32.84 C ATOM 1605 CG1 VAL B 416 15.207 19.482 -30.051 1.00 33.82 C ATOM 1606 CG2 VAL B 416 13.298 18.314 -31.162 1.00 34.91 C ATOM 1607 H VAL B 416 12.586 20.128 -28.747 1.00 0.00 H ATOM 1608 N LYS B 417 10.804 20.922 -31.440 1.00 32.93 N ATOM 1609 CA LYS B 417 9.754 21.121 -32.444 1.00 37.26 C ATOM 1610 C LYS B 417 9.225 22.532 -32.425 1.00 37.44 C ATOM 1611 O LYS B 417 8.323 22.894 -33.187 1.00 41.63 O ATOM 1612 CB LYS B 417 8.615 20.185 -32.128 1.00 39.82 C ATOM 1613 CG LYS B 417 8.993 18.752 -32.304 1.00 44.75 C ATOM 1614 CD LYS B 417 8.130 17.915 -31.390 1.00 44.50 C ATOM 1615 CE LYS B 417 8.600 16.452 -31.375 1.00 44.57 C ATOM 1616 NZ LYS B 417 7.548 15.696 -30.649 1.00 42.74 N ATOM 1617 HZ1 LYS B 417 7.455 16.073 -29.684 1.00 0.00 H ATOM 1618 HZ2 LYS B 417 6.642 15.797 -31.150 1.00 0.00 H ATOM 1619 HZ3 LYS B 417 7.812 14.691 -30.606 1.00 0.00 H ATOM 1620 H LYS B 417 10.556 20.745 -30.446 1.00 0.00 H ATOM 1621 N LEU B 418 9.719 23.323 -31.493 1.00 41.21 N ATOM 1622 CA LEU B 418 9.161 24.653 -31.320 1.00 45.48 C ATOM 1623 C LEU B 418 9.834 25.748 -32.225 1.00 47.78 C ATOM 1624 O LEU B 418 9.661 26.955 -32.020 1.00 49.21 O ATOM 1625 CB LEU B 418 9.012 25.025 -29.806 1.00 36.57 C ATOM 1626 CG LEU B 418 7.925 24.234 -29.041 1.00 37.84 C ATOM 1627 CD1 LEU B 418 7.724 24.713 -27.598 1.00 34.38 C ATOM 1628 CD2 LEU B 418 6.562 24.184 -29.762 1.00 35.15 C ATOM 1629 H LEU B 418 10.500 22.998 -30.888 1.00 0.00 H ATOM 1630 N LYS B 419 10.566 25.325 -33.248 1.00 53.29 N ATOM 1631 CA LYS B 419 11.130 26.315 -34.213 1.00 57.56 C ATOM 1632 C LYS B 419 12.133 27.304 -33.559 1.00 64.88 C ATOM 1633 O LYS B 419 12.075 28.507 -33.847 1.00 73.03 O ATOM 1634 CB LYS B 419 10.032 27.184 -34.882 1.00 51.05 C ATOM 1635 CG LYS B 419 8.772 26.479 -35.359 1.00 54.14 C ATOM 1636 CD LYS B 419 8.876 25.972 -36.784 1.00 52.85 C ATOM 1637 CE LYS B 419 7.506 25.552 -37.298 1.00 51.79 C ATOM 1638 NZ LYS B 419 7.665 24.212 -37.925 1.00 60.35 N ATOM 1639 HZ1 LYS B 419 8.347 24.276 -38.708 1.00 0.00 H ATOM 1640 HZ2 LYS B 419 8.013 23.537 -37.214 1.00 0.00 H ATOM 1641 HZ3 LYS B 419 6.746 23.890 -38.290 1.00 0.00 H ATOM 1642 H LYS B 419 10.746 24.309 -33.377 1.00 0.00 H ATOM 1643 N GLY B 420 13.029 26.841 -32.686 1.00 54.66 N ATOM 1644 CA GLY B 420 13.899 27.790 -31.973 1.00 51.37 C ATOM 1645 C GLY B 420 13.326 28.814 -30.960 1.00 50.47 C ATOM 1646 O GLY B 420 14.131 29.566 -30.424 1.00 47.28 O ATOM 1647 H GLY B 420 13.112 25.819 -32.511 1.00 0.00 H ATOM 1648 N GLN B 421 11.980 28.887 -30.747 1.00 46.97 N ATOM 1649 CA GLN B 421 11.269 29.682 -29.659 1.00 39.42 C ATOM 1650 C GLN B 421 11.582 29.113 -28.215 1.00 36.66 C ATOM 1651 O GLN B 421 12.086 27.949 -28.080 1.00 37.65 O ATOM 1652 CB GLN B 421 9.723 29.650 -29.815 1.00 45.98 C ATOM 1653 CG GLN B 421 9.067 29.643 -31.211 1.00 49.52 C ATOM 1654 CD GLN B 421 7.511 29.455 -31.121 1.00 49.45 C ATOM 1655 OE1 GLN B 421 6.793 30.276 -30.552 1.00 58.08 O ATOM 1656 NE2 GLN B 421 7.022 28.382 -31.660 1.00 38.18 N ATOM 1657 HE22 GLN B 421 7.653 27.705 -32.135 1.00 0.00 H ATOM 1658 HE21 GLN B 421 5.999 28.198 -31.618 1.00 0.00 H ATOM 1659 H GLN B 421 11.376 28.343 -31.396 1.00 0.00 H ATOM 1660 N VAL B 422 11.260 29.892 -27.177 1.00 29.96 N ATOM 1661 CA VAL B 422 11.577 29.557 -25.778 1.00 31.44 C ATOM 1662 C VAL B 422 10.557 28.575 -25.174 1.00 31.89 C ATOM 1663 O VAL B 422 9.319 28.775 -25.304 1.00 30.27 O ATOM 1664 CB VAL B 422 11.806 30.786 -24.830 1.00 33.27 C ATOM 1665 CG1 VAL B 422 12.248 30.331 -23.447 1.00 33.83 C ATOM 1666 CG2 VAL B 422 12.902 31.713 -25.358 1.00 36.04 C ATOM 1667 H VAL B 422 10.758 30.783 -27.368 1.00 0.00 H ATOM 1668 N LEU B 423 11.085 27.488 -24.610 1.00 27.61 N ATOM 1669 CA LEU B 423 10.335 26.589 -23.752 1.00 27.81 C ATOM 1670 C LEU B 423 10.862 26.717 -22.307 1.00 29.54 C ATOM 1671 O LEU B 423 12.091 26.667 -21.984 1.00 29.42 O ATOM 1672 CB LEU B 423 10.400 25.140 -24.318 1.00 27.10 C ATOM 1673 CG LEU B 423 9.662 24.055 -23.502 1.00 35.24 C ATOM 1674 CD1 LEU B 423 8.694 23.243 -24.330 1.00 41.65 C ATOM 1675 CD2 LEU B 423 10.620 23.089 -22.828 1.00 39.25 C ATOM 1676 H LEU B 423 12.086 27.273 -24.794 1.00 0.00 H ATOM 1677 N SER B 424 9.951 26.853 -21.385 1.00 26.52 N ATOM 1678 CA SER B 424 10.385 26.943 -20.041 1.00 29.97 C ATOM 1679 C SER B 424 9.805 25.783 -19.220 1.00 32.37 C ATOM 1680 O SER B 424 8.773 25.207 -19.586 1.00 28.33 O ATOM 1681 CB SER B 424 10.061 28.364 -19.570 1.00 30.00 C ATOM 1682 OG SER B 424 9.595 28.350 -18.270 1.00 36.52 O ATOM 1683 HG SER B 424 9.391 29.276 -17.984 1.00 0.00 H ATOM 1684 H SER B 424 8.941 26.894 -21.628 1.00 0.00 H ATOM 1685 N VAL B 425 10.507 25.377 -18.178 1.00 28.85 N ATOM 1686 CA VAL B 425 10.071 24.235 -17.391 1.00 30.67 C ATOM 1687 C VAL B 425 10.481 24.479 -15.938 1.00 31.48 C ATOM 1688 O VAL B 425 11.586 24.956 -15.686 1.00 29.82 O ATOM 1689 CB VAL B 425 10.643 22.867 -17.921 1.00 28.09 C ATOM 1690 CG1 VAL B 425 12.194 22.784 -17.802 1.00 24.17 C ATOM 1691 CG2 VAL B 425 10.074 21.690 -17.156 1.00 26.25 C ATOM 1692 H VAL B 425 11.380 25.879 -17.918 1.00 0.00 H ATOM 1693 N MET B 426 9.623 24.094 -14.984 1.00 25.43 N ATOM 1694 CA MET B 426 10.043 24.110 -13.570 1.00 29.04 C ATOM 1695 C MET B 426 10.208 22.700 -12.992 1.00 25.27 C ATOM 1696 O MET B 426 9.350 21.835 -13.227 1.00 31.07 O ATOM 1697 CB MET B 426 9.012 24.874 -12.749 1.00 32.72 C ATOM 1698 CG MET B 426 9.486 26.243 -12.315 1.00 42.24 C ATOM 1699 SD MET B 426 8.212 26.965 -11.252 1.00 47.73 S ATOM 1700 CE MET B 426 8.792 26.472 -9.646 1.00 31.80 C ATOM 1701 H MET B 426 8.663 23.785 -15.240 1.00 0.00 H ATOM 1702 N PHE B 427 11.305 22.426 -12.307 1.00 22.64 N ATOM 1703 CA PHE B 427 11.493 21.102 -11.741 1.00 27.41 C ATOM 1704 C PHE B 427 12.438 21.194 -10.573 1.00 28.53 C ATOM 1705 O PHE B 427 13.108 22.186 -10.407 1.00 29.43 O ATOM 1706 CB PHE B 427 12.107 20.142 -12.781 1.00 25.38 C ATOM 1707 CG PHE B 427 13.556 20.487 -13.157 1.00 26.32 C ATOM 1708 CD1 PHE B 427 14.608 19.840 -12.563 1.00 26.63 C ATOM 1709 CD2 PHE B 427 13.814 21.464 -14.086 1.00 27.25 C ATOM 1710 CE1 PHE B 427 15.947 20.157 -12.856 1.00 30.54 C ATOM 1711 CE2 PHE B 427 15.124 21.796 -14.411 1.00 30.07 C ATOM 1712 CZ PHE B 427 16.203 21.132 -13.805 1.00 28.50 C ATOM 1713 H PHE B 427 12.032 23.157 -12.174 1.00 0.00 H ATOM 1714 N ARG B 428 12.518 20.135 -9.803 1.00 26.52 N ATOM 1715 CA ARG B 428 13.362 20.083 -8.642 1.00 23.74 C ATOM 1716 C ARG B 428 14.620 19.380 -9.011 1.00 24.97 C ATOM 1717 O ARG B 428 14.589 18.241 -9.529 1.00 24.54 O ATOM 1718 CB ARG B 428 12.653 19.367 -7.425 1.00 29.13 C ATOM 1719 CG ARG B 428 11.291 20.022 -7.102 1.00 24.80 C ATOM 1720 CD ARG B 428 10.433 19.035 -6.364 1.00 30.37 C ATOM 1721 NE ARG B 428 9.492 18.447 -7.297 1.00 30.97 N ATOM 1722 CZ ARG B 428 8.437 17.746 -6.942 1.00 29.73 C ATOM 1723 NH1 ARG B 428 8.164 17.550 -5.656 1.00 30.23 N ATOM 1724 NH2 ARG B 428 7.650 17.272 -7.880 1.00 29.96 N ATOM 1725 HE ARG B 428 9.662 18.589 -8.313 1.00 0.00 H ATOM 1726 HH12 ARG B 428 7.329 16.995 -5.380 1.00 0.00 H ATOM 1727 HH11 ARG B 428 8.786 17.952 -4.925 1.00 0.00 H ATOM 1728 HH22 ARG B 428 6.810 16.715 -7.622 1.00 0.00 H ATOM 1729 HH21 ARG B 428 7.866 17.453 -8.881 1.00 0.00 H ATOM 1730 H ARG B 428 11.947 19.299 -10.043 1.00 0.00 H ATOM 1731 N PHE B 429 15.724 20.056 -8.667 1.00 24.18 N ATOM 1732 CA PHE B 429 17.058 19.679 -9.025 1.00 25.53 C ATOM 1733 C PHE B 429 17.835 19.385 -7.757 1.00 25.55 C ATOM 1734 O PHE B 429 17.740 20.129 -6.817 1.00 23.77 O ATOM 1735 CB PHE B 429 17.702 20.852 -9.769 1.00 24.55 C ATOM 1736 CG PHE B 429 19.094 20.597 -10.256 1.00 25.01 C ATOM 1737 CD1 PHE B 429 19.377 20.593 -11.635 1.00 25.95 C ATOM 1738 CD2 PHE B 429 20.156 20.476 -9.361 1.00 25.94 C ATOM 1739 CE1 PHE B 429 20.692 20.356 -12.101 1.00 28.58 C ATOM 1740 CE2 PHE B 429 21.457 20.225 -9.822 1.00 26.76 C ATOM 1741 CZ PHE B 429 21.726 20.178 -11.175 1.00 27.27 C ATOM 1742 H PHE B 429 15.603 20.918 -8.098 1.00 0.00 H ATOM 1743 N ARG B 430 18.633 18.314 -7.741 1.00 28.48 N ATOM 1744 CA ARG B 430 19.219 17.841 -6.530 1.00 32.71 C ATOM 1745 C ARG B 430 20.577 18.547 -6.430 1.00 32.54 C ATOM 1746 O ARG B 430 21.472 18.259 -7.254 1.00 27.26 O ATOM 1747 CB ARG B 430 19.363 16.297 -6.573 1.00 39.62 C ATOM 1748 CG ARG B 430 19.916 15.640 -5.316 1.00 47.37 C ATOM 1749 CD ARG B 430 20.291 14.162 -5.567 1.00 54.23 C ATOM 1750 NE ARG B 430 21.562 14.046 -6.310 1.00 56.63 N ATOM 1751 CZ ARG B 430 21.676 13.667 -7.578 1.00 49.88 C ATOM 1752 NH1 ARG B 430 20.597 13.303 -8.292 1.00 45.28 N ATOM 1753 NH2 ARG B 430 22.885 13.644 -8.119 1.00 54.09 N ATOM 1754 HE ARG B 430 22.438 14.280 -5.800 1.00 0.00 H ATOM 1755 HH12 ARG B 430 20.705 13.009 -9.284 1.00 0.00 H ATOM 1756 HH11 ARG B 430 19.654 13.315 -7.853 1.00 0.00 H ATOM 1757 HH22 ARG B 430 23.006 13.352 -9.110 1.00 0.00 H ATOM 1758 HH21 ARG B 430 23.713 13.918 -7.553 1.00 0.00 H ATOM 1759 H ARG B 430 18.831 17.814 -8.631 1.00 0.00 H ATOM 1760 N SER B 431 20.700 19.500 -5.483 1.00 28.37 N ATOM 1761 CA SER B 431 21.951 20.290 -5.311 1.00 30.56 C ATOM 1762 C SER B 431 23.046 19.397 -4.796 1.00 31.01 C ATOM 1763 O SER B 431 22.786 18.270 -4.340 1.00 34.60 O ATOM 1764 CB SER B 431 21.754 21.418 -4.288 1.00 36.97 C ATOM 1765 OG SER B 431 21.753 20.880 -2.970 1.00 37.27 O ATOM 1766 HG SER B 431 21.626 21.612 -2.316 1.00 0.00 H ATOM 1767 H SER B 431 19.895 19.689 -4.852 1.00 0.00 H ATOM 1768 N LYS B 432 24.275 19.877 -4.802 1.00 32.75 N ATOM 1769 CA LYS B 432 25.323 19.070 -4.232 1.00 34.54 C ATOM 1770 C LYS B 432 25.101 18.813 -2.714 1.00 40.76 C ATOM 1771 O LYS B 432 25.639 17.869 -2.178 1.00 41.85 O ATOM 1772 CB LYS B 432 26.671 19.730 -4.472 1.00 35.64 C ATOM 1773 CG LYS B 432 27.780 18.736 -4.431 1.00 38.53 C ATOM 1774 CD LYS B 432 29.137 19.385 -4.284 1.00 44.07 C ATOM 1775 CE LYS B 432 30.181 18.282 -4.146 1.00 51.31 C ATOM 1776 NZ LYS B 432 29.804 17.013 -4.867 1.00 46.22 N ATOM 1777 HZ1 LYS B 432 28.909 16.649 -4.481 1.00 0.00 H ATOM 1778 HZ2 LYS B 432 29.690 17.213 -5.881 1.00 0.00 H ATOM 1779 HZ3 LYS B 432 30.554 16.305 -4.734 1.00 0.00 H ATOM 1780 H LYS B 432 24.481 20.812 -5.207 1.00 0.00 H ATOM 1781 N ASN B 433 24.308 19.627 -2.020 1.00 51.32 N ATOM 1782 CA ASN B 433 23.903 19.262 -0.630 1.00 59.95 C ATOM 1783 C ASN B 433 22.863 18.102 -0.528 1.00 61.22 C ATOM 1784 O ASN B 433 22.494 17.636 0.540 1.00 63.27 O ATOM 1785 CB ASN B 433 23.451 20.505 0.141 1.00 70.11 C ATOM 1786 CG ASN B 433 23.019 20.190 1.579 1.00 85.29 C ATOM 1787 OD1 ASN B 433 23.632 19.369 2.275 1.00 89.74 O ATOM 1788 ND2 ASN B 433 21.977 20.871 2.040 1.00 90.54 N ATOM 1789 HD22 ASN B 433 21.488 21.552 1.425 1.00 0.00 H ATOM 1790 HD21 ASN B 433 21.650 20.723 3.016 1.00 0.00 H ATOM 1791 H ASN B 433 23.972 20.515 -2.445 1.00 0.00 H ATOM 1792 N GLN B 434 22.439 17.590 -1.659 1.00 58.23 N ATOM 1793 CA GLN B 434 21.374 16.595 -1.707 1.00 63.07 C ATOM 1794 C GLN B 434 19.976 17.180 -1.330 1.00 59.38 C ATOM 1795 O GLN B 434 18.992 16.376 -1.277 1.00 65.44 O ATOM 1796 CB GLN B 434 21.750 15.256 -0.994 1.00 66.06 C ATOM 1797 CG GLN B 434 22.880 14.479 -1.682 1.00 62.66 C ATOM 1798 CD GLN B 434 23.165 13.081 -1.085 1.00 75.17 C ATOM 1799 OE1 GLN B 434 23.421 12.095 -1.815 1.00 78.33 O ATOM 1800 NE2 GLN B 434 23.133 12.988 0.234 1.00 64.84 N ATOM 1801 HE22 GLN B 434 22.917 13.827 0.809 1.00 0.00 H ATOM 1802 HE21 GLN B 434 23.324 12.076 0.696 1.00 0.00 H ATOM 1803 H GLN B 434 22.876 17.904 -2.549 1.00 0.00 H ATOM 1804 N GLU B 435 19.885 18.539 -1.182 1.00 39.55 N ATOM 1805 CA GLU B 435 18.570 19.300 -1.164 1.00 36.79 C ATOM 1806 C GLU B 435 17.821 19.489 -2.532 1.00 33.15 C ATOM 1807 O GLU B 435 18.441 19.703 -3.554 1.00 28.76 O ATOM 1808 CB GLU B 435 18.677 20.649 -0.406 1.00 45.45 C ATOM 1809 CG GLU B 435 18.816 20.497 1.127 1.00 52.55 C ATOM 1810 CD GLU B 435 19.449 21.687 1.865 1.00 57.82 C ATOM 1811 OE1 GLU B 435 19.980 22.606 1.205 1.00 59.06 O ATOM 1812 OE2 GLU B 435 19.437 21.713 3.136 1.00 57.78 O ATOM 1813 H GLU B 435 20.766 19.081 -1.076 1.00 0.00 H ATOM 1814 N TRP B 436 16.478 19.442 -2.557 1.00 30.59 N ATOM 1815 CA TRP B 436 15.773 19.669 -3.783 1.00 26.16 C ATOM 1816 C TRP B 436 15.572 21.167 -3.964 1.00 29.46 C ATOM 1817 O TRP B 436 14.913 21.796 -3.173 1.00 28.06 O ATOM 1818 CB TRP B 436 14.428 18.961 -3.773 1.00 27.90 C ATOM 1819 CG TRP B 436 14.519 17.429 -3.888 1.00 30.25 C ATOM 1820 CD1 TRP B 436 14.083 16.495 -2.975 1.00 29.69 C ATOM 1821 CD2 TRP B 436 15.044 16.660 -5.013 1.00 28.77 C ATOM 1822 NE1 TRP B 436 14.310 15.217 -3.451 1.00 32.52 N ATOM 1823 CE2 TRP B 436 14.879 15.246 -4.669 1.00 30.16 C ATOM 1824 CE3 TRP B 436 15.591 16.993 -6.248 1.00 29.07 C ATOM 1825 CZ2 TRP B 436 15.278 14.210 -5.526 1.00 28.67 C ATOM 1826 CZ3 TRP B 436 16.011 15.954 -7.096 1.00 27.20 C ATOM 1827 CH2 TRP B 436 15.835 14.569 -6.742 1.00 30.89 C ATOM 1828 HE1 TRP B 436 14.072 14.346 -2.934 1.00 0.00 H ATOM 1829 H TRP B 436 15.950 19.240 -1.684 1.00 0.00 H ATOM 1830 N LEU B 437 16.150 21.742 -5.014 1.00 26.23 N ATOM 1831 CA LEU B 437 16.025 23.180 -5.330 1.00 24.74 C ATOM 1832 C LEU B 437 15.048 23.299 -6.493 1.00 24.81 C ATOM 1833 O LEU B 437 15.119 22.547 -7.550 1.00 25.60 O ATOM 1834 CB LEU B 437 17.377 23.767 -5.707 1.00 22.31 C ATOM 1835 CG LEU B 437 18.482 23.514 -4.711 1.00 26.05 C ATOM 1836 CD1 LEU B 437 19.783 24.156 -5.167 1.00 25.70 C ATOM 1837 CD2 LEU B 437 18.092 24.083 -3.292 1.00 26.33 C ATOM 1838 H LEU B 437 16.721 21.147 -5.648 1.00 0.00 H ATOM 1839 N TRP B 438 14.141 24.238 -6.358 1.00 24.11 N ATOM 1840 CA TRP B 438 13.293 24.554 -7.462 1.00 26.57 C ATOM 1841 C TRP B 438 14.055 25.324 -8.528 1.00 28.80 C ATOM 1842 O TRP B 438 14.628 26.384 -8.232 1.00 26.88 O ATOM 1843 CB TRP B 438 12.110 25.353 -7.025 1.00 26.90 C ATOM 1844 CG TRP B 438 11.052 24.488 -6.423 1.00 30.75 C ATOM 1845 CD1 TRP B 438 10.717 24.337 -5.077 1.00 29.20 C ATOM 1846 CD2 TRP B 438 10.143 23.597 -7.170 1.00 31.01 C ATOM 1847 NE1 TRP B 438 9.672 23.420 -4.940 1.00 31.53 N ATOM 1848 CE2 TRP B 438 9.294 22.944 -6.176 1.00 34.26 C ATOM 1849 CE3 TRP B 438 9.992 23.267 -8.506 1.00 31.06 C ATOM 1850 CZ2 TRP B 438 8.313 22.023 -6.553 1.00 36.23 C ATOM 1851 CZ3 TRP B 438 8.996 22.342 -8.869 1.00 35.60 C ATOM 1852 CH2 TRP B 438 8.158 21.759 -7.907 1.00 31.26 C ATOM 1853 HE1 TRP B 438 9.242 23.138 -4.036 1.00 0.00 H ATOM 1854 H TRP B 438 14.041 24.746 -5.456 1.00 0.00 H ATOM 1855 N MET B 439 14.072 24.743 -9.750 1.00 24.18 N ATOM 1856 CA MET B 439 14.718 25.319 -10.945 1.00 29.75 C ATOM 1857 C MET B 439 13.737 25.749 -12.004 1.00 29.28 C ATOM 1858 O MET B 439 12.771 25.010 -12.295 1.00 29.73 O ATOM 1859 CB MET B 439 15.769 24.391 -11.549 1.00 27.77 C ATOM 1860 CG MET B 439 16.907 24.074 -10.574 1.00 29.99 C ATOM 1861 SD MET B 439 17.863 25.550 -10.037 1.00 38.91 S ATOM 1862 CE MET B 439 18.494 25.918 -11.678 1.00 23.88 C ATOM 1863 H MET B 439 13.596 23.824 -9.854 1.00 0.00 H ATOM 1864 N ARG B 440 13.945 26.956 -12.573 1.00 25.73 N ATOM 1865 CA ARG B 440 13.271 27.287 -13.823 1.00 31.50 C ATOM 1866 C ARG B 440 14.343 27.242 -14.943 1.00 33.66 C ATOM 1867 O ARG B 440 15.366 27.936 -14.869 1.00 30.71 O ATOM 1868 CB ARG B 440 12.528 28.611 -13.797 1.00 35.35 C ATOM 1869 CG ARG B 440 11.783 28.861 -15.119 1.00 36.26 C ATOM 1870 CD ARG B 440 10.738 29.933 -14.997 1.00 42.29 C ATOM 1871 NE ARG B 440 9.816 29.659 -13.890 1.00 49.79 N ATOM 1872 CZ ARG B 440 9.612 30.498 -12.866 1.00 53.18 C ATOM 1873 NH1 ARG B 440 10.205 31.705 -12.817 1.00 56.72 N ATOM 1874 NH2 ARG B 440 8.766 30.155 -11.912 1.00 44.77 N ATOM 1875 HE ARG B 440 9.290 28.762 -13.901 1.00 0.00 H ATOM 1876 HH12 ARG B 440 10.030 32.338 -12.011 1.00 0.00 H ATOM 1877 HH11 ARG B 440 10.838 32.005 -13.586 1.00 0.00 H ATOM 1878 HH22 ARG B 440 8.598 30.796 -11.111 1.00 0.00 H ATOM 1879 HH21 ARG B 440 8.268 29.243 -11.962 1.00 0.00 H ATOM 1880 H ARG B 440 14.581 27.645 -12.123 1.00 0.00 H ATOM 1881 N THR B 441 14.146 26.348 -15.909 1.00 33.38 N ATOM 1882 CA THR B 441 15.071 26.228 -17.079 1.00 29.22 C ATOM 1883 C THR B 441 14.278 26.748 -18.273 1.00 31.24 C ATOM 1884 O THR B 441 13.120 26.286 -18.517 1.00 32.57 O ATOM 1885 CB THR B 441 15.495 24.727 -17.257 1.00 30.74 C ATOM 1886 OG1 THR B 441 16.419 24.369 -16.256 1.00 30.69 O ATOM 1887 CG2 THR B 441 16.151 24.405 -18.640 1.00 28.72 C ATOM 1888 HG1 THR B 441 17.220 24.946 -16.326 1.00 0.00 H ATOM 1889 H THR B 441 13.324 25.714 -15.849 1.00 0.00 H ATOM 1890 N SER B 442 14.829 27.758 -18.951 1.00 24.95 N ATOM 1891 CA SER B 442 14.310 28.329 -20.172 1.00 24.29 C ATOM 1892 C SER B 442 15.236 27.844 -21.235 1.00 28.53 C ATOM 1893 O SER B 442 16.496 27.965 -21.096 1.00 22.66 O ATOM 1894 CB SER B 442 14.293 29.847 -20.152 1.00 23.30 C ATOM 1895 OG SER B 442 13.389 30.251 -19.141 1.00 35.99 O ATOM 1896 HG SER B 442 13.357 31.240 -19.105 1.00 0.00 H ATOM 1897 H SER B 442 15.705 28.168 -18.568 1.00 0.00 H ATOM 1898 N SER B 443 14.656 27.195 -22.227 1.00 25.03 N ATOM 1899 CA SER B 443 15.510 26.642 -23.238 1.00 26.54 C ATOM 1900 C SER B 443 15.029 26.950 -24.661 1.00 28.54 C ATOM 1901 O SER B 443 13.833 27.217 -24.908 1.00 27.33 O ATOM 1902 CB SER B 443 15.760 25.188 -22.934 1.00 28.83 C ATOM 1903 OG SER B 443 14.607 24.471 -23.126 1.00 29.93 O ATOM 1904 HG SER B 443 14.776 23.516 -22.925 1.00 0.00 H ATOM 1905 H SER B 443 13.622 27.089 -22.274 1.00 0.00 H ATOM 1906 N PHE B 444 15.951 26.905 -25.611 1.00 25.27 N ATOM 1907 CA PHE B 444 15.589 27.072 -27.028 1.00 28.54 C ATOM 1908 C PHE B 444 16.655 26.385 -27.880 1.00 32.21 C ATOM 1909 O PHE B 444 17.773 26.135 -27.396 1.00 24.72 O ATOM 1910 CB PHE B 444 15.513 28.579 -27.350 1.00 27.79 C ATOM 1911 CG PHE B 444 16.805 29.332 -27.072 1.00 30.33 C ATOM 1912 CD1 PHE B 444 17.037 29.940 -25.836 1.00 30.98 C ATOM 1913 CD2 PHE B 444 17.759 29.481 -28.065 1.00 32.73 C ATOM 1914 CE1 PHE B 444 18.226 30.654 -25.590 1.00 33.24 C ATOM 1915 CE2 PHE B 444 18.962 30.177 -27.817 1.00 31.68 C ATOM 1916 CZ PHE B 444 19.176 30.800 -26.602 1.00 30.14 C ATOM 1917 H PHE B 444 16.946 26.749 -25.352 1.00 0.00 H ATOM 1918 N THR B 445 16.315 25.999 -29.110 1.00 31.96 N ATOM 1919 CA THR B 445 17.319 25.321 -29.934 1.00 32.98 C ATOM 1920 C THR B 445 18.139 26.346 -30.772 1.00 31.43 C ATOM 1921 O THR B 445 17.730 27.483 -31.002 1.00 29.01 O ATOM 1922 CB THR B 445 16.653 24.418 -30.948 1.00 34.17 C ATOM 1923 OG1 THR B 445 15.699 25.233 -31.627 1.00 29.11 O ATOM 1924 CG2 THR B 445 16.023 23.183 -30.284 1.00 36.25 C ATOM 1925 HG1 THR B 445 16.165 25.987 -32.068 1.00 0.00 H ATOM 1926 H THR B 445 15.358 26.175 -29.477 1.00 0.00 H ATOM 1927 N PHE B 446 19.351 25.957 -31.140 1.00 31.51 N ATOM 1928 CA PHE B 446 20.115 26.772 -32.043 1.00 29.97 C ATOM 1929 C PHE B 446 20.642 25.838 -33.098 1.00 26.05 C ATOM 1930 O PHE B 446 21.055 24.725 -32.780 1.00 26.47 O ATOM 1931 CB PHE B 446 21.318 27.377 -31.398 1.00 29.54 C ATOM 1932 CG PHE B 446 22.181 28.099 -32.387 1.00 32.21 C ATOM 1933 CD1 PHE B 446 21.738 29.270 -33.002 1.00 32.14 C ATOM 1934 CD2 PHE B 446 23.399 27.559 -32.759 1.00 31.99 C ATOM 1935 CE1 PHE B 446 22.528 29.927 -33.942 1.00 37.38 C ATOM 1936 CE2 PHE B 446 24.211 28.229 -33.685 1.00 32.40 C ATOM 1937 CZ PHE B 446 23.775 29.393 -34.278 1.00 28.18 C ATOM 1938 H PHE B 446 19.747 25.066 -30.777 1.00 0.00 H ATOM 1939 N GLN B 447 20.654 26.328 -34.330 1.00 29.41 N ATOM 1940 CA GLN B 447 21.139 25.563 -35.442 1.00 30.68 C ATOM 1941 C GLN B 447 21.670 26.611 -36.400 1.00 28.02 C ATOM 1942 O GLN B 447 20.951 27.491 -36.819 1.00 26.64 O ATOM 1943 CB GLN B 447 19.973 24.787 -36.088 1.00 35.80 C ATOM 1944 CG GLN B 447 20.454 23.603 -36.908 1.00 40.23 C ATOM 1945 CD GLN B 447 20.858 24.044 -38.283 1.00 44.93 C ATOM 1946 OE1 GLN B 447 21.953 23.737 -38.755 1.00 51.38 O ATOM 1947 NE2 GLN B 447 19.988 24.808 -38.923 1.00 44.45 N ATOM 1948 HE22 GLN B 447 19.075 25.039 -38.481 1.00 0.00 H ATOM 1949 HE21 GLN B 447 20.217 25.177 -39.868 1.00 0.00 H ATOM 1950 H GLN B 447 20.302 27.293 -34.494 1.00 0.00 H ATOM 1951 N ASN B 448 22.973 26.548 -36.664 1.00 28.14 N ATOM 1952 CA ASN B 448 23.597 27.472 -37.572 1.00 32.81 C ATOM 1953 C ASN B 448 23.077 27.250 -39.018 1.00 32.11 C ATOM 1954 O ASN B 448 23.197 26.132 -39.588 1.00 29.47 O ATOM 1955 CB ASN B 448 25.116 27.297 -37.515 1.00 27.98 C ATOM 1956 CG ASN B 448 25.809 28.376 -38.271 1.00 34.67 C ATOM 1957 OD1 ASN B 448 25.230 28.963 -39.207 1.00 30.89 O ATOM 1958 ND2 ASN B 448 27.032 28.732 -37.814 1.00 30.64 N ATOM 1959 HD22 ASN B 448 27.467 28.206 -37.030 1.00 0.00 H ATOM 1960 HD21 ASN B 448 27.537 29.532 -38.247 1.00 0.00 H ATOM 1961 H ASN B 448 23.551 25.816 -36.204 1.00 0.00 H ATOM 1962 N PRO B 449 22.515 28.309 -39.607 1.00 29.45 N ATOM 1963 CA PRO B 449 21.813 28.131 -40.864 1.00 37.01 C ATOM 1964 C PRO B 449 22.776 28.065 -42.060 1.00 33.28 C ATOM 1965 O PRO B 449 22.332 27.794 -43.120 1.00 33.59 O ATOM 1966 CB PRO B 449 20.908 29.359 -40.935 1.00 32.75 C ATOM 1967 CG PRO B 449 21.656 30.385 -40.158 1.00 35.52 C ATOM 1968 CD PRO B 449 22.335 29.661 -39.046 1.00 32.72 C ATOM 1969 N TYR B 450 24.081 28.271 -41.841 1.00 30.37 N ATOM 1970 CA TYR B 450 25.108 27.953 -42.854 1.00 29.43 C ATOM 1971 C TYR B 450 25.377 26.458 -42.943 1.00 31.14 C ATOM 1972 O TYR B 450 26.085 26.008 -43.848 1.00 25.11 O ATOM 1973 CB TYR B 450 26.443 28.643 -42.498 1.00 27.43 C ATOM 1974 CG TYR B 450 26.379 30.097 -42.813 1.00 27.83 C ATOM 1975 CD1 TYR B 450 26.463 30.510 -44.140 1.00 29.51 C ATOM 1976 CD2 TYR B 450 26.272 31.081 -41.799 1.00 24.85 C ATOM 1977 CE1 TYR B 450 26.425 31.858 -44.464 1.00 31.11 C ATOM 1978 CE2 TYR B 450 26.199 32.418 -42.145 1.00 27.12 C ATOM 1979 CZ TYR B 450 26.310 32.791 -43.478 1.00 29.97 C ATOM 1980 OH TYR B 450 26.226 34.140 -43.885 1.00 31.44 O ATOM 1981 HH TYR B 450 26.329 34.194 -44.868 1.00 0.00 H ATOM 1982 H TYR B 450 24.381 28.668 -40.928 1.00 0.00 H ATOM 1983 N SER B 451 24.828 25.683 -42.014 1.00 29.28 N ATOM 1984 CA SER B 451 25.122 24.254 -41.946 1.00 33.53 C ATOM 1985 C SER B 451 23.817 23.503 -41.833 1.00 35.31 C ATOM 1986 O SER B 451 22.731 24.107 -41.689 1.00 32.34 O ATOM 1987 CB SER B 451 25.889 23.919 -40.686 1.00 32.74 C ATOM 1988 OG SER B 451 24.927 23.842 -39.633 1.00 43.88 O ATOM 1989 HG SER B 451 24.465 24.713 -39.545 1.00 0.00 H ATOM 1990 H SER B 451 24.176 26.102 -41.321 1.00 0.00 H ATOM 1991 N ASP B 452 23.961 22.180 -41.884 1.00 34.78 N ATOM 1992 CA ASP B 452 22.892 21.261 -41.566 1.00 36.80 C ATOM 1993 C ASP B 452 23.377 20.293 -40.477 1.00 38.92 C ATOM 1994 O ASP B 452 23.139 19.088 -40.539 1.00 34.85 O ATOM 1995 CB ASP B 452 22.457 20.513 -42.814 1.00 35.65 C ATOM 1996 CG ASP B 452 21.223 19.686 -42.574 1.00 39.31 C ATOM 1997 OD1 ASP B 452 20.214 20.246 -42.069 1.00 37.60 O ATOM 1998 OD2 ASP B 452 21.296 18.474 -42.884 1.00 36.55 O ATOM 1999 H ASP B 452 24.884 21.791 -42.165 1.00 0.00 H ATOM 2000 N GLU B 453 24.103 20.833 -39.499 1.00 36.09 N ATOM 2001 CA GLU B 453 24.427 20.086 -38.306 1.00 39.81 C ATOM 2002 C GLU B 453 23.203 19.979 -37.368 1.00 37.33 C ATOM 2003 O GLU B 453 22.320 20.849 -37.344 1.00 32.21 O ATOM 2004 CB GLU B 453 25.643 20.669 -37.573 1.00 42.80 C ATOM 2005 CG GLU B 453 26.949 20.569 -38.358 1.00 42.11 C ATOM 2006 CD GLU B 453 27.319 19.124 -38.676 1.00 48.10 C ATOM 2007 OE1 GLU B 453 27.726 18.419 -37.722 1.00 47.14 O ATOM 2008 OE2 GLU B 453 27.225 18.669 -39.859 1.00 39.29 O ATOM 2009 H GLU B 453 24.443 21.811 -39.596 1.00 0.00 H ATOM 2010 N ILE B 454 23.177 18.876 -36.626 1.00 36.78 N ATOM 2011 CA ILE B 454 22.129 18.594 -35.648 1.00 44.13 C ATOM 2012 C ILE B 454 21.977 19.798 -34.679 1.00 38.49 C ATOM 2013 O ILE B 454 22.958 20.280 -34.094 1.00 30.13 O ATOM 2014 CB ILE B 454 22.484 17.311 -34.871 1.00 44.55 C ATOM 2015 CG1 ILE B 454 21.474 17.050 -33.746 1.00 54.64 C ATOM 2016 CG2 ILE B 454 23.890 17.421 -34.274 1.00 49.76 C ATOM 2017 CD1 ILE B 454 20.228 16.308 -34.152 1.00 48.45 C ATOM 2018 H ILE B 454 23.940 18.180 -36.748 1.00 0.00 H ATOM 2019 N GLU B 455 20.765 20.303 -34.537 1.00 30.98 N ATOM 2020 CA GLU B 455 20.563 21.392 -33.593 1.00 36.52 C ATOM 2021 C GLU B 455 20.922 20.973 -32.161 1.00 35.01 C ATOM 2022 O GLU B 455 20.824 19.791 -31.799 1.00 41.21 O ATOM 2023 CB GLU B 455 19.146 21.934 -33.633 1.00 40.52 C ATOM 2024 CG GLU B 455 18.142 21.080 -32.936 1.00 52.75 C ATOM 2025 CD GLU B 455 17.553 20.042 -33.866 1.00 68.04 C ATOM 2026 OE1 GLU B 455 16.461 20.313 -34.414 1.00 71.59 O ATOM 2027 OE2 GLU B 455 18.182 18.973 -34.061 1.00 74.08 O ATOM 2028 H GLU B 455 19.968 19.929 -35.091 1.00 0.00 H ATOM 2029 N TYR B 456 21.347 21.930 -31.356 1.00 31.94 N ATOM 2030 CA TYR B 456 21.416 21.650 -29.933 1.00 37.26 C ATOM 2031 C TYR B 456 20.600 22.656 -29.101 1.00 29.43 C ATOM 2032 O TYR B 456 19.904 23.574 -29.621 1.00 28.20 O ATOM 2033 CB TYR B 456 22.887 21.509 -29.428 1.00 36.94 C ATOM 2034 CG TYR B 456 23.686 22.715 -29.783 1.00 40.61 C ATOM 2035 CD1 TYR B 456 24.517 22.736 -30.923 1.00 37.10 C ATOM 2036 CD2 TYR B 456 23.558 23.877 -29.026 1.00 44.46 C ATOM 2037 CE1 TYR B 456 25.241 23.879 -31.234 1.00 42.25 C ATOM 2038 CE2 TYR B 456 24.245 25.009 -29.349 1.00 44.32 C ATOM 2039 CZ TYR B 456 25.100 25.009 -30.439 1.00 46.12 C ATOM 2040 OH TYR B 456 25.797 26.193 -30.705 1.00 44.29 O ATOM 2041 HH TYR B 456 26.370 26.065 -31.502 1.00 0.00 H ATOM 2042 H TYR B 456 21.625 22.859 -31.731 1.00 0.00 H ATOM 2043 N ILE B 457 20.671 22.427 -27.807 1.00 26.87 N ATOM 2044 CA ILE B 457 19.723 23.055 -26.879 1.00 24.72 C ATOM 2045 C ILE B 457 20.476 23.955 -25.932 1.00 21.78 C ATOM 2046 O ILE B 457 21.544 23.560 -25.355 1.00 26.46 O ATOM 2047 CB ILE B 457 18.883 21.995 -26.151 1.00 24.51 C ATOM 2048 CG1 ILE B 457 18.050 21.257 -27.170 1.00 29.94 C ATOM 2049 CG2 ILE B 457 17.901 22.669 -25.203 1.00 24.42 C ATOM 2050 CD1 ILE B 457 17.668 19.881 -26.662 1.00 33.12 C ATOM 2051 H ILE B 457 21.408 21.793 -27.437 1.00 0.00 H ATOM 2052 N ILE B 458 20.050 25.217 -25.871 1.00 20.93 N ATOM 2053 CA ILE B 458 20.740 26.188 -24.976 1.00 23.20 C ATOM 2054 C ILE B 458 19.785 26.425 -23.814 1.00 23.39 C ATOM 2055 O ILE B 458 18.571 26.750 -24.063 1.00 25.18 O ATOM 2056 CB ILE B 458 20.936 27.543 -25.681 1.00 23.57 C ATOM 2057 CG1 ILE B 458 21.840 27.399 -26.933 1.00 29.11 C ATOM 2058 CG2 ILE B 458 21.439 28.622 -24.673 1.00 22.93 C ATOM 2059 CD1 ILE B 458 23.196 26.943 -26.485 1.00 28.25 C ATOM 2060 H ILE B 458 19.239 25.522 -26.446 1.00 0.00 H ATOM 2061 N CYS B 459 20.280 26.288 -22.595 1.00 21.10 N ATOM 2062 CA CYS B 459 19.442 26.505 -21.409 1.00 26.09 C ATOM 2063 C CYS B 459 19.948 27.602 -20.526 1.00 27.96 C ATOM 2064 O CYS B 459 21.203 27.739 -20.288 1.00 27.19 O ATOM 2065 CB CYS B 459 19.405 25.203 -20.578 1.00 28.29 C ATOM 2066 SG CYS B 459 18.563 23.856 -21.434 1.00 29.95 S ATOM 2067 H CYS B 459 21.278 26.022 -22.475 1.00 0.00 H ATOM 2068 N THR B 460 19.026 28.343 -19.942 1.00 22.04 N ATOM 2069 CA THR B 460 19.413 29.131 -18.790 1.00 26.48 C ATOM 2070 C THR B 460 18.666 28.523 -17.611 1.00 24.74 C ATOM 2071 O THR B 460 17.404 28.316 -17.726 1.00 23.97 O ATOM 2072 CB THR B 460 18.836 30.570 -18.847 1.00 31.38 C ATOM 2073 OG1 THR B 460 18.891 31.061 -20.181 1.00 48.47 O ATOM 2074 CG2 THR B 460 19.565 31.423 -17.960 1.00 28.27 C ATOM 2075 HG1 THR B 460 18.521 31.979 -20.209 1.00 0.00 H ATOM 2076 H THR B 460 18.049 28.361 -20.299 1.00 0.00 H ATOM 2077 N ASN B 461 19.375 28.349 -16.507 1.00 22.51 N ATOM 2078 CA ASN B 461 18.848 27.628 -15.309 1.00 26.11 C ATOM 2079 C ASN B 461 18.838 28.512 -14.045 1.00 27.82 C ATOM 2080 O ASN B 461 19.934 28.832 -13.487 1.00 29.65 O ATOM 2081 CB ASN B 461 19.717 26.396 -15.046 1.00 24.01 C ATOM 2082 CG ASN B 461 19.855 25.490 -16.260 1.00 27.50 C ATOM 2083 OD1 ASN B 461 18.896 24.811 -16.657 1.00 28.68 O ATOM 2084 ND2 ASN B 461 21.079 25.399 -16.819 1.00 24.50 N ATOM 2085 HD22 ASN B 461 21.860 25.984 -16.459 1.00 0.00 H ATOM 2086 HD21 ASN B 461 21.242 24.743 -17.610 1.00 0.00 H ATOM 2087 H ASN B 461 20.342 28.731 -16.472 1.00 0.00 H ATOM 2088 N THR B 462 17.639 28.917 -13.576 1.00 25.76 N ATOM 2089 CA THR B 462 17.536 29.789 -12.385 1.00 25.08 C ATOM 2090 C THR B 462 16.852 29.124 -11.153 1.00 27.80 C ATOM 2091 O THR B 462 15.770 28.561 -11.318 1.00 27.34 O ATOM 2092 CB THR B 462 16.758 31.052 -12.754 1.00 30.01 C ATOM 2093 OG1 THR B 462 17.329 31.586 -13.944 1.00 36.22 O ATOM 2094 CG2 THR B 462 16.803 32.131 -11.621 1.00 23.90 C ATOM 2095 HG1 THR B 462 17.261 30.917 -14.670 1.00 0.00 H ATOM 2096 H THR B 462 16.771 28.611 -14.061 1.00 0.00 H ATOM 2097 N ASN B 463 17.443 29.229 -9.948 1.00 26.29 N ATOM 2098 CA ASN B 463 16.797 28.858 -8.651 1.00 26.22 C ATOM 2099 C ASN B 463 15.640 29.813 -8.343 1.00 25.94 C ATOM 2100 O ASN B 463 15.834 30.995 -8.178 1.00 31.74 O ATOM 2101 CB ASN B 463 17.849 28.814 -7.543 1.00 30.03 C ATOM 2102 CG ASN B 463 17.413 28.061 -6.212 1.00 36.15 C ATOM 2103 OD1 ASN B 463 18.246 28.018 -5.287 1.00 36.03 O ATOM 2104 ND2 ASN B 463 16.166 27.479 -6.100 1.00 25.38 N ATOM 2105 HD22 ASN B 463 15.494 27.533 -6.892 1.00 0.00 H ATOM 2106 HD21 ASN B 463 15.899 26.986 -5.224 1.00 0.00 H ATOM 2107 H ASN B 463 18.417 29.593 -9.917 1.00 0.00 H ATOM 2108 N VAL B 464 14.418 29.312 -8.382 1.00 25.42 N ATOM 2109 CA VAL B 464 13.227 30.156 -8.213 1.00 25.19 C ATOM 2110 C VAL B 464 12.440 29.632 -6.992 1.00 26.19 C ATOM 2111 O VAL B 464 12.685 28.542 -6.529 1.00 26.40 O ATOM 2112 CB VAL B 464 12.287 30.104 -9.430 1.00 28.11 C ATOM 2113 CG1 VAL B 464 12.819 30.902 -10.643 1.00 30.92 C ATOM 2114 CG2 VAL B 464 11.942 28.636 -9.795 1.00 29.46 C ATOM 2115 H VAL B 464 14.296 28.291 -8.537 1.00 0.00 H ATOM 2116 N LYS B 465 11.482 30.410 -6.521 1.00 30.06 N ATOM 2117 CA LYS B 465 10.587 30.066 -5.448 1.00 31.42 C ATOM 2118 C LYS B 465 9.425 29.323 -6.065 1.00 32.02 C ATOM 2119 O LYS B 465 8.809 29.816 -7.014 1.00 35.22 O ATOM 2120 CB LYS B 465 9.972 31.363 -4.873 1.00 27.95 C ATOM 2121 CG LYS B 465 10.973 32.117 -4.097 1.00 34.45 C ATOM 2122 CD LYS B 465 10.282 32.963 -3.075 1.00 39.70 C ATOM 2123 CE LYS B 465 10.916 34.324 -3.092 1.00 42.76 C ATOM 2124 NZ LYS B 465 10.187 35.064 -2.044 1.00 42.46 N ATOM 2125 HZ1 LYS B 465 9.176 35.097 -2.284 1.00 0.00 H ATOM 2126 HZ2 LYS B 465 10.312 34.582 -1.131 1.00 0.00 H ATOM 2127 HZ3 LYS B 465 10.561 36.032 -1.981 1.00 0.00 H ATOM 2128 H LYS B 465 11.365 31.345 -6.961 1.00 0.00 H ATOM 2129 N ASN B 466 9.056 28.179 -5.520 1.00 32.18 N ATOM 2130 CA ASN B 466 7.757 27.705 -5.927 1.00 33.99 C ATOM 2131 C ASN B 466 6.686 28.230 -4.940 1.00 42.57 C ATOM 2132 O ASN B 466 6.479 27.653 -3.879 1.00 39.19 O ATOM 2133 CB ASN B 466 7.720 26.214 -6.016 1.00 31.35 C ATOM 2134 CG ASN B 466 6.325 25.721 -6.286 1.00 31.35 C ATOM 2135 OD1 ASN B 466 5.546 26.413 -6.928 1.00 33.27 O ATOM 2136 ND2 ASN B 466 6.007 24.575 -5.798 1.00 34.99 N ATOM 2137 HD22 ASN B 466 6.708 24.027 -5.259 1.00 0.00 H ATOM 2138 HD21 ASN B 466 5.049 24.196 -5.942 1.00 0.00 H ATOM 2139 H ASN B 466 9.656 27.659 -4.848 1.00 0.00 H ATOM 2140 N SER B 467 6.067 29.365 -5.267 1.00 46.66 N ATOM 2141 CA SER B 467 5.010 29.934 -4.413 1.00 55.71 C ATOM 2142 C SER B 467 4.329 31.175 -5.023 1.00 54.91 C ATOM 2143 O SER B 467 4.789 31.733 -6.028 1.00 59.18 O ATOM 2144 CB SER B 467 5.530 30.235 -2.993 1.00 50.60 C ATOM 2145 OG SER B 467 6.294 31.427 -2.976 1.00 55.32 O ATOM 2146 HG SER B 467 6.616 31.598 -2.056 1.00 0.00 H ATOM 2147 H SER B 467 6.336 29.858 -6.142 1.00 0.00 H TER 2148 SER B 467 HETATM 2149 O HOH 1 29.005 -8.889 -10.585 1.00 28.71 O HETATM 2150 O HOH 2 16.548 -12.154 -20.061 1.00 41.88 O HETATM 2151 O HOH 3 12.812 -7.742 0.719 1.00 47.48 O HETATM 2152 O HOH 4 25.852 3.748 -9.696 1.00 47.75 O HETATM 2153 O HOH 5 15.623 9.357 -19.385 1.00 40.91 O HETATM 2154 O HOH 6 38.883 -5.108 -25.175 1.00 61.72 O HETATM 2155 O HOH 7 43.760 -7.667 -22.490 1.00 47.47 O HETATM 2156 O HOH 8 19.833 8.868 -18.371 1.00 38.88 O HETATM 2157 O HOH 9 20.615 9.115 -8.390 1.00 46.66 O HETATM 2158 O HOH 10 17.064 -6.522 -21.582 1.00 35.72 O HETATM 2159 O HOH 11 14.693 10.644 -4.098 1.00 38.76 O HETATM 2160 O HOH 12 21.309 -3.004 -25.495 1.00 34.91 O HETATM 2161 O HOH 13 29.389 4.073 -21.893 1.00 48.22 O HETATM 2162 O HOH 14 30.060 -13.598 -5.510 1.00 51.04 O HETATM 2163 O HOH 15 14.821 -12.802 -18.280 1.00 33.64 O HETATM 2164 O HOH 16 11.010 -14.498 -18.740 1.00 51.30 O HETATM 2165 O HOH 17 9.620 -9.344 -3.334 1.00 45.23 O HETATM 2166 O HOH 18 10.093 -0.625 -23.606 1.00 52.78 O HETATM 2167 O HOH 19 14.620 -13.150 -15.721 1.00 45.10 O HETATM 2168 O HOH 20 37.015 -8.332 -17.008 1.00 43.04 O HETATM 2169 O HOH 21 21.812 2.156 -23.512 1.00 40.16 O HETATM 2170 O HOH 22 15.858 -9.070 -22.465 1.00 44.14 O HETATM 2171 O HOH 23 27.271 25.493 -25.678 1.00 42.26 O HETATM 2172 O HOH 24 10.275 8.674 -15.050 1.00 37.87 O HETATM 2173 O HOH 25 21.476 22.442 -1.184 1.00 38.87 O HETATM 2174 O HOH 26 6.964 27.980 -25.767 1.00 30.77 O HETATM 2175 O HOH 27 23.503 11.119 -8.254 1.00 69.79 O HETATM 2176 O HOH 28 8.507 11.720 -13.704 1.00 33.77 O HETATM 2177 O HOH 29 30.934 31.388 -15.544 1.00 39.96 O HETATM 2178 O HOH 30 21.742 17.763 -30.394 1.00 38.28 O HETATM 2179 O HOH 31 25.360 19.878 -33.069 1.00 49.30 O HETATM 2180 O HOH 32 7.782 22.742 -3.218 1.00 34.88 O HETATM 2181 O HOH 33 7.073 23.413 -15.439 1.00 27.03 O HETATM 2182 O HOH 34 5.587 17.068 -11.435 1.00 27.17 O HETATM 2183 O HOH 35 23.627 15.172 -4.688 1.00 62.92 O HETATM 2184 O HOH 36 17.068 26.100 -33.817 1.00 45.54 O HETATM 2185 O HOH 37 13.332 26.052 -29.602 1.00 37.83 O HETATM 2186 O HOH 38 11.136 15.761 -30.595 1.00 41.24 O HETATM 2187 O HOH 39 31.403 23.259 -20.104 1.00 36.46 O HETATM 2188 O HOH 40 15.548 30.283 -16.316 1.00 32.35 O HETATM 2189 O HOH 41 29.941 29.707 -9.284 1.00 39.32 O HETATM 2190 O HOH 42 8.011 22.505 -20.359 1.00 28.38 O HETATM 2191 O HOH 43 15.371 33.733 -8.590 1.00 50.36 O HETATM 2192 O HOH 44 30.248 14.229 -15.024 1.00 63.05 O HETATM 2193 O HOH 45 25.880 13.132 -0.418 1.00 53.70 O HETATM 2194 O HOH 46 7.107 16.276 -25.789 1.00 32.41 O HETATM 2195 O HOH 47 32.274 29.232 -16.960 1.00 39.77 O HETATM 2196 O HOH 48 6.667 14.487 -14.695 1.00 22.56 O HETATM 2197 O HOH 49 11.424 33.171 -7.651 1.00 33.21 O HETATM 2198 O HOH 50 17.907 16.223 -35.258 1.00 55.84 O HETATM 2199 O HOH 51 14.155 13.788 -23.729 1.00 51.70 O HETATM 2200 O HOH 52 19.987 29.865 -7.325 1.00 74.16 O HETATM 2201 O HOH 53 33.243 15.644 -17.090 1.00 47.85 O HETATM 2202 O HOH 54 20.896 13.299 -28.459 1.00 45.80 O HETATM 2203 O HOH 55 2.095 31.683 -4.155 1.00 59.32 O HETATM 2204 O HOH 56 31.183 32.006 -12.647 1.00 51.16 O HETATM 2205 O HOH 57 22.100 14.812 -30.628 1.00 46.29 O HETATM 2206 O HOH 58 5.894 22.805 -18.041 1.00 29.78 O HETATM 2207 O HOH 59 29.267 32.287 -9.576 1.00 38.96 O HETATM 2208 O HOH 60 35.114 17.339 -17.322 1.00 51.03 O HETATM 2209 N1 UNN A 61 18.310 1.941 -8.716 1.00 -0.33 N HETATM 2210 C17 UNN A 61 18.912 1.127 -9.315 1.00 0.10 C HETATM 2211 C6 UNN A 61 19.583 0.213 -9.963 1.00 0.09 C HETATM 2212 C7 UNN A 61 20.885 0.509 -10.428 1.00 0.00 C HETATM 2213 C8 UNN A 61 21.591 -0.477 -11.089 1.00 0.12 C HETATM 2214 C9 UNN A 61 21.029 -1.737 -11.284 1.00 0.01 C HETATM 2215 C10 UNN A 61 19.745 -2.033 -10.831 1.00 0.14 C HETATM 2216 F1 UNN A 61 19.198 -3.270 -11.021 1.00 -0.18 F HETATM 2217 C5 UNN A 61 19.013 -1.052 -10.141 1.00 -0.00 C HETATM 2218 H3 UNN A 61 18.025 -1.271 -9.754 1.00 0.06 H HETATM 2219 H2 UNN A 61 21.601 -2.501 -11.798 1.00 0.06 H HETATM 2220 O1 UNN A 61 22.826 -0.118 -11.584 1.00 -0.26 O HETATM 2221 C1 UNN A 61 23.921 -0.267 -10.808 1.00 0.11 C HETATM 2222 C14 UNN A 61 25.095 0.102 -11.412 1.00 0.00 C HETATM 2223 C15 UNN A 61 25.260 0.610 -12.859 1.00 0.05 C HETATM 2224 C11 UNN A 61 26.787 0.391 -13.028 1.00 0.29 C HETATM 2225 F5 UNN A 61 27.224 1.338 -13.845 1.00 -0.20 F HETATM 2226 F2 UNN A 61 27.103 -0.790 -13.550 1.00 -0.20 F HETATM 2227 C12 UNN A 61 27.398 0.341 -11.627 1.00 0.15 C HETATM 2228 C13 UNN A 61 26.259 -0.105 -10.728 1.00 0.01 C HETATM 2229 C4 UNN A 61 26.254 -0.639 -9.405 1.00 0.08 C HETATM 2230 C3 UNN A 61 25.039 -0.940 -8.766 1.00 -0.06 C HETATM 2231 C2 UNN A 61 23.831 -0.723 -9.499 1.00 -0.04 C HETATM 2232 H9 UNN A 61 22.866 -0.910 -9.043 1.00 0.05 H HETATM 2233 H8 UNN A 61 25.019 -1.323 -7.752 1.00 0.05 H HETATM 2234 S1 UNN A 61 27.645 -0.897 -8.524 1.00 0.05 S HETATM 2235 O2 UNN A 61 28.541 -1.407 -9.462 1.00 -0.17 O HETATM 2236 O3 UNN A 61 27.424 -1.918 -7.508 1.00 -0.17 O HETATM 2237 C16 UNN A 61 28.107 0.537 -7.865 1.00 0.35 C HETATM 2238 F3 UNN A 61 27.365 0.572 -6.743 1.00 -0.18 F HETATM 2239 F4 UNN A 61 27.591 1.530 -8.596 1.00 -0.18 F HETATM 2240 H10 UNN A 61 29.192 0.625 -7.708 1.00 0.13 H HETATM 2241 O4 UNN A 61 27.761 1.684 -11.224 1.00 -0.37 O HETATM 2242 H7 UNN A 61 28.474 1.995 -11.769 1.00 0.21 H HETATM 2243 H6 UNN A 61 28.260 -0.340 -11.578 1.00 0.08 H HETATM 2244 H4 UNN A 61 24.983 1.670 -12.957 1.00 0.04 H HETATM 2245 H5 UNN A 61 24.677 0.011 -13.574 1.00 0.04 H HETATM 2246 H1 UNN A 61 21.320 1.489 -10.269 1.00 0.06 H CONECT 1 2 9 10 11 CONECT 9 1 CONECT 10 1 CONECT 11 1 CONECT 897 898 903 904 905 CONECT 904 897 CONECT 905 897 CONECT 1019 1020 1025 1026 1027 CONECT 1025 1019 CONECT 1026 1019 CONECT 1027 1019 CONECT 2209 2210 CONECT 2210 2209 2211 CONECT 2211 2210 2212 2217 CONECT 2212 2211 2213 2246 CONECT 2213 2212 2214 2220 CONECT 2214 2213 2215 2219 CONECT 2215 2214 2216 2217 CONECT 2216 2215 CONECT 2217 2211 2215 2218 CONECT 2218 2217 CONECT 2219 2214 CONECT 2220 2213 2221 CONECT 2221 2220 2222 2231 CONECT 2222 2221 2223 2228 CONECT 2223 2222 2224 2244 2245 CONECT 2224 2223 2225 2226 2227 CONECT 2225 2224 CONECT 2226 2224 CONECT 2227 2224 2228 2241 2243 CONECT 2228 2222 2227 2229 CONECT 2229 2228 2230 2234 CONECT 2230 2229 2231 2233 CONECT 2231 2221 2230 2232 CONECT 2232 2231 CONECT 2233 2230 CONECT 2234 2229 2235 2236 2237 CONECT 2235 2234 CONECT 2236 2234 CONECT 2237 2234 2238 2239 2240 CONECT 2238 2237 CONECT 2239 2237 CONECT 2240 2237 CONECT 2241 2227 2242 CONECT 2242 2241 CONECT 2243 2227 CONECT 2244 2223 CONECT 2245 2223 CONECT 2246 2212 MASTER 0 0 0 0 0 0 0 0 2243 3 49 17 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 5ufp
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
3f1p
RCSB PDB
PDBbind
121aa, >3F1P_2|Chain... *
4ghi
RCSB PDB
PDBbind
121aa, >4GHI_2|Chain... at 100%
4gs9
RCSB PDB
PDBbind
121aa, >4GS9_2|Chain... at 100%
4xt2
RCSB PDB
PDBbind
121aa, >4XT2_1|Chains... at 100%
5tbm
RCSB PDB
PDBbind
117aa, >5TBM_2|Chain... at 95%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
5ufp
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
human HIF2a-B*:ARNT-B* complex
Ligand Name
86D
EC.Number
E.C.-.-.-.-
Resolution
2.2(Å)
Affinity (Kd/Ki/IC50)
Kd=42.5nM
Release Year
2016
Protein/NA Sequence
Check fasta file
Primary Reference
(2016) Nature Vol. 539: pp. 107-111
Ligand Properties
Formula
C
1
7
H
1
0
F
5
NO
4
S
Molecular Weight
419.323
Exact Mass
419.025
No. of atoms
38
No. of bonds
40
Polar Surface Area
95.77
LOGP Value
3.31 (
Computed with XLOGP3
)
4.79 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 4
No. of Rotatable Bonds: 5
No. of Nitrogen and Oxygen Atoms: 5
No. of Rings: 3
Canonical SMILES
N#Cc1cc(cc(c1)F)Oc1ccc(c2c1CC([C@H]2O)(F)F)S(=O)(=O)C(F)F
InChI String
InChI=1S/C17H10F5NO4S/c18-9-3-8(7-23)4-10(5-9)27-12-1-2-13(28(25,26)16(19)20)14-11(12)6-17(21,22)15(14)24/h1-5,15-16,24H,6H2/t15-/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
Q99814
P27540
Entrez Gene ID
NCBI Entrez Gene ID:
2034
405
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com